Show More
@@ -1,657 +1,654 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Display formatters. |
|
2 | """Display formatters. | |
3 |
|
3 | |||
4 | Inheritance diagram: |
|
4 | Inheritance diagram: | |
5 |
|
5 | |||
6 | .. inheritance-diagram:: IPython.core.formatters |
|
6 | .. inheritance-diagram:: IPython.core.formatters | |
7 | :parts: 3 |
|
7 | :parts: 3 | |
8 |
|
8 | |||
9 | Authors: |
|
9 | Authors: | |
10 |
|
10 | |||
11 | * Robert Kern |
|
11 | * Robert Kern | |
12 | * Brian Granger |
|
12 | * Brian Granger | |
13 | """ |
|
13 | """ | |
14 | #----------------------------------------------------------------------------- |
|
14 | #----------------------------------------------------------------------------- | |
15 | # Copyright (C) 2010-2011, IPython Development Team. |
|
15 | # Copyright (C) 2010-2011, IPython Development Team. | |
16 | # |
|
16 | # | |
17 | # Distributed under the terms of the Modified BSD License. |
|
17 | # Distributed under the terms of the Modified BSD License. | |
18 | # |
|
18 | # | |
19 | # The full license is in the file COPYING.txt, distributed with this software. |
|
19 | # The full license is in the file COPYING.txt, distributed with this software. | |
20 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
21 |
|
21 | |||
22 | #----------------------------------------------------------------------------- |
|
22 | #----------------------------------------------------------------------------- | |
23 | # Imports |
|
23 | # Imports | |
24 | #----------------------------------------------------------------------------- |
|
24 | #----------------------------------------------------------------------------- | |
25 |
|
25 | |||
26 | # Stdlib imports |
|
26 | # Stdlib imports | |
27 | import abc |
|
27 | import abc | |
28 | import sys |
|
28 | import sys | |
29 | import warnings |
|
29 | import warnings | |
30 |
|
30 | |||
31 | # Our own imports |
|
31 | # Our own imports | |
32 | from IPython.config.configurable import Configurable |
|
32 | from IPython.config.configurable import Configurable | |
33 | from IPython.lib import pretty |
|
33 | from IPython.lib import pretty | |
34 | from IPython.utils.traitlets import ( |
|
34 | from IPython.utils.traitlets import ( | |
35 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
35 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, | |
36 | ) |
|
36 | ) | |
37 | from IPython.utils.py3compat import unicode_to_str, with_metaclass, PY3 |
|
37 | from IPython.utils.py3compat import unicode_to_str, with_metaclass, PY3 | |
38 |
|
38 | |||
39 | if PY3: |
|
39 | if PY3: | |
40 | from io import StringIO |
|
40 | from io import StringIO | |
41 | else: |
|
41 | else: | |
42 | from StringIO import StringIO |
|
42 | from StringIO import StringIO | |
43 |
|
43 | |||
44 |
|
44 | |||
45 | #----------------------------------------------------------------------------- |
|
45 | #----------------------------------------------------------------------------- | |
46 | # The main DisplayFormatter class |
|
46 | # The main DisplayFormatter class | |
47 | #----------------------------------------------------------------------------- |
|
47 | #----------------------------------------------------------------------------- | |
48 |
|
48 | |||
49 |
|
49 | |||
50 | class DisplayFormatter(Configurable): |
|
50 | class DisplayFormatter(Configurable): | |
51 |
|
51 | |||
52 | # When set to true only the default plain text formatter will be used. |
|
52 | # When set to true only the default plain text formatter will be used. | |
53 | plain_text_only = Bool(False, config=True) |
|
53 | plain_text_only = Bool(False, config=True) | |
54 | def _plain_text_only_changed(self, name, old, new): |
|
54 | def _plain_text_only_changed(self, name, old, new): | |
55 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. |
|
55 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. | |
56 |
|
56 | |||
57 | Use DisplayFormatter.active_types = ['text/plain'] |
|
57 | Use DisplayFormatter.active_types = ['text/plain'] | |
58 | for the same effect. |
|
58 | for the same effect. | |
59 | """, DeprecationWarning) |
|
59 | """, DeprecationWarning) | |
60 | if new: |
|
60 | if new: | |
61 | self.active_types = ['text/plain'] |
|
61 | self.active_types = ['text/plain'] | |
62 | else: |
|
62 | else: | |
63 | self.active_types = self.format_types |
|
63 | self.active_types = self.format_types | |
64 |
|
64 | |||
65 | active_types = List(Unicode, config=True, |
|
65 | active_types = List(Unicode, config=True, | |
66 | help="""List of currently active mime-types to display. |
|
66 | help="""List of currently active mime-types to display. | |
67 | You can use this to set a white-list for formats to display. |
|
67 | You can use this to set a white-list for formats to display. | |
68 |
|
68 | |||
69 | Most users will not need to change this value. |
|
69 | Most users will not need to change this value. | |
70 | """) |
|
70 | """) | |
71 | def _active_types_default(self): |
|
71 | def _active_types_default(self): | |
72 | return self.format_types |
|
72 | return self.format_types | |
73 |
|
73 | |||
74 | def _active_types_changed(self, name, old, new): |
|
74 | def _active_types_changed(self, name, old, new): | |
75 | for key, formatter in self.formatters.items(): |
|
75 | for key, formatter in self.formatters.items(): | |
76 | if key in new: |
|
76 | if key in new: | |
77 | formatter.enabled = True |
|
77 | formatter.enabled = True | |
78 | else: |
|
78 | else: | |
79 | formatter.enabled = False |
|
79 | formatter.enabled = False | |
80 |
|
80 | |||
81 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
81 | # A dict of formatter whose keys are format types (MIME types) and whose | |
82 | # values are subclasses of BaseFormatter. |
|
82 | # values are subclasses of BaseFormatter. | |
83 | formatters = Dict() |
|
83 | formatters = Dict() | |
84 | def _formatters_default(self): |
|
84 | def _formatters_default(self): | |
85 | """Activate the default formatters.""" |
|
85 | """Activate the default formatters.""" | |
86 | formatter_classes = [ |
|
86 | formatter_classes = [ | |
87 | PlainTextFormatter, |
|
87 | PlainTextFormatter, | |
88 | HTMLFormatter, |
|
88 | HTMLFormatter, | |
89 | SVGFormatter, |
|
89 | SVGFormatter, | |
90 | PNGFormatter, |
|
90 | PNGFormatter, | |
91 | JPEGFormatter, |
|
91 | JPEGFormatter, | |
92 | LatexFormatter, |
|
92 | LatexFormatter, | |
93 | JSONFormatter, |
|
93 | JSONFormatter, | |
94 | JavascriptFormatter |
|
94 | JavascriptFormatter | |
95 | ] |
|
95 | ] | |
96 | d = {} |
|
96 | d = {} | |
97 | for cls in formatter_classes: |
|
97 | for cls in formatter_classes: | |
98 | f = cls(parent=self) |
|
98 | f = cls(parent=self) | |
99 | d[f.format_type] = f |
|
99 | d[f.format_type] = f | |
100 | return d |
|
100 | return d | |
101 |
|
101 | |||
102 | def format(self, obj, include=None, exclude=None): |
|
102 | def format(self, obj, include=None, exclude=None): | |
103 | """Return a format data dict for an object. |
|
103 | """Return a format data dict for an object. | |
104 |
|
104 | |||
105 | By default all format types will be computed. |
|
105 | By default all format types will be computed. | |
106 |
|
106 | |||
107 | The following MIME types are currently implemented: |
|
107 | The following MIME types are currently implemented: | |
108 |
|
108 | |||
109 | * text/plain |
|
109 | * text/plain | |
110 | * text/html |
|
110 | * text/html | |
111 | * text/latex |
|
111 | * text/latex | |
112 | * application/json |
|
112 | * application/json | |
113 | * application/javascript |
|
113 | * application/javascript | |
114 | * image/png |
|
114 | * image/png | |
115 | * image/jpeg |
|
115 | * image/jpeg | |
116 | * image/svg+xml |
|
116 | * image/svg+xml | |
117 |
|
117 | |||
118 | Parameters |
|
118 | Parameters | |
119 | ---------- |
|
119 | ---------- | |
120 | obj : object |
|
120 | obj : object | |
121 | The Python object whose format data will be computed. |
|
121 | The Python object whose format data will be computed. | |
122 | include : list or tuple, optional |
|
122 | include : list or tuple, optional | |
123 | A list of format type strings (MIME types) to include in the |
|
123 | A list of format type strings (MIME types) to include in the | |
124 | format data dict. If this is set *only* the format types included |
|
124 | format data dict. If this is set *only* the format types included | |
125 | in this list will be computed. |
|
125 | in this list will be computed. | |
126 | exclude : list or tuple, optional |
|
126 | exclude : list or tuple, optional | |
127 | A list of format type string (MIME types) to exclude in the format |
|
127 | A list of format type string (MIME types) to exclude in the format | |
128 | data dict. If this is set all format types will be computed, |
|
128 | data dict. If this is set all format types will be computed, | |
129 | except for those included in this argument. |
|
129 | except for those included in this argument. | |
130 |
|
130 | |||
131 | Returns |
|
131 | Returns | |
132 | ------- |
|
132 | ------- | |
133 | (format_dict, metadata_dict) : tuple of two dicts |
|
133 | (format_dict, metadata_dict) : tuple of two dicts | |
134 |
|
134 | |||
135 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
135 | format_dict is a dictionary of key/value pairs, one of each format that was | |
136 | generated for the object. The keys are the format types, which |
|
136 | generated for the object. The keys are the format types, which | |
137 | will usually be MIME type strings and the values and JSON'able |
|
137 | will usually be MIME type strings and the values and JSON'able | |
138 | data structure containing the raw data for the representation in |
|
138 | data structure containing the raw data for the representation in | |
139 | that format. |
|
139 | that format. | |
140 |
|
140 | |||
141 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
141 | metadata_dict is a dictionary of metadata about each mime-type output. | |
142 | Its keys will be a strict subset of the keys in format_dict. |
|
142 | Its keys will be a strict subset of the keys in format_dict. | |
143 | """ |
|
143 | """ | |
144 | format_dict = {} |
|
144 | format_dict = {} | |
145 | md_dict = {} |
|
145 | md_dict = {} | |
146 |
|
146 | |||
147 | for format_type, formatter in self.formatters.items(): |
|
147 | for format_type, formatter in self.formatters.items(): | |
148 | if include and format_type not in include: |
|
148 | if include and format_type not in include: | |
149 | continue |
|
149 | continue | |
150 | if exclude and format_type in exclude: |
|
150 | if exclude and format_type in exclude: | |
151 | continue |
|
151 | continue | |
152 |
|
152 | |||
153 | md = None |
|
153 | md = None | |
154 | try: |
|
154 | try: | |
155 | data = formatter(obj) |
|
155 | data = formatter(obj) | |
156 | except: |
|
156 | except: | |
157 | # FIXME: log the exception |
|
157 | # FIXME: log the exception | |
158 | raise |
|
158 | raise | |
159 |
|
159 | |||
160 | # formatters can return raw data or (data, metadata) |
|
160 | # formatters can return raw data or (data, metadata) | |
161 | if isinstance(data, tuple) and len(data) == 2: |
|
161 | if isinstance(data, tuple) and len(data) == 2: | |
162 | data, md = data |
|
162 | data, md = data | |
163 |
|
163 | |||
164 | if data is not None: |
|
164 | if data is not None: | |
165 | format_dict[format_type] = data |
|
165 | format_dict[format_type] = data | |
166 | if md is not None: |
|
166 | if md is not None: | |
167 | md_dict[format_type] = md |
|
167 | md_dict[format_type] = md | |
168 |
|
168 | |||
169 | return format_dict, md_dict |
|
169 | return format_dict, md_dict | |
170 |
|
170 | |||
171 | @property |
|
171 | @property | |
172 | def format_types(self): |
|
172 | def format_types(self): | |
173 | """Return the format types (MIME types) of the active formatters.""" |
|
173 | """Return the format types (MIME types) of the active formatters.""" | |
174 | return list(self.formatters.keys()) |
|
174 | return list(self.formatters.keys()) | |
175 |
|
175 | |||
176 |
|
176 | |||
177 | #----------------------------------------------------------------------------- |
|
177 | #----------------------------------------------------------------------------- | |
178 | # Formatters for specific format types (text, html, svg, etc.) |
|
178 | # Formatters for specific format types (text, html, svg, etc.) | |
179 | #----------------------------------------------------------------------------- |
|
179 | #----------------------------------------------------------------------------- | |
180 |
|
180 | |||
181 |
|
181 | |||
182 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): |
|
182 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): | |
183 | """ Abstract base class for Formatters. |
|
183 | """ Abstract base class for Formatters. | |
184 |
|
184 | |||
185 | A formatter is a callable class that is responsible for computing the |
|
