Show More
@@ -1,944 +1,937 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Top-level display functions for displaying object in different formats. |
|
2 | """Top-level display functions for displaying object in different formats. | |
3 |
|
3 | |||
4 | Authors: |
|
4 | Authors: | |
5 |
|
5 | |||
6 | * Brian Granger |
|
6 | * Brian Granger | |
7 | """ |
|
7 | """ | |
8 |
|
8 | |||
9 | #----------------------------------------------------------------------------- |
|
9 | #----------------------------------------------------------------------------- | |
10 | # Copyright (C) 2013 The IPython Development Team |
|
10 | # Copyright (C) 2013 The IPython Development Team | |
11 | # |
|
11 | # | |
12 | # Distributed under the terms of the BSD License. The full license is in |
|
12 | # Distributed under the terms of the BSD License. The full license is in | |
13 | # the file COPYING, distributed as part of this software. |
|
13 | # the file COPYING, distributed as part of this software. | |
14 | #----------------------------------------------------------------------------- |
|
14 | #----------------------------------------------------------------------------- | |
15 |
|
15 | |||
16 | #----------------------------------------------------------------------------- |
|
16 | #----------------------------------------------------------------------------- | |
17 | # Imports |
|
17 | # Imports | |
18 | #----------------------------------------------------------------------------- |
|
18 | #----------------------------------------------------------------------------- | |
19 |
|
19 | |||
20 | from __future__ import print_function |
|
20 | from __future__ import print_function | |
21 |
|
21 | |||
22 | import os |
|
22 | import os | |
23 | import struct |
|
23 | import struct | |
24 | import mimetypes |
|
24 | import mimetypes | |
25 |
|
25 | |||
26 | from IPython.core.formatters import _safe_get_formatter_method |
|
26 | from IPython.core.formatters import _safe_get_formatter_method | |
27 | from IPython.utils.py3compat import (string_types, cast_bytes_py2, cast_unicode, |
|
27 | from IPython.utils.py3compat import (string_types, cast_bytes_py2, cast_unicode, | |
28 | unicode_type) |
|
28 | unicode_type) | |
29 | from IPython.testing.skipdoctest import skip_doctest |
|
29 | from IPython.testing.skipdoctest import skip_doctest | |
30 |
|
30 | |||
31 | __all__ = ['display', 'display_pretty', 'display_html', 'display_markdown', |
|
31 | __all__ = ['display', 'display_pretty', 'display_html', 'display_markdown', | |
32 | 'display_svg', 'display_png', 'display_jpeg', 'display_latex', 'display_json', |
|
32 | 'display_svg', 'display_png', 'display_jpeg', 'display_latex', 'display_json', | |
33 | 'display_javascript', 'display_pdf', 'DisplayObject', 'TextDisplayObject', |
|
33 | 'display_javascript', 'display_pdf', 'DisplayObject', 'TextDisplayObject', | |
34 | 'Pretty', 'HTML', 'Markdown', 'Math', 'Latex', 'SVG', 'JSON', 'Javascript', |
|
34 | 'Pretty', 'HTML', 'Markdown', 'Math', 'Latex', 'SVG', 'JSON', 'Javascript', | |
35 | 'Image', 'clear_output', 'set_matplotlib_formats', 'set_matplotlib_close', |
|
35 | 'Image', 'clear_output', 'set_matplotlib_formats', 'set_matplotlib_close', | |
36 | 'publish_display_data'] |
|
36 | 'publish_display_data'] | |
37 |
|
37 | |||
38 | #----------------------------------------------------------------------------- |
|
38 | #----------------------------------------------------------------------------- | |
39 | # utility functions |
|
39 | # utility functions | |
40 | #----------------------------------------------------------------------------- |
|
40 | #----------------------------------------------------------------------------- | |
41 |
|
41 | |||
42 | def _safe_exists(path): |
|
42 | def _safe_exists(path): | |
43 | """Check path, but don't let exceptions raise""" |
|
43 | """Check path, but don't let exceptions raise""" | |
44 | try: |
|
44 | try: | |
45 | return os.path.exists(path) |
|
45 | return os.path.exists(path) | |
46 | except Exception: |
|
46 | except Exception: | |
47 | return False |
|
47 | return False | |
48 |
|
48 | |||
49 | def _merge(d1, d2): |
|
49 | def _merge(d1, d2): | |
50 | """Like update, but merges sub-dicts instead of clobbering at the top level. |
|
50 | """Like update, but merges sub-dicts instead of clobbering at the top level. | |
51 |
|
51 | |||
52 | Updates d1 in-place |
|
52 | Updates d1 in-place | |
53 | """ |
|
53 | """ | |
54 |
|
54 | |||
55 | if not isinstance(d2, dict) or not isinstance(d1, dict): |
|
55 | if not isinstance(d2, dict) or not isinstance(d1, dict): | |
56 | return d2 |
|
56 | return d2 | |
57 | for key, value in d2.items(): |
|
57 | for key, value in d2.items(): | |
58 | d1[key] = _merge(d1.get(key), value) |
|
58 | d1[key] = _merge(d1.get(key), value) | |
59 | return d1 |
|
59 | return d1 | |
60 |
|
60 | |||
61 | def _display_mimetype(mimetype, objs, raw=False, metadata=None): |
|
61 | def _display_mimetype(mimetype, objs, raw=False, metadata=None): | |
62 | """internal implementation of all display_foo methods |
|
62 | """internal implementation of all display_foo methods | |
63 |
|
63 | |||
64 | Parameters |
|
64 | Parameters | |
65 | ---------- |
|
65 | ---------- | |
66 | mimetype : str |
|
66 | mimetype : str | |
67 | The mimetype to be published (e.g. 'image/png') |
|
67 | The mimetype to be published (e.g. 'image/png') | |
68 | objs : tuple of objects |
|
68 | objs : tuple of objects | |
69 | The Python objects to display, or if raw=True raw text data to |
|
69 | The Python objects to display, or if raw=True raw text data to | |
70 | display. |
|
70 | display. | |
71 | raw : bool |
|
71 | raw : bool | |
72 | Are the data objects raw data or Python objects that need to be |
|
72 | Are the data objects raw data or Python objects that need to be | |
73 | formatted before display? [default: False] |
|
73 | formatted before display? [default: False] | |
74 | metadata : dict (optional) |
|
74 | metadata : dict (optional) | |
75 | Metadata to be associated with the specific mimetype output. |
|
75 | Metadata to be associated with the specific mimetype output. | |
76 | """ |
|
76 | """ | |
77 | if metadata: |
|
77 | if metadata: | |
78 | metadata = {mimetype: metadata} |
|
78 | metadata = {mimetype: metadata} | |
79 | if raw: |
|
79 | if raw: | |
80 | # turn list of pngdata into list of { 'image/png': pngdata } |
|
80 | # turn list of pngdata into list of { 'image/png': pngdata } | |
81 | objs = [ {mimetype: obj} for obj in objs ] |
|
81 | objs = [ {mimetype: obj} for obj in objs ] | |
82 | display(*objs, raw=raw, metadata=metadata, include=[mimetype]) |
|
82 | display(*objs, raw=raw, metadata=metadata, include=[mimetype]) | |
83 |
|
83 | |||
84 | #----------------------------------------------------------------------------- |
|
84 | #----------------------------------------------------------------------------- | |
85 | # Main functions |
|
85 | # Main functions | |
86 | #----------------------------------------------------------------------------- |
|
86 | #----------------------------------------------------------------------------- | |
87 |
|
87 | |||
88 | def publish_display_data(data, metadata=None, source=None): |
|
88 | def publish_display_data(data, metadata=None, source=None): | |
89 | """Publish data and metadata to all frontends. |
|
89 | """Publish data and metadata to all frontends. | |
90 |
|
90 | |||
91 | See the ``display_data`` message in the messaging documentation for |
|
91 | See the ``display_data`` message in the messaging documentation for | |
92 | more details about this message type. |
|
92 | more details about this message type. | |
93 |
|
93 | |||
94 | The following MIME types are currently implemented: |
|
94 | The following MIME types are currently implemented: | |
95 |
|
95 | |||
96 | * text/plain |
|
96 | * text/plain | |
97 | * text/html |
|
97 | * text/html | |
98 | * text/markdown |
|
98 | * text/markdown | |
99 | * text/latex |
|
99 | * text/latex | |
100 | * application/json |
|
100 | * application/json | |
101 | * application/javascript |
|
101 | * application/javascript | |
102 | * image/png |
|
102 | * image/png | |
103 | * image/jpeg |
|
103 | * image/jpeg | |
104 | * image/svg+xml |
|
104 | * image/svg+xml | |
105 |
|
105 | |||
106 | Parameters |
|
106 | Parameters | |
107 | ---------- |
|
107 | ---------- | |
108 | data : dict |
|
108 | data : dict | |
109 | A dictionary having keys that are valid MIME types (like |
|
109 | A dictionary having keys that are valid MIME types (like | |
110 | 'text/plain' or 'image/svg+xml') and values that are the data for |
|
110 | 'text/plain' or 'image/svg+xml') and values that are the data for | |
111 | that MIME type. The data itself must be a JSON'able data |
|
111 | that MIME type. The data itself must be a JSON'able data | |
112 | structure. Minimally all data should have the 'text/plain' data, |
|
112 | structure. Minimally all data should have the 'text/plain' data, | |
113 | which can be displayed by all frontends. If more than the plain |
|
113 | which can be displayed by all frontends. If more than the plain | |
114 | text is given, it is up to the frontend to decide which |
|
114 | text is given, it is up to the frontend to decide which | |
115 | representation to use. |
|
115 | representation to use. | |
116 | metadata : dict |
|
116 | metadata : dict | |
117 | A dictionary for metadata related to the data. This can contain |
|
117 | A dictionary for metadata related to the data. This can contain | |
118 | arbitrary key, value pairs that frontends can use to interpret |
|
118 | arbitrary key, value pairs that frontends can use to interpret | |
119 | the data. mime-type keys matching those in data can be used |
|
119 | the data. mime-type keys matching those in data can be used | |
120 | to specify metadata about particular representations. |
|
120 | to specify metadata about particular representations. | |
121 | source : str, deprecated |
|
121 | source : str, deprecated | |
122 | Unused. |
|
122 | Unused. | |
123 | """ |
|
123 | """ | |
124 | from IPython.core.interactiveshell import InteractiveShell |
|
124 | from IPython.core.interactiveshell import InteractiveShell | |
125 | InteractiveShell.instance().display_pub.publish( |
|
125 | InteractiveShell.instance().display_pub.publish( | |
126 | data=data, |
|
126 | data=data, | |
127 | metadata=metadata, |
|
127 | metadata=metadata, | |
128 | ) |
|
128 | ) | |
129 |
|
129 | |||
130 | def display(*objs, **kwargs): |
|
130 | def display(*objs, **kwargs): | |
131 | """Display a Python object in all frontends. |
|
131 | """Display a Python object in all frontends. | |
132 |
|
132 | |||
133 | By default all representations will be computed and sent to the frontends. |
|
133 | By default all representations will be computed and sent to the frontends. | |
134 | Frontends can decide which representation is used and how. |
|
134 | Frontends can decide which representation is used and how. | |
135 |
|
135 | |||
136 | Parameters |
|
136 | Parameters | |
137 | ---------- |
|
137 | ---------- | |
138 | objs : tuple of objects |
|
138 | objs : tuple of objects | |
139 | The Python objects to display. |
|
139 | The Python objects to display. | |
140 | raw : bool, optional |
|
140 | raw : bool, optional | |
141 | Are the objects to be displayed already mimetype-keyed dicts of raw display data, |
|
141 | Are the objects to be displayed already mimetype-keyed dicts of raw display data, | |
142 | or Python objects that need to be formatted before display? [default: False] |
|
142 | or Python objects that need to be formatted before display? [default: False] | |
143 | include : list or tuple, optional |
|
143 | include : list or tuple, optional | |
144 | A list of format type strings (MIME types) to include in the |
|
144 | A list of format type strings (MIME types) to include in the | |
145 | format data dict. If this is set *only* the format types included |
|
145 | format data dict. If this is set *only* the format types included | |
146 | in this list will be computed. |
|
146 | in this list will be computed. | |
147 | exclude : list or tuple, optional |
|
147 | exclude : list or tuple, optional | |
148 | A list of format type strings (MIME types) to exclude in the format |
|
148 | A list of format type strings (MIME types) to exclude in the format | |
149 | data dict. If this is set all format types will be computed, |
|
149 | data dict. If this is set all format types will be computed, | |
150 | except for those included in this argument. |
|
150 | except for those included in this argument. | |
151 | metadata : dict, optional |
|
151 | metadata : dict, optional | |
152 | A dictionary of metadata to associate with the output. |
|
152 | A dictionary of metadata to associate with the output. | |
153 | mime-type keys in this dictionary will be associated with the individual |
|
153 | mime-type keys in this dictionary will be associated with the individual | |
154 | representation formats, if they exist. |
|
154 | representation formats, if they exist. | |
155 | """ |
|
155 | """ | |
156 | raw = kwargs.get('raw', False) |
|
156 | raw = kwargs.get('raw', False) | |
157 | include = kwargs.get('include') |
|
157 | include = kwargs.get('include') | |
158 | exclude = kwargs.get('exclude') |
|
158 | exclude = kwargs.get('exclude') | |
159 | metadata = kwargs.get('metadata') |
|
159 | metadata = kwargs.get('metadata') | |
160 |
|
160 | |||
161 | from IPython.core.interactiveshell import InteractiveShell |
|
161 | from IPython.core.interactiveshell import InteractiveShell | |
162 |
|
162 | |||
163 | if not raw: |
|
163 | if not raw: | |
164 | format = InteractiveShell.instance().display_formatter.format |
|
164 | format = InteractiveShell.instance().display_formatter.format | |
165 |
|
165 | |||
166 | for obj in objs: |
|
166 | for obj in objs: | |
167 |
|
||||
168 | # If _ipython_display_ is defined, use that to display this object. |
|
|||
169 | display_method = _safe_get_formatter_method(obj, '_ipython_display_') |
|
|||
170 | if display_method is not None: |
|
|||
171 | try: |
|
|||
172 | display_method(**kwargs) |
|
|||
173 | except NotImplementedError: |
|
|||
174 | pass |
|
|||
175 | else: |
|
|||
176 | continue |
|
|||
177 | if raw: |
|
167 | if raw: | |
178 | publish_display_data(data=obj, metadata=metadata) |
|
168 | publish_display_data(data=obj, metadata=metadata) | |
179 | else: |
|
169 | else: | |
180 | format_dict, md_dict = format(obj, include=include, exclude=exclude) |
|
170 | format_dict, md_dict = format(obj, include=include, exclude=exclude) | |
|
171 | if not format_dict: | |||
|
172 | # nothing to display (e.g. _ipython_display_ took over) | |||
|
173 | continue | |||
181 | if metadata: |
|
174 | if metadata: | |
182 | # kwarg-specified metadata gets precedence |
|
175 | # kwarg-specified metadata gets precedence | |
183 | _merge(md_dict, metadata) |
|
176 | _merge(md_dict, metadata) | |
184 | publish_display_data(data=format_dict, metadata=md_dict) |
|
177 | publish_display_data(data=format_dict, metadata=md_dict) | |
185 |
|
178 | |||
186 |
|
179 | |||
187 | def display_pretty(*objs, **kwargs): |
|
180 | def display_pretty(*objs, **kwargs): | |
188 | """Display the pretty (default) representation of an object. |
|
181 | """Display the pretty (default) representation of an object. | |
189 |
|
182 | |||
190 | Parameters |
|
183 | Parameters | |
191 | ---------- |
|
184 | ---------- | |
192 | objs : tuple of objects |
|
185 | objs : tuple of objects | |
193 | The Python objects to display, or if raw=True raw text data to |
|
186 | The Python objects to display, or if raw=True raw text data to | |
194 | display. |
|
187 | display. | |
195 | raw : bool |
|
188 | raw : bool | |
196 | Are the data objects raw data or Python objects that need to be |
|
189 | Are the data objects raw data or Python objects that need to be | |
197 | formatted before display? [default: False] |
|
190 | formatted before display? [default: False] | |
198 | metadata : dict (optional) |
|
191 | metadata : dict (optional) | |
199 | Metadata to be associated with the specific mimetype output. |
|
192 | Metadata to be associated with the specific mimetype output. | |
200 | """ |
|
193 | """ | |
201 | _display_mimetype('text/plain', objs, **kwargs) |
|
194 | _display_mimetype('text/plain', objs, **kwargs) | |
202 |
|
195 | |||
203 |
|
196 | |||
204 | def display_html(*objs, **kwargs): |
|
197 | def display_html(*objs, **kwargs): | |
205 | """Display the HTML representation of an object. |
|
198 | """Display the HTML representation of an object. | |
206 |
|
199 | |||
207 | Parameters |
|
200 | Parameters | |
208 | ---------- |
|
201 | ---------- | |
209 | objs : tuple of objects |
|
202 | objs : tuple of objects | |
210 | The Python objects to display, or if raw=True raw HTML data to |
|
203 | The Python objects to display, or if raw=True raw HTML data to | |
211 | display. |
|
204 | display. | |
212 | raw : bool |
|
205 | raw : bool | |
213 | Are the data objects raw data or Python objects that need to be |
|
206 | Are the data objects raw data or Python objects that need to be | |
214 | formatted before display? [default: False] |
|
207 | formatted before display? [default: False] | |
215 | metadata : dict (optional) |
|
208 | metadata : dict (optional) | |
216 | Metadata to be associated with the specific mimetype output. |
|
209 | Metadata to be associated with the specific mimetype output. | |
217 | """ |
|
210 | """ | |
218 | _display_mimetype('text/html', objs, **kwargs) |
|
211 | _display_mimetype('text/html', objs, **kwargs) | |
219 |
|
212 | |||
220 |
|
213 | |||
221 | def display_markdown(*objs, **kwargs): |
|
214 | def display_markdown(*objs, **kwargs): | |
222 | """Displays the Markdown representation of an object. |
|
215 | """Displays the Markdown representation of an object. | |
223 |
|
216 | |||
224 | Parameters |
|
217 | Parameters | |
225 | ---------- |
|
218 | ---------- | |
226 | objs : tuple of objects |
|
219 | objs : tuple of objects | |
227 | The Python objects to display, or if raw=True raw markdown data to |
|
220 | The Python objects to display, or if raw=True raw markdown data to | |
228 | display. |
|
221 | display. | |
229 | raw : bool |
|
222 | raw : bool | |
230 | Are the data objects raw data or Python objects that need to be |
|
223 | Are the data objects raw data or Python objects that need to be | |
231 | formatted before display? [default: False] |
|
224 | formatted before display? [default: False] | |
232 | metadata : dict (optional) |
|
225 | metadata : dict (optional) | |
233 | Metadata to be associated with the specific mimetype output. |
|
226 | Metadata to be associated with the specific mimetype output. | |
234 | """ |
|
227 | """ | |
235 |
|
228 | |||
236 | _display_mimetype('text/markdown', objs, **kwargs) |
|
229 | _display_mimetype('text/markdown', objs, **kwargs) | |
237 |
|
230 | |||
238 |
|
231 | |||
239 | def display_svg(*objs, **kwargs): |
|
232 | def display_svg(*objs, **kwargs): | |
240 | """Display the SVG representation of an object. |
|
233 | """Display the SVG representation of an object. | |
241 |
|
234 | |||
242 | Parameters |
|
235 | Parameters | |
243 | ---------- |
|
236 | ---------- | |
244 | objs : tuple of objects |
|
237 | objs : tuple of objects | |
245 | The Python objects to display, or if raw=True raw svg data to |
|
238 | The Python objects to display, or if raw=True raw svg data to | |
246 | display. |
|
239 | display. | |
247 | raw : bool |
|
240 | raw : bool | |
248 | Are the data objects raw data or Python objects that need to be |
|
241 | Are the data objects raw data or Python objects that need to be | |
249 | formatted before display? [default: False] |
|
242 | formatted before display? [default: False] | |
250 | metadata : dict (optional) |
|
243 | metadata : dict (optional) | |
251 | Metadata to be associated with the specific mimetype output. |
|
244 | Metadata to be associated with the specific mimetype output. | |
252 | """ |
|
