Show More
@@ -0,0 +1,17 b'' | |||||
|
1 | """Sentinel class for constants with useful reprs""" | |||
|
2 | ||||
|
3 | # Copyright (c) IPython Development Team. | |||
|
4 | # Distributed under the terms of the Modified BSD License. | |||
|
5 | ||||
|
6 | class Sentinel(object): | |||
|
7 | ||||
|
8 | def __init__(self, name, module, docstring=None): | |||
|
9 | self.name = name | |||
|
10 | self.module = module | |||
|
11 | if docstring: | |||
|
12 | self.__doc__ = docstring | |||
|
13 | ||||
|
14 | ||||
|
15 | def __repr__(self): | |||
|
16 | return str(self.module)+'.'+self.name | |||
|
17 |
@@ -0,0 +1,17 b'' | |||||
|
1 | """Sentinel class for constants with useful reprs""" | |||
|
2 | ||||
|
3 | # Copyright (c) IPython Development Team. | |||
|
4 | # Distributed under the terms of the Modified BSD License. | |||
|
5 | ||||
|
6 | class Sentinel(object): | |||
|
7 | ||||
|
8 | def __init__(self, name, module, docstring=None): | |||
|
9 | self.name = name | |||
|
10 | self.module = module | |||
|
11 | if docstring: | |||
|
12 | self.__doc__ = docstring | |||
|
13 | ||||
|
14 | ||||
|
15 | def __repr__(self): | |||
|
16 | return str(self.module)+'.'+self.name | |||
|
17 |
@@ -0,0 +1,17 b'' | |||||
|
1 | """Sentinel class for constants with useful reprs""" | |||
|
2 | ||||
|
3 | # Copyright (c) IPython Development Team. | |||
|
4 | # Distributed under the terms of the Modified BSD License. | |||
|
5 | ||||
|
6 | class Sentinel(object): | |||
|
7 | ||||
|
8 | def __init__(self, name, module, docstring=None): | |||
|
9 | self.name = name | |||
|
10 | self.module = module | |||
|
11 | if docstring: | |||
|
12 | self.__doc__ = docstring | |||
|
13 | ||||
|
14 | ||||
|
15 | def __repr__(self): | |||
|
16 | return str(self.module)+'.'+self.name | |||
|
17 |
@@ -1,972 +1,972 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Display formatters. |
|
2 | """Display formatters. | |
3 |
|
3 | |||
4 | Inheritance diagram: |
|
4 | Inheritance diagram: | |
5 |
|
5 | |||
6 | .. inheritance-diagram:: IPython.core.formatters |
|
6 | .. inheritance-diagram:: IPython.core.formatters | |
7 | :parts: 3 |
|
7 | :parts: 3 | |
8 | """ |
|
8 | """ | |
9 |
|
9 | |||
10 | # Copyright (c) IPython Development Team. |
|
10 | # Copyright (c) IPython Development Team. | |
11 | # Distributed under the terms of the Modified BSD License. |
|
11 | # Distributed under the terms of the Modified BSD License. | |
12 |
|
12 | |||
13 | import abc |
|
13 | import abc | |
14 | import inspect |
|
14 | import inspect | |
15 | import json |
|
15 | import json | |
16 | import sys |
|
16 | import sys | |
17 | import traceback |
|
17 | import traceback | |
18 | import warnings |
|
18 | import warnings | |
19 |
|
19 | |||
20 | from decorator import decorator |
|
20 | from decorator import decorator | |
21 |
|
21 | |||
22 | from IPython.config.configurable import Configurable |
|
22 | from IPython.config.configurable import Configurable | |
23 | from IPython.core.getipython import get_ipython |
|
23 | from IPython.core.getipython import get_ipython | |
24 |
from IPython.utils.s |
|
24 | from IPython.utils.sentinel import Sentinel | |
25 | from IPython.lib import pretty |
|
25 | from IPython.lib import pretty | |
26 | from IPython.utils.traitlets import ( |
|
26 | from IPython.utils.traitlets import ( | |
27 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
27 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, | |
28 | ForwardDeclaredInstance, |
|
28 | ForwardDeclaredInstance, | |
29 | ) |
|
29 | ) | |
30 | from IPython.utils.py3compat import ( |
|
30 | from IPython.utils.py3compat import ( | |
31 | with_metaclass, string_types, unicode_type, |
|
31 | with_metaclass, string_types, unicode_type, | |
32 | ) |
|
32 | ) | |
33 |
|
33 | |||
34 |
|
34 | |||
35 | #----------------------------------------------------------------------------- |
|
35 | #----------------------------------------------------------------------------- | |
36 | # The main DisplayFormatter class |
|
36 | # The main DisplayFormatter class | |
37 | #----------------------------------------------------------------------------- |
|
37 | #----------------------------------------------------------------------------- | |
38 |
|
38 | |||
39 |
|
39 | |||
40 | def _safe_get_formatter_method(obj, name): |
|
40 | def _safe_get_formatter_method(obj, name): | |
41 | """Safely get a formatter method |
|
41 | """Safely get a formatter method | |
42 |
|
42 | |||
43 | - Classes cannot have formatter methods, only instance |
|
43 | - Classes cannot have formatter methods, only instance | |
44 | - protect against proxy objects that claim to have everything |
|
44 | - protect against proxy objects that claim to have everything | |
45 | """ |
|
45 | """ | |
46 | if inspect.isclass(obj): |
|
46 | if inspect.isclass(obj): | |
47 | # repr methods only make sense on instances, not classes |
|
47 | # repr methods only make sense on instances, not classes | |
48 | return None |
|
48 | return None | |
49 | method = pretty._safe_getattr(obj, name, None) |
|
49 | method = pretty._safe_getattr(obj, name, None) | |
50 | if callable(method): |
|
50 | if callable(method): | |
51 | # obj claims to have repr method... |
|
51 | # obj claims to have repr method... | |
52 | if callable(pretty._safe_getattr(obj, '_ipython_canary_method_should_not_exist_', None)): |
|
52 | if callable(pretty._safe_getattr(obj, '_ipython_canary_method_should_not_exist_', None)): | |
53 | # ...but don't trust proxy objects that claim to have everything |
|
53 | # ...but don't trust proxy objects that claim to have everything | |
54 | return None |
|
54 | return None | |
55 | return method |
|
55 | return method | |
56 |
|
56 | |||
57 |
|
57 | |||
58 | class DisplayFormatter(Configurable): |
|
58 | class DisplayFormatter(Configurable): | |
59 |
|
59 | |||
60 | # When set to true only the default plain text formatter will be used. |
|
60 | # When set to true only the default plain text formatter will be used. | |
61 | plain_text_only = Bool(False, config=True) |
|
61 | plain_text_only = Bool(False, config=True) | |
62 | def _plain_text_only_changed(self, name, old, new): |
|
62 | def _plain_text_only_changed(self, name, old, new): | |
63 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. |
|
63 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. | |
64 |
|
64 | |||
65 | Use DisplayFormatter.active_types = ['text/plain'] |
|
65 | Use DisplayFormatter.active_types = ['text/plain'] | |
66 | for the same effect. |
|
66 | for the same effect. | |
67 | """, DeprecationWarning) |
|
67 | """, DeprecationWarning) | |
68 | if new: |
|
68 | if new: | |
69 | self.active_types = ['text/plain'] |
|
69 | self.active_types = ['text/plain'] | |
70 | else: |
|
70 | else: | |
71 | self.active_types = self.format_types |
|
71 | self.active_types = self.format_types | |
72 |
|
72 | |||
73 | active_types = List(Unicode, config=True, |
|
73 | active_types = List(Unicode, config=True, | |
74 | help="""List of currently active mime-types to display. |
|
74 | help="""List of currently active mime-types to display. | |
75 | You can use this to set a white-list for formats to display. |
|
75 | You can use this to set a white-list for formats to display. | |
76 |
|
76 | |||
77 | Most users will not need to change this value. |
|
77 | Most users will not need to change this value. | |
78 | """) |
|
78 | """) | |
79 | def _active_types_default(self): |
|
79 | def _active_types_default(self): | |
80 | return self.format_types |
|
80 | return self.format_types | |
81 |
|
81 | |||
82 | def _active_types_changed(self, name, old, new): |
|
82 | def _active_types_changed(self, name, old, new): | |
83 | for key, formatter in self.formatters.items(): |
|
83 | for key, formatter in self.formatters.items(): | |
84 | if key in new: |
|
84 | if key in new: | |
85 | formatter.enabled = True |
|
85 | formatter.enabled = True | |
86 | else: |
|
86 | else: | |
87 | formatter.enabled = False |
|
87 | formatter.enabled = False | |
88 |
|
88 | |||
89 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') |
|
89 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') | |
90 | def _ipython_display_formatter_default(self): |
|
90 | def _ipython_display_formatter_default(self): | |
91 | return IPythonDisplayFormatter(parent=self) |
|
91 | return IPythonDisplayFormatter(parent=self) | |
92 |
|
92 | |||
93 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
93 | # A dict of formatter whose keys are format types (MIME types) and whose | |
94 | # values are subclasses of BaseFormatter. |
|
94 | # values are subclasses of BaseFormatter. | |
95 | formatters = Dict() |
|
95 | formatters = Dict() | |
96 | def _formatters_default(self): |
|
96 | def _formatters_default(self): | |
97 | """Activate the default formatters.""" |
|
97 | """Activate the default formatters.""" | |
98 | formatter_classes = [ |
|
98 | formatter_classes = [ | |
99 | PlainTextFormatter, |
|
99 | PlainTextFormatter, | |
100 | HTMLFormatter, |
|
100 | HTMLFormatter, | |
101 | MarkdownFormatter, |
|
101 | MarkdownFormatter, | |
102 | SVGFormatter, |
|
102 | SVGFormatter, | |
103 | PNGFormatter, |
|
103 | PNGFormatter, | |
104 | PDFFormatter, |
|
104 | PDFFormatter, | |
105 | JPEGFormatter, |
|
105 | JPEGFormatter, | |
106 | LatexFormatter, |
|
106 | LatexFormatter, | |
107 | JSONFormatter, |
|
107 | JSONFormatter, | |
108 | JavascriptFormatter |
|
108 | JavascriptFormatter | |
109 | ] |
|
109 | ] | |
110 | d = {} |
|
110 | d = {} | |
111 | for cls in formatter_classes: |
|
111 | for cls in formatter_classes: | |
112 | f = cls(parent=self) |
|
112 | f = cls(parent=self) | |
113 | d[f.format_type] = f |
|
113 | d[f.format_type] = f | |
114 | return d |
|
114 | return d | |
115 |
|
115 | |||
116 | def format(self, obj, include=None, exclude=None): |
|
116 | def format(self, obj, include=None, exclude=None): | |
117 | """Return a format data dict for an object. |
|
117 | """Return a format data dict for an object. | |
118 |
|
118 | |||
119 | By default all format types will be computed. |
|
119 | By default all format types will be computed. | |
120 |
|
120 | |||
121 | The following MIME types are currently implemented: |
|
121 | The following MIME types are currently implemented: | |
122 |
|
122 | |||
123 | * text/plain |
|
123 | * text/plain | |
124 | * text/html |
|
124 | * text/html | |
125 | * text/markdown |
|
125 | * text/markdown | |
126 | * text/latex |
|
126 | * text/latex | |
127 | * application/json |
|
127 | * application/json | |
128 | * application/javascript |
|
128 | * application/javascript | |
129 | * application/pdf |
|
129 | * application/pdf | |
130 | * image/png |
|
130 | * image/png | |
131 | * image/jpeg |
|
131 | * image/jpeg | |
132 | * image/svg+xml |
|
132 | * image/svg+xml | |
133 |
|
133 | |||
134 | Parameters |
|
134 | Parameters | |
135 | ---------- |
|
135 | ---------- | |
136 | obj : object |
|
136 | obj : object | |
137 | The Python object whose format data will be computed. |
|
137 | The Python object whose format data will be computed. | |
138 | include : list or tuple, optional |
|
138 | include : list or tuple, optional | |
139 | A list of format type strings (MIME types) to include in the |
|
139 | A list of format type strings (MIME types) to include in the | |
140 | format data dict. If this is set *only* the format types included |
|
140 | format data dict. If this is set *only* the format types included | |
141 | in this list will be computed. |
|
141 | in this list will be computed. | |
142 | exclude : list or tuple, optional |
|
142 | exclude : list or tuple, optional | |
143 | A list of format type string (MIME types) to exclude in the format |
|
143 | A list of format type string (MIME types) to exclude in the format | |
144 | data dict. If this is set all format types will be computed, |
|
144 | data dict. If this is set all format types will be computed, | |
145 | except for those included in this argument. |
|
145 | except for those included in this argument. | |
146 |
|
146 | |||
147 | Returns |
|
147 | Returns | |
148 | ------- |
|
148 | ------- | |
149 | (format_dict, metadata_dict) : tuple of two dicts |
|
149 | (format_dict, metadata_dict) : tuple of two dicts | |
150 |
|
150 | |||
151 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
151 | format_dict is a dictionary of key/value pairs, one of each format that was | |
152 | generated for the object. The keys are the format types, which |
|
152 | generated for the object. The keys are the format types, which | |
153 | will usually be MIME type strings and the values and JSON'able |
|
153 | will usually be MIME type strings and the values and JSON'able | |
154 | data structure containing the raw data for the representation in |
|
154 | data structure containing the raw data for the representation in | |
155 | that format. |
|
155 | that format. | |
156 |
|
156 | |||
157 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
157 | metadata_dict is a dictionary of metadata about each mime-type output. | |
158 | Its keys will be a strict subset of the keys in format_dict. |
|
158 | Its keys will be a strict subset of the keys in format_dict. | |
159 | """ |
|
159 | """ | |
160 | format_dict = {} |
|
160 | format_dict = {} | |
161 | md_dict = {} |
|
161 | md_dict = {} | |
162 |
|
162 | |||
163 | if self.ipython_display_formatter(obj): |
|
163 | if self.ipython_display_formatter(obj): | |
164 | # object handled itself, don't proceed |
|
164 | # object handled itself, don't proceed | |
165 | return {}, {} |
|
165 | return {}, {} | |
166 |
|
166 | |||
167 | for format_type, formatter in self.formatters.items(): |
|
167 | for format_type, formatter in self.formatters.items(): | |
168 | if include and format_type not in include: |
|
168 | if include and format_type not in include: | |
169 | continue |
|
169 | continue | |
170 | if exclude and format_type in exclude: |
|
170 | if exclude and format_type in exclude: | |
171 | continue |
|
171 | continue | |
172 |
|
172 | |||
173 | md = None |
|
173 | md = None | |
174 | try: |
|
174 | try: | |
175 | data = formatter(obj) |
|
175 | data = formatter(obj) | |
176 | except: |
|
176 | except: | |
177 | # FIXME: log the exception |
|
177 | # FIXME: log the exception | |
178 | raise |
|
178 | raise | |
179 |
|
179 | |||
180 | # formatters can return raw data or (data, metadata) |
|
180 | # formatters can return raw data or (data, metadata) | |
181 | if isinstance(data, tuple) and len(data) == 2: |
|
181 | if isinstance(data, tuple) and len(data) == 2: | |
182 | data, md = data |
|
182 | data, md = data | |
183 |
|
183 | |||
184 | if data is not None: |
|
184 | if data is not None: | |
185 | format_dict[format_type] = data |
|
185 | format_dict[format_type] = data | |
186 | if md is not None: |
|
186 | if md is not None: | |
187 | md_dict[format_type] = md |
|
187 | md_dict[format_type] = md | |
188 |
|
188 | |||
189 | return format_dict, md_dict |
|
189 | return format_dict, md_dict | |
190 |
|
190 | |||
191 | @property |
|
191 | @property | |
192 | def format_types(self): |
|
192 | def format_types(self): | |
193 | """Return the format types (MIME types) of the active formatters.""" |
|
193 | """Return the format types (MIME types) of the active formatters.""" | |
194 | return list(self.formatters.keys()) |
|
194 | return list(self.formatters.keys()) | |
195 |
|
195 | |||
196 |
|
196 | |||
197 | #----------------------------------------------------------------------------- |
|
197 | #----------------------------------------------------------------------------- | |
198 | # Formatters for specific format types (text, html, svg, etc.) |
|
198 | # Formatters for specific format types (text, html, svg, etc.) | |
199 | #----------------------------------------------------------------------------- |
|
199 | #----------------------------------------------------------------------------- | |
200 |
|
200 | |||
201 |
|
201 | |||
202 | def _safe_repr(obj): |
|
202 | def _safe_repr(obj): | |
203 | """Try to return a repr of an object |
|
203 | """Try to return a repr of an object | |
204 |
|
204 | |||
205 | always returns a string, at least. |
|
205 | always returns a string, at least. | |
206 | """ |
|
206 | """ | |
207 | try: |
|
207 | try: | |
208 | return repr(obj) |
|
208 | return repr(obj) | |
209 | except Exception as e: |
|
209 | except Exception as e: | |
210 | return "un-repr-able object (%r)" % e |
|
210 | return "un-repr-able object (%r)" % e | |
211 |
|
211 | |||
212 |
|
212 | |||
213 | class FormatterWarning(UserWarning): |
|
213 | class FormatterWarning(UserWarning): | |
214 | """Warning class for errors in formatters""" |
|
214 | """Warning class for errors in formatters""" | |
215 |
|
215 | |||
216 | @decorator |
|
216 | @decorator | |
217 | def catch_format_error(method, self, *args, **kwargs): |
|
217 | def catch_format_error(method, self, *args, **kwargs): | |
218 | """show traceback on failed format call""" |
|
218 | """show traceback on failed format call""" | |
219 | try: |
|
219 | try: | |
220 | r = method(self, *args, **kwargs) |
|
220 | r = method(self, *args, **kwargs) | |
221 | except NotImplementedError: |
|
221 | except NotImplementedError: | |
222 | # don't warn on NotImplementedErrors |
|
222 | # don't warn on NotImplementedErrors | |
223 | return None |
|
223 | return None | |
224 | except Exception: |
|
224 | except Exception: | |
225 | exc_info = sys.exc_info() |
|
225 | exc_info = sys.exc_info() | |
226 | ip = get_ipython() |
|
226 | ip = get_ipython() | |
227 | if ip is not None: |
|
227 | if ip is not None: | |
228 | ip.showtraceback(exc_info) |
|
228 | ip.showtraceback(exc_info) | |
229 | else: |
|
229 | else: | |
230 | traceback.print_exception(*exc_info) |
|
230 | traceback.print_exception(*exc_info) | |
231 | return None |
|
231 | return None | |
232 | return self._check_return(r, args[0]) |
|
232 | return self._check_return(r, args[0]) | |
233 |
|
233 | |||
234 |
|
234 | |||
235 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): |
|
235 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): | |
236 | """ Abstract base class for Formatters. |
|
236 | """ Abstract base class for Formatters. | |
237 |
|
237 | |||
238 | A formatter is a callable class that is responsible for computing the |
|
238 | A formatter is a callable class that is responsible for computing the | |
239 | raw format data for a particular format type (MIME type). For example, |
|
239 | raw format data for a particular format type (MIME type). For example, | |
240 | an HTML formatter would have a format type of `text/html` and would return |
|
240 | an HTML formatter would have a format type of `text/html` and would return | |
241 | the HTML representation of the object when called. |
|
241 | the HTML representation of the object when called. | |
242 | """ |
|
242 | """ | |
243 |
|
243 | |||
244 | # The format type of the data returned, usually a MIME type. |
|
244 | # The format type of the data returned, usually a MIME type. | |
245 | format_type = 'text/plain' |
|
245 | format_type = 'text/plain' | |
246 |
|
246 | |||
247 | # Is the formatter enabled... |
|
247 | # Is the formatter enabled... | |
248 | enabled = True |
|
248 | enabled = True | |
249 |
|
249 | |||
250 | @abc.abstractmethod |
|
250 | @abc.abstractmethod | |
251 | def __call__(self, obj): |
|
251 | def __call__(self, obj): | |
252 | """Return a JSON'able representation of the object. |
|
252 | """Return a JSON'able representation of the object. | |
253 |
|
253 | |||
254 | If the object cannot be formatted by this formatter, |
|
254 | If the object cannot be formatted by this formatter, | |
255 | warn and return None. |
|
255 | warn and return None. | |
256 | """ |
|
256 | """ | |
257 | return repr(obj) |
|
257 | return repr(obj) | |
258 |
|
258 | |||
259 |
|
259 | |||
260 | def _mod_name_key(typ): |
|
260 | def _mod_name_key(typ): | |
261 | """Return a (__module__, __name__) tuple for a type. |
|
261 | """Return a (__module__, __name__) tuple for a type. | |
262 |
|
262 | |||
263 | Used as key in Formatter.deferred_printers. |
|
263 | Used as key in Formatter.deferred_printers. | |
264 | """ |
|
264 | """ | |
265 | module = getattr(typ, '__module__', None) |
|
265 | module = getattr(typ, '__module__', None) | |
266 | name = getattr(typ, '__name__', None) |
|
266 | name = getattr(typ, '__name__', None) | |
267 | return (module, name) |
|
267 | return (module, name) | |
268 |
|
268 | |||
269 |
|
269 | |||
270 | def _get_type(obj): |
|
270 | def _get_type(obj): | |
271 | """Return the type of an instance (old and new-style)""" |
|
271 | """Return the type of an instance (old and new-style)""" | |
272 | return getattr(obj, '__class__', None) or type(obj) |
|
272 | return getattr(obj, '__class__', None) or type(obj) | |
273 |
|
273 | |||
274 |
|
274 | |||
275 | _raise_key_error = Sentinel('_raise_key_error', __name__, |
|
275 | _raise_key_error = Sentinel('_raise_key_error', __name__, | |
276 | """ |
|
276 | """ | |
277 | Special value to raise a KeyError |
|
277 | Special value to raise a KeyError | |
278 |
|
278 | |||
279 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` |
|
279 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` | |
280 | """) |
|
280 | """) | |
281 |
|
281 | |||
282 |
|
282 | |||
283 | class BaseFormatter(Configurable): |
|
283 | class BaseFormatter(Configurable): | |
284 | """A base formatter class that is configurable. |
|
284 | """A base formatter class that is configurable. | |
285 |
|
285 | |||
286 | This formatter should usually be used as the base class of all formatters. |
|
286 | This formatter should usually be used as the base class of all formatters. | |
287 | It is a traited :class:`Configurable` class and includes an extensible |
|
287 | It is a traited :class:`Configurable` class and includes an extensible | |
288 | API for users to determine how their objects are formatted. The following |
|
288 | API for users to determine how their objects are formatted. The following | |
289 | logic is used to find a function to format an given object. |
|
289 | logic is used to find a function to format an given object. | |
290 |
|
290 | |||
291 | 1. The object is introspected to see if it has a method with the name |
|
291 | 1. The object is introspected to see if it has a method with the name | |
292 | :attr:`print_method`. If is does, that object is passed to that method |
|
292 | :attr:`print_method`. If is does, that object is passed to that method | |
293 | for formatting. |
|
293 | for formatting. | |
294 | 2. If no print method is found, three internal dictionaries are consulted |
|
294 | 2. If no print method is found, three internal dictionaries are consulted | |
295 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
295 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` | |
296 | and :attr:`deferred_printers`. |
|
296 | and :attr:`deferred_printers`. | |
297 |
|
297 | |||
298 | Users should use these dictionaries to register functions that will be |
|
298 | Users should use these dictionaries to register functions that will be | |
299 | used to compute the format data for their objects (if those objects don't |
|
299 | used to compute the format data for their objects (if those objects don't | |
300 | have the special print methods). The easiest way of using these |
|
300 | have the special print methods). The easiest way of using these | |
301 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
301 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` | |
302 | methods. |
|
302 | methods. | |
303 |
|
303 | |||
304 | If no function/callable is found to compute the format data, ``None`` is |
|
304 | If no function/callable is found to compute the format data, ``None`` is | |
305 | returned and this format type is not used. |
|
305 | returned and this format type is not used. | |
306 | """ |
|
306 | """ | |
307 |
|
307 | |||
308 | format_type = Unicode('text/plain') |
|
308 | format_type = Unicode('text/plain') | |
309 | _return_type = string_types |
|
309 | _return_type = string_types | |
310 |
|
310 | |||
311 | enabled = Bool(True, config=True) |
|
311 | enabled = Bool(True, config=True) | |
312 |
|
312 | |||
313 | print_method = ObjectName('__repr__') |
|
313 | print_method = ObjectName('__repr__') | |
314 |
|
314 | |||
315 | # The singleton printers. |
|
315 | # The singleton printers. | |
316 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
316 | # Maps the IDs of the builtin singleton objects to the format functions. | |
317 | singleton_printers = Dict(config=True) |
|
317 | singleton_printers = Dict(config=True) | |
318 |
|
318 | |||
319 | # The type-specific printers. |
|
319 | # The type-specific printers. | |
320 | # Map type objects to the format functions. |
|
320 | # Map type objects to the format functions. | |
321 | type_printers = Dict(config=True) |
|
321 | type_printers = Dict(config=True) | |
322 |
|
322 | |||
323 | # The deferred-import type-specific printers. |
|
323 | # The deferred-import type-specific printers. | |
324 | # Map (modulename, classname) pairs to the format functions. |
|
324 | # Map (modulename, classname) pairs to the format functions. | |
325 | deferred_printers = Dict(config=True) |
|
325 | deferred_printers = Dict(config=True) | |
326 |
|
326 | |||
327 | @catch_format_error |
|
327 | @catch_format_error | |
328 | def __call__(self, obj): |
|
328 | def __call__(self, obj): | |
329 | """Compute the format for an object.""" |
|
329 | """Compute the format for an object.""" | |
330 | if self.enabled: |
|
330 | if self.enabled: | |
331 | # lookup registered printer |
|
331 | # lookup registered printer | |
332 | try: |
|
332 | try: | |
333 | printer = self.lookup(obj) |
|
333 | printer = self.lookup(obj) | |
334 | except KeyError: |
|
334 | except KeyError: | |
335 | pass |
|
335 | pass | |
336 | else: |
|
336 | else: | |
337 | return printer(obj) |
|
337 | return printer(obj) | |
338 | # Finally look for special method names |
|
338 | # Finally look for special method names | |
339 | method = _safe_get_formatter_method(obj, self.print_method) |
|
339 | method = _safe_get_formatter_method(obj, self.print_method) | |
340 | if method is not None: |
|
340 | if method is not None: | |
341 | return method() |
|
341 | return method() | |
342 | return None |
|
342 | return None | |
343 | else: |
|
343 | else: | |
344 | return None |
|
344 | return None | |
345 |
|
345 | |||
346 | def __contains__(self, typ): |
|
346 | def __contains__(self, typ): | |
347 | """map in to lookup_by_type""" |
|
347 | """map in to lookup_by_type""" | |
348 | try: |
|
348 | try: | |
349 | self.lookup_by_type(typ) |
|
349 | self.lookup_by_type(typ) | |
350 | except KeyError: |
|
350 | except KeyError: | |
351 | return False |
|
351 | return False | |
352 | else: |
|
352 | else: | |
353 | return True |
|
353 | return True | |
354 |
|
354 | |||
355 | def _check_return(self, r, obj): |
|
355 | def _check_return(self, r, obj): | |
356 | """Check that a return value is appropriate |
|
356 | """Check that a return value is appropriate | |
357 |
|
357 | |||
358 | Return the value if so, None otherwise, warning if invalid. |
|
358 | Return the value if so, None otherwise, warning if invalid. | |
359 | """ |
|
359 | """ | |
360 | if r is None or isinstance(r, self._return_type) or \ |
|
360 | if r is None or isinstance(r, self._return_type) or \ | |
361 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
361 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): | |
362 | return r |
|
362 | return r | |
363 | else: |
|
363 | else: | |
364 | warnings.warn( |
|
364 | warnings.warn( | |
365 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
365 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ | |
366 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), |
|
366 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), | |
367 | FormatterWarning |
|
367 | FormatterWarning | |
368 | ) |
|
368 | ) | |
369 |
|
369 | |||
370 | def lookup(self, obj): |
|
370 | def lookup(self, obj): | |
371 | """Look up the formatter for a given instance. |
|
371 | """Look up the formatter for a given instance. | |
372 |
|
372 | |||
373 | Parameters |
|
373 | Parameters | |
374 | ---------- |
|
374 | ---------- | |
375 | obj : object instance |
|
375 | obj : object instance | |
376 |
|
376 | |||
377 | Returns |
|
377 | Returns | |
378 | ------- |
|
378 | ------- | |
379 | f : callable |
|
379 | f : callable | |
380 | The registered formatting callable for the type. |
|
380 | The registered formatting callable for the type. | |
381 |
|
381 | |||
382 | Raises |
|
382 | Raises | |
383 | ------ |
|
383 | ------ | |
384 | KeyError if the type has not been registered. |
|
384 | KeyError if the type has not been registered. | |
385 | """ |
|
385 | """ | |
386 | # look for singleton first |
|
386 | # look for singleton first | |
387 | obj_id = id(obj) |
|
387 | obj_id = id(obj) | |
388 | if obj_id in self.singleton_printers: |
|
388 | if obj_id in self.singleton_printers: | |
389 | return self.singleton_printers[obj_id] |
|
389 | return self.singleton_printers[obj_id] | |
390 | # then lookup by type |
|
390 | # then lookup by type | |
391 | return self.lookup_by_type(_get_type(obj)) |
|
391 | return self.lookup_by_type(_get_type(obj)) | |
392 |
|
392 | |||
393 | def lookup_by_type(self, typ): |
|
393 | def lookup_by_type(self, typ): | |
394 | """Look up the registered formatter for a type. |
|
394 | """Look up the registered formatter for a type. | |
395 |
|
395 | |||
396 | Parameters |
|
396 | Parameters | |
397 | ---------- |
|
397 | ---------- | |
398 | typ : type or '__module__.__name__' string for a type |
|
398 | typ : type or '__module__.__name__' string for a type | |
399 |
|
399 | |||
400 | Returns |
|
400 | Returns | |
401 | ------- |
|
401 | ------- | |
402 | f : callable |
|
402 | f : callable | |
403 | The registered formatting callable for the type. |
|
403 | The registered formatting callable for the type. | |
404 |
|
404 | |||
405 | Raises |
|
405 | Raises | |
406 | ------ |
|
406 | ------ | |
407 | KeyError if the type has not been registered. |
|
407 | KeyError if the type has not been registered. | |
408 | """ |
|
408 | """ | |
409 | if isinstance(typ, string_types): |
|
409 | if isinstance(typ, string_types): | |
410 | typ_key = tuple(typ.rsplit('.',1)) |
|
410 | typ_key = tuple(typ.rsplit('.',1)) | |
411 | if typ_key not in self.deferred_printers: |
|
411 | if typ_key not in self.deferred_printers: | |
412 | # We may have it cached in the type map. We will have to |
|
412 | # We may have it cached in the type map. We will have to | |
413 | # iterate over all of the types to check. |
|
413 | # iterate over all of the types to check. | |
414 | for cls in self.type_printers: |
|
414 | for cls in self.type_printers: | |
415 | if _mod_name_key(cls) == typ_key: |
|
415 | if _mod_name_key(cls) == typ_key: | |
416 | return self.type_printers[cls] |
|
416 | return self.type_printers[cls] | |
417 | else: |
|
417 | else: | |
418 | return self.deferred_printers[typ_key] |
|
418 | return self.deferred_printers[typ_key] | |
419 | else: |
|
419 | else: | |
420 | for cls in pretty._get_mro(typ): |
|
420 | for cls in pretty._get_mro(typ): | |
421 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
421 | if cls in self.type_printers or self._in_deferred_types(cls): | |
422 | return self.type_printers[cls] |
|
422 | return self.type_printers[cls] | |
423 |
|
423 | |||
424 | # If we have reached here, the lookup failed. |
|
424 | # If we have reached here, the lookup failed. | |
425 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
425 | raise KeyError("No registered printer for {0!r}".format(typ)) | |
426 |
|
426 | |||
427 | def for_type(self, typ, func=None): |
|
427 | def for_type(self, typ, func=None): | |
428 | """Add a format function for a given type. |
|
428 | """Add a format function for a given type. | |
429 |
|
429 | |||
430 | Parameters |
|
430 | Parameters | |
431 | ----------- |
|
431 | ----------- | |
432 | typ : type or '__module__.__name__' string for a type |
|
432 | typ : type or '__module__.__name__' string for a type | |
433 | The class of the object that will be formatted using `func`. |
|
433 | The class of the object that will be formatted using `func`. | |
434 | func : callable |
|
434 | func : callable | |
435 | A callable for computing the format data. |
|
435 | A callable for computing the format data. | |
436 | `func` will be called with the object to be formatted, |
|
436 | `func` will be called with the object to be formatted, | |
437 | and will return the raw data in this formatter's format. |
|
437 | and will return the raw data in this formatter's format. | |
438 | Subclasses may use a different call signature for the |
|
438 | Subclasses may use a different call signature for the | |
439 | `func` argument. |
|
439 | `func` argument. | |
440 |
|
440 | |||
441 | If `func` is None or not specified, there will be no change, |
|
441 | If `func` is None or not specified, there will be no change, | |
442 | only returning the current value. |
|
442 | only returning the current value. | |
443 |
|
443 | |||
444 | Returns |
|
444 | Returns | |
445 | ------- |
|
445 | ------- | |
446 | oldfunc : callable |
|
446 | oldfunc : callable | |
447 | The currently registered callable. |
|
447 | The currently registered callable. | |
448 | If you are registering a new formatter, |
|
448 | If you are registering a new formatter, | |
449 | this will be the previous value (to enable restoring later). |
|
449 | this will be the previous value (to enable restoring later). | |
450 | """ |
|
450 | """ | |
451 | # if string given, interpret as 'pkg.module.class_name' |
|
451 | # if string given, interpret as 'pkg.module.class_name' | |
452 | if isinstance(typ, string_types): |
|
452 | if isinstance(typ, string_types): | |
453 | type_module, type_name = typ.rsplit('.', 1) |
|
453 | type_module, type_name = typ.rsplit('.', 1) | |
454 | return self.for_type_by_name(type_module, type_name, func) |
|
454 | return self.for_type_by_name(type_module, type_name, func) | |
455 |
|
455 | |||
456 | try: |
|
456 | try: | |
457 | oldfunc = self.lookup_by_type(typ) |
|
457 | oldfunc = self.lookup_by_type(typ) | |
458 | except KeyError: |
|
458 | except KeyError: | |
459 | oldfunc = None |
|
459 | oldfunc = None | |
460 |
|
460 | |||
461 | if func is not None: |
|
461 | if func is not None: | |
462 | self.type_printers[typ] = func |
|
462 | self.type_printers[typ] = func | |
463 |
|
463 | |||
464 | return oldfunc |
|
464 | return oldfunc | |
465 |
|
465 | |||
466 | def for_type_by_name(self, type_module, type_name, func=None): |
|
466 | def for_type_by_name(self, type_module, type_name, func=None): | |
467 | """Add a format function for a type specified by the full dotted |
|
467 | """Add a format function for a type specified by the full dotted | |
468 | module and name of the type, rather than the type of the object. |