185 | A formatter is a callable class that is responsible for computing the | |
186 | raw format data for a particular format type (MIME type). For example, |
|
186 | raw format data for a particular format type (MIME type). For example, | |
187 | an HTML formatter would have a format type of `text/html` and would return |
|
187 | an HTML formatter would have a format type of `text/html` and would return | |
188 | the HTML representation of the object when called. |
|
188 | the HTML representation of the object when called. | |
189 | """ |
|
189 | """ | |
190 |
|
190 | |||
191 | # The format type of the data returned, usually a MIME type. |
|
191 | # The format type of the data returned, usually a MIME type. | |
192 | format_type = 'text/plain' |
|
192 | format_type = 'text/plain' | |
193 |
|
193 | |||
194 | # Is the formatter enabled... |
|
194 | # Is the formatter enabled... | |
195 | enabled = True |
|
195 | enabled = True | |
196 |
|
196 | |||
197 | @abc.abstractmethod |
|
197 | @abc.abstractmethod | |
198 | def __call__(self, obj): |
|
198 | def __call__(self, obj): | |
199 | """Return a JSON'able representation of the object. |
|
199 | """Return a JSON'able representation of the object. | |
200 |
|
200 | |||
201 | If the object cannot be formatted by this formatter, then return None |
|
201 | If the object cannot be formatted by this formatter, then return None | |
202 | """ |
|
202 | """ | |
203 | try: |
|
203 | try: | |
204 | return repr(obj) |
|
204 | return repr(obj) | |
205 |
except |
|
205 | except Exception: | |
206 | return None |
|
206 | return None | |
207 |
|
207 | |||
208 |
|
208 | |||
209 | class BaseFormatter(Configurable): |
|
209 | class BaseFormatter(Configurable): | |
210 | """A base formatter class that is configurable. |
|
210 | """A base formatter class that is configurable. | |
211 |
|
211 | |||
212 | This formatter should usually be used as the base class of all formatters. |
|
212 | This formatter should usually be used as the base class of all formatters. | |
213 | It is a traited :class:`Configurable` class and includes an extensible |
|
213 | It is a traited :class:`Configurable` class and includes an extensible | |
214 | API for users to determine how their objects are formatted. The following |
|
214 | API for users to determine how their objects are formatted. The following | |
215 | logic is used to find a function to format an given object. |
|
215 | logic is used to find a function to format an given object. | |
216 |
|
216 | |||
217 | 1. The object is introspected to see if it has a method with the name |
|
217 | 1. The object is introspected to see if it has a method with the name | |
218 | :attr:`print_method`. If is does, that object is passed to that method |
|
218 | :attr:`print_method`. If is does, that object is passed to that method | |
219 | for formatting. |
|
219 | for formatting. | |
220 | 2. If no print method is found, three internal dictionaries are consulted |
|
220 | 2. If no print method is found, three internal dictionaries are consulted | |
221 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
221 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` | |
222 | and :attr:`deferred_printers`. |
|
222 | and :attr:`deferred_printers`. | |
223 |
|
223 | |||
224 | Users should use these dictionaries to register functions that will be |
|
224 | Users should use these dictionaries to register functions that will be | |
225 | used to compute the format data for their objects (if those objects don't |
|
225 | used to compute the format data for their objects (if those objects don't | |
226 | have the special print methods). The easiest way of using these |
|
226 | have the special print methods). The easiest way of using these | |
227 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
227 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` | |
228 | methods. |
|
228 | methods. | |
229 |
|
229 | |||
230 | If no function/callable is found to compute the format data, ``None`` is |
|
230 | If no function/callable is found to compute the format data, ``None`` is | |
231 | returned and this format type is not used. |
|
231 | returned and this format type is not used. | |
232 | """ |
|
232 | """ | |
233 |
|
233 | |||
234 | format_type = Unicode('text/plain') |
|
234 | format_type = Unicode('text/plain') | |
235 |
|
235 | |||
236 | enabled = Bool(True, config=True) |
|
236 | enabled = Bool(True, config=True) | |
237 |
|
237 | |||
238 | print_method = ObjectName('__repr__') |
|
238 | print_method = ObjectName('__repr__') | |
239 |
|
239 | |||
240 | # The singleton printers. |
|
240 | # The singleton printers. | |
241 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
241 | # Maps the IDs of the builtin singleton objects to the format functions. | |
242 | singleton_printers = Dict(config=True) |
|
242 | singleton_printers = Dict(config=True) | |
243 | def _singleton_printers_default(self): |
|
243 | def _singleton_printers_default(self): | |
244 | return {} |
|
244 | return {} | |
245 |
|
245 | |||
246 | # The type-specific printers. |
|
246 | # The type-specific printers. | |
247 | # Map type objects to the format functions. |
|
247 | # Map type objects to the format functions. | |
248 | type_printers = Dict(config=True) |
|
248 | type_printers = Dict(config=True) | |
249 | def _type_printers_default(self): |
|
249 | def _type_printers_default(self): | |
250 | return {} |
|
250 | return {} | |
251 |
|
251 | |||
252 | # The deferred-import type-specific printers. |
|
252 | # The deferred-import type-specific printers. | |
253 | # Map (modulename, classname) pairs to the format functions. |
|
253 | # Map (modulename, classname) pairs to the format functions. | |
254 | deferred_printers = Dict(config=True) |
|
254 | deferred_printers = Dict(config=True) | |
255 | def _deferred_printers_default(self): |
|
255 | def _deferred_printers_default(self): | |
256 | return {} |
|
256 | return {} | |
257 |
|
257 | |||
258 | def __call__(self, obj): |
|
258 | def __call__(self, obj): | |
259 | """Compute the format for an object.""" |
|
259 | """Compute the format for an object.""" | |
260 | if self.enabled: |
|
260 | if self.enabled: | |
261 | obj_id = id(obj) |
|
261 | obj_id = id(obj) | |
262 | try: |
|
262 | try: | |
263 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
263 | obj_class = getattr(obj, '__class__', None) or type(obj) | |
264 | # First try to find registered singleton printers for the type. |
|
264 | # First try to find registered singleton printers for the type. | |
265 | try: |
|
265 | try: | |
266 | printer = self.singleton_printers[obj_id] |
|
266 | printer = self.singleton_printers[obj_id] | |
267 | except (TypeError, KeyError): |
|
267 | except (TypeError, KeyError): | |
268 | pass |
|
268 | pass | |
269 | else: |
|
269 | else: | |
270 | return printer(obj) |
|
270 | return printer(obj) | |
271 | # Next look for type_printers. |
|
271 | # Next look for type_printers. | |
272 | for cls in pretty._get_mro(obj_class): |
|
272 | for cls in pretty._get_mro(obj_class): | |
273 | if cls in self.type_printers: |
|
273 | if cls in self.type_printers: | |
274 | return self.type_printers[cls](obj) |
|
274 | return self.type_printers[cls](obj) | |
275 | else: |
|
275 | else: | |
276 | printer = self._in_deferred_types(cls) |
|
276 | printer = self._in_deferred_types(cls) | |
277 | if printer is not None: |
|
277 | if printer is not None: | |
278 | return printer(obj) |
|
278 | return printer(obj) | |
279 | # Finally look for special method names. |
|
279 | # Finally look for special method names. | |
280 | if hasattr(obj_class, self.print_method): |
|
280 | if hasattr(obj_class, self.print_method): | |
281 | printer = getattr(obj_class, self.print_method) |
|
281 | printer = getattr(obj_class, self.print_method) | |
282 | return printer(obj) |
|
282 | return printer(obj) | |
283 | return None |
|
283 | return None | |
284 | except Exception: |
|
284 | except Exception: | |
285 | pass |
|
285 | pass | |
286 | else: |
|
286 | else: | |
287 | return None |
|
287 | return None | |
288 |
|
288 | |||
289 | def for_type(self, typ, func): |
|
289 | def for_type(self, typ, func): | |
290 | """Add a format function for a given type. |
|
290 | """Add a format function for a given type. | |
291 |
|
291 | |||
292 | Parameters |
|
292 | Parameters | |
293 | ----------- |
|
293 | ----------- | |
294 | typ : class |
|
294 | typ : class | |
295 | The class of the object that will be formatted using `func`. |
|
295 | The class of the object that will be formatted using `func`. | |
296 | func : callable |
|
296 | func : callable | |
297 | The callable that will be called to compute the format data. The |
|
297 | The callable that will be called to compute the format data. The | |
298 | call signature of this function is simple, it must take the |
|
298 | call signature of this function is simple, it must take the | |
299 | object to be formatted and return the raw data for the given |
|
299 | object to be formatted and return the raw data for the given | |
300 | format. Subclasses may use a different call signature for the |
|
300 | format. Subclasses may use a different call signature for the | |
301 | `func` argument. |
|
301 | `func` argument. | |
302 | """ |
|
302 | """ | |
303 | oldfunc = self.type_printers.get(typ, None) |
|
303 | oldfunc = self.type_printers.get(typ, None) | |
304 | if func is not None: |
|
304 | if func is not None: | |
305 | # To support easy restoration of old printers, we need to ignore |
|
305 | # To support easy restoration of old printers, we need to ignore | |
306 | # Nones. |
|
306 | # Nones. | |
307 | self.type_printers[typ] = func |
|
307 | self.type_printers[typ] = func | |
308 | return oldfunc |
|
308 | return oldfunc | |
309 |
|
309 | |||
310 | def for_type_by_name(self, type_module, type_name, func): |
|
310 | def for_type_by_name(self, type_module, type_name, func): | |
311 | """Add a format function for a type specified by the full dotted |
|
311 | """Add a format function for a type specified by the full dotted | |
312 | module and name of the type, rather than the type of the object. |
|
312 | module and name of the type, rather than the type of the object. | |
313 |
|
313 | |||
314 | Parameters |
|
314 | Parameters | |
315 | ---------- |
|
315 | ---------- | |
316 | type_module : str |
|
316 | type_module : str | |
317 | The full dotted name of the module the type is defined in, like |
|
317 | The full dotted name of the module the type is defined in, like | |
318 | ``numpy``. |
|
318 | ``numpy``. | |
319 | type_name : str |
|
319 | type_name : str | |
320 | The name of the type (the class name), like ``dtype`` |
|
320 | The name of the type (the class name), like ``dtype`` | |
321 | func : callable |
|
321 | func : callable | |
322 | The callable that will be called to compute the format data. The |
|
322 | The callable that will be called to compute the format data. The | |
323 | call signature of this function is simple, it must take the |
|
323 | call signature of this function is simple, it must take the | |
324 | object to be formatted and return the raw data for the given |
|
324 | object to be formatted and return the raw data for the given | |
325 | format. Subclasses may use a different call signature for the |
|
325 | format. Subclasses may use a different call signature for the | |
326 | `func` argument. |
|
326 | `func` argument. | |
327 | """ |
|
327 | """ | |
328 | key = (type_module, type_name) |
|
328 | key = (type_module, type_name) | |
329 | oldfunc = self.deferred_printers.get(key, None) |
|
329 | oldfunc = self.deferred_printers.get(key, None) | |
330 | if func is not None: |
|
330 | if func is not None: | |
331 | # To support easy restoration of old printers, we need to ignore |
|
331 | # To support easy restoration of old printers, we need to ignore | |
332 | # Nones. |
|
332 | # Nones. | |
333 | self.deferred_printers[key] = func |
|
333 | self.deferred_printers[key] = func | |
334 | return oldfunc |
|
334 | return oldfunc | |
335 |
|
335 | |||
336 | def _in_deferred_types(self, cls): |
|
336 | def _in_deferred_types(self, cls): | |
337 | """ |
|
337 | """ | |
338 | Check if the given class is specified in the deferred type registry. |
|
338 | Check if the given class is specified in the deferred type registry. | |
339 |
|
339 | |||
340 | Returns the printer from the registry if it exists, and None if the |
|
340 | Returns the printer from the registry if it exists, and None if the | |
341 | class is not in the registry. Successful matches will be moved to the |
|
341 | class is not in the registry. Successful matches will be moved to the | |
342 | regular type registry for future use. |
|
342 | regular type registry for future use. | |
343 | """ |
|
343 | """ | |
344 | mod = getattr(cls, '__module__', None) |
|
344 | mod = getattr(cls, '__module__', None) | |
345 | name = getattr(cls, '__name__', None) |
|