245 | """ | |
253 | _display_mimetype('image/svg+xml', objs, **kwargs) |
|
246 | _display_mimetype('image/svg+xml', objs, **kwargs) | |
254 |
|
247 | |||
255 |
|
248 | |||
256 | def display_png(*objs, **kwargs): |
|
249 | def display_png(*objs, **kwargs): | |
257 | """Display the PNG representation of an object. |
|
250 | """Display the PNG representation of an object. | |
258 |
|
251 | |||
259 | Parameters |
|
252 | Parameters | |
260 | ---------- |
|
253 | ---------- | |
261 | objs : tuple of objects |
|
254 | objs : tuple of objects | |
262 | The Python objects to display, or if raw=True raw png data to |
|
255 | The Python objects to display, or if raw=True raw png data to | |
263 | display. |
|
256 | display. | |
264 | raw : bool |
|
257 | raw : bool | |
265 | Are the data objects raw data or Python objects that need to be |
|
258 | Are the data objects raw data or Python objects that need to be | |
266 | formatted before display? [default: False] |
|
259 | formatted before display? [default: False] | |
267 | metadata : dict (optional) |
|
260 | metadata : dict (optional) | |
268 | Metadata to be associated with the specific mimetype output. |
|
261 | Metadata to be associated with the specific mimetype output. | |
269 | """ |
|
262 | """ | |
270 | _display_mimetype('image/png', objs, **kwargs) |
|
263 | _display_mimetype('image/png', objs, **kwargs) | |
271 |
|
264 | |||
272 |
|
265 | |||
273 | def display_jpeg(*objs, **kwargs): |
|
266 | def display_jpeg(*objs, **kwargs): | |
274 | """Display the JPEG representation of an object. |
|
267 | """Display the JPEG representation of an object. | |
275 |
|
268 | |||
276 | Parameters |
|
269 | Parameters | |
277 | ---------- |
|
270 | ---------- | |
278 | objs : tuple of objects |
|
271 | objs : tuple of objects | |
279 | The Python objects to display, or if raw=True raw JPEG data to |
|
272 | The Python objects to display, or if raw=True raw JPEG data to | |
280 | display. |
|
273 | display. | |
281 | raw : bool |
|
274 | raw : bool | |
282 | Are the data objects raw data or Python objects that need to be |
|
275 | Are the data objects raw data or Python objects that need to be | |
283 | formatted before display? [default: False] |
|
276 | formatted before display? [default: False] | |
284 | metadata : dict (optional) |
|
277 | metadata : dict (optional) | |
285 | Metadata to be associated with the specific mimetype output. |
|
278 | Metadata to be associated with the specific mimetype output. | |
286 | """ |
|
279 | """ | |
287 | _display_mimetype('image/jpeg', objs, **kwargs) |
|
280 | _display_mimetype('image/jpeg', objs, **kwargs) | |
288 |
|
281 | |||
289 |
|
282 | |||
290 | def display_latex(*objs, **kwargs): |
|
283 | def display_latex(*objs, **kwargs): | |
291 | """Display the LaTeX representation of an object. |
|
284 | """Display the LaTeX representation of an object. | |
292 |
|
285 | |||
293 | Parameters |
|
286 | Parameters | |
294 | ---------- |
|
287 | ---------- | |
295 | objs : tuple of objects |
|
288 | objs : tuple of objects | |
296 | The Python objects to display, or if raw=True raw latex data to |
|
289 | The Python objects to display, or if raw=True raw latex data to | |
297 | display. |
|
290 | display. | |
298 | raw : bool |
|
291 | raw : bool | |
299 | Are the data objects raw data or Python objects that need to be |
|
292 | Are the data objects raw data or Python objects that need to be | |
300 | formatted before display? [default: False] |
|
293 | formatted before display? [default: False] | |
301 | metadata : dict (optional) |
|
294 | metadata : dict (optional) | |
302 | Metadata to be associated with the specific mimetype output. |
|
295 | Metadata to be associated with the specific mimetype output. | |
303 | """ |
|
296 | """ | |
304 | _display_mimetype('text/latex', objs, **kwargs) |
|
297 | _display_mimetype('text/latex', objs, **kwargs) | |
305 |
|
298 | |||
306 |
|
299 | |||
307 | def display_json(*objs, **kwargs): |
|
300 | def display_json(*objs, **kwargs): | |
308 | """Display the JSON representation of an object. |
|
301 | """Display the JSON representation of an object. | |
309 |
|
302 | |||
310 | Note that not many frontends support displaying JSON. |
|
303 | Note that not many frontends support displaying JSON. | |
311 |
|
304 | |||
312 | Parameters |
|
305 | Parameters | |
313 | ---------- |
|
306 | ---------- | |
314 | objs : tuple of objects |
|
307 | objs : tuple of objects | |
315 | The Python objects to display, or if raw=True raw json data to |
|
308 | The Python objects to display, or if raw=True raw json data to | |
316 | display. |
|
309 | display. | |
317 | raw : bool |
|
310 | raw : bool | |
318 | Are the data objects raw data or Python objects that need to be |
|
311 | Are the data objects raw data or Python objects that need to be | |
319 | formatted before display? [default: False] |
|
312 | formatted before display? [default: False] | |
320 | metadata : dict (optional) |
|
313 | metadata : dict (optional) | |
321 | Metadata to be associated with the specific mimetype output. |
|
314 | Metadata to be associated with the specific mimetype output. | |
322 | """ |
|
315 | """ | |
323 | _display_mimetype('application/json', objs, **kwargs) |
|
316 | _display_mimetype('application/json', objs, **kwargs) | |
324 |
|
317 | |||
325 |
|
318 | |||
326 | def display_javascript(*objs, **kwargs): |
|
319 | def display_javascript(*objs, **kwargs): | |
327 | """Display the Javascript representation of an object. |
|
320 | """Display the Javascript representation of an object. | |
328 |
|
321 | |||
329 | Parameters |
|
322 | Parameters | |
330 | ---------- |
|
323 | ---------- | |
331 | objs : tuple of objects |
|
324 | objs : tuple of objects | |
332 | The Python objects to display, or if raw=True raw javascript data to |
|
325 | The Python objects to display, or if raw=True raw javascript data to | |
333 | display. |
|
326 | display. | |
334 | raw : bool |
|
327 | raw : bool | |
335 | Are the data objects raw data or Python objects that need to be |
|
328 | Are the data objects raw data or Python objects that need to be | |
336 | formatted before display? [default: False] |
|
329 | formatted before display? [default: False] | |
337 | metadata : dict (optional) |
|
330 | metadata : dict (optional) | |
338 | Metadata to be associated with the specific mimetype output. |
|
331 | Metadata to be associated with the specific mimetype output. | |
339 | """ |
|
332 | """ | |
340 | _display_mimetype('application/javascript', objs, **kwargs) |
|
333 | _display_mimetype('application/javascript', objs, **kwargs) | |
341 |
|
334 | |||
342 |
|
335 | |||
343 | def display_pdf(*objs, **kwargs): |
|
336 | def display_pdf(*objs, **kwargs): | |
344 | """Display the PDF representation of an object. |
|
337 | """Display the PDF representation of an object. | |
345 |
|
338 | |||
346 | Parameters |
|
339 | Parameters | |
347 | ---------- |
|
340 | ---------- | |
348 | objs : tuple of objects |
|
341 | objs : tuple of objects | |
349 | The Python objects to display, or if raw=True raw javascript data to |
|
342 | The Python objects to display, or if raw=True raw javascript data to | |
350 | display. |
|
343 | display. | |
351 | raw : bool |
|
344 | raw : bool | |
352 | Are the data objects raw data or Python objects that need to be |
|
345 | Are the data objects raw data or Python objects that need to be | |
353 | formatted before display? [default: False] |
|
346 | formatted before display? [default: False] | |
354 | metadata : dict (optional) |
|
347 | metadata : dict (optional) | |
355 | Metadata to be associated with the specific mimetype output. |
|
348 | Metadata to be associated with the specific mimetype output. | |
356 | """ |
|
349 | """ | |
357 | _display_mimetype('application/pdf', objs, **kwargs) |
|
350 | _display_mimetype('application/pdf', objs, **kwargs) | |
358 |
|
351 | |||
359 |
|
352 | |||
360 | #----------------------------------------------------------------------------- |
|
353 | #----------------------------------------------------------------------------- | |
361 | # Smart classes |
|
354 | # Smart classes | |
362 | #----------------------------------------------------------------------------- |
|
355 | #----------------------------------------------------------------------------- | |
363 |
|
356 | |||
364 |
|
357 | |||
365 | class DisplayObject(object): |
|
358 | class DisplayObject(object): | |
366 | """An object that wraps data to be displayed.""" |
|
359 | """An object that wraps data to be displayed.""" | |
367 |
|
360 | |||
368 | _read_flags = 'r' |
|
361 | _read_flags = 'r' | |
369 | _show_mem_addr = False |
|
362 | _show_mem_addr = False | |
370 |
|
363 | |||
371 | def __init__(self, data=None, url=None, filename=None): |
|
364 | def __init__(self, data=None, url=None, filename=None): | |
372 | """Create a display object given raw data. |
|
365 | """Create a display object given raw data. | |
373 |
|
366 | |||
374 | When this object is returned by an expression or passed to the |
|
367 | When this object is returned by an expression or passed to the | |
375 | display function, it will result in the data being displayed |
|
368 | display function, it will result in the data being displayed | |
376 | in the frontend. The MIME type of the data should match the |
|
369 | in the frontend. The MIME type of the data should match the | |
377 | subclasses used, so the Png subclass should be used for 'image/png' |
|
370 | subclasses used, so the Png subclass should be used for 'image/png' | |
378 | data. If the data is a URL, the data will first be downloaded |
|
371 | data. If the data is a URL, the data will first be downloaded | |
379 | and then displayed. If |
|
372 | and then displayed. If | |
380 |
|
373 | |||
381 | Parameters |
|
374 | Parameters | |
382 | ---------- |
|
375 | ---------- | |
383 | data : unicode, str or bytes |
|
376 | data : unicode, str or bytes | |
384 | The raw data or a URL or file to load the data from |
|
377 | The raw data or a URL or file to load the data from | |
385 | url : unicode |
|
378 | url : unicode | |
386 | A URL to download the data from. |
|
379 | A URL to download the data from. | |
387 | filename : unicode |
|
380 | filename : unicode | |
388 | Path to a local file to load the data from. |
|
381 | Path to a local file to load the data from. | |
389 | """ |
|
382 | """ | |
390 | if data is not None and isinstance(data, string_types): |
|
383 | if data is not None and isinstance(data, string_types): | |
391 | if data.startswith('http') and url is None: |
|
384 | if data.startswith('http') and url is None: | |
392 | url = data |
|
385 | url = data | |
393 | filename = None |
|
386 | filename = None | |
394 | data = None |
|
387 | data = None | |
395 | elif _safe_exists(data) and filename is None: |
|
388 | elif _safe_exists(data) and filename is None: | |
396 | url = None |
|
389 | url = None | |
397 | filename = data |
|
390 | filename = data | |
398 | data = None |
|
391 | data = None | |
399 |
|
392 | |||
400 | self.data = data |
|
393 | self.data = data | |
401 | self.url = url |
|
394 | self.url = url | |
402 | self.filename = None if filename is None else unicode_type(filename) |
|
395 | self.filename = None if filename is None else unicode_type(filename) | |
403 |
|
396 | |||
404 | self.reload() |
|
397 | self.reload() | |
405 | self._check_data() |
|
398 | self._check_data() | |
406 |
|
399 | |||
407 | def __repr__(self): |
|
400 | def __repr__(self): | |
408 | if not self._show_mem_addr: |
|
401 | if not self._show_mem_addr: | |
409 | cls = self.__class__ |
|
402 | cls = self.__class__ | |
410 | r = "<%s.%s object>" % (cls.__module__, cls.__name__) |
|
403 | r = "<%s.%s object>" % (cls.__module__, cls.__name__) | |
411 | else: |
|
404 | else: | |
412 | r = super(DisplayObject, self).__repr__() |
|
405 | r = super(DisplayObject, self).__repr__() | |
413 | return r |
|
406 | return r | |
414 |
|
407 | |||
415 | def _check_data(self): |
|
408 | def _check_data(self): | |
416 | """Override in subclasses if there's something to check.""" |
|
409 | """Override in subclasses if there's something to check.""" | |
417 | pass |
|
410 | pass | |
418 |
|
411 | |||
419 | def reload(self): |
|
412 | def reload(self): | |
420 | """Reload the raw data from file or URL.""" |
|
413 | """Reload the raw data from file or URL.""" | |
421 | if self.filename is not None: |
|
414 | if self.filename is not None: | |
422 | with open(self.filename, self._read_flags) as f: |
|
415 | with open(self.filename, self._read_flags) as f: | |
423 | self.data = f.read() |
|
416 | self.data = f.read() | |
424 | elif self.url is not None: |
|
417 | elif self.url is not None: | |
425 | try: |
|
418 | try: | |
426 | try: |
|
419 | try: | |
427 | from urllib.request import urlopen # Py3 |
|
420 | from urllib.request import urlopen # Py3 | |
428 | except ImportError: |
|
421 | except ImportError: | |
429 | from urllib2 import urlopen |
|
422 | from urllib2 import urlopen | |
430 | response = urlopen(self.url) |
|
423 | response = urlopen(self.url) | |
431 | self.data = response.read() |
|
424 | self.data = response.read() | |
432 | # extract encoding from header, if there is one: |
|
425 | # extract encoding from header, if there is one: | |
433 | encoding = None |
|
426 | encoding = None | |
434 | for sub in response.headers['content-type'].split(';'): |
|
427 | for sub in response.headers['content-type'].split(';'): | |
435 | sub = sub.strip() |
|
428 | sub = sub.strip() | |
436 | if sub.startswith('charset'): |
|
429 | if sub.startswith('charset'): | |
437 | encoding = sub.split('=')[-1].strip() |
|
430 | encoding = sub.split('=')[-1].strip() | |
438 | break |
|
431 | break | |
439 | # decode data, if an encoding was specified |
|
432 | # decode data, if an encoding was specified | |
440 | if encoding: |
|
433 | if encoding: | |
441 | self.data = self.data.decode(encoding, 'replace') |
|
434 | self.data = self.data.decode(encoding, 'replace') | |
442 | except: |
|
435 | except: | |
443 | self.data = None |
|
436 | self.data = None | |
444 |
|
437 | |||
445 | class TextDisplayObject(DisplayObject): |
|
438 | class TextDisplayObject(DisplayObject): | |
446 | """Validate that display data is text""" |
|
439 | """Validate that display data is text""" | |
447 | def _check_data(self): |
|
440 | def _check_data(self): | |
448 | if self.data is not None and not isinstance(self.data, string_types): |
|
441 | if self.data is not None and not isinstance(self.data, string_types): | |
449 | raise TypeError("%s expects text, not %r" % (self.__class__.__name__, self.data)) |
|
442 | raise TypeError("%s expects text, not %r" % (self.__class__.__name__, self.data)) | |
450 |
|
443 | |||
451 | class Pretty(TextDisplayObject): |
|
444 | class Pretty(TextDisplayObject): | |
452 |
|
445 | |||
453 | def _repr_pretty_(self): |
|
446 | def _repr_pretty_(self): | |
454 | return self.data |
|
447 | return self.data | |
455 |
|
448 | |||
456 |
|
449 | |||
457 | class HTML(TextDisplayObject): |
|
450 | class HTML(TextDisplayObject): | |
458 |
|
451 | |||
459 | def _repr_html_(self): |
|
452 | def _repr_html_(self): | |
460 | return self.data |
|
453 | return self.data | |
461 |
|
454 | |||
462 | def __html__(self): |
|
455 | def __html__(self): | |
463 | """ |
|
456 | """ | |
464 | This method exists to inform other HTML-using modules (e.g. Markupsafe, |
|
457 | This method exists to inform other HTML-using modules (e.g. Markupsafe, | |
465 | htmltag, etc) that this object is HTML and does not need things like |
|
458 | htmltag, etc) that this object is HTML and does not need things like | |
466 | special characters (<>&) escaped. |
|
459 | special characters (<>&) escaped. | |
467 | """ |
|
460 | """ | |
468 | return self._repr_html_() |
|
461 | return self._repr_html_() | |
469 |
|
462 | |||
470 |
|
463 | |||
471 | class Markdown(TextDisplayObject): |
|
464 | class Markdown(TextDisplayObject): | |
472 |
|
465 | |||
473 | def _repr_markdown_(self): |
|
466 | def _repr_markdown_(self): | |
474 | return self.data |
|
467 | return self.data | |
475 |
|
468 | |||
476 |
|
469 | |||
477 | class Math(TextDisplayObject): |
|
470 | class Math(TextDisplayObject): | |
478 |
|
471 | |||
479 | def _repr_latex_(self): |
|
472 | def _repr_latex_(self): | |
480 | s = self.data.strip('$') |
|
473 | s = self.data.strip('$') | |
481 | return "$$%s$$" % s |
|
474 | return "$$%s$$" % s | |
482 |
|
475 | |||
483 |
|
476 | |||
484 | class Latex(TextDisplayObject): |
|
477 | class Latex(TextDisplayObject): | |
485 |
|
478 | |||
486 | def _repr_latex_(self): |
|
479 | def _repr_latex_(self): | |
487 | return self.data |
|
480 | return self.data | |
488 |
|
481 | |||
489 |
|
482 | |||
490 | class SVG(DisplayObject): |
|
483 | class SVG(DisplayObject): | |
491 |
|
484 | |||
492 | # wrap data in a property, which extracts the <svg> tag, discarding |
|
485 | # wrap data in a property, which extracts the <svg> tag, discarding | |
493 | # document headers |
|
486 | # document headers | |
494 | _data = None |
|
487 | _data = None | |
495 |
|
488 | |||
496 | @property |
|
489 | @property | |
497 | def data(self): |
|
490 | def data(self): | |
498 | return self._data |
|
491 | return self._data | |
499 |
|
492 | |||
500 | @data.setter |
|
493 | @data.setter | |
501 | def data(self, svg): |
|
494 | def data(self, svg): | |
502 | if svg is None: |
|
495 | if svg is None: | |
503 | self._data = None |
|
496 | self._data = None | |
504 | return |
|
497 | return | |
505 | # parse into dom object |
|
498 | # parse into dom object | |
506 | from xml.dom import minidom |
|
499 | from xml.dom import minidom | |
507 | svg = cast_bytes_py2(svg) |
|
500 | svg = cast_bytes_py2(svg) | |
508 | x = minidom.parseString(svg) |
|
501 | x = minidom.parseString(svg) | |
509 | # get svg tag (should be 1) |
|
502 | # get svg tag (should be 1) | |
510 | found_svg = x.getElementsByTagName('svg') |
|
503 | found_svg = x.getElementsByTagName('svg') | |
511 | if found_svg: |
|
504 | if found_svg: | |
512 | svg = found_svg[0].toxml() |
|
505 | svg = found_svg[0].toxml() | |
513 | else: |
|
506 | else: | |
514 | # fallback on the input, trust the user |
|
507 | # fallback on the input, trust the user | |
515 | # but this is probably an error. |
|
508 | # but this is probably an error. | |
516 | pass |
|
509 | pass | |
517 | svg = cast_unicode(svg) |
|
510 | svg = cast_unicode(svg) | |
518 | self._data = svg |
|
511 | self._data = svg | |
519 |
|
512 | |||
520 | def _repr_svg_(self): |
|
513 | def _repr_svg_(self): | |
521 | return self.data |
|
514 | return self.data | |
522 |
|
515 | |||
523 |
|
516 | |||
524 | class JSON(TextDisplayObject): |
|
517 | class JSON(TextDisplayObject): | |
525 |
|
518 | |||
526 | def _repr_json_(self): |
|
519 | def _repr_json_(self): | |
527 | return self.data |
|
520 | return self.data | |
528 |
|
521 | |||
529 | css_t = """$("head").append($("<link/>").attr({ |
|
522 | css_t = """$("head").append($("<link/>").attr({ | |
530 | rel: "stylesheet", |
|
523 | rel: "stylesheet", | |
531 | type: "text/css", |
|
524 | type: "text/css", | |
532 | href: "%s" |
|
525 | href: "%s" | |
533 | })); |
|
526 | })); | |
534 | """ |
|
527 | """ | |
535 |
|
528 | |||
536 | lib_t1 = """$.getScript("%s", function () { |
|
529 | lib_t1 = """$.getScript("%s", function () { | |
537 | """ |
|
530 | """ | |
538 | lib_t2 = """}); |
|
531 | lib_t2 = """}); | |
539 | """ |
|
532 | """ | |
540 |
|
533 | |||
541 | class Javascript(TextDisplayObject): |
|
534 | class Javascript(TextDisplayObject): | |
542 |
|
535 | |||
543 | def __init__(self, data=None, url=None, filename=None, lib=None, css=None): |
|
536 | def __init__(self, data=None, url=None, filename=None, lib=None, css=None): | |
544 | """Create a Javascript display object given raw data. |
|
537 | """Create a Javascript display object given raw data. | |
545 |
|
538 | |||
546 | When this object is returned by an expression or passed to the |
|
539 | When this object is returned by an expression or passed to the | |