|
468 | module and name of the type, rather than the type of the object. | |
469 |
|
469 | |||
470 | Parameters |
|
470 | Parameters | |
471 | ---------- |
|
471 | ---------- | |
472 | type_module : str |
|
472 | type_module : str | |
473 | The full dotted name of the module the type is defined in, like |
|
473 | The full dotted name of the module the type is defined in, like | |
474 | ``numpy``. |
|
474 | ``numpy``. | |
475 | type_name : str |
|
475 | type_name : str | |
476 | The name of the type (the class name), like ``dtype`` |
|
476 | The name of the type (the class name), like ``dtype`` | |
477 | func : callable |
|
477 | func : callable | |
478 | A callable for computing the format data. |
|
478 | A callable for computing the format data. | |
479 | `func` will be called with the object to be formatted, |
|
479 | `func` will be called with the object to be formatted, | |
480 | and will return the raw data in this formatter's format. |
|
480 | and will return the raw data in this formatter's format. | |
481 | Subclasses may use a different call signature for the |
|
481 | Subclasses may use a different call signature for the | |
482 | `func` argument. |
|
482 | `func` argument. | |
483 |
|
483 | |||
484 | If `func` is None or unspecified, there will be no change, |
|
484 | If `func` is None or unspecified, there will be no change, | |
485 | only returning the current value. |
|
485 | only returning the current value. | |
486 |
|
486 | |||
487 | Returns |
|
487 | Returns | |
488 | ------- |
|
488 | ------- | |
489 | oldfunc : callable |
|
489 | oldfunc : callable | |
490 | The currently registered callable. |
|
490 | The currently registered callable. | |
491 | If you are registering a new formatter, |
|
491 | If you are registering a new formatter, | |
492 | this will be the previous value (to enable restoring later). |
|
492 | this will be the previous value (to enable restoring later). | |
493 | """ |
|
493 | """ | |
494 | key = (type_module, type_name) |
|
494 | key = (type_module, type_name) | |
495 |
|
495 | |||
496 | try: |
|
496 | try: | |
497 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
497 | oldfunc = self.lookup_by_type("%s.%s" % key) | |
498 | except KeyError: |
|
498 | except KeyError: | |
499 | oldfunc = None |
|
499 | oldfunc = None | |
500 |
|
500 | |||
501 | if func is not None: |
|
501 | if func is not None: | |
502 | self.deferred_printers[key] = func |
|
502 | self.deferred_printers[key] = func | |
503 | return oldfunc |
|
503 | return oldfunc | |
504 |
|
504 | |||
505 | def pop(self, typ, default=_raise_key_error): |
|
505 | def pop(self, typ, default=_raise_key_error): | |
506 | """Pop a formatter for the given type. |
|
506 | """Pop a formatter for the given type. | |
507 |
|
507 | |||
508 | Parameters |
|
508 | Parameters | |
509 | ---------- |
|
509 | ---------- | |
510 | typ : type or '__module__.__name__' string for a type |
|
510 | typ : type or '__module__.__name__' string for a type | |
511 | default : object |
|
511 | default : object | |
512 | value to be returned if no formatter is registered for typ. |
|
512 | value to be returned if no formatter is registered for typ. | |
513 |
|
513 | |||
514 | Returns |
|
514 | Returns | |
515 | ------- |
|
515 | ------- | |
516 | obj : object |
|
516 | obj : object | |
517 | The last registered object for the type. |
|
517 | The last registered object for the type. | |
518 |
|
518 | |||
519 | Raises |
|
519 | Raises | |
520 | ------ |
|
520 | ------ | |
521 | KeyError if the type is not registered and default is not specified. |
|
521 | KeyError if the type is not registered and default is not specified. | |
522 | """ |
|
522 | """ | |
523 |
|
523 | |||
524 | if isinstance(typ, string_types): |
|
524 | if isinstance(typ, string_types): | |
525 | typ_key = tuple(typ.rsplit('.',1)) |
|
525 | typ_key = tuple(typ.rsplit('.',1)) | |
526 | if typ_key not in self.deferred_printers: |
|
526 | if typ_key not in self.deferred_printers: | |
527 | # We may have it cached in the type map. We will have to |
|
527 | # We may have it cached in the type map. We will have to | |
528 | # iterate over all of the types to check. |
|
528 | # iterate over all of the types to check. | |
529 | for cls in self.type_printers: |
|
529 | for cls in self.type_printers: | |
530 | if _mod_name_key(cls) == typ_key: |
|
530 | if _mod_name_key(cls) == typ_key: | |
531 | old = self.type_printers.pop(cls) |
|
531 | old = self.type_printers.pop(cls) | |
532 | break |
|
532 | break | |
533 | else: |
|
533 | else: | |
534 | old = default |
|
534 | old = default | |
535 | else: |
|
535 | else: | |
536 | old = self.deferred_printers.pop(typ_key) |
|
536 | old = self.deferred_printers.pop(typ_key) | |
537 | else: |
|
537 | else: | |
538 | if typ in self.type_printers: |
|
538 | if typ in self.type_printers: | |
539 | old = self.type_printers.pop(typ) |
|
539 | old = self.type_printers.pop(typ) | |
540 | else: |
|
540 | else: | |
541 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
541 | old = self.deferred_printers.pop(_mod_name_key(typ), default) | |
542 | if old is _raise_key_error: |
|
542 | if old is _raise_key_error: | |
543 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
543 | raise KeyError("No registered value for {0!r}".format(typ)) | |
544 | return old |
|
544 | return old | |
545 |
|
545 | |||
546 | def _in_deferred_types(self, cls): |
|
546 | def _in_deferred_types(self, cls): | |
547 | """ |
|
547 | """ | |
548 | Check if the given class is specified in the deferred type registry. |
|
548 | Check if the given class is specified in the deferred type registry. | |
549 |
|
549 | |||
550 | Successful matches will be moved to the regular type registry for future use. |
|
550 | Successful matches will be moved to the regular type registry for future use. | |
551 | """ |
|
551 | """ | |
552 | mod = getattr(cls, '__module__', None) |
|
552 | mod = getattr(cls, '__module__', None) | |
553 | name = getattr(cls, '__name__', None) |
|
553 | name = getattr(cls, '__name__', None) | |
554 | key = (mod, name) |
|
554 | key = (mod, name) | |
555 | if key in self.deferred_printers: |
|
555 | if key in self.deferred_printers: | |
556 | # Move the printer over to the regular registry. |
|
556 | # Move the printer over to the regular registry. | |
557 | printer = self.deferred_printers.pop(key) |
|
557 | printer = self.deferred_printers.pop(key) | |
558 | self.type_printers[cls] = printer |
|
558 | self.type_printers[cls] = printer | |
559 | return True |
|
559 | return True | |
560 | return False |
|
560 | return False | |
561 |
|
561 | |||
562 |
|
562 | |||
563 | class PlainTextFormatter(BaseFormatter): |
|
563 | class PlainTextFormatter(BaseFormatter): | |
564 | """The default pretty-printer. |
|
564 | """The default pretty-printer. | |
565 |
|
565 | |||
566 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
566 | This uses :mod:`IPython.lib.pretty` to compute the format data of | |
567 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
567 | the object. If the object cannot be pretty printed, :func:`repr` is used. | |
568 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
568 | See the documentation of :mod:`IPython.lib.pretty` for details on | |
569 | how to write pretty printers. Here is a simple example:: |
|
569 | how to write pretty printers. Here is a simple example:: | |
570 |
|
570 | |||
571 | def dtype_pprinter(obj, p, cycle): |
|
571 | def dtype_pprinter(obj, p, cycle): | |
572 | if cycle: |
|
572 | if cycle: | |
573 | return p.text('dtype(...)') |
|
573 | return p.text('dtype(...)') | |
574 | if hasattr(obj, 'fields'): |
|
574 | if hasattr(obj, 'fields'): | |
575 | if obj.fields is None: |
|
575 | if obj.fields is None: | |
576 | p.text(repr(obj)) |
|
576 | p.text(repr(obj)) | |
577 | else: |
|
577 | else: | |
578 | p.begin_group(7, 'dtype([') |
|
578 | p.begin_group(7, 'dtype([') | |
579 | for i, field in enumerate(obj.descr): |
|
579 | for i, field in enumerate(obj.descr): | |
580 | if i > 0: |
|
580 | if i > 0: | |
581 | p.text(',') |
|
581 | p.text(',') | |
582 | p.breakable() |
|
582 | p.breakable() | |
583 | p.pretty(field) |
|
583 | p.pretty(field) | |
584 | p.end_group(7, '])') |
|
584 | p.end_group(7, '])') | |
585 | """ |
|
585 | """ | |
586 |
|
586 | |||
587 | # The format type of data returned. |
|
587 | # The format type of data returned. | |
588 | format_type = Unicode('text/plain') |
|
588 | format_type = Unicode('text/plain') | |
589 |
|
589 | |||
590 | # This subclass ignores this attribute as it always need to return |
|
590 | # This subclass ignores this attribute as it always need to return | |
591 | # something. |
|
591 | # something. | |
592 | enabled = Bool(True, config=False) |
|
592 | enabled = Bool(True, config=False) | |
593 |
|
593 | |||
594 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, config=True, |
|
594 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, config=True, | |
595 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
595 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. | |
596 |
|
596 | |||
597 | Set to 0 to disable truncation. |
|
597 | Set to 0 to disable truncation. | |
598 | """ |
|
598 | """ | |
599 | ) |
|
599 | ) | |
600 |
|
600 | |||
601 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
601 | # Look for a _repr_pretty_ methods to use for pretty printing. | |
602 | print_method = ObjectName('_repr_pretty_') |
|
602 | print_method = ObjectName('_repr_pretty_') | |
603 |
|
603 | |||
604 | # Whether to pretty-print or not. |
|
604 | # Whether to pretty-print or not. | |
605 | pprint = Bool(True, config=True) |
|
605 | pprint = Bool(True, config=True) | |
606 |
|
606 | |||
607 | # Whether to be verbose or not. |
|
607 | # Whether to be verbose or not. | |
608 | verbose = Bool(False, config=True) |
|
608 | verbose = Bool(False, config=True) | |
609 |
|
609 | |||
610 | # The maximum width. |
|
610 | # The maximum width. | |
611 | max_width = Integer(79, config=True) |
|
611 | max_width = Integer(79, config=True) | |
612 |
|
612 | |||
613 | # The newline character. |
|
613 | # The newline character. | |
614 | newline = Unicode('\n', config=True) |
|
614 | newline = Unicode('\n', config=True) | |
615 |
|
615 | |||
616 | # format-string for pprinting floats |
|
616 | # format-string for pprinting floats | |
617 | float_format = Unicode('%r') |
|
617 | float_format = Unicode('%r') | |
618 | # setter for float precision, either int or direct format-string |
|
618 | # setter for float precision, either int or direct format-string | |
619 | float_precision = CUnicode('', config=True) |
|
619 | float_precision = CUnicode('', config=True) | |
620 |
|
620 | |||
621 | def _float_precision_changed(self, name, old, new): |
|
621 | def _float_precision_changed(self, name, old, new): | |
622 | """float_precision changed, set float_format accordingly. |
|
622 | """float_precision changed, set float_format accordingly. | |
623 |
|
623 | |||
624 | float_precision can be set by int or str. |
|
624 | float_precision can be set by int or str. | |
625 | This will set float_format, after interpreting input. |
|
625 | This will set float_format, after interpreting input. | |
626 | If numpy has been imported, numpy print precision will also be set. |
|
626 | If numpy has been imported, numpy print precision will also be set. | |
627 |
|
627 | |||
628 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
628 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
629 |
|
629 | |||
630 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
630 | An empty string returns to defaults (repr for float, 8 for numpy). | |
631 |
|
631 | |||
632 | This parameter can be set via the '%precision' magic. |
|
632 | This parameter can be set via the '%precision' magic. | |
633 | """ |
|
633 | """ | |
634 |
|
634 | |||
635 | if '%' in new: |
|
635 | if '%' in new: | |
636 | # got explicit format string |
|
636 | # got explicit format string | |
637 | fmt = new |
|
637 | fmt = new | |
638 | try: |
|
638 | try: | |
639 | fmt%3.14159 |
|
639 | fmt%3.14159 | |
640 | except Exception: |
|
640 | except Exception: | |
641 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
641 | raise ValueError("Precision must be int or format string, not %r"%new) | |
642 | elif new: |
|
642 | elif new: | |
643 | # otherwise, should be an int |
|
643 | # otherwise, should be an int | |
644 | try: |
|
644 | try: | |
645 | i = int(new) |
|
645 | i = int(new) | |
646 | assert i >= 0 |
|
646 | assert i >= 0 | |
647 | except ValueError: |
|
647 | except ValueError: | |
648 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
648 | raise ValueError("Precision must be int or format string, not %r"%new) | |
649 | except AssertionError: |
|
649 | except AssertionError: | |
650 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
650 | raise ValueError("int precision must be non-negative, not %r"%i) | |
651 |
|
651 | |||
652 | fmt = '%%.%if'%i |
|
652 | fmt = '%%.%if'%i | |
653 | if 'numpy' in sys.modules: |
|
653 | if 'numpy' in sys.modules: | |
654 | # set numpy precision if it has been imported |
|
654 | # set numpy precision if it has been imported | |
655 | import numpy |
|
655 | import numpy | |
656 | numpy.set_printoptions(precision=i) |
|
656 | numpy.set_printoptions(precision=i) | |
657 | else: |
|
657 | else: | |
658 | # default back to repr |
|
658 | # default back to repr | |
659 | fmt = '%r' |
|
659 | fmt = '%r' | |
660 | if 'numpy' in sys.modules: |
|
660 | if 'numpy' in sys.modules: | |
661 | import numpy |
|
661 | import numpy | |
662 | # numpy default is 8 |
|
662 | # numpy default is 8 | |
663 | numpy.set_printoptions(precision=8) |
|
663 | numpy.set_printoptions(precision=8) | |
664 | self.float_format = fmt |
|
664 | self.float_format = fmt | |
665 |
|
665 | |||
666 | # Use the default pretty printers from IPython.lib.pretty. |
|
666 | # Use the default pretty printers from IPython.lib.pretty. | |
667 | def _singleton_printers_default(self): |
|
667 | def _singleton_printers_default(self): | |
668 | return pretty._singleton_pprinters.copy() |
|
668 | return pretty._singleton_pprinters.copy() | |
669 |
|
669 | |||
670 | def _type_printers_default(self): |
|
670 | def _type_printers_default(self): | |
671 | d = pretty._type_pprinters.copy() |
|
671 | d = pretty._type_pprinters.copy() | |
672 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
672 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
673 | return d |
|
673 | return d | |
674 |
|
674 | |||
675 | def _deferred_printers_default(self): |
|
675 | def _deferred_printers_default(self): | |
676 | return pretty._deferred_type_pprinters.copy() |
|
676 | return pretty._deferred_type_pprinters.copy() | |
677 |
|
677 | |||
678 | #### FormatterABC interface #### |
|
678 | #### FormatterABC interface #### | |
679 |
|
679 | |||
680 | @catch_format_error |
|
680 | @catch_format_error | |
681 | def __call__(self, obj): |
|
681 | def __call__(self, obj): | |
682 | """Compute the pretty representation of the object.""" |
|
682 | """Compute the pretty representation of the object.""" | |
683 | if not self.pprint: |
|
683 | if not self.pprint: | |
684 | return repr(obj) |
|
684 | return repr(obj) | |
685 | else: |
|
685 | else: | |
686 | # handle str and unicode on Python 2 |
|
686 | # handle str and unicode on Python 2 | |
687 | # io.StringIO only accepts unicode, |
|
687 | # io.StringIO only accepts unicode, | |
688 | # cStringIO doesn't handle unicode on py2, |
|
688 | # cStringIO doesn't handle unicode on py2, | |
689 | # StringIO allows str, unicode but only ascii str |
|
689 | # StringIO allows str, unicode but only ascii str | |
690 | stream = pretty.CUnicodeIO() |
|
690 | stream = pretty.CUnicodeIO() | |
691 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
691 | printer = pretty.RepresentationPrinter(stream, self.verbose, | |
692 | self.max_width, self.newline, |
|
692 | self.max_width, self.newline, | |
693 | max_seq_length=self.max_seq_length, |
|
693 | max_seq_length=self.max_seq_length, | |
694 | singleton_pprinters=self.singleton_printers, |
|
694 | singleton_pprinters=self.singleton_printers, | |
695 | type_pprinters=self.type_printers, |
|
695 | type_pprinters=self.type_printers, | |
696 | deferred_pprinters=self.deferred_printers) |
|
696 | deferred_pprinters=self.deferred_printers) | |
697 | printer.pretty(obj) |
|
697 | printer.pretty(obj) | |
698 | printer.flush() |
|
698 | printer.flush() | |
699 | return stream.getvalue() |
|
699 | return stream.getvalue() | |
700 |
|
700 | |||
701 |
|
701 | |||
702 | class HTMLFormatter(BaseFormatter): |
|
702 | class HTMLFormatter(BaseFormatter): | |
703 | """An HTML formatter. |
|
703 | """An HTML formatter. | |
704 |
|
704 | |||
705 | To define the callables that compute the HTML representation of your |
|
705 | To define the callables that compute the HTML representation of your | |
706 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
706 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` | |
707 | or :meth:`for_type_by_name` methods to register functions that handle |
|
707 | or :meth:`for_type_by_name` methods to register functions that handle | |
708 | this. |
|
708 | this. | |
709 |
|
709 | |||
710 | The return value of this formatter should be a valid HTML snippet that |
|
710 | The return value of this formatter should be a valid HTML snippet that | |
711 | could be injected into an existing DOM. It should *not* include the |
|
711 | could be injected into an existing DOM. It should *not* include the | |
712 | ```<html>`` or ```<body>`` tags. |
|
712 | ```<html>`` or ```<body>`` tags. | |
713 | """ |
|
713 | """ | |
714 | format_type = Unicode('text/html') |
|
714 | format_type = Unicode('text/html') | |
715 |
|
715 | |||
716 | print_method = ObjectName('_repr_html_') |
|
716 | print_method = ObjectName('_repr_html_') | |
717 |
|
717 | |||
718 |
|
718 | |||
719 | class MarkdownFormatter(BaseFormatter): |
|
719 | class MarkdownFormatter(BaseFormatter): | |
720 | """A Markdown formatter. |
|
720 | """A Markdown formatter. | |
721 |
|
721 | |||
722 | To define the callables that compute the Markdown representation of your |
|
722 | To define the callables that compute the Markdown representation of your | |
723 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
723 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` | |
724 | or :meth:`for_type_by_name` methods to register functions that handle |
|
724 | or :meth:`for_type_by_name` methods to register functions that handle | |
725 | this. |
|
725 | this. | |
726 |
|
726 | |||
727 | The return value of this formatter should be a valid Markdown. |
|
727 | The return value of this formatter should be a valid Markdown. | |
728 | """ |
|
728 | """ | |
729 | format_type = Unicode('text/markdown') |
|
729 | format_type = Unicode('text/markdown') | |
730 |
|
730 | |||
731 | print_method = ObjectName('_repr_markdown_') |
|
731 | print_method = ObjectName('_repr_markdown_') | |
732 |
|
732 | |||
733 | class SVGFormatter(BaseFormatter): |
|
733 | class SVGFormatter(BaseFormatter): | |
734 | """An SVG formatter. |
|
734 | """An SVG formatter. | |
735 |
|
735 | |||
736 | To define the callables that compute the SVG representation of your |
|
736 | To define the callables that compute the SVG representation of your | |
737 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
737 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` | |
738 | or :meth:`for_type_by_name` methods to register functions that handle |
|
738 | or :meth:`for_type_by_name` methods to register functions that handle | |
739 | this. |
|
739 | this. | |
740 |
|
740 | |||
741 | The return value of this formatter should be valid SVG enclosed in |
|
741 | The return value of this formatter should be valid SVG enclosed in | |
742 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
742 | ```<svg>``` tags, that could be injected into an existing DOM. It should | |
743 | *not* include the ```<html>`` or ```<body>`` tags. |
|
743 | *not* include the ```<html>`` or ```<body>`` tags. | |
744 | """ |
|
744 | """ | |
745 | format_type = Unicode('image/svg+xml') |
|
745 | format_type = Unicode('image/svg+xml') | |
746 |
|
746 | |||
747 | print_method = ObjectName('_repr_svg_') |
|
747 | print_method = ObjectName('_repr_svg_') | |
748 |
|
748 | |||
749 |
|
749 | |||
750 | class PNGFormatter(BaseFormatter): |
|
750 | class PNGFormatter(BaseFormatter): | |
751 | """A PNG formatter. |
|
751 | """A PNG formatter. | |
752 |
|
752 | |||
753 | To define the callables that compute the PNG representation of your |
|
753 | To define the callables that compute the PNG representation of your | |
754 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
754 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` | |
755 | or :meth:`for_type_by_name` methods to register functions that handle |
|
755 | or :meth:`for_type_by_name` methods to register functions that handle | |
756 | this. |
|
756 | this. | |
757 |
|
757 | |||
758 | The return value of this formatter should be raw PNG data, *not* |
|
758 | The return value of this formatter should be raw PNG data, *not* | |
759 | base64 encoded. |
|
759 | base64 encoded. | |
760 | """ |
|
760 | """ | |
761 | format_type = Unicode('image/png') |
|
761 | format_type = Unicode('image/png') | |
762 |
|
762 | |||
763 | print_method = ObjectName('_repr_png_') |
|
763 | print_method = ObjectName('_repr_png_') | |
764 |
|
764 | |||
765 | _return_type = (bytes, unicode_type) |
|
765 | _return_type = (bytes, unicode_type) | |
766 |
|
766 | |||
767 |
|
767 | |||
768 | class JPEGFormatter(BaseFormatter): |
|
768 | class JPEGFormatter(BaseFormatter): | |
769 | """A JPEG formatter. |
|
769 | """A JPEG formatter. | |
770 |
|
770 | |||
771 | To define the callables that compute the JPEG representation of your |
|
771 | To define the callables that compute the JPEG representation of your | |
772 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
772 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` | |
773 | or :meth:`for_type_by_name` methods to register functions that handle |
|
773 | or :meth:`for_type_by_name` methods to register functions that handle | |
774 | this. |
|
774 | this. | |
775 |
|
775 | |||
776 | The return value of this formatter should be raw JPEG data, *not* |
|
776 | The return value of this formatter should be raw JPEG data, *not* | |
777 | base64 encoded. |
|
777 | base64 encoded. | |
778 | """ |
|
778 | """ | |
779 | format_type = Unicode('image/jpeg') |
|
779 | format_type = Unicode('image/jpeg') | |
780 |
|
780 | |||
781 | print_method = ObjectName('_repr_jpeg_') |
|
781 | print_method = ObjectName('_repr_jpeg_') | |
782 |
|
782 | |||
783 | _return_type = (bytes, unicode_type) |
|
783 | _return_type = (bytes, unicode_type) | |
784 |
|
784 | |||
785 |
|
785 | |||
786 | class LatexFormatter(BaseFormatter): |
|
786 | class LatexFormatter(BaseFormatter): | |
787 | """A LaTeX formatter. |
|
787 | """A LaTeX formatter. | |
788 |
|
788 | |||
789 | To define the callables that compute the LaTeX representation of your |
|
789 | To define the callables that compute the LaTeX representation of your | |
790 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
790 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` | |
791 | or :meth:`for_type_by_name` methods to register functions that handle |
|
791 | or :meth:`for_type_by_name` methods to register functions that handle | |
792 | this. |
|
792 | this. | |
793 |
|
793 | |||
794 | The return value of this formatter should be a valid LaTeX equation, |
|
794 | The return value of this formatter should be a valid LaTeX equation, | |
795 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
795 | enclosed in either ```$```, ```$$``` or another LaTeX equation | |
796 | environment. |
|
796 | environment. | |
797 | """ |
|
797 | """ | |
798 | format_type = Unicode('text/latex') |
|
798 | format_type = Unicode('text/latex') | |
799 |
|
799 | |||
800 | print_method = ObjectName('_repr_latex_') |
|
800 | print_method = ObjectName('_repr_latex_') | |
801 |
|
801 | |||
802 |
|
802 | |||
803 | class JSONFormatter(BaseFormatter): |
|
803 | class JSONFormatter(BaseFormatter): | |
804 | """A JSON string formatter. |
|
804 | """A JSON string formatter. | |
805 |
|
805 | |||
806 | To define the callables that compute the JSONable representation of |
|
806 | To define the callables that compute the JSONable representation of | |
807 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
807 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` | |
808 | or :meth:`for_type_by_name` methods to register functions that handle |
|
808 | or :meth:`for_type_by_name` methods to register functions that handle | |
809 | this. |
|
809 | this. | |
810 |
|
810 | |||
811 | The return value of this formatter should be a JSONable list or dict. |
|
811 | The return value of this formatter should be a JSONable list or dict. | |
812 | JSON scalars (None, number, string) are not allowed, only dict or list containers. |
|
812 | JSON scalars (None, number, string) are not allowed, only dict or list containers. | |
813 | """ |
|
813 | """ | |
814 | format_type = Unicode('application/json') |
|
814 | format_type = Unicode('application/json') | |
815 | _return_type = (list, dict) |
|
815 | _return_type = (list, dict) | |
816 |
|
816 | |||
817 | print_method = ObjectName('_repr_json_') |
|
817 | print_method = ObjectName('_repr_json_') | |
818 |
|
818 | |||
819 | def _check_return(self, r, obj): |
|
819 | def _check_return(self, r, obj): | |
820 | """Check that a return value is appropriate |
|
820 | """Check that a return value is appropriate | |
821 |
|
821 | |||
822 | Return the value if so, None otherwise, warning if invalid. |
|
822 | Return the value if so, None otherwise, warning if invalid. | |
823 | """ |
|
823 | """ | |
824 | if r is None: |
|
824 | if r is None: | |
825 | return |
|
825 | return | |
826 | md = None |
|
826 | md = None | |
827 | if isinstance(r, tuple): |
|
827 | if isinstance(r, tuple): | |
828 | # unpack data, metadata tuple for type checking on first element |
|
828 | # unpack data, metadata tuple for type checking on first element | |
829 | r, md = r |
|
829 | r, md = r | |
830 |
|
830 | |||
831 | # handle deprecated JSON-as-string form from IPython < 3 |
|
831 | # handle deprecated JSON-as-string form from IPython < 3 | |
832 | if isinstance(r, string_types): |
|
832 | if isinstance(r, string_types): | |
833 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", |
|
833 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", | |
834 | FormatterWarning) |
|
834 | FormatterWarning) | |
835 | r = json.loads(r) |
|
835 | r = json.loads(r) | |
836 |
|
836 | |||
837 | if md is not None: |
|
837 | if md is not None: | |
838 | # put the tuple back together |
|
838 | # put the tuple back together | |
839 | r = (r, md) |
|
839 | r = (r, md) | |
840 | return super(JSONFormatter, self)._check_return(r, obj) |
|
840 | return super(JSONFormatter, self)._check_return(r, obj) | |
841 |
|
841 | |||
842 |
|
842 | |||
843 | class JavascriptFormatter(BaseFormatter): |
|
843 | class JavascriptFormatter(BaseFormatter): | |
844 | """A Javascript formatter. |
|
844 | """A Javascript formatter. | |
845 |
|
845 | |||
846 | To define the callables that compute the Javascript representation of |
|
846 | To define the callables that compute the Javascript representation of | |
847 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
847 | your objects, define a :meth:`_repr_javascript_` method or use the | |
848 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
848 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions | |
849 | that handle this. |
|
849 | that handle this. | |
850 |
|
850 | |||
851 | The return value of this formatter should be valid Javascript code and |
|
851 | The return value of this formatter should be valid Javascript code and | |
852 | should *not* be enclosed in ```<script>``` tags. |
|
852 | should *not* be enclosed in ```<script>``` tags. | |
853 | """ |
|
853 | """ | |
854 | format_type = Unicode('application/javascript') |
|
854 | format_type = Unicode('application/javascript') | |
855 |
|
855 | |||
856 | print_method = ObjectName('_repr_javascript_') |
|
856 | print_method = ObjectName('_repr_javascript_') | |
857 |
|
857 | |||
858 |
|
858 | |||
859 | class PDFFormatter(BaseFormatter): |
|
859 | class PDFFormatter(BaseFormatter): | |
860 | """A PDF formatter. |
|
860 | """A PDF formatter. | |
861 |
|
861 | |||
862 | To define the callables that compute the PDF representation of your |
|
862 | To define the callables that compute the PDF representation of your | |
863 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
863 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` | |
864 | or :meth:`for_type_by_name` methods to register functions that handle |
|
864 | or :meth:`for_type_by_name` methods to register functions that handle | |
865 | this. |
|
865 | this. | |
866 |
|
866 | |||
867 | The return value of this formatter should be raw PDF data, *not* |
|
867 | The return value of this formatter should be raw PDF data, *not* | |
868 | base64 encoded. |
|
868 | base64 encoded. | |
869 | """ |
|
869 | """ | |
870 | format_type = Unicode('application/pdf') |
|
870 | format_type = Unicode('application/pdf') | |
871 |
|
871 | |||
872 | print_method = ObjectName('_repr_pdf_') |
|
872 | print_method = ObjectName('_repr_pdf_') | |
873 |
|
873 | |||
874 | _return_type = (bytes, unicode_type) |
|
874 | _return_type = (bytes, unicode_type) | |
875 |
|
875 | |||
876 | class IPythonDisplayFormatter(BaseFormatter): |
|
876 | class IPythonDisplayFormatter(BaseFormatter): | |
877 | """A Formatter for objects that know how to display themselves. |
|
877 | """A Formatter for objects that know how to display themselves. | |
878 |
|
878 | |||
879 | To define the callables that compute the representation of your |
|
879 | To define the callables that compute the representation of your | |
880 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` |
|
880 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` | |
881 | or :meth:`for_type_by_name` methods to register functions that handle |
|
881 | or :meth:`for_type_by_name` methods to register functions that handle | |
882 | this. Unlike mime-type displays, this method should not return anything, |
|
882 | this. Unlike mime-type displays, this method should not return anything, | |
883 | instead calling any appropriate display methods itself. |
|
883 | instead calling any appropriate display methods itself. | |
884 |
|
884 | |||
885 | This display formatter has highest priority. |
|
885 | This display formatter has highest priority. | |
886 | If it fires, no other display formatter will be called. |
|
886 | If it fires, no other display formatter will be called. | |
887 | """ |
|
887 | """ | |
888 | print_method = ObjectName('_ipython_display_') |
|
888 | print_method = ObjectName('_ipython_display_') | |
889 | _return_type = (type(None), bool) |
|
889 | _return_type = (type(None), bool) | |
890 |
|
890 | |||
891 |
|
891 | |||
892 | @catch_format_error |
|
892 | @catch_format_error | |
893 | def __call__(self, obj): |
|
893 | def __call__(self, obj): | |
894 | """Compute the format for an object.""" |
|
894 | """Compute the format for an object.""" | |
895 | if self.enabled: |
|
895 | if self.enabled: | |
896 | # lookup registered printer |
|
896 | # lookup registered printer | |
897 | try: |
|
897 | try: | |
898 | printer = self.lookup(obj) |
|
898 | printer = self.lookup(obj) | |
899 | except KeyError: |
|
899 | except KeyError: | |
900 | pass |
|
900 | pass | |
901 | else: |
|
901 | else: | |
902 | printer(obj) |
|
902 | printer(obj) | |
903 | return True |
|
903 | return True | |
904 | # Finally look for special method names |
|
904 | # Finally look for special method names | |
905 | method = _safe_get_formatter_method(obj, self.print_method) |
|
905 | method = _safe_get_formatter_method(obj, self.print_method) | |
906 | if method is not None: |
|
906 | if method is not None: | |
907 | method() |
|
907 | method() | |
908 | return True |
|
908 | return True | |
909 |
|
909 | |||
910 |
|
910 | |||
911 | FormatterABC.register(BaseFormatter) |
|
911 | FormatterABC.register(BaseFormatter) | |
912 | FormatterABC.register(PlainTextFormatter) |
|
912 | FormatterABC.register(PlainTextFormatter) | |
913 | FormatterABC.register(HTMLFormatter) |
|
913 | FormatterABC.register(HTMLFormatter) | |
914 | FormatterABC.register(MarkdownFormatter) |
|
914 | FormatterABC.register(MarkdownFormatter) | |
915 | FormatterABC.register(SVGFormatter) |
|
915 | FormatterABC.register(SVGFormatter) | |
916 | FormatterABC.register(PNGFormatter) |
|
916 | FormatterABC.register(PNGFormatter) | |
917 | FormatterABC.register(PDFFormatter) |
|
917 | FormatterABC.register(PDFFormatter) | |
918 | FormatterABC.register(JPEGFormatter) |
|
918 | FormatterABC.register(JPEGFormatter) | |
919 | FormatterABC.register(LatexFormatter) |
|
919 | FormatterABC.register(LatexFormatter) | |
920 | FormatterABC.register(JSONFormatter) |
|
920 | FormatterABC.register(JSONFormatter) | |
921 | FormatterABC.register(JavascriptFormatter) |
|
921 | FormatterABC.register(JavascriptFormatter) | |
922 | FormatterABC.register(IPythonDisplayFormatter) |
|
922 | FormatterABC.register(IPythonDisplayFormatter) | |
923 |
|
923 | |||
924 |
|
924 | |||
925 | def format_display_data(obj, include=None, exclude=None): |
|
925 | def format_display_data(obj, include=None, exclude=None): | |
926 | """Return a format data dict for an object. |
|
926 | """Return a format data dict for an object. | |
927 |
|
927 | |||
928 | By default all format types will be computed. |
|
928 | By default all format types will be computed. | |
929 |
|
929 | |||
930 | The following MIME types are currently implemented: |
|
930 | The following MIME types are currently implemented: | |
931 |
|
931 | |||
932 | * text/plain |
|
932 | * text/plain | |
933 | * text/html |
|
933 | * text/html | |
934 | * text/markdown |
|
934 | * text/markdown | |
935 | * text/latex |
|
935 | * text/latex | |
936 | * application/json |
|
936 | * application/json | |
937 | * application/javascript |
|
937 | * application/javascript | |
938 | * application/pdf |
|
938 | * application/pdf | |
939 | * image/png |
|
939 | * image/png | |
940 | * image/jpeg |
|
940 | * image/jpeg | |
941 | * image/svg+xml |
|
941 | * image/svg+xml | |
942 |
|
942 | |||
943 | Parameters |
|
943 | Parameters | |
944 | ---------- |
|
944 | ---------- | |
945 | obj : object |
|
945 | obj : object | |
946 | The Python object whose format data will be computed. |
|
946 | The Python object whose format data will be computed. | |
947 |
|
947 | |||
948 | Returns |
|
948 | Returns | |
949 | ------- |
|
949 | ------- | |
950 | format_dict : dict |
|
950 | format_dict : dict | |
951 | A dictionary of key/value pairs, one or each format that was |