345 | name = getattr(cls, '__name__', None) | |
346 | key = (mod, name) |
|
346 | key = (mod, name) | |
347 | printer = None |
|
347 | printer = None | |
348 | if key in self.deferred_printers: |
|
348 | if key in self.deferred_printers: | |
349 | # Move the printer over to the regular registry. |
|
349 | # Move the printer over to the regular registry. | |
350 | printer = self.deferred_printers.pop(key) |
|
350 | printer = self.deferred_printers.pop(key) | |
351 | self.type_printers[cls] = printer |
|
351 | self.type_printers[cls] = printer | |
352 | return printer |
|
352 | return printer | |
353 |
|
353 | |||
354 |
|
354 | |||
355 | class PlainTextFormatter(BaseFormatter): |
|
355 | class PlainTextFormatter(BaseFormatter): | |
356 | """The default pretty-printer. |
|
356 | """The default pretty-printer. | |
357 |
|
357 | |||
358 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
358 | This uses :mod:`IPython.lib.pretty` to compute the format data of | |
359 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
359 | the object. If the object cannot be pretty printed, :func:`repr` is used. | |
360 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
360 | See the documentation of :mod:`IPython.lib.pretty` for details on | |
361 | how to write pretty printers. Here is a simple example:: |
|
361 | how to write pretty printers. Here is a simple example:: | |
362 |
|
362 | |||
363 | def dtype_pprinter(obj, p, cycle): |
|
363 | def dtype_pprinter(obj, p, cycle): | |
364 | if cycle: |
|
364 | if cycle: | |
365 | return p.text('dtype(...)') |
|
365 | return p.text('dtype(...)') | |
366 | if hasattr(obj, 'fields'): |
|
366 | if hasattr(obj, 'fields'): | |
367 | if obj.fields is None: |
|
367 | if obj.fields is None: | |
368 | p.text(repr(obj)) |
|
368 | p.text(repr(obj)) | |
369 | else: |
|
369 | else: | |
370 | p.begin_group(7, 'dtype([') |
|
370 | p.begin_group(7, 'dtype([') | |
371 | for i, field in enumerate(obj.descr): |
|
371 | for i, field in enumerate(obj.descr): | |
372 | if i > 0: |
|
372 | if i > 0: | |
373 | p.text(',') |
|
373 | p.text(',') | |
374 | p.breakable() |
|
374 | p.breakable() | |
375 | p.pretty(field) |
|
375 | p.pretty(field) | |
376 | p.end_group(7, '])') |
|
376 | p.end_group(7, '])') | |
377 | """ |
|
377 | """ | |
378 |
|
378 | |||
379 | # The format type of data returned. |
|
379 | # The format type of data returned. | |
380 | format_type = Unicode('text/plain') |
|
380 | format_type = Unicode('text/plain') | |
381 |
|
381 | |||
382 | # This subclass ignores this attribute as it always need to return |
|
382 | # This subclass ignores this attribute as it always need to return | |
383 | # something. |
|
383 | # something. | |
384 | enabled = Bool(True, config=False) |
|
384 | enabled = Bool(True, config=False) | |
385 |
|
385 | |||
386 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
386 | # Look for a _repr_pretty_ methods to use for pretty printing. | |
387 | print_method = ObjectName('_repr_pretty_') |
|
387 | print_method = ObjectName('_repr_pretty_') | |
388 |
|
388 | |||
389 | # Whether to pretty-print or not. |
|
389 | # Whether to pretty-print or not. | |
390 | pprint = Bool(True, config=True) |
|
390 | pprint = Bool(True, config=True) | |
391 |
|
391 | |||
392 | # Whether to be verbose or not. |
|
392 | # Whether to be verbose or not. | |
393 | verbose = Bool(False, config=True) |
|
393 | verbose = Bool(False, config=True) | |
394 |
|
394 | |||
395 | # The maximum width. |
|
395 | # The maximum width. | |
396 | max_width = Integer(79, config=True) |
|
396 | max_width = Integer(79, config=True) | |
397 |
|
397 | |||
398 | # The newline character. |
|
398 | # The newline character. | |
399 | newline = Unicode('\n', config=True) |
|
399 | newline = Unicode('\n', config=True) | |
400 |
|
400 | |||
401 | # format-string for pprinting floats |
|
401 | # format-string for pprinting floats | |
402 | float_format = Unicode('%r') |
|
402 | float_format = Unicode('%r') | |
403 | # setter for float precision, either int or direct format-string |
|
403 | # setter for float precision, either int or direct format-string | |
404 | float_precision = CUnicode('', config=True) |
|
404 | float_precision = CUnicode('', config=True) | |
405 |
|
405 | |||
406 | def _float_precision_changed(self, name, old, new): |
|
406 | def _float_precision_changed(self, name, old, new): | |
407 | """float_precision changed, set float_format accordingly. |
|
407 | """float_precision changed, set float_format accordingly. | |
408 |
|
408 | |||
409 | float_precision can be set by int or str. |
|
409 | float_precision can be set by int or str. | |
410 | This will set float_format, after interpreting input. |
|
410 | This will set float_format, after interpreting input. | |
411 | If numpy has been imported, numpy print precision will also be set. |
|
411 | If numpy has been imported, numpy print precision will also be set. | |
412 |
|
412 | |||
413 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
413 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
414 |
|
414 | |||
415 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
415 | An empty string returns to defaults (repr for float, 8 for numpy). | |
416 |
|
416 | |||
417 | This parameter can be set via the '%precision' magic. |
|
417 | This parameter can be set via the '%precision' magic. | |
418 | """ |
|
418 | """ | |
419 |
|
419 | |||
420 | if '%' in new: |
|
420 | if '%' in new: | |
421 | # got explicit format string |
|
421 | # got explicit format string | |
422 | fmt = new |
|
422 | fmt = new | |
423 | try: |
|
423 | try: | |
424 | fmt%3.14159 |
|
424 | fmt%3.14159 | |
425 | except Exception: |
|
425 | except Exception: | |
426 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
426 | raise ValueError("Precision must be int or format string, not %r"%new) | |
427 | elif new: |
|
427 | elif new: | |
428 | # otherwise, should be an int |
|
428 | # otherwise, should be an int | |
429 | try: |
|
429 | try: | |
430 | i = int(new) |
|
430 | i = int(new) | |
431 | assert i >= 0 |
|
431 | assert i >= 0 | |
432 | except ValueError: |
|
432 | except ValueError: | |
433 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
433 | raise ValueError("Precision must be int or format string, not %r"%new) | |
434 | except AssertionError: |
|
434 | except AssertionError: | |
435 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
435 | raise ValueError("int precision must be non-negative, not %r"%i) | |
436 |
|
436 | |||
437 | fmt = '%%.%if'%i |
|
437 | fmt = '%%.%if'%i | |
438 | if 'numpy' in sys.modules: |
|
438 | if 'numpy' in sys.modules: | |
439 | # set numpy precision if it has been imported |
|
439 | # set numpy precision if it has been imported | |
440 | import numpy |
|
440 | import numpy | |
441 | numpy.set_printoptions(precision=i) |
|
441 | numpy.set_printoptions(precision=i) | |
442 | else: |
|
442 | else: | |
443 | # default back to repr |
|
443 | # default back to repr | |
444 | fmt = '%r' |
|
444 | fmt = '%r' | |
445 | if 'numpy' in sys.modules: |
|
445 | if 'numpy' in sys.modules: | |
446 | import numpy |
|
446 | import numpy | |
447 | # numpy default is 8 |
|
447 | # numpy default is 8 | |
448 | numpy.set_printoptions(precision=8) |
|
448 | numpy.set_printoptions(precision=8) | |
449 | self.float_format = fmt |
|
449 | self.float_format = fmt | |
450 |
|
450 | |||
451 | # Use the default pretty printers from IPython.lib.pretty. |
|
451 | # Use the default pretty printers from IPython.lib.pretty. | |
452 | def _singleton_printers_default(self): |
|
452 | def _singleton_printers_default(self): | |
453 | return pretty._singleton_pprinters.copy() |
|
453 | return pretty._singleton_pprinters.copy() | |
454 |
|
454 | |||
455 | def _type_printers_default(self): |
|
455 | def _type_printers_default(self): | |
456 | d = pretty._type_pprinters.copy() |
|
456 | d = pretty._type_pprinters.copy() | |
457 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
457 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
458 | return d |
|
458 | return d | |
459 |
|
459 | |||
460 | def _deferred_printers_default(self): |
|
460 | def _deferred_printers_default(self): | |
461 | return pretty._deferred_type_pprinters.copy() |
|
461 | return pretty._deferred_type_pprinters.copy() | |
462 |
|
462 | |||
463 | #### FormatterABC interface #### |
|
463 | #### FormatterABC interface #### | |
464 |
|
464 | |||
465 | def __call__(self, obj): |
|
465 | def __call__(self, obj): | |
466 | """Compute the pretty representation of the object.""" |
|
466 | """Compute the pretty representation of the object.""" | |
467 | if not self.pprint: |
|
467 | if not self.pprint: | |
468 | try: |
|
468 | return pretty._safe_repr(obj) | |
469 | return repr(obj) |
|
|||
470 | except TypeError: |
|
|||
471 | return '' |
|
|||
472 | else: |
|
469 | else: | |
473 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
470 | # This uses use StringIO, as cStringIO doesn't handle unicode. | |
474 | stream = StringIO() |
|
471 | stream = StringIO() | |
475 | # self.newline.encode() is a quick fix for issue gh-597. We need to |
|
472 | # self.newline.encode() is a quick fix for issue gh-597. We need to | |
476 | # ensure that stream does not get a mix of unicode and bytestrings, |
|
473 | # ensure that stream does not get a mix of unicode and bytestrings, | |
477 | # or it will cause trouble. |
|
474 | # or it will cause trouble. | |
478 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
475 | printer = pretty.RepresentationPrinter(stream, self.verbose, | |
479 | self.max_width, unicode_to_str(self.newline), |
|
476 | self.max_width, unicode_to_str(self.newline), | |
480 | singleton_pprinters=self.singleton_printers, |
|
477 | singleton_pprinters=self.singleton_printers, | |
481 | type_pprinters=self.type_printers, |
|
478 | type_pprinters=self.type_printers, | |
482 | deferred_pprinters=self.deferred_printers) |
|
479 | deferred_pprinters=self.deferred_printers) | |
483 | printer.pretty(obj) |
|
480 | printer.pretty(obj) | |
484 | printer.flush() |
|
481 | printer.flush() | |
485 | return stream.getvalue() |
|
482 | return stream.getvalue() | |
486 |
|
483 | |||
487 |
|
484 | |||
488 | class HTMLFormatter(BaseFormatter): |
|
485 | class HTMLFormatter(BaseFormatter): | |
489 | """An HTML formatter. |
|
486 | """An HTML formatter. | |
490 |
|
487 | |||
491 | To define the callables that compute the HTML representation of your |
|
488 | To define the callables that compute the HTML representation of your | |
492 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
489 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` | |
493 | or :meth:`for_type_by_name` methods to register functions that handle |
|
490 | or :meth:`for_type_by_name` methods to register functions that handle | |
494 | this. |
|
491 | this. | |
495 |
|
492 | |||
496 | The return value of this formatter should be a valid HTML snippet that |
|
493 | The return value of this formatter should be a valid HTML snippet that | |
497 | could be injected into an existing DOM. It should *not* include the |
|
494 | could be injected into an existing DOM. It should *not* include the | |
498 | ```<html>`` or ```<body>`` tags. |
|
495 | ```<html>`` or ```<body>`` tags. | |
499 | """ |
|
496 | """ | |
500 | format_type = Unicode('text/html') |
|
497 | format_type = Unicode('text/html') | |
501 |
|
498 | |||
502 | print_method = ObjectName('_repr_html_') |
|
499 | print_method = ObjectName('_repr_html_') | |
503 |
|
500 | |||
504 |
|
501 | |||
505 | class SVGFormatter(BaseFormatter): |
|
502 | class SVGFormatter(BaseFormatter): | |
506 | """An SVG formatter. |
|
503 | """An SVG formatter. | |
507 |
|
504 | |||
508 | To define the callables that compute the SVG representation of your |
|
505 | To define the callables that compute the SVG representation of your | |
509 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
506 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` | |
510 | or :meth:`for_type_by_name` methods to register functions that handle |
|
507 | or :meth:`for_type_by_name` methods to register functions that handle | |
511 | this. |
|
508 | this. | |
512 |
|
509 | |||
513 | The return value of this formatter should be valid SVG enclosed in |
|
510 | The return value of this formatter should be valid SVG enclosed in | |
514 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
511 | ```<svg>``` tags, that could be injected into an existing DOM. It should | |
515 | *not* include the ```<html>`` or ```<body>`` tags. |
|
512 | *not* include the ```<html>`` or ```<body>`` tags. | |
516 | """ |
|
513 | """ | |
517 | format_type = Unicode('image/svg+xml') |
|
514 | format_type = Unicode('image/svg+xml') | |
518 |
|
515 | |||
519 | print_method = ObjectName('_repr_svg_') |
|
516 | print_method = ObjectName('_repr_svg_') | |
520 |
|
517 | |||
521 |
|
518 | |||
522 | class PNGFormatter(BaseFormatter): |
|
519 | class PNGFormatter(BaseFormatter): | |
523 | """A PNG formatter. |