547 | display function, it will result in the data being displayed |
|
540 | display function, it will result in the data being displayed | |
548 | in the frontend. If the data is a URL, the data will first be |
|
541 | in the frontend. If the data is a URL, the data will first be | |
549 | downloaded and then displayed. |
|
542 | downloaded and then displayed. | |
550 |
|
543 | |||
551 | In the Notebook, the containing element will be available as `element`, |
|
544 | In the Notebook, the containing element will be available as `element`, | |
552 | and jQuery will be available. Content appended to `element` will be |
|
545 | and jQuery will be available. Content appended to `element` will be | |
553 | visible in the output area. |
|
546 | visible in the output area. | |
554 |
|
547 | |||
555 | Parameters |
|
548 | Parameters | |
556 | ---------- |
|
549 | ---------- | |
557 | data : unicode, str or bytes |
|
550 | data : unicode, str or bytes | |
558 | The Javascript source code or a URL to download it from. |
|
551 | The Javascript source code or a URL to download it from. | |
559 | url : unicode |
|
552 | url : unicode | |
560 | A URL to download the data from. |
|
553 | A URL to download the data from. | |
561 | filename : unicode |
|
554 | filename : unicode | |
562 | Path to a local file to load the data from. |
|
555 | Path to a local file to load the data from. | |
563 | lib : list or str |
|
556 | lib : list or str | |
564 | A sequence of Javascript library URLs to load asynchronously before |
|
557 | A sequence of Javascript library URLs to load asynchronously before | |
565 | running the source code. The full URLs of the libraries should |
|
558 | running the source code. The full URLs of the libraries should | |
566 | be given. A single Javascript library URL can also be given as a |
|
559 | be given. A single Javascript library URL can also be given as a | |
567 | string. |
|
560 | string. | |
568 | css: : list or str |
|
561 | css: : list or str | |
569 | A sequence of css files to load before running the source code. |
|
562 | A sequence of css files to load before running the source code. | |
570 | The full URLs of the css files should be given. A single css URL |
|
563 | The full URLs of the css files should be given. A single css URL | |
571 | can also be given as a string. |
|
564 | can also be given as a string. | |
572 | """ |
|
565 | """ | |
573 | if isinstance(lib, string_types): |
|
566 | if isinstance(lib, string_types): | |
574 | lib = [lib] |
|
567 | lib = [lib] | |
575 | elif lib is None: |
|
568 | elif lib is None: | |
576 | lib = [] |
|
569 | lib = [] | |
577 | if isinstance(css, string_types): |
|
570 | if isinstance(css, string_types): | |
578 | css = [css] |
|
571 | css = [css] | |
579 | elif css is None: |
|
572 | elif css is None: | |
580 | css = [] |
|
573 | css = [] | |
581 | if not isinstance(lib, (list,tuple)): |
|
574 | if not isinstance(lib, (list,tuple)): | |
582 | raise TypeError('expected sequence, got: %r' % lib) |
|
575 | raise TypeError('expected sequence, got: %r' % lib) | |
583 | if not isinstance(css, (list,tuple)): |
|
576 | if not isinstance(css, (list,tuple)): | |
584 | raise TypeError('expected sequence, got: %r' % css) |
|
577 | raise TypeError('expected sequence, got: %r' % css) | |
585 | self.lib = lib |
|
578 | self.lib = lib | |
586 | self.css = css |
|
579 | self.css = css | |
587 | super(Javascript, self).__init__(data=data, url=url, filename=filename) |
|
580 | super(Javascript, self).__init__(data=data, url=url, filename=filename) | |
588 |
|
581 | |||
589 | def _repr_javascript_(self): |
|
582 | def _repr_javascript_(self): | |
590 | r = '' |
|
583 | r = '' | |
591 | for c in self.css: |
|
584 | for c in self.css: | |
592 | r += css_t % c |
|
585 | r += css_t % c | |
593 | for l in self.lib: |
|
586 | for l in self.lib: | |
594 | r += lib_t1 % l |
|
587 | r += lib_t1 % l | |
595 | r += self.data |
|
588 | r += self.data | |
596 | r += lib_t2*len(self.lib) |
|
589 | r += lib_t2*len(self.lib) | |
597 | return r |
|
590 | return r | |
598 |
|
591 | |||
599 | # constants for identifying png/jpeg data |
|
592 | # constants for identifying png/jpeg data | |
600 | _PNG = b'\x89PNG\r\n\x1a\n' |
|
593 | _PNG = b'\x89PNG\r\n\x1a\n' | |
601 | _JPEG = b'\xff\xd8' |
|
594 | _JPEG = b'\xff\xd8' | |
602 |
|
595 | |||
603 | def _pngxy(data): |
|
596 | def _pngxy(data): | |
604 | """read the (width, height) from a PNG header""" |
|
597 | """read the (width, height) from a PNG header""" | |
605 | ihdr = data.index(b'IHDR') |
|
598 | ihdr = data.index(b'IHDR') | |
606 | # next 8 bytes are width/height |
|
599 | # next 8 bytes are width/height | |
607 | w4h4 = data[ihdr+4:ihdr+12] |
|
600 | w4h4 = data[ihdr+4:ihdr+12] | |
608 | return struct.unpack('>ii', w4h4) |
|
601 | return struct.unpack('>ii', w4h4) | |
609 |
|
602 | |||
610 | def _jpegxy(data): |
|
603 | def _jpegxy(data): | |
611 | """read the (width, height) from a JPEG header""" |
|
604 | """read the (width, height) from a JPEG header""" | |
612 | # adapted from http://www.64lines.com/jpeg-width-height |
|
605 | # adapted from http://www.64lines.com/jpeg-width-height | |
613 |
|
606 | |||
614 | idx = 4 |
|
607 | idx = 4 | |
615 | while True: |
|
608 | while True: | |
616 | block_size = struct.unpack('>H', data[idx:idx+2])[0] |
|
609 | block_size = struct.unpack('>H', data[idx:idx+2])[0] | |
617 | idx = idx + block_size |
|
610 | idx = idx + block_size | |
618 | if data[idx:idx+2] == b'\xFF\xC0': |
|
611 | if data[idx:idx+2] == b'\xFF\xC0': | |
619 | # found Start of Frame |
|
612 | # found Start of Frame | |
620 | iSOF = idx |
|
613 | iSOF = idx | |
621 | break |
|
614 | break | |
622 | else: |
|
615 | else: | |
623 | # read another block |
|
616 | # read another block | |
624 | idx += 2 |
|
617 | idx += 2 | |
625 |
|
618 | |||
626 | h, w = struct.unpack('>HH', data[iSOF+5:iSOF+9]) |
|
619 | h, w = struct.unpack('>HH', data[iSOF+5:iSOF+9]) | |
627 | return w, h |
|
620 | return w, h | |
628 |
|
621 | |||
629 | class Image(DisplayObject): |
|
622 | class Image(DisplayObject): | |
630 |
|
623 | |||
631 | _read_flags = 'rb' |
|
624 | _read_flags = 'rb' | |
632 | _FMT_JPEG = u'jpeg' |
|
625 | _FMT_JPEG = u'jpeg' | |
633 | _FMT_PNG = u'png' |
|
626 | _FMT_PNG = u'png' | |
634 | _ACCEPTABLE_EMBEDDINGS = [_FMT_JPEG, _FMT_PNG] |
|
627 | _ACCEPTABLE_EMBEDDINGS = [_FMT_JPEG, _FMT_PNG] | |
635 |
|
628 | |||
636 | def __init__(self, data=None, url=None, filename=None, format=u'png', embed=None, width=None, height=None, retina=False): |
|
629 | def __init__(self, data=None, url=None, filename=None, format=u'png', embed=None, width=None, height=None, retina=False): | |
637 | """Create a PNG/JPEG image object given raw data. |
|
630 | """Create a PNG/JPEG image object given raw data. | |
638 |
|
631 | |||
639 | When this object is returned by an input cell or passed to the |
|
632 | When this object is returned by an input cell or passed to the | |
640 | display function, it will result in the image being displayed |
|
633 | display function, it will result in the image being displayed | |
641 | in the frontend. |
|
634 | in the frontend. | |
642 |
|
635 | |||
643 | Parameters |
|
636 | Parameters | |
644 | ---------- |
|
637 | ---------- | |
645 | data : unicode, str or bytes |
|
638 | data : unicode, str or bytes | |
646 | The raw image data or a URL or filename to load the data from. |
|
639 | The raw image data or a URL or filename to load the data from. | |
647 | This always results in embedded image data. |
|
640 | This always results in embedded image data. | |
648 | url : unicode |
|
641 | url : unicode | |
649 | A URL to download the data from. If you specify `url=`, |
|
642 | A URL to download the data from. If you specify `url=`, | |
650 | the image data will not be embedded unless you also specify `embed=True`. |
|
643 | the image data will not be embedded unless you also specify `embed=True`. | |
651 | filename : unicode |
|
644 | filename : unicode | |
652 | Path to a local file to load the data from. |
|
645 | Path to a local file to load the data from. | |
653 | Images from a file are always embedded. |
|
646 | Images from a file are always embedded. | |
654 | format : unicode |
|
647 | format : unicode | |
655 | The format of the image data (png/jpeg/jpg). If a filename or URL is given |
|
648 | The format of the image data (png/jpeg/jpg). If a filename or URL is given | |
656 | for format will be inferred from the filename extension. |
|
649 | for format will be inferred from the filename extension. | |
657 | embed : bool |
|
650 | embed : bool | |
658 | Should the image data be embedded using a data URI (True) or be |
|
651 | Should the image data be embedded using a data URI (True) or be | |
659 | loaded using an <img> tag. Set this to True if you want the image |
|
652 | loaded using an <img> tag. Set this to True if you want the image | |
660 | to be viewable later with no internet connection in the notebook. |
|
653 | to be viewable later with no internet connection in the notebook. | |
661 |
|
654 | |||
662 | Default is `True`, unless the keyword argument `url` is set, then |
|
655 | Default is `True`, unless the keyword argument `url` is set, then | |
663 | default value is `False`. |
|
656 | default value is `False`. | |
664 |
|
657 | |||
665 | Note that QtConsole is not able to display images if `embed` is set to `False` |
|
658 | Note that QtConsole is not able to display images if `embed` is set to `False` | |
666 | width : int |
|
659 | width : int | |
667 | Width to which to constrain the image in html |
|
660 | Width to which to constrain the image in html | |
668 | height : int |
|
661 | height : int | |
669 | Height to which to constrain the image in html |
|
662 | Height to which to constrain the image in html | |
670 | retina : bool |
|
663 | retina : bool | |
671 | Automatically set the width and height to half of the measured |
|
664 | Automatically set the width and height to half of the measured | |
672 | width and height. |
|
665 | width and height. | |
673 | This only works for embedded images because it reads the width/height |
|
666 | This only works for embedded images because it reads the width/height | |
674 | from image data. |
|
667 | from image data. | |
675 | For non-embedded images, you can just set the desired display width |
|
668 | For non-embedded images, you can just set the desired display width | |
676 | and height directly. |
|
669 | and height directly. | |
677 |
|
670 | |||
678 | Examples |
|
671 | Examples | |
679 | -------- |
|
672 | -------- | |
680 | # embedded image data, works in qtconsole and notebook |
|
673 | # embedded image data, works in qtconsole and notebook | |
681 | # when passed positionally, the first arg can be any of raw image data, |
|
674 | # when passed positionally, the first arg can be any of raw image data, | |
682 | # a URL, or a filename from which to load image data. |
|
675 | # a URL, or a filename from which to load image data. | |
683 | # The result is always embedding image data for inline images. |
|
676 | # The result is always embedding image data for inline images. | |
684 | Image('http://www.google.fr/images/srpr/logo3w.png') |
|
677 | Image('http://www.google.fr/images/srpr/logo3w.png') | |
685 | Image('/path/to/image.jpg') |
|
678 | Image('/path/to/image.jpg') | |
686 | Image(b'RAW_PNG_DATA...') |
|
679 | Image(b'RAW_PNG_DATA...') | |
687 |
|
680 | |||
688 | # Specifying Image(url=...) does not embed the image data, |
|
681 | # Specifying Image(url=...) does not embed the image data, | |
689 | # it only generates `<img>` tag with a link to the source. |
|
682 | # it only generates `<img>` tag with a link to the source. | |
690 | # This will not work in the qtconsole or offline. |
|
683 | # This will not work in the qtconsole or offline. | |
691 | Image(url='http://www.google.fr/images/srpr/logo3w.png') |
|
684 | Image(url='http://www.google.fr/images/srpr/logo3w.png') | |
692 |
|
685 | |||
693 | """ |
|
686 | """ | |
694 | if filename is not None: |
|
687 | if filename is not None: | |
695 | ext = self._find_ext(filename) |
|
688 | ext = self._find_ext(filename) | |
696 | elif url is not None: |
|
689 | elif url is not None: | |
697 | ext = self._find_ext(url) |
|
690 | ext = self._find_ext(url) | |
698 | elif data is None: |
|
691 | elif data is None: | |
699 | raise ValueError("No image data found. Expecting filename, url, or data.") |
|
692 | raise ValueError("No image data found. Expecting filename, url, or data.") | |
700 | elif isinstance(data, string_types) and ( |
|
693 | elif isinstance(data, string_types) and ( | |
701 | data.startswith('http') or _safe_exists(data) |
|
694 | data.startswith('http') or _safe_exists(data) | |
702 | ): |
|
695 | ): | |
703 | ext = self._find_ext(data) |
|
696 | ext = self._find_ext(data) | |
704 | else: |
|
697 | else: | |
705 | ext = None |
|
698 | ext = None | |
706 |
|
699 | |||
707 | if ext is not None: |
|
700 | if ext is not None: | |
708 | format = ext.lower() |
|
701 | format = ext.lower() | |
709 | if ext == u'jpg' or ext == u'jpeg': |
|
702 | if ext == u'jpg' or ext == u'jpeg': | |
710 | format = self._FMT_JPEG |
|
703 | format = self._FMT_JPEG | |
711 | if ext == u'png': |
|
704 | if ext == u'png': | |
712 | format = self._FMT_PNG |
|
705 | format = self._FMT_PNG | |
713 | elif isinstance(data, bytes) and format == 'png': |
|
706 | elif isinstance(data, bytes) and format == 'png': | |
714 | # infer image type from image data header, |
|
707 | # infer image type from image data header, | |
715 | # only if format might not have been specified. |
|
708 | # only if format might not have been specified. | |
716 | if data[:2] == _JPEG: |
|
709 | if data[:2] == _JPEG: | |
717 | format = 'jpeg' |
|
710 | format = 'jpeg' | |
718 |
|
711 | |||
719 | self.format = unicode_type(format).lower() |
|
712 | self.format = unicode_type(format).lower() | |
720 | self.embed = embed if embed is not None else (url is None) |
|
713 | self.embed = embed if embed is not None else (url is None) | |
721 |
|
714 | |||
722 | if self.embed and self.format not in self._ACCEPTABLE_EMBEDDINGS: |
|
715 | if self.embed and self.format not in self._ACCEPTABLE_EMBEDDINGS: | |
723 | raise ValueError("Cannot embed the '%s' image format" % (self.format)) |
|
716 | raise ValueError("Cannot embed the '%s' image format" % (self.format)) | |
724 | self.width = width |
|
717 | self.width = width | |
725 | self.height = height |
|
718 | self.height = height | |
726 | self.retina = retina |
|
719 | self.retina = retina | |
727 | super(Image, self).__init__(data=data, url=url, filename=filename) |
|
720 | super(Image, self).__init__(data=data, url=url, filename=filename) | |
728 |
|
721 | |||
729 | if retina: |
|
722 | if retina: | |
730 | self._retina_shape() |
|
723 | self._retina_shape() | |
731 |
|
724 | |||
732 | def _retina_shape(self): |
|
725 | def _retina_shape(self): | |
733 | """load pixel-doubled width and height from image data""" |
|
726 | """load pixel-doubled width and height from image data""" | |
734 | if not self.embed: |
|
727 | if not self.embed: | |
735 | return |
|
728 | return | |
736 | if self.format == 'png': |
|
729 | if self.format == 'png': | |
737 | w, h = _pngxy(self.data) |
|
730 | w, h = _pngxy(self.data) | |
738 | elif self.format == 'jpeg': |
|
731 | elif self.format == 'jpeg': | |
739 | w, h = _jpegxy(self.data) |
|
732 | w, h = _jpegxy(self.data) | |
740 | else: |
|
733 | else: | |
741 | # retina only supports png |
|
734 | # retina only supports png | |
742 | return |
|
735 | return | |
743 | self.width = w // 2 |
|
736 | self.width = w // 2 | |
744 | self.height = h // 2 |
|
737 | self.height = h // 2 | |
745 |
|
738 | |||
746 | def reload(self): |
|
739 | def reload(self): | |
747 | """Reload the raw data from file or URL.""" |
|
740 | """Reload the raw data from file or URL.""" | |
748 | if self.embed: |
|
741 | if self.embed: | |
749 | super(Image,self).reload() |
|
742 | super(Image,self).reload() | |
750 | if self.retina: |
|
743 | if self.retina: | |
751 | self._retina_shape() |
|
744 | self._retina_shape() | |
752 |
|
745 | |||
753 | def _repr_html_(self): |
|
746 | def _repr_html_(self): | |
754 | if not self.embed: |
|
747 | if not self.embed: | |
755 | width = height = '' |
|
748 | width = height = '' | |
756 | if self.width: |
|
749 | if self.width: | |
757 | width = ' width="%d"' % self.width |
|
750 | width = ' width="%d"' % self.width | |
758 | if self.height: |
|
751 | if self.height: | |
759 | height = ' height="%d"' % self.height |
|
752 | height = ' height="%d"' % self.height | |
760 | return u'<img src="%s"%s%s/>' % (self.url, width, height) |
|
753 | return u'<img src="%s"%s%s/>' % (self.url, width, height) | |
761 |
|
754 | |||
762 | def _data_and_metadata(self): |
|
755 | def _data_and_metadata(self): | |
763 | """shortcut for returning metadata with shape information, if defined""" |
|
756 | """shortcut for returning metadata with shape information, if defined""" | |
764 | md = {} |
|
757 | md = {} | |
765 | if self.width: |
|
758 | if self.width: | |
766 | md['width'] = self.width |
|
759 | md['width'] = self.width | |
767 | if self.height: |
|
760 | if self.height: | |
768 | md['height'] = self.height |
|
761 | md['height'] = self.height | |
769 | if md: |
|
762 | if md: | |
770 | return self.data, md |
|
763 | return self.data, md | |
771 | else: |
|
764 | else: | |
772 | return self.data |
|
765 | return self.data | |
773 |
|
766 | |||
774 | def _repr_png_(self): |
|
767 | def _repr_png_(self): | |
775 | if self.embed and self.format == u'png': |
|
768 | if self.embed and self.format == u'png': | |
776 | return self._data_and_metadata() |
|
769 | return self._data_and_metadata() | |
777 |
|
770 | |||
778 | def _repr_jpeg_(self): |
|
771 | def _repr_jpeg_(self): | |
779 | if self.embed and (self.format == u'jpeg' or self.format == u'jpg'): |
|
772 | if self.embed and (self.format == u'jpeg' or self.format == u'jpg'): | |
780 | return self._data_and_metadata() |
|
773 | return self._data_and_metadata() | |
781 |
|
774 | |||
782 | def _find_ext(self, s): |
|
775 | def _find_ext(self, s): | |
783 | return unicode_type(s.split('.')[-1].lower()) |
|
776 | return unicode_type(s.split('.')[-1].lower()) | |
784 |
|
777 | |||
785 | class Video(DisplayObject): |
|
778 | class Video(DisplayObject): | |
786 |
|
779 | |||
787 | def __init__(self, data=None, url=None, filename=None, embed=None, mimetype=None): |
|
780 | def __init__(self, data=None, url=None, filename=None, embed=None, mimetype=None): | |
788 | """Create a video object given raw data or an URL. |
|
781 | """Create a video object given raw data or an URL. | |
789 |
|
782 | |||
790 | When this object is returned by an input cell or passed to the |
|
783 | When this object is returned by an input cell or passed to the | |
791 | display function, it will result in the video being displayed |
|
784 | display function, it will result in the video being displayed | |
792 | in the frontend. |
|
785 | in the frontend. | |
793 |
|
786 | |||
794 | Parameters |
|
787 | Parameters | |
795 | ---------- |
|
788 | ---------- | |
796 | data : unicode, str or bytes |
|
789 | data : unicode, str or bytes | |
797 | The raw image data or a URL or filename to load the data from. |
|
790 | The raw image data or a URL or filename to load the data from. | |
798 | This always results in embedded image data. |
|
791 | This always results in embedded image data. | |
799 | url : unicode |
|
792 | url : unicode | |
800 | A URL to download the data from. If you specify `url=`, |
|
793 | A URL to download the data from. If you specify `url=`, | |
801 | the image data will not be embedded unless you also specify `embed=True`. |
|
794 | the image data will not be embedded unless you also specify `embed=True`. | |
802 | filename : unicode |
|
795 | filename : unicode | |
803 | Path to a local file to load the data from. |
|
796 | Path to a local file to load the data from. | |