|
951 | A dictionary of key/value pairs, one or each format that was | |
952 | generated for the object. The keys are the format types, which |
|
952 | generated for the object. The keys are the format types, which | |
953 | will usually be MIME type strings and the values and JSON'able |
|
953 | will usually be MIME type strings and the values and JSON'able | |
954 | data structure containing the raw data for the representation in |
|
954 | data structure containing the raw data for the representation in | |
955 | that format. |
|
955 | that format. | |
956 | include : list or tuple, optional |
|
956 | include : list or tuple, optional | |
957 | A list of format type strings (MIME types) to include in the |
|
957 | A list of format type strings (MIME types) to include in the | |
958 | format data dict. If this is set *only* the format types included |
|
958 | format data dict. If this is set *only* the format types included | |
959 | in this list will be computed. |
|
959 | in this list will be computed. | |
960 | exclude : list or tuple, optional |
|
960 | exclude : list or tuple, optional | |
961 | A list of format type string (MIME types) to exclue in the format |
|
961 | A list of format type string (MIME types) to exclue in the format | |
962 | data dict. If this is set all format types will be computed, |
|
962 | data dict. If this is set all format types will be computed, | |
963 | except for those included in this argument. |
|
963 | except for those included in this argument. | |
964 | """ |
|
964 | """ | |
965 | from IPython.core.interactiveshell import InteractiveShell |
|
965 | from IPython.core.interactiveshell import InteractiveShell | |
966 |
|
966 | |||
967 | InteractiveShell.instance().display_formatter.format( |
|
967 | InteractiveShell.instance().display_formatter.format( | |
968 | obj, |
|
968 | obj, | |
969 | include, |
|
969 | include, | |
970 | exclude |
|
970 | exclude | |
971 | ) |
|
971 | ) | |
972 |
|
972 |
@@ -1,832 +1,817 b'' | |||||
1 | """Function signature objects for callables. |
|
1 | """Function signature objects for callables. | |
2 |
|
2 | |||
3 | Back port of Python 3.3's function signature tools from the inspect module, |
|
3 | Back port of Python 3.3's function signature tools from the inspect module, | |
4 | modified to be compatible with Python 2.7 and 3.2+. |
|
4 | modified to be compatible with Python 2.7 and 3.2+. | |
5 | """ |
|
5 | """ | |
6 |
|
6 | |||
7 | #----------------------------------------------------------------------------- |
|
7 | #----------------------------------------------------------------------------- | |
8 | # Python 3.3 stdlib inspect.py is public domain |
|
8 | # Python 3.3 stdlib inspect.py is public domain | |
9 | # |
|
9 | # | |
10 | # Backports Copyright (C) 2013 Aaron Iles |
|
10 | # Backports Copyright (C) 2013 Aaron Iles | |
11 | # Used under Apache License Version 2.0 |
|
11 | # Used under Apache License Version 2.0 | |
12 | # |
|
12 | # | |
13 | # Further Changes are Copyright (C) 2013 The IPython Development Team |
|
13 | # Further Changes are Copyright (C) 2013 The IPython Development Team | |
14 | # |
|
14 | # | |
15 | # Distributed under the terms of the BSD License. The full license is in |
|
15 | # Distributed under the terms of the BSD License. The full license is in | |
16 | # the file COPYING, distributed as part of this software. |
|
16 | # the file COPYING, distributed as part of this software. | |
17 | #----------------------------------------------------------------------------- |
|
17 | #----------------------------------------------------------------------------- | |
18 |
|
18 | |||
19 | from __future__ import absolute_import, division, print_function |
|
19 | from __future__ import absolute_import, division, print_function | |
20 | import itertools |
|
20 | import itertools | |
21 | import functools |
|
21 | import functools | |
22 | import re |
|
22 | import re | |
23 | import types |
|
23 | import types | |
24 |
|
24 | |||
25 |
|
25 | |||
26 | # patch for single-file |
|
26 | # patch for single-file | |
27 | # we don't support 2.6, so we can just import OrderedDict |
|
27 | # we don't support 2.6, so we can just import OrderedDict | |
28 | from collections import OrderedDict |
|
28 | from collections import OrderedDict | |
29 |
|
29 | |||
30 | __version__ = '0.3' |
|
30 | __version__ = '0.3' | |
31 | # end patch |
|
31 | # end patch | |
32 |
|
32 | |||
33 | __all__ = ['BoundArguments', 'Parameter', 'Signature', 'signature'] |
|
33 | __all__ = ['BoundArguments', 'Parameter', 'Signature', 'signature'] | |
34 |
|
34 | |||
35 |
|
35 | |||
36 | _WrapperDescriptor = type(type.__call__) |
|
36 | _WrapperDescriptor = type(type.__call__) | |
37 | _MethodWrapper = type(all.__call__) |
|
37 | _MethodWrapper = type(all.__call__) | |
38 |
|
38 | |||
39 | _NonUserDefinedCallables = (_WrapperDescriptor, |
|
39 | _NonUserDefinedCallables = (_WrapperDescriptor, | |
40 | _MethodWrapper, |
|
40 | _MethodWrapper, | |
41 | types.BuiltinFunctionType) |
|
41 | types.BuiltinFunctionType) | |
42 |
|
42 | |||
43 |
|
43 | |||
44 | def formatannotation(annotation, base_module=None): |
|
44 | def formatannotation(annotation, base_module=None): | |
45 | if isinstance(annotation, type): |
|
45 | if isinstance(annotation, type): | |
46 | if annotation.__module__ in ('builtins', '__builtin__', base_module): |
|
46 | if annotation.__module__ in ('builtins', '__builtin__', base_module): | |
47 | return annotation.__name__ |
|
47 | return annotation.__name__ | |
48 | return annotation.__module__+'.'+annotation.__name__ |
|
48 | return annotation.__module__+'.'+annotation.__name__ | |
49 | return repr(annotation) |
|
49 | return repr(annotation) | |
50 |
|
50 | |||
51 |
|
51 | |||
52 | def _get_user_defined_method(cls, method_name, *nested): |
|
52 | def _get_user_defined_method(cls, method_name, *nested): | |
53 | try: |
|
53 | try: | |
54 | if cls is type: |
|
54 | if cls is type: | |
55 | return |
|
55 | return | |
56 | meth = getattr(cls, method_name) |
|
56 | meth = getattr(cls, method_name) | |
57 | for name in nested: |
|
57 | for name in nested: | |
58 | meth = getattr(meth, name, meth) |
|
58 | meth = getattr(meth, name, meth) | |
59 | except AttributeError: |
|
59 | except AttributeError: | |
60 | return |
|
60 | return | |
61 | else: |
|
61 | else: | |
62 | if not isinstance(meth, _NonUserDefinedCallables): |
|
62 | if not isinstance(meth, _NonUserDefinedCallables): | |
63 | # Once '__signature__' will be added to 'C'-level |
|
63 | # Once '__signature__' will be added to 'C'-level | |
64 | # callables, this check won't be necessary |
|
64 | # callables, this check won't be necessary | |
65 | return meth |
|
65 | return meth | |
66 |
|
66 | |||
67 |
|
67 | |||
68 | def signature(obj): |
|
68 | def signature(obj): | |
69 | '''Get a signature object for the passed callable.''' |
|
69 | '''Get a signature object for the passed callable.''' | |
70 |
|
70 | |||
71 | if not callable(obj): |
|
71 | if not callable(obj): | |
72 | raise TypeError('{0!r} is not a callable object'.format(obj)) |
|
72 | raise TypeError('{0!r} is not a callable object'.format(obj)) | |
73 |
|
73 | |||
74 | if isinstance(obj, types.MethodType): |
|
74 | if isinstance(obj, types.MethodType): | |
75 | if obj.__self__ is None: |
|
75 | if obj.__self__ is None: | |
76 | # Unbound method - treat it as a function (no distinction in Py 3) |
|
76 | # Unbound method - treat it as a function (no distinction in Py 3) | |
77 | obj = obj.__func__ |
|
77 | obj = obj.__func__ | |
78 | else: |
|
78 | else: | |
79 | # Bound method: trim off the first parameter (typically self or cls) |
|
79 | # Bound method: trim off the first parameter (typically self or cls) | |
80 | sig = signature(obj.__func__) |
|
80 | sig = signature(obj.__func__) | |
81 | return sig.replace(parameters=tuple(sig.parameters.values())[1:]) |
|
81 | return sig.replace(parameters=tuple(sig.parameters.values())[1:]) | |
82 |
|
82 | |||
83 | try: |
|
83 | try: | |
84 | sig = obj.__signature__ |
|
84 | sig = obj.__signature__ | |
85 | except AttributeError: |
|
85 | except AttributeError: | |
86 | pass |
|
86 | pass | |
87 | else: |
|
87 | else: | |
88 | if sig is not None: |
|
88 | if sig is not None: | |
89 | return sig |
|
89 | return sig | |
90 |
|
90 | |||
91 | try: |
|
91 | try: | |
92 | # Was this function wrapped by a decorator? |
|
92 | # Was this function wrapped by a decorator? | |
93 | wrapped = obj.__wrapped__ |
|
93 | wrapped = obj.__wrapped__ | |
94 | except AttributeError: |
|
94 | except AttributeError: | |
95 | pass |
|
95 | pass | |
96 | else: |
|
96 | else: | |
97 | return signature(wrapped) |
|
97 | return signature(wrapped) | |
98 |
|
98 | |||
99 | if isinstance(obj, types.FunctionType): |
|
99 | if isinstance(obj, types.FunctionType): | |
100 | return Signature.from_function(obj) |
|
100 | return Signature.from_function(obj) | |
101 |
|
101 | |||
102 | if isinstance(obj, functools.partial): |
|
102 | if isinstance(obj, functools.partial): | |
103 | sig = signature(obj.func) |
|
103 | sig = signature(obj.func) | |
104 |
|
104 | |||
105 | new_params = OrderedDict(sig.parameters.items()) |
|
105 | new_params = OrderedDict(sig.parameters.items()) | |
106 |
|
106 | |||
107 | partial_args = obj.args or () |
|
107 | partial_args = obj.args or () | |
108 | partial_keywords = obj.keywords or {} |
|
108 | partial_keywords = obj.keywords or {} | |
109 | try: |
|
109 | try: | |
110 | ba = sig.bind_partial(*partial_args, **partial_keywords) |
|
110 | ba = sig.bind_partial(*partial_args, **partial_keywords) | |
111 | except TypeError as ex: |
|
111 | except TypeError as ex: | |
112 | msg = 'partial object {0!r} has incorrect arguments'.format(obj) |
|
112 | msg = 'partial object {0!r} has incorrect arguments'.format(obj) | |
113 | raise ValueError(msg) |
|
113 | raise ValueError(msg) | |
114 |
|
114 | |||
115 | for arg_name, arg_value in ba.arguments.items(): |
|
115 | for arg_name, arg_value in ba.arguments.items(): | |
116 | param = new_params[arg_name] |
|
116 | param = new_params[arg_name] | |
117 | if arg_name in partial_keywords: |
|
117 | if arg_name in partial_keywords: | |
118 | # We set a new default value, because the following code |
|
118 | # We set a new default value, because the following code | |
119 | # is correct: |
|
119 | # is correct: | |
120 | # |
|
120 | # | |
121 | # >>> def foo(a): print(a) |
|
121 | # >>> def foo(a): print(a) | |
122 | # >>> print(partial(partial(foo, a=10), a=20)()) |
|
122 | # >>> print(partial(partial(foo, a=10), a=20)()) | |
123 | # 20 |
|
123 | # 20 | |
124 | # >>> print(partial(partial(foo, a=10), a=20)(a=30)) |
|
124 | # >>> print(partial(partial(foo, a=10), a=20)(a=30)) | |
125 | # 30 |
|
125 | # 30 | |
126 | # |
|
126 | # | |
127 | # So, with 'partial' objects, passing a keyword argument is |
|
127 | # So, with 'partial' objects, passing a keyword argument is | |
128 | # like setting a new default value for the corresponding |
|
128 | # like setting a new default value for the corresponding | |
129 | # parameter |
|
129 | # parameter | |
130 | # |
|
130 | # | |
131 | # We also mark this parameter with '_partial_kwarg' |
|
131 | # We also mark this parameter with '_partial_kwarg' | |
132 | # flag. Later, in '_bind', the 'default' value of this |
|
132 | # flag. Later, in '_bind', the 'default' value of this | |
133 | # parameter will be added to 'kwargs', to simulate |
|
133 | # parameter will be added to 'kwargs', to simulate | |
134 | # the 'functools.partial' real call. |
|
134 | # the 'functools.partial' real call. | |
135 | new_params[arg_name] = param.replace(default=arg_value, |
|
135 | new_params[arg_name] = param.replace(default=arg_value, | |
136 | _partial_kwarg=True) |
|
136 | _partial_kwarg=True) | |
137 |
|
137 | |||
138 | elif (param.kind not in (_VAR_KEYWORD, _VAR_POSITIONAL) and |
|
138 | elif (param.kind not in (_VAR_KEYWORD, _VAR_POSITIONAL) and | |
139 | not param._partial_kwarg): |
|
139 | not param._partial_kwarg): | |
140 | new_params.pop(arg_name) |
|
140 | new_params.pop(arg_name) | |
141 |
|
141 | |||
142 | return sig.replace(parameters=new_params.values()) |
|
142 | return sig.replace(parameters=new_params.values()) | |
143 |
|
143 | |||
144 | sig = None |
|
144 | sig = None | |
145 | if isinstance(obj, type): |
|
145 | if isinstance(obj, type): | |
146 | # obj is a class or a metaclass |
|
146 | # obj is a class or a metaclass | |
147 |
|
147 | |||
148 | # First, let's see if it has an overloaded __call__ defined |
|
148 | # First, let's see if it has an overloaded __call__ defined | |
149 | # in its metaclass |
|
149 | # in its metaclass | |
150 | call = _get_user_defined_method(type(obj), '__call__') |
|
150 | call = _get_user_defined_method(type(obj), '__call__') | |
151 | if call is not None: |
|
151 | if call is not None: | |
152 | sig = signature(call) |
|
152 | sig = signature(call) | |
153 | else: |
|
153 | else: | |
154 | # Now we check if the 'obj' class has a '__new__' method |
|
154 | # Now we check if the 'obj' class has a '__new__' method | |
155 | new = _get_user_defined_method(obj, '__new__') |
|
155 | new = _get_user_defined_method(obj, '__new__') | |
156 | if new is not None: |
|
156 | if new is not None: | |
157 | sig = signature(new) |
|
157 | sig = signature(new) | |
158 | else: |
|
158 | else: | |
159 | # Finally, we should have at least __init__ implemented |
|
159 | # Finally, we should have at least __init__ implemented | |
160 | init = _get_user_defined_method(obj, '__init__') |
|
160 | init = _get_user_defined_method(obj, '__init__') | |
161 | if init is not None: |
|
161 | if init is not None: | |
162 | sig = signature(init) |
|
162 | sig = signature(init) | |
163 | elif not isinstance(obj, _NonUserDefinedCallables): |
|
163 | elif not isinstance(obj, _NonUserDefinedCallables): | |
164 | # An object with __call__ |
|
164 | # An object with __call__ | |
165 | # We also check that the 'obj' is not an instance of |
|
165 | # We also check that the 'obj' is not an instance of | |
166 | # _WrapperDescriptor or _MethodWrapper to avoid |
|
166 | # _WrapperDescriptor or _MethodWrapper to avoid | |
167 | # infinite recursion (and even potential segfault) |
|
167 | # infinite recursion (and even potential segfault) | |
168 | call = _get_user_defined_method(type(obj), '__call__', 'im_func') |
|
168 | call = _get_user_defined_method(type(obj), '__call__', 'im_func') | |
169 | if call is not None: |
|
169 | if call is not None: | |
170 | sig = signature(call) |
|
170 | sig = signature(call) | |
171 |
|
171 | |||
172 | if sig is not None: |
|
172 | if sig is not None: | |
173 | return sig |
|
173 | return sig | |
174 |
|
174 | |||
175 | if isinstance(obj, types.BuiltinFunctionType): |
|
175 | if isinstance(obj, types.BuiltinFunctionType): | |
176 | # Raise a nicer error message for builtins |
|
176 | # Raise a nicer error message for builtins | |
177 | msg = 'no signature found for builtin function {0!r}'.format(obj) |
|
177 | msg = 'no signature found for builtin function {0!r}'.format(obj) | |
178 | raise ValueError(msg) |
|
178 | raise ValueError(msg) | |
179 |
|
179 | |||
180 | raise ValueError('callable {0!r} is not supported by signature'.format(obj)) |
|
180 | raise ValueError('callable {0!r} is not supported by signature'.format(obj)) | |
181 |
|
181 | |||
182 |
|
182 | |||
183 | class _void(object): |
|
183 | class _void(object): | |
184 | '''A private marker - used in Parameter & Signature''' |
|
184 | '''A private marker - used in Parameter & Signature''' | |
185 |
|
185 | |||
186 |
|
186 | |||
187 | class _empty(object): |
|
187 | class _empty(object): | |
188 | pass |
|
188 | pass | |
189 |
|
189 | |||
190 |
|
190 | |||
191 | class _ParameterKind(int): |
|
191 | class _ParameterKind(int): | |
192 | def __new__(self, *args, **kwargs): |
|
192 | def __new__(self, *args, **kwargs): | |
193 | obj = int.__new__(self, *args) |
|
193 | obj = int.__new__(self, *args) | |
194 | obj._name = kwargs['name'] |
|
194 | obj._name = kwargs['name'] | |
195 | return obj |
|
195 | return obj | |
196 |
|
196 | |||
197 | def __str__(self): |
|
197 | def __str__(self): | |
198 | return self._name |
|
198 | return self._name | |
199 |
|
199 | |||
200 | def __repr__(self): |
|
200 | def __repr__(self): | |
201 | return '<_ParameterKind: {0!r}>'.format(self._name) |
|
201 | return '<_ParameterKind: {0!r}>'.format(self._name) | |
202 |
|
202 | |||
203 |
|
203 | |||
204 | _POSITIONAL_ONLY = _ParameterKind(0, name='POSITIONAL_ONLY') |
|
204 | _POSITIONAL_ONLY = _ParameterKind(0, name='POSITIONAL_ONLY') | |
205 | _POSITIONAL_OR_KEYWORD = _ParameterKind(1, name='POSITIONAL_OR_KEYWORD') |
|
205 | _POSITIONAL_OR_KEYWORD = _ParameterKind(1, name='POSITIONAL_OR_KEYWORD') | |
206 | _VAR_POSITIONAL = _ParameterKind(2, name='VAR_POSITIONAL') |
|
206 | _VAR_POSITIONAL = _ParameterKind(2, name='VAR_POSITIONAL') | |
207 | _KEYWORD_ONLY = _ParameterKind(3, name='KEYWORD_ONLY') |
|
207 | _KEYWORD_ONLY = _ParameterKind(3, name='KEYWORD_ONLY') | |
208 | _VAR_KEYWORD = _ParameterKind(4, name='VAR_KEYWORD') |
|
208 | _VAR_KEYWORD = _ParameterKind(4, name='VAR_KEYWORD') | |
209 |
|
209 | |||
210 |
|
210 | |||
211 | class Parameter(object): |
|
211 | class Parameter(object): | |
212 | '''Represents a parameter in a function signature. |
|
212 | '''Represents a parameter in a function signature. | |
213 |
|
213 | |||
214 | Has the following public attributes: |
|
214 | Has the following public attributes: | |
215 |
|
215 | |||
216 | * name : str |
|
216 | * name : str | |
217 | The name of the parameter as a string. |
|
217 | The name of the parameter as a string. | |
218 | * default : object |
|
218 | * default : object | |
219 | The default value for the parameter if specified. If the |
|
219 | The default value for the parameter if specified. If the | |
220 | parameter has no default value, this attribute is not set. |
|
220 | parameter has no default value, this attribute is not set. | |
221 | * annotation |
|
221 | * annotation | |
222 | The annotation for the parameter if specified. If the |
|
222 | The annotation for the parameter if specified. If the | |
223 | parameter has no annotation, this attribute is not set. |
|
223 | parameter has no annotation, this attribute is not set. | |
224 | * kind : str |
|
224 | * kind : str | |
225 | Describes how argument values are bound to the parameter. |
|
225 | Describes how argument values are bound to the parameter. | |
226 | Possible values: `Parameter.POSITIONAL_ONLY`, |
|
226 | Possible values: `Parameter.POSITIONAL_ONLY`, | |
227 | `Parameter.POSITIONAL_OR_KEYWORD`, `Parameter.VAR_POSITIONAL`, |
|
227 | `Parameter.POSITIONAL_OR_KEYWORD`, `Parameter.VAR_POSITIONAL`, | |
228 | `Parameter.KEYWORD_ONLY`, `Parameter.VAR_KEYWORD`. |
|
228 | `Parameter.KEYWORD_ONLY`, `Parameter.VAR_KEYWORD`. | |
229 | ''' |
|
229 | ''' | |
230 |
|
230 | |||
231 | __slots__ = ('_name', '_kind', '_default', '_annotation', '_partial_kwarg') |
|
231 | __slots__ = ('_name', '_kind', '_default', '_annotation', '_partial_kwarg') | |
232 |
|
232 | |||
233 | POSITIONAL_ONLY = _POSITIONAL_ONLY |
|
233 | POSITIONAL_ONLY = _POSITIONAL_ONLY | |
234 | POSITIONAL_OR_KEYWORD = _POSITIONAL_OR_KEYWORD |
|
234 | POSITIONAL_OR_KEYWORD = _POSITIONAL_OR_KEYWORD | |
235 | VAR_POSITIONAL = _VAR_POSITIONAL |
|
235 | VAR_POSITIONAL = _VAR_POSITIONAL | |
236 | KEYWORD_ONLY = _KEYWORD_ONLY |
|
236 | KEYWORD_ONLY = _KEYWORD_ONLY | |
237 | VAR_KEYWORD = _VAR_KEYWORD |
|
237 | VAR_KEYWORD = _VAR_KEYWORD | |
238 |
|
238 | |||
239 | empty = _empty |
|
239 | empty = _empty | |
240 |
|
240 | |||
241 | def __init__(self, name, kind, default=_empty, annotation=_empty, |
|
241 | def __init__(self, name, kind, default=_empty, annotation=_empty, | |
242 | _partial_kwarg=False): |
|
242 | _partial_kwarg=False): | |
243 |
|
243 | |||
244 | if kind not in (_POSITIONAL_ONLY, _POSITIONAL_OR_KEYWORD, |
|
244 | if kind not in (_POSITIONAL_ONLY, _POSITIONAL_OR_KEYWORD, | |
245 | _VAR_POSITIONAL, _KEYWORD_ONLY, _VAR_KEYWORD): |
|
245 | _VAR_POSITIONAL, _KEYWORD_ONLY, _VAR_KEYWORD): | |
246 | raise ValueError("invalid value for 'Parameter.kind' attribute") |
|
246 | raise ValueError("invalid value for 'Parameter.kind' attribute") | |
247 | self._kind = kind |
|
247 | self._kind = kind | |
248 |
|
248 | |||
249 | if default is not _empty: |
|
249 | if default is not _empty: | |
250 | if kind in (_VAR_POSITIONAL, _VAR_KEYWORD): |
|
250 | if kind in (_VAR_POSITIONAL, _VAR_KEYWORD): | |
251 | msg = '{0} parameters cannot have default values'.format(kind) |
|
251 | msg = '{0} parameters cannot have default values'.format(kind) | |
252 | raise ValueError(msg) |
|
252 | raise ValueError(msg) | |
253 | self._default = default |
|
253 | self._default = default | |
254 | self._annotation = annotation |
|
254 | self._annotation = annotation | |
255 |
|
255 | |||
256 | if name is None: |
|
256 | if name is None: | |
257 | if kind != _POSITIONAL_ONLY: |
|
257 | if kind != _POSITIONAL_ONLY: | |
258 | raise ValueError("None is not a valid name for a " |
|
258 | raise ValueError("None is not a valid name for a " | |
259 | "non-positional-only parameter") |
|
259 | "non-positional-only parameter") | |
260 | self._name = name |
|
260 | self._name = name | |
261 | else: |
|
261 | else: | |
262 | name = str(name) |
|
262 | name = str(name) | |
263 | if kind != _POSITIONAL_ONLY and not re.match(r'[a-z_]\w*$', name, re.I): |
|
263 | if kind != _POSITIONAL_ONLY and not re.match(r'[a-z_]\w*$', name, re.I): | |
264 | msg = '{0!r} is not a valid parameter name'.format(name) |
|
264 | msg = '{0!r} is not a valid parameter name'.format(name) | |
265 | raise ValueError(msg) |
|
265 | raise ValueError(msg) | |
266 | self._name = name |
|
266 | self._name = name | |
267 |
|
267 | |||
268 | self._partial_kwarg = _partial_kwarg |
|
268 | self._partial_kwarg = _partial_kwarg | |
269 |
|
269 | |||
270 | @property |
|
270 | @property | |
271 | def name(self): |
|
271 | def name(self): | |
272 | return self._name |
|
272 | return self._name | |
273 |
|
273 | |||
274 | @property |
|
274 | @property | |
275 | def default(self): |
|
275 | def default(self): | |
276 | return self._default |
|
276 | return self._default | |
277 |
|
277 | |||
278 | @property |
|
278 | @property | |
279 | def annotation(self): |
|
279 | def annotation(self): | |
280 | return self._annotation |
|
280 | return self._annotation | |
281 |
|
281 | |||
282 | @property |
|
282 | @property | |
283 | def kind(self): |
|
283 | def kind(self): | |
284 | return self._kind |
|
284 | return self._kind | |
285 |
|
285 | |||
286 | def replace(self, name=_void, kind=_void, annotation=_void, |
|
286 | def replace(self, name=_void, kind=_void, annotation=_void, | |
287 | default=_void, _partial_kwarg=_void): |
|
287 | default=_void, _partial_kwarg=_void): | |
288 | '''Creates a customized copy of the Parameter.''' |
|
288 | '''Creates a customized copy of the Parameter.''' | |
289 |
|
289 | |||
290 | if name is _void: |
|
290 | if name is _void: | |
291 | name = self._name |
|
291 | name = self._name | |
292 |
|
292 | |||
293 | if kind is _void: |
|
293 | if kind is _void: | |
294 | kind = self._kind |
|
294 | kind = self._kind | |
295 |
|
295 | |||
296 | if annotation is _void: |
|
296 | if annotation is _void: | |
297 | annotation = self._annotation |
|
297 | annotation = self._annotation | |
298 |
|
298 | |||
299 | if default is _void: |
|
299 | if default is _void: | |
300 | default = self._default |
|
300 | default = self._default | |
301 |
|
301 | |||
302 | if _partial_kwarg is _void: |
|
302 | if _partial_kwarg is _void: | |
303 | _partial_kwarg = self._partial_kwarg |
|
303 | _partial_kwarg = self._partial_kwarg | |
304 |
|
304 | |||
305 | return type(self)(name, kind, default=default, annotation=annotation, |
|
305 | return type(self)(name, kind, default=default, annotation=annotation, | |
306 | _partial_kwarg=_partial_kwarg) |
|
306 | _partial_kwarg=_partial_kwarg) | |
307 |
|
307 | |||
308 | def __str__(self): |
|
308 | def __str__(self): | |
309 | kind = self.kind |
|
309 | kind = self.kind | |
310 |
|
310 | |||
311 | formatted = self._name |
|
311 | formatted = self._name | |
312 | if kind == _POSITIONAL_ONLY: |
|
312 | if kind == _POSITIONAL_ONLY: | |
313 | if formatted is None: |
|
313 | if formatted is None: | |
314 | formatted = '' |
|
314 | formatted = '' | |
315 | formatted = '<{0}>'.format(formatted) |
|
315 | formatted = '<{0}>'.format(formatted) | |
316 |
|
316 | |||
317 | # Add annotation and default value |
|
317 | # Add annotation and default value | |
318 | if self._annotation is not _empty: |
|
318 | if self._annotation is not _empty: | |
319 | formatted = '{0}:{1}'.format(formatted, |
|
319 | formatted = '{0}:{1}'.format(formatted, | |
320 | formatannotation(self._annotation)) |
|
320 | formatannotation(self._annotation)) | |
321 |
|
321 | |||
322 | if self._default is not _empty: |
|
322 | if self._default is not _empty: | |
323 | formatted = '{0}={1}'.format(formatted, repr(self._default)) |
|
323 | formatted = '{0}={1}'.format(formatted, repr(self._default)) | |
324 |
|
324 | |||
325 | if kind == _VAR_POSITIONAL: |
|
325 | if kind == _VAR_POSITIONAL: | |
326 | formatted = '*' + formatted |
|
326 | formatted = '*' + formatted | |
327 | elif kind == _VAR_KEYWORD: |
|
327 | elif kind == _VAR_KEYWORD: | |
328 | formatted = '**' + formatted |
|
328 | formatted = '**' + formatted | |
329 |
|
329 | |||
330 | return formatted |
|
330 | return formatted | |
331 |
|
331 | |||
332 | def __repr__(self): |
|
332 | def __repr__(self): | |
333 | return '<{0} at {1:#x} {2!r}>'.format(self.__class__.__name__, |
|
333 | return '<{0} at {1:#x} {2!r}>'.format(self.__class__.__name__, | |
334 | id(self), self.name) |
|
334 | id(self), self.name) | |
335 |
|
335 | |||
336 | def __hash__(self): |
|
336 | def __hash__(self): | |
337 | msg = "unhashable type: '{0}'".format(self.__class__.__name__) |
|
337 | msg = "unhashable type: '{0}'".format(self.__class__.__name__) | |
338 | raise TypeError(msg) |
|
338 | raise TypeError(msg) | |
339 |
|
339 | |||
340 | def __eq__(self, other): |
|
340 | def __eq__(self, other): | |
341 | return (issubclass(other.__class__, Parameter) and |
|
341 | return (issubclass(other.__class__, Parameter) and | |
342 | self._name == other._name and |
|
342 | self._name == other._name and | |
343 | self._kind == other._kind and |
|
343 | self._kind == other._kind and | |
344 | self._default == other._default and |
|
344 | self._default == other._default and | |
345 | self._annotation == other._annotation) |
|
345 | self._annotation == other._annotation) | |
346 |
|
346 | |||
347 | def __ne__(self, other): |
|
347 | def __ne__(self, other): | |
348 | return not self.__eq__(other) |
|
348 | return not self.__eq__(other) | |
349 |
|
349 | |||
350 |
|
350 | |||
351 | class BoundArguments(object): |
|
351 | class BoundArguments(object): | |
352 | '''Result of :meth:`Signature.bind` call. Holds the mapping of arguments |
|
352 | '''Result of :meth:`Signature.bind` call. Holds the mapping of arguments | |
353 | to the function's parameters. |
|
353 | to the function's parameters. | |
354 |
|
354 | |||
355 | Has the following public attributes: |
|
355 | Has the following public attributes: | |
356 |
|
356 | |||
357 | arguments : :class:`collections.OrderedDict` |
|
357 | arguments : :class:`collections.OrderedDict` | |
358 | An ordered mutable mapping of parameters' names to arguments' values. |
|
358 | An ordered mutable mapping of parameters' names to arguments' values. | |
359 | Does not contain arguments' default values. |
|
359 | Does not contain arguments' default values. | |
360 | signature : :class:`Signature` |
|
360 | signature : :class:`Signature` | |
361 | The Signature object that created this instance. |
|
361 | The Signature object that created this instance. | |
362 | args : tuple |
|
362 | args : tuple | |
363 | Tuple of positional arguments values. |
|
363 | Tuple of positional arguments values. | |
364 | kwargs : dict |
|
364 | kwargs : dict | |
365 | Dict of keyword arguments values. |
|
365 | Dict of keyword arguments values. | |
366 | ''' |
|
366 | ''' | |
367 |
|
367 | |||
368 | def __init__(self, signature, arguments): |
|
368 | def __init__(self, signature, arguments): | |
369 | self.arguments = arguments |
|
369 | self.arguments = arguments | |
370 | self._signature = signature |
|
370 | self._signature = signature | |
371 |
|
371 | |||
372 | @property |
|
372 | @property | |
373 | def signature(self): |
|
373 | def signature(self): | |
374 | return self._signature |
|
374 | return self._signature | |
375 |
|
375 | |||
376 | @property |
|
376 | @property | |
377 | def args(self): |
|
377 | def args(self): | |
378 | args = [] |
|
378 | args = [] | |
379 | for param_name, param in self._signature.parameters.items(): |
|
379 | for param_name, param in self._signature.parameters.items(): | |
380 | if (param.kind in (_VAR_KEYWORD, _KEYWORD_ONLY) or |
|
380 | if (param.kind in (_VAR_KEYWORD, _KEYWORD_ONLY) or | |
381 | param._partial_kwarg): |
|
381 | param._partial_kwarg): | |
382 | # Keyword arguments mapped by 'functools.partial' |
|
382 | # Keyword arguments mapped by 'functools.partial' | |
383 | # (Parameter._partial_kwarg is True) are mapped |
|
383 | # (Parameter._partial_kwarg is True) are mapped | |
384 | # in 'BoundArguments.kwargs', along with VAR_KEYWORD & |
|
384 | # in 'BoundArguments.kwargs', along with VAR_KEYWORD & | |
385 | # KEYWORD_ONLY |
|
385 | # KEYWORD_ONLY | |
386 | break |
|
386 | break | |
387 |
|
387 | |||
388 | try: |
|
388 | try: | |
389 | arg = self.arguments[param_name] |
|
389 | arg = self.arguments[param_name] | |
390 | except KeyError: |
|
390 | except KeyError: | |
391 | # We're done here. Other arguments |
|
391 | # We're done here. Other arguments | |
392 | # will be mapped in 'BoundArguments.kwargs' |
|
392 | # will be mapped in 'BoundArguments.kwargs' | |
393 | break |
|
393 | break | |
394 | else: |
|
394 | else: | |
395 | if param.kind == _VAR_POSITIONAL: |
|
395 | if param.kind == _VAR_POSITIONAL: | |
396 | # *args |
|
396 | # *args | |
397 | args.extend(arg) |
|
397 | args.extend(arg) | |
398 | else: |
|
398 | else: | |
399 | # plain argument |
|
399 | # plain argument | |
400 | args.append(arg) |
|
400 | args.append(arg) | |
401 |
|
401 | |||
402 | return tuple(args) |
|
402 | return tuple(args) | |
403 |
|
403 | |||
404 | @property |
|
404 | @property | |
405 | def kwargs(self): |
|
405 | def kwargs(self): | |
406 | kwargs = {} |
|
406 | kwargs = {} | |
407 | kwargs_started = False |
|
407 | kwargs_started = False | |
408 | for param_name, param in self._signature.parameters.items(): |
|
408 | for param_name, param in self._signature.parameters.items(): | |
409 | if not kwargs_started: |
|
409 | if not kwargs_started: | |
410 | if (param.kind in (_VAR_KEYWORD, _KEYWORD_ONLY) or |
|
410 | if (param.kind in (_VAR_KEYWORD, _KEYWORD_ONLY) or | |
411 | param._partial_kwarg): |
|
411 | param._partial_kwarg): | |
412 | kwargs_started = True |
|
412 | kwargs_started = True | |
413 | else: |
|
413 | else: | |
414 | if param_name not in self.arguments: |
|
414 | if param_name not in self.arguments: | |
415 | kwargs_started = True |
|
415 | kwargs_started = True | |
416 | continue |
|
416 | continue | |
417 |
|
417 | |||
418 | if not kwargs_started: |
|
418 | if not kwargs_started: | |
419 | continue |
|
419 | continue | |
420 |
|
420 | |||
421 | try: |
|
421 | try: | |
422 | arg = self.arguments[param_name] |
|
422 | arg = self.arguments[param_name] | |
423 | except KeyError: |
|
423 | except KeyError: | |
424 | pass |
|
424 | pass | |
425 | else: |
|
425 | else: | |
426 | if param.kind == _VAR_KEYWORD: |
|
426 | if param.kind == _VAR_KEYWORD: | |
427 | # **kwargs |
|
427 | # **kwargs | |
428 | kwargs.update(arg) |
|
428 | kwargs.update(arg) | |
429 | else: |
|
429 | else: | |
430 | # plain keyword argument |
|
430 | # plain keyword argument | |
431 | kwargs[param_name] = arg |
|
431 | kwargs[param_name] = arg | |
432 |
|
432 | |||
433 | return kwargs |
|
433 | return kwargs | |
434 |
|
434 | |||
435 | def __hash__(self): |
|
435 | def __hash__(self): | |
436 | msg = "unhashable type: '{0}'".format(self.__class__.__name__) |
|
436 | msg = "unhashable type: '{0}'".format(self.__class__.__name__) | |
437 | raise TypeError(msg) |
|
437 | raise TypeError(msg) | |
438 |
|
438 | |||
439 | def __eq__(self, other): |
|
439 | def __eq__(self, other): | |
440 | return (issubclass(other.__class__, BoundArguments) and |
|
440 | return (issubclass(other.__class__, BoundArguments) and | |
441 | self.signature == other.signature and |
|
441 | self.signature == other.signature and | |
442 | self.arguments == other.arguments) |
|
442 | self.arguments == other.arguments) | |
443 |
|
443 | |||
444 | def __ne__(self, other): |
|
444 | def __ne__(self, other): | |
445 | return not self.__eq__(other) |
|
445 | return not self.__eq__(other) | |
446 |
|
446 | |||
447 |
|
447 | |||
448 | class Signature(object): |
|
448 | class Signature(object): | |
449 | '''A Signature object represents the overall signature of a function. |
|
449 | '''A Signature object represents the overall signature of a function. | |
450 | It stores a Parameter object for each parameter accepted by the |
|
450 | It stores a Parameter object for each parameter accepted by the | |
451 | function, as well as information specific to the function itself. |
|
451 | function, as well as information specific to the function itself. | |
452 |
|
452 | |||
453 | A Signature object has the following public attributes: |
|
453 | A Signature object has the following public attributes: | |
454 |
|
454 | |||
455 | parameters : :class:`collections.OrderedDict` |
|
455 | parameters : :class:`collections.OrderedDict` | |
456 | An ordered mapping of parameters' names to the corresponding |
|
456 | An ordered mapping of parameters' names to the corresponding | |
457 | Parameter objects (keyword-only arguments are in the same order |
|
457 | Parameter objects (keyword-only arguments are in the same order | |
458 | as listed in `code.co_varnames`). |
|
458 | as listed in `code.co_varnames`). | |
459 | return_annotation |
|
459 | return_annotation | |
460 | The annotation for the return type of the function if specified. |
|
460 | The annotation for the return type of the function if specified. | |
461 | If the function has no annotation for its return type, this |
|
461 | If the function has no annotation for its return type, this | |
462 | attribute is not set. |
|
462 | attribute is not set. | |
463 | ''' |
|
463 | ''' | |
464 |
|
464 | |||
465 | __slots__ = ('_return_annotation', '_parameters') |
|
465 | __slots__ = ('_return_annotation', '_parameters') | |
466 |
|
466 | |||
467 | _parameter_cls = Parameter |
|
467 | _parameter_cls = Parameter | |
468 | _bound_arguments_cls = BoundArguments |
|