|
520 | """A PNG formatter. | |
524 |
|
521 | |||
525 | To define the callables that compute the PNG representation of your |
|
522 | To define the callables that compute the PNG representation of your | |
526 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
523 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` | |
527 | or :meth:`for_type_by_name` methods to register functions that handle |
|
524 | or :meth:`for_type_by_name` methods to register functions that handle | |
528 | this. |
|
525 | this. | |
529 |
|
526 | |||
530 | The return value of this formatter should be raw PNG data, *not* |
|
527 | The return value of this formatter should be raw PNG data, *not* | |
531 | base64 encoded. |
|
528 | base64 encoded. | |
532 | """ |
|
529 | """ | |
533 | format_type = Unicode('image/png') |
|
530 | format_type = Unicode('image/png') | |
534 |
|
531 | |||
535 | print_method = ObjectName('_repr_png_') |
|
532 | print_method = ObjectName('_repr_png_') | |
536 |
|
533 | |||
537 |
|
534 | |||
538 | class JPEGFormatter(BaseFormatter): |
|
535 | class JPEGFormatter(BaseFormatter): | |
539 | """A JPEG formatter. |
|
536 | """A JPEG formatter. | |
540 |
|
537 | |||
541 | To define the callables that compute the JPEG representation of your |
|
538 | To define the callables that compute the JPEG representation of your | |
542 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
539 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` | |
543 | or :meth:`for_type_by_name` methods to register functions that handle |
|
540 | or :meth:`for_type_by_name` methods to register functions that handle | |
544 | this. |
|
541 | this. | |
545 |
|
542 | |||
546 | The return value of this formatter should be raw JPEG data, *not* |
|
543 | The return value of this formatter should be raw JPEG data, *not* | |
547 | base64 encoded. |
|
544 | base64 encoded. | |
548 | """ |
|
545 | """ | |
549 | format_type = Unicode('image/jpeg') |
|
546 | format_type = Unicode('image/jpeg') | |
550 |
|
547 | |||
551 | print_method = ObjectName('_repr_jpeg_') |
|
548 | print_method = ObjectName('_repr_jpeg_') | |
552 |
|
549 | |||
553 |
|
550 | |||
554 | class LatexFormatter(BaseFormatter): |
|
551 | class LatexFormatter(BaseFormatter): | |
555 | """A LaTeX formatter. |
|
552 | """A LaTeX formatter. | |
556 |
|
553 | |||
557 | To define the callables that compute the LaTeX representation of your |
|
554 | To define the callables that compute the LaTeX representation of your | |
558 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
555 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` | |
559 | or :meth:`for_type_by_name` methods to register functions that handle |
|
556 | or :meth:`for_type_by_name` methods to register functions that handle | |
560 | this. |
|
557 | this. | |
561 |
|
558 | |||
562 | The return value of this formatter should be a valid LaTeX equation, |
|
559 | The return value of this formatter should be a valid LaTeX equation, | |
563 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
560 | enclosed in either ```$```, ```$$``` or another LaTeX equation | |
564 | environment. |
|
561 | environment. | |
565 | """ |
|
562 | """ | |
566 | format_type = Unicode('text/latex') |
|
563 | format_type = Unicode('text/latex') | |
567 |
|
564 | |||
568 | print_method = ObjectName('_repr_latex_') |
|
565 | print_method = ObjectName('_repr_latex_') | |
569 |
|
566 | |||
570 |
|
567 | |||
571 | class JSONFormatter(BaseFormatter): |
|
568 | class JSONFormatter(BaseFormatter): | |
572 | """A JSON string formatter. |
|
569 | """A JSON string formatter. | |
573 |
|
570 | |||
574 | To define the callables that compute the JSON string representation of |
|
571 | To define the callables that compute the JSON string representation of | |
575 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
572 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` | |
576 | or :meth:`for_type_by_name` methods to register functions that handle |
|
573 | or :meth:`for_type_by_name` methods to register functions that handle | |
577 | this. |
|
574 | this. | |
578 |
|
575 | |||
579 | The return value of this formatter should be a valid JSON string. |
|
576 | The return value of this formatter should be a valid JSON string. | |
580 | """ |
|
577 | """ | |
581 | format_type = Unicode('application/json') |
|
578 | format_type = Unicode('application/json') | |
582 |
|
579 | |||
583 | print_method = ObjectName('_repr_json_') |
|
580 | print_method = ObjectName('_repr_json_') | |
584 |
|
581 | |||
585 |
|
582 | |||
586 | class JavascriptFormatter(BaseFormatter): |
|
583 | class JavascriptFormatter(BaseFormatter): | |
587 | """A Javascript formatter. |
|
584 | """A Javascript formatter. | |
588 |
|
585 | |||
589 | To define the callables that compute the Javascript representation of |
|
586 | To define the callables that compute the Javascript representation of | |
590 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
587 | your objects, define a :meth:`_repr_javascript_` method or use the | |
591 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
588 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions | |
592 | that handle this. |
|
589 | that handle this. | |
593 |
|
590 | |||
594 | The return value of this formatter should be valid Javascript code and |
|
591 | The return value of this formatter should be valid Javascript code and | |
595 | should *not* be enclosed in ```<script>``` tags. |
|
592 | should *not* be enclosed in ```<script>``` tags. | |
596 | """ |
|
593 | """ | |
597 | format_type = Unicode('application/javascript') |
|
594 | format_type = Unicode('application/javascript') | |
598 |
|
595 | |||
599 | print_method = ObjectName('_repr_javascript_') |
|
596 | print_method = ObjectName('_repr_javascript_') | |
600 |
|
597 | |||
601 | FormatterABC.register(BaseFormatter) |
|
598 | FormatterABC.register(BaseFormatter) | |
602 | FormatterABC.register(PlainTextFormatter) |
|
599 | FormatterABC.register(PlainTextFormatter) | |
603 | FormatterABC.register(HTMLFormatter) |
|
600 | FormatterABC.register(HTMLFormatter) | |
604 | FormatterABC.register(SVGFormatter) |
|
601 | FormatterABC.register(SVGFormatter) | |
605 | FormatterABC.register(PNGFormatter) |
|
602 | FormatterABC.register(PNGFormatter) | |
606 | FormatterABC.register(JPEGFormatter) |
|
603 | FormatterABC.register(JPEGFormatter) | |
607 | FormatterABC.register(LatexFormatter) |
|
604 | FormatterABC.register(LatexFormatter) | |
608 | FormatterABC.register(JSONFormatter) |
|
605 | FormatterABC.register(JSONFormatter) | |
609 | FormatterABC.register(JavascriptFormatter) |
|
606 | FormatterABC.register(JavascriptFormatter) | |
610 |
|
607 | |||
611 |
|
608 | |||
612 | def format_display_data(obj, include=None, exclude=None): |
|
609 | def format_display_data(obj, include=None, exclude=None): | |
613 | """Return a format data dict for an object. |
|
610 | """Return a format data dict for an object. | |
614 |
|
611 | |||
615 | By default all format types will be computed. |
|
612 | By default all format types will be computed. | |
616 |
|
613 | |||
617 | The following MIME types are currently implemented: |
|
614 | The following MIME types are currently implemented: | |
618 |
|
615 | |||
619 | * text/plain |
|
616 | * text/plain | |
620 | * text/html |
|
617 | * text/html | |
621 | * text/latex |
|
618 | * text/latex | |
622 | * application/json |
|
619 | * application/json | |
623 | * application/javascript |
|
620 | * application/javascript | |
624 | * image/png |
|
621 | * image/png | |
625 | * image/jpeg |
|
622 | * image/jpeg | |
626 | * image/svg+xml |
|
623 | * image/svg+xml | |
627 |
|
624 | |||
628 | Parameters |
|
625 | Parameters | |
629 | ---------- |
|
626 | ---------- | |
630 | obj : object |
|
627 | obj : object | |
631 | The Python object whose format data will be computed. |
|
628 | The Python object whose format data will be computed. | |
632 |
|
629 | |||
633 | Returns |
|
630 | Returns | |
634 | ------- |
|
631 | ------- | |
635 | format_dict : dict |
|
632 | format_dict : dict | |
636 | A dictionary of key/value pairs, one or each format that was |
|
633 | A dictionary of key/value pairs, one or each format that was | |
637 | generated for the object. The keys are the format types, which |
|
634 | generated for the object. The keys are the format types, which | |
638 | will usually be MIME type strings and the values and JSON'able |
|
635 | will usually be MIME type strings and the values and JSON'able | |
639 | data structure containing the raw data for the representation in |
|
636 | data structure containing the raw data for the representation in | |
640 | that format. |
|
637 | that format. | |
641 | include : list or tuple, optional |
|
638 | include : list or tuple, optional | |
642 | A list of format type strings (MIME types) to include in the |
|
639 | A list of format type strings (MIME types) to include in the | |
643 | format data dict. If this is set *only* the format types included |
|
640 | format data dict. If this is set *only* the format types included | |
644 | in this list will be computed. |
|
641 | in this list will be computed. | |
645 | exclude : list or tuple, optional |
|
642 | exclude : list or tuple, optional | |
646 | A list of format type string (MIME types) to exclue in the format |
|
643 | A list of format type string (MIME types) to exclue in the format | |
647 | data dict. If this is set all format types will be computed, |
|
644 | data dict. If this is set all format types will be computed, | |
648 | except for those included in this argument. |
|
645 | except for those included in this argument. | |
649 | """ |
|
646 | """ | |
650 | from IPython.core.interactiveshell import InteractiveShell |
|
647 | from IPython.core.interactiveshell import InteractiveShell | |
651 |
|
648 | |||
652 | InteractiveShell.instance().display_formatter.format( |
|
649 | InteractiveShell.instance().display_formatter.format( | |
653 | obj, |
|
650 | obj, | |
654 | include, |
|
651 | include, | |
655 | exclude |
|
652 | exclude | |
656 | ) |
|
653 | ) | |
657 |
|
654 |
@@ -1,797 +1,804 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ |
|
2 | """ | |
3 | Python advanced pretty printer. This pretty printer is intended to |
|
3 | Python advanced pretty printer. This pretty printer is intended to | |
4 | replace the old `pprint` python module which does not allow developers |
|
4 | replace the old `pprint` python module which does not allow developers | |
5 | to provide their own pretty print callbacks. |
|
5 | to provide their own pretty print callbacks. | |
6 |
|
6 | |||
7 | This module is based on ruby's `prettyprint.rb` library by `Tanaka Akira`. |
|
7 | This module is based on ruby's `prettyprint.rb` library by `Tanaka Akira`. | |
8 |
|
8 | |||
9 |
|
9 | |||
10 | Example Usage |
|
10 | Example Usage | |
11 | ------------- |
|
11 | ------------- | |
12 |
|
12 | |||
13 | To directly print the representation of an object use `pprint`:: |
|
13 | To directly print the representation of an object use `pprint`:: | |
14 |
|
14 | |||
15 | from pretty import pprint |
|
15 | from pretty import pprint | |
16 | pprint(complex_object) |
|
16 | pprint(complex_object) | |
17 |
|
17 | |||
18 | To get a string of the output use `pretty`:: |
|
18 | To get a string of the output use `pretty`:: | |
19 |
|
19 | |||
20 | from pretty import pretty |
|
20 | from pretty import pretty | |
21 | string = pretty(complex_object) |
|
21 | string = pretty(complex_object) | |
22 |
|
22 | |||
23 |
|
23 | |||
24 | Extending |
|
24 | Extending | |
25 | --------- |
|
25 | --------- | |
26 |
|
26 | |||
27 | The pretty library allows developers to add pretty printing rules for their |
|
27 | The pretty library allows developers to add pretty printing rules for their | |
28 | own objects. This process is straightforward. All you have to do is to |
|
28 | own objects. This process is straightforward. All you have to do is to | |
29 | add a `_repr_pretty_` method to your object and call the methods on the |
|
29 | add a `_repr_pretty_` method to your object and call the methods on the | |
30 | pretty printer passed:: |
|
30 | pretty printer passed:: | |
31 |
|
31 | |||
32 | class MyObject(object): |
|
32 | class MyObject(object): | |
33 |
|
33 | |||
34 | def _repr_pretty_(self, p, cycle): |
|
34 | def _repr_pretty_(self, p, cycle): | |
35 | ... |
|
35 | ... | |
36 |
|
36 | |||
37 | Depending on the python version you want to support you have two |
|
37 | Depending on the python version you want to support you have two | |
38 | possibilities. The following list shows the python 2.5 version and the |
|
38 | possibilities. The following list shows the python 2.5 version and the | |
39 | compatibility one. |
|
39 | compatibility one. | |
40 |
|
40 | |||
41 |
|
41 | |||
42 | Here the example implementation of a `_repr_pretty_` method for a list |
|
42 | Here the example implementation of a `_repr_pretty_` method for a list | |