804 | Videos from a file are always embedded. |
|
797 | Videos from a file are always embedded. | |
805 | embed : bool |
|
798 | embed : bool | |
806 | Should the image data be embedded using a data URI (True) or be |
|
799 | Should the image data be embedded using a data URI (True) or be | |
807 | loaded using an <img> tag. Set this to True if you want the image |
|
800 | loaded using an <img> tag. Set this to True if you want the image | |
808 | to be viewable later with no internet connection in the notebook. |
|
801 | to be viewable later with no internet connection in the notebook. | |
809 |
|
802 | |||
810 | Default is `True`, unless the keyword argument `url` is set, then |
|
803 | Default is `True`, unless the keyword argument `url` is set, then | |
811 | default value is `False`. |
|
804 | default value is `False`. | |
812 |
|
805 | |||
813 | Note that QtConsole is not able to display images if `embed` is set to `False` |
|
806 | Note that QtConsole is not able to display images if `embed` is set to `False` | |
814 | mimetype: unicode |
|
807 | mimetype: unicode | |
815 | Specify the mimetype in case you load in a encoded video. |
|
808 | Specify the mimetype in case you load in a encoded video. | |
816 | Examples |
|
809 | Examples | |
817 | -------- |
|
810 | -------- | |
818 | Video('https://archive.org/download/Sita_Sings_the_Blues/Sita_Sings_the_Blues_small.mp4') |
|
811 | Video('https://archive.org/download/Sita_Sings_the_Blues/Sita_Sings_the_Blues_small.mp4') | |
819 | Video('path/to/video.mp4') |
|
812 | Video('path/to/video.mp4') | |
820 | Video('path/to/video.mp4', embed=False) |
|
813 | Video('path/to/video.mp4', embed=False) | |
821 | """ |
|
814 | """ | |
822 | if url is None and (data.startswith('http') or data.startswith('https')): |
|
815 | if url is None and (data.startswith('http') or data.startswith('https')): | |
823 | url = data |
|
816 | url = data | |
824 | data = None |
|
817 | data = None | |
825 | embed = False |
|
818 | embed = False | |
826 | elif os.path.exists(data): |
|
819 | elif os.path.exists(data): | |
827 | filename = data |
|
820 | filename = data | |
828 | data = None |
|
821 | data = None | |
829 |
|
822 | |||
830 | self.mimetype = mimetype |
|
823 | self.mimetype = mimetype | |
831 | self.embed = embed if embed is not None else (filename is not None) |
|
824 | self.embed = embed if embed is not None else (filename is not None) | |
832 | super(Video, self).__init__(data=data, url=url, filename=filename) |
|
825 | super(Video, self).__init__(data=data, url=url, filename=filename) | |
833 |
|
826 | |||
834 | def _repr_html_(self): |
|
827 | def _repr_html_(self): | |
835 | # External URLs and potentially local files are not embedded into the |
|
828 | # External URLs and potentially local files are not embedded into the | |
836 | # notebook output. |
|
829 | # notebook output. | |
837 | if not self.embed: |
|
830 | if not self.embed: | |
838 | url = self.url if self.url is not None else self.filename |
|
831 | url = self.url if self.url is not None else self.filename | |
839 | output = """<video src="{0}" controls> |
|
832 | output = """<video src="{0}" controls> | |
840 | Your browser does not support the <code>video</code> element. |
|
833 | Your browser does not support the <code>video</code> element. | |
841 | </video>""".format(url) |
|
834 | </video>""".format(url) | |
842 | return output |
|
835 | return output | |
843 | # Embedded videos uses base64 encoded videos. |
|
836 | # Embedded videos uses base64 encoded videos. | |
844 | if self.filename is not None: |
|
837 | if self.filename is not None: | |
845 | mimetypes.init() |
|
838 | mimetypes.init() | |
846 | mimetype, encoding = mimetypes.guess_type(self.filename) |
|
839 | mimetype, encoding = mimetypes.guess_type(self.filename) | |
847 |
|
840 | |||
848 | video = open(self.filename, 'rb').read() |
|
841 | video = open(self.filename, 'rb').read() | |
849 | video_encoded = video.encode('base64') |
|
842 | video_encoded = video.encode('base64') | |
850 | else: |
|
843 | else: | |
851 | video_encoded = self.data |
|
844 | video_encoded = self.data | |
852 | mimetype = self.mimetype |
|
845 | mimetype = self.mimetype | |
853 | output = """<video controls> |
|
846 | output = """<video controls> | |
854 | <source src="data:{0};base64,{1}" type="{0}"> |
|
847 | <source src="data:{0};base64,{1}" type="{0}"> | |
855 | Your browser does not support the video tag. |
|
848 | Your browser does not support the video tag. | |
856 | </video>""".format(mimetype, video_encoded) |
|
849 | </video>""".format(mimetype, video_encoded) | |
857 | return output |
|
850 | return output | |
858 |
|
851 | |||
859 | def reload(self): |
|
852 | def reload(self): | |
860 | # TODO |
|
853 | # TODO | |
861 | pass |
|
854 | pass | |
862 |
|
855 | |||
863 | def _repr_png_(self): |
|
856 | def _repr_png_(self): | |
864 | # TODO |
|
857 | # TODO | |
865 | pass |
|
858 | pass | |
866 | def _repr_jpeg_(self): |
|
859 | def _repr_jpeg_(self): | |
867 | # TODO |
|
860 | # TODO | |
868 | pass |
|
861 | pass | |
869 |
|
862 | |||
870 | def clear_output(wait=False): |
|
863 | def clear_output(wait=False): | |
871 | """Clear the output of the current cell receiving output. |
|
864 | """Clear the output of the current cell receiving output. | |
872 |
|
865 | |||
873 | Parameters |
|
866 | Parameters | |
874 | ---------- |
|
867 | ---------- | |
875 | wait : bool [default: false] |
|
868 | wait : bool [default: false] | |
876 | Wait to clear the output until new output is available to replace it.""" |
|
869 | Wait to clear the output until new output is available to replace it.""" | |
877 | from IPython.core.interactiveshell import InteractiveShell |
|
870 | from IPython.core.interactiveshell import InteractiveShell | |
878 | if InteractiveShell.initialized(): |
|
871 | if InteractiveShell.initialized(): | |
879 | InteractiveShell.instance().display_pub.clear_output(wait) |
|
872 | InteractiveShell.instance().display_pub.clear_output(wait) | |
880 | else: |
|
873 | else: | |
881 | from IPython.utils import io |
|
874 | from IPython.utils import io | |
882 | print('\033[2K\r', file=io.stdout, end='') |
|
875 | print('\033[2K\r', file=io.stdout, end='') | |
883 | io.stdout.flush() |
|
876 | io.stdout.flush() | |
884 | print('\033[2K\r', file=io.stderr, end='') |
|
877 | print('\033[2K\r', file=io.stderr, end='') | |
885 | io.stderr.flush() |
|
878 | io.stderr.flush() | |
886 |
|
879 | |||
887 |
|
880 | |||
888 | @skip_doctest |
|
881 | @skip_doctest | |
889 | def set_matplotlib_formats(*formats, **kwargs): |
|
882 | def set_matplotlib_formats(*formats, **kwargs): | |
890 | """Select figure formats for the inline backend. Optionally pass quality for JPEG. |
|
883 | """Select figure formats for the inline backend. Optionally pass quality for JPEG. | |
891 |
|
884 | |||
892 | For example, this enables PNG and JPEG output with a JPEG quality of 90%:: |
|
885 | For example, this enables PNG and JPEG output with a JPEG quality of 90%:: | |
893 |
|
886 | |||
894 | In [1]: set_matplotlib_formats('png', 'jpeg', quality=90) |
|
887 | In [1]: set_matplotlib_formats('png', 'jpeg', quality=90) | |
895 |
|
888 | |||
896 | To set this in your config files use the following:: |
|
889 | To set this in your config files use the following:: | |
897 |
|
890 | |||
898 | c.InlineBackend.figure_formats = {'png', 'jpeg'} |
|
891 | c.InlineBackend.figure_formats = {'png', 'jpeg'} | |
899 | c.InlineBackend.print_figure_kwargs.update({'quality' : 90}) |
|
892 | c.InlineBackend.print_figure_kwargs.update({'quality' : 90}) | |
900 |
|
893 | |||
901 | Parameters |
|
894 | Parameters | |
902 | ---------- |
|
895 | ---------- | |
903 | *formats : strs |
|
896 | *formats : strs | |
904 | One or more figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'. |
|
897 | One or more figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'. | |
905 | **kwargs : |
|
898 | **kwargs : | |
906 | Keyword args will be relayed to ``figure.canvas.print_figure``. |
|
899 | Keyword args will be relayed to ``figure.canvas.print_figure``. | |
907 | """ |
|
900 | """ | |
908 | from IPython.core.interactiveshell import InteractiveShell |
|
901 | from IPython.core.interactiveshell import InteractiveShell | |
909 | from IPython.core.pylabtools import select_figure_formats |
|
902 | from IPython.core.pylabtools import select_figure_formats | |
910 | from IPython.kernel.zmq.pylab.config import InlineBackend |
|
903 | from IPython.kernel.zmq.pylab.config import InlineBackend | |
911 | # build kwargs, starting with InlineBackend config |
|
904 | # build kwargs, starting with InlineBackend config | |
912 | kw = {} |
|
905 | kw = {} | |
913 | cfg = InlineBackend.instance() |
|
906 | cfg = InlineBackend.instance() | |
914 | kw.update(cfg.print_figure_kwargs) |
|
907 | kw.update(cfg.print_figure_kwargs) | |
915 | kw.update(**kwargs) |
|
908 | kw.update(**kwargs) | |
916 | shell = InteractiveShell.instance() |
|
909 | shell = InteractiveShell.instance() | |
917 | select_figure_formats(shell, formats, **kw) |
|
910 | select_figure_formats(shell, formats, **kw) | |
918 |
|
911 | |||
919 | @skip_doctest |
|
912 | @skip_doctest | |
920 | def set_matplotlib_close(close=True): |
|
913 | def set_matplotlib_close(close=True): | |
921 | """Set whether the inline backend closes all figures automatically or not. |
|
914 | """Set whether the inline backend closes all figures automatically or not. | |
922 |
|
915 | |||
923 | By default, the inline backend used in the IPython Notebook will close all |
|
916 | By default, the inline backend used in the IPython Notebook will close all | |
924 | matplotlib figures automatically after each cell is run. This means that |
|
917 | matplotlib figures automatically after each cell is run. This means that | |
925 | plots in different cells won't interfere. Sometimes, you may want to make |
|
918 | plots in different cells won't interfere. Sometimes, you may want to make | |
926 | a plot in one cell and then refine it in later cells. This can be accomplished |
|
919 | a plot in one cell and then refine it in later cells. This can be accomplished | |
927 | by:: |
|
920 | by:: | |
928 |
|
921 | |||
929 | In [1]: set_matplotlib_close(False) |
|
922 | In [1]: set_matplotlib_close(False) | |
930 |
|
923 | |||
931 | To set this in your config files use the following:: |
|
924 | To set this in your config files use the following:: | |
932 |
|
925 | |||
933 | c.InlineBackend.close_figures = False |
|
926 | c.InlineBackend.close_figures = False | |
934 |
|
927 | |||
935 | Parameters |
|
928 | Parameters | |
936 | ---------- |
|
929 | ---------- | |
937 | close : bool |
|
930 | close : bool | |
938 | Should all matplotlib figures be automatically closed after each cell is |
|
931 | Should all matplotlib figures be automatically closed after each cell is | |
939 | run? |
|
932 | run? | |
940 | """ |
|
933 | """ | |
941 | from IPython.kernel.zmq.pylab.config import InlineBackend |
|
934 | from IPython.kernel.zmq.pylab.config import InlineBackend | |
942 | cfg = InlineBackend.instance() |
|
935 | cfg = InlineBackend.instance() | |
943 | cfg.close_figures = close |
|
936 | cfg.close_figures = close | |
944 |
|
937 |
@@ -1,282 +1,275 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Displayhook for IPython. |
|
2 | """Displayhook for IPython. | |
3 |
|
3 | |||
4 | This defines a callable class that IPython uses for `sys.displayhook`. |
|
4 | This defines a callable class that IPython uses for `sys.displayhook`. | |
5 | """ |
|
5 | """ | |
6 |
|
6 | |||
7 | # Copyright (c) IPython Development Team. |
|
7 | # Copyright (c) IPython Development Team. | |
8 | # Distributed under the terms of the Modified BSD License. |
|
8 | # Distributed under the terms of the Modified BSD License. | |
9 |
|
9 | |||
10 | from __future__ import print_function |
|
10 | from __future__ import print_function | |
11 |
|
11 | |||
12 | import sys |
|
12 | import sys | |
13 |
|
13 | |||
14 | from IPython.core.formatters import _safe_get_formatter_method |
|
14 | from IPython.core.formatters import _safe_get_formatter_method | |
15 | from IPython.config.configurable import Configurable |
|
15 | from IPython.config.configurable import Configurable | |
16 | from IPython.utils import io |
|
16 | from IPython.utils import io | |
17 | from IPython.utils.py3compat import builtin_mod |
|
17 | from IPython.utils.py3compat import builtin_mod | |
18 | from IPython.utils.traitlets import Instance, Float |
|
18 | from IPython.utils.traitlets import Instance, Float | |
19 | from IPython.utils.warn import warn |
|
19 | from IPython.utils.warn import warn | |
20 |
|
20 | |||
21 | # TODO: Move the various attributes (cache_size, [others now moved]). Some |
|
21 | # TODO: Move the various attributes (cache_size, [others now moved]). Some | |
22 | # of these are also attributes of InteractiveShell. They should be on ONE object |
|
22 | # of these are also attributes of InteractiveShell. They should be on ONE object | |
23 | # only and the other objects should ask that one object for their values. |
|
23 | # only and the other objects should ask that one object for their values. | |
24 |
|
24 | |||
25 | class DisplayHook(Configurable): |
|
25 | class DisplayHook(Configurable): | |
26 | """The custom IPython displayhook to replace sys.displayhook. |
|
26 | """The custom IPython displayhook to replace sys.displayhook. | |
27 |
|
27 | |||
28 | This class does many things, but the basic idea is that it is a callable |
|
28 | This class does many things, but the basic idea is that it is a callable | |
29 | that gets called anytime user code returns a value. |
|
29 | that gets called anytime user code returns a value. | |
30 | """ |
|
30 | """ | |
31 |
|
31 | |||
32 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
32 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
33 | cull_fraction = Float(0.2) |
|
33 | cull_fraction = Float(0.2) | |
34 |
|
34 | |||
35 | def __init__(self, shell=None, cache_size=1000, **kwargs): |
|
35 | def __init__(self, shell=None, cache_size=1000, **kwargs): | |
36 | super(DisplayHook, self).__init__(shell=shell, **kwargs) |
|
36 | super(DisplayHook, self).__init__(shell=shell, **kwargs) | |
37 | cache_size_min = 3 |
|
37 | cache_size_min = 3 | |
38 | if cache_size <= 0: |
|
38 | if cache_size <= 0: | |
39 | self.do_full_cache = 0 |
|
39 | self.do_full_cache = 0 | |
40 | cache_size = 0 |
|
40 | cache_size = 0 | |
41 | elif cache_size < cache_size_min: |
|
41 | elif cache_size < cache_size_min: | |
42 | self.do_full_cache = 0 |
|
42 | self.do_full_cache = 0 | |
43 | cache_size = 0 |
|
43 | cache_size = 0 | |
44 | warn('caching was disabled (min value for cache size is %s).' % |
|
44 | warn('caching was disabled (min value for cache size is %s).' % | |
45 | cache_size_min,level=3) |
|
45 | cache_size_min,level=3) | |
46 | else: |
|
46 | else: | |
47 | self.do_full_cache = 1 |
|
47 | self.do_full_cache = 1 | |
48 |
|
48 | |||
49 | self.cache_size = cache_size |
|
49 | self.cache_size = cache_size | |
50 |
|
50 | |||
51 | # we need a reference to the user-level namespace |
|
51 | # we need a reference to the user-level namespace | |
52 | self.shell = shell |
|
52 | self.shell = shell | |
53 |
|
53 | |||
54 | self._,self.__,self.___ = '','','' |
|
54 | self._,self.__,self.___ = '','','' | |
55 |
|
55 | |||
56 | # these are deliberately global: |
|
56 | # these are deliberately global: | |
57 | to_user_ns = {'_':self._,'__':self.__,'___':self.___} |
|
57 | to_user_ns = {'_':self._,'__':self.__,'___':self.___} | |
58 | self.shell.user_ns.update(to_user_ns) |
|
58 | self.shell.user_ns.update(to_user_ns) | |
59 |
|
59 | |||
60 | @property |
|
60 | @property | |
61 | def prompt_count(self): |
|
61 | def prompt_count(self): | |
62 | return self.shell.execution_count |
|
62 | return self.shell.execution_count | |
63 |
|
63 | |||
64 | #------------------------------------------------------------------------- |
|
64 | #------------------------------------------------------------------------- | |
65 | # Methods used in __call__. Override these methods to modify the behavior |
|
65 | # Methods used in __call__. Override these methods to modify the behavior | |
66 | # of the displayhook. |
|
66 | # of the displayhook. | |
67 | #------------------------------------------------------------------------- |
|
67 | #------------------------------------------------------------------------- | |
68 |
|
68 | |||
69 | def check_for_underscore(self): |
|
69 | def check_for_underscore(self): | |
70 | """Check if the user has set the '_' variable by hand.""" |
|
70 | """Check if the user has set the '_' variable by hand.""" | |
71 | # If something injected a '_' variable in __builtin__, delete |
|
71 | # If something injected a '_' variable in __builtin__, delete | |
72 | # ipython's automatic one so we don't clobber that. gettext() in |
|
72 | # ipython's automatic one so we don't clobber that. gettext() in | |
73 | # particular uses _, so we need to stay away from it. |
|
73 | # particular uses _, so we need to stay away from it. | |
74 | if '_' in builtin_mod.__dict__: |
|
74 | if '_' in builtin_mod.__dict__: | |
75 | try: |
|
75 | try: | |
76 | del self.shell.user_ns['_'] |
|
76 | del self.shell.user_ns['_'] | |
77 | except KeyError: |
|
77 | except KeyError: | |
78 | pass |
|
78 | pass | |
79 |
|
79 | |||
80 | def quiet(self): |
|
80 | def quiet(self): | |
81 | """Should we silence the display hook because of ';'?""" |
|
81 | """Should we silence the display hook because of ';'?""" | |
82 | # do not print output if input ends in ';' |
|
82 | # do not print output if input ends in ';' | |
83 | try: |
|
83 | try: | |
84 | cell = self.shell.history_manager.input_hist_parsed[self.prompt_count] |
|
84 | cell = self.shell.history_manager.input_hist_parsed[self.prompt_count] | |
85 | return cell.rstrip().endswith(';') |
|
85 | return cell.rstrip().endswith(';') | |
86 | except IndexError: |
|
86 | except IndexError: | |
87 | # some uses of ipshellembed may fail here |
|
87 | # some uses of ipshellembed may fail here | |
88 | return False |
|
88 | return False | |
89 |
|
89 | |||
90 | def start_displayhook(self): |
|
90 | def start_displayhook(self): | |
91 | """Start the displayhook, initializing resources.""" |
|
91 | """Start the displayhook, initializing resources.""" | |
92 | pass |
|
92 | pass | |
93 |
|
93 | |||
94 | def write_output_prompt(self): |
|
94 | def write_output_prompt(self): | |
95 | """Write the output prompt. |
|
95 | """Write the output prompt. | |
96 |
|
96 | |||
97 | The default implementation simply writes the prompt to |
|
97 | The default implementation simply writes the prompt to | |
98 | ``io.stdout``. |
|
98 | ``io.stdout``. | |
99 | """ |
|
99 | """ | |
100 | # Use write, not print which adds an extra space. |
|
100 | # Use write, not print which adds an extra space. | |
101 | io.stdout.write(self.shell.separate_out) |
|
101 | io.stdout.write(self.shell.separate_out) | |
102 | outprompt = self.shell.prompt_manager.render('out') |
|
102 | outprompt = self.shell.prompt_manager.render('out') | |
103 | if self.do_full_cache: |
|
103 | if self.do_full_cache: | |
104 | io.stdout.write(outprompt) |
|
104 | io.stdout.write(outprompt) | |
105 |
|
105 | |||
106 | def compute_format_data(self, result): |
|
106 | def compute_format_data(self, result): | |
107 | """Compute format data of the object to be displayed. |
|
107 | """Compute format data of the object to be displayed. | |
108 |
|
108 | |||
109 | The format data is a generalization of the :func:`repr` of an object. |
|
109 | The format data is a generalization of the :func:`repr` of an object. | |
110 | In the default implementation the format data is a :class:`dict` of |
|
110 | In the default implementation the format data is a :class:`dict` of | |
111 | key value pair where the keys are valid MIME types and the values |
|
111 | key value pair where the keys are valid MIME types and the values | |
112 | are JSON'able data structure containing the raw data for that MIME |