468 | _bound_arguments_cls = BoundArguments | |
469 |
|
469 | |||
470 | empty = _empty |
|
470 | empty = _empty | |
471 |
|
471 | |||
472 | def __init__(self, parameters=None, return_annotation=_empty, |
|
472 | def __init__(self, parameters=None, return_annotation=_empty, | |
473 | __validate_parameters__=True): |
|
473 | __validate_parameters__=True): | |
474 | '''Constructs Signature from the given list of Parameter |
|
474 | '''Constructs Signature from the given list of Parameter | |
475 | objects and 'return_annotation'. All arguments are optional. |
|
475 | objects and 'return_annotation'. All arguments are optional. | |
476 | ''' |
|
476 | ''' | |
477 |
|
477 | |||
478 | if parameters is None: |
|
478 | if parameters is None: | |
479 | params = OrderedDict() |
|
479 | params = OrderedDict() | |
480 | else: |
|
480 | else: | |
481 | if __validate_parameters__: |
|
481 | if __validate_parameters__: | |
482 | params = OrderedDict() |
|
482 | params = OrderedDict() | |
483 | top_kind = _POSITIONAL_ONLY |
|
483 | top_kind = _POSITIONAL_ONLY | |
484 |
|
484 | |||
485 | for idx, param in enumerate(parameters): |
|
485 | for idx, param in enumerate(parameters): | |
486 | kind = param.kind |
|
486 | kind = param.kind | |
487 | if kind < top_kind: |
|
487 | if kind < top_kind: | |
488 | msg = 'wrong parameter order: {0} before {1}' |
|
488 | msg = 'wrong parameter order: {0} before {1}' | |
489 | msg = msg.format(top_kind, param.kind) |
|
489 | msg = msg.format(top_kind, param.kind) | |
490 | raise ValueError(msg) |
|
490 | raise ValueError(msg) | |
491 | else: |
|
491 | else: | |
492 | top_kind = kind |
|
492 | top_kind = kind | |
493 |
|
493 | |||
494 | name = param.name |
|
494 | name = param.name | |
495 | if name is None: |
|
495 | if name is None: | |
496 | name = str(idx) |
|
496 | name = str(idx) | |
497 | param = param.replace(name=name) |
|
497 | param = param.replace(name=name) | |
498 |
|
498 | |||
499 | if name in params: |
|
499 | if name in params: | |
500 | msg = 'duplicate parameter name: {0!r}'.format(name) |
|
500 | msg = 'duplicate parameter name: {0!r}'.format(name) | |
501 | raise ValueError(msg) |
|
501 | raise ValueError(msg) | |
502 | params[name] = param |
|
502 | params[name] = param | |
503 | else: |
|
503 | else: | |
504 | params = OrderedDict(((param.name, param) |
|
504 | params = OrderedDict(((param.name, param) | |
505 | for param in parameters)) |
|
505 | for param in parameters)) | |
506 |
|
506 | |||
507 | self._parameters = params |
|
507 | self._parameters = params | |
508 | self._return_annotation = return_annotation |
|
508 | self._return_annotation = return_annotation | |
509 |
|
509 | |||
510 | @classmethod |
|
510 | @classmethod | |
511 | def from_function(cls, func): |
|
511 | def from_function(cls, func): | |
512 | '''Constructs Signature for the given python function''' |
|
512 | '''Constructs Signature for the given python function''' | |
513 |
|
513 | |||
514 | if not isinstance(func, types.FunctionType): |
|
514 | if not isinstance(func, types.FunctionType): | |
515 | raise TypeError('{0!r} is not a Python function'.format(func)) |
|
515 | raise TypeError('{0!r} is not a Python function'.format(func)) | |
516 |
|
516 | |||
517 | Parameter = cls._parameter_cls |
|
517 | Parameter = cls._parameter_cls | |
518 |
|
518 | |||
519 | # Parameter information. |
|
519 | # Parameter information. | |
520 | func_code = func.__code__ |
|
520 | func_code = func.__code__ | |
521 | pos_count = func_code.co_argcount |
|
521 | pos_count = func_code.co_argcount | |
522 | arg_names = func_code.co_varnames |
|
522 | arg_names = func_code.co_varnames | |
523 | positional = tuple(arg_names[:pos_count]) |
|
523 | positional = tuple(arg_names[:pos_count]) | |
524 | keyword_only_count = getattr(func_code, 'co_kwonlyargcount', 0) |
|
524 | keyword_only_count = getattr(func_code, 'co_kwonlyargcount', 0) | |
525 | keyword_only = arg_names[pos_count:(pos_count + keyword_only_count)] |
|
525 | keyword_only = arg_names[pos_count:(pos_count + keyword_only_count)] | |
526 | annotations = getattr(func, '__annotations__', {}) |
|
526 | annotations = getattr(func, '__annotations__', {}) | |
527 | defaults = func.__defaults__ |
|
527 | defaults = func.__defaults__ | |
528 | kwdefaults = getattr(func, '__kwdefaults__', None) |
|
528 | kwdefaults = getattr(func, '__kwdefaults__', None) | |
529 |
|
529 | |||
530 | if defaults: |
|
530 | if defaults: | |
531 | pos_default_count = len(defaults) |
|
531 | pos_default_count = len(defaults) | |
532 | else: |
|
532 | else: | |
533 | pos_default_count = 0 |
|
533 | pos_default_count = 0 | |
534 |
|
534 | |||
535 | parameters = [] |
|
535 | parameters = [] | |
536 |
|
536 | |||
537 | # Non-keyword-only parameters w/o defaults. |
|
537 | # Non-keyword-only parameters w/o defaults. | |
538 | non_default_count = pos_count - pos_default_count |
|
538 | non_default_count = pos_count - pos_default_count | |
539 | for name in positional[:non_default_count]: |
|
539 | for name in positional[:non_default_count]: | |
540 | annotation = annotations.get(name, _empty) |
|
540 | annotation = annotations.get(name, _empty) | |
541 | parameters.append(Parameter(name, annotation=annotation, |
|
541 | parameters.append(Parameter(name, annotation=annotation, | |
542 | kind=_POSITIONAL_OR_KEYWORD)) |
|
542 | kind=_POSITIONAL_OR_KEYWORD)) | |
543 |
|
543 | |||
544 | # ... w/ defaults. |
|
544 | # ... w/ defaults. | |
545 | for offset, name in enumerate(positional[non_default_count:]): |
|
545 | for offset, name in enumerate(positional[non_default_count:]): | |
546 | annotation = annotations.get(name, _empty) |
|
546 | annotation = annotations.get(name, _empty) | |
547 | parameters.append(Parameter(name, annotation=annotation, |
|
547 | parameters.append(Parameter(name, annotation=annotation, | |
548 | kind=_POSITIONAL_OR_KEYWORD, |
|
548 | kind=_POSITIONAL_OR_KEYWORD, | |
549 | default=defaults[offset])) |
|
549 | default=defaults[offset])) | |
550 |
|
550 | |||
551 | # *args |
|
551 | # *args | |
552 | if func_code.co_flags & 0x04: |
|
552 | if func_code.co_flags & 0x04: | |
553 | name = arg_names[pos_count + keyword_only_count] |
|
553 | name = arg_names[pos_count + keyword_only_count] | |
554 | annotation = annotations.get(name, _empty) |
|
554 | annotation = annotations.get(name, _empty) | |
555 | parameters.append(Parameter(name, annotation=annotation, |
|
555 | parameters.append(Parameter(name, annotation=annotation, | |
556 | kind=_VAR_POSITIONAL)) |
|
556 | kind=_VAR_POSITIONAL)) | |
557 |
|
557 | |||
558 | # Keyword-only parameters. |
|
558 | # Keyword-only parameters. | |
559 | for name in keyword_only: |
|
559 | for name in keyword_only: | |
560 | default = _empty |
|
560 | default = _empty | |
561 | if kwdefaults is not None: |
|
561 | if kwdefaults is not None: | |
562 | default = kwdefaults.get(name, _empty) |
|
562 | default = kwdefaults.get(name, _empty) | |
563 |
|
563 | |||
564 | annotation = annotations.get(name, _empty) |
|
564 | annotation = annotations.get(name, _empty) | |
565 | parameters.append(Parameter(name, annotation=annotation, |
|
565 | parameters.append(Parameter(name, annotation=annotation, | |
566 | kind=_KEYWORD_ONLY, |
|
566 | kind=_KEYWORD_ONLY, | |
567 | default=default)) |
|
567 | default=default)) | |
568 | # **kwargs |
|
568 | # **kwargs | |
569 | if func_code.co_flags & 0x08: |
|
569 | if func_code.co_flags & 0x08: | |
570 | index = pos_count + keyword_only_count |
|
570 | index = pos_count + keyword_only_count | |
571 | if func_code.co_flags & 0x04: |
|
571 | if func_code.co_flags & 0x04: | |
572 | index += 1 |
|
572 | index += 1 | |
573 |
|
573 | |||
574 | name = arg_names[index] |
|
574 | name = arg_names[index] | |
575 | annotation = annotations.get(name, _empty) |
|
575 | annotation = annotations.get(name, _empty) | |
576 | parameters.append(Parameter(name, annotation=annotation, |
|
576 | parameters.append(Parameter(name, annotation=annotation, | |
577 | kind=_VAR_KEYWORD)) |
|
577 | kind=_VAR_KEYWORD)) | |
578 |
|
578 | |||
579 | return cls(parameters, |
|
579 | return cls(parameters, | |
580 | return_annotation=annotations.get('return', _empty), |
|
580 | return_annotation=annotations.get('return', _empty), | |
581 | __validate_parameters__=False) |
|
581 | __validate_parameters__=False) | |
582 |
|
582 | |||
583 | @property |
|
583 | @property | |
584 | def parameters(self): |
|
584 | def parameters(self): | |
585 | try: |
|
585 | try: | |
586 | return types.MappingProxyType(self._parameters) |
|
586 | return types.MappingProxyType(self._parameters) | |
587 | except AttributeError: |
|
587 | except AttributeError: | |
588 | return OrderedDict(self._parameters.items()) |
|
588 | return OrderedDict(self._parameters.items()) | |
589 |
|
589 | |||
590 | @property |
|
590 | @property | |
591 | def return_annotation(self): |
|
591 | def return_annotation(self): | |
592 | return self._return_annotation |
|
592 | return self._return_annotation | |
593 |
|
593 | |||
594 | def replace(self, parameters=_void, return_annotation=_void): |
|
594 | def replace(self, parameters=_void, return_annotation=_void): | |
595 | '''Creates a customized copy of the Signature. |
|
595 | '''Creates a customized copy of the Signature. | |
596 | Pass 'parameters' and/or 'return_annotation' arguments |
|
596 | Pass 'parameters' and/or 'return_annotation' arguments | |
597 | to override them in the new copy. |
|
597 | to override them in the new copy. | |
598 | ''' |
|
598 | ''' | |
599 |
|
599 | |||
600 | if parameters is _void: |
|
600 | if parameters is _void: | |
601 | parameters = self.parameters.values() |
|
601 | parameters = self.parameters.values() | |
602 |
|
602 | |||
603 | if return_annotation is _void: |
|
603 | if return_annotation is _void: | |
604 | return_annotation = self._return_annotation |
|
604 | return_annotation = self._return_annotation | |
605 |
|
605 | |||
606 | return type(self)(parameters, |
|
606 | return type(self)(parameters, | |
607 | return_annotation=return_annotation) |
|
607 | return_annotation=return_annotation) | |
608 |
|
608 | |||
609 | def __hash__(self): |
|
609 | def __hash__(self): | |
610 | msg = "unhashable type: '{0}'".format(self.__class__.__name__) |
|
610 | msg = "unhashable type: '{0}'".format(self.__class__.__name__) | |
611 | raise TypeError(msg) |
|
611 | raise TypeError(msg) | |
612 |
|
612 | |||
613 | def __eq__(self, other): |
|
613 | def __eq__(self, other): | |
614 | if (not issubclass(type(other), Signature) or |
|
614 | if (not issubclass(type(other), Signature) or | |
615 | self.return_annotation != other.return_annotation or |
|
615 | self.return_annotation != other.return_annotation or | |
616 | len(self.parameters) != len(other.parameters)): |
|
616 | len(self.parameters) != len(other.parameters)): | |
617 | return False |
|
617 | return False | |
618 |
|
618 | |||
619 | other_positions = dict((param, idx) |
|
619 | other_positions = dict((param, idx) | |
620 | for idx, param in enumerate(other.parameters.keys())) |
|
620 | for idx, param in enumerate(other.parameters.keys())) | |
621 |
|
621 | |||
622 | for idx, (param_name, param) in enumerate(self.parameters.items()): |
|
622 | for idx, (param_name, param) in enumerate(self.parameters.items()): | |
623 | if param.kind == _KEYWORD_ONLY: |
|
623 | if param.kind == _KEYWORD_ONLY: | |
624 | try: |
|
624 | try: | |
625 | other_param = other.parameters[param_name] |
|
625 | other_param = other.parameters[param_name] | |
626 | except KeyError: |
|
626 | except KeyError: | |
627 | return False |
|
627 | return False | |
628 | else: |
|
628 | else: | |
629 | if param != other_param: |
|
629 | if param != other_param: | |
630 | return False |
|
630 | return False | |
631 | else: |
|
631 | else: | |
632 | try: |
|
632 | try: | |
633 | other_idx = other_positions[param_name] |
|
633 | other_idx = other_positions[param_name] | |
634 | except KeyError: |
|
634 | except KeyError: | |
635 | return False |
|
635 | return False | |
636 | else: |
|
636 | else: | |
637 | if (idx != other_idx or |
|
637 | if (idx != other_idx or | |
638 | param != other.parameters[param_name]): |
|
638 | param != other.parameters[param_name]): | |
639 | return False |
|
639 | return False | |
640 |
|
640 | |||
641 | return True |
|
641 | return True | |
642 |
|
642 | |||
643 | def __ne__(self, other): |
|
643 | def __ne__(self, other): | |
644 | return not self.__eq__(other) |
|
644 | return not self.__eq__(other) | |
645 |
|
645 | |||
646 | def _bind(self, args, kwargs, partial=False): |
|
646 | def _bind(self, args, kwargs, partial=False): | |
647 | '''Private method. Don't use directly.''' |
|
647 | '''Private method. Don't use directly.''' | |
648 |
|
648 | |||
649 | arguments = OrderedDict() |
|
649 | arguments = OrderedDict() | |
650 |
|
650 | |||
651 | parameters = iter(self.parameters.values()) |
|
651 | parameters = iter(self.parameters.values()) | |
652 | parameters_ex = () |
|
652 | parameters_ex = () | |
653 | arg_vals = iter(args) |
|
653 | arg_vals = iter(args) | |
654 |
|
654 | |||
655 | if partial: |
|
655 | if partial: | |
656 | # Support for binding arguments to 'functools.partial' objects. |
|
656 | # Support for binding arguments to 'functools.partial' objects. | |
657 | # See 'functools.partial' case in 'signature()' implementation |
|
657 | # See 'functools.partial' case in 'signature()' implementation | |
658 | # for details. |
|
658 | # for details. | |
659 | for param_name, param in self.parameters.items(): |
|
659 | for param_name, param in self.parameters.items(): | |
660 | if (param._partial_kwarg and param_name not in kwargs): |
|
660 | if (param._partial_kwarg and param_name not in kwargs): | |
661 | # Simulating 'functools.partial' behavior |
|
661 | # Simulating 'functools.partial' behavior | |
662 | kwargs[param_name] = param.default |
|
662 | kwargs[param_name] = param.default | |
663 |
|
663 | |||
664 | while True: |
|
664 | while True: | |
665 | # Let's iterate through the positional arguments and corresponding |
|
665 | # Let's iterate through the positional arguments and corresponding | |
666 | # parameters |
|
666 | # parameters | |
667 | try: |
|
667 | try: | |
668 | arg_val = next(arg_vals) |
|
668 | arg_val = next(arg_vals) | |
669 | except StopIteration: |
|
669 | except StopIteration: | |
670 | # No more positional arguments |
|
670 | # No more positional arguments | |
671 | try: |
|
671 | try: | |
672 | param = next(parameters) |
|
672 | param = next(parameters) | |
673 | except StopIteration: |
|
673 | except StopIteration: | |
674 | # No more parameters. That's it. Just need to check that |
|
674 | # No more parameters. That's it. Just need to check that | |
675 | # we have no `kwargs` after this while loop |
|
675 | # we have no `kwargs` after this while loop | |
676 | break |
|
676 | break | |
677 | else: |
|
677 | else: | |
678 | if param.kind == _VAR_POSITIONAL: |
|
678 | if param.kind == _VAR_POSITIONAL: | |
679 | # That's OK, just empty *args. Let's start parsing |
|
679 | # That's OK, just empty *args. Let's start parsing | |
680 | # kwargs |
|
680 | # kwargs | |
681 | break |
|
681 | break | |
682 | elif param.name in kwargs: |
|
682 | elif param.name in kwargs: | |
683 | if param.kind == _POSITIONAL_ONLY: |
|
683 | if param.kind == _POSITIONAL_ONLY: | |
684 | msg = '{arg!r} parameter is positional only, ' \ |
|
684 | msg = '{arg!r} parameter is positional only, ' \ | |
685 | 'but was passed as a keyword' |
|
685 | 'but was passed as a keyword' | |
686 | msg = msg.format(arg=param.name) |
|
686 | msg = msg.format(arg=param.name) | |
687 | raise TypeError(msg) |
|
687 | raise TypeError(msg) | |
688 | parameters_ex = (param,) |
|
688 | parameters_ex = (param,) | |
689 | break |
|
689 | break | |
690 | elif (param.kind == _VAR_KEYWORD or |
|
690 | elif (param.kind == _VAR_KEYWORD or | |
691 | param.default is not _empty): |
|
691 | param.default is not _empty): | |
692 | # That's fine too - we have a default value for this |
|
692 | # That's fine too - we have a default value for this | |
693 | # parameter. So, lets start parsing `kwargs`, starting |
|
693 | # parameter. So, lets start parsing `kwargs`, starting | |
694 | # with the current parameter |
|
694 | # with the current parameter | |
695 | parameters_ex = (param,) |
|
695 | parameters_ex = (param,) | |
696 | break |
|
696 | break | |
697 | else: |
|
697 | else: | |
698 | if partial: |
|
698 | if partial: | |
699 | parameters_ex = (param,) |
|
699 | parameters_ex = (param,) | |
700 | break |
|
700 | break | |
701 | else: |
|
701 | else: | |
702 | msg = '{arg!r} parameter lacking default value' |
|
702 | msg = '{arg!r} parameter lacking default value' | |
703 | msg = msg.format(arg=param.name) |
|
703 | msg = msg.format(arg=param.name) | |
704 | raise TypeError(msg) |
|
704 | raise TypeError(msg) | |
705 | else: |
|
705 | else: | |
706 | # We have a positional argument to process |
|
706 | # We have a positional argument to process | |
707 | try: |
|
707 | try: | |
708 | param = next(parameters) |
|
708 | param = next(parameters) | |
709 | except StopIteration: |
|
709 | except StopIteration: | |
710 | raise TypeError('too many positional arguments') |
|
710 | raise TypeError('too many positional arguments') | |
711 | else: |
|
711 | else: | |
712 | if param.kind in (_VAR_KEYWORD, _KEYWORD_ONLY): |
|
712 | if param.kind in (_VAR_KEYWORD, _KEYWORD_ONLY): | |
713 | # Looks like we have no parameter for this positional |
|
713 | # Looks like we have no parameter for this positional | |
714 | # argument |
|
714 | # argument | |
715 | raise TypeError('too many positional arguments') |
|
715 | raise TypeError('too many positional arguments') | |
716 |
|
716 | |||
717 | if param.kind == _VAR_POSITIONAL: |
|
717 | if param.kind == _VAR_POSITIONAL: | |
718 | # We have an '*args'-like argument, let's fill it with |
|
718 | # We have an '*args'-like argument, let's fill it with | |
719 | # all positional arguments we have left and move on to |
|
719 | # all positional arguments we have left and move on to | |
720 | # the next phase |
|
720 | # the next phase | |
721 | values = [arg_val] |
|
721 | values = [arg_val] | |
722 | values.extend(arg_vals) |
|
722 | values.extend(arg_vals) | |
723 | arguments[param.name] = tuple(values) |
|
723 | arguments[param.name] = tuple(values) | |
724 | break |
|
724 | break | |
725 |
|
725 | |||
726 | if param.name in kwargs: |
|
726 | if param.name in kwargs: | |
727 | raise TypeError('multiple values for argument ' |
|
727 | raise TypeError('multiple values for argument ' | |
728 | '{arg!r}'.format(arg=param.name)) |
|
728 | '{arg!r}'.format(arg=param.name)) | |
729 |
|
729 | |||
730 | arguments[param.name] = arg_val |
|
730 | arguments[param.name] = arg_val | |
731 |
|
731 | |||
732 | # Now, we iterate through the remaining parameters to process |
|
732 | # Now, we iterate through the remaining parameters to process | |
733 | # keyword arguments |
|
733 | # keyword arguments | |
734 | kwargs_param = None |
|
734 | kwargs_param = None | |
735 | for param in itertools.chain(parameters_ex, parameters): |
|
735 | for param in itertools.chain(parameters_ex, parameters): | |
736 | if param.kind == _POSITIONAL_ONLY: |
|
736 | if param.kind == _POSITIONAL_ONLY: | |
737 | # This should never happen in case of a properly built |
|
737 | # This should never happen in case of a properly built | |
738 | # Signature object (but let's have this check here |
|
738 | # Signature object (but let's have this check here | |
739 | # to ensure correct behaviour just in case) |
|
739 | # to ensure correct behaviour just in case) | |
740 | raise TypeError('{arg!r} parameter is positional only, ' |
|
740 | raise TypeError('{arg!r} parameter is positional only, ' | |
741 | 'but was passed as a keyword'. \ |
|
741 | 'but was passed as a keyword'. \ | |
742 | format(arg=param.name)) |
|
742 | format(arg=param.name)) | |
743 |
|
743 | |||
744 | if param.kind == _VAR_KEYWORD: |
|
744 | if param.kind == _VAR_KEYWORD: | |
745 | # Memorize that we have a '**kwargs'-like parameter |
|
745 | # Memorize that we have a '**kwargs'-like parameter | |
746 | kwargs_param = param |
|
746 | kwargs_param = param | |
747 | continue |
|
747 | continue | |
748 |
|
748 | |||
749 | param_name = param.name |
|
749 | param_name = param.name | |
750 | try: |
|
750 | try: | |
751 | arg_val = kwargs.pop(param_name) |
|
751 | arg_val = kwargs.pop(param_name) | |
752 | except KeyError: |
|
752 | except KeyError: | |
753 | # We have no value for this parameter. It's fine though, |
|
753 | # We have no value for this parameter. It's fine though, | |
754 | # if it has a default value, or it is an '*args'-like |
|
754 | # if it has a default value, or it is an '*args'-like | |
755 | # parameter, left alone by the processing of positional |
|
755 | # parameter, left alone by the processing of positional | |
756 | # arguments. |
|
756 | # arguments. | |
757 | if (not partial and param.kind != _VAR_POSITIONAL and |
|
757 | if (not partial and param.kind != _VAR_POSITIONAL and | |
758 | param.default is _empty): |
|
758 | param.default is _empty): | |
759 | raise TypeError('{arg!r} parameter lacking default value'. \ |
|
759 | raise TypeError('{arg!r} parameter lacking default value'. \ | |
760 | format(arg=param_name)) |
|
760 | format(arg=param_name)) | |
761 |
|
761 | |||
762 | else: |
|
762 | else: | |
763 | arguments[param_name] = arg_val |
|
763 | arguments[param_name] = arg_val | |
764 |
|
764 | |||
765 | if kwargs: |
|
765 | if kwargs: | |
766 | if kwargs_param is not None: |
|
766 | if kwargs_param is not None: | |
767 | # Process our '**kwargs'-like parameter |
|
767 | # Process our '**kwargs'-like parameter | |
768 | arguments[kwargs_param.name] = kwargs |
|
768 | arguments[kwargs_param.name] = kwargs | |
769 | else: |
|
769 | else: | |
770 | raise TypeError('too many keyword arguments') |
|
770 | raise TypeError('too many keyword arguments') | |
771 |
|
771 | |||
772 | return self._bound_arguments_cls(self, arguments) |
|
772 | return self._bound_arguments_cls(self, arguments) | |
773 |
|
773 | |||
774 | def bind(self, *args, **kwargs): |
|
774 | def bind(self, *args, **kwargs): | |
775 | '''Get a :class:`BoundArguments` object, that maps the passed `args` |
|
775 | '''Get a :class:`BoundArguments` object, that maps the passed `args` | |
776 | and `kwargs` to the function's signature. Raises :exc:`TypeError` |
|
776 | and `kwargs` to the function's signature. Raises :exc:`TypeError` | |
777 | if the passed arguments can not be bound. |
|
777 | if the passed arguments can not be bound. | |
778 | ''' |
|
778 | ''' | |
779 | return self._bind(args, kwargs) |
|
779 | return self._bind(args, kwargs) | |
780 |
|
780 | |||
781 | def bind_partial(self, *args, **kwargs): |
|
781 | def bind_partial(self, *args, **kwargs): | |
782 | '''Get a :class:`BoundArguments` object, that partially maps the |
|
782 | '''Get a :class:`BoundArguments` object, that partially maps the | |
783 | passed `args` and `kwargs` to the function's signature. |
|
783 | passed `args` and `kwargs` to the function's signature. | |
784 | Raises :exc:`TypeError` if the passed arguments can not be bound. |
|
784 | Raises :exc:`TypeError` if the passed arguments can not be bound. | |
785 | ''' |
|
785 | ''' | |
786 | return self._bind(args, kwargs, partial=True) |
|
786 | return self._bind(args, kwargs, partial=True) | |
787 |
|
787 | |||
788 | def __str__(self): |
|
788 | def __str__(self): | |
789 | result = [] |
|
789 | result = [] | |
790 | render_kw_only_separator = True |
|
790 | render_kw_only_separator = True | |
791 | for idx, param in enumerate(self.parameters.values()): |
|
791 | for idx, param in enumerate(self.parameters.values()): | |
792 | formatted = str(param) |
|
792 | formatted = str(param) | |
793 |
|
793 | |||
794 | kind = param.kind |
|
794 | kind = param.kind | |
795 | if kind == _VAR_POSITIONAL: |
|
795 | if kind == _VAR_POSITIONAL: | |
796 | # OK, we have an '*args'-like parameter, so we won't need |
|
796 | # OK, we have an '*args'-like parameter, so we won't need | |
797 | # a '*' to separate keyword-only arguments |
|
797 | # a '*' to separate keyword-only arguments | |
798 | render_kw_only_separator = False |
|
798 | render_kw_only_separator = False | |
799 | elif kind == _KEYWORD_ONLY and render_kw_only_separator: |
|
799 | elif kind == _KEYWORD_ONLY and render_kw_only_separator: | |
800 | # We have a keyword-only parameter to render and we haven't |
|
800 | # We have a keyword-only parameter to render and we haven't | |
801 | # rendered an '*args'-like parameter before, so add a '*' |
|
801 | # rendered an '*args'-like parameter before, so add a '*' | |
802 | # separator to the parameters list ("foo(arg1, *, arg2)" case) |
|
802 | # separator to the parameters list ("foo(arg1, *, arg2)" case) | |
803 | result.append('*') |
|
803 | result.append('*') | |
804 | # This condition should be only triggered once, so |
|
804 | # This condition should be only triggered once, so | |
805 | # reset the flag |
|
805 | # reset the flag | |
806 | render_kw_only_separator = False |
|
806 | render_kw_only_separator = False | |
807 |
|
807 | |||
808 | result.append(formatted) |
|
808 | result.append(formatted) | |
809 |
|
809 | |||
810 | rendered = '({0})'.format(', '.join(result)) |
|
810 | rendered = '({0})'.format(', '.join(result)) | |
811 |
|
811 | |||
812 | if self.return_annotation is not _empty: |
|
812 | if self.return_annotation is not _empty: | |
813 | anno = formatannotation(self.return_annotation) |
|
813 | anno = formatannotation(self.return_annotation) | |
814 | rendered += ' -> {0}'.format(anno) |
|
814 | rendered += ' -> {0}'.format(anno) | |
815 |
|
815 | |||
816 | return rendered |
|
816 | return rendered | |
817 |
|
817 | |||
818 | ## Fake unique value as KWargs, in some places. |
|
|||
819 | # do not put docstrings here or they will appear |
|
|||
820 | # on created fake values. |
|
|||
821 | class Sentinel(object): |
|
|||
822 |
|
||||
823 | def __init__(self, name, module, docstring=None): |
|
|||
824 | self.name = name |
|
|||
825 | self.module = module |
|
|||
826 | if docstring: |
|
|||
827 | self.__doc__ = docstring |
|
|||
828 |
|
||||
829 |
|
||||
830 | def __repr__(self): |
|
|||
831 | return str(self.module)+'.'+self.name |
|
|||
832 |
|
@@ -1,167 +1,167 b'' | |||||
1 | """The IPython notebook format |
|
1 | """The IPython notebook format | |
2 |
|
2 | |||
3 | Use this module to read or write notebook files as particular nbformat versions. |
|
3 | Use this module to read or write notebook files as particular nbformat versions. | |
4 | """ |
|
4 | """ | |
5 |
|
5 | |||
6 | # Copyright (c) IPython Development Team. |
|
6 | # Copyright (c) IPython Development Team. | |
7 | # Distributed under the terms of the Modified BSD License. |
|
7 | # Distributed under the terms of the Modified BSD License. | |
8 | import io |
|
8 | import io | |
9 | from IPython.utils import py3compat |
|
9 | from IPython.utils import py3compat | |
10 |
|
10 | |||
11 | from IPython.utils.log import get_logger |
|
11 | from IPython.utils.log import get_logger | |
12 |
|
12 | |||
13 | from . import v1 |
|
13 | from . import v1 | |
14 | from . import v2 |
|
14 | from . import v2 | |
15 | from . import v3 |
|
15 | from . import v3 | |
16 | from . import v4 |
|
16 | from . import v4 | |
17 |
from |
|
17 | from .sentinel import Sentinel | |
18 |
|
18 | |||
19 | __all__ = ['versions', 'validate', 'ValidationError', 'convert', 'from_dict', |
|
19 | __all__ = ['versions', 'validate', 'ValidationError', 'convert', 'from_dict', | |
20 | 'NotebookNode', 'current_nbformat', 'current_nbformat_minor', |
|
20 | 'NotebookNode', 'current_nbformat', 'current_nbformat_minor', | |
21 | 'NBFormatError', 'NO_CONVERT', 'reads', 'read', 'writes', 'write'] |
|
21 | 'NBFormatError', 'NO_CONVERT', 'reads', 'read', 'writes', 'write'] | |
22 |
|
22 | |||
23 | versions = { |
|
23 | versions = { | |
24 | 1: v1, |
|
24 | 1: v1, | |
25 | 2: v2, |
|
25 | 2: v2, | |
26 | 3: v3, |
|
26 | 3: v3, | |
27 | 4: v4, |
|
27 | 4: v4, | |
28 | } |
|
28 | } | |
29 |
|
29 | |||
30 | from .validator import validate, ValidationError |
|
30 | from .validator import validate, ValidationError | |
31 | from .converter import convert |
|
31 | from .converter import convert | |
32 | from . import reader |
|
32 | from . import reader | |
33 | from .notebooknode import from_dict, NotebookNode |
|
33 | from .notebooknode import from_dict, NotebookNode | |
34 |
|
34 | |||
35 | from .v4 import ( |
|
35 | from .v4 import ( | |
36 | nbformat as current_nbformat, |
|
36 | nbformat as current_nbformat, | |
37 | nbformat_minor as current_nbformat_minor, |
|
37 | nbformat_minor as current_nbformat_minor, | |
38 | ) |
|
38 | ) | |
39 |
|
39 | |||
40 | class NBFormatError(ValueError): |
|
40 | class NBFormatError(ValueError): | |
41 | pass |
|
41 | pass | |
42 |
|
42 | |||
43 | # no-conversion singleton |
|
43 | # no-conversion singleton | |
44 | NO_CONVERT = Sentinel('NO_CONVERT', __name__, |
|
44 | NO_CONVERT = Sentinel('NO_CONVERT', __name__, | |
45 | """Value to prevent nbformat to convert notebooks to most recent version. |
|
45 | """Value to prevent nbformat to convert notebooks to most recent version. | |
46 | """) |
|
46 | """) | |
47 |
|
47 | |||
48 |
|
48 | |||
49 | def reads(s, as_version, **kwargs): |
|
49 | def reads(s, as_version, **kwargs): | |
50 | """Read a notebook from a string and return the NotebookNode object as the given version. |
|
50 | """Read a notebook from a string and return the NotebookNode object as the given version. | |
51 |
|
51 | |||
52 | The string can contain a notebook of any version. |
|
52 | The string can contain a notebook of any version. | |
53 | The notebook will be returned `as_version`, converting, if necessary. |
|
53 | The notebook will be returned `as_version`, converting, if necessary. | |
54 |
|
54 | |||
55 | Notebook format errors will be logged. |
|
55 | Notebook format errors will be logged. | |
56 |
|
56 | |||
57 | Parameters |
|
57 | Parameters | |
58 | ---------- |
|
58 | ---------- | |
59 | s : unicode |
|
59 | s : unicode | |
60 | The raw unicode string to read the notebook from. |
|
60 | The raw unicode string to read the notebook from. | |
61 | as_version : int |
|
61 | as_version : int | |
62 | The version of the notebook format to return. |
|
62 | The version of the notebook format to return. | |
63 | The notebook will be converted, if necessary. |
|
63 | The notebook will be converted, if necessary. | |
64 | Pass nbformat.NO_CONVERT to prevent conversion. |
|
64 | Pass nbformat.NO_CONVERT to prevent conversion. | |
65 |
|
65 | |||
66 | Returns |
|
66 | Returns | |
67 | ------- |
|
67 | ------- | |
68 | nb : NotebookNode |
|
68 | nb : NotebookNode | |
69 | The notebook that was read. |
|
69 | The notebook that was read. | |
70 | """ |
|
70 | """ | |
71 | nb = reader.reads(s, **kwargs) |
|
71 | nb = reader.reads(s, **kwargs) | |
72 | if as_version is not NO_CONVERT: |
|
72 | if as_version is not NO_CONVERT: | |
73 | nb = convert(nb, as_version) |
|
73 | nb = convert(nb, as_version) | |
74 | try: |
|
74 | try: | |
75 | validate(nb) |
|
75 | validate(nb) | |
76 | except ValidationError as e: |
|
76 | except ValidationError as e: | |
77 | get_logger().error("Notebook JSON is invalid: %s", e) |
|
77 | get_logger().error("Notebook JSON is invalid: %s", e) | |
78 | return nb |
|
78 | return nb | |
79 |
|
79 | |||
80 |
|
80 | |||
81 | def writes(nb, version=NO_CONVERT, **kwargs): |
|
81 | def writes(nb, version=NO_CONVERT, **kwargs): | |
82 | """Write a notebook to a string in a given format in the given nbformat version. |
|
82 | """Write a notebook to a string in a given format in the given nbformat version. | |
83 |
|
83 | |||
84 | Any notebook format errors will be logged. |
|
84 | Any notebook format errors will be logged. | |
85 |
|
85 | |||
86 | Parameters |
|
86 | Parameters | |
87 | ---------- |
|
87 | ---------- | |
88 | nb : NotebookNode |
|
88 | nb : NotebookNode | |
89 | The notebook to write. |
|
89 | The notebook to write. | |
90 | version : int, optional |
|
90 | version : int, optional | |
91 | The nbformat version to write. |
|
91 | The nbformat version to write. | |
92 | If unspecified, or specified as nbformat.NO_CONVERT, |
|
92 | If unspecified, or specified as nbformat.NO_CONVERT, | |
93 | the notebook's own version will be used and no conversion performed. |
|
93 | the notebook's own version will be used and no conversion performed. | |
94 |
|
94 | |||
95 | Returns |
|
95 | Returns | |
96 | ------- |
|
96 | ------- | |
97 | s : unicode |
|
97 | s : unicode | |
98 | The notebook as a JSON string. |
|
98 | The notebook as a JSON string. | |
99 | """ |
|
99 | """ | |
100 | if version is not NO_CONVERT: |
|
100 | if version is not NO_CONVERT: | |
101 | nb = convert(nb, version) |
|
101 | nb = convert(nb, version) | |
102 | else: |
|
102 | else: | |
103 | version, _ = reader.get_version(nb) |
|
103 | version, _ = reader.get_version(nb) | |
104 | try: |
|
104 | try: | |
105 | validate(nb) |
|
105 | validate(nb) | |
106 | except ValidationError as e: |
|
106 | except ValidationError as e: | |
107 | get_logger().error("Notebook JSON is invalid: %s", e) |
|
107 | get_logger().error("Notebook JSON is invalid: %s", e) | |
108 | return versions[version].writes_json(nb, **kwargs) |
|
108 | return versions[version].writes_json(nb, **kwargs) | |
109 |
|
109 | |||
110 |
|
110 | |||
111 | def read(fp, as_version, **kwargs): |
|
111 | def read(fp, as_version, **kwargs): | |
112 | """Read a notebook from a file as a NotebookNode of the given version. |
|
112 | """Read a notebook from a file as a NotebookNode of the given version. | |
113 |
|
113 | |||
114 | The string can contain a notebook of any version. |
|
114 | The string can contain a notebook of any version. | |
115 | The notebook will be returned `as_version`, converting, if necessary. |
|
115 | The notebook will be returned `as_version`, converting, if necessary. | |
116 |
|
116 | |||
117 | Notebook format errors will be logged. |
|
117 | Notebook format errors will be logged. | |
118 |
|
118 | |||
119 | Parameters |
|
119 | Parameters | |
120 | ---------- |
|
120 | ---------- | |
121 | fp : file or str |
|
121 | fp : file or str | |
122 | Any file-like object with a read method, or a path to a file. |
|
122 | Any file-like object with a read method, or a path to a file. | |
123 | as_version: int |
|
123 | as_version: int | |
124 | The version of the notebook format to return. |
|
124 | The version of the notebook format to return. | |
125 | The notebook will be converted, if necessary. |
|
125 | The notebook will be converted, if necessary. | |
126 | Pass nbformat.NO_CONVERT to prevent conversion. |
|
126 | Pass nbformat.NO_CONVERT to prevent conversion. | |
127 |
|
127 | |||
128 | Returns |
|
128 | Returns | |
129 | ------- |
|
129 | ------- | |
130 | nb : NotebookNode |
|
130 | nb : NotebookNode | |