43 | subclass for python 2.5 and higher (python 2.5 requires the with statement |
|
43 | subclass for python 2.5 and higher (python 2.5 requires the with statement | |
44 | __future__ import):: |
|
44 | __future__ import):: | |
45 |
|
45 | |||
46 | class MyList(list): |
|
46 | class MyList(list): | |
47 |
|
47 | |||
48 | def _repr_pretty_(self, p, cycle): |
|
48 | def _repr_pretty_(self, p, cycle): | |
49 | if cycle: |
|
49 | if cycle: | |
50 | p.text('MyList(...)') |
|
50 | p.text('MyList(...)') | |
51 | else: |
|
51 | else: | |
52 | with p.group(8, 'MyList([', '])'): |
|
52 | with p.group(8, 'MyList([', '])'): | |
53 | for idx, item in enumerate(self): |
|
53 | for idx, item in enumerate(self): | |
54 | if idx: |
|
54 | if idx: | |
55 | p.text(',') |
|
55 | p.text(',') | |
56 | p.breakable() |
|
56 | p.breakable() | |
57 | p.pretty(item) |
|
57 | p.pretty(item) | |
58 |
|
58 | |||
59 | The `cycle` parameter is `True` if pretty detected a cycle. You *have* to |
|
59 | The `cycle` parameter is `True` if pretty detected a cycle. You *have* to | |
60 | react to that or the result is an infinite loop. `p.text()` just adds |
|
60 | react to that or the result is an infinite loop. `p.text()` just adds | |
61 | non breaking text to the output, `p.breakable()` either adds a whitespace |
|
61 | non breaking text to the output, `p.breakable()` either adds a whitespace | |
62 | or breaks here. If you pass it an argument it's used instead of the |
|
62 | or breaks here. If you pass it an argument it's used instead of the | |
63 | default space. `p.pretty` prettyprints another object using the pretty print |
|
63 | default space. `p.pretty` prettyprints another object using the pretty print | |
64 | method. |
|
64 | method. | |
65 |
|
65 | |||
66 | The first parameter to the `group` function specifies the extra indentation |
|
66 | The first parameter to the `group` function specifies the extra indentation | |
67 | of the next line. In this example the next item will either be not |
|
67 | of the next line. In this example the next item will either be not | |
68 | breaked (if the items are short enough) or aligned with the right edge of |
|
68 | breaked (if the items are short enough) or aligned with the right edge of | |
69 | the opening bracked of `MyList`. |
|
69 | the opening bracked of `MyList`. | |
70 |
|
70 | |||
71 | If you want to support python 2.4 and lower you can use this code:: |
|
71 | If you want to support python 2.4 and lower you can use this code:: | |
72 |
|
72 | |||
73 | class MyList(list): |
|
73 | class MyList(list): | |
74 |
|
74 | |||
75 | def _repr_pretty_(self, p, cycle): |
|
75 | def _repr_pretty_(self, p, cycle): | |
76 | if cycle: |
|
76 | if cycle: | |
77 | p.text('MyList(...)') |
|
77 | p.text('MyList(...)') | |
78 | else: |
|
78 | else: | |
79 | p.begin_group(8, 'MyList([') |
|
79 | p.begin_group(8, 'MyList([') | |
80 | for idx, item in enumerate(self): |
|
80 | for idx, item in enumerate(self): | |
81 | if idx: |
|
81 | if idx: | |
82 | p.text(',') |
|
82 | p.text(',') | |
83 | p.breakable() |
|
83 | p.breakable() | |
84 | p.pretty(item) |
|
84 | p.pretty(item) | |
85 | p.end_group(8, '])') |
|
85 | p.end_group(8, '])') | |
86 |
|
86 | |||
87 | If you just want to indent something you can use the group function |
|
87 | If you just want to indent something you can use the group function | |
88 | without open / close parameters. Under python 2.5 you can also use this |
|
88 | without open / close parameters. Under python 2.5 you can also use this | |
89 | code:: |
|
89 | code:: | |
90 |
|
90 | |||
91 | with p.indent(2): |
|
91 | with p.indent(2): | |
92 | ... |
|
92 | ... | |
93 |
|
93 | |||
94 | Or under python2.4 you might want to modify ``p.indentation`` by hand but |
|
94 | Or under python2.4 you might want to modify ``p.indentation`` by hand but | |
95 | this is rather ugly. |
|
95 | this is rather ugly. | |
96 |
|
96 | |||
97 | Inheritance diagram: |
|
97 | Inheritance diagram: | |
98 |
|
98 | |||
99 | .. inheritance-diagram:: IPython.lib.pretty |
|
99 | .. inheritance-diagram:: IPython.lib.pretty | |
100 | :parts: 3 |
|
100 | :parts: 3 | |
101 |
|
101 | |||
102 | :copyright: 2007 by Armin Ronacher. |
|
102 | :copyright: 2007 by Armin Ronacher. | |
103 | Portions (c) 2009 by Robert Kern. |
|
103 | Portions (c) 2009 by Robert Kern. | |
104 | :license: BSD License. |
|
104 | :license: BSD License. | |
105 | """ |
|
105 | """ | |
106 | from __future__ import print_function |
|
106 | from __future__ import print_function | |
107 | from contextlib import contextmanager |
|
107 | from contextlib import contextmanager | |
108 | import sys |
|
108 | import sys | |
109 | import types |
|
109 | import types | |
110 | import re |
|
110 | import re | |
111 | import datetime |
|
111 | import datetime | |
112 | from collections import deque |
|
112 | from collections import deque | |
113 |
|
113 | |||
114 | from IPython.utils.py3compat import PY3 |
|
114 | from IPython.utils.py3compat import PY3 | |
115 |
|
115 | |||
116 | if PY3: |
|
116 | if PY3: | |
117 | from io import StringIO |
|
117 | from io import StringIO | |
118 | else: |
|
118 | else: | |
119 | from StringIO import StringIO |
|
119 | from StringIO import StringIO | |
120 |
|
120 | |||
121 |
|
121 | |||
122 | __all__ = ['pretty', 'pprint', 'PrettyPrinter', 'RepresentationPrinter', |
|
122 | __all__ = ['pretty', 'pprint', 'PrettyPrinter', 'RepresentationPrinter', | |
123 | 'for_type', 'for_type_by_name'] |
|
123 | 'for_type', 'for_type_by_name'] | |
124 |
|
124 | |||
125 |
|
125 | |||
126 | _re_pattern_type = type(re.compile('')) |
|
126 | _re_pattern_type = type(re.compile('')) | |
127 |
|
127 | |||
|
128 | def _safe_repr(obj): | |||
|
129 | """Don't trust repr to not be broken.""" | |||
|
130 | try: | |||
|
131 | return repr(obj) | |||
|
132 | except Exception as e: | |||
|
133 | return "<repr(obj) failed: %s>" % e | |||
|
134 | ||||
128 |
|
135 | |||
129 | def pretty(obj, verbose=False, max_width=79, newline='\n'): |
|
136 | def pretty(obj, verbose=False, max_width=79, newline='\n'): | |
130 | """ |
|
137 | """ | |
131 | Pretty print the object's representation. |
|
138 | Pretty print the object's representation. | |
132 | """ |
|
139 | """ | |
133 | stream = StringIO() |
|
140 | stream = StringIO() | |
134 | printer = RepresentationPrinter(stream, verbose, max_width, newline) |
|
141 | printer = RepresentationPrinter(stream, verbose, max_width, newline) | |
135 | printer.pretty(obj) |
|
142 | printer.pretty(obj) | |
136 | printer.flush() |
|
143 | printer.flush() | |
137 | return stream.getvalue() |
|
144 | return stream.getvalue() | |
138 |
|
145 | |||
139 |
|
146 | |||
140 | def pprint(obj, verbose=False, max_width=79, newline='\n'): |
|
147 | def pprint(obj, verbose=False, max_width=79, newline='\n'): | |
141 | """ |
|
148 | """ | |
142 | Like `pretty` but print to stdout. |
|
149 | Like `pretty` but print to stdout. | |
143 | """ |
|
150 | """ | |
144 | printer = RepresentationPrinter(sys.stdout, verbose, max_width, newline) |
|
151 | printer = RepresentationPrinter(sys.stdout, verbose, max_width, newline) | |
145 | printer.pretty(obj) |
|
152 | printer.pretty(obj) | |
146 | printer.flush() |
|
153 | printer.flush() | |
147 | sys.stdout.write(newline) |
|
154 | sys.stdout.write(newline) | |
148 | sys.stdout.flush() |
|
155 | sys.stdout.flush() | |
149 |
|
156 | |||
150 | class _PrettyPrinterBase(object): |
|
157 | class _PrettyPrinterBase(object): | |
151 |
|
158 | |||
152 | @contextmanager |
|
159 | @contextmanager | |
153 | def indent(self, indent): |
|
160 | def indent(self, indent): | |
154 | """with statement support for indenting/dedenting.""" |
|
161 | """with statement support for indenting/dedenting.""" | |
155 | self.indentation += indent |
|
162 | self.indentation += indent | |
156 | try: |
|
163 | try: | |
157 | yield |
|
164 | yield | |
158 | finally: |
|
165 | finally: | |
159 | self.indentation -= indent |
|
166 | self.indentation -= indent | |
160 |
|
167 | |||
161 | @contextmanager |
|
168 | @contextmanager | |
162 | def group(self, indent=0, open='', close=''): |
|
169 | def group(self, indent=0, open='', close=''): | |
163 | """like begin_group / end_group but for the with statement.""" |
|
170 | """like begin_group / end_group but for the with statement.""" | |
164 | self.begin_group(indent, open) |
|
171 | self.begin_group(indent, open) | |
165 | try: |
|
172 | try: | |
166 | yield |
|
173 | yield | |
167 | finally: |
|
174 | finally: | |
168 | self.end_group(indent, close) |
|
175 | self.end_group(indent, close) | |
169 |
|
176 | |||
170 | class PrettyPrinter(_PrettyPrinterBase): |
|
177 | class PrettyPrinter(_PrettyPrinterBase): | |
171 | """ |
|
178 | """ | |
172 | Baseclass for the `RepresentationPrinter` prettyprinter that is used to |
|
179 | Baseclass for the `RepresentationPrinter` prettyprinter that is used to | |
173 | generate pretty reprs of objects. Contrary to the `RepresentationPrinter` |
|
180 | generate pretty reprs of objects. Contrary to the `RepresentationPrinter` | |
174 | this printer knows nothing about the default pprinters or the `_repr_pretty_` |
|
181 | this printer knows nothing about the default pprinters or the `_repr_pretty_` | |
175 | callback method. |
|
182 | callback method. | |
176 | """ |
|
183 | """ | |
177 |
|
184 | |||
178 | def __init__(self, output, max_width=79, newline='\n'): |
|
185 | def __init__(self, output, max_width=79, newline='\n'): | |
179 | self.output = output |
|
186 | self.output = output | |
180 | self.max_width = max_width |
|
187 | self.max_width = max_width | |
181 | self.newline = newline |
|
188 | self.newline = newline | |
182 | self.output_width = 0 |
|
189 | self.output_width = 0 | |
183 | self.buffer_width = 0 |
|
190 | self.buffer_width = 0 | |
184 | self.buffer = deque() |
|
191 | self.buffer = deque() | |
185 |
|
192 | |||
186 | root_group = Group(0) |
|
193 | root_group = Group(0) | |
187 | self.group_stack = [root_group] |
|
194 | self.group_stack = [root_group] | |
188 | self.group_queue = GroupQueue(root_group) |
|
195 | self.group_queue = GroupQueue(root_group) | |
189 | self.indentation = 0 |
|
196 | self.indentation = 0 | |
190 |
|
197 | |||
191 | def _break_outer_groups(self): |
|
198 | def _break_outer_groups(self): | |
192 | while self.max_width < self.output_width + self.buffer_width: |
|
199 | while self.max_width < self.output_width + self.buffer_width: | |
193 | group = self.group_queue.deq() |
|
200 | group = self.group_queue.deq() | |
194 | if not group: |
|
201 | if not group: | |
195 | return |
|
202 | return | |
196 | while group.breakables: |
|
203 | while group.breakables: | |
197 | x = self.buffer.popleft() |
|
204 | x = self.buffer.popleft() | |
198 | self.output_width = x.output(self.output, self.output_width) |
|
205 | self.output_width = x.output(self.output, self.output_width) | |
199 | self.buffer_width -= x.width |
|
206 | self.buffer_width -= x.width | |
200 | while self.buffer and isinstance(self.buffer[0], Text): |
|
207 | while self.buffer and isinstance(self.buffer[0], Text): | |
201 | x = self.buffer.popleft() |
|
208 | x = self.buffer.popleft() | |
202 | self.output_width = x.output(self.output, self.output_width) |
|
209 | self.output_width = x.output(self.output, self.output_width) | |
203 | self.buffer_width -= x.width |
|
210 | self.buffer_width -= x.width | |
204 |
|
211 | |||
205 | def text(self, obj): |
|
212 | def text(self, obj): | |
206 | """Add literal text to the output.""" |
|
213 | """Add literal text to the output.""" | |
207 | width = len(obj) |
|
214 | width = len(obj) | |
208 | if self.buffer: |
|
215 | if self.buffer: | |
209 | text = self.buffer[-1] |
|
216 | text = self.buffer[-1] | |
210 | if not isinstance(text, Text): |
|
217 | if not isinstance(text, Text): | |
211 | text = Text() |
|
218 | text = Text() | |
212 | self.buffer.append(text) |
|
219 | self.buffer.append(text) | |
213 | text.add(obj, width) |
|
220 | text.add(obj, width) | |
214 | self.buffer_width += width |
|
221 | self.buffer_width += width | |
215 | self._break_outer_groups() |
|
222 | self._break_outer_groups() | |
216 | else: |
|
223 | else: | |
217 | self.output.write(obj) |
|
224 | self.output.write(obj) | |
218 | self.output_width += width |
|
225 | self.output_width += width | |
219 |
|
226 | |||
220 | def breakable(self, sep=' '): |
|
227 | def breakable(self, sep=' '): | |
221 | """ |
|
228 | """ | |
222 | Add a breakable separator to the output. This does not mean that it |
|
229 | Add a breakable separator to the output. This does not mean that it | |
223 | will automatically break here. If no breaking on this position takes |
|
230 | will automatically break here. If no breaking on this position takes | |
224 | place the `sep` is inserted which default to one space. |
|
231 | place the `sep` is inserted which default to one space. | |
225 | """ |
|
232 | """ | |
226 | width = len(sep) |
|