|
112 | are JSON'able data structure containing the raw data for that MIME | |
113 | type. It is up to frontends to determine pick a MIME to to use and |
|
113 | type. It is up to frontends to determine pick a MIME to to use and | |
114 | display that data in an appropriate manner. |
|
114 | display that data in an appropriate manner. | |
115 |
|
115 | |||
116 | This method only computes the format data for the object and should |
|
116 | This method only computes the format data for the object and should | |
117 | NOT actually print or write that to a stream. |
|
117 | NOT actually print or write that to a stream. | |
118 |
|
118 | |||
119 | Parameters |
|
119 | Parameters | |
120 | ---------- |
|
120 | ---------- | |
121 | result : object |
|
121 | result : object | |
122 | The Python object passed to the display hook, whose format will be |
|
122 | The Python object passed to the display hook, whose format will be | |
123 | computed. |
|
123 | computed. | |
124 |
|
124 | |||
125 | Returns |
|
125 | Returns | |
126 | ------- |
|
126 | ------- | |
127 | (format_dict, md_dict) : dict |
|
127 | (format_dict, md_dict) : dict | |
128 | format_dict is a :class:`dict` whose keys are valid MIME types and values are |
|
128 | format_dict is a :class:`dict` whose keys are valid MIME types and values are | |
129 | JSON'able raw data for that MIME type. It is recommended that |
|
129 | JSON'able raw data for that MIME type. It is recommended that | |
130 | all return values of this should always include the "text/plain" |
|
130 | all return values of this should always include the "text/plain" | |
131 | MIME type representation of the object. |
|
131 | MIME type representation of the object. | |
132 | md_dict is a :class:`dict` with the same MIME type keys |
|
132 | md_dict is a :class:`dict` with the same MIME type keys | |
133 | of metadata associated with each output. |
|
133 | of metadata associated with each output. | |
134 |
|
134 | |||
135 | """ |
|
135 | """ | |
136 | return self.shell.display_formatter.format(result) |
|
136 | return self.shell.display_formatter.format(result) | |
137 |
|
137 | |||
138 | def write_format_data(self, format_dict, md_dict=None): |
|
138 | def write_format_data(self, format_dict, md_dict=None): | |
139 | """Write the format data dict to the frontend. |
|
139 | """Write the format data dict to the frontend. | |
140 |
|
140 | |||
141 | This default version of this method simply writes the plain text |
|
141 | This default version of this method simply writes the plain text | |
142 | representation of the object to ``io.stdout``. Subclasses should |
|
142 | representation of the object to ``io.stdout``. Subclasses should | |
143 | override this method to send the entire `format_dict` to the |
|
143 | override this method to send the entire `format_dict` to the | |
144 | frontends. |
|
144 | frontends. | |
145 |
|
145 | |||
146 | Parameters |
|
146 | Parameters | |
147 | ---------- |
|
147 | ---------- | |
148 | format_dict : dict |
|
148 | format_dict : dict | |
149 | The format dict for the object passed to `sys.displayhook`. |
|
149 | The format dict for the object passed to `sys.displayhook`. | |
150 | md_dict : dict (optional) |
|
150 | md_dict : dict (optional) | |
151 | The metadata dict to be associated with the display data. |
|
151 | The metadata dict to be associated with the display data. | |
152 | """ |
|
152 | """ | |
153 | if 'text/plain' not in format_dict: |
|
153 | if 'text/plain' not in format_dict: | |
154 | # nothing to do |
|
154 | # nothing to do | |
155 | return |
|
155 | return | |
156 | # We want to print because we want to always make sure we have a |
|
156 | # We want to print because we want to always make sure we have a | |
157 | # newline, even if all the prompt separators are ''. This is the |
|
157 | # newline, even if all the prompt separators are ''. This is the | |
158 | # standard IPython behavior. |
|
158 | # standard IPython behavior. | |
159 | result_repr = format_dict['text/plain'] |
|
159 | result_repr = format_dict['text/plain'] | |
160 | if '\n' in result_repr: |
|
160 | if '\n' in result_repr: | |
161 | # So that multi-line strings line up with the left column of |
|
161 | # So that multi-line strings line up with the left column of | |
162 | # the screen, instead of having the output prompt mess up |
|
162 | # the screen, instead of having the output prompt mess up | |
163 | # their first line. |
|
163 | # their first line. | |
164 | # We use the prompt template instead of the expanded prompt |
|
164 | # We use the prompt template instead of the expanded prompt | |
165 | # because the expansion may add ANSI escapes that will interfere |
|
165 | # because the expansion may add ANSI escapes that will interfere | |
166 | # with our ability to determine whether or not we should add |
|
166 | # with our ability to determine whether or not we should add | |
167 | # a newline. |
|
167 | # a newline. | |
168 | prompt_template = self.shell.prompt_manager.out_template |
|
168 | prompt_template = self.shell.prompt_manager.out_template | |
169 | if prompt_template and not prompt_template.endswith('\n'): |
|
169 | if prompt_template and not prompt_template.endswith('\n'): | |
170 | # But avoid extraneous empty lines. |
|
170 | # But avoid extraneous empty lines. | |
171 | result_repr = '\n' + result_repr |
|
171 | result_repr = '\n' + result_repr | |
172 |
|
172 | |||
173 | print(result_repr, file=io.stdout) |
|
173 | print(result_repr, file=io.stdout) | |
174 |
|
174 | |||
175 | def update_user_ns(self, result): |
|
175 | def update_user_ns(self, result): | |
176 | """Update user_ns with various things like _, __, _1, etc.""" |
|
176 | """Update user_ns with various things like _, __, _1, etc.""" | |
177 |
|
177 | |||
178 | # Avoid recursive reference when displaying _oh/Out |
|
178 | # Avoid recursive reference when displaying _oh/Out | |
179 | if result is not self.shell.user_ns['_oh']: |
|
179 | if result is not self.shell.user_ns['_oh']: | |
180 | if len(self.shell.user_ns['_oh']) >= self.cache_size and self.do_full_cache: |
|
180 | if len(self.shell.user_ns['_oh']) >= self.cache_size and self.do_full_cache: | |
181 | self.cull_cache() |
|
181 | self.cull_cache() | |
182 | # Don't overwrite '_' and friends if '_' is in __builtin__ (otherwise |
|
182 | # Don't overwrite '_' and friends if '_' is in __builtin__ (otherwise | |
183 | # we cause buggy behavior for things like gettext). |
|
183 | # we cause buggy behavior for things like gettext). | |
184 |
|
184 | |||
185 | if '_' not in builtin_mod.__dict__: |
|
185 | if '_' not in builtin_mod.__dict__: | |
186 | self.___ = self.__ |
|
186 | self.___ = self.__ | |
187 | self.__ = self._ |
|
187 | self.__ = self._ | |
188 | self._ = result |
|
188 | self._ = result | |
189 | self.shell.push({'_':self._, |
|
189 | self.shell.push({'_':self._, | |
190 | '__':self.__, |
|
190 | '__':self.__, | |
191 | '___':self.___}, interactive=False) |
|
191 | '___':self.___}, interactive=False) | |
192 |
|
192 | |||
193 | # hackish access to top-level namespace to create _1,_2... dynamically |
|
193 | # hackish access to top-level namespace to create _1,_2... dynamically | |
194 | to_main = {} |
|
194 | to_main = {} | |
195 | if self.do_full_cache: |
|
195 | if self.do_full_cache: | |
196 | new_result = '_'+repr(self.prompt_count) |
|
196 | new_result = '_'+repr(self.prompt_count) | |
197 | to_main[new_result] = result |
|
197 | to_main[new_result] = result | |
198 | self.shell.push(to_main, interactive=False) |
|
198 | self.shell.push(to_main, interactive=False) | |
199 | self.shell.user_ns['_oh'][self.prompt_count] = result |
|
199 | self.shell.user_ns['_oh'][self.prompt_count] = result | |
200 |
|
200 | |||
201 | def log_output(self, format_dict): |
|
201 | def log_output(self, format_dict): | |
202 | """Log the output.""" |
|
202 | """Log the output.""" | |
203 | if 'text/plain' not in format_dict: |
|
203 | if 'text/plain' not in format_dict: | |
204 | # nothing to do |
|
204 | # nothing to do | |
205 | return |
|
205 | return | |
206 | if self.shell.logger.log_output: |
|
206 | if self.shell.logger.log_output: | |
207 | self.shell.logger.log_write(format_dict['text/plain'], 'output') |
|
207 | self.shell.logger.log_write(format_dict['text/plain'], 'output') | |
208 | self.shell.history_manager.output_hist_reprs[self.prompt_count] = \ |
|
208 | self.shell.history_manager.output_hist_reprs[self.prompt_count] = \ | |
209 | format_dict['text/plain'] |
|
209 | format_dict['text/plain'] | |
210 |
|
210 | |||
211 | def finish_displayhook(self): |
|
211 | def finish_displayhook(self): | |
212 | """Finish up all displayhook activities.""" |
|
212 | """Finish up all displayhook activities.""" | |
213 | io.stdout.write(self.shell.separate_out2) |
|
213 | io.stdout.write(self.shell.separate_out2) | |
214 | io.stdout.flush() |
|
214 | io.stdout.flush() | |
215 |
|
215 | |||
216 | def __call__(self, result=None): |
|
216 | def __call__(self, result=None): | |
217 | """Printing with history cache management. |
|
217 | """Printing with history cache management. | |
218 |
|
218 | |||
219 | This is invoked everytime the interpreter needs to print, and is |
|
219 | This is invoked everytime the interpreter needs to print, and is | |
220 | activated by setting the variable sys.displayhook to it. |
|
220 | activated by setting the variable sys.displayhook to it. | |
221 | """ |
|
221 | """ | |
222 | self.check_for_underscore() |
|
222 | self.check_for_underscore() | |
223 | if result is not None and not self.quiet(): |
|
223 | if result is not None and not self.quiet(): | |
224 | # If _ipython_display_ is defined, use that to display this object. |
|
|||
225 | display_method = _safe_get_formatter_method(result, '_ipython_display_') |
|
|||
226 | if display_method is not None: |
|
|||
227 | try: |
|
|||
228 | return display_method() |
|
|||
229 | except NotImplementedError: |
|
|||
230 | pass |
|
|||
231 |
|
||||
232 | self.start_displayhook() |
|
224 | self.start_displayhook() | |
233 | self.write_output_prompt() |
|
225 | self.write_output_prompt() | |
234 | format_dict, md_dict = self.compute_format_data(result) |
|
226 | format_dict, md_dict = self.compute_format_data(result) | |
235 | self.write_format_data(format_dict, md_dict) |
|
|||
236 | self.update_user_ns(result) |
|
227 | self.update_user_ns(result) | |
|
228 | if format_dict: | |||
|
229 | self.write_format_data(format_dict, md_dict) | |||
237 | self.log_output(format_dict) |
|
230 | self.log_output(format_dict) | |
238 | self.finish_displayhook() |
|
231 | self.finish_displayhook() | |
239 |
|
232 | |||
240 | def cull_cache(self): |
|
233 | def cull_cache(self): | |
241 | """Output cache is full, cull the oldest entries""" |
|
234 | """Output cache is full, cull the oldest entries""" | |
242 | oh = self.shell.user_ns.get('_oh', {}) |
|
235 | oh = self.shell.user_ns.get('_oh', {}) | |
243 | sz = len(oh) |
|
236 | sz = len(oh) | |
244 | cull_count = max(int(sz * self.cull_fraction), 2) |
|
237 | cull_count = max(int(sz * self.cull_fraction), 2) | |
245 | warn('Output cache limit (currently {sz} entries) hit.\n' |
|
238 | warn('Output cache limit (currently {sz} entries) hit.\n' | |
246 | 'Flushing oldest {cull_count} entries.'.format(sz=sz, cull_count=cull_count)) |
|
239 | 'Flushing oldest {cull_count} entries.'.format(sz=sz, cull_count=cull_count)) | |
247 |
|
240 | |||
248 | for i, n in enumerate(sorted(oh)): |
|
241 | for i, n in enumerate(sorted(oh)): | |
249 | if i >= cull_count: |
|
242 | if i >= cull_count: | |
250 | break |
|
243 | break | |
251 | self.shell.user_ns.pop('_%i' % n, None) |
|
244 | self.shell.user_ns.pop('_%i' % n, None) | |
252 | oh.pop(n, None) |
|
245 | oh.pop(n, None) | |
253 |
|
246 | |||
254 |
|
247 | |||
255 | def flush(self): |
|
248 | def flush(self): | |
256 | if not self.do_full_cache: |
|
249 | if not self.do_full_cache: | |
257 | raise ValueError("You shouldn't have reached the cache flush " |
|
250 | raise ValueError("You shouldn't have reached the cache flush " | |
258 | "if full caching is not enabled!") |
|
251 | "if full caching is not enabled!") | |
259 | # delete auto-generated vars from global namespace |
|
252 | # delete auto-generated vars from global namespace | |
260 |
|
253 | |||
261 | for n in range(1,self.prompt_count + 1): |
|
254 | for n in range(1,self.prompt_count + 1): | |
262 | key = '_'+repr(n) |
|
255 | key = '_'+repr(n) | |
263 | try: |
|
256 | try: | |
264 | del self.shell.user_ns[key] |
|
257 | del self.shell.user_ns[key] | |
265 | except: pass |
|
258 | except: pass | |
266 | # In some embedded circumstances, the user_ns doesn't have the |
|
259 | # In some embedded circumstances, the user_ns doesn't have the | |
267 | # '_oh' key set up. |
|
260 | # '_oh' key set up. | |
268 | oh = self.shell.user_ns.get('_oh', None) |
|
261 | oh = self.shell.user_ns.get('_oh', None) | |
269 | if oh is not None: |
|
262 | if oh is not None: | |
270 | oh.clear() |
|
263 | oh.clear() | |
271 |
|
264 | |||
272 | # Release our own references to objects: |
|
265 | # Release our own references to objects: | |
273 | self._, self.__, self.___ = '', '', '' |
|
266 | self._, self.__, self.___ = '', '', '' | |
274 |
|
267 | |||
275 | if '_' not in builtin_mod.__dict__: |
|
268 | if '_' not in builtin_mod.__dict__: | |
276 | self.shell.user_ns.update({'_':None,'__':None, '___':None}) |
|
269 | self.shell.user_ns.update({'_':None,'__':None, '___':None}) | |
277 | import gc |
|
270 | import gc | |
278 | # TODO: Is this really needed? |
|
271 | # TODO: Is this really needed? | |
279 | # IronPython blocks here forever |
|
272 | # IronPython blocks here forever | |
280 | if sys.platform != "cli": |
|
273 | if sys.platform != "cli": | |
281 | gc.collect() |
|
274 | gc.collect() | |
282 |
|
275 |
@@ -1,895 +1,939 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Display formatters. |
|
2 | """Display formatters. | |
3 |
|
3 | |||
4 | Inheritance diagram: |
|
4 | Inheritance diagram: | |
5 |
|
5 | |||
6 | .. inheritance-diagram:: IPython.core.formatters |
|
6 | .. inheritance-diagram:: IPython.core.formatters | |
7 | :parts: 3 |
|
7 | :parts: 3 | |
8 | """ |
|
8 | """ | |
9 |
|
9 | |||
10 | # Copyright (c) IPython Development Team. |
|
10 | # Copyright (c) IPython Development Team. | |
11 | # Distributed under the terms of the Modified BSD License. |
|
11 | # Distributed under the terms of the Modified BSD License. | |
12 |
|
12 | |||
13 | import abc |
|
13 | import abc | |
14 | import inspect |
|
14 | import inspect | |
15 | import sys |
|
15 | import sys | |
16 | import traceback |
|
16 | import traceback | |
17 | import types |
|
17 | import types | |
18 | import warnings |
|
18 | import warnings | |
19 |
|
19 | |||
20 | from IPython.external.decorator import decorator |
|
20 | from IPython.external.decorator import decorator | |
21 |
|
21 | |||
22 | from IPython.config.configurable import Configurable |
|
22 | from IPython.config.configurable import Configurable | |
23 | from IPython.core.getipython import get_ipython |
|
23 | from IPython.core.getipython import get_ipython | |
24 | from IPython.lib import pretty |
|
24 | from IPython.lib import pretty | |
25 | from IPython.utils.traitlets import ( |
|
25 | from IPython.utils.traitlets import ( | |
26 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
26 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, | |
|
27 | Instance, | |||
27 | ) |
|
28 | ) | |
28 | from IPython.utils.py3compat import ( |
|
29 | from IPython.utils.py3compat import ( | |
29 | unicode_to_str, with_metaclass, PY3, string_types, unicode_type, |
|
30 | unicode_to_str, with_metaclass, PY3, string_types, unicode_type, | |
30 | ) |
|
31 | ) | |
31 |
|
32 | |||
32 | if PY3: |
|
33 | if PY3: | |
33 | from io import StringIO |
|
34 | from io import StringIO | |
34 | else: |
|
35 | else: | |
35 | from StringIO import StringIO |
|
36 | from StringIO import StringIO | |
36 |
|
37 | |||
37 |
|
38 | |||
38 | #----------------------------------------------------------------------------- |
|
39 | #----------------------------------------------------------------------------- | |
39 | # The main DisplayFormatter class |
|
40 | # The main DisplayFormatter class | |
40 | #----------------------------------------------------------------------------- |
|
41 | #----------------------------------------------------------------------------- | |
41 |
|
42 | |||
42 |
|
43 | |||
43 | def _safe_get_formatter_method(obj, name): |
|
44 | def _safe_get_formatter_method(obj, name): | |
44 | """Safely get a formatter method |
|
45 | """Safely get a formatter method | |
45 |
|
46 | |||
46 | - Classes cannot have formatter methods, only instance |
|
47 | - Classes cannot have formatter methods, only instance | |
47 | - protect against proxy objects that claim to have everything |
|
48 | - protect against proxy objects that claim to have everything | |
48 | """ |
|
49 | """ | |
49 | if inspect.isclass(obj): |
|
50 | if inspect.isclass(obj): | |
50 | # repr methods only make sense on instances, not classes |
|
51 | # repr methods only make sense on instances, not classes | |
51 | return None |
|
52 | return None | |
52 | method = pretty._safe_getattr(obj, name, None) |
|
53 | method = pretty._safe_getattr(obj, name, None) | |
53 | if callable(method): |
|
54 | if callable(method): | |
54 | # obj claims to have repr method... |
|
55 | # obj claims to have repr method... | |
55 | if callable(pretty._safe_getattr(obj, '_ipython_canary_method_should_not_exist_', None)): |
|
56 | if callable(pretty._safe_getattr(obj, '_ipython_canary_method_should_not_exist_', None)): | |
56 | # ...but don't trust proxy objects that claim to have everything |
|
57 | # ...but don't trust proxy objects that claim to have everything | |
57 | return None |
|
58 | return None | |
58 | return method |
|
59 | return method | |
59 |
|
60 | |||
60 |
|
61 | |||
61 | class DisplayFormatter(Configurable): |
|
62 | class DisplayFormatter(Configurable): | |
62 |
|
63 | |||
63 | # When set to true only the default plain text formatter will be used. |
|
64 | # When set to true only the default plain text formatter will be used. | |
64 | plain_text_only = Bool(False, config=True) |
|
65 | plain_text_only = Bool(False, config=True) | |
65 | def _plain_text_only_changed(self, name, old, new): |
|
66 | def _plain_text_only_changed(self, name, old, new): | |
66 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. |
|
67 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. | |
67 |
|
68 | |||
68 | Use DisplayFormatter.active_types = ['text/plain'] |
|
69 | Use DisplayFormatter.active_types = ['text/plain'] | |
69 | for the same effect. |
|
70 | for the same effect. | |
70 | """, DeprecationWarning) |
|
71 | """, DeprecationWarning) | |
71 | if new: |
|
72 | if new: | |
72 | self.active_types = ['text/plain'] |
|
73 | self.active_types = ['text/plain'] | |
73 | else: |
|
74 | else: | |
74 | self.active_types = self.format_types |
|
75 | self.active_types = self.format_types | |
75 |
|
76 | |||
76 | active_types = List(Unicode, config=True, |
|
77 | active_types = List(Unicode, config=True, | |
77 | help="""List of currently active mime-types to display. |
|
78 | help="""List of currently active mime-types to display. | |
78 | You can use this to set a white-list for formats to display. |
|
79 | You can use this to set a white-list for formats to display. | |
79 |
|
80 | |||
80 | Most users will not need to change this value. |
|
81 | Most users will not need to change this value. | |
81 | """) |
|
82 | """) | |
82 | def _active_types_default(self): |
|
83 | def _active_types_default(self): | |
83 | return self.format_types |
|
84 | return self.format_types | |
84 |
|
85 | |||
85 | def _active_types_changed(self, name, old, new): |
|
86 | def _active_types_changed(self, name, old, new): | |
86 | for key, formatter in self.formatters.items(): |
|
87 | for key, formatter in self.formatters.items(): | |
87 | if key in new: |
|
88 | if key in new: | |