131 | The notebook that was read. |
|
131 | The notebook that was read. | |
132 | """ |
|
132 | """ | |
133 | if isinstance(fp, py3compat.string_types): |
|
133 | if isinstance(fp, py3compat.string_types): | |
134 | with io.open(fp, encoding='utf-8') as f: |
|
134 | with io.open(fp, encoding='utf-8') as f: | |
135 | return read(f, as_version, **kwargs) |
|
135 | return read(f, as_version, **kwargs) | |
136 |
|
136 | |||
137 | return reads(fp.read(), as_version, **kwargs) |
|
137 | return reads(fp.read(), as_version, **kwargs) | |
138 |
|
138 | |||
139 |
|
139 | |||
140 | def write(nb, fp, version=NO_CONVERT, **kwargs): |
|
140 | def write(nb, fp, version=NO_CONVERT, **kwargs): | |
141 | """Write a notebook to a file in a given nbformat version. |
|
141 | """Write a notebook to a file in a given nbformat version. | |
142 |
|
142 | |||
143 | The file-like object must accept unicode input. |
|
143 | The file-like object must accept unicode input. | |
144 |
|
144 | |||
145 | Parameters |
|
145 | Parameters | |
146 | ---------- |
|
146 | ---------- | |
147 | nb : NotebookNode |
|
147 | nb : NotebookNode | |
148 | The notebook to write. |
|
148 | The notebook to write. | |
149 | fp : file or str |
|
149 | fp : file or str | |
150 | Any file-like object with a write method that accepts unicode, or |
|
150 | Any file-like object with a write method that accepts unicode, or | |
151 | a path to write a file. |
|
151 | a path to write a file. | |
152 | version : int, optional |
|
152 | version : int, optional | |
153 | The nbformat version to write. |
|
153 | The nbformat version to write. | |
154 | If nb is not this version, it will be converted. |
|
154 | If nb is not this version, it will be converted. | |
155 | If unspecified, or specified as nbformat.NO_CONVERT, |
|
155 | If unspecified, or specified as nbformat.NO_CONVERT, | |
156 | the notebook's own version will be used and no conversion performed. |
|
156 | the notebook's own version will be used and no conversion performed. | |
157 | """ |
|
157 | """ | |
158 | if isinstance(fp, py3compat.string_types): |
|
158 | if isinstance(fp, py3compat.string_types): | |
159 | with io.open(fp, 'w', encoding='utf-8') as f: |
|
159 | with io.open(fp, 'w', encoding='utf-8') as f: | |
160 | return write(nb, f, version=version, **kwargs) |
|
160 | return write(nb, f, version=version, **kwargs) | |
161 |
|
161 | |||
162 | s = writes(nb, version, **kwargs) |
|
162 | s = writes(nb, version, **kwargs) | |
163 | if isinstance(s, bytes): |
|
163 | if isinstance(s, bytes): | |
164 | s = s.decode('utf8') |
|
164 | s = s.decode('utf8') | |
165 | fp.write(s) |
|
165 | fp.write(s) | |
166 | if not s.endswith(u'\n'): |
|
166 | if not s.endswith(u'\n'): | |
167 | fp.write(u'\n') |
|
167 | fp.write(u'\n') |
@@ -1,1878 +1,1878 b'' | |||||
1 | # encoding: utf-8 |
|
1 | # encoding: utf-8 | |
2 | """ |
|
2 | """ | |
3 | A lightweight Traits like module. |
|
3 | A lightweight Traits like module. | |
4 |
|
4 | |||
5 | This is designed to provide a lightweight, simple, pure Python version of |
|
5 | This is designed to provide a lightweight, simple, pure Python version of | |
6 | many of the capabilities of enthought.traits. This includes: |
|
6 | many of the capabilities of enthought.traits. This includes: | |
7 |
|
7 | |||
8 | * Validation |
|
8 | * Validation | |
9 | * Type specification with defaults |
|
9 | * Type specification with defaults | |
10 | * Static and dynamic notification |
|
10 | * Static and dynamic notification | |
11 | * Basic predefined types |
|
11 | * Basic predefined types | |
12 | * An API that is similar to enthought.traits |
|
12 | * An API that is similar to enthought.traits | |
13 |
|
13 | |||
14 | We don't support: |
|
14 | We don't support: | |
15 |
|
15 | |||
16 | * Delegation |
|
16 | * Delegation | |
17 | * Automatic GUI generation |
|
17 | * Automatic GUI generation | |
18 | * A full set of trait types. Most importantly, we don't provide container |
|
18 | * A full set of trait types. Most importantly, we don't provide container | |
19 | traits (list, dict, tuple) that can trigger notifications if their |
|
19 | traits (list, dict, tuple) that can trigger notifications if their | |
20 | contents change. |
|
20 | contents change. | |
21 | * API compatibility with enthought.traits |
|
21 | * API compatibility with enthought.traits | |
22 |
|
22 | |||
23 | There are also some important difference in our design: |
|
23 | There are also some important difference in our design: | |
24 |
|
24 | |||
25 | * enthought.traits does not validate default values. We do. |
|
25 | * enthought.traits does not validate default values. We do. | |
26 |
|
26 | |||
27 | We choose to create this module because we need these capabilities, but |
|
27 | We choose to create this module because we need these capabilities, but | |
28 | we need them to be pure Python so they work in all Python implementations, |
|
28 | we need them to be pure Python so they work in all Python implementations, | |
29 | including Jython and IronPython. |
|
29 | including Jython and IronPython. | |
30 |
|
30 | |||
31 | Inheritance diagram: |
|
31 | Inheritance diagram: | |
32 |
|
32 | |||
33 | .. inheritance-diagram:: IPython.utils.traitlets |
|
33 | .. inheritance-diagram:: IPython.utils.traitlets | |
34 | :parts: 3 |
|
34 | :parts: 3 | |
35 | """ |
|
35 | """ | |
36 |
|
36 | |||
37 | # Copyright (c) IPython Development Team. |
|
37 | # Copyright (c) IPython Development Team. | |
38 | # Distributed under the terms of the Modified BSD License. |
|
38 | # Distributed under the terms of the Modified BSD License. | |
39 | # |
|
39 | # | |
40 | # Adapted from enthought.traits, Copyright (c) Enthought, Inc., |
|
40 | # Adapted from enthought.traits, Copyright (c) Enthought, Inc., | |
41 | # also under the terms of the Modified BSD License. |
|
41 | # also under the terms of the Modified BSD License. | |
42 |
|
42 | |||
43 | import contextlib |
|
43 | import contextlib | |
44 | import inspect |
|
44 | import inspect | |
45 | import re |
|
45 | import re | |
46 | import sys |
|
46 | import sys | |
47 | import types |
|
47 | import types | |
48 | from types import FunctionType |
|
48 | from types import FunctionType | |
49 | try: |
|
49 | try: | |
50 | from types import ClassType, InstanceType |
|
50 | from types import ClassType, InstanceType | |
51 | ClassTypes = (ClassType, type) |
|
51 | ClassTypes = (ClassType, type) | |
52 | except: |
|
52 | except: | |
53 | ClassTypes = (type,) |
|
53 | ClassTypes = (type,) | |
54 | from warnings import warn |
|
54 | from warnings import warn | |
55 |
|
55 | |||
56 | from IPython.utils import py3compat |
|
56 | from IPython.utils import py3compat | |
57 | from IPython.utils import eventful |
|
57 | from IPython.utils import eventful | |
58 | from IPython.utils.getargspec import getargspec |
|
58 | from IPython.utils.getargspec import getargspec | |
59 | from IPython.utils.signatures import Sentinel |
|
|||
60 | from IPython.utils.importstring import import_item |
|
59 | from IPython.utils.importstring import import_item | |
61 | from IPython.utils.py3compat import iteritems, string_types |
|
60 | from IPython.utils.py3compat import iteritems, string_types | |
62 | from IPython.testing.skipdoctest import skip_doctest |
|
61 | from IPython.testing.skipdoctest import skip_doctest | |
63 |
|
62 | |||
|
63 | from .sentinel import Sentinel | |||
64 | SequenceTypes = (list, tuple, set, frozenset) |
|
64 | SequenceTypes = (list, tuple, set, frozenset) | |
65 |
|
65 | |||
66 | #----------------------------------------------------------------------------- |
|
66 | #----------------------------------------------------------------------------- | |
67 | # Basic classes |
|
67 | # Basic classes | |
68 | #----------------------------------------------------------------------------- |
|
68 | #----------------------------------------------------------------------------- | |
69 |
|
69 | |||
70 |
|
70 | |||
71 | NoDefaultSpecified = Sentinel('NoDefaultSpecified', __name__, |
|
71 | NoDefaultSpecified = Sentinel('NoDefaultSpecified', __name__, | |
72 | ''' |
|
72 | ''' | |
73 | Used in Traitlets to specify that no defaults are set in kwargs |
|
73 | Used in Traitlets to specify that no defaults are set in kwargs | |
74 | ''' |
|
74 | ''' | |
75 | ) |
|
75 | ) | |
76 |
|
76 | |||
77 |
|
77 | |||
78 | class Undefined ( object ): pass |
|
78 | class Undefined ( object ): pass | |
79 | Undefined = Undefined() |
|
79 | Undefined = Undefined() | |
80 |
|
80 | |||
81 | class TraitError(Exception): |
|
81 | class TraitError(Exception): | |
82 | pass |
|
82 | pass | |
83 |
|
83 | |||
84 | #----------------------------------------------------------------------------- |
|
84 | #----------------------------------------------------------------------------- | |
85 | # Utilities |
|
85 | # Utilities | |
86 | #----------------------------------------------------------------------------- |
|
86 | #----------------------------------------------------------------------------- | |
87 |
|
87 | |||
88 |
|
88 | |||
89 | def class_of ( object ): |
|
89 | def class_of ( object ): | |
90 | """ Returns a string containing the class name of an object with the |
|
90 | """ Returns a string containing the class name of an object with the | |
91 | correct indefinite article ('a' or 'an') preceding it (e.g., 'an Image', |
|
91 | correct indefinite article ('a' or 'an') preceding it (e.g., 'an Image', | |
92 | 'a PlotValue'). |
|
92 | 'a PlotValue'). | |
93 | """ |
|
93 | """ | |
94 | if isinstance( object, py3compat.string_types ): |
|
94 | if isinstance( object, py3compat.string_types ): | |
95 | return add_article( object ) |
|
95 | return add_article( object ) | |
96 |
|
96 | |||
97 | return add_article( object.__class__.__name__ ) |
|
97 | return add_article( object.__class__.__name__ ) | |
98 |
|
98 | |||
99 |
|
99 | |||
100 | def add_article ( name ): |
|
100 | def add_article ( name ): | |
101 | """ Returns a string containing the correct indefinite article ('a' or 'an') |
|
101 | """ Returns a string containing the correct indefinite article ('a' or 'an') | |
102 | prefixed to the specified string. |
|
102 | prefixed to the specified string. | |
103 | """ |
|
103 | """ | |
104 | if name[:1].lower() in 'aeiou': |
|
104 | if name[:1].lower() in 'aeiou': | |
105 | return 'an ' + name |
|
105 | return 'an ' + name | |
106 |
|
106 | |||
107 | return 'a ' + name |
|
107 | return 'a ' + name | |
108 |
|
108 | |||
109 |
|
109 | |||
110 | def repr_type(obj): |
|
110 | def repr_type(obj): | |
111 | """ Return a string representation of a value and its type for readable |
|
111 | """ Return a string representation of a value and its type for readable | |
112 | error messages. |
|
112 | error messages. | |
113 | """ |
|
113 | """ | |
114 | the_type = type(obj) |
|
114 | the_type = type(obj) | |
115 | if (not py3compat.PY3) and the_type is InstanceType: |
|
115 | if (not py3compat.PY3) and the_type is InstanceType: | |
116 | # Old-style class. |
|
116 | # Old-style class. | |
117 | the_type = obj.__class__ |
|
117 | the_type = obj.__class__ | |
118 | msg = '%r %r' % (obj, the_type) |
|
118 | msg = '%r %r' % (obj, the_type) | |
119 | return msg |
|
119 | return msg | |
120 |
|
120 | |||
121 |
|
121 | |||
122 | def is_trait(t): |
|
122 | def is_trait(t): | |
123 | """ Returns whether the given value is an instance or subclass of TraitType. |
|
123 | """ Returns whether the given value is an instance or subclass of TraitType. | |
124 | """ |
|
124 | """ | |
125 | return (isinstance(t, TraitType) or |
|
125 | return (isinstance(t, TraitType) or | |
126 | (isinstance(t, type) and issubclass(t, TraitType))) |
|
126 | (isinstance(t, type) and issubclass(t, TraitType))) | |
127 |
|
127 | |||
128 |
|
128 | |||
129 | def parse_notifier_name(name): |
|
129 | def parse_notifier_name(name): | |
130 | """Convert the name argument to a list of names. |
|
130 | """Convert the name argument to a list of names. | |
131 |
|
131 | |||
132 | Examples |
|
132 | Examples | |
133 | -------- |
|
133 | -------- | |
134 |
|
134 | |||
135 | >>> parse_notifier_name('a') |
|
135 | >>> parse_notifier_name('a') | |
136 | ['a'] |
|
136 | ['a'] | |
137 | >>> parse_notifier_name(['a','b']) |
|
137 | >>> parse_notifier_name(['a','b']) | |
138 | ['a', 'b'] |
|
138 | ['a', 'b'] | |
139 | >>> parse_notifier_name(None) |
|
139 | >>> parse_notifier_name(None) | |
140 | ['anytrait'] |
|
140 | ['anytrait'] | |
141 | """ |
|
141 | """ | |
142 | if isinstance(name, string_types): |
|
142 | if isinstance(name, string_types): | |
143 | return [name] |
|
143 | return [name] | |
144 | elif name is None: |
|
144 | elif name is None: | |
145 | return ['anytrait'] |
|
145 | return ['anytrait'] | |
146 | elif isinstance(name, (list, tuple)): |
|
146 | elif isinstance(name, (list, tuple)): | |
147 | for n in name: |
|
147 | for n in name: | |
148 | assert isinstance(n, string_types), "names must be strings" |
|
148 | assert isinstance(n, string_types), "names must be strings" | |
149 | return name |
|
149 | return name | |
150 |
|
150 | |||
151 |
|
151 | |||
152 | class _SimpleTest: |
|
152 | class _SimpleTest: | |
153 | def __init__ ( self, value ): self.value = value |
|
153 | def __init__ ( self, value ): self.value = value | |
154 | def __call__ ( self, test ): |
|
154 | def __call__ ( self, test ): | |
155 | return test == self.value |
|
155 | return test == self.value | |
156 | def __repr__(self): |
|
156 | def __repr__(self): | |
157 | return "<SimpleTest(%r)" % self.value |
|
157 | return "<SimpleTest(%r)" % self.value | |
158 | def __str__(self): |
|
158 | def __str__(self): | |
159 | return self.__repr__() |
|
159 | return self.__repr__() | |
160 |
|
160 | |||
161 |
|
161 | |||
162 | def getmembers(object, predicate=None): |
|
162 | def getmembers(object, predicate=None): | |
163 | """A safe version of inspect.getmembers that handles missing attributes. |
|
163 | """A safe version of inspect.getmembers that handles missing attributes. | |
164 |
|
164 | |||
165 | This is useful when there are descriptor based attributes that for |
|
165 | This is useful when there are descriptor based attributes that for | |
166 | some reason raise AttributeError even though they exist. This happens |
|
166 | some reason raise AttributeError even though they exist. This happens | |
167 | in zope.inteface with the __provides__ attribute. |
|
167 | in zope.inteface with the __provides__ attribute. | |
168 | """ |
|
168 | """ | |
169 | results = [] |
|
169 | results = [] | |
170 | for key in dir(object): |
|
170 | for key in dir(object): | |
171 | try: |
|
171 | try: | |
172 | value = getattr(object, key) |
|
172 | value = getattr(object, key) | |
173 | except AttributeError: |
|
173 | except AttributeError: | |
174 | pass |
|
174 | pass | |
175 | else: |
|
175 | else: | |
176 | if not predicate or predicate(value): |
|
176 | if not predicate or predicate(value): | |
177 | results.append((key, value)) |
|
177 | results.append((key, value)) | |
178 | results.sort() |
|
178 | results.sort() | |
179 | return results |
|
179 | return results | |
180 |
|
180 | |||
181 | def _validate_link(*tuples): |
|
181 | def _validate_link(*tuples): | |
182 | """Validate arguments for traitlet link functions""" |
|
182 | """Validate arguments for traitlet link functions""" | |
183 | for t in tuples: |
|
183 | for t in tuples: | |
184 | if not len(t) == 2: |
|
184 | if not len(t) == 2: | |
185 | raise TypeError("Each linked traitlet must be specified as (HasTraits, 'trait_name'), not %r" % t) |
|
185 | raise TypeError("Each linked traitlet must be specified as (HasTraits, 'trait_name'), not %r" % t) | |
186 | obj, trait_name = t |
|
186 | obj, trait_name = t | |
187 | if not isinstance(obj, HasTraits): |
|
187 | if not isinstance(obj, HasTraits): | |
188 | raise TypeError("Each object must be HasTraits, not %r" % type(obj)) |
|
188 | raise TypeError("Each object must be HasTraits, not %r" % type(obj)) | |
189 | if not trait_name in obj.traits(): |
|
189 | if not trait_name in obj.traits(): | |
190 | raise TypeError("%r has no trait %r" % (obj, trait_name)) |
|
190 | raise TypeError("%r has no trait %r" % (obj, trait_name)) | |
191 |
|
191 | |||
192 | @skip_doctest |
|
192 | @skip_doctest | |
193 | class link(object): |
|
193 | class link(object): | |
194 | """Link traits from different objects together so they remain in sync. |
|
194 | """Link traits from different objects together so they remain in sync. | |
195 |
|
195 | |||
196 | Parameters |
|
196 | Parameters | |
197 | ---------- |
|
197 | ---------- | |
198 | *args : pairs of objects/attributes |
|
198 | *args : pairs of objects/attributes | |
199 |
|
199 | |||
200 | Examples |
|
200 | Examples | |
201 | -------- |
|
201 | -------- | |
202 |
|
202 | |||
203 | >>> c = link((obj1, 'value'), (obj2, 'value'), (obj3, 'value')) |
|
203 | >>> c = link((obj1, 'value'), (obj2, 'value'), (obj3, 'value')) | |
204 | >>> obj1.value = 5 # updates other objects as well |
|
204 | >>> obj1.value = 5 # updates other objects as well | |
205 | """ |
|
205 | """ | |
206 | updating = False |
|
206 | updating = False | |
207 | def __init__(self, *args): |
|
207 | def __init__(self, *args): | |
208 | if len(args) < 2: |
|
208 | if len(args) < 2: | |
209 | raise TypeError('At least two traitlets must be provided.') |
|
209 | raise TypeError('At least two traitlets must be provided.') | |
210 | _validate_link(*args) |
|
210 | _validate_link(*args) | |
211 |
|
211 | |||
212 | self.objects = {} |
|
212 | self.objects = {} | |
213 |
|
213 | |||
214 | initial = getattr(args[0][0], args[0][1]) |
|
214 | initial = getattr(args[0][0], args[0][1]) | |
215 | for obj, attr in args: |
|
215 | for obj, attr in args: | |
216 | setattr(obj, attr, initial) |
|
216 | setattr(obj, attr, initial) | |
217 |
|
217 | |||
218 | callback = self._make_closure(obj, attr) |
|
218 | callback = self._make_closure(obj, attr) | |
219 | obj.on_trait_change(callback, attr) |
|
219 | obj.on_trait_change(callback, attr) | |
220 | self.objects[(obj, attr)] = callback |
|
220 | self.objects[(obj, attr)] = callback | |
221 |
|
221 | |||
222 | @contextlib.contextmanager |
|
222 | @contextlib.contextmanager | |
223 | def _busy_updating(self): |
|
223 | def _busy_updating(self): | |
224 | self.updating = True |
|
224 | self.updating = True | |
225 | try: |
|
225 | try: | |
226 | yield |
|
226 | yield | |
227 | finally: |
|
227 | finally: | |
228 | self.updating = False |
|
228 | self.updating = False | |
229 |
|
229 | |||
230 | def _make_closure(self, sending_obj, sending_attr): |
|
230 | def _make_closure(self, sending_obj, sending_attr): | |
231 | def update(name, old, new): |
|
231 | def update(name, old, new): | |
232 | self._update(sending_obj, sending_attr, new) |
|
232 | self._update(sending_obj, sending_attr, new) | |
233 | return update |
|
233 | return update | |
234 |
|
234 | |||
235 | def _update(self, sending_obj, sending_attr, new): |
|
235 | def _update(self, sending_obj, sending_attr, new): | |
236 | if self.updating: |
|
236 | if self.updating: | |
237 | return |
|
237 | return | |
238 | with self._busy_updating(): |
|
238 | with self._busy_updating(): | |
239 | for obj, attr in self.objects.keys(): |
|
239 | for obj, attr in self.objects.keys(): | |
240 | setattr(obj, attr, new) |
|
240 | setattr(obj, attr, new) | |
241 |
|
241 | |||
242 | def unlink(self): |
|
242 | def unlink(self): | |
243 | for key, callback in self.objects.items(): |
|
243 | for key, callback in self.objects.items(): | |
244 | (obj, attr) = key |
|
244 | (obj, attr) = key | |
245 | obj.on_trait_change(callback, attr, remove=True) |
|
245 | obj.on_trait_change(callback, attr, remove=True) | |
246 |
|
246 | |||
247 | @skip_doctest |
|
247 | @skip_doctest | |
248 | class directional_link(object): |
|
248 | class directional_link(object): | |
249 | """Link the trait of a source object with traits of target objects. |
|
249 | """Link the trait of a source object with traits of target objects. | |
250 |
|
250 | |||
251 | Parameters |
|
251 | Parameters | |
252 | ---------- |
|
252 | ---------- | |
253 | source : pair of object, name |
|
253 | source : pair of object, name | |
254 | targets : pairs of objects/attributes |
|
254 | targets : pairs of objects/attributes | |
255 |
|
255 | |||
256 | Examples |
|
256 | Examples | |
257 | -------- |
|
257 | -------- | |
258 |
|
258 | |||
259 | >>> c = directional_link((src, 'value'), (tgt1, 'value'), (tgt2, 'value')) |
|
259 | >>> c = directional_link((src, 'value'), (tgt1, 'value'), (tgt2, 'value')) | |
260 | >>> src.value = 5 # updates target objects |
|
260 | >>> src.value = 5 # updates target objects | |
261 | >>> tgt1.value = 6 # does not update other objects |
|
261 | >>> tgt1.value = 6 # does not update other objects | |
262 | """ |
|
262 | """ | |
263 | updating = False |
|
263 | updating = False | |
264 |
|
264 | |||
265 | def __init__(self, source, *targets): |
|
265 | def __init__(self, source, *targets): | |
266 | if len(targets) < 1: |
|
266 | if len(targets) < 1: | |
267 | raise TypeError('At least two traitlets must be provided.') |
|
267 | raise TypeError('At least two traitlets must be provided.') | |
268 | _validate_link(source, *targets) |
|
268 | _validate_link(source, *targets) | |
269 | self.source = source |
|
269 | self.source = source | |
270 | self.targets = targets |
|
270 | self.targets = targets | |
271 |
|
271 | |||
272 | # Update current value |
|
272 | # Update current value | |
273 | src_attr_value = getattr(source[0], source[1]) |
|
273 | src_attr_value = getattr(source[0], source[1]) | |
274 | for obj, attr in targets: |
|
274 | for obj, attr in targets: | |
275 | setattr(obj, attr, src_attr_value) |
|
275 | setattr(obj, attr, src_attr_value) | |
276 |
|
276 | |||
277 | # Wire |
|
277 | # Wire | |
278 | self.source[0].on_trait_change(self._update, self.source[1]) |
|
278 | self.source[0].on_trait_change(self._update, self.source[1]) | |
279 |
|
279 | |||
280 | @contextlib.contextmanager |
|
280 | @contextlib.contextmanager | |
281 | def _busy_updating(self): |
|
281 | def _busy_updating(self): | |
282 | self.updating = True |
|
282 | self.updating = True | |
283 | try: |
|
283 | try: | |
284 | yield |
|
284 | yield | |
285 | finally: |
|
285 | finally: | |
286 | self.updating = False |
|
286 | self.updating = False | |
287 |
|
287 | |||
288 | def _update(self, name, old, new): |
|
288 | def _update(self, name, old, new): | |
289 | if self.updating: |
|
289 | if self.updating: | |
290 | return |
|
290 | return | |
291 | with self._busy_updating(): |
|
291 | with self._busy_updating(): | |
292 | for obj, attr in self.targets: |
|
292 | for obj, attr in self.targets: | |
293 | setattr(obj, attr, new) |
|
293 | setattr(obj, attr, new) | |
294 |
|
294 | |||
295 | def unlink(self): |
|
295 | def unlink(self): | |
296 | self.source[0].on_trait_change(self._update, self.source[1], remove=True) |
|
296 | self.source[0].on_trait_change(self._update, self.source[1], remove=True) | |
297 | self.source = None |
|
297 | self.source = None | |
298 | self.targets = [] |
|
298 | self.targets = [] | |
299 |
|
299 | |||
300 | dlink = directional_link |
|
300 | dlink = directional_link | |
301 |
|
301 | |||
302 |
|
302 | |||
303 | #----------------------------------------------------------------------------- |
|
303 | #----------------------------------------------------------------------------- | |
304 | # Base TraitType for all traits |
|
304 | # Base TraitType for all traits | |
305 | #----------------------------------------------------------------------------- |
|
305 | #----------------------------------------------------------------------------- | |
306 |
|
306 | |||
307 |
|
307 | |||
308 | class TraitType(object): |
|
308 | class TraitType(object): | |
309 | """A base class for all trait descriptors. |
|
309 | """A base class for all trait descriptors. | |
310 |
|
310 | |||
311 | Notes |
|
311 | Notes | |
312 | ----- |
|
312 | ----- | |
313 | Our implementation of traits is based on Python's descriptor |
|
313 | Our implementation of traits is based on Python's descriptor | |
314 | prototol. This class is the base class for all such descriptors. The |
|
314 | prototol. This class is the base class for all such descriptors. The | |
315 | only magic we use is a custom metaclass for the main :class:`HasTraits` |
|
315 | only magic we use is a custom metaclass for the main :class:`HasTraits` | |
316 | class that does the following: |
|
316 | class that does the following: | |
317 |
|
317 | |||
318 | 1. Sets the :attr:`name` attribute of every :class:`TraitType` |
|
318 | 1. Sets the :attr:`name` attribute of every :class:`TraitType` | |
319 | instance in the class dict to the name of the attribute. |
|
319 | instance in the class dict to the name of the attribute. | |
320 | 2. Sets the :attr:`this_class` attribute of every :class:`TraitType` |
|
320 | 2. Sets the :attr:`this_class` attribute of every :class:`TraitType` | |
321 | instance in the class dict to the *class* that declared the trait. |
|
321 | instance in the class dict to the *class* that declared the trait. | |
322 | This is used by the :class:`This` trait to allow subclasses to |
|
322 | This is used by the :class:`This` trait to allow subclasses to | |
323 | accept superclasses for :class:`This` values. |
|
323 | accept superclasses for :class:`This` values. | |
324 | """ |
|
324 | """ | |
325 |
|
325 | |||
326 | metadata = {} |
|
326 | metadata = {} | |
327 | default_value = Undefined |
|
327 | default_value = Undefined | |
328 | allow_none = False |
|
328 | allow_none = False | |
329 | info_text = 'any value' |
|
329 | info_text = 'any value' | |
330 |
|
330 | |||
331 | def __init__(self, default_value=NoDefaultSpecified, allow_none=None, **metadata): |
|
331 | def __init__(self, default_value=NoDefaultSpecified, allow_none=None, **metadata): | |
332 | """Create a TraitType. |
|
332 | """Create a TraitType. | |
333 | """ |
|
333 | """ | |
334 | if default_value is not NoDefaultSpecified: |
|
334 | if default_value is not NoDefaultSpecified: | |
335 | self.default_value = default_value |
|
335 | self.default_value = default_value | |
336 | if allow_none is not None: |
|
336 | if allow_none is not None: | |
337 | self.allow_none = allow_none |
|
337 | self.allow_none = allow_none | |
338 |
|
338 | |||
339 | if 'default' in metadata: |
|
339 | if 'default' in metadata: | |
340 | # Warn the user that they probably meant default_value. |
|
340 | # Warn the user that they probably meant default_value. | |
341 | warn( |
|
341 | warn( | |
342 | "Parameter 'default' passed to TraitType. " |
|
342 | "Parameter 'default' passed to TraitType. " | |
343 | "Did you mean 'default_value'?" |
|
343 | "Did you mean 'default_value'?" | |
344 | ) |
|
344 | ) | |
345 |
|
345 | |||
346 | if len(metadata) > 0: |
|
346 | if len(metadata) > 0: | |
347 | if len(self.metadata) > 0: |
|
347 | if len(self.metadata) > 0: | |
348 | self._metadata = self.metadata.copy() |
|
348 | self._metadata = self.metadata.copy() | |
349 | self._metadata.update(metadata) |
|
349 | self._metadata.update(metadata) | |
350 | else: |
|
350 | else: | |
351 | self._metadata = metadata |
|
351 | self._metadata = metadata | |
352 | else: |
|
352 | else: | |
353 | self._metadata = self.metadata |
|
353 | self._metadata = self.metadata | |
354 |
|
354 | |||
355 | self.init() |
|
355 | self.init() | |
356 |
|
356 | |||
357 | def init(self): |
|
357 | def init(self): | |
358 | pass |
|
358 | pass | |
359 |
|
359 | |||
360 | def get_default_value(self): |
|
360 | def get_default_value(self): | |
361 | """Create a new instance of the default value.""" |
|
361 | """Create a new instance of the default value.""" | |
362 | return self.default_value |
|
362 | return self.default_value | |
363 |
|
363 | |||
364 | def instance_init(self): |
|
364 | def instance_init(self): | |
365 | """Part of the initialization which may depends on the underlying |
|
365 | """Part of the initialization which may depends on the underlying | |
366 | HasTraits instance. |
|
366 | HasTraits instance. | |
367 |
|
367 | |||
368 | It is typically overloaded for specific trait types. |
|
368 | It is typically overloaded for specific trait types. | |
369 |
|
369 | |||
370 | This method is called by :meth:`HasTraits.__new__` and in the |
|
370 | This method is called by :meth:`HasTraits.__new__` and in the | |
371 | :meth:`TraitType.instance_init` method of trait types holding |
|
371 | :meth:`TraitType.instance_init` method of trait types holding | |
372 | other trait types. |
|
372 | other trait types. | |
373 | """ |
|
373 | """ | |
374 | pass |
|
374 | pass | |
375 |
|
375 | |||
376 | def init_default_value(self, obj): |
|
376 | def init_default_value(self, obj): | |
377 | """Instantiate the default value for the trait type. |
|
377 | """Instantiate the default value for the trait type. | |
378 |
|
378 | |||
379 | This method is called by :meth:`TraitType.set_default_value` in the |
|
379 | This method is called by :meth:`TraitType.set_default_value` in the | |
380 | case a default value is provided at construction time or later when |
|
380 | case a default value is provided at construction time or later when | |
381 | accessing the trait value for the first time in |
|
381 | accessing the trait value for the first time in | |
382 | :meth:`HasTraits.__get__`. |
|
382 | :meth:`HasTraits.__get__`. | |
383 | """ |
|
383 | """ | |
384 | value = self.get_default_value() |
|
384 | value = self.get_default_value() | |
385 | value = self._validate(obj, value) |
|
385 | value = self._validate(obj, value) | |
386 | obj._trait_values[self.name] = value |
|
386 | obj._trait_values[self.name] = value | |
387 | return value |
|
387 | return value | |
388 |
|
388 | |||
389 | def set_default_value(self, obj): |
|
389 | def set_default_value(self, obj): | |
390 | """Set the default value on a per instance basis. |
|
390 | """Set the default value on a per instance basis. | |
391 |
|
391 | |||
392 | This method is called by :meth:`HasTraits.__new__` to instantiate and |
|
392 | This method is called by :meth:`HasTraits.__new__` to instantiate and | |
393 | validate the default value. The creation and validation of |
|
393 | validate the default value. The creation and validation of | |
394 | default values must be delayed until the parent :class:`HasTraits` |
|
394 | default values must be delayed until the parent :class:`HasTraits` | |
395 | class has been instantiated. |
|
395 | class has been instantiated. | |
396 | Parameters |
|
396 | Parameters | |
397 | ---------- |
|
397 | ---------- | |
398 | obj : :class:`HasTraits` instance |
|
398 | obj : :class:`HasTraits` instance | |
399 | The parent :class:`HasTraits` instance that has just been |
|
399 | The parent :class:`HasTraits` instance that has just been | |
400 | created. |
|
400 | created. | |
401 | """ |
|
401 | """ | |
402 | # Check for a deferred initializer defined in the same class as the |
|
402 | # Check for a deferred initializer defined in the same class as the | |
403 | # trait declaration or above. |
|
403 | # trait declaration or above. | |
404 | mro = type(obj).mro() |
|
404 | mro = type(obj).mro() | |
405 | meth_name = '_%s_default' % self.name |
|
405 | meth_name = '_%s_default' % self.name | |
406 | for cls in mro[:mro.index(self.this_class)+1]: |
|
406 | for cls in mro[:mro.index(self.this_class)+1]: | |
407 | if meth_name in cls.__dict__: |
|
407 | if meth_name in cls.__dict__: | |
408 | break |
|
408 | break | |
409 | else: |
|
409 | else: | |
410 | # We didn't find one. Do static initialization. |
|
410 | # We didn't find one. Do static initialization. | |
411 | self.init_default_value(obj) |
|
411 | self.init_default_value(obj) | |
412 | return |
|
412 | return | |
413 | # Complete the dynamic initialization. |
|
413 | # Complete the dynamic initialization. | |
414 | obj._trait_dyn_inits[self.name] = meth_name |
|
414 | obj._trait_dyn_inits[self.name] = meth_name | |
415 |
|
415 | |||
416 | def __get__(self, obj, cls=None): |
|
416 | def __get__(self, obj, cls=None): | |
417 | """Get the value of the trait by self.name for the instance. |
|
417 | """Get the value of the trait by self.name for the instance. | |
418 |
|
418 | |||
419 | Default values are instantiated when :meth:`HasTraits.__new__` |
|
419 | Default values are instantiated when :meth:`HasTraits.__new__` | |
420 | is called. Thus by the time this method gets called either the |
|
420 | is called. Thus by the time this method gets called either the | |
421 | default value or a user defined value (they called :meth:`__set__`) |
|
421 | default value or a user defined value (they called :meth:`__set__`) | |
422 | is in the :class:`HasTraits` instance. |
|
422 | is in the :class:`HasTraits` instance. | |
423 | """ |
|
423 | """ | |
424 | if obj is None: |
|
424 | if obj is None: | |
425 | return self |
|
425 | return self | |
426 | else: |
|
426 | else: | |
427 | try: |
|
427 | try: | |
428 | value = obj._trait_values[self.name] |
|
428 | value = obj._trait_values[self.name] | |
429 | except KeyError: |
|
429 | except KeyError: | |
430 | # Check for a dynamic initializer. |
|
430 | # Check for a dynamic initializer. | |
431 | if self.name in obj._trait_dyn_inits: |
|
431 | if self.name in obj._trait_dyn_inits: | |
432 | method = getattr(obj, obj._trait_dyn_inits[self.name]) |
|
432 | method = getattr(obj, obj._trait_dyn_inits[self.name]) | |
433 | value = method() |
|
433 | value = method() | |
434 | # FIXME: Do we really validate here? |
|
434 | # FIXME: Do we really validate here? | |
435 | value = self._validate(obj, value) |
|
435 | value = self._validate(obj, value) | |
436 | obj._trait_values[self.name] = value |
|
436 | obj._trait_values[self.name] = value | |
437 | return value |
|
437 | return value | |
438 | else: |
|
438 | else: | |
439 | return self.init_default_value(obj) |
|
439 | return self.init_default_value(obj) | |
440 | except Exception: |
|
440 | except Exception: | |
441 | # HasTraits should call set_default_value to populate |
|
441 | # HasTraits should call set_default_value to populate | |
442 | # this. So this should never be reached. |
|
442 | # this. So this should never be reached. | |
443 | raise TraitError('Unexpected error in TraitType: ' |
|
443 | raise TraitError('Unexpected error in TraitType: ' | |
444 | 'default value not set properly') |
|
444 | 'default value not set properly') | |
445 | else: |
|
445 | else: | |
446 | return value |
|
446 | return value | |
447 |
|
447 | |||
448 | def __set__(self, obj, value): |
|
448 | def __set__(self, obj, value): | |
449 | new_value = self._validate(obj, value) |
|
449 | new_value = self._validate(obj, value) | |
450 | try: |
|
450 | try: | |
451 | old_value = obj._trait_values[self.name] |
|
451 | old_value = obj._trait_values[self.name] | |
452 | except KeyError: |
|
452 | except KeyError: | |