233 | width = len(sep) | |
227 | group = self.group_stack[-1] |
|
234 | group = self.group_stack[-1] | |
228 | if group.want_break: |
|
235 | if group.want_break: | |
229 | self.flush() |
|
236 | self.flush() | |
230 | self.output.write(self.newline) |
|
237 | self.output.write(self.newline) | |
231 | self.output.write(' ' * self.indentation) |
|
238 | self.output.write(' ' * self.indentation) | |
232 | self.output_width = self.indentation |
|
239 | self.output_width = self.indentation | |
233 | self.buffer_width = 0 |
|
240 | self.buffer_width = 0 | |
234 | else: |
|
241 | else: | |
235 | self.buffer.append(Breakable(sep, width, self)) |
|
242 | self.buffer.append(Breakable(sep, width, self)) | |
236 | self.buffer_width += width |
|
243 | self.buffer_width += width | |
237 | self._break_outer_groups() |
|
244 | self._break_outer_groups() | |
238 |
|
245 | |||
239 | def break_(self): |
|
246 | def break_(self): | |
240 | """ |
|
247 | """ | |
241 | Explicitly insert a newline into the output, maintaining correct indentation. |
|
248 | Explicitly insert a newline into the output, maintaining correct indentation. | |
242 | """ |
|
249 | """ | |
243 | self.flush() |
|
250 | self.flush() | |
244 | self.output.write(self.newline) |
|
251 | self.output.write(self.newline) | |
245 | self.output.write(' ' * self.indentation) |
|
252 | self.output.write(' ' * self.indentation) | |
246 | self.output_width = self.indentation |
|
253 | self.output_width = self.indentation | |
247 | self.buffer_width = 0 |
|
254 | self.buffer_width = 0 | |
248 |
|
255 | |||
249 |
|
256 | |||
250 | def begin_group(self, indent=0, open=''): |
|
257 | def begin_group(self, indent=0, open=''): | |
251 | """ |
|
258 | """ | |
252 | Begin a group. If you want support for python < 2.5 which doesn't has |
|
259 | Begin a group. If you want support for python < 2.5 which doesn't has | |
253 | the with statement this is the preferred way: |
|
260 | the with statement this is the preferred way: | |
254 |
|
261 | |||
255 | p.begin_group(1, '{') |
|
262 | p.begin_group(1, '{') | |
256 | ... |
|
263 | ... | |
257 | p.end_group(1, '}') |
|
264 | p.end_group(1, '}') | |
258 |
|
265 | |||
259 | The python 2.5 expression would be this: |
|
266 | The python 2.5 expression would be this: | |
260 |
|
267 | |||
261 | with p.group(1, '{', '}'): |
|
268 | with p.group(1, '{', '}'): | |
262 | ... |
|
269 | ... | |
263 |
|
270 | |||
264 | The first parameter specifies the indentation for the next line (usually |
|
271 | The first parameter specifies the indentation for the next line (usually | |
265 | the width of the opening text), the second the opening text. All |
|
272 | the width of the opening text), the second the opening text. All | |
266 | parameters are optional. |
|
273 | parameters are optional. | |
267 | """ |
|
274 | """ | |
268 | if open: |
|
275 | if open: | |
269 | self.text(open) |
|
276 | self.text(open) | |
270 | group = Group(self.group_stack[-1].depth + 1) |
|
277 | group = Group(self.group_stack[-1].depth + 1) | |
271 | self.group_stack.append(group) |
|
278 | self.group_stack.append(group) | |
272 | self.group_queue.enq(group) |
|
279 | self.group_queue.enq(group) | |
273 | self.indentation += indent |
|
280 | self.indentation += indent | |
274 |
|
281 | |||
275 | def end_group(self, dedent=0, close=''): |
|
282 | def end_group(self, dedent=0, close=''): | |
276 | """End a group. See `begin_group` for more details.""" |
|
283 | """End a group. See `begin_group` for more details.""" | |
277 | self.indentation -= dedent |
|
284 | self.indentation -= dedent | |
278 | group = self.group_stack.pop() |
|
285 | group = self.group_stack.pop() | |
279 | if not group.breakables: |
|
286 | if not group.breakables: | |
280 | self.group_queue.remove(group) |
|
287 | self.group_queue.remove(group) | |
281 | if close: |
|
288 | if close: | |
282 | self.text(close) |
|
289 | self.text(close) | |
283 |
|
290 | |||
284 | def flush(self): |
|
291 | def flush(self): | |
285 | """Flush data that is left in the buffer.""" |
|
292 | """Flush data that is left in the buffer.""" | |
286 | for data in self.buffer: |
|
293 | for data in self.buffer: | |
287 | self.output_width += data.output(self.output, self.output_width) |
|
294 | self.output_width += data.output(self.output, self.output_width) | |
288 | self.buffer.clear() |
|
295 | self.buffer.clear() | |
289 | self.buffer_width = 0 |
|
296 | self.buffer_width = 0 | |
290 |
|
297 | |||
291 |
|
298 | |||
292 | def _get_mro(obj_class): |
|
299 | def _get_mro(obj_class): | |
293 | """ Get a reasonable method resolution order of a class and its superclasses |
|
300 | """ Get a reasonable method resolution order of a class and its superclasses | |
294 | for both old-style and new-style classes. |
|
301 | for both old-style and new-style classes. | |
295 | """ |
|
302 | """ | |
296 | if not hasattr(obj_class, '__mro__'): |
|
303 | if not hasattr(obj_class, '__mro__'): | |
297 | # Old-style class. Mix in object to make a fake new-style class. |
|
304 | # Old-style class. Mix in object to make a fake new-style class. | |
298 | try: |
|
305 | try: | |
299 | obj_class = type(obj_class.__name__, (obj_class, object), {}) |
|
306 | obj_class = type(obj_class.__name__, (obj_class, object), {}) | |
300 | except TypeError: |
|
307 | except TypeError: | |
301 | # Old-style extension type that does not descend from object. |
|
308 | # Old-style extension type that does not descend from object. | |
302 | # FIXME: try to construct a more thorough MRO. |
|
309 | # FIXME: try to construct a more thorough MRO. | |
303 | mro = [obj_class] |
|
310 | mro = [obj_class] | |
304 | else: |
|
311 | else: | |
305 | mro = obj_class.__mro__[1:-1] |
|
312 | mro = obj_class.__mro__[1:-1] | |
306 | else: |
|
313 | else: | |
307 | mro = obj_class.__mro__ |
|
314 | mro = obj_class.__mro__ | |
308 | return mro |
|
315 | return mro | |
309 |
|
316 | |||
310 |
|
317 | |||
311 | class RepresentationPrinter(PrettyPrinter): |
|
318 | class RepresentationPrinter(PrettyPrinter): | |
312 | """ |
|
319 | """ | |
313 | Special pretty printer that has a `pretty` method that calls the pretty |
|
320 | Special pretty printer that has a `pretty` method that calls the pretty | |
314 | printer for a python object. |
|
321 | printer for a python object. | |
315 |
|
322 | |||
316 | This class stores processing data on `self` so you must *never* use |
|
323 | This class stores processing data on `self` so you must *never* use | |
317 | this class in a threaded environment. Always lock it or reinstanciate |
|
324 | this class in a threaded environment. Always lock it or reinstanciate | |
318 | it. |
|
325 | it. | |
319 |
|
326 | |||
320 | Instances also have a verbose flag callbacks can access to control their |
|
327 | Instances also have a verbose flag callbacks can access to control their | |
321 | output. For example the default instance repr prints all attributes and |
|
328 | output. For example the default instance repr prints all attributes and | |
322 | methods that are not prefixed by an underscore if the printer is in |
|
329 | methods that are not prefixed by an underscore if the printer is in | |
323 | verbose mode. |
|
330 | verbose mode. | |
324 | """ |
|
331 | """ | |
325 |
|
332 | |||
326 | def __init__(self, output, verbose=False, max_width=79, newline='\n', |
|
333 | def __init__(self, output, verbose=False, max_width=79, newline='\n', | |
327 | singleton_pprinters=None, type_pprinters=None, deferred_pprinters=None): |
|
334 | singleton_pprinters=None, type_pprinters=None, deferred_pprinters=None): | |
328 |
|
335 | |||
329 | PrettyPrinter.__init__(self, output, max_width, newline) |
|
336 | PrettyPrinter.__init__(self, output, max_width, newline) | |
330 | self.verbose = verbose |
|
337 | self.verbose = verbose | |
331 | self.stack = [] |
|
338 | self.stack = [] | |
332 | if singleton_pprinters is None: |
|
339 | if singleton_pprinters is None: | |
333 | singleton_pprinters = _singleton_pprinters.copy() |
|
340 | singleton_pprinters = _singleton_pprinters.copy() | |
334 | self.singleton_pprinters = singleton_pprinters |
|
341 | self.singleton_pprinters = singleton_pprinters | |
335 | if type_pprinters is None: |
|
342 | if type_pprinters is None: | |
336 | type_pprinters = _type_pprinters.copy() |
|
343 | type_pprinters = _type_pprinters.copy() | |
337 | self.type_pprinters = type_pprinters |
|
344 | self.type_pprinters = type_pprinters | |
338 | if deferred_pprinters is None: |
|
345 | if deferred_pprinters is None: | |
339 | deferred_pprinters = _deferred_type_pprinters.copy() |
|
346 | deferred_pprinters = _deferred_type_pprinters.copy() | |
340 | self.deferred_pprinters = deferred_pprinters |
|
347 | self.deferred_pprinters = deferred_pprinters | |
341 |
|
348 | |||
342 | def pretty(self, obj): |
|
349 | def pretty(self, obj): | |
343 | """Pretty print the given object.""" |
|
350 | """Pretty print the given object.""" | |
344 | obj_id = id(obj) |
|
351 | obj_id = id(obj) | |
345 | cycle = obj_id in self.stack |
|
352 | cycle = obj_id in self.stack | |
346 | self.stack.append(obj_id) |
|
353 | self.stack.append(obj_id) | |
347 | self.begin_group() |
|
354 | self.begin_group() | |
348 | try: |
|
355 | try: | |
349 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
356 | obj_class = getattr(obj, '__class__', None) or type(obj) | |
350 | # First try to find registered singleton printers for the type. |
|
357 | # First try to find registered singleton printers for the type. | |
351 | try: |
|
358 | try: | |
352 | printer = self.singleton_pprinters[obj_id] |
|
359 | printer = self.singleton_pprinters[obj_id] | |
353 | except (TypeError, KeyError): |
|
360 | except (TypeError, KeyError): | |
354 | pass |
|
361 | pass | |
355 | else: |
|
362 | else: | |
356 | return printer(obj, self, cycle) |
|
363 | return printer(obj, self, cycle) | |
357 | # Next walk the mro and check for either: |
|
364 | # Next walk the mro and check for either: | |
358 | # 1) a registered printer |
|
365 | # 1) a registered printer | |
359 | # 2) a _repr_pretty_ method |
|
366 | # 2) a _repr_pretty_ method | |
360 | for cls in _get_mro(obj_class): |
|
367 | for cls in _get_mro(obj_class): | |
361 | if cls in self.type_pprinters: |
|
368 | if cls in self.type_pprinters: | |
362 | # printer registered in self.type_pprinters |
|
369 | # printer registered in self.type_pprinters | |
363 | return self.type_pprinters[cls](obj, self, cycle) |
|
370 | return self.type_pprinters[cls](obj, self, cycle) | |
364 | else: |
|
371 | else: | |
365 | # deferred printer |
|
372 | # deferred printer | |
366 | printer = self._in_deferred_types(cls) |
|
373 | printer = self._in_deferred_types(cls) | |
367 | if printer is not None: |
|
374 | if printer is not None: | |
368 | return printer(obj, self, cycle) |
|
375 | return printer(obj, self, cycle) | |
369 | else: |
|
376 | else: | |
370 | # Finally look for special method names. |
|
377 | # Finally look for special method names. | |
371 | # Some objects automatically create any requested |
|
378 | # Some objects automatically create any requested | |
372 | # attribute. Try to ignore most of them by checking for |
|
379 | # attribute. Try to ignore most of them by checking for | |
373 | # callability. |
|
380 | # callability. | |
374 | if '_repr_pretty_' in cls.__dict__: |
|
381 | if '_repr_pretty_' in cls.__dict__: | |
375 | meth = cls._repr_pretty_ |
|
382 | meth = cls._repr_pretty_ | |
376 | if callable(meth): |
|
383 | if callable(meth): | |
377 | return meth(obj, self, cycle) |
|
384 | return meth(obj, self, cycle) | |
378 | return _default_pprint(obj, self, cycle) |
|
385 | return _default_pprint(obj, self, cycle) | |
379 | finally: |
|
386 | finally: | |
380 | self.end_group() |
|
387 | self.end_group() | |
381 | self.stack.pop() |
|
388 | self.stack.pop() | |
382 |
|
389 | |||
383 | def _in_deferred_types(self, cls): |
|
390 | def _in_deferred_types(self, cls): | |
384 | """ |
|
391 | """ | |
385 | Check if the given class is specified in the deferred type registry. |
|
392 | Check if the given class is specified in the deferred type registry. | |
386 |
|
393 | |||
387 | Returns the printer from the registry if it exists, and None if the |
|
394 | Returns the printer from the registry if it exists, and None if the | |
388 | class is not in the registry. Successful matches will be moved to the |
|
395 | class is not in the registry. Successful matches will be moved to the | |
389 | regular type registry for future use. |
|
396 | regular type registry for future use. | |
390 | """ |
|
397 | """ | |
391 | mod = getattr(cls, '__module__', None) |
|
398 | mod = getattr(cls, '__module__', None) | |
392 | name = getattr(cls, '__name__', None) |
|
399 | name = getattr(cls, '__name__', None) | |
393 | key = (mod, name) |
|
400 | key = (mod, name) | |
394 | printer = None |
|
401 | printer = None | |
395 | if key in self.deferred_pprinters: |
|
402 | if key in self.deferred_pprinters: | |