88 | formatter.enabled = True |
|
89 | formatter.enabled = True | |
89 | else: |
|
90 | else: | |
90 | formatter.enabled = False |
|
91 | formatter.enabled = False | |
91 |
|
92 | |||
|
93 | self_formatter = Instance(__name__ +'.SelfDisplayingFormatter') | |||
|
94 | def _self_formatter_default(self): | |||
|
95 | return SelfDisplayingFormatter(parent=self) | |||
|
96 | ||||
92 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
97 | # A dict of formatter whose keys are format types (MIME types) and whose | |
93 | # values are subclasses of BaseFormatter. |
|
98 | # values are subclasses of BaseFormatter. | |
94 | formatters = Dict() |
|
99 | formatters = Dict() | |
95 | def _formatters_default(self): |
|
100 | def _formatters_default(self): | |
96 | """Activate the default formatters.""" |
|
101 | """Activate the default formatters.""" | |
97 | formatter_classes = [ |
|
102 | formatter_classes = [ | |
98 | PlainTextFormatter, |
|
103 | PlainTextFormatter, | |
99 | HTMLFormatter, |
|
104 | HTMLFormatter, | |
100 | MarkdownFormatter, |
|
105 | MarkdownFormatter, | |
101 | SVGFormatter, |
|
106 | SVGFormatter, | |
102 | PNGFormatter, |
|
107 | PNGFormatter, | |
103 | PDFFormatter, |
|
108 | PDFFormatter, | |
104 | JPEGFormatter, |
|
109 | JPEGFormatter, | |
105 | LatexFormatter, |
|
110 | LatexFormatter, | |
106 | JSONFormatter, |
|
111 | JSONFormatter, | |
107 | JavascriptFormatter |
|
112 | JavascriptFormatter | |
108 | ] |
|
113 | ] | |
109 | d = {} |
|
114 | d = {} | |
110 | for cls in formatter_classes: |
|
115 | for cls in formatter_classes: | |
111 | f = cls(parent=self) |
|
116 | f = cls(parent=self) | |
112 | d[f.format_type] = f |
|
117 | d[f.format_type] = f | |
113 | return d |
|
118 | return d | |
114 |
|
119 | |||
115 | def format(self, obj, include=None, exclude=None): |
|
120 | def format(self, obj, include=None, exclude=None): | |
116 | """Return a format data dict for an object. |
|
121 | """Return a format data dict for an object. | |
117 |
|
122 | |||
118 | By default all format types will be computed. |
|
123 | By default all format types will be computed. | |
119 |
|
124 | |||
120 | The following MIME types are currently implemented: |
|
125 | The following MIME types are currently implemented: | |
121 |
|
126 | |||
122 | * text/plain |
|
127 | * text/plain | |
123 | * text/html |
|
128 | * text/html | |
124 | * text/markdown |
|
129 | * text/markdown | |
125 | * text/latex |
|
130 | * text/latex | |
126 | * application/json |
|
131 | * application/json | |
127 | * application/javascript |
|
132 | * application/javascript | |
128 | * application/pdf |
|
133 | * application/pdf | |
129 | * image/png |
|
134 | * image/png | |
130 | * image/jpeg |
|
135 | * image/jpeg | |
131 | * image/svg+xml |
|
136 | * image/svg+xml | |
132 |
|
137 | |||
133 | Parameters |
|
138 | Parameters | |
134 | ---------- |
|
139 | ---------- | |
135 | obj : object |
|
140 | obj : object | |
136 | The Python object whose format data will be computed. |
|
141 | The Python object whose format data will be computed. | |
137 | include : list or tuple, optional |
|
142 | include : list or tuple, optional | |
138 | A list of format type strings (MIME types) to include in the |
|
143 | A list of format type strings (MIME types) to include in the | |
139 | format data dict. If this is set *only* the format types included |
|
144 | format data dict. If this is set *only* the format types included | |
140 | in this list will be computed. |
|
145 | in this list will be computed. | |
141 | exclude : list or tuple, optional |
|
146 | exclude : list or tuple, optional | |
142 | A list of format type string (MIME types) to exclude in the format |
|
147 | A list of format type string (MIME types) to exclude in the format | |
143 | data dict. If this is set all format types will be computed, |
|
148 | data dict. If this is set all format types will be computed, | |
144 | except for those included in this argument. |
|
149 | except for those included in this argument. | |
145 |
|
150 | |||
146 | Returns |
|
151 | Returns | |
147 | ------- |
|
152 | ------- | |
148 | (format_dict, metadata_dict) : tuple of two dicts |
|
153 | (format_dict, metadata_dict) : tuple of two dicts | |
149 |
|
154 | |||
150 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
155 | format_dict is a dictionary of key/value pairs, one of each format that was | |
151 | generated for the object. The keys are the format types, which |
|
156 | generated for the object. The keys are the format types, which | |
152 | will usually be MIME type strings and the values and JSON'able |
|
157 | will usually be MIME type strings and the values and JSON'able | |
153 | data structure containing the raw data for the representation in |
|
158 | data structure containing the raw data for the representation in | |
154 | that format. |
|
159 | that format. | |
155 |
|
160 | |||
156 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
161 | metadata_dict is a dictionary of metadata about each mime-type output. | |
157 | Its keys will be a strict subset of the keys in format_dict. |
|
162 | Its keys will be a strict subset of the keys in format_dict. | |
158 | """ |
|
163 | """ | |
159 | format_dict = {} |
|
164 | format_dict = {} | |
160 | md_dict = {} |
|
165 | md_dict = {} | |
161 |
|
166 | |||
|
167 | if self.self_formatter(obj): | |||
|
168 | # object handled itself, don't proceed | |||
|
169 | return {}, {} | |||
|
170 | ||||
162 | for format_type, formatter in self.formatters.items(): |
|
171 | for format_type, formatter in self.formatters.items(): | |
163 | if include and format_type not in include: |
|
172 | if include and format_type not in include: | |
164 | continue |
|
173 | continue | |
165 | if exclude and format_type in exclude: |
|
174 | if exclude and format_type in exclude: | |
166 | continue |
|
175 | continue | |
167 |
|
176 | |||
168 | md = None |
|
177 | md = None | |
169 | try: |
|
178 | try: | |
170 | data = formatter(obj) |
|
179 | data = formatter(obj) | |
171 | except: |
|
180 | except: | |
172 | # FIXME: log the exception |
|
181 | # FIXME: log the exception | |
173 | raise |
|
182 | raise | |
174 |
|
183 | |||
175 | # formatters can return raw data or (data, metadata) |
|
184 | # formatters can return raw data or (data, metadata) | |
176 | if isinstance(data, tuple) and len(data) == 2: |
|
185 | if isinstance(data, tuple) and len(data) == 2: | |
177 | data, md = data |
|
186 | data, md = data | |
178 |
|
187 | |||
179 | if data is not None: |
|
188 | if data is not None: | |
180 | format_dict[format_type] = data |
|
189 | format_dict[format_type] = data | |
181 | if md is not None: |
|
190 | if md is not None: | |
182 | md_dict[format_type] = md |
|
191 | md_dict[format_type] = md | |
183 |
|
192 | |||
184 | return format_dict, md_dict |
|
193 | return format_dict, md_dict | |
185 |
|
194 | |||
186 | @property |
|
195 | @property | |
187 | def format_types(self): |
|
196 | def format_types(self): | |
188 | """Return the format types (MIME types) of the active formatters.""" |
|
197 | """Return the format types (MIME types) of the active formatters.""" | |
189 | return list(self.formatters.keys()) |
|
198 | return list(self.formatters.keys()) | |
190 |
|
199 | |||
191 |
|
200 | |||
192 | #----------------------------------------------------------------------------- |
|
201 | #----------------------------------------------------------------------------- | |
193 | # Formatters for specific format types (text, html, svg, etc.) |
|
202 | # Formatters for specific format types (text, html, svg, etc.) | |
194 | #----------------------------------------------------------------------------- |
|
203 | #----------------------------------------------------------------------------- | |
195 |
|
204 | |||
196 |
|
205 | |||
197 | def _safe_repr(obj): |
|
206 | def _safe_repr(obj): | |
198 | """Try to return a repr of an object |
|
207 | """Try to return a repr of an object | |
199 |
|
208 | |||
200 | always returns a string, at least. |
|
209 | always returns a string, at least. | |
201 | """ |
|
210 | """ | |
202 | try: |
|
211 | try: | |
203 | return repr(obj) |
|
212 | return repr(obj) | |
204 | except Exception as e: |
|
213 | except Exception as e: | |
205 | return "un-repr-able object (%r)" % e |
|
214 | return "un-repr-able object (%r)" % e | |
206 |
|
215 | |||
207 |
|
216 | |||
208 | class FormatterWarning(UserWarning): |
|
217 | class FormatterWarning(UserWarning): | |
209 | """Warning class for errors in formatters""" |
|
218 | """Warning class for errors in formatters""" | |
210 |
|
219 | |||
211 | @decorator |
|
220 | @decorator | |
212 | def warn_format_error(method, self, *args, **kwargs): |
|
221 | def warn_format_error(method, self, *args, **kwargs): | |
213 | """decorator for warning on failed format call""" |
|
222 | """decorator for warning on failed format call""" | |
214 | try: |
|
223 | try: | |
215 | r = method(self, *args, **kwargs) |
|
224 | r = method(self, *args, **kwargs) | |
216 | except NotImplementedError: |
|
225 | except NotImplementedError: | |
217 | # don't warn on NotImplementedErrors |
|
226 | # don't warn on NotImplementedErrors | |
218 | return None |
|
227 | return None | |
219 | except Exception: |
|
228 | except Exception: | |
220 | exc_info = sys.exc_info() |
|
229 | exc_info = sys.exc_info() | |
221 | ip = get_ipython() |
|
230 | ip = get_ipython() | |
222 | if ip is not None: |
|
231 | if ip is not None: | |
223 | ip.showtraceback(exc_info) |
|
232 | ip.showtraceback(exc_info) | |
224 | else: |
|
233 | else: | |
225 | traceback.print_exception(*exc_info) |
|
234 | traceback.print_exception(*exc_info) | |
226 | return None |
|
235 | return None | |
227 | if r is None or isinstance(r, self._return_type) or \ |
|
236 | if r is None or isinstance(r, self._return_type) or \ | |
228 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
237 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): | |
229 | return r |
|
238 | return r | |
230 | else: |
|
239 | else: | |
231 | warnings.warn( |
|
240 | warnings.warn( | |
232 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
241 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ | |
233 | (self.format_type, type(r), self._return_type, _safe_repr(args[0])), |
|
242 | (self.format_type, type(r), self._return_type, _safe_repr(args[0])), | |
234 | FormatterWarning |
|
243 | FormatterWarning | |
235 | ) |
|
244 | ) | |
236 |
|
245 | |||
237 |
|
246 | |||
238 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): |
|
247 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): | |
239 | """ Abstract base class for Formatters. |
|
248 | """ Abstract base class for Formatters. | |
240 |
|
249 | |||
241 | A formatter is a callable class that is responsible for computing the |
|
250 | A formatter is a callable class that is responsible for computing the | |
242 | raw format data for a particular format type (MIME type). For example, |
|
251 | raw format data for a particular format type (MIME type). For example, | |
243 | an HTML formatter would have a format type of `text/html` and would return |
|
252 | an HTML formatter would have a format type of `text/html` and would return | |
244 | the HTML representation of the object when called. |
|
253 | the HTML representation of the object when called. | |
245 | """ |
|
254 | """ | |
246 |
|
255 | |||
247 | # The format type of the data returned, usually a MIME type. |
|
256 | # The format type of the data returned, usually a MIME type. | |
248 | format_type = 'text/plain' |
|
257 | format_type = 'text/plain' | |
249 |
|
258 | |||
250 | # Is the formatter enabled... |
|
259 | # Is the formatter enabled... | |
251 | enabled = True |
|
260 | enabled = True | |
252 |
|
261 | |||
253 | @abc.abstractmethod |
|
262 | @abc.abstractmethod | |
254 | @warn_format_error |
|
263 | @warn_format_error | |
255 | def __call__(self, obj): |
|
264 | def __call__(self, obj): | |
256 | """Return a JSON'able representation of the object. |
|
265 | """Return a JSON'able representation of the object. | |
257 |
|
266 | |||
258 | If the object cannot be formatted by this formatter, |
|
267 | If the object cannot be formatted by this formatter, | |
259 | warn and return None. |
|
268 | warn and return None. | |
260 | """ |
|
269 | """ | |
261 | return repr(obj) |
|
270 | return repr(obj) | |
262 |
|
271 | |||
263 |
|
272 | |||
264 | def _mod_name_key(typ): |
|
273 | def _mod_name_key(typ): | |
265 | """Return a (__module__, __name__) tuple for a type. |
|
274 | """Return a (__module__, __name__) tuple for a type. | |
266 |
|
275 | |||
267 | Used as key in Formatter.deferred_printers. |
|
276 | Used as key in Formatter.deferred_printers. | |
268 | """ |
|
277 | """ | |
269 | module = getattr(typ, '__module__', None) |
|
278 | module = getattr(typ, '__module__', None) | |
270 | name = getattr(typ, '__name__', None) |
|
279 | name = getattr(typ, '__name__', None) | |
271 | return (module, name) |
|
280 | return (module, name) | |
272 |
|
281 | |||
273 |
|
282 | |||
274 | def _get_type(obj): |
|
283 | def _get_type(obj): | |
275 | """Return the type of an instance (old and new-style)""" |
|
284 | """Return the type of an instance (old and new-style)""" | |
276 | return getattr(obj, '__class__', None) or type(obj) |
|
285 | return getattr(obj, '__class__', None) or type(obj) | |
277 |
|
286 | |||
278 | _raise_key_error = object() |
|
287 | _raise_key_error = object() | |
279 |
|
288 | |||
280 |
|
289 | |||
281 | class BaseFormatter(Configurable): |
|
290 | class BaseFormatter(Configurable): | |
282 | """A base formatter class that is configurable. |
|
291 | """A base formatter class that is configurable. | |
283 |
|
292 | |||
284 | This formatter should usually be used as the base class of all formatters. |
|
293 | This formatter should usually be used as the base class of all formatters. | |
285 | It is a traited :class:`Configurable` class and includes an extensible |
|
294 | It is a traited :class:`Configurable` class and includes an extensible | |
286 | API for users to determine how their objects are formatted. The following |
|
295 | API for users to determine how their objects are formatted. The following | |
287 | logic is used to find a function to format an given object. |
|
296 | logic is used to find a function to format an given object. | |
288 |
|
297 | |||
289 | 1. The object is introspected to see if it has a method with the name |
|
298 | 1. The object is introspected to see if it has a method with the name | |
290 | :attr:`print_method`. If is does, that object is passed to that method |
|
299 | :attr:`print_method`. If is does, that object is passed to that method | |
291 | for formatting. |
|
300 | for formatting. | |
292 | 2. If no print method is found, three internal dictionaries are consulted |
|
301 | 2. If no print method is found, three internal dictionaries are consulted | |
293 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
302 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` | |
294 | and :attr:`deferred_printers`. |
|
303 | and :attr:`deferred_printers`. | |
295 |
|
304 | |||
296 | Users should use these dictionaries to register functions that will be |
|
305 | Users should use these dictionaries to register functions that will be | |
297 | used to compute the format data for their objects (if those objects don't |
|
306 | used to compute the format data for their objects (if those objects don't | |
298 | have the special print methods). The easiest way of using these |
|
307 | have the special print methods). The easiest way of using these | |
299 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
308 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` | |
300 | methods. |
|
309 | methods. | |
301 |
|
310 | |||
302 | If no function/callable is found to compute the format data, ``None`` is |
|
311 | If no function/callable is found to compute the format data, ``None`` is | |
303 | returned and this format type is not used. |
|
312 | returned and this format type is not used. | |
304 | """ |
|
313 | """ | |
305 |
|
314 | |||
306 | format_type = Unicode('text/plain') |
|
315 | format_type = Unicode('text/plain') | |
307 | _return_type = string_types |
|
316 | _return_type = string_types | |
308 |
|
317 | |||
309 | enabled = Bool(True, config=True) |
|
318 | enabled = Bool(True, config=True) | |
310 |
|
319 | |||
311 | print_method = ObjectName('__repr__') |
|
320 | print_method = ObjectName('__repr__') | |
312 |
|
321 | |||
313 | # The singleton printers. |
|
322 | # The singleton printers. | |
314 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
323 | # Maps the IDs of the builtin singleton objects to the format functions. | |
315 | singleton_printers = Dict(config=True) |
|
324 | singleton_printers = Dict(config=True) | |
316 |
|
325 | |||
317 | # The type-specific printers. |
|
326 | # The type-specific printers. | |
318 | # Map type objects to the format functions. |
|
327 | # Map type objects to the format functions. | |
319 | type_printers = Dict(config=True) |
|
328 | type_printers = Dict(config=True) | |
320 |
|
329 | |||
321 | # The deferred-import type-specific printers. |
|
330 | # The deferred-import type-specific printers. | |
322 | # Map (modulename, classname) pairs to the format functions. |
|
331 | # Map (modulename, classname) pairs to the format functions. | |
323 | deferred_printers = Dict(config=True) |
|
332 | deferred_printers = Dict(config=True) | |
324 |
|
333 | |||
325 | @warn_format_error |
|
334 | @warn_format_error | |
326 | def __call__(self, obj): |
|
335 | def __call__(self, obj): | |
327 | """Compute the format for an object.""" |
|
336 | """Compute the format for an object.""" | |
328 | if self.enabled: |
|
337 | if self.enabled: | |
329 | # lookup registered printer |
|
338 | # lookup registered printer | |
330 | try: |
|
339 | try: | |
331 | printer = self.lookup(obj) |
|
340 | printer = self.lookup(obj) | |
332 | except KeyError: |
|
341 | except KeyError: | |
333 | pass |
|
342 | pass | |
334 | else: |
|
343 | else: | |
335 | return printer(obj) |
|
344 | return printer(obj) | |
336 | # Finally look for special method names |
|
345 | # Finally look for special method names | |
337 | method = _safe_get_formatter_method(obj, self.print_method) |
|
346 | method = _safe_get_formatter_method(obj, self.print_method) | |
338 | if method is not None: |
|
347 | if method is not None: | |
339 | return method() |
|
348 | return method() | |
340 | return None |
|
349 | return None | |
341 | else: |
|
350 | else: | |
342 | return None |
|
351 | return None | |
343 |
|
352 | |||
344 | def __contains__(self, typ): |
|
353 | def __contains__(self, typ): | |
345 | """map in to lookup_by_type""" |
|
354 | """map in to lookup_by_type""" | |
346 | try: |
|
355 | try: | |
347 | self.lookup_by_type(typ) |
|
356 | self.lookup_by_type(typ) | |
348 | except KeyError: |
|
357 | except KeyError: | |
349 | return False |
|
358 | return False | |
350 | else: |
|
359 | else: | |
351 | return True |
|
360 | return True | |
352 |
|
361 | |||
353 | def lookup(self, obj): |
|
362 | def lookup(self, obj): | |
354 | """Look up the formatter for a given instance. |
|
363 | """Look up the formatter for a given instance. | |
355 |
|
364 | |||
356 | Parameters |
|
365 | Parameters | |
357 | ---------- |
|
366 | ---------- | |
358 | obj : object instance |
|
367 | obj : object instance | |
359 |
|
368 | |||
360 | Returns |
|
369 | Returns | |
361 | ------- |
|
370 | ------- | |
362 | f : callable |
|
371 | f : callable | |
363 | The registered formatting callable for the type. |
|
372 | The registered formatting callable for the type. | |
364 |
|
373 | |||
365 | Raises |
|
374 | Raises | |
366 | ------ |
|
375 | ------ | |
367 | KeyError if the type has not been registered. |
|
376 | KeyError if the type has not been registered. | |
368 | """ |
|
377 | """ | |
369 | # look for singleton first |
|
378 | # look for singleton first | |
370 | obj_id = id(obj) |
|
379 | obj_id = id(obj) | |