453 | old_value = Undefined |
|
453 | old_value = Undefined | |
454 |
|
454 | |||
455 | obj._trait_values[self.name] = new_value |
|
455 | obj._trait_values[self.name] = new_value | |
456 | try: |
|
456 | try: | |
457 | silent = bool(old_value == new_value) |
|
457 | silent = bool(old_value == new_value) | |
458 | except: |
|
458 | except: | |
459 | # if there is an error in comparing, default to notify |
|
459 | # if there is an error in comparing, default to notify | |
460 | silent = False |
|
460 | silent = False | |
461 | if silent is not True: |
|
461 | if silent is not True: | |
462 | # we explicitly compare silent to True just in case the equality |
|
462 | # we explicitly compare silent to True just in case the equality | |
463 | # comparison above returns something other than True/False |
|
463 | # comparison above returns something other than True/False | |
464 | obj._notify_trait(self.name, old_value, new_value) |
|
464 | obj._notify_trait(self.name, old_value, new_value) | |
465 |
|
465 | |||
466 | def _validate(self, obj, value): |
|
466 | def _validate(self, obj, value): | |
467 | if value is None and self.allow_none: |
|
467 | if value is None and self.allow_none: | |
468 | return value |
|
468 | return value | |
469 | if hasattr(self, 'validate'): |
|
469 | if hasattr(self, 'validate'): | |
470 | value = self.validate(obj, value) |
|
470 | value = self.validate(obj, value) | |
471 | if obj._cross_validation_lock is False: |
|
471 | if obj._cross_validation_lock is False: | |
472 | value = self._cross_validate(obj, value) |
|
472 | value = self._cross_validate(obj, value) | |
473 | return value |
|
473 | return value | |
474 |
|
474 | |||
475 | def _cross_validate(self, obj, value): |
|
475 | def _cross_validate(self, obj, value): | |
476 | if hasattr(obj, '_%s_validate' % self.name): |
|
476 | if hasattr(obj, '_%s_validate' % self.name): | |
477 | cross_validate = getattr(obj, '_%s_validate' % self.name) |
|
477 | cross_validate = getattr(obj, '_%s_validate' % self.name) | |
478 | value = cross_validate(value, self) |
|
478 | value = cross_validate(value, self) | |
479 | return value |
|
479 | return value | |
480 |
|
480 | |||
481 | def __or__(self, other): |
|
481 | def __or__(self, other): | |
482 | if isinstance(other, Union): |
|
482 | if isinstance(other, Union): | |
483 | return Union([self] + other.trait_types) |
|
483 | return Union([self] + other.trait_types) | |
484 | else: |
|
484 | else: | |
485 | return Union([self, other]) |
|
485 | return Union([self, other]) | |
486 |
|
486 | |||
487 | def info(self): |
|
487 | def info(self): | |
488 | return self.info_text |
|
488 | return self.info_text | |
489 |
|
489 | |||
490 | def error(self, obj, value): |
|
490 | def error(self, obj, value): | |
491 | if obj is not None: |
|
491 | if obj is not None: | |
492 | e = "The '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
492 | e = "The '%s' trait of %s instance must be %s, but a value of %s was specified." \ | |
493 | % (self.name, class_of(obj), |
|
493 | % (self.name, class_of(obj), | |
494 | self.info(), repr_type(value)) |
|
494 | self.info(), repr_type(value)) | |
495 | else: |
|
495 | else: | |
496 | e = "The '%s' trait must be %s, but a value of %r was specified." \ |
|
496 | e = "The '%s' trait must be %s, but a value of %r was specified." \ | |
497 | % (self.name, self.info(), repr_type(value)) |
|
497 | % (self.name, self.info(), repr_type(value)) | |
498 | raise TraitError(e) |
|
498 | raise TraitError(e) | |
499 |
|
499 | |||
500 | def get_metadata(self, key, default=None): |
|
500 | def get_metadata(self, key, default=None): | |
501 | return getattr(self, '_metadata', {}).get(key, default) |
|
501 | return getattr(self, '_metadata', {}).get(key, default) | |
502 |
|
502 | |||
503 | def set_metadata(self, key, value): |
|
503 | def set_metadata(self, key, value): | |
504 | getattr(self, '_metadata', {})[key] = value |
|
504 | getattr(self, '_metadata', {})[key] = value | |
505 |
|
505 | |||
506 |
|
506 | |||
507 | #----------------------------------------------------------------------------- |
|
507 | #----------------------------------------------------------------------------- | |
508 | # The HasTraits implementation |
|
508 | # The HasTraits implementation | |
509 | #----------------------------------------------------------------------------- |
|
509 | #----------------------------------------------------------------------------- | |
510 |
|
510 | |||
511 |
|
511 | |||
512 | class MetaHasTraits(type): |
|
512 | class MetaHasTraits(type): | |
513 | """A metaclass for HasTraits. |
|
513 | """A metaclass for HasTraits. | |
514 |
|
514 | |||
515 | This metaclass makes sure that any TraitType class attributes are |
|
515 | This metaclass makes sure that any TraitType class attributes are | |
516 | instantiated and sets their name attribute. |
|
516 | instantiated and sets their name attribute. | |
517 | """ |
|
517 | """ | |
518 |
|
518 | |||
519 | def __new__(mcls, name, bases, classdict): |
|
519 | def __new__(mcls, name, bases, classdict): | |
520 | """Create the HasTraits class. |
|
520 | """Create the HasTraits class. | |
521 |
|
521 | |||
522 | This instantiates all TraitTypes in the class dict and sets their |
|
522 | This instantiates all TraitTypes in the class dict and sets their | |
523 | :attr:`name` attribute. |
|
523 | :attr:`name` attribute. | |
524 | """ |
|
524 | """ | |
525 | # print "MetaHasTraitlets (mcls, name): ", mcls, name |
|
525 | # print "MetaHasTraitlets (mcls, name): ", mcls, name | |
526 | # print "MetaHasTraitlets (bases): ", bases |
|
526 | # print "MetaHasTraitlets (bases): ", bases | |
527 | # print "MetaHasTraitlets (classdict): ", classdict |
|
527 | # print "MetaHasTraitlets (classdict): ", classdict | |
528 | for k,v in iteritems(classdict): |
|
528 | for k,v in iteritems(classdict): | |
529 | if isinstance(v, TraitType): |
|
529 | if isinstance(v, TraitType): | |
530 | v.name = k |
|
530 | v.name = k | |
531 | elif inspect.isclass(v): |
|
531 | elif inspect.isclass(v): | |
532 | if issubclass(v, TraitType): |
|
532 | if issubclass(v, TraitType): | |
533 | vinst = v() |
|
533 | vinst = v() | |
534 | vinst.name = k |
|
534 | vinst.name = k | |
535 | classdict[k] = vinst |
|
535 | classdict[k] = vinst | |
536 | return super(MetaHasTraits, mcls).__new__(mcls, name, bases, classdict) |
|
536 | return super(MetaHasTraits, mcls).__new__(mcls, name, bases, classdict) | |
537 |
|
537 | |||
538 | def __init__(cls, name, bases, classdict): |
|
538 | def __init__(cls, name, bases, classdict): | |
539 | """Finish initializing the HasTraits class. |
|
539 | """Finish initializing the HasTraits class. | |
540 |
|
540 | |||
541 | This sets the :attr:`this_class` attribute of each TraitType in the |
|
541 | This sets the :attr:`this_class` attribute of each TraitType in the | |
542 | class dict to the newly created class ``cls``. |
|
542 | class dict to the newly created class ``cls``. | |
543 | """ |
|
543 | """ | |
544 | for k, v in iteritems(classdict): |
|
544 | for k, v in iteritems(classdict): | |
545 | if isinstance(v, TraitType): |
|
545 | if isinstance(v, TraitType): | |
546 | v.this_class = cls |
|
546 | v.this_class = cls | |
547 | super(MetaHasTraits, cls).__init__(name, bases, classdict) |
|
547 | super(MetaHasTraits, cls).__init__(name, bases, classdict) | |
548 |
|
548 | |||
549 |
|
549 | |||
550 | class HasTraits(py3compat.with_metaclass(MetaHasTraits, object)): |
|
550 | class HasTraits(py3compat.with_metaclass(MetaHasTraits, object)): | |
551 |
|
551 | |||
552 | def __new__(cls, *args, **kw): |
|
552 | def __new__(cls, *args, **kw): | |
553 | # This is needed because object.__new__ only accepts |
|
553 | # This is needed because object.__new__ only accepts | |
554 | # the cls argument. |
|
554 | # the cls argument. | |
555 | new_meth = super(HasTraits, cls).__new__ |
|
555 | new_meth = super(HasTraits, cls).__new__ | |
556 | if new_meth is object.__new__: |
|
556 | if new_meth is object.__new__: | |
557 | inst = new_meth(cls) |
|
557 | inst = new_meth(cls) | |
558 | else: |
|
558 | else: | |
559 | inst = new_meth(cls, **kw) |
|
559 | inst = new_meth(cls, **kw) | |
560 | inst._trait_values = {} |
|
560 | inst._trait_values = {} | |
561 | inst._trait_notifiers = {} |
|
561 | inst._trait_notifiers = {} | |
562 | inst._trait_dyn_inits = {} |
|
562 | inst._trait_dyn_inits = {} | |
563 | inst._cross_validation_lock = True |
|
563 | inst._cross_validation_lock = True | |
564 | # Here we tell all the TraitType instances to set their default |
|
564 | # Here we tell all the TraitType instances to set their default | |
565 | # values on the instance. |
|
565 | # values on the instance. | |
566 | for key in dir(cls): |
|
566 | for key in dir(cls): | |
567 | # Some descriptors raise AttributeError like zope.interface's |
|
567 | # Some descriptors raise AttributeError like zope.interface's | |
568 | # __provides__ attributes even though they exist. This causes |
|
568 | # __provides__ attributes even though they exist. This causes | |
569 | # AttributeErrors even though they are listed in dir(cls). |
|
569 | # AttributeErrors even though they are listed in dir(cls). | |
570 | try: |
|
570 | try: | |
571 | value = getattr(cls, key) |
|
571 | value = getattr(cls, key) | |
572 | except AttributeError: |
|
572 | except AttributeError: | |
573 | pass |
|
573 | pass | |
574 | else: |
|
574 | else: | |
575 | if isinstance(value, TraitType): |
|
575 | if isinstance(value, TraitType): | |
576 | value.instance_init() |
|
576 | value.instance_init() | |
577 | if key not in kw: |
|
577 | if key not in kw: | |
578 | value.set_default_value(inst) |
|
578 | value.set_default_value(inst) | |
579 | inst._cross_validation_lock = False |
|
579 | inst._cross_validation_lock = False | |
580 | return inst |
|
580 | return inst | |
581 |
|
581 | |||
582 | def __init__(self, *args, **kw): |
|
582 | def __init__(self, *args, **kw): | |
583 | # Allow trait values to be set using keyword arguments. |
|
583 | # Allow trait values to be set using keyword arguments. | |
584 | # We need to use setattr for this to trigger validation and |
|
584 | # We need to use setattr for this to trigger validation and | |
585 | # notifications. |
|
585 | # notifications. | |
586 | with self.hold_trait_notifications(): |
|
586 | with self.hold_trait_notifications(): | |
587 | for key, value in iteritems(kw): |
|
587 | for key, value in iteritems(kw): | |
588 | setattr(self, key, value) |
|
588 | setattr(self, key, value) | |
589 |
|
589 | |||
590 | @contextlib.contextmanager |
|
590 | @contextlib.contextmanager | |
591 | def hold_trait_notifications(self): |
|
591 | def hold_trait_notifications(self): | |
592 | """Context manager for bundling trait change notifications and cross |
|
592 | """Context manager for bundling trait change notifications and cross | |
593 | validation. |
|
593 | validation. | |
594 |
|
594 | |||
595 | Use this when doing multiple trait assignments (init, config), to avoid |
|
595 | Use this when doing multiple trait assignments (init, config), to avoid | |
596 | race conditions in trait notifiers requesting other trait values. |
|
596 | race conditions in trait notifiers requesting other trait values. | |
597 | All trait notifications will fire after all values have been assigned. |
|
597 | All trait notifications will fire after all values have been assigned. | |
598 | """ |
|
598 | """ | |
599 | if self._cross_validation_lock is True: |
|
599 | if self._cross_validation_lock is True: | |
600 | yield |
|
600 | yield | |
601 | return |
|
601 | return | |
602 | else: |
|
602 | else: | |
603 | self._cross_validation_lock = True |
|
603 | self._cross_validation_lock = True | |
604 | cache = {} |
|
604 | cache = {} | |
605 | notifications = {} |
|
605 | notifications = {} | |
606 | _notify_trait = self._notify_trait |
|
606 | _notify_trait = self._notify_trait | |
607 |
|
607 | |||
608 | def cache_values(*a): |
|
608 | def cache_values(*a): | |
609 | cache[a[0]] = a |
|
609 | cache[a[0]] = a | |
610 |
|
610 | |||
611 | def hold_notifications(*a): |
|
611 | def hold_notifications(*a): | |
612 | notifications[a[0]] = a |
|
612 | notifications[a[0]] = a | |
613 |
|
613 | |||
614 | self._notify_trait = cache_values |
|
614 | self._notify_trait = cache_values | |
615 |
|
615 | |||
616 | try: |
|
616 | try: | |
617 | yield |
|
617 | yield | |
618 | finally: |
|
618 | finally: | |
619 | try: |
|
619 | try: | |
620 | self._notify_trait = hold_notifications |
|
620 | self._notify_trait = hold_notifications | |
621 | for name in cache: |
|
621 | for name in cache: | |
622 | if hasattr(self, '_%s_validate' % name): |
|
622 | if hasattr(self, '_%s_validate' % name): | |
623 | cross_validate = getattr(self, '_%s_validate' % name) |
|
623 | cross_validate = getattr(self, '_%s_validate' % name) | |
624 | setattr(self, name, cross_validate(getattr(self, name), self)) |
|
624 | setattr(self, name, cross_validate(getattr(self, name), self)) | |
625 | except TraitError as e: |
|
625 | except TraitError as e: | |
626 | self._notify_trait = lambda *x: None |
|
626 | self._notify_trait = lambda *x: None | |
627 | for name in cache: |
|
627 | for name in cache: | |
628 | if cache[name][1] is not Undefined: |
|
628 | if cache[name][1] is not Undefined: | |
629 | setattr(self, name, cache[name][1]) |
|
629 | setattr(self, name, cache[name][1]) | |
630 | else: |
|
630 | else: | |
631 | delattr(self, name) |
|
631 | delattr(self, name) | |
632 | cache = {} |
|
632 | cache = {} | |
633 | notifications = {} |
|
633 | notifications = {} | |
634 | raise e |
|
634 | raise e | |
635 | finally: |
|
635 | finally: | |
636 | self._notify_trait = _notify_trait |
|
636 | self._notify_trait = _notify_trait | |
637 | self._cross_validation_lock = False |
|
637 | self._cross_validation_lock = False | |
638 | if isinstance(_notify_trait, types.MethodType): |
|
638 | if isinstance(_notify_trait, types.MethodType): | |
639 | # FIXME: remove when support is bumped to 3.4. |
|
639 | # FIXME: remove when support is bumped to 3.4. | |
640 | # when original method is restored, |
|
640 | # when original method is restored, | |
641 | # remove the redundant value from __dict__ |
|
641 | # remove the redundant value from __dict__ | |
642 | # (only used to preserve pickleability on Python < 3.4) |
|
642 | # (only used to preserve pickleability on Python < 3.4) | |
643 | self.__dict__.pop('_notify_trait', None) |
|
643 | self.__dict__.pop('_notify_trait', None) | |
644 | # trigger delayed notifications |
|
644 | # trigger delayed notifications | |
645 | for v in dict(cache, **notifications).values(): |
|
645 | for v in dict(cache, **notifications).values(): | |
646 | self._notify_trait(*v) |
|
646 | self._notify_trait(*v) | |
647 |
|
647 | |||
648 | def _notify_trait(self, name, old_value, new_value): |
|
648 | def _notify_trait(self, name, old_value, new_value): | |
649 |
|
649 | |||
650 | # First dynamic ones |
|
650 | # First dynamic ones | |
651 | callables = [] |
|
651 | callables = [] | |
652 | callables.extend(self._trait_notifiers.get(name,[])) |
|
652 | callables.extend(self._trait_notifiers.get(name,[])) | |
653 | callables.extend(self._trait_notifiers.get('anytrait',[])) |
|
653 | callables.extend(self._trait_notifiers.get('anytrait',[])) | |
654 |
|
654 | |||
655 | # Now static ones |
|
655 | # Now static ones | |
656 | try: |
|
656 | try: | |
657 | cb = getattr(self, '_%s_changed' % name) |
|
657 | cb = getattr(self, '_%s_changed' % name) | |
658 | except: |
|
658 | except: | |
659 | pass |
|
659 | pass | |
660 | else: |
|
660 | else: | |
661 | callables.append(cb) |
|
661 | callables.append(cb) | |
662 |
|
662 | |||
663 | # Call them all now |
|
663 | # Call them all now | |
664 | for c in callables: |
|
664 | for c in callables: | |
665 | # Traits catches and logs errors here. I allow them to raise |
|
665 | # Traits catches and logs errors here. I allow them to raise | |
666 | if callable(c): |
|
666 | if callable(c): | |
667 | argspec = getargspec(c) |
|
667 | argspec = getargspec(c) | |
668 |
|
668 | |||
669 | nargs = len(argspec[0]) |
|
669 | nargs = len(argspec[0]) | |
670 | # Bound methods have an additional 'self' argument |
|
670 | # Bound methods have an additional 'self' argument | |
671 | # I don't know how to treat unbound methods, but they |
|
671 | # I don't know how to treat unbound methods, but they | |
672 | # can't really be used for callbacks. |
|
672 | # can't really be used for callbacks. | |
673 | if isinstance(c, types.MethodType): |
|
673 | if isinstance(c, types.MethodType): | |
674 | offset = -1 |
|
674 | offset = -1 | |
675 | else: |
|
675 | else: | |
676 | offset = 0 |
|
676 | offset = 0 | |
677 | if nargs + offset == 0: |
|
677 | if nargs + offset == 0: | |
678 | c() |
|
678 | c() | |
679 | elif nargs + offset == 1: |
|
679 | elif nargs + offset == 1: | |
680 | c(name) |
|
680 | c(name) | |
681 | elif nargs + offset == 2: |
|
681 | elif nargs + offset == 2: | |
682 | c(name, new_value) |
|
682 | c(name, new_value) | |
683 | elif nargs + offset == 3: |
|
683 | elif nargs + offset == 3: | |
684 | c(name, old_value, new_value) |
|
684 | c(name, old_value, new_value) | |
685 | else: |
|
685 | else: | |
686 | raise TraitError('a trait changed callback ' |
|
686 | raise TraitError('a trait changed callback ' | |
687 | 'must have 0-3 arguments.') |
|
687 | 'must have 0-3 arguments.') | |
688 | else: |
|
688 | else: | |
689 | raise TraitError('a trait changed callback ' |
|
689 | raise TraitError('a trait changed callback ' | |
690 | 'must be callable.') |
|
690 | 'must be callable.') | |
691 |
|
691 | |||
692 |
|
692 | |||
693 | def _add_notifiers(self, handler, name): |
|
693 | def _add_notifiers(self, handler, name): | |
694 | if name not in self._trait_notifiers: |
|
694 | if name not in self._trait_notifiers: | |
695 | nlist = [] |
|
695 | nlist = [] | |
696 | self._trait_notifiers[name] = nlist |
|
696 | self._trait_notifiers[name] = nlist | |
697 | else: |
|
697 | else: | |
698 | nlist = self._trait_notifiers[name] |
|
698 | nlist = self._trait_notifiers[name] | |
699 | if handler not in nlist: |
|
699 | if handler not in nlist: | |
700 | nlist.append(handler) |
|
700 | nlist.append(handler) | |
701 |
|
701 | |||
702 | def _remove_notifiers(self, handler, name): |
|
702 | def _remove_notifiers(self, handler, name): | |
703 | if name in self._trait_notifiers: |
|
703 | if name in self._trait_notifiers: | |
704 | nlist = self._trait_notifiers[name] |
|
704 | nlist = self._trait_notifiers[name] | |
705 | try: |
|
705 | try: | |
706 | index = nlist.index(handler) |
|
706 | index = nlist.index(handler) | |
707 | except ValueError: |
|
707 | except ValueError: | |
708 | pass |
|
708 | pass | |
709 | else: |
|
709 | else: | |
710 | del nlist[index] |
|
710 | del nlist[index] | |
711 |
|
711 | |||
712 | def on_trait_change(self, handler, name=None, remove=False): |
|
712 | def on_trait_change(self, handler, name=None, remove=False): | |
713 | """Setup a handler to be called when a trait changes. |
|
713 | """Setup a handler to be called when a trait changes. | |
714 |
|
714 | |||
715 | This is used to setup dynamic notifications of trait changes. |
|
715 | This is used to setup dynamic notifications of trait changes. | |
716 |
|
716 | |||
717 | Static handlers can be created by creating methods on a HasTraits |
|
717 | Static handlers can be created by creating methods on a HasTraits | |
718 | subclass with the naming convention '_[traitname]_changed'. Thus, |
|
718 | subclass with the naming convention '_[traitname]_changed'. Thus, | |
719 | to create static handler for the trait 'a', create the method |
|
719 | to create static handler for the trait 'a', create the method | |
720 | _a_changed(self, name, old, new) (fewer arguments can be used, see |
|
720 | _a_changed(self, name, old, new) (fewer arguments can be used, see | |
721 | below). |
|
721 | below). | |
722 |
|
722 | |||
723 | Parameters |
|
723 | Parameters | |
724 | ---------- |
|
724 | ---------- | |
725 | handler : callable |
|
725 | handler : callable | |
726 | A callable that is called when a trait changes. Its |
|
726 | A callable that is called when a trait changes. Its | |
727 | signature can be handler(), handler(name), handler(name, new) |
|
727 | signature can be handler(), handler(name), handler(name, new) | |
728 | or handler(name, old, new). |
|
728 | or handler(name, old, new). | |
729 | name : list, str, None |
|
729 | name : list, str, None | |
730 | If None, the handler will apply to all traits. If a list |
|
730 | If None, the handler will apply to all traits. If a list | |
731 | of str, handler will apply to all names in the list. If a |
|
731 | of str, handler will apply to all names in the list. If a | |
732 | str, the handler will apply just to that name. |
|
732 | str, the handler will apply just to that name. | |
733 | remove : bool |
|
733 | remove : bool | |
734 | If False (the default), then install the handler. If True |
|
734 | If False (the default), then install the handler. If True | |
735 | then unintall it. |
|
735 | then unintall it. | |
736 | """ |
|
736 | """ | |
737 | if remove: |
|
737 | if remove: | |
738 | names = parse_notifier_name(name) |
|
738 | names = parse_notifier_name(name) | |
739 | for n in names: |
|
739 | for n in names: | |
740 | self._remove_notifiers(handler, n) |
|
740 | self._remove_notifiers(handler, n) | |
741 | else: |
|
741 | else: | |
742 | names = parse_notifier_name(name) |
|
742 | names = parse_notifier_name(name) | |
743 | for n in names: |
|
743 | for n in names: | |
744 | self._add_notifiers(handler, n) |
|
744 | self._add_notifiers(handler, n) | |
745 |
|
745 | |||
746 | @classmethod |
|
746 | @classmethod | |
747 | def class_trait_names(cls, **metadata): |
|
747 | def class_trait_names(cls, **metadata): | |
748 | """Get a list of all the names of this class' traits. |
|
748 | """Get a list of all the names of this class' traits. | |
749 |
|
749 | |||
750 | This method is just like the :meth:`trait_names` method, |
|
750 | This method is just like the :meth:`trait_names` method, | |
751 | but is unbound. |
|
751 | but is unbound. | |
752 | """ |
|
752 | """ | |
753 | return cls.class_traits(**metadata).keys() |
|
753 | return cls.class_traits(**metadata).keys() | |
754 |
|
754 | |||
755 | @classmethod |
|
755 | @classmethod | |
756 | def class_traits(cls, **metadata): |
|
756 | def class_traits(cls, **metadata): | |
757 | """Get a `dict` of all the traits of this class. The dictionary |
|
757 | """Get a `dict` of all the traits of this class. The dictionary | |
758 | is keyed on the name and the values are the TraitType objects. |
|
758 | is keyed on the name and the values are the TraitType objects. | |
759 |
|
759 | |||
760 | This method is just like the :meth:`traits` method, but is unbound. |
|
760 | This method is just like the :meth:`traits` method, but is unbound. | |
761 |
|
761 | |||
762 | The TraitTypes returned don't know anything about the values |
|
762 | The TraitTypes returned don't know anything about the values | |
763 | that the various HasTrait's instances are holding. |
|
763 | that the various HasTrait's instances are holding. | |
764 |
|
764 | |||
765 | The metadata kwargs allow functions to be passed in which |
|
765 | The metadata kwargs allow functions to be passed in which | |
766 | filter traits based on metadata values. The functions should |
|
766 | filter traits based on metadata values. The functions should | |
767 | take a single value as an argument and return a boolean. If |
|
767 | take a single value as an argument and return a boolean. If | |
768 | any function returns False, then the trait is not included in |
|
768 | any function returns False, then the trait is not included in | |
769 | the output. This does not allow for any simple way of |
|
769 | the output. This does not allow for any simple way of | |
770 | testing that a metadata name exists and has any |
|
770 | testing that a metadata name exists and has any | |
771 | value because get_metadata returns None if a metadata key |
|
771 | value because get_metadata returns None if a metadata key | |
772 | doesn't exist. |
|
772 | doesn't exist. | |
773 | """ |
|
773 | """ | |
774 | traits = dict([memb for memb in getmembers(cls) if |
|
774 | traits = dict([memb for memb in getmembers(cls) if | |
775 | isinstance(memb[1], TraitType)]) |
|
775 | isinstance(memb[1], TraitType)]) | |
776 |
|
776 | |||
777 | if len(metadata) == 0: |
|
777 | if len(metadata) == 0: | |
778 | return traits |
|
778 | return traits | |
779 |
|
779 | |||
780 | for meta_name, meta_eval in metadata.items(): |
|
780 | for meta_name, meta_eval in metadata.items(): | |
781 | if type(meta_eval) is not FunctionType: |
|
781 | if type(meta_eval) is not FunctionType: | |
782 | metadata[meta_name] = _SimpleTest(meta_eval) |
|
782 | metadata[meta_name] = _SimpleTest(meta_eval) | |
783 |
|
783 | |||
784 | result = {} |
|
784 | result = {} | |
785 | for name, trait in traits.items(): |
|
785 | for name, trait in traits.items(): | |
786 | for meta_name, meta_eval in metadata.items(): |
|
786 | for meta_name, meta_eval in metadata.items(): | |
787 | if not meta_eval(trait.get_metadata(meta_name)): |
|
787 | if not meta_eval(trait.get_metadata(meta_name)): | |
788 | break |
|
788 | break | |
789 | else: |
|
789 | else: | |
790 | result[name] = trait |
|
790 | result[name] = trait | |
791 |
|
791 | |||
792 | return result |
|
792 | return result | |
793 |
|
793 | |||
794 | def trait_names(self, **metadata): |
|
794 | def trait_names(self, **metadata): | |
795 | """Get a list of all the names of this class' traits.""" |
|
795 | """Get a list of all the names of this class' traits.""" | |
796 | return self.traits(**metadata).keys() |
|
796 | return self.traits(**metadata).keys() | |
797 |
|
797 | |||
798 | def traits(self, **metadata): |
|
798 | def traits(self, **metadata): | |
799 | """Get a `dict` of all the traits of this class. The dictionary |
|
799 | """Get a `dict` of all the traits of this class. The dictionary | |
800 | is keyed on the name and the values are the TraitType objects. |
|
800 | is keyed on the name and the values are the TraitType objects. | |
801 |
|
801 | |||
802 | The TraitTypes returned don't know anything about the values |
|
802 | The TraitTypes returned don't know anything about the values | |
803 | that the various HasTrait's instances are holding. |
|
803 | that the various HasTrait's instances are holding. | |
804 |
|
804 | |||
805 | The metadata kwargs allow functions to be passed in which |
|
805 | The metadata kwargs allow functions to be passed in which | |
806 | filter traits based on metadata values. The functions should |
|
806 | filter traits based on metadata values. The functions should | |
807 | take a single value as an argument and return a boolean. If |
|
807 | take a single value as an argument and return a boolean. If | |
808 | any function returns False, then the trait is not included in |
|
808 | any function returns False, then the trait is not included in | |
809 | the output. This does not allow for any simple way of |
|
809 | the output. This does not allow for any simple way of | |
810 | testing that a metadata name exists and has any |
|
810 | testing that a metadata name exists and has any | |
811 | value because get_metadata returns None if a metadata key |
|
811 | value because get_metadata returns None if a metadata key | |
812 | doesn't exist. |
|
812 | doesn't exist. | |
813 | """ |
|
813 | """ | |
814 | traits = dict([memb for memb in getmembers(self.__class__) if |
|
814 | traits = dict([memb for memb in getmembers(self.__class__) if | |
815 | isinstance(memb[1], TraitType)]) |
|
815 | isinstance(memb[1], TraitType)]) | |
816 |
|
816 | |||
817 | if len(metadata) == 0: |
|
817 | if len(metadata) == 0: | |
818 | return traits |
|
818 | return traits | |
819 |
|
819 | |||
820 | for meta_name, meta_eval in metadata.items(): |
|
820 | for meta_name, meta_eval in metadata.items(): | |
821 | if type(meta_eval) is not FunctionType: |
|
821 | if type(meta_eval) is not FunctionType: | |
822 | metadata[meta_name] = _SimpleTest(meta_eval) |
|
822 | metadata[meta_name] = _SimpleTest(meta_eval) | |
823 |
|
823 | |||
824 | result = {} |
|
824 | result = {} | |
825 | for name, trait in traits.items(): |
|
825 | for name, trait in traits.items(): | |
826 | for meta_name, meta_eval in metadata.items(): |
|
826 | for meta_name, meta_eval in metadata.items(): | |
827 | if not meta_eval(trait.get_metadata(meta_name)): |
|
827 | if not meta_eval(trait.get_metadata(meta_name)): | |
828 | break |
|
828 | break | |
829 | else: |
|
829 | else: | |
830 | result[name] = trait |
|
830 | result[name] = trait | |
831 |
|
831 | |||
832 | return result |
|
832 | return result | |
833 |
|
833 | |||
834 | def trait_metadata(self, traitname, key, default=None): |
|
834 | def trait_metadata(self, traitname, key, default=None): | |
835 | """Get metadata values for trait by key.""" |
|
835 | """Get metadata values for trait by key.""" | |
836 | try: |
|
836 | try: | |
837 | trait = getattr(self.__class__, traitname) |
|
837 | trait = getattr(self.__class__, traitname) | |
838 | except AttributeError: |
|
838 | except AttributeError: | |
839 | raise TraitError("Class %s does not have a trait named %s" % |
|
839 | raise TraitError("Class %s does not have a trait named %s" % | |
840 | (self.__class__.__name__, traitname)) |
|
840 | (self.__class__.__name__, traitname)) | |
841 | else: |
|
841 | else: | |
842 | return trait.get_metadata(key, default) |
|
842 | return trait.get_metadata(key, default) | |
843 |
|
843 | |||
844 | def add_trait(self, traitname, trait): |
|
844 | def add_trait(self, traitname, trait): | |
845 | """Dynamically add a trait attribute to the HasTraits instance.""" |
|
845 | """Dynamically add a trait attribute to the HasTraits instance.""" | |
846 | self.__class__ = type(self.__class__.__name__, (self.__class__,), |
|
846 | self.__class__ = type(self.__class__.__name__, (self.__class__,), | |
847 | {traitname: trait}) |
|
847 | {traitname: trait}) | |
848 | trait.set_default_value(self) |
|
848 | trait.set_default_value(self) | |
849 |
|
849 | |||
850 | #----------------------------------------------------------------------------- |
|
850 | #----------------------------------------------------------------------------- | |
851 | # Actual TraitTypes implementations/subclasses |
|
851 | # Actual TraitTypes implementations/subclasses | |
852 | #----------------------------------------------------------------------------- |
|
852 | #----------------------------------------------------------------------------- | |
853 |
|
853 | |||
854 | #----------------------------------------------------------------------------- |
|
854 | #----------------------------------------------------------------------------- | |
855 | # TraitTypes subclasses for handling classes and instances of classes |
|
855 | # TraitTypes subclasses for handling classes and instances of classes | |
856 | #----------------------------------------------------------------------------- |
|
856 | #----------------------------------------------------------------------------- | |
857 |
|
857 | |||
858 |
|
858 | |||
859 | class ClassBasedTraitType(TraitType): |
|
859 | class ClassBasedTraitType(TraitType): | |
860 | """ |
|
860 | """ | |
861 | A trait with error reporting and string -> type resolution for Type, |
|
861 | A trait with error reporting and string -> type resolution for Type, | |
862 | Instance and This. |
|
862 | Instance and This. | |
863 | """ |
|
863 | """ | |
864 |
|
864 | |||
865 | def _resolve_string(self, string): |
|
865 | def _resolve_string(self, string): | |
866 | """ |
|
866 | """ | |
867 | Resolve a string supplied for a type into an actual object. |
|
867 | Resolve a string supplied for a type into an actual object. | |
868 | """ |
|
868 | """ | |
869 | return import_item(string) |
|
869 | return import_item(string) | |
870 |
|
870 | |||
871 | def error(self, obj, value): |
|
871 | def error(self, obj, value): | |
872 | kind = type(value) |
|
872 | kind = type(value) | |
873 | if (not py3compat.PY3) and kind is InstanceType: |
|
873 | if (not py3compat.PY3) and kind is InstanceType: | |
874 | msg = 'class %s' % value.__class__.__name__ |
|
874 | msg = 'class %s' % value.__class__.__name__ | |
875 | else: |
|
875 | else: | |
876 | msg = '%s (i.e. %s)' % ( str( kind )[1:-1], repr( value ) ) |
|
876 | msg = '%s (i.e. %s)' % ( str( kind )[1:-1], repr( value ) ) | |
877 |
|
877 | |||
878 | if obj is not None: |
|
878 | if obj is not None: | |
879 | e = "The '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
879 | e = "The '%s' trait of %s instance must be %s, but a value of %s was specified." \ | |
880 | % (self.name, class_of(obj), |
|
880 | % (self.name, class_of(obj), | |
881 | self.info(), msg) |
|
881 | self.info(), msg) | |
882 | else: |
|
882 | else: | |
883 | e = "The '%s' trait must be %s, but a value of %r was specified." \ |
|
883 | e = "The '%s' trait must be %s, but a value of %r was specified." \ | |
884 | % (self.name, self.info(), msg) |
|
884 | % (self.name, self.info(), msg) | |
885 |
|
885 | |||
886 | raise TraitError(e) |
|
886 | raise TraitError(e) | |
887 |
|
887 | |||
888 |
|
888 | |||
889 | class Type(ClassBasedTraitType): |
|
889 | class Type(ClassBasedTraitType): | |
890 | """A trait whose value must be a subclass of a specified class.""" |
|
890 | """A trait whose value must be a subclass of a specified class.""" | |
891 |
|
891 | |||
892 | def __init__ (self, default_value=None, klass=None, allow_none=False, |
|
892 | def __init__ (self, default_value=None, klass=None, allow_none=False, | |
893 | **metadata): |
|
893 | **metadata): | |
894 | """Construct a Type trait |
|
894 | """Construct a Type trait | |
895 |
|
895 | |||
896 | A Type trait specifies that its values must be subclasses of |
|
896 | A Type trait specifies that its values must be subclasses of | |
897 | a particular class. |
|
897 | a particular class. | |
898 |
|
898 | |||
899 | If only ``default_value`` is given, it is used for the ``klass`` as |
|
899 | If only ``default_value`` is given, it is used for the ``klass`` as | |
900 | well. |
|
900 | well. | |
901 |
|
901 | |||
902 | Parameters |
|
902 | Parameters | |
903 | ---------- |
|
903 | ---------- | |
904 | default_value : class, str or None |
|
904 | default_value : class, str or None | |
905 | The default value must be a subclass of klass. If an str, |
|
905 | The default value must be a subclass of klass. If an str, | |
906 | the str must be a fully specified class name, like 'foo.bar.Bah'. |
|
906 | the str must be a fully specified class name, like 'foo.bar.Bah'. | |
907 | The string is resolved into real class, when the parent |
|
907 | The string is resolved into real class, when the parent | |
908 | :class:`HasTraits` class is instantiated. |