396 | # Move the printer over to the regular registry. |
|
403 | # Move the printer over to the regular registry. | |
397 | printer = self.deferred_pprinters.pop(key) |
|
404 | printer = self.deferred_pprinters.pop(key) | |
398 | self.type_pprinters[cls] = printer |
|
405 | self.type_pprinters[cls] = printer | |
399 | return printer |
|
406 | return printer | |
400 |
|
407 | |||
401 |
|
408 | |||
402 | class Printable(object): |
|
409 | class Printable(object): | |
403 |
|
410 | |||
404 | def output(self, stream, output_width): |
|
411 | def output(self, stream, output_width): | |
405 | return output_width |
|
412 | return output_width | |
406 |
|
413 | |||
407 |
|
414 | |||
408 | class Text(Printable): |
|
415 | class Text(Printable): | |
409 |
|
416 | |||
410 | def __init__(self): |
|
417 | def __init__(self): | |
411 | self.objs = [] |
|
418 | self.objs = [] | |
412 | self.width = 0 |
|
419 | self.width = 0 | |
413 |
|
420 | |||
414 | def output(self, stream, output_width): |
|
421 | def output(self, stream, output_width): | |
415 | for obj in self.objs: |
|
422 | for obj in self.objs: | |
416 | stream.write(obj) |
|
423 | stream.write(obj) | |
417 | return output_width + self.width |
|
424 | return output_width + self.width | |
418 |
|
425 | |||
419 | def add(self, obj, width): |
|
426 | def add(self, obj, width): | |
420 | self.objs.append(obj) |
|
427 | self.objs.append(obj) | |
421 | self.width += width |
|
428 | self.width += width | |
422 |
|
429 | |||
423 |
|
430 | |||
424 | class Breakable(Printable): |
|
431 | class Breakable(Printable): | |
425 |
|
432 | |||
426 | def __init__(self, seq, width, pretty): |
|
433 | def __init__(self, seq, width, pretty): | |
427 | self.obj = seq |
|
434 | self.obj = seq | |
428 | self.width = width |
|
435 | self.width = width | |
429 | self.pretty = pretty |
|
436 | self.pretty = pretty | |
430 | self.indentation = pretty.indentation |
|
437 | self.indentation = pretty.indentation | |
431 | self.group = pretty.group_stack[-1] |
|
438 | self.group = pretty.group_stack[-1] | |
432 | self.group.breakables.append(self) |
|
439 | self.group.breakables.append(self) | |
433 |
|
440 | |||
434 | def output(self, stream, output_width): |
|
441 | def output(self, stream, output_width): | |
435 | self.group.breakables.popleft() |
|
442 | self.group.breakables.popleft() | |
436 | if self.group.want_break: |
|
443 | if self.group.want_break: | |
437 | stream.write(self.pretty.newline) |
|
444 | stream.write(self.pretty.newline) | |
438 | stream.write(' ' * self.indentation) |
|
445 | stream.write(' ' * self.indentation) | |
439 | return self.indentation |
|
446 | return self.indentation | |
440 | if not self.group.breakables: |
|
447 | if not self.group.breakables: | |
441 | self.pretty.group_queue.remove(self.group) |
|
448 | self.pretty.group_queue.remove(self.group) | |
442 | stream.write(self.obj) |
|
449 | stream.write(self.obj) | |
443 | return output_width + self.width |
|
450 | return output_width + self.width | |
444 |
|
451 | |||
445 |
|
452 | |||
446 | class Group(Printable): |
|
453 | class Group(Printable): | |
447 |
|
454 | |||
448 | def __init__(self, depth): |
|
455 | def __init__(self, depth): | |
449 | self.depth = depth |
|
456 | self.depth = depth | |
450 | self.breakables = deque() |
|
457 | self.breakables = deque() | |
451 | self.want_break = False |
|
458 | self.want_break = False | |
452 |
|
459 | |||
453 |
|
460 | |||
454 | class GroupQueue(object): |
|
461 | class GroupQueue(object): | |
455 |
|
462 | |||
456 | def __init__(self, *groups): |
|
463 | def __init__(self, *groups): | |
457 | self.queue = [] |
|
464 | self.queue = [] | |
458 | for group in groups: |
|
465 | for group in groups: | |
459 | self.enq(group) |
|
466 | self.enq(group) | |
460 |
|
467 | |||
461 | def enq(self, group): |
|
468 | def enq(self, group): | |
462 | depth = group.depth |
|
469 | depth = group.depth | |
463 | while depth > len(self.queue) - 1: |
|
470 | while depth > len(self.queue) - 1: | |
464 | self.queue.append([]) |
|
471 | self.queue.append([]) | |
465 | self.queue[depth].append(group) |
|
472 | self.queue[depth].append(group) | |
466 |
|
473 | |||
467 | def deq(self): |
|
474 | def deq(self): | |
468 | for stack in self.queue: |
|
475 | for stack in self.queue: | |
469 | for idx, group in enumerate(reversed(stack)): |
|
476 | for idx, group in enumerate(reversed(stack)): | |
470 | if group.breakables: |
|
477 | if group.breakables: | |
471 | del stack[idx] |
|
478 | del stack[idx] | |
472 | group.want_break = True |
|
479 | group.want_break = True | |
473 | return group |
|
480 | return group | |
474 | for group in stack: |
|
481 | for group in stack: | |
475 | group.want_break = True |
|
482 | group.want_break = True | |
476 | del stack[:] |
|
483 | del stack[:] | |
477 |
|
484 | |||
478 | def remove(self, group): |
|
485 | def remove(self, group): | |
479 | try: |
|
486 | try: | |
480 | self.queue[group.depth].remove(group) |
|
487 | self.queue[group.depth].remove(group) | |
481 | except ValueError: |
|
488 | except ValueError: | |
482 | pass |
|
489 | pass | |
483 |
|
490 | |||
484 | try: |
|
491 | try: | |
485 | _baseclass_reprs = (object.__repr__, types.InstanceType.__repr__) |
|
492 | _baseclass_reprs = (object.__repr__, types.InstanceType.__repr__) | |
486 | except AttributeError: # Python 3 |
|
493 | except AttributeError: # Python 3 | |
487 | _baseclass_reprs = (object.__repr__,) |
|
494 | _baseclass_reprs = (object.__repr__,) | |
488 |
|
495 | |||
489 |
|
496 | |||
490 | def _default_pprint(obj, p, cycle): |
|
497 | def _default_pprint(obj, p, cycle): | |
491 | """ |
|
498 | """ | |
492 | The default print function. Used if an object does not provide one and |
|
499 | The default print function. Used if an object does not provide one and | |
493 | it's none of the builtin objects. |
|
500 | it's none of the builtin objects. | |
494 | """ |
|
501 | """ | |
495 | klass = getattr(obj, '__class__', None) or type(obj) |
|
502 | klass = getattr(obj, '__class__', None) or type(obj) | |
496 | if getattr(klass, '__repr__', None) not in _baseclass_reprs: |
|
503 | if getattr(klass, '__repr__', None) not in _baseclass_reprs: | |
497 | # A user-provided repr. Find newlines and replace them with p.break_() |
|
504 | # A user-provided repr. Find newlines and replace them with p.break_() | |
498 | output = repr(obj) |
|
505 | output = _safe_repr(obj) | |
499 | for idx,output_line in enumerate(output.splitlines()): |
|
506 | for idx,output_line in enumerate(output.splitlines()): | |
500 | if idx: |
|
507 | if idx: | |
501 | p.break_() |
|
508 | p.break_() | |
502 | p.text(output_line) |
|
509 | p.text(output_line) | |
503 | return |
|
510 | return | |
504 | p.begin_group(1, '<') |
|
511 | p.begin_group(1, '<') | |
505 | p.pretty(klass) |
|
512 | p.pretty(klass) | |
506 | p.text(' at 0x%x' % id(obj)) |
|
513 | p.text(' at 0x%x' % id(obj)) | |
507 | if cycle: |
|
514 | if cycle: | |
508 | p.text(' ...') |
|
515 | p.text(' ...') | |
509 | elif p.verbose: |
|
516 | elif p.verbose: | |
510 | first = True |
|
517 | first = True | |
511 | for key in dir(obj): |
|
518 | for key in dir(obj): | |
512 | if not key.startswith('_'): |
|
519 | if not key.startswith('_'): | |
513 | try: |
|
520 | try: | |
514 | value = getattr(obj, key) |
|
521 | value = getattr(obj, key) | |
515 | except AttributeError: |
|
522 | except AttributeError: | |
516 | continue |
|
523 | continue | |
517 | if isinstance(value, types.MethodType): |
|
524 | if isinstance(value, types.MethodType): | |
518 | continue |
|
525 | continue | |
519 | if not first: |
|
526 | if not first: | |
520 | p.text(',') |
|
527 | p.text(',') | |
521 | p.breakable() |
|
528 | p.breakable() | |
522 | p.text(key) |
|
529 | p.text(key) | |
523 | p.text('=') |
|
530 | p.text('=') | |
524 | step = len(key) + 1 |
|
531 | step = len(key) + 1 | |
525 | p.indentation += step |
|
532 | p.indentation += step | |
526 | p.pretty(value) |
|
533 | p.pretty(value) | |
527 | p.indentation -= step |
|
534 | p.indentation -= step | |
528 | first = False |
|
535 | first = False | |
529 | p.end_group(1, '>') |
|
536 | p.end_group(1, '>') | |
530 |
|
537 | |||
531 |
|
538 | |||
532 | def _seq_pprinter_factory(start, end, basetype): |
|
539 | def _seq_pprinter_factory(start, end, basetype): | |
533 | """ |
|
540 | """ | |
534 | Factory that returns a pprint function useful for sequences. Used by |
|
541 | Factory that returns a pprint function useful for sequences. Used by | |
535 | the default pprint for tuples, dicts, and lists. |
|
542 | the default pprint for tuples, dicts, and lists. | |
536 | """ |
|
543 | """ | |
537 | def inner(obj, p, cycle): |
|
544 | def inner(obj, p, cycle): | |
538 | typ = type(obj) |
|
545 | typ = type(obj) | |
539 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: |
|
546 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: | |
540 | # If the subclass provides its own repr, use it instead. |
|
547 | # If the subclass provides its own repr, use it instead. | |
541 | return p.text(typ.__repr__(obj)) |
|
548 | return p.text(typ.__repr__(obj)) | |
542 |
|
549 | |||
543 | if cycle: |
|
550 | if cycle: | |
544 | return p.text(start + '...' + end) |
|
551 | return p.text(start + '...' + end) | |
545 | step = len(start) |
|
552 | step = len(start) | |
546 | p.begin_group(step, start) |
|
553 | p.begin_group(step, start) | |
547 | for idx, x in enumerate(obj): |
|
554 | for idx, x in enumerate(obj): | |
548 | if idx: |
|
555 | if idx: | |
549 | p.text(',') |
|
556 | p.text(',') | |
550 | p.breakable() |
|
557 | p.breakable() | |
551 | p.pretty(x) |
|
558 | p.pretty(x) | |
552 | if len(obj) == 1 and type(obj) is tuple: |
|
559 | if len(obj) == 1 and type(obj) is tuple: | |
553 | # Special case for 1-item tuples. |
|
560 | # Special case for 1-item tuples. | |
554 | p.text(',') |
|
561 | p.text(',') | |
555 | p.end_group(step, end) |
|
562 | p.end_group(step, end) | |
556 | return inner |
|
563 | return inner | |
557 |
|
564 | |||
558 |
|
565 | |||
559 | def _set_pprinter_factory(start, end, basetype): |
|
566 | def _set_pprinter_factory(start, end, basetype): | |
560 | """ |
|
567 | """ | |
561 | Factory that returns a pprint function useful for sets and frozensets. |
|
568 | Factory that returns a pprint function useful for sets and frozensets. | |
562 | """ |
|
569 | """ | |
563 | def inner(obj, p, cycle): |
|
570 | def inner(obj, p, cycle): | |
564 | typ = type(obj) |
|
571 | typ = type(obj) | |
565 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: |
|
572 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: | |
566 | # If the subclass provides its own repr, use it instead. |
|
573 | # If the subclass provides its own repr, use it instead. | |
567 | return p.text(typ.__repr__(obj)) |
|
574 | return p.text(typ.__repr__(obj)) | |
568 |
|
575 | |||
569 | if cycle: |
|
576 | if cycle: | |
570 | return p.text(start + '...' + end) |
|
577 | return p.text(start + '...' + end) | |
571 | if len(obj) == 0: |
|
578 | if len(obj) == 0: | |
572 | # Special case. |
|
579 | # Special case. | |
573 | p.text(basetype.__name__ + '()') |
|
580 | p.text(basetype.__name__ + '()') | |
574 | else: |
|
581 | else: | |
575 | step = len(start) |
|
582 | step = len(start) | |
576 | p.begin_group(step, start) |
|
583 | p.begin_group(step, start) | |
577 | # Like dictionary keys, we will try to sort the items. |
|
584 | # Like dictionary keys, we will try to sort the items. | |
578 | items = list(obj) |
|
585 | items = list(obj) | |
579 | try: |
|
586 | try: | |
580 | items.sort() |
|
587 | items.sort() | |
581 | except Exception: |
|
588 | except Exception: | |
582 | # Sometimes the items don't sort. |
|
589 | # Sometimes the items don't sort. | |
583 | pass |
|
590 | pass | |
584 | for idx, x in enumerate(items): |
|
591 | for idx, x in enumerate(items): | |
585 | if idx: |
|
592 | if idx: | |
586 | p.text(',') |
|
593 | p.text(',') | |
587 | p.breakable() |
|
594 | p.breakable() | |
588 | p.pretty(x) |
|
595 | p.pretty(x) | |
589 | p.end_group(step, end) |
|
596 | p.end_group(step, end) | |
590 | return inner |
|
597 | return inner | |
591 |
|
598 | |||
592 |
|
599 | |||
593 | def _dict_pprinter_factory(start, end, basetype=None): |
|
600 | def _dict_pprinter_factory(start, end, basetype=None): | |
594 | """ |
|
601 | """ | |
595 | Factory that returns a pprint function used by the default pprint of |
|
602 | Factory that returns a pprint function used by the default pprint of | |
596 | dicts and dict proxies. |
|
603 | dicts and dict proxies. | |
597 | """ |
|
604 | """ | |
598 | def inner(obj, p, cycle): |
|
605 | def inner(obj, p, cycle): | |
599 | typ = type(obj) |
|
606 | typ = type(obj) | |
600 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: |
|
607 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: | |
601 | # If the subclass provides its own repr, use it instead. |
|
608 | # If the subclass provides its own repr, use it instead. | |