371 | if obj_id in self.singleton_printers: |
|
380 | if obj_id in self.singleton_printers: | |
372 | return self.singleton_printers[obj_id] |
|
381 | return self.singleton_printers[obj_id] | |
373 | # then lookup by type |
|
382 | # then lookup by type | |
374 | return self.lookup_by_type(_get_type(obj)) |
|
383 | return self.lookup_by_type(_get_type(obj)) | |
375 |
|
384 | |||
376 | def lookup_by_type(self, typ): |
|
385 | def lookup_by_type(self, typ): | |
377 | """Look up the registered formatter for a type. |
|
386 | """Look up the registered formatter for a type. | |
378 |
|
387 | |||
379 | Parameters |
|
388 | Parameters | |
380 | ---------- |
|
389 | ---------- | |
381 | typ : type or '__module__.__name__' string for a type |
|
390 | typ : type or '__module__.__name__' string for a type | |
382 |
|
391 | |||
383 | Returns |
|
392 | Returns | |
384 | ------- |
|
393 | ------- | |
385 | f : callable |
|
394 | f : callable | |
386 | The registered formatting callable for the type. |
|
395 | The registered formatting callable for the type. | |
387 |
|
396 | |||
388 | Raises |
|
397 | Raises | |
389 | ------ |
|
398 | ------ | |
390 | KeyError if the type has not been registered. |
|
399 | KeyError if the type has not been registered. | |
391 | """ |
|
400 | """ | |
392 | if isinstance(typ, string_types): |
|
401 | if isinstance(typ, string_types): | |
393 | typ_key = tuple(typ.rsplit('.',1)) |
|
402 | typ_key = tuple(typ.rsplit('.',1)) | |
394 | if typ_key not in self.deferred_printers: |
|
403 | if typ_key not in self.deferred_printers: | |
395 | # We may have it cached in the type map. We will have to |
|
404 | # We may have it cached in the type map. We will have to | |
396 | # iterate over all of the types to check. |
|
405 | # iterate over all of the types to check. | |
397 | for cls in self.type_printers: |
|
406 | for cls in self.type_printers: | |
398 | if _mod_name_key(cls) == typ_key: |
|
407 | if _mod_name_key(cls) == typ_key: | |
399 | return self.type_printers[cls] |
|
408 | return self.type_printers[cls] | |
400 | else: |
|
409 | else: | |
401 | return self.deferred_printers[typ_key] |
|
410 | return self.deferred_printers[typ_key] | |
402 | else: |
|
411 | else: | |
403 | for cls in pretty._get_mro(typ): |
|
412 | for cls in pretty._get_mro(typ): | |
404 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
413 | if cls in self.type_printers or self._in_deferred_types(cls): | |
405 | return self.type_printers[cls] |
|
414 | return self.type_printers[cls] | |
406 |
|
415 | |||
407 | # If we have reached here, the lookup failed. |
|
416 | # If we have reached here, the lookup failed. | |
408 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
417 | raise KeyError("No registered printer for {0!r}".format(typ)) | |
409 |
|
418 | |||
410 | def for_type(self, typ, func=None): |
|
419 | def for_type(self, typ, func=None): | |
411 | """Add a format function for a given type. |
|
420 | """Add a format function for a given type. | |
412 |
|
421 | |||
413 | Parameters |
|
422 | Parameters | |
414 | ----------- |
|
423 | ----------- | |
415 | typ : type or '__module__.__name__' string for a type |
|
424 | typ : type or '__module__.__name__' string for a type | |
416 | The class of the object that will be formatted using `func`. |
|
425 | The class of the object that will be formatted using `func`. | |
417 | func : callable |
|
426 | func : callable | |
418 | A callable for computing the format data. |
|
427 | A callable for computing the format data. | |
419 | `func` will be called with the object to be formatted, |
|
428 | `func` will be called with the object to be formatted, | |
420 | and will return the raw data in this formatter's format. |
|
429 | and will return the raw data in this formatter's format. | |
421 | Subclasses may use a different call signature for the |
|
430 | Subclasses may use a different call signature for the | |
422 | `func` argument. |
|
431 | `func` argument. | |
423 |
|
432 | |||
424 | If `func` is None or not specified, there will be no change, |
|
433 | If `func` is None or not specified, there will be no change, | |
425 | only returning the current value. |
|
434 | only returning the current value. | |
426 |
|
435 | |||
427 | Returns |
|
436 | Returns | |
428 | ------- |
|
437 | ------- | |
429 | oldfunc : callable |
|
438 | oldfunc : callable | |
430 | The currently registered callable. |
|
439 | The currently registered callable. | |
431 | If you are registering a new formatter, |
|
440 | If you are registering a new formatter, | |
432 | this will be the previous value (to enable restoring later). |
|
441 | this will be the previous value (to enable restoring later). | |
433 | """ |
|
442 | """ | |
434 | # if string given, interpret as 'pkg.module.class_name' |
|
443 | # if string given, interpret as 'pkg.module.class_name' | |
435 | if isinstance(typ, string_types): |
|
444 | if isinstance(typ, string_types): | |
436 | type_module, type_name = typ.rsplit('.', 1) |
|
445 | type_module, type_name = typ.rsplit('.', 1) | |
437 | return self.for_type_by_name(type_module, type_name, func) |
|
446 | return self.for_type_by_name(type_module, type_name, func) | |
438 |
|
447 | |||
439 | try: |
|
448 | try: | |
440 | oldfunc = self.lookup_by_type(typ) |
|
449 | oldfunc = self.lookup_by_type(typ) | |
441 | except KeyError: |
|
450 | except KeyError: | |
442 | oldfunc = None |
|
451 | oldfunc = None | |
443 |
|
452 | |||
444 | if func is not None: |
|
453 | if func is not None: | |
445 | self.type_printers[typ] = func |
|
454 | self.type_printers[typ] = func | |
446 |
|
455 | |||
447 | return oldfunc |
|
456 | return oldfunc | |
448 |
|
457 | |||
449 | def for_type_by_name(self, type_module, type_name, func=None): |
|
458 | def for_type_by_name(self, type_module, type_name, func=None): | |
450 | """Add a format function for a type specified by the full dotted |
|
459 | """Add a format function for a type specified by the full dotted | |
451 | module and name of the type, rather than the type of the object. |
|
460 | module and name of the type, rather than the type of the object. | |
452 |
|
461 | |||
453 | Parameters |
|
462 | Parameters | |
454 | ---------- |
|
463 | ---------- | |
455 | type_module : str |
|
464 | type_module : str | |
456 | The full dotted name of the module the type is defined in, like |
|
465 | The full dotted name of the module the type is defined in, like | |
457 | ``numpy``. |
|
466 | ``numpy``. | |
458 | type_name : str |
|
467 | type_name : str | |
459 | The name of the type (the class name), like ``dtype`` |
|
468 | The name of the type (the class name), like ``dtype`` | |
460 | func : callable |
|
469 | func : callable | |
461 | A callable for computing the format data. |
|
470 | A callable for computing the format data. | |
462 | `func` will be called with the object to be formatted, |
|
471 | `func` will be called with the object to be formatted, | |
463 | and will return the raw data in this formatter's format. |
|
472 | and will return the raw data in this formatter's format. | |
464 | Subclasses may use a different call signature for the |
|
473 | Subclasses may use a different call signature for the | |
465 | `func` argument. |
|
474 | `func` argument. | |
466 |
|
475 | |||
467 | If `func` is None or unspecified, there will be no change, |
|
476 | If `func` is None or unspecified, there will be no change, | |
468 | only returning the current value. |
|
477 | only returning the current value. | |
469 |
|
478 | |||
470 | Returns |
|
479 | Returns | |
471 | ------- |
|
480 | ------- | |
472 | oldfunc : callable |
|
481 | oldfunc : callable | |
473 | The currently registered callable. |
|
482 | The currently registered callable. | |
474 | If you are registering a new formatter, |
|
483 | If you are registering a new formatter, | |
475 | this will be the previous value (to enable restoring later). |
|
484 | this will be the previous value (to enable restoring later). | |
476 | """ |
|
485 | """ | |
477 | key = (type_module, type_name) |
|
486 | key = (type_module, type_name) | |
478 |
|
487 | |||
479 | try: |
|
488 | try: | |
480 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
489 | oldfunc = self.lookup_by_type("%s.%s" % key) | |
481 | except KeyError: |
|
490 | except KeyError: | |
482 | oldfunc = None |
|
491 | oldfunc = None | |
483 |
|
492 | |||
484 | if func is not None: |
|
493 | if func is not None: | |
485 | self.deferred_printers[key] = func |
|
494 | self.deferred_printers[key] = func | |
486 | return oldfunc |
|
495 | return oldfunc | |
487 |
|
496 | |||
488 | def pop(self, typ, default=_raise_key_error): |
|
497 | def pop(self, typ, default=_raise_key_error): | |
489 | """Pop a formatter for the given type. |
|
498 | """Pop a formatter for the given type. | |
490 |
|
499 | |||
491 | Parameters |
|
500 | Parameters | |
492 | ---------- |
|
501 | ---------- | |
493 | typ : type or '__module__.__name__' string for a type |
|
502 | typ : type or '__module__.__name__' string for a type | |
494 | default : object |
|
503 | default : object | |
495 | value to be returned if no formatter is registered for typ. |
|
504 | value to be returned if no formatter is registered for typ. | |
496 |
|
505 | |||
497 | Returns |
|
506 | Returns | |
498 | ------- |
|
507 | ------- | |
499 | obj : object |
|
508 | obj : object | |
500 | The last registered object for the type. |
|
509 | The last registered object for the type. | |
501 |
|
510 | |||
502 | Raises |
|
511 | Raises | |
503 | ------ |
|
512 | ------ | |
504 | KeyError if the type is not registered and default is not specified. |
|
513 | KeyError if the type is not registered and default is not specified. | |
505 | """ |
|
514 | """ | |
506 |
|
515 | |||
507 | if isinstance(typ, string_types): |
|
516 | if isinstance(typ, string_types): | |
508 | typ_key = tuple(typ.rsplit('.',1)) |
|
517 | typ_key = tuple(typ.rsplit('.',1)) | |
509 | if typ_key not in self.deferred_printers: |
|
518 | if typ_key not in self.deferred_printers: | |
510 | # We may have it cached in the type map. We will have to |
|
519 | # We may have it cached in the type map. We will have to | |
511 | # iterate over all of the types to check. |
|
520 | # iterate over all of the types to check. | |
512 | for cls in self.type_printers: |
|
521 | for cls in self.type_printers: | |
513 | if _mod_name_key(cls) == typ_key: |
|
522 | if _mod_name_key(cls) == typ_key: | |
514 | old = self.type_printers.pop(cls) |
|
523 | old = self.type_printers.pop(cls) | |
515 | break |
|
524 | break | |
516 | else: |
|
525 | else: | |
517 | old = default |
|
526 | old = default | |
518 | else: |
|
527 | else: | |
519 | old = self.deferred_printers.pop(typ_key) |
|
528 | old = self.deferred_printers.pop(typ_key) | |
520 | else: |
|
529 | else: | |
521 | if typ in self.type_printers: |
|
530 | if typ in self.type_printers: | |
522 | old = self.type_printers.pop(typ) |
|
531 | old = self.type_printers.pop(typ) | |
523 | else: |
|
532 | else: | |
524 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
533 | old = self.deferred_printers.pop(_mod_name_key(typ), default) | |
525 | if old is _raise_key_error: |
|
534 | if old is _raise_key_error: | |
526 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
535 | raise KeyError("No registered value for {0!r}".format(typ)) | |
527 | return old |
|
536 | return old | |
528 |
|
537 | |||
529 | def _in_deferred_types(self, cls): |
|
538 | def _in_deferred_types(self, cls): | |
530 | """ |
|
539 | """ | |
531 | Check if the given class is specified in the deferred type registry. |
|
540 | Check if the given class is specified in the deferred type registry. | |
532 |
|
541 | |||
533 | Successful matches will be moved to the regular type registry for future use. |
|
542 | Successful matches will be moved to the regular type registry for future use. | |
534 | """ |
|
543 | """ | |
535 | mod = getattr(cls, '__module__', None) |
|
544 | mod = getattr(cls, '__module__', None) | |
536 | name = getattr(cls, '__name__', None) |
|
545 | name = getattr(cls, '__name__', None) | |
537 | key = (mod, name) |
|
546 | key = (mod, name) | |
538 | if key in self.deferred_printers: |
|
547 | if key in self.deferred_printers: | |
539 | # Move the printer over to the regular registry. |
|
548 | # Move the printer over to the regular registry. | |
540 | printer = self.deferred_printers.pop(key) |
|
549 | printer = self.deferred_printers.pop(key) | |
541 | self.type_printers[cls] = printer |
|
550 | self.type_printers[cls] = printer | |
542 | return True |
|
551 | return True | |
543 | return False |
|
552 | return False | |
544 |
|
553 | |||
545 |
|
554 | |||
546 | class PlainTextFormatter(BaseFormatter): |
|
555 | class PlainTextFormatter(BaseFormatter): | |
547 | """The default pretty-printer. |
|
556 | """The default pretty-printer. | |
548 |
|
557 | |||
549 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
558 | This uses :mod:`IPython.lib.pretty` to compute the format data of | |
550 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
559 | the object. If the object cannot be pretty printed, :func:`repr` is used. | |
551 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
560 | See the documentation of :mod:`IPython.lib.pretty` for details on | |
552 | how to write pretty printers. Here is a simple example:: |
|
561 | how to write pretty printers. Here is a simple example:: | |
553 |
|
562 | |||
554 | def dtype_pprinter(obj, p, cycle): |
|
563 | def dtype_pprinter(obj, p, cycle): | |
555 | if cycle: |
|
564 | if cycle: | |
556 | return p.text('dtype(...)') |
|
565 | return p.text('dtype(...)') | |
557 | if hasattr(obj, 'fields'): |
|
566 | if hasattr(obj, 'fields'): | |
558 | if obj.fields is None: |
|
567 | if obj.fields is None: | |
559 | p.text(repr(obj)) |
|
568 | p.text(repr(obj)) | |
560 | else: |
|
569 | else: | |
561 | p.begin_group(7, 'dtype([') |
|
570 | p.begin_group(7, 'dtype([') | |
562 | for i, field in enumerate(obj.descr): |
|
571 | for i, field in enumerate(obj.descr): | |
563 | if i > 0: |
|
572 | if i > 0: | |
564 | p.text(',') |
|
573 | p.text(',') | |
565 | p.breakable() |
|
574 | p.breakable() | |
566 | p.pretty(field) |
|
575 | p.pretty(field) | |
567 | p.end_group(7, '])') |
|
576 | p.end_group(7, '])') | |
568 | """ |
|
577 | """ | |
569 |
|
578 | |||
570 | # The format type of data returned. |
|
579 | # The format type of data returned. | |
571 | format_type = Unicode('text/plain') |
|
580 | format_type = Unicode('text/plain') | |
572 |
|
581 | |||
573 | # This subclass ignores this attribute as it always need to return |
|
582 | # This subclass ignores this attribute as it always need to return | |
574 | # something. |
|
583 | # something. | |
575 | enabled = Bool(True, config=False) |
|
584 | enabled = Bool(True, config=False) | |
576 |
|
585 | |||
577 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, config=True, |
|
586 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, config=True, | |
578 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
587 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. | |
579 |
|
588 | |||
580 | Set to 0 to disable truncation. |
|
589 | Set to 0 to disable truncation. | |
581 | """ |
|
590 | """ | |
582 | ) |
|
591 | ) | |
583 |
|
592 | |||
584 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
593 | # Look for a _repr_pretty_ methods to use for pretty printing. | |
585 | print_method = ObjectName('_repr_pretty_') |
|
594 | print_method = ObjectName('_repr_pretty_') | |
586 |
|
595 | |||
587 | # Whether to pretty-print or not. |
|
596 | # Whether to pretty-print or not. | |
588 | pprint = Bool(True, config=True) |
|
597 | pprint = Bool(True, config=True) | |
589 |
|
598 | |||
590 | # Whether to be verbose or not. |
|
599 | # Whether to be verbose or not. | |
591 | verbose = Bool(False, config=True) |
|
600 | verbose = Bool(False, config=True) | |
592 |
|
601 | |||
593 | # The maximum width. |
|
602 | # The maximum width. | |
594 | max_width = Integer(79, config=True) |
|
603 | max_width = Integer(79, config=True) | |
595 |
|
604 | |||
596 | # The newline character. |
|
605 | # The newline character. | |
597 | newline = Unicode('\n', config=True) |
|
606 | newline = Unicode('\n', config=True) | |
598 |
|
607 | |||
599 | # format-string for pprinting floats |
|
608 | # format-string for pprinting floats | |
600 | float_format = Unicode('%r') |
|
609 | float_format = Unicode('%r') | |
601 | # setter for float precision, either int or direct format-string |
|
610 | # setter for float precision, either int or direct format-string | |
602 | float_precision = CUnicode('', config=True) |
|
611 | float_precision = CUnicode('', config=True) | |
603 |
|
612 | |||
604 | def _float_precision_changed(self, name, old, new): |
|
613 | def _float_precision_changed(self, name, old, new): | |
605 | """float_precision changed, set float_format accordingly. |
|
614 | """float_precision changed, set float_format accordingly. | |
606 |
|
615 | |||
607 | float_precision can be set by int or str. |
|
616 | float_precision can be set by int or str. | |
608 | This will set float_format, after interpreting input. |
|
617 | This will set float_format, after interpreting input. | |
609 | If numpy has been imported, numpy print precision will also be set. |
|
618 | If numpy has been imported, numpy print precision will also be set. | |
610 |
|
619 | |||
611 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
620 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
612 |
|
621 | |||
613 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
622 | An empty string returns to defaults (repr for float, 8 for numpy). | |
614 |
|
623 | |||
615 | This parameter can be set via the '%precision' magic. |
|
624 | This parameter can be set via the '%precision' magic. | |
616 | """ |
|
625 | """ | |
617 |
|
626 | |||
618 | if '%' in new: |
|
627 | if '%' in new: | |
619 | # got explicit format string |
|
628 | # got explicit format string | |
620 | fmt = new |
|
629 | fmt = new | |
621 | try: |
|
630 | try: | |
622 | fmt%3.14159 |
|
631 | fmt%3.14159 | |
623 | except Exception: |
|
632 | except Exception: | |
624 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
633 | raise ValueError("Precision must be int or format string, not %r"%new) | |
625 | elif new: |
|
634 | elif new: | |
626 | # otherwise, should be an int |
|
635 | # otherwise, should be an int | |
627 | try: |
|
636 | try: | |
628 | i = int(new) |
|
637 | i = int(new) | |
629 | assert i >= 0 |
|
638 | assert i >= 0 | |
630 | except ValueError: |
|
639 | except ValueError: | |
631 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
640 | raise ValueError("Precision must be int or format string, not %r"%new) | |
632 | except AssertionError: |
|
641 | except AssertionError: | |
633 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
642 | raise ValueError("int precision must be non-negative, not %r"%i) | |
634 |
|
643 | |||
635 | fmt = '%%.%if'%i |
|
644 | fmt = '%%.%if'%i | |
636 | if 'numpy' in sys.modules: |
|
645 | if 'numpy' in sys.modules: | |
637 | # set numpy precision if it has been imported |
|
646 | # set numpy precision if it has been imported | |
638 | import numpy |
|
647 | import numpy | |
639 | numpy.set_printoptions(precision=i) |
|
648 | numpy.set_printoptions(precision=i) | |
640 | else: |
|
649 | else: | |
641 | # default back to repr |
|
650 | # default back to repr | |
642 | fmt = '%r' |
|
651 | fmt = '%r' | |
643 | if 'numpy' in sys.modules: |
|
652 | if 'numpy' in sys.modules: | |
644 | import numpy |
|
653 | import numpy | |
645 | # numpy default is 8 |
|
654 | # numpy default is 8 | |
646 | numpy.set_printoptions(precision=8) |
|
655 | numpy.set_printoptions(precision=8) | |
647 | self.float_format = fmt |
|
656 | self.float_format = fmt | |
648 |
|
657 | |||
649 | # Use the default pretty printers from IPython.lib.pretty. |
|
658 | # Use the default pretty printers from IPython.lib.pretty. | |
650 | def _singleton_printers_default(self): |
|
659 | def _singleton_printers_default(self): | |