|
908 | :class:`HasTraits` class is instantiated. | |
909 | klass : class, str, None |
|
909 | klass : class, str, None | |
910 | Values of this trait must be a subclass of klass. The klass |
|
910 | Values of this trait must be a subclass of klass. The klass | |
911 | may be specified in a string like: 'foo.bar.MyClass'. |
|
911 | may be specified in a string like: 'foo.bar.MyClass'. | |
912 | The string is resolved into real class, when the parent |
|
912 | The string is resolved into real class, when the parent | |
913 | :class:`HasTraits` class is instantiated. |
|
913 | :class:`HasTraits` class is instantiated. | |
914 | allow_none : bool [ default True ] |
|
914 | allow_none : bool [ default True ] | |
915 | Indicates whether None is allowed as an assignable value. Even if |
|
915 | Indicates whether None is allowed as an assignable value. Even if | |
916 | ``False``, the default value may be ``None``. |
|
916 | ``False``, the default value may be ``None``. | |
917 | """ |
|
917 | """ | |
918 | if default_value is None: |
|
918 | if default_value is None: | |
919 | if klass is None: |
|
919 | if klass is None: | |
920 | klass = object |
|
920 | klass = object | |
921 | elif klass is None: |
|
921 | elif klass is None: | |
922 | klass = default_value |
|
922 | klass = default_value | |
923 |
|
923 | |||
924 | if not (inspect.isclass(klass) or isinstance(klass, py3compat.string_types)): |
|
924 | if not (inspect.isclass(klass) or isinstance(klass, py3compat.string_types)): | |
925 | raise TraitError("A Type trait must specify a class.") |
|
925 | raise TraitError("A Type trait must specify a class.") | |
926 |
|
926 | |||
927 | self.klass = klass |
|
927 | self.klass = klass | |
928 |
|
928 | |||
929 | super(Type, self).__init__(default_value, allow_none=allow_none, **metadata) |
|
929 | super(Type, self).__init__(default_value, allow_none=allow_none, **metadata) | |
930 |
|
930 | |||
931 | def validate(self, obj, value): |
|
931 | def validate(self, obj, value): | |
932 | """Validates that the value is a valid object instance.""" |
|
932 | """Validates that the value is a valid object instance.""" | |
933 | if isinstance(value, py3compat.string_types): |
|
933 | if isinstance(value, py3compat.string_types): | |
934 | try: |
|
934 | try: | |
935 | value = self._resolve_string(value) |
|
935 | value = self._resolve_string(value) | |
936 | except ImportError: |
|
936 | except ImportError: | |
937 | raise TraitError("The '%s' trait of %s instance must be a type, but " |
|
937 | raise TraitError("The '%s' trait of %s instance must be a type, but " | |
938 | "%r could not be imported" % (self.name, obj, value)) |
|
938 | "%r could not be imported" % (self.name, obj, value)) | |
939 | try: |
|
939 | try: | |
940 | if issubclass(value, self.klass): |
|
940 | if issubclass(value, self.klass): | |
941 | return value |
|
941 | return value | |
942 | except: |
|
942 | except: | |
943 | pass |
|
943 | pass | |
944 |
|
944 | |||
945 | self.error(obj, value) |
|
945 | self.error(obj, value) | |
946 |
|
946 | |||
947 | def info(self): |
|
947 | def info(self): | |
948 | """ Returns a description of the trait.""" |
|
948 | """ Returns a description of the trait.""" | |
949 | if isinstance(self.klass, py3compat.string_types): |
|
949 | if isinstance(self.klass, py3compat.string_types): | |
950 | klass = self.klass |
|
950 | klass = self.klass | |
951 | else: |
|
951 | else: | |
952 | klass = self.klass.__name__ |
|
952 | klass = self.klass.__name__ | |
953 | result = 'a subclass of ' + klass |
|
953 | result = 'a subclass of ' + klass | |
954 | if self.allow_none: |
|
954 | if self.allow_none: | |
955 | return result + ' or None' |
|
955 | return result + ' or None' | |
956 | return result |
|
956 | return result | |
957 |
|
957 | |||
958 | def instance_init(self): |
|
958 | def instance_init(self): | |
959 | self._resolve_classes() |
|
959 | self._resolve_classes() | |
960 | super(Type, self).instance_init() |
|
960 | super(Type, self).instance_init() | |
961 |
|
961 | |||
962 | def _resolve_classes(self): |
|
962 | def _resolve_classes(self): | |
963 | if isinstance(self.klass, py3compat.string_types): |
|
963 | if isinstance(self.klass, py3compat.string_types): | |
964 | self.klass = self._resolve_string(self.klass) |
|
964 | self.klass = self._resolve_string(self.klass) | |
965 | if isinstance(self.default_value, py3compat.string_types): |
|
965 | if isinstance(self.default_value, py3compat.string_types): | |
966 | self.default_value = self._resolve_string(self.default_value) |
|
966 | self.default_value = self._resolve_string(self.default_value) | |
967 |
|
967 | |||
968 | def get_default_value(self): |
|
968 | def get_default_value(self): | |
969 | return self.default_value |
|
969 | return self.default_value | |
970 |
|
970 | |||
971 |
|
971 | |||
972 | class DefaultValueGenerator(object): |
|
972 | class DefaultValueGenerator(object): | |
973 | """A class for generating new default value instances.""" |
|
973 | """A class for generating new default value instances.""" | |
974 |
|
974 | |||
975 | def __init__(self, *args, **kw): |
|
975 | def __init__(self, *args, **kw): | |
976 | self.args = args |
|
976 | self.args = args | |
977 | self.kw = kw |
|
977 | self.kw = kw | |
978 |
|
978 | |||
979 | def generate(self, klass): |
|
979 | def generate(self, klass): | |
980 | return klass(*self.args, **self.kw) |
|
980 | return klass(*self.args, **self.kw) | |
981 |
|
981 | |||
982 |
|
982 | |||
983 | class Instance(ClassBasedTraitType): |
|
983 | class Instance(ClassBasedTraitType): | |
984 | """A trait whose value must be an instance of a specified class. |
|
984 | """A trait whose value must be an instance of a specified class. | |
985 |
|
985 | |||
986 | The value can also be an instance of a subclass of the specified class. |
|
986 | The value can also be an instance of a subclass of the specified class. | |
987 |
|
987 | |||
988 | Subclasses can declare default classes by overriding the klass attribute |
|
988 | Subclasses can declare default classes by overriding the klass attribute | |
989 | """ |
|
989 | """ | |
990 |
|
990 | |||
991 | klass = None |
|
991 | klass = None | |
992 |
|
992 | |||
993 | def __init__(self, klass=None, args=None, kw=None, allow_none=False, |
|
993 | def __init__(self, klass=None, args=None, kw=None, allow_none=False, | |
994 | **metadata ): |
|
994 | **metadata ): | |
995 | """Construct an Instance trait. |
|
995 | """Construct an Instance trait. | |
996 |
|
996 | |||
997 | This trait allows values that are instances of a particular |
|
997 | This trait allows values that are instances of a particular | |
998 | class or its subclasses. Our implementation is quite different |
|
998 | class or its subclasses. Our implementation is quite different | |
999 | from that of enthough.traits as we don't allow instances to be used |
|
999 | from that of enthough.traits as we don't allow instances to be used | |
1000 | for klass and we handle the ``args`` and ``kw`` arguments differently. |
|
1000 | for klass and we handle the ``args`` and ``kw`` arguments differently. | |
1001 |
|
1001 | |||
1002 | Parameters |
|
1002 | Parameters | |
1003 | ---------- |
|
1003 | ---------- | |
1004 | klass : class, str |
|
1004 | klass : class, str | |
1005 | The class that forms the basis for the trait. Class names |
|
1005 | The class that forms the basis for the trait. Class names | |
1006 | can also be specified as strings, like 'foo.bar.Bar'. |
|
1006 | can also be specified as strings, like 'foo.bar.Bar'. | |
1007 | args : tuple |
|
1007 | args : tuple | |
1008 | Positional arguments for generating the default value. |
|
1008 | Positional arguments for generating the default value. | |
1009 | kw : dict |
|
1009 | kw : dict | |
1010 | Keyword arguments for generating the default value. |
|
1010 | Keyword arguments for generating the default value. | |
1011 | allow_none : bool [default True] |
|
1011 | allow_none : bool [default True] | |
1012 | Indicates whether None is allowed as a value. |
|
1012 | Indicates whether None is allowed as a value. | |
1013 |
|
1013 | |||
1014 | Notes |
|
1014 | Notes | |
1015 | ----- |
|
1015 | ----- | |
1016 | If both ``args`` and ``kw`` are None, then the default value is None. |
|
1016 | If both ``args`` and ``kw`` are None, then the default value is None. | |
1017 | If ``args`` is a tuple and ``kw`` is a dict, then the default is |
|
1017 | If ``args`` is a tuple and ``kw`` is a dict, then the default is | |
1018 | created as ``klass(*args, **kw)``. If exactly one of ``args`` or ``kw`` is |
|
1018 | created as ``klass(*args, **kw)``. If exactly one of ``args`` or ``kw`` is | |
1019 | None, the None is replaced by ``()`` or ``{}``, respectively. |
|
1019 | None, the None is replaced by ``()`` or ``{}``, respectively. | |
1020 | """ |
|
1020 | """ | |
1021 | if klass is None: |
|
1021 | if klass is None: | |
1022 | klass = self.klass |
|
1022 | klass = self.klass | |
1023 |
|
1023 | |||
1024 | if (klass is not None) and (inspect.isclass(klass) or isinstance(klass, py3compat.string_types)): |
|
1024 | if (klass is not None) and (inspect.isclass(klass) or isinstance(klass, py3compat.string_types)): | |
1025 | self.klass = klass |
|
1025 | self.klass = klass | |
1026 | else: |
|
1026 | else: | |
1027 | raise TraitError('The klass attribute must be a class' |
|
1027 | raise TraitError('The klass attribute must be a class' | |
1028 | ' not: %r' % klass) |
|
1028 | ' not: %r' % klass) | |
1029 |
|
1029 | |||
1030 | # self.klass is a class, so handle default_value |
|
1030 | # self.klass is a class, so handle default_value | |
1031 | if args is None and kw is None: |
|
1031 | if args is None and kw is None: | |
1032 | default_value = None |
|
1032 | default_value = None | |
1033 | else: |
|
1033 | else: | |
1034 | if args is None: |
|
1034 | if args is None: | |
1035 | # kw is not None |
|
1035 | # kw is not None | |
1036 | args = () |
|
1036 | args = () | |
1037 | elif kw is None: |
|
1037 | elif kw is None: | |
1038 | # args is not None |
|
1038 | # args is not None | |
1039 | kw = {} |
|
1039 | kw = {} | |
1040 |
|
1040 | |||
1041 | if not isinstance(kw, dict): |
|
1041 | if not isinstance(kw, dict): | |
1042 | raise TraitError("The 'kw' argument must be a dict or None.") |
|
1042 | raise TraitError("The 'kw' argument must be a dict or None.") | |
1043 | if not isinstance(args, tuple): |
|
1043 | if not isinstance(args, tuple): | |
1044 | raise TraitError("The 'args' argument must be a tuple or None.") |
|
1044 | raise TraitError("The 'args' argument must be a tuple or None.") | |
1045 |
|
1045 | |||
1046 | default_value = DefaultValueGenerator(*args, **kw) |
|
1046 | default_value = DefaultValueGenerator(*args, **kw) | |
1047 |
|
1047 | |||
1048 | super(Instance, self).__init__(default_value, allow_none=allow_none, **metadata) |
|
1048 | super(Instance, self).__init__(default_value, allow_none=allow_none, **metadata) | |
1049 |
|
1049 | |||
1050 | def validate(self, obj, value): |
|
1050 | def validate(self, obj, value): | |
1051 | if isinstance(value, self.klass): |
|
1051 | if isinstance(value, self.klass): | |
1052 | return value |
|
1052 | return value | |
1053 | else: |
|
1053 | else: | |
1054 | self.error(obj, value) |
|
1054 | self.error(obj, value) | |
1055 |
|
1055 | |||
1056 | def info(self): |
|
1056 | def info(self): | |
1057 | if isinstance(self.klass, py3compat.string_types): |
|
1057 | if isinstance(self.klass, py3compat.string_types): | |
1058 | klass = self.klass |
|
1058 | klass = self.klass | |
1059 | else: |
|
1059 | else: | |
1060 | klass = self.klass.__name__ |
|
1060 | klass = self.klass.__name__ | |
1061 | result = class_of(klass) |
|
1061 | result = class_of(klass) | |
1062 | if self.allow_none: |
|
1062 | if self.allow_none: | |
1063 | return result + ' or None' |
|
1063 | return result + ' or None' | |
1064 |
|
1064 | |||
1065 | return result |
|
1065 | return result | |
1066 |
|
1066 | |||
1067 | def instance_init(self): |
|
1067 | def instance_init(self): | |
1068 | self._resolve_classes() |
|
1068 | self._resolve_classes() | |
1069 | super(Instance, self).instance_init() |
|
1069 | super(Instance, self).instance_init() | |
1070 |
|
1070 | |||
1071 | def _resolve_classes(self): |
|
1071 | def _resolve_classes(self): | |
1072 | if isinstance(self.klass, py3compat.string_types): |
|
1072 | if isinstance(self.klass, py3compat.string_types): | |
1073 | self.klass = self._resolve_string(self.klass) |
|
1073 | self.klass = self._resolve_string(self.klass) | |
1074 |
|
1074 | |||
1075 | def get_default_value(self): |
|
1075 | def get_default_value(self): | |
1076 | """Instantiate a default value instance. |
|
1076 | """Instantiate a default value instance. | |
1077 |
|
1077 | |||
1078 | This is called when the containing HasTraits classes' |
|
1078 | This is called when the containing HasTraits classes' | |
1079 | :meth:`__new__` method is called to ensure that a unique instance |
|
1079 | :meth:`__new__` method is called to ensure that a unique instance | |
1080 | is created for each HasTraits instance. |
|
1080 | is created for each HasTraits instance. | |
1081 | """ |
|
1081 | """ | |
1082 | dv = self.default_value |
|
1082 | dv = self.default_value | |
1083 | if isinstance(dv, DefaultValueGenerator): |
|
1083 | if isinstance(dv, DefaultValueGenerator): | |
1084 | return dv.generate(self.klass) |
|
1084 | return dv.generate(self.klass) | |
1085 | else: |
|
1085 | else: | |
1086 | return dv |
|
1086 | return dv | |
1087 |
|
1087 | |||
1088 |
|
1088 | |||
1089 | class ForwardDeclaredMixin(object): |
|
1089 | class ForwardDeclaredMixin(object): | |
1090 | """ |
|
1090 | """ | |
1091 | Mixin for forward-declared versions of Instance and Type. |
|
1091 | Mixin for forward-declared versions of Instance and Type. | |
1092 | """ |
|
1092 | """ | |
1093 | def _resolve_string(self, string): |
|
1093 | def _resolve_string(self, string): | |
1094 | """ |
|
1094 | """ | |
1095 | Find the specified class name by looking for it in the module in which |
|
1095 | Find the specified class name by looking for it in the module in which | |
1096 | our this_class attribute was defined. |
|
1096 | our this_class attribute was defined. | |
1097 | """ |
|
1097 | """ | |
1098 | modname = self.this_class.__module__ |
|
1098 | modname = self.this_class.__module__ | |
1099 | return import_item('.'.join([modname, string])) |
|
1099 | return import_item('.'.join([modname, string])) | |
1100 |
|
1100 | |||
1101 |
|
1101 | |||
1102 | class ForwardDeclaredType(ForwardDeclaredMixin, Type): |
|
1102 | class ForwardDeclaredType(ForwardDeclaredMixin, Type): | |
1103 | """ |
|
1103 | """ | |
1104 | Forward-declared version of Type. |
|
1104 | Forward-declared version of Type. | |
1105 | """ |
|
1105 | """ | |
1106 | pass |
|
1106 | pass | |
1107 |
|
1107 | |||
1108 |
|
1108 | |||
1109 | class ForwardDeclaredInstance(ForwardDeclaredMixin, Instance): |
|
1109 | class ForwardDeclaredInstance(ForwardDeclaredMixin, Instance): | |
1110 | """ |
|
1110 | """ | |
1111 | Forward-declared version of Instance. |
|
1111 | Forward-declared version of Instance. | |
1112 | """ |
|
1112 | """ | |
1113 | pass |
|
1113 | pass | |
1114 |
|
1114 | |||
1115 |
|
1115 | |||
1116 | class This(ClassBasedTraitType): |
|
1116 | class This(ClassBasedTraitType): | |
1117 | """A trait for instances of the class containing this trait. |
|
1117 | """A trait for instances of the class containing this trait. | |
1118 |
|
1118 | |||
1119 | Because how how and when class bodies are executed, the ``This`` |
|
1119 | Because how how and when class bodies are executed, the ``This`` | |
1120 | trait can only have a default value of None. This, and because we |
|
1120 | trait can only have a default value of None. This, and because we | |
1121 | always validate default values, ``allow_none`` is *always* true. |
|
1121 | always validate default values, ``allow_none`` is *always* true. | |
1122 | """ |
|
1122 | """ | |
1123 |
|
1123 | |||
1124 | info_text = 'an instance of the same type as the receiver or None' |
|
1124 | info_text = 'an instance of the same type as the receiver or None' | |
1125 |
|
1125 | |||
1126 | def __init__(self, **metadata): |
|
1126 | def __init__(self, **metadata): | |
1127 | super(This, self).__init__(None, **metadata) |
|
1127 | super(This, self).__init__(None, **metadata) | |
1128 |
|
1128 | |||
1129 | def validate(self, obj, value): |
|
1129 | def validate(self, obj, value): | |
1130 | # What if value is a superclass of obj.__class__? This is |
|
1130 | # What if value is a superclass of obj.__class__? This is | |
1131 | # complicated if it was the superclass that defined the This |
|
1131 | # complicated if it was the superclass that defined the This | |
1132 | # trait. |
|
1132 | # trait. | |
1133 | if isinstance(value, self.this_class) or (value is None): |
|
1133 | if isinstance(value, self.this_class) or (value is None): | |
1134 | return value |
|
1134 | return value | |
1135 | else: |
|
1135 | else: | |
1136 | self.error(obj, value) |
|
1136 | self.error(obj, value) | |
1137 |
|
1137 | |||
1138 |
|
1138 | |||
1139 | class Union(TraitType): |
|
1139 | class Union(TraitType): | |
1140 | """A trait type representing a Union type.""" |
|
1140 | """A trait type representing a Union type.""" | |
1141 |
|
1141 | |||
1142 | def __init__(self, trait_types, **metadata): |
|
1142 | def __init__(self, trait_types, **metadata): | |
1143 | """Construct a Union trait. |
|
1143 | """Construct a Union trait. | |
1144 |
|
1144 | |||
1145 | This trait allows values that are allowed by at least one of the |
|
1145 | This trait allows values that are allowed by at least one of the | |
1146 | specified trait types. A Union traitlet cannot have metadata on |
|
1146 | specified trait types. A Union traitlet cannot have metadata on | |
1147 | its own, besides the metadata of the listed types. |
|
1147 | its own, besides the metadata of the listed types. | |
1148 |
|
1148 | |||
1149 | Parameters |
|
1149 | Parameters | |
1150 | ---------- |
|
1150 | ---------- | |
1151 | trait_types: sequence |
|
1151 | trait_types: sequence | |
1152 | The list of trait types of length at least 1. |
|
1152 | The list of trait types of length at least 1. | |
1153 |
|
1153 | |||
1154 | Notes |
|
1154 | Notes | |
1155 | ----- |
|
1155 | ----- | |
1156 | Union([Float(), Bool(), Int()]) attempts to validate the provided values |
|
1156 | Union([Float(), Bool(), Int()]) attempts to validate the provided values | |
1157 | with the validation function of Float, then Bool, and finally Int. |
|
1157 | with the validation function of Float, then Bool, and finally Int. | |
1158 | """ |
|
1158 | """ | |
1159 | self.trait_types = trait_types |
|
1159 | self.trait_types = trait_types | |
1160 | self.info_text = " or ".join([tt.info_text for tt in self.trait_types]) |
|
1160 | self.info_text = " or ".join([tt.info_text for tt in self.trait_types]) | |
1161 | self.default_value = self.trait_types[0].get_default_value() |
|
1161 | self.default_value = self.trait_types[0].get_default_value() | |
1162 | super(Union, self).__init__(**metadata) |
|
1162 | super(Union, self).__init__(**metadata) | |
1163 |
|
1163 | |||
1164 | def instance_init(self): |
|
1164 | def instance_init(self): | |
1165 | for trait_type in self.trait_types: |
|
1165 | for trait_type in self.trait_types: | |
1166 | trait_type.name = self.name |
|
1166 | trait_type.name = self.name | |
1167 | trait_type.this_class = self.this_class |
|
1167 | trait_type.this_class = self.this_class | |
1168 | trait_type.instance_init() |
|
1168 | trait_type.instance_init() | |
1169 | super(Union, self).instance_init() |
|
1169 | super(Union, self).instance_init() | |
1170 |
|
1170 | |||
1171 | def validate(self, obj, value): |
|
1171 | def validate(self, obj, value): | |
1172 | for trait_type in self.trait_types: |
|
1172 | for trait_type in self.trait_types: | |
1173 | try: |
|
1173 | try: | |
1174 | v = trait_type._validate(obj, value) |
|
1174 | v = trait_type._validate(obj, value) | |
1175 | self._metadata = trait_type._metadata |
|
1175 | self._metadata = trait_type._metadata | |
1176 | return v |
|
1176 | return v | |
1177 | except TraitError: |
|
1177 | except TraitError: | |
1178 | continue |
|
1178 | continue | |
1179 | self.error(obj, value) |
|
1179 | self.error(obj, value) | |
1180 |
|
1180 | |||
1181 | def __or__(self, other): |
|
1181 | def __or__(self, other): | |
1182 | if isinstance(other, Union): |
|
1182 | if isinstance(other, Union): | |
1183 | return Union(self.trait_types + other.trait_types) |
|
1183 | return Union(self.trait_types + other.trait_types) | |
1184 | else: |
|
1184 | else: | |
1185 | return Union(self.trait_types + [other]) |
|
1185 | return Union(self.trait_types + [other]) | |
1186 |
|
1186 | |||
1187 | #----------------------------------------------------------------------------- |
|
1187 | #----------------------------------------------------------------------------- | |
1188 | # Basic TraitTypes implementations/subclasses |
|
1188 | # Basic TraitTypes implementations/subclasses | |
1189 | #----------------------------------------------------------------------------- |
|
1189 | #----------------------------------------------------------------------------- | |
1190 |
|
1190 | |||
1191 |
|
1191 | |||
1192 | class Any(TraitType): |
|
1192 | class Any(TraitType): | |
1193 | default_value = None |
|
1193 | default_value = None | |
1194 | info_text = 'any value' |
|
1194 | info_text = 'any value' | |
1195 |
|
1195 | |||
1196 |
|
1196 | |||
1197 | class Int(TraitType): |
|
1197 | class Int(TraitType): | |
1198 | """An int trait.""" |
|
1198 | """An int trait.""" | |
1199 |
|
1199 | |||
1200 | default_value = 0 |
|
1200 | default_value = 0 | |
1201 | info_text = 'an int' |
|
1201 | info_text = 'an int' | |
1202 |
|
1202 | |||
1203 | def validate(self, obj, value): |
|
1203 | def validate(self, obj, value): | |
1204 | if isinstance(value, int): |
|
1204 | if isinstance(value, int): | |
1205 | return value |
|
1205 | return value | |
1206 | self.error(obj, value) |
|
1206 | self.error(obj, value) | |
1207 |
|
1207 | |||
1208 | class CInt(Int): |
|
1208 | class CInt(Int): | |
1209 | """A casting version of the int trait.""" |
|
1209 | """A casting version of the int trait.""" | |
1210 |
|
1210 | |||
1211 | def validate(self, obj, value): |
|
1211 | def validate(self, obj, value): | |
1212 | try: |
|
1212 | try: | |
1213 | return int(value) |
|
1213 | return int(value) | |
1214 | except: |
|
1214 | except: | |
1215 | self.error(obj, value) |
|
1215 | self.error(obj, value) | |
1216 |
|
1216 | |||
1217 | if py3compat.PY3: |
|
1217 | if py3compat.PY3: | |
1218 | Long, CLong = Int, CInt |
|
1218 | Long, CLong = Int, CInt | |
1219 | Integer = Int |
|
1219 | Integer = Int | |
1220 | else: |
|
1220 | else: | |
1221 | class Long(TraitType): |
|
1221 | class Long(TraitType): | |
1222 | """A long integer trait.""" |
|
1222 | """A long integer trait.""" | |
1223 |
|
1223 | |||
1224 | default_value = 0 |
|
1224 | default_value = 0 | |
1225 | info_text = 'a long' |
|
1225 | info_text = 'a long' | |
1226 |
|
1226 | |||
1227 | def validate(self, obj, value): |
|
1227 | def validate(self, obj, value): | |
1228 | if isinstance(value, long): |
|
1228 | if isinstance(value, long): | |
1229 | return value |
|
1229 | return value | |
1230 | if isinstance(value, int): |
|
1230 | if isinstance(value, int): | |
1231 | return long(value) |
|
1231 | return long(value) | |
1232 | self.error(obj, value) |
|
1232 | self.error(obj, value) | |
1233 |
|
1233 | |||
1234 |
|
1234 | |||
1235 | class CLong(Long): |
|
1235 | class CLong(Long): | |
1236 | """A casting version of the long integer trait.""" |
|
1236 | """A casting version of the long integer trait.""" | |
1237 |
|
1237 | |||
1238 | def validate(self, obj, value): |
|
1238 | def validate(self, obj, value): | |
1239 | try: |
|
1239 | try: | |
1240 | return long(value) |
|
1240 | return long(value) | |
1241 | except: |
|
1241 | except: | |
1242 | self.error(obj, value) |
|
1242 | self.error(obj, value) | |
1243 |
|
1243 | |||
1244 | class Integer(TraitType): |
|
1244 | class Integer(TraitType): | |
1245 | """An integer trait. |
|
1245 | """An integer trait. | |
1246 |
|
1246 | |||
1247 | Longs that are unnecessary (<= sys.maxint) are cast to ints.""" |
|
1247 | Longs that are unnecessary (<= sys.maxint) are cast to ints.""" | |
1248 |
|
1248 | |||
1249 | default_value = 0 |
|
1249 | default_value = 0 | |
1250 | info_text = 'an integer' |
|
1250 | info_text = 'an integer' | |
1251 |
|
1251 | |||
1252 | def validate(self, obj, value): |
|
1252 | def validate(self, obj, value): | |
1253 | if isinstance(value, int): |
|
1253 | if isinstance(value, int): | |
1254 | return value |
|
1254 | return value | |
1255 | if isinstance(value, long): |
|
1255 | if isinstance(value, long): | |
1256 | # downcast longs that fit in int: |
|
1256 | # downcast longs that fit in int: | |
1257 | # note that int(n > sys.maxint) returns a long, so |
|
1257 | # note that int(n > sys.maxint) returns a long, so | |
1258 | # we don't need a condition on this cast |
|
1258 | # we don't need a condition on this cast | |
1259 | return int(value) |
|
1259 | return int(value) | |
1260 | if sys.platform == "cli": |
|
1260 | if sys.platform == "cli": | |
1261 | from System import Int64 |
|
1261 | from System import Int64 | |
1262 | if isinstance(value, Int64): |
|
1262 | if isinstance(value, Int64): | |
1263 | return int(value) |
|
1263 | return int(value) | |
1264 | self.error(obj, value) |
|
1264 | self.error(obj, value) | |
1265 |
|
1265 | |||
1266 |
|
1266 | |||
1267 | class Float(TraitType): |
|
1267 | class Float(TraitType): | |
1268 | """A float trait.""" |
|
1268 | """A float trait.""" | |
1269 |
|
1269 | |||
1270 | default_value = 0.0 |
|
1270 | default_value = 0.0 | |
1271 | info_text = 'a float' |
|
1271 | info_text = 'a float' | |
1272 |
|
1272 | |||
1273 | def validate(self, obj, value): |
|
1273 | def validate(self, obj, value): | |
1274 | if isinstance(value, float): |
|
1274 | if isinstance(value, float): | |
1275 | return value |
|
1275 | return value | |
1276 | if isinstance(value, int): |
|
1276 | if isinstance(value, int): | |
1277 | return float(value) |
|
1277 | return float(value) | |
1278 | self.error(obj, value) |
|
1278 | self.error(obj, value) | |
1279 |
|
1279 | |||
1280 |
|
1280 | |||
1281 | class CFloat(Float): |
|
1281 | class CFloat(Float): | |
1282 | """A casting version of the float trait.""" |
|
1282 | """A casting version of the float trait.""" | |
1283 |
|
1283 | |||
1284 | def validate(self, obj, value): |
|
1284 | def validate(self, obj, value): | |
1285 | try: |
|
1285 | try: | |
1286 | return float(value) |
|
1286 | return float(value) | |
1287 | except: |
|
1287 | except: | |
1288 | self.error(obj, value) |
|
1288 | self.error(obj, value) | |
1289 |
|
1289 | |||
1290 | class Complex(TraitType): |
|
1290 | class Complex(TraitType): | |
1291 | """A trait for complex numbers.""" |
|
1291 | """A trait for complex numbers.""" | |
1292 |
|
1292 | |||
1293 | default_value = 0.0 + 0.0j |
|
1293 | default_value = 0.0 + 0.0j | |
1294 | info_text = 'a complex number' |
|
1294 | info_text = 'a complex number' | |
1295 |
|
1295 | |||
1296 | def validate(self, obj, value): |
|
1296 | def validate(self, obj, value): | |
1297 | if isinstance(value, complex): |
|
1297 | if isinstance(value, complex): | |
1298 | return value |
|
1298 | return value | |
1299 | if isinstance(value, (float, int)): |
|
1299 | if isinstance(value, (float, int)): | |
1300 | return complex(value) |
|
1300 | return complex(value) | |
1301 | self.error(obj, value) |
|
1301 | self.error(obj, value) | |
1302 |
|
1302 | |||
1303 |
|
1303 | |||
1304 | class CComplex(Complex): |
|
1304 | class CComplex(Complex): | |
1305 | """A casting version of the complex number trait.""" |
|
1305 | """A casting version of the complex number trait.""" | |
1306 |
|
1306 | |||
1307 | def validate (self, obj, value): |
|
1307 | def validate (self, obj, value): | |
1308 | try: |
|
1308 | try: | |
1309 | return complex(value) |
|
1309 | return complex(value) | |
1310 | except: |
|
1310 | except: | |
1311 | self.error(obj, value) |
|
1311 | self.error(obj, value) | |
1312 |
|
1312 | |||
1313 | # We should always be explicit about whether we're using bytes or unicode, both |
|
1313 | # We should always be explicit about whether we're using bytes or unicode, both | |
1314 | # for Python 3 conversion and for reliable unicode behaviour on Python 2. So |
|
1314 | # for Python 3 conversion and for reliable unicode behaviour on Python 2. So | |
1315 | # we don't have a Str type. |
|
1315 | # we don't have a Str type. | |
1316 | class Bytes(TraitType): |
|
1316 | class Bytes(TraitType): | |
1317 | """A trait for byte strings.""" |
|
1317 | """A trait for byte strings.""" | |
1318 |
|
1318 | |||
1319 | default_value = b'' |
|
1319 | default_value = b'' | |
1320 | info_text = 'a bytes object' |
|
1320 | info_text = 'a bytes object' | |
1321 |
|
1321 | |||
1322 | def validate(self, obj, value): |
|
1322 | def validate(self, obj, value): | |
1323 | if isinstance(value, bytes): |
|
1323 | if isinstance(value, bytes): | |
1324 | return value |
|
1324 | return value | |
1325 | self.error(obj, value) |
|
1325 | self.error(obj, value) | |
1326 |
|
1326 | |||
1327 |
|
1327 | |||
1328 | class CBytes(Bytes): |
|
1328 | class CBytes(Bytes): | |
1329 | """A casting version of the byte string trait.""" |
|
1329 | """A casting version of the byte string trait.""" | |
1330 |
|
1330 | |||
1331 | def validate(self, obj, value): |
|
1331 | def validate(self, obj, value): | |
1332 | try: |
|
1332 | try: | |
1333 | return bytes(value) |
|
1333 | return bytes(value) | |
1334 | except: |
|
1334 | except: | |
1335 | self.error(obj, value) |
|
1335 | self.error(obj, value) | |
1336 |
|
1336 | |||
1337 |
|
1337 | |||
1338 | class Unicode(TraitType): |
|
1338 | class Unicode(TraitType): | |
1339 | """A trait for unicode strings.""" |
|
1339 | """A trait for unicode strings.""" | |
1340 |
|
1340 | |||
1341 | default_value = u'' |
|
1341 | default_value = u'' | |
1342 | info_text = 'a unicode string' |
|
1342 | info_text = 'a unicode string' | |
1343 |
|
1343 | |||
1344 | def validate(self, obj, value): |
|
1344 | def validate(self, obj, value): | |
1345 | if isinstance(value, py3compat.unicode_type): |
|
1345 | if isinstance(value, py3compat.unicode_type): | |
1346 | return value |
|
1346 | return value | |
1347 | if isinstance(value, bytes): |
|
1347 | if isinstance(value, bytes): | |
1348 | try: |
|
1348 | try: | |
1349 | return value.decode('ascii', 'strict') |
|
1349 | return value.decode('ascii', 'strict') | |
1350 | except UnicodeDecodeError: |
|
1350 | except UnicodeDecodeError: | |
1351 | msg = "Could not decode {!r} for unicode trait '{}' of {} instance." |
|
1351 | msg = "Could not decode {!r} for unicode trait '{}' of {} instance." | |
1352 | raise TraitError(msg.format(value, self.name, class_of(obj))) |
|
1352 | raise TraitError(msg.format(value, self.name, class_of(obj))) | |
1353 | self.error(obj, value) |
|
1353 | self.error(obj, value) | |
1354 |
|
1354 | |||
1355 |
|
1355 | |||
1356 | class CUnicode(Unicode): |
|
1356 | class CUnicode(Unicode): | |
1357 | """A casting version of the unicode trait.""" |
|
1357 | """A casting version of the unicode trait.""" | |
1358 |
|
1358 | |||
1359 | def validate(self, obj, value): |
|
1359 | def validate(self, obj, value): | |
1360 | try: |
|
1360 | try: | |
1361 | return py3compat.unicode_type(value) |
|
1361 | return py3compat.unicode_type(value) | |
1362 | except: |
|
1362 | except: | |
1363 | self.error(obj, value) |
|
1363 | self.error(obj, value) | |
1364 |
|
1364 | |||
1365 |
|
1365 | |||
1366 | class ObjectName(TraitType): |
|
1366 | class ObjectName(TraitType): | |
1367 | """A string holding a valid object name in this version of Python. |
|
1367 | """A string holding a valid object name in this version of Python. | |
1368 |
|
1368 | |||
1369 | This does not check that the name exists in any scope.""" |
|
1369 | This does not check that the name exists in any scope.""" | |
1370 | info_text = "a valid object identifier in Python" |
|
1370 | info_text = "a valid object identifier in Python" | |
1371 |
|
1371 | |||
1372 | if py3compat.PY3: |
|
1372 | if py3compat.PY3: | |
1373 | # Python 3: |
|
1373 | # Python 3: | |
1374 | coerce_str = staticmethod(lambda _,s: s) |
|
1374 | coerce_str = staticmethod(lambda _,s: s) | |
1375 |
|
1375 | |||
1376 | else: |
|
1376 | else: | |
1377 | # Python 2: |
|
1377 | # Python 2: | |
1378 | def coerce_str(self, obj, value): |
|
1378 | def coerce_str(self, obj, value): | |
1379 | "In Python 2, coerce ascii-only unicode to str" |
|
1379 | "In Python 2, coerce ascii-only unicode to str" | |
1380 | if isinstance(value, unicode): |
|
1380 | if isinstance(value, unicode): | |
1381 | try: |
|
1381 | try: | |
1382 | return str(value) |
|
1382 | return str(value) | |
1383 | except UnicodeEncodeError: |
|
1383 | except UnicodeEncodeError: | |
1384 | self.error(obj, value) |
|
1384 | self.error(obj, value) | |
1385 | return value |
|
1385 | return value | |
1386 |
|
1386 | |||
1387 | def validate(self, obj, value): |
|
1387 | def validate(self, obj, value): | |
1388 | value = self.coerce_str(obj, value) |
|
1388 | value = self.coerce_str(obj, value) | |
1389 |
|
1389 | |||
1390 | if isinstance(value, string_types) and py3compat.isidentifier(value): |
|
1390 | if isinstance(value, string_types) and py3compat.isidentifier(value): | |
1391 | return value |
|
1391 | return value | |
1392 | self.error(obj, value) |
|
1392 | self.error(obj, value) | |
1393 |
|
1393 | |||
1394 | class DottedObjectName(ObjectName): |
|
1394 | class DottedObjectName(ObjectName): | |
1395 | """A string holding a valid dotted object name in Python, such as A.b3._c""" |
|
1395 | """A string holding a valid dotted object name in Python, such as A.b3._c""" | |
1396 | def validate(self, obj, value): |
|
1396 | def validate(self, obj, value): | |
1397 | value = self.coerce_str(obj, value) |
|
1397 | value = self.coerce_str(obj, value) | |
1398 |
|
1398 | |||
1399 | if isinstance(value, string_types) and py3compat.isidentifier(value, dotted=True): |
|
1399 | if isinstance(value, string_types) and py3compat.isidentifier(value, dotted=True): | |
1400 | return value |
|
1400 | return value | |
1401 | self.error(obj, value) |
|
1401 | self.error(obj, value) | |
1402 |
|
1402 | |||
1403 |
|
1403 | |||
1404 | class Bool(TraitType): |
|
1404 | class Bool(TraitType): | |
1405 | """A boolean (True, False) trait.""" |
|
1405 | """A boolean (True, False) trait.""" | |
1406 |
|
1406 | |||
1407 | default_value = False |
|
1407 | default_value = False | |
1408 | info_text = 'a boolean' |
|
1408 | info_text = 'a boolean' | |
1409 |
|
1409 | |||
1410 | def validate(self, obj, value): |
|