651 | return pretty._singleton_pprinters.copy() |
|
660 | return pretty._singleton_pprinters.copy() | |
652 |
|
661 | |||
653 | def _type_printers_default(self): |
|
662 | def _type_printers_default(self): | |
654 | d = pretty._type_pprinters.copy() |
|
663 | d = pretty._type_pprinters.copy() | |
655 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
664 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
656 | return d |
|
665 | return d | |
657 |
|
666 | |||
658 | def _deferred_printers_default(self): |
|
667 | def _deferred_printers_default(self): | |
659 | return pretty._deferred_type_pprinters.copy() |
|
668 | return pretty._deferred_type_pprinters.copy() | |
660 |
|
669 | |||
661 | #### FormatterABC interface #### |
|
670 | #### FormatterABC interface #### | |
662 |
|
671 | |||
663 | @warn_format_error |
|
672 | @warn_format_error | |
664 | def __call__(self, obj): |
|
673 | def __call__(self, obj): | |
665 | """Compute the pretty representation of the object.""" |
|
674 | """Compute the pretty representation of the object.""" | |
666 | if not self.pprint: |
|
675 | if not self.pprint: | |
667 | return repr(obj) |
|
676 | return repr(obj) | |
668 | else: |
|
677 | else: | |
669 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
678 | # This uses use StringIO, as cStringIO doesn't handle unicode. | |
670 | stream = StringIO() |
|
679 | stream = StringIO() | |
671 | # self.newline.encode() is a quick fix for issue gh-597. We need to |
|
680 | # self.newline.encode() is a quick fix for issue gh-597. We need to | |
672 | # ensure that stream does not get a mix of unicode and bytestrings, |
|
681 | # ensure that stream does not get a mix of unicode and bytestrings, | |
673 | # or it will cause trouble. |
|
682 | # or it will cause trouble. | |
674 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
683 | printer = pretty.RepresentationPrinter(stream, self.verbose, | |
675 | self.max_width, unicode_to_str(self.newline), |
|
684 | self.max_width, unicode_to_str(self.newline), | |
676 | max_seq_length=self.max_seq_length, |
|
685 | max_seq_length=self.max_seq_length, | |
677 | singleton_pprinters=self.singleton_printers, |
|
686 | singleton_pprinters=self.singleton_printers, | |
678 | type_pprinters=self.type_printers, |
|
687 | type_pprinters=self.type_printers, | |
679 | deferred_pprinters=self.deferred_printers) |
|
688 | deferred_pprinters=self.deferred_printers) | |
680 | printer.pretty(obj) |
|
689 | printer.pretty(obj) | |
681 | printer.flush() |
|
690 | printer.flush() | |
682 | return stream.getvalue() |
|
691 | return stream.getvalue() | |
683 |
|
692 | |||
684 |
|
693 | |||
685 | class HTMLFormatter(BaseFormatter): |
|
694 | class HTMLFormatter(BaseFormatter): | |
686 | """An HTML formatter. |
|
695 | """An HTML formatter. | |
687 |
|
696 | |||
688 | To define the callables that compute the HTML representation of your |
|
697 | To define the callables that compute the HTML representation of your | |
689 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
698 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` | |
690 | or :meth:`for_type_by_name` methods to register functions that handle |
|
699 | or :meth:`for_type_by_name` methods to register functions that handle | |
691 | this. |
|
700 | this. | |
692 |
|
701 | |||
693 | The return value of this formatter should be a valid HTML snippet that |
|
702 | The return value of this formatter should be a valid HTML snippet that | |
694 | could be injected into an existing DOM. It should *not* include the |
|
703 | could be injected into an existing DOM. It should *not* include the | |
695 | ```<html>`` or ```<body>`` tags. |
|
704 | ```<html>`` or ```<body>`` tags. | |
696 | """ |
|
705 | """ | |
697 | format_type = Unicode('text/html') |
|
706 | format_type = Unicode('text/html') | |
698 |
|
707 | |||
699 | print_method = ObjectName('_repr_html_') |
|
708 | print_method = ObjectName('_repr_html_') | |
700 |
|
709 | |||
701 |
|
710 | |||
702 | class MarkdownFormatter(BaseFormatter): |
|
711 | class MarkdownFormatter(BaseFormatter): | |
703 | """A Markdown formatter. |
|
712 | """A Markdown formatter. | |
704 |
|
713 | |||
705 | To define the callables that compute the Markdown representation of your |
|
714 | To define the callables that compute the Markdown representation of your | |
706 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
715 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` | |
707 | or :meth:`for_type_by_name` methods to register functions that handle |
|
716 | or :meth:`for_type_by_name` methods to register functions that handle | |
708 | this. |
|
717 | this. | |
709 |
|
718 | |||
710 | The return value of this formatter should be a valid Markdown. |
|
719 | The return value of this formatter should be a valid Markdown. | |
711 | """ |
|
720 | """ | |
712 | format_type = Unicode('text/markdown') |
|
721 | format_type = Unicode('text/markdown') | |
713 |
|
722 | |||
714 | print_method = ObjectName('_repr_markdown_') |
|
723 | print_method = ObjectName('_repr_markdown_') | |
715 |
|
724 | |||
716 | class SVGFormatter(BaseFormatter): |
|
725 | class SVGFormatter(BaseFormatter): | |
717 | """An SVG formatter. |
|
726 | """An SVG formatter. | |
718 |
|
727 | |||
719 | To define the callables that compute the SVG representation of your |
|
728 | To define the callables that compute the SVG representation of your | |
720 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
729 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` | |
721 | or :meth:`for_type_by_name` methods to register functions that handle |
|
730 | or :meth:`for_type_by_name` methods to register functions that handle | |
722 | this. |
|
731 | this. | |
723 |
|
732 | |||
724 | The return value of this formatter should be valid SVG enclosed in |
|
733 | The return value of this formatter should be valid SVG enclosed in | |
725 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
734 | ```<svg>``` tags, that could be injected into an existing DOM. It should | |
726 | *not* include the ```<html>`` or ```<body>`` tags. |
|
735 | *not* include the ```<html>`` or ```<body>`` tags. | |
727 | """ |
|
736 | """ | |
728 | format_type = Unicode('image/svg+xml') |
|
737 | format_type = Unicode('image/svg+xml') | |
729 |
|
738 | |||
730 | print_method = ObjectName('_repr_svg_') |
|
739 | print_method = ObjectName('_repr_svg_') | |
731 |
|
740 | |||
732 |
|
741 | |||
733 | class PNGFormatter(BaseFormatter): |
|
742 | class PNGFormatter(BaseFormatter): | |
734 | """A PNG formatter. |
|
743 | """A PNG formatter. | |
735 |
|
744 | |||
736 | To define the callables that compute the PNG representation of your |
|
745 | To define the callables that compute the PNG representation of your | |
737 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
746 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` | |
738 | or :meth:`for_type_by_name` methods to register functions that handle |
|
747 | or :meth:`for_type_by_name` methods to register functions that handle | |
739 | this. |
|
748 | this. | |
740 |
|
749 | |||
741 | The return value of this formatter should be raw PNG data, *not* |
|
750 | The return value of this formatter should be raw PNG data, *not* | |
742 | base64 encoded. |
|
751 | base64 encoded. | |
743 | """ |
|
752 | """ | |
744 | format_type = Unicode('image/png') |
|
753 | format_type = Unicode('image/png') | |
745 |
|
754 | |||
746 | print_method = ObjectName('_repr_png_') |
|
755 | print_method = ObjectName('_repr_png_') | |
747 |
|
756 | |||
748 | _return_type = (bytes, unicode_type) |
|
757 | _return_type = (bytes, unicode_type) | |
749 |
|
758 | |||
750 |
|
759 | |||
751 | class JPEGFormatter(BaseFormatter): |
|
760 | class JPEGFormatter(BaseFormatter): | |
752 | """A JPEG formatter. |
|
761 | """A JPEG formatter. | |
753 |
|
762 | |||
754 | To define the callables that compute the JPEG representation of your |
|
763 | To define the callables that compute the JPEG representation of your | |
755 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
764 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` | |
756 | or :meth:`for_type_by_name` methods to register functions that handle |
|
765 | or :meth:`for_type_by_name` methods to register functions that handle | |
757 | this. |
|
766 | this. | |
758 |
|
767 | |||
759 | The return value of this formatter should be raw JPEG data, *not* |
|
768 | The return value of this formatter should be raw JPEG data, *not* | |
760 | base64 encoded. |
|
769 | base64 encoded. | |
761 | """ |
|
770 | """ | |
762 | format_type = Unicode('image/jpeg') |
|
771 | format_type = Unicode('image/jpeg') | |
763 |
|
772 | |||
764 | print_method = ObjectName('_repr_jpeg_') |
|
773 | print_method = ObjectName('_repr_jpeg_') | |
765 |
|
774 | |||
766 | _return_type = (bytes, unicode_type) |
|
775 | _return_type = (bytes, unicode_type) | |
767 |
|
776 | |||
768 |
|
777 | |||
769 | class LatexFormatter(BaseFormatter): |
|
778 | class LatexFormatter(BaseFormatter): | |
770 | """A LaTeX formatter. |
|
779 | """A LaTeX formatter. | |
771 |
|
780 | |||
772 | To define the callables that compute the LaTeX representation of your |
|
781 | To define the callables that compute the LaTeX representation of your | |
773 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
782 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` | |
774 | or :meth:`for_type_by_name` methods to register functions that handle |
|
783 | or :meth:`for_type_by_name` methods to register functions that handle | |
775 | this. |
|
784 | this. | |
776 |
|
785 | |||
777 | The return value of this formatter should be a valid LaTeX equation, |
|
786 | The return value of this formatter should be a valid LaTeX equation, | |
778 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
787 | enclosed in either ```$```, ```$$``` or another LaTeX equation | |
779 | environment. |
|
788 | environment. | |
780 | """ |
|
789 | """ | |
781 | format_type = Unicode('text/latex') |
|
790 | format_type = Unicode('text/latex') | |
782 |
|
791 | |||
783 | print_method = ObjectName('_repr_latex_') |
|
792 | print_method = ObjectName('_repr_latex_') | |
784 |
|
793 | |||
785 |
|
794 | |||
786 | class JSONFormatter(BaseFormatter): |
|
795 | class JSONFormatter(BaseFormatter): | |
787 | """A JSON string formatter. |
|
796 | """A JSON string formatter. | |
788 |
|
797 | |||
789 | To define the callables that compute the JSON string representation of |
|
798 | To define the callables that compute the JSON string representation of | |
790 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
799 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` | |
791 | or :meth:`for_type_by_name` methods to register functions that handle |
|
800 | or :meth:`for_type_by_name` methods to register functions that handle | |
792 | this. |
|
801 | this. | |
793 |
|
802 | |||
794 | The return value of this formatter should be a valid JSON string. |
|
803 | The return value of this formatter should be a valid JSON string. | |
795 | """ |
|
804 | """ | |
796 | format_type = Unicode('application/json') |
|
805 | format_type = Unicode('application/json') | |
797 |
|
806 | |||
798 | print_method = ObjectName('_repr_json_') |
|
807 | print_method = ObjectName('_repr_json_') | |
799 |
|
808 | |||
800 |
|
809 | |||
801 | class JavascriptFormatter(BaseFormatter): |
|
810 | class JavascriptFormatter(BaseFormatter): | |
802 | """A Javascript formatter. |
|
811 | """A Javascript formatter. | |
803 |
|
812 | |||
804 | To define the callables that compute the Javascript representation of |
|
813 | To define the callables that compute the Javascript representation of | |
805 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
814 | your objects, define a :meth:`_repr_javascript_` method or use the | |
806 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
815 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions | |
807 | that handle this. |
|
816 | that handle this. | |
808 |
|
817 | |||
809 | The return value of this formatter should be valid Javascript code and |
|
818 | The return value of this formatter should be valid Javascript code and | |
810 | should *not* be enclosed in ```<script>``` tags. |
|
819 | should *not* be enclosed in ```<script>``` tags. | |
811 | """ |
|
820 | """ | |
812 | format_type = Unicode('application/javascript') |
|
821 | format_type = Unicode('application/javascript') | |
813 |
|
822 | |||
814 | print_method = ObjectName('_repr_javascript_') |
|
823 | print_method = ObjectName('_repr_javascript_') | |
815 |
|
824 | |||
816 |
|
825 | |||
817 | class PDFFormatter(BaseFormatter): |
|
826 | class PDFFormatter(BaseFormatter): | |
818 | """A PDF formatter. |
|
827 | """A PDF formatter. | |
819 |
|
828 | |||
820 | To define the callables that compute the PDF representation of your |
|
829 | To define the callables that compute the PDF representation of your | |
821 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
830 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` | |
822 | or :meth:`for_type_by_name` methods to register functions that handle |
|
831 | or :meth:`for_type_by_name` methods to register functions that handle | |
823 | this. |
|
832 | this. | |
824 |
|
833 | |||
825 | The return value of this formatter should be raw PDF data, *not* |
|
834 | The return value of this formatter should be raw PDF data, *not* | |
826 | base64 encoded. |
|
835 | base64 encoded. | |
827 | """ |
|
836 | """ | |
828 | format_type = Unicode('application/pdf') |
|
837 | format_type = Unicode('application/pdf') | |
829 |
|
838 | |||
830 | print_method = ObjectName('_repr_pdf_') |
|
839 | print_method = ObjectName('_repr_pdf_') | |
831 |
|
840 | |||
832 | _return_type = (bytes, unicode_type) |
|
841 | _return_type = (bytes, unicode_type) | |
833 |
|
842 | |||
|
843 | class SelfDisplayingFormatter(BaseFormatter): | |||
|
844 | """A Formatter for objects that know how to display themselves. | |||
|
845 | ||||
|
846 | To define the callables that compute the representation of your | |||
|
847 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` | |||
|
848 | or :meth:`for_type_by_name` methods to register functions that handle | |||
|
849 | this. Unlike mime-type displays, this method should not return anything, | |||
|
850 | instead calling any appropriate display methods itself. | |||
|
851 | ||||
|
852 | This display formatter has highest priority. | |||
|
853 | If it fires, no other display formatter will be called. | |||
|
854 | """ | |||
|
855 | print_method = ObjectName('_ipython_display_') | |||
|
856 | _return_type = (type(None), bool) | |||
|
857 | ||||
|
858 | ||||
|
859 | @warn_format_error | |||
|
860 | def __call__(self, obj): | |||
|
861 | """Compute the format for an object.""" | |||
|
862 | if self.enabled: | |||
|
863 | # lookup registered printer | |||
|
864 | try: | |||
|
865 | printer = self.lookup(obj) | |||
|
866 | except KeyError: | |||
|
867 | pass | |||
|
868 | else: | |||
|
869 | printer(obj) | |||
|
870 | return True | |||
|
871 | # Finally look for special method names | |||
|
872 | method = _safe_get_formatter_method(obj, self.print_method) | |||
|
873 | if method is not None: | |||
|
874 | method() | |||
|
875 | return True | |||
|
876 | ||||
834 |
|
877 | |||
835 | FormatterABC.register(BaseFormatter) |
|
878 | FormatterABC.register(BaseFormatter) | |
836 | FormatterABC.register(PlainTextFormatter) |
|
879 | FormatterABC.register(PlainTextFormatter) | |
837 | FormatterABC.register(HTMLFormatter) |
|
880 | FormatterABC.register(HTMLFormatter) | |
838 | FormatterABC.register(MarkdownFormatter) |
|
881 | FormatterABC.register(MarkdownFormatter) | |
839 | FormatterABC.register(SVGFormatter) |
|
882 | FormatterABC.register(SVGFormatter) | |
840 | FormatterABC.register(PNGFormatter) |
|
883 | FormatterABC.register(PNGFormatter) | |
841 | FormatterABC.register(PDFFormatter) |
|
884 | FormatterABC.register(PDFFormatter) | |
842 | FormatterABC.register(JPEGFormatter) |
|
885 | FormatterABC.register(JPEGFormatter) | |
843 | FormatterABC.register(LatexFormatter) |
|
886 | FormatterABC.register(LatexFormatter) | |
844 | FormatterABC.register(JSONFormatter) |
|
887 | FormatterABC.register(JSONFormatter) | |
845 | FormatterABC.register(JavascriptFormatter) |
|
888 | FormatterABC.register(JavascriptFormatter) | |
|
889 | FormatterABC.register(SelfDisplayingFormatter) | |||
846 |
|
890 | |||
847 |
|
891 | |||
848 | def format_display_data(obj, include=None, exclude=None): |
|
892 | def format_display_data(obj, include=None, exclude=None): | |
849 | """Return a format data dict for an object. |
|
893 | """Return a format data dict for an object. | |
850 |
|
894 | |||
851 | By default all format types will be computed. |
|
895 | By default all format types will be computed. | |
852 |
|
896 | |||
853 | The following MIME types are currently implemented: |
|
897 | The following MIME types are currently implemented: | |
854 |
|
898 | |||
855 | * text/plain |
|
899 | * text/plain | |
856 | * text/html |
|
900 | * text/html | |
857 | * text/markdown |
|
901 | * text/markdown | |
858 | * text/latex |
|
902 | * text/latex | |
859 | * application/json |
|
903 | * application/json | |
860 | * application/javascript |
|
904 | * application/javascript | |
861 | * application/pdf |
|
905 | * application/pdf | |
862 | * image/png |
|
906 | * image/png | |
863 | * image/jpeg |
|
907 | * image/jpeg | |
864 | * image/svg+xml |
|
908 | * image/svg+xml | |
865 |
|
909 | |||
866 | Parameters |
|
910 | Parameters | |
867 | ---------- |
|
911 | ---------- | |
868 | obj : object |
|
912 | obj : object | |
869 | The Python object whose format data will be computed. |
|
913 | The Python object whose format data will be computed. | |
870 |
|
914 | |||
871 | Returns |
|
915 | Returns | |
872 | ------- |
|
916 | ------- | |
873 | format_dict : dict |
|
917 | format_dict : dict | |
874 | A dictionary of key/value pairs, one or each format that was |
|
918 | A dictionary of key/value pairs, one or each format that was | |
875 | generated for the object. The keys are the format types, which |
|
919 | generated for the object. The keys are the format types, which | |
876 | will usually be MIME type strings and the values and JSON'able |
|
920 | will usually be MIME type strings and the values and JSON'able | |
877 | data structure containing the raw data for the representation in |
|
921 | data structure containing the raw data for the representation in | |
878 | that format. |
|
922 | that format. | |
879 | include : list or tuple, optional |
|
923 | include : list or tuple, optional | |
880 | A list of format type strings (MIME types) to include in the |
|
924 | A list of format type strings (MIME types) to include in the | |
881 | format data dict. If this is set *only* the format types included |
|
925 | format data dict. If this is set *only* the format types included | |
882 | in this list will be computed. |
|
926 | in this list will be computed. | |
883 | exclude : list or tuple, optional |
|
927 | exclude : list or tuple, optional | |
884 | A list of format type string (MIME types) to exclue in the format |
|
928 | A list of format type string (MIME types) to exclue in the format | |
885 | data dict. If this is set all format types will be computed, |
|
929 | data dict. If this is set all format types will be computed, | |
886 | except for those included in this argument. |
|
930 | except for those included in this argument. | |
887 | """ |
|
931 | """ | |
888 | from IPython.core.interactiveshell import InteractiveShell |
|
932 | from IPython.core.interactiveshell import InteractiveShell | |
889 |
|
933 | |||
890 | InteractiveShell.instance().display_formatter.format( |
|
934 | InteractiveShell.instance().display_formatter.format( | |
891 | obj, |
|
935 | obj, | |
892 | include, |
|
936 | include, | |
893 | exclude |
|
937 | exclude | |
894 | ) |
|
938 | ) | |
895 |
|
939 |
General Comments 0
You need to be logged in to leave comments.
Login now