1410 | def validate(self, obj, value): | |
1411 | if isinstance(value, bool): |
|
1411 | if isinstance(value, bool): | |
1412 | return value |
|
1412 | return value | |
1413 | self.error(obj, value) |
|
1413 | self.error(obj, value) | |
1414 |
|
1414 | |||
1415 |
|
1415 | |||
1416 | class CBool(Bool): |
|
1416 | class CBool(Bool): | |
1417 | """A casting version of the boolean trait.""" |
|
1417 | """A casting version of the boolean trait.""" | |
1418 |
|
1418 | |||
1419 | def validate(self, obj, value): |
|
1419 | def validate(self, obj, value): | |
1420 | try: |
|
1420 | try: | |
1421 | return bool(value) |
|
1421 | return bool(value) | |
1422 | except: |
|
1422 | except: | |
1423 | self.error(obj, value) |
|
1423 | self.error(obj, value) | |
1424 |
|
1424 | |||
1425 |
|
1425 | |||
1426 | class Enum(TraitType): |
|
1426 | class Enum(TraitType): | |
1427 | """An enum that whose value must be in a given sequence.""" |
|
1427 | """An enum that whose value must be in a given sequence.""" | |
1428 |
|
1428 | |||
1429 | def __init__(self, values, default_value=None, **metadata): |
|
1429 | def __init__(self, values, default_value=None, **metadata): | |
1430 | self.values = values |
|
1430 | self.values = values | |
1431 | super(Enum, self).__init__(default_value, **metadata) |
|
1431 | super(Enum, self).__init__(default_value, **metadata) | |
1432 |
|
1432 | |||
1433 | def validate(self, obj, value): |
|
1433 | def validate(self, obj, value): | |
1434 | if value in self.values: |
|
1434 | if value in self.values: | |
1435 | return value |
|
1435 | return value | |
1436 | self.error(obj, value) |
|
1436 | self.error(obj, value) | |
1437 |
|
1437 | |||
1438 | def info(self): |
|
1438 | def info(self): | |
1439 | """ Returns a description of the trait.""" |
|
1439 | """ Returns a description of the trait.""" | |
1440 | result = 'any of ' + repr(self.values) |
|
1440 | result = 'any of ' + repr(self.values) | |
1441 | if self.allow_none: |
|
1441 | if self.allow_none: | |
1442 | return result + ' or None' |
|
1442 | return result + ' or None' | |
1443 | return result |
|
1443 | return result | |
1444 |
|
1444 | |||
1445 | class CaselessStrEnum(Enum): |
|
1445 | class CaselessStrEnum(Enum): | |
1446 | """An enum of strings that are caseless in validate.""" |
|
1446 | """An enum of strings that are caseless in validate.""" | |
1447 |
|
1447 | |||
1448 | def validate(self, obj, value): |
|
1448 | def validate(self, obj, value): | |
1449 | if not isinstance(value, py3compat.string_types): |
|
1449 | if not isinstance(value, py3compat.string_types): | |
1450 | self.error(obj, value) |
|
1450 | self.error(obj, value) | |
1451 |
|
1451 | |||
1452 | for v in self.values: |
|
1452 | for v in self.values: | |
1453 | if v.lower() == value.lower(): |
|
1453 | if v.lower() == value.lower(): | |
1454 | return v |
|
1454 | return v | |
1455 | self.error(obj, value) |
|
1455 | self.error(obj, value) | |
1456 |
|
1456 | |||
1457 | class Container(Instance): |
|
1457 | class Container(Instance): | |
1458 | """An instance of a container (list, set, etc.) |
|
1458 | """An instance of a container (list, set, etc.) | |
1459 |
|
1459 | |||
1460 | To be subclassed by overriding klass. |
|
1460 | To be subclassed by overriding klass. | |
1461 | """ |
|
1461 | """ | |
1462 | klass = None |
|
1462 | klass = None | |
1463 | _cast_types = () |
|
1463 | _cast_types = () | |
1464 | _valid_defaults = SequenceTypes |
|
1464 | _valid_defaults = SequenceTypes | |
1465 | _trait = None |
|
1465 | _trait = None | |
1466 |
|
1466 | |||
1467 | def __init__(self, trait=None, default_value=None, allow_none=False, |
|
1467 | def __init__(self, trait=None, default_value=None, allow_none=False, | |
1468 | **metadata): |
|
1468 | **metadata): | |
1469 | """Create a container trait type from a list, set, or tuple. |
|
1469 | """Create a container trait type from a list, set, or tuple. | |
1470 |
|
1470 | |||
1471 | The default value is created by doing ``List(default_value)``, |
|
1471 | The default value is created by doing ``List(default_value)``, | |
1472 | which creates a copy of the ``default_value``. |
|
1472 | which creates a copy of the ``default_value``. | |
1473 |
|
1473 | |||
1474 | ``trait`` can be specified, which restricts the type of elements |
|
1474 | ``trait`` can be specified, which restricts the type of elements | |
1475 | in the container to that TraitType. |
|
1475 | in the container to that TraitType. | |
1476 |
|
1476 | |||
1477 | If only one arg is given and it is not a Trait, it is taken as |
|
1477 | If only one arg is given and it is not a Trait, it is taken as | |
1478 | ``default_value``: |
|
1478 | ``default_value``: | |
1479 |
|
1479 | |||
1480 | ``c = List([1,2,3])`` |
|
1480 | ``c = List([1,2,3])`` | |
1481 |
|
1481 | |||
1482 | Parameters |
|
1482 | Parameters | |
1483 | ---------- |
|
1483 | ---------- | |
1484 |
|
1484 | |||
1485 | trait : TraitType [ optional ] |
|
1485 | trait : TraitType [ optional ] | |
1486 | the type for restricting the contents of the Container. If unspecified, |
|
1486 | the type for restricting the contents of the Container. If unspecified, | |
1487 | types are not checked. |
|
1487 | types are not checked. | |
1488 |
|
1488 | |||
1489 | default_value : SequenceType [ optional ] |
|
1489 | default_value : SequenceType [ optional ] | |
1490 | The default value for the Trait. Must be list/tuple/set, and |
|
1490 | The default value for the Trait. Must be list/tuple/set, and | |
1491 | will be cast to the container type. |
|
1491 | will be cast to the container type. | |
1492 |
|
1492 | |||
1493 | allow_none : bool [ default False ] |
|
1493 | allow_none : bool [ default False ] | |
1494 | Whether to allow the value to be None |
|
1494 | Whether to allow the value to be None | |
1495 |
|
1495 | |||
1496 | **metadata : any |
|
1496 | **metadata : any | |
1497 | further keys for extensions to the Trait (e.g. config) |
|
1497 | further keys for extensions to the Trait (e.g. config) | |
1498 |
|
1498 | |||
1499 | """ |
|
1499 | """ | |
1500 | # allow List([values]): |
|
1500 | # allow List([values]): | |
1501 | if default_value is None and not is_trait(trait): |
|
1501 | if default_value is None and not is_trait(trait): | |
1502 | default_value = trait |
|
1502 | default_value = trait | |
1503 | trait = None |
|
1503 | trait = None | |
1504 |
|
1504 | |||
1505 | if default_value is None: |
|
1505 | if default_value is None: | |
1506 | args = () |
|
1506 | args = () | |
1507 | elif isinstance(default_value, self._valid_defaults): |
|
1507 | elif isinstance(default_value, self._valid_defaults): | |
1508 | args = (default_value,) |
|
1508 | args = (default_value,) | |
1509 | else: |
|
1509 | else: | |
1510 | raise TypeError('default value of %s was %s' %(self.__class__.__name__, default_value)) |
|
1510 | raise TypeError('default value of %s was %s' %(self.__class__.__name__, default_value)) | |
1511 |
|
1511 | |||
1512 | if is_trait(trait): |
|
1512 | if is_trait(trait): | |
1513 | self._trait = trait() if isinstance(trait, type) else trait |
|
1513 | self._trait = trait() if isinstance(trait, type) else trait | |
1514 | self._trait.name = 'element' |
|
1514 | self._trait.name = 'element' | |
1515 | elif trait is not None: |
|
1515 | elif trait is not None: | |
1516 | raise TypeError("`trait` must be a Trait or None, got %s"%repr_type(trait)) |
|
1516 | raise TypeError("`trait` must be a Trait or None, got %s"%repr_type(trait)) | |
1517 |
|
1517 | |||
1518 | super(Container,self).__init__(klass=self.klass, args=args, |
|
1518 | super(Container,self).__init__(klass=self.klass, args=args, | |
1519 | allow_none=allow_none, **metadata) |
|
1519 | allow_none=allow_none, **metadata) | |
1520 |
|
1520 | |||
1521 | def element_error(self, obj, element, validator): |
|
1521 | def element_error(self, obj, element, validator): | |
1522 | e = "Element of the '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
1522 | e = "Element of the '%s' trait of %s instance must be %s, but a value of %s was specified." \ | |
1523 | % (self.name, class_of(obj), validator.info(), repr_type(element)) |
|
1523 | % (self.name, class_of(obj), validator.info(), repr_type(element)) | |
1524 | raise TraitError(e) |
|
1524 | raise TraitError(e) | |
1525 |
|
1525 | |||
1526 | def validate(self, obj, value): |
|
1526 | def validate(self, obj, value): | |
1527 | if isinstance(value, self._cast_types): |
|
1527 | if isinstance(value, self._cast_types): | |
1528 | value = self.klass(value) |
|
1528 | value = self.klass(value) | |
1529 | value = super(Container, self).validate(obj, value) |
|
1529 | value = super(Container, self).validate(obj, value) | |
1530 | if value is None: |
|
1530 | if value is None: | |
1531 | return value |
|
1531 | return value | |
1532 |
|
1532 | |||
1533 | value = self.validate_elements(obj, value) |
|
1533 | value = self.validate_elements(obj, value) | |
1534 |
|
1534 | |||
1535 | return value |
|
1535 | return value | |
1536 |
|
1536 | |||
1537 | def validate_elements(self, obj, value): |
|
1537 | def validate_elements(self, obj, value): | |
1538 | validated = [] |
|
1538 | validated = [] | |
1539 | if self._trait is None or isinstance(self._trait, Any): |
|
1539 | if self._trait is None or isinstance(self._trait, Any): | |
1540 | return value |
|
1540 | return value | |
1541 | for v in value: |
|
1541 | for v in value: | |
1542 | try: |
|
1542 | try: | |
1543 | v = self._trait._validate(obj, v) |
|
1543 | v = self._trait._validate(obj, v) | |
1544 | except TraitError: |
|
1544 | except TraitError: | |
1545 | self.element_error(obj, v, self._trait) |
|
1545 | self.element_error(obj, v, self._trait) | |
1546 | else: |
|
1546 | else: | |
1547 | validated.append(v) |
|
1547 | validated.append(v) | |
1548 | return self.klass(validated) |
|
1548 | return self.klass(validated) | |
1549 |
|
1549 | |||
1550 | def instance_init(self): |
|
1550 | def instance_init(self): | |
1551 | if isinstance(self._trait, TraitType): |
|
1551 | if isinstance(self._trait, TraitType): | |
1552 | self._trait.this_class = self.this_class |
|
1552 | self._trait.this_class = self.this_class | |
1553 | self._trait.instance_init() |
|
1553 | self._trait.instance_init() | |
1554 | super(Container, self).instance_init() |
|
1554 | super(Container, self).instance_init() | |
1555 |
|
1555 | |||
1556 |
|
1556 | |||
1557 | class List(Container): |
|
1557 | class List(Container): | |
1558 | """An instance of a Python list.""" |
|
1558 | """An instance of a Python list.""" | |
1559 | klass = list |
|
1559 | klass = list | |
1560 | _cast_types = (tuple,) |
|
1560 | _cast_types = (tuple,) | |
1561 |
|
1561 | |||
1562 | def __init__(self, trait=None, default_value=None, minlen=0, maxlen=sys.maxsize, **metadata): |
|
1562 | def __init__(self, trait=None, default_value=None, minlen=0, maxlen=sys.maxsize, **metadata): | |
1563 | """Create a List trait type from a list, set, or tuple. |
|
1563 | """Create a List trait type from a list, set, or tuple. | |
1564 |
|
1564 | |||
1565 | The default value is created by doing ``List(default_value)``, |
|
1565 | The default value is created by doing ``List(default_value)``, | |
1566 | which creates a copy of the ``default_value``. |
|
1566 | which creates a copy of the ``default_value``. | |
1567 |
|
1567 | |||
1568 | ``trait`` can be specified, which restricts the type of elements |
|
1568 | ``trait`` can be specified, which restricts the type of elements | |
1569 | in the container to that TraitType. |
|
1569 | in the container to that TraitType. | |
1570 |
|
1570 | |||
1571 | If only one arg is given and it is not a Trait, it is taken as |
|
1571 | If only one arg is given and it is not a Trait, it is taken as | |
1572 | ``default_value``: |
|
1572 | ``default_value``: | |
1573 |
|
1573 | |||
1574 | ``c = List([1,2,3])`` |
|
1574 | ``c = List([1,2,3])`` | |
1575 |
|
1575 | |||
1576 | Parameters |
|
1576 | Parameters | |
1577 | ---------- |
|
1577 | ---------- | |
1578 |
|
1578 | |||
1579 | trait : TraitType [ optional ] |
|
1579 | trait : TraitType [ optional ] | |
1580 | the type for restricting the contents of the Container. If unspecified, |
|
1580 | the type for restricting the contents of the Container. If unspecified, | |
1581 | types are not checked. |
|
1581 | types are not checked. | |
1582 |
|
1582 | |||
1583 | default_value : SequenceType [ optional ] |
|
1583 | default_value : SequenceType [ optional ] | |
1584 | The default value for the Trait. Must be list/tuple/set, and |
|
1584 | The default value for the Trait. Must be list/tuple/set, and | |
1585 | will be cast to the container type. |
|
1585 | will be cast to the container type. | |
1586 |
|
1586 | |||
1587 | minlen : Int [ default 0 ] |
|
1587 | minlen : Int [ default 0 ] | |
1588 | The minimum length of the input list |
|
1588 | The minimum length of the input list | |
1589 |
|
1589 | |||
1590 | maxlen : Int [ default sys.maxsize ] |
|
1590 | maxlen : Int [ default sys.maxsize ] | |
1591 | The maximum length of the input list |
|
1591 | The maximum length of the input list | |
1592 |
|
1592 | |||
1593 | allow_none : bool [ default False ] |
|
1593 | allow_none : bool [ default False ] | |
1594 | Whether to allow the value to be None |
|
1594 | Whether to allow the value to be None | |
1595 |
|
1595 | |||
1596 | **metadata : any |
|
1596 | **metadata : any | |
1597 | further keys for extensions to the Trait (e.g. config) |
|
1597 | further keys for extensions to the Trait (e.g. config) | |
1598 |
|
1598 | |||
1599 | """ |
|
1599 | """ | |
1600 | self._minlen = minlen |
|
1600 | self._minlen = minlen | |
1601 | self._maxlen = maxlen |
|
1601 | self._maxlen = maxlen | |
1602 | super(List, self).__init__(trait=trait, default_value=default_value, |
|
1602 | super(List, self).__init__(trait=trait, default_value=default_value, | |
1603 | **metadata) |
|
1603 | **metadata) | |
1604 |
|
1604 | |||
1605 | def length_error(self, obj, value): |
|
1605 | def length_error(self, obj, value): | |
1606 | e = "The '%s' trait of %s instance must be of length %i <= L <= %i, but a value of %s was specified." \ |
|
1606 | e = "The '%s' trait of %s instance must be of length %i <= L <= %i, but a value of %s was specified." \ | |
1607 | % (self.name, class_of(obj), self._minlen, self._maxlen, value) |
|
1607 | % (self.name, class_of(obj), self._minlen, self._maxlen, value) | |
1608 | raise TraitError(e) |
|
1608 | raise TraitError(e) | |
1609 |
|
1609 | |||
1610 | def validate_elements(self, obj, value): |
|
1610 | def validate_elements(self, obj, value): | |
1611 | length = len(value) |
|
1611 | length = len(value) | |
1612 | if length < self._minlen or length > self._maxlen: |
|
1612 | if length < self._minlen or length > self._maxlen: | |
1613 | self.length_error(obj, value) |
|
1613 | self.length_error(obj, value) | |
1614 |
|
1614 | |||
1615 | return super(List, self).validate_elements(obj, value) |
|
1615 | return super(List, self).validate_elements(obj, value) | |
1616 |
|
1616 | |||
1617 | def validate(self, obj, value): |
|
1617 | def validate(self, obj, value): | |
1618 | value = super(List, self).validate(obj, value) |
|
1618 | value = super(List, self).validate(obj, value) | |
1619 | value = self.validate_elements(obj, value) |
|
1619 | value = self.validate_elements(obj, value) | |
1620 | return value |
|
1620 | return value | |
1621 |
|
1621 | |||
1622 |
|
1622 | |||
1623 | class Set(List): |
|
1623 | class Set(List): | |
1624 | """An instance of a Python set.""" |
|
1624 | """An instance of a Python set.""" | |
1625 | klass = set |
|
1625 | klass = set | |
1626 | _cast_types = (tuple, list) |
|
1626 | _cast_types = (tuple, list) | |
1627 |
|
1627 | |||
1628 |
|
1628 | |||
1629 | class Tuple(Container): |
|
1629 | class Tuple(Container): | |
1630 | """An instance of a Python tuple.""" |
|
1630 | """An instance of a Python tuple.""" | |
1631 | klass = tuple |
|
1631 | klass = tuple | |
1632 | _cast_types = (list,) |
|
1632 | _cast_types = (list,) | |
1633 |
|
1633 | |||
1634 | def __init__(self, *traits, **metadata): |
|
1634 | def __init__(self, *traits, **metadata): | |
1635 | """Tuple(*traits, default_value=None, **medatata) |
|
1635 | """Tuple(*traits, default_value=None, **medatata) | |
1636 |
|
1636 | |||
1637 | Create a tuple from a list, set, or tuple. |
|
1637 | Create a tuple from a list, set, or tuple. | |
1638 |
|
1638 | |||
1639 | Create a fixed-type tuple with Traits: |
|
1639 | Create a fixed-type tuple with Traits: | |
1640 |
|
1640 | |||
1641 | ``t = Tuple(Int, Str, CStr)`` |
|
1641 | ``t = Tuple(Int, Str, CStr)`` | |
1642 |
|
1642 | |||
1643 | would be length 3, with Int,Str,CStr for each element. |
|
1643 | would be length 3, with Int,Str,CStr for each element. | |
1644 |
|
1644 | |||
1645 | If only one arg is given and it is not a Trait, it is taken as |
|
1645 | If only one arg is given and it is not a Trait, it is taken as | |
1646 | default_value: |
|
1646 | default_value: | |
1647 |
|
1647 | |||
1648 | ``t = Tuple((1,2,3))`` |
|
1648 | ``t = Tuple((1,2,3))`` | |
1649 |
|
1649 | |||
1650 | Otherwise, ``default_value`` *must* be specified by keyword. |
|
1650 | Otherwise, ``default_value`` *must* be specified by keyword. | |
1651 |
|
1651 | |||
1652 | Parameters |
|
1652 | Parameters | |
1653 | ---------- |
|
1653 | ---------- | |
1654 |
|
1654 | |||
1655 | *traits : TraitTypes [ optional ] |
|
1655 | *traits : TraitTypes [ optional ] | |
1656 | the types for restricting the contents of the Tuple. If unspecified, |
|
1656 | the types for restricting the contents of the Tuple. If unspecified, | |
1657 | types are not checked. If specified, then each positional argument |
|
1657 | types are not checked. If specified, then each positional argument | |
1658 | corresponds to an element of the tuple. Tuples defined with traits |
|
1658 | corresponds to an element of the tuple. Tuples defined with traits | |
1659 | are of fixed length. |
|
1659 | are of fixed length. | |
1660 |
|
1660 | |||
1661 | default_value : SequenceType [ optional ] |
|
1661 | default_value : SequenceType [ optional ] | |
1662 | The default value for the Tuple. Must be list/tuple/set, and |
|
1662 | The default value for the Tuple. Must be list/tuple/set, and | |
1663 | will be cast to a tuple. If `traits` are specified, the |
|
1663 | will be cast to a tuple. If `traits` are specified, the | |
1664 | `default_value` must conform to the shape and type they specify. |
|
1664 | `default_value` must conform to the shape and type they specify. | |
1665 |
|
1665 | |||
1666 | allow_none : bool [ default False ] |
|
1666 | allow_none : bool [ default False ] | |
1667 | Whether to allow the value to be None |
|
1667 | Whether to allow the value to be None | |
1668 |
|
1668 | |||
1669 | **metadata : any |
|
1669 | **metadata : any | |
1670 | further keys for extensions to the Trait (e.g. config) |
|
1670 | further keys for extensions to the Trait (e.g. config) | |
1671 |
|
1671 | |||
1672 | """ |
|
1672 | """ | |
1673 | default_value = metadata.pop('default_value', None) |
|
1673 | default_value = metadata.pop('default_value', None) | |
1674 | allow_none = metadata.pop('allow_none', True) |
|
1674 | allow_none = metadata.pop('allow_none', True) | |
1675 |
|
1675 | |||
1676 | # allow Tuple((values,)): |
|
1676 | # allow Tuple((values,)): | |
1677 | if len(traits) == 1 and default_value is None and not is_trait(traits[0]): |
|
1677 | if len(traits) == 1 and default_value is None and not is_trait(traits[0]): | |
1678 | default_value = traits[0] |
|
1678 | default_value = traits[0] | |
1679 | traits = () |
|
1679 | traits = () | |
1680 |
|
1680 | |||
1681 | if default_value is None: |
|
1681 | if default_value is None: | |
1682 | args = () |
|
1682 | args = () | |
1683 | elif isinstance(default_value, self._valid_defaults): |
|
1683 | elif isinstance(default_value, self._valid_defaults): | |
1684 | args = (default_value,) |
|
1684 | args = (default_value,) | |
1685 | else: |
|
1685 | else: | |
1686 | raise TypeError('default value of %s was %s' %(self.__class__.__name__, default_value)) |
|
1686 | raise TypeError('default value of %s was %s' %(self.__class__.__name__, default_value)) | |
1687 |
|
1687 | |||
1688 | self._traits = [] |
|
1688 | self._traits = [] | |
1689 | for trait in traits: |
|
1689 | for trait in traits: | |
1690 | t = trait() if isinstance(trait, type) else trait |
|
1690 | t = trait() if isinstance(trait, type) else trait | |
1691 | t.name = 'element' |
|
1691 | t.name = 'element' | |
1692 | self._traits.append(t) |
|
1692 | self._traits.append(t) | |
1693 |
|
1693 | |||
1694 | if self._traits and default_value is None: |
|
1694 | if self._traits and default_value is None: | |
1695 | # don't allow default to be an empty container if length is specified |
|
1695 | # don't allow default to be an empty container if length is specified | |
1696 | args = None |
|
1696 | args = None | |
1697 | super(Container,self).__init__(klass=self.klass, args=args, allow_none=allow_none, **metadata) |
|
1697 | super(Container,self).__init__(klass=self.klass, args=args, allow_none=allow_none, **metadata) | |
1698 |
|
1698 | |||
1699 | def validate_elements(self, obj, value): |
|
1699 | def validate_elements(self, obj, value): | |
1700 | if not self._traits: |
|
1700 | if not self._traits: | |
1701 | # nothing to validate |
|
1701 | # nothing to validate | |
1702 | return value |
|
1702 | return value | |
1703 | if len(value) != len(self._traits): |
|
1703 | if len(value) != len(self._traits): | |
1704 | e = "The '%s' trait of %s instance requires %i elements, but a value of %s was specified." \ |
|
1704 | e = "The '%s' trait of %s instance requires %i elements, but a value of %s was specified." \ | |
1705 | % (self.name, class_of(obj), len(self._traits), repr_type(value)) |
|
1705 | % (self.name, class_of(obj), len(self._traits), repr_type(value)) | |
1706 | raise TraitError(e) |
|
1706 | raise TraitError(e) | |
1707 |
|
1707 | |||
1708 | validated = [] |
|
1708 | validated = [] | |
1709 | for t, v in zip(self._traits, value): |
|
1709 | for t, v in zip(self._traits, value): | |
1710 | try: |
|
1710 | try: | |
1711 | v = t._validate(obj, v) |
|
1711 | v = t._validate(obj, v) | |
1712 | except TraitError: |
|
1712 | except TraitError: | |
1713 | self.element_error(obj, v, t) |
|
1713 | self.element_error(obj, v, t) | |
1714 | else: |
|
1714 | else: | |
1715 | validated.append(v) |
|
1715 | validated.append(v) | |
1716 | return tuple(validated) |
|
1716 | return tuple(validated) | |
1717 |
|
1717 | |||
1718 | def instance_init(self): |
|
1718 | def instance_init(self): | |
1719 | for trait in self._traits: |
|
1719 | for trait in self._traits: | |
1720 | if isinstance(trait, TraitType): |
|
1720 | if isinstance(trait, TraitType): | |
1721 | trait.this_class = self.this_class |
|
1721 | trait.this_class = self.this_class | |
1722 | trait.instance_init() |
|
1722 | trait.instance_init() | |
1723 | super(Container, self).instance_init() |
|
1723 | super(Container, self).instance_init() | |
1724 |
|
1724 | |||
1725 |
|
1725 | |||
1726 | class Dict(Instance): |
|
1726 | class Dict(Instance): | |
1727 | """An instance of a Python dict.""" |
|
1727 | """An instance of a Python dict.""" | |
1728 | _trait = None |
|
1728 | _trait = None | |
1729 |
|
1729 | |||
1730 | def __init__(self, trait=None, default_value=NoDefaultSpecified, allow_none=False, **metadata): |
|
1730 | def __init__(self, trait=None, default_value=NoDefaultSpecified, allow_none=False, **metadata): | |
1731 | """Create a dict trait type from a dict. |
|
1731 | """Create a dict trait type from a dict. | |
1732 |
|
1732 | |||
1733 | The default value is created by doing ``dict(default_value)``, |
|
1733 | The default value is created by doing ``dict(default_value)``, | |
1734 | which creates a copy of the ``default_value``. |
|
1734 | which creates a copy of the ``default_value``. | |
1735 |
|
1735 | |||
1736 | trait : TraitType [ optional ] |
|
1736 | trait : TraitType [ optional ] | |
1737 | the type for restricting the contents of the Container. If unspecified, |
|
1737 | the type for restricting the contents of the Container. If unspecified, | |
1738 | types are not checked. |
|
1738 | types are not checked. | |
1739 |
|
1739 | |||
1740 | default_value : SequenceType [ optional ] |
|
1740 | default_value : SequenceType [ optional ] | |
1741 | The default value for the Dict. Must be dict, tuple, or None, and |
|
1741 | The default value for the Dict. Must be dict, tuple, or None, and | |
1742 | will be cast to a dict if not None. If `trait` is specified, the |
|
1742 | will be cast to a dict if not None. If `trait` is specified, the | |
1743 | `default_value` must conform to the constraints it specifies. |
|
1743 | `default_value` must conform to the constraints it specifies. | |
1744 |
|
1744 | |||
1745 | allow_none : bool [ default False ] |
|
1745 | allow_none : bool [ default False ] | |
1746 | Whether to allow the value to be None |
|
1746 | Whether to allow the value to be None | |
1747 |
|
1747 | |||
1748 | """ |
|
1748 | """ | |
1749 | if default_value is NoDefaultSpecified and trait is not None: |
|
1749 | if default_value is NoDefaultSpecified and trait is not None: | |
1750 | if not is_trait(trait): |
|
1750 | if not is_trait(trait): | |
1751 | default_value = trait |
|
1751 | default_value = trait | |
1752 | trait = None |
|
1752 | trait = None | |
1753 | if default_value is NoDefaultSpecified: |
|
1753 | if default_value is NoDefaultSpecified: | |
1754 | default_value = {} |
|
1754 | default_value = {} | |
1755 | if default_value is None: |
|
1755 | if default_value is None: | |
1756 | args = None |
|
1756 | args = None | |
1757 | elif isinstance(default_value, dict): |
|
1757 | elif isinstance(default_value, dict): | |
1758 | args = (default_value,) |
|
1758 | args = (default_value,) | |
1759 | elif isinstance(default_value, SequenceTypes): |
|
1759 | elif isinstance(default_value, SequenceTypes): | |
1760 | args = (default_value,) |
|
1760 | args = (default_value,) | |
1761 | else: |
|
1761 | else: | |
1762 | raise TypeError('default value of Dict was %s' % default_value) |
|
1762 | raise TypeError('default value of Dict was %s' % default_value) | |
1763 |
|
1763 | |||
1764 | if is_trait(trait): |
|
1764 | if is_trait(trait): | |
1765 | self._trait = trait() if isinstance(trait, type) else trait |
|
1765 | self._trait = trait() if isinstance(trait, type) else trait | |
1766 | self._trait.name = 'element' |
|
1766 | self._trait.name = 'element' | |
1767 | elif trait is not None: |
|
1767 | elif trait is not None: | |
1768 | raise TypeError("`trait` must be a Trait or None, got %s"%repr_type(trait)) |
|
1768 | raise TypeError("`trait` must be a Trait or None, got %s"%repr_type(trait)) | |
1769 |
|
1769 | |||
1770 | super(Dict,self).__init__(klass=dict, args=args, |
|
1770 | super(Dict,self).__init__(klass=dict, args=args, | |
1771 | allow_none=allow_none, **metadata) |
|
1771 | allow_none=allow_none, **metadata) | |
1772 |
|
1772 | |||
1773 | def element_error(self, obj, element, validator): |
|
1773 | def element_error(self, obj, element, validator): | |
1774 | e = "Element of the '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
1774 | e = "Element of the '%s' trait of %s instance must be %s, but a value of %s was specified." \ | |
1775 | % (self.name, class_of(obj), validator.info(), repr_type(element)) |
|
1775 | % (self.name, class_of(obj), validator.info(), repr_type(element)) | |
1776 | raise TraitError(e) |
|
1776 | raise TraitError(e) | |
1777 |
|
1777 | |||
1778 | def validate(self, obj, value): |
|
1778 | def validate(self, obj, value): | |
1779 | value = super(Dict, self).validate(obj, value) |
|
1779 | value = super(Dict, self).validate(obj, value) | |
1780 | if value is None: |
|
1780 | if value is None: | |
1781 | return value |
|
1781 | return value | |
1782 | value = self.validate_elements(obj, value) |
|
1782 | value = self.validate_elements(obj, value) | |
1783 | return value |
|
1783 | return value | |
1784 |
|
1784 | |||
1785 | def validate_elements(self, obj, value): |
|
1785 | def validate_elements(self, obj, value): | |
1786 | if self._trait is None or isinstance(self._trait, Any): |
|
1786 | if self._trait is None or isinstance(self._trait, Any): | |
1787 | return value |
|
1787 | return value | |
1788 | validated = {} |
|
1788 | validated = {} | |
1789 | for key in value: |
|
1789 | for key in value: | |
1790 | v = value[key] |
|
1790 | v = value[key] | |
1791 | try: |
|
1791 | try: | |
1792 | v = self._trait._validate(obj, v) |
|
1792 | v = self._trait._validate(obj, v) | |
1793 | except TraitError: |
|
1793 | except TraitError: | |
1794 | self.element_error(obj, v, self._trait) |
|
1794 | self.element_error(obj, v, self._trait) | |
1795 | else: |
|
1795 | else: | |
1796 | validated[key] = v |
|
1796 | validated[key] = v | |
1797 | return self.klass(validated) |
|
1797 | return self.klass(validated) | |
1798 |
|
1798 | |||
1799 | def instance_init(self): |
|
1799 | def instance_init(self): | |
1800 | if isinstance(self._trait, TraitType): |
|
1800 | if isinstance(self._trait, TraitType): | |
1801 | self._trait.this_class = self.this_class |
|
1801 | self._trait.this_class = self.this_class | |
1802 | self._trait.instance_init() |
|
1802 | self._trait.instance_init() | |
1803 | super(Dict, self).instance_init() |
|
1803 | super(Dict, self).instance_init() | |
1804 |
|
1804 | |||
1805 |
|
1805 | |||
1806 | class EventfulDict(Instance): |
|
1806 | class EventfulDict(Instance): | |
1807 | """An instance of an EventfulDict.""" |
|
1807 | """An instance of an EventfulDict.""" | |
1808 |
|
1808 | |||
1809 | def __init__(self, default_value={}, allow_none=False, **metadata): |
|
1809 | def __init__(self, default_value={}, allow_none=False, **metadata): | |
1810 | """Create a EventfulDict trait type from a dict. |
|
1810 | """Create a EventfulDict trait type from a dict. | |
1811 |
|
1811 | |||
1812 | The default value is created by doing |
|
1812 | The default value is created by doing | |
1813 | ``eventful.EvenfulDict(default_value)``, which creates a copy of the |
|
1813 | ``eventful.EvenfulDict(default_value)``, which creates a copy of the | |
1814 | ``default_value``. |
|
1814 | ``default_value``. | |
1815 | """ |
|
1815 | """ | |
1816 | if default_value is None: |
|
1816 | if default_value is None: | |
1817 | args = None |
|
1817 | args = None | |
1818 | elif isinstance(default_value, dict): |
|
1818 | elif isinstance(default_value, dict): | |
1819 | args = (default_value,) |
|
1819 | args = (default_value,) | |
1820 | elif isinstance(default_value, SequenceTypes): |
|
1820 | elif isinstance(default_value, SequenceTypes): | |
1821 | args = (default_value,) |
|
1821 | args = (default_value,) | |
1822 | else: |
|
1822 | else: | |
1823 | raise TypeError('default value of EventfulDict was %s' % default_value) |
|
1823 | raise TypeError('default value of EventfulDict was %s' % default_value) | |
1824 |
|
1824 | |||
1825 | super(EventfulDict, self).__init__(klass=eventful.EventfulDict, args=args, |
|
1825 | super(EventfulDict, self).__init__(klass=eventful.EventfulDict, args=args, | |
1826 | allow_none=allow_none, **metadata) |
|
1826 | allow_none=allow_none, **metadata) | |
1827 |
|
1827 | |||
1828 |
|
1828 | |||
1829 | class EventfulList(Instance): |
|
1829 | class EventfulList(Instance): | |
1830 | """An instance of an EventfulList.""" |
|
1830 | """An instance of an EventfulList.""" | |
1831 |
|
1831 | |||
1832 | def __init__(self, default_value=None, allow_none=False, **metadata): |
|
1832 | def __init__(self, default_value=None, allow_none=False, **metadata): | |
1833 | """Create a EventfulList trait type from a dict. |
|
1833 | """Create a EventfulList trait type from a dict. | |
1834 |
|
1834 | |||
1835 | The default value is created by doing |
|
1835 | The default value is created by doing | |
1836 | ``eventful.EvenfulList(default_value)``, which creates a copy of the |
|
1836 | ``eventful.EvenfulList(default_value)``, which creates a copy of the | |
1837 | ``default_value``. |
|
1837 | ``default_value``. | |
1838 | """ |
|
1838 | """ | |
1839 | if default_value is None: |
|
1839 | if default_value is None: | |
1840 | args = ((),) |
|
1840 | args = ((),) | |
1841 | else: |
|
1841 | else: | |
1842 | args = (default_value,) |
|
1842 | args = (default_value,) | |
1843 |
|
1843 | |||
1844 | super(EventfulList, self).__init__(klass=eventful.EventfulList, args=args, |
|
1844 | super(EventfulList, self).__init__(klass=eventful.EventfulList, args=args, | |
1845 | allow_none=allow_none, **metadata) |
|
1845 | allow_none=allow_none, **metadata) | |
1846 |
|
1846 | |||
1847 |
|
1847 | |||
1848 | class TCPAddress(TraitType): |
|
1848 | class TCPAddress(TraitType): | |
1849 | """A trait for an (ip, port) tuple. |
|
1849 | """A trait for an (ip, port) tuple. | |
1850 |
|
1850 | |||
1851 | This allows for both IPv4 IP addresses as well as hostnames. |
|
1851 | This allows for both IPv4 IP addresses as well as hostnames. | |
1852 | """ |
|
1852 | """ | |
1853 |
|
1853 | |||
1854 | default_value = ('127.0.0.1', 0) |
|
1854 | default_value = ('127.0.0.1', 0) | |
1855 | info_text = 'an (ip, port) tuple' |
|
1855 | info_text = 'an (ip, port) tuple' | |
1856 |
|
1856 | |||
1857 | def validate(self, obj, value): |
|
1857 | def validate(self, obj, value): | |
1858 | if isinstance(value, tuple): |
|
1858 | if isinstance(value, tuple): | |
1859 | if len(value) == 2: |
|
1859 | if len(value) == 2: | |
1860 | if isinstance(value[0], py3compat.string_types) and isinstance(value[1], int): |
|
1860 | if isinstance(value[0], py3compat.string_types) and isinstance(value[1], int): | |
1861 | port = value[1] |
|
1861 | port = value[1] | |
1862 | if port >= 0 and port <= 65535: |
|
1862 | if port >= 0 and port <= 65535: | |
1863 | return value |
|
1863 | return value | |
1864 | self.error(obj, value) |
|
1864 | self.error(obj, value) | |
1865 |
|
1865 | |||
1866 | class CRegExp(TraitType): |
|
1866 | class CRegExp(TraitType): | |
1867 | """A casting compiled regular expression trait. |
|
1867 | """A casting compiled regular expression trait. | |
1868 |
|
1868 | |||
1869 | Accepts both strings and compiled regular expressions. The resulting |
|
1869 | Accepts both strings and compiled regular expressions. The resulting | |
1870 | attribute will be a compiled regular expression.""" |
|
1870 | attribute will be a compiled regular expression.""" | |
1871 |
|
1871 | |||
1872 | info_text = 'a regular expression' |
|
1872 | info_text = 'a regular expression' | |
1873 |
|
1873 | |||
1874 | def validate(self, obj, value): |
|
1874 | def validate(self, obj, value): | |
1875 | try: |
|
1875 | try: | |
1876 | return re.compile(value) |
|
1876 | return re.compile(value) | |
1877 | except: |
|
1877 | except: | |
1878 | self.error(obj, value) |
|
1878 | self.error(obj, value) |
General Comments 0
You need to be logged in to leave comments.
Login now