602 | return p.text(typ.__repr__(obj)) |
|
609 | return p.text(typ.__repr__(obj)) | |
603 |
|
610 | |||
604 | if cycle: |
|
611 | if cycle: | |
605 | return p.text('{...}') |
|
612 | return p.text('{...}') | |
606 | p.begin_group(1, start) |
|
613 | p.begin_group(1, start) | |
607 | keys = obj.keys() |
|
614 | keys = obj.keys() | |
608 | try: |
|
615 | try: | |
609 | keys.sort() |
|
616 | keys.sort() | |
610 | except Exception as e: |
|
617 | except Exception as e: | |
611 | # Sometimes the keys don't sort. |
|
618 | # Sometimes the keys don't sort. | |
612 | pass |
|
619 | pass | |
613 | for idx, key in enumerate(keys): |
|
620 | for idx, key in enumerate(keys): | |
614 | if idx: |
|
621 | if idx: | |
615 | p.text(',') |
|
622 | p.text(',') | |
616 | p.breakable() |
|
623 | p.breakable() | |
617 | p.pretty(key) |
|
624 | p.pretty(key) | |
618 | p.text(': ') |
|
625 | p.text(': ') | |
619 | p.pretty(obj[key]) |
|
626 | p.pretty(obj[key]) | |
620 | p.end_group(1, end) |
|
627 | p.end_group(1, end) | |
621 | return inner |
|
628 | return inner | |
622 |
|
629 | |||
623 |
|
630 | |||
624 | def _super_pprint(obj, p, cycle): |
|
631 | def _super_pprint(obj, p, cycle): | |
625 | """The pprint for the super type.""" |
|
632 | """The pprint for the super type.""" | |
626 | p.begin_group(8, '<super: ') |
|
633 | p.begin_group(8, '<super: ') | |
627 | p.pretty(obj.__self_class__) |
|
634 | p.pretty(obj.__self_class__) | |
628 | p.text(',') |
|
635 | p.text(',') | |
629 | p.breakable() |
|
636 | p.breakable() | |
630 | p.pretty(obj.__self__) |
|
637 | p.pretty(obj.__self__) | |
631 | p.end_group(8, '>') |
|
638 | p.end_group(8, '>') | |
632 |
|
639 | |||
633 |
|
640 | |||
634 | def _re_pattern_pprint(obj, p, cycle): |
|
641 | def _re_pattern_pprint(obj, p, cycle): | |
635 | """The pprint function for regular expression patterns.""" |
|
642 | """The pprint function for regular expression patterns.""" | |
636 | p.text('re.compile(') |
|
643 | p.text('re.compile(') | |
637 | pattern = repr(obj.pattern) |
|
644 | pattern = repr(obj.pattern) | |
638 | if pattern[:1] in 'uU': |
|
645 | if pattern[:1] in 'uU': | |
639 | pattern = pattern[1:] |
|
646 | pattern = pattern[1:] | |
640 | prefix = 'ur' |
|
647 | prefix = 'ur' | |
641 | else: |
|
648 | else: | |
642 | prefix = 'r' |
|
649 | prefix = 'r' | |
643 | pattern = prefix + pattern.replace('\\\\', '\\') |
|
650 | pattern = prefix + pattern.replace('\\\\', '\\') | |
644 | p.text(pattern) |
|
651 | p.text(pattern) | |
645 | if obj.flags: |
|
652 | if obj.flags: | |
646 | p.text(',') |
|
653 | p.text(',') | |
647 | p.breakable() |
|
654 | p.breakable() | |
648 | done_one = False |
|
655 | done_one = False | |
649 | for flag in ('TEMPLATE', 'IGNORECASE', 'LOCALE', 'MULTILINE', 'DOTALL', |
|
656 | for flag in ('TEMPLATE', 'IGNORECASE', 'LOCALE', 'MULTILINE', 'DOTALL', | |
650 | 'UNICODE', 'VERBOSE', 'DEBUG'): |
|
657 | 'UNICODE', 'VERBOSE', 'DEBUG'): | |
651 | if obj.flags & getattr(re, flag): |
|
658 | if obj.flags & getattr(re, flag): | |
652 | if done_one: |
|
659 | if done_one: | |
653 | p.text('|') |
|
660 | p.text('|') | |
654 | p.text('re.' + flag) |
|
661 | p.text('re.' + flag) | |
655 | done_one = True |
|
662 | done_one = True | |
656 | p.text(')') |
|
663 | p.text(')') | |
657 |
|
664 | |||
658 |
|
665 | |||
659 | def _type_pprint(obj, p, cycle): |
|
666 | def _type_pprint(obj, p, cycle): | |
660 | """The pprint for classes and types.""" |
|
667 | """The pprint for classes and types.""" | |
661 | mod = getattr(obj, '__module__', None) |
|
668 | mod = getattr(obj, '__module__', None) | |
662 | if mod is None: |
|
669 | if mod is None: | |
663 | # Heap allocated types might not have the module attribute, |
|
670 | # Heap allocated types might not have the module attribute, | |
664 | # and others may set it to None. |
|
671 | # and others may set it to None. | |
665 | return p.text(obj.__name__) |
|
672 | return p.text(obj.__name__) | |
666 |
|
673 | |||
667 | if mod in ('__builtin__', 'builtins', 'exceptions'): |
|
674 | if mod in ('__builtin__', 'builtins', 'exceptions'): | |
668 | name = obj.__name__ |
|
675 | name = obj.__name__ | |
669 | else: |
|
676 | else: | |
670 | name = mod + '.' + obj.__name__ |
|
677 | name = mod + '.' + obj.__name__ | |
671 | p.text(name) |
|
678 | p.text(name) | |
672 |
|
679 | |||
673 |
|
680 | |||
674 | def _repr_pprint(obj, p, cycle): |
|
681 | def _repr_pprint(obj, p, cycle): | |
675 | """A pprint that just redirects to the normal repr function.""" |
|
682 | """A pprint that just redirects to the normal repr function.""" | |
676 | p.text(repr(obj)) |
|
683 | p.text(_safe_repr(obj)) | |
677 |
|
684 | |||
678 |
|
685 | |||
679 | def _function_pprint(obj, p, cycle): |
|
686 | def _function_pprint(obj, p, cycle): | |
680 | """Base pprint for all functions and builtin functions.""" |
|
687 | """Base pprint for all functions and builtin functions.""" | |
681 | if obj.__module__ in ('__builtin__', 'builtins', 'exceptions') or not obj.__module__: |
|
688 | if obj.__module__ in ('__builtin__', 'builtins', 'exceptions') or not obj.__module__: | |
682 | name = obj.__name__ |
|
689 | name = obj.__name__ | |
683 | else: |
|
690 | else: | |
684 | name = obj.__module__ + '.' + obj.__name__ |
|
691 | name = obj.__module__ + '.' + obj.__name__ | |
685 | p.text('<function %s>' % name) |
|
692 | p.text('<function %s>' % name) | |
686 |
|
693 | |||
687 |
|
694 | |||
688 | def _exception_pprint(obj, p, cycle): |
|
695 | def _exception_pprint(obj, p, cycle): | |
689 | """Base pprint for all exceptions.""" |
|
696 | """Base pprint for all exceptions.""" | |
690 | if obj.__class__.__module__ in ('exceptions', 'builtins'): |
|
697 | if obj.__class__.__module__ in ('exceptions', 'builtins'): | |
691 | name = obj.__class__.__name__ |
|
698 | name = obj.__class__.__name__ | |
692 | else: |
|
699 | else: | |
693 | name = '%s.%s' % ( |
|
700 | name = '%s.%s' % ( | |
694 | obj.__class__.__module__, |
|
701 | obj.__class__.__module__, | |
695 | obj.__class__.__name__ |
|
702 | obj.__class__.__name__ | |
696 | ) |
|
703 | ) | |
697 | step = len(name) + 1 |
|
704 | step = len(name) + 1 | |
698 | p.begin_group(step, name + '(') |
|
705 | p.begin_group(step, name + '(') | |
699 | for idx, arg in enumerate(getattr(obj, 'args', ())): |
|
706 | for idx, arg in enumerate(getattr(obj, 'args', ())): | |
700 | if idx: |
|
707 | if idx: | |
701 | p.text(',') |
|
708 | p.text(',') | |
702 | p.breakable() |
|
709 | p.breakable() | |
703 | p.pretty(arg) |
|
710 | p.pretty(arg) | |
704 | p.end_group(step, ')') |
|
711 | p.end_group(step, ')') | |
705 |
|
712 | |||
706 |
|
713 | |||
707 | #: the exception base |
|
714 | #: the exception base | |
708 | try: |
|
715 | try: | |
709 | _exception_base = BaseException |
|
716 | _exception_base = BaseException | |
710 | except NameError: |
|
717 | except NameError: | |
711 | _exception_base = Exception |
|
718 | _exception_base = Exception | |
712 |
|
719 | |||
713 |
|
720 | |||
714 | #: printers for builtin types |
|
721 | #: printers for builtin types | |
715 | _type_pprinters = { |
|
722 | _type_pprinters = { | |
716 | int: _repr_pprint, |
|
723 | int: _repr_pprint, | |
717 | float: _repr_pprint, |
|
724 | float: _repr_pprint, | |
718 | str: _repr_pprint, |
|
725 | str: _repr_pprint, | |
719 | tuple: _seq_pprinter_factory('(', ')', tuple), |
|
726 | tuple: _seq_pprinter_factory('(', ')', tuple), | |
720 | list: _seq_pprinter_factory('[', ']', list), |
|
727 | list: _seq_pprinter_factory('[', ']', list), | |
721 | dict: _dict_pprinter_factory('{', '}', dict), |
|
728 | dict: _dict_pprinter_factory('{', '}', dict), | |
722 |
|
729 | |||
723 | set: _set_pprinter_factory('{', '}', set), |
|
730 | set: _set_pprinter_factory('{', '}', set), | |
724 | frozenset: _set_pprinter_factory('frozenset({', '})', frozenset), |
|
731 | frozenset: _set_pprinter_factory('frozenset({', '})', frozenset), | |
725 | super: _super_pprint, |
|
732 | super: _super_pprint, | |
726 | _re_pattern_type: _re_pattern_pprint, |
|
733 | _re_pattern_type: _re_pattern_pprint, | |
727 | type: _type_pprint, |
|
734 | type: _type_pprint, | |
728 | types.FunctionType: _function_pprint, |
|
735 | types.FunctionType: _function_pprint, | |
729 | types.BuiltinFunctionType: _function_pprint, |
|
736 | types.BuiltinFunctionType: _function_pprint, | |
730 | types.MethodType: _repr_pprint, |
|
737 | types.MethodType: _repr_pprint, | |
731 |
|
738 | |||
732 | datetime.datetime: _repr_pprint, |
|
739 | datetime.datetime: _repr_pprint, | |
733 | datetime.timedelta: _repr_pprint, |
|
740 | datetime.timedelta: _repr_pprint, | |
734 | _exception_base: _exception_pprint |
|
741 | _exception_base: _exception_pprint | |
735 | } |
|
742 | } | |
736 |
|
743 | |||
737 | try: |
|
744 | try: | |
738 | _type_pprinters[types.DictProxyType] = _dict_pprinter_factory('<dictproxy {', '}>') |
|
745 | _type_pprinters[types.DictProxyType] = _dict_pprinter_factory('<dictproxy {', '}>') | |
739 | _type_pprinters[types.ClassType] = _type_pprint |
|
746 | _type_pprinters[types.ClassType] = _type_pprint | |
740 | _type_pprinters[types.SliceType] = _repr_pprint |
|
747 | _type_pprinters[types.SliceType] = _repr_pprint | |
741 | except AttributeError: # Python 3 |
|
748 | except AttributeError: # Python 3 | |
742 | _type_pprinters[slice] = _repr_pprint |
|
749 | _type_pprinters[slice] = _repr_pprint | |
743 |
|
750 | |||
744 | try: |
|
751 | try: | |
745 | _type_pprinters[xrange] = _repr_pprint |
|
752 | _type_pprinters[xrange] = _repr_pprint | |
746 | _type_pprinters[long] = _repr_pprint |
|
753 | _type_pprinters[long] = _repr_pprint | |
747 | _type_pprinters[unicode] = _repr_pprint |
|
754 | _type_pprinters[unicode] = _repr_pprint | |
748 | except NameError: |
|
755 | except NameError: | |
749 | _type_pprinters[range] = _repr_pprint |
|
756 | _type_pprinters[range] = _repr_pprint | |
750 | _type_pprinters[bytes] = _repr_pprint |
|
757 | _type_pprinters[bytes] = _repr_pprint | |
751 |
|
758 | |||
752 | #: printers for types specified by name |
|
759 | #: printers for types specified by name | |
753 | _deferred_type_pprinters = { |
|
760 | _deferred_type_pprinters = { | |
754 | } |
|
761 | } | |
755 |
|
762 | |||
756 | def for_type(typ, func): |
|
763 | def for_type(typ, func): | |
757 | """ |
|
764 | """ | |
758 | Add a pretty printer for a given type. |
|
765 | Add a pretty printer for a given type. | |
759 | """ |
|
766 | """ | |
760 | oldfunc = _type_pprinters.get(typ, None) |
|
767 | oldfunc = _type_pprinters.get(typ, None) | |
761 | if func is not None: |
|
768 | if func is not None: | |
762 | # To support easy restoration of old pprinters, we need to ignore Nones. |
|
769 | # To support easy restoration of old pprinters, we need to ignore Nones. | |
763 | _type_pprinters[typ] = func |
|
770 | _type_pprinters[typ] = func | |
764 | return oldfunc |
|
771 | return oldfunc | |
765 |
|
772 | |||
766 | def for_type_by_name(type_module, type_name, func): |
|
773 | def for_type_by_name(type_module, type_name, func): | |
767 | """ |
|
774 | """ | |
768 | Add a pretty printer for a type specified by the module and name of a type |
|
775 | Add a pretty printer for a type specified by the module and name of a type | |
769 | rather than the type object itself. |
|
776 | rather than the type object itself. | |
770 | """ |
|
777 | """ | |
771 | key = (type_module, type_name) |
|
778 | key = (type_module, type_name) | |
772 | oldfunc = _deferred_type_pprinters.get(key, None) |
|
779 | oldfunc = _deferred_type_pprinters.get(key, None) | |
773 | if func is not None: |
|
780 | if func is not None: | |
774 | # To support easy restoration of old pprinters, we need to ignore Nones. |
|
781 | # To support easy restoration of old pprinters, we need to ignore Nones. | |
775 | _deferred_type_pprinters[key] = func |
|
782 | _deferred_type_pprinters[key] = func | |
776 | return oldfunc |
|
783 | return oldfunc | |
777 |
|
784 | |||
778 |
|
785 | |||
779 | #: printers for the default singletons |
|
786 | #: printers for the default singletons | |
780 | _singleton_pprinters = dict.fromkeys(map(id, [None, True, False, Ellipsis, |
|
787 | _singleton_pprinters = dict.fromkeys(map(id, [None, True, False, Ellipsis, | |
781 | NotImplemented]), _repr_pprint) |
|
788 | NotImplemented]), _repr_pprint) | |
782 |
|
789 | |||
783 |
|
790 | |||
784 | if __name__ == '__main__': |
|
791 | if __name__ == '__main__': | |
785 | from random import randrange |
|
792 | from random import randrange | |
786 | class Foo(object): |
|
793 | class Foo(object): | |
787 | def __init__(self): |
|
794 | def __init__(self): | |
788 | self.foo = 1 |
|
795 | self.foo = 1 | |
789 | self.bar = re.compile(r'\s+') |
|
796 | self.bar = re.compile(r'\s+') | |
790 | self.blub = dict.fromkeys(range(30), randrange(1, 40)) |
|
797 | self.blub = dict.fromkeys(range(30), randrange(1, 40)) | |
791 | self.hehe = 23424.234234 |
|
798 | self.hehe = 23424.234234 | |
792 | self.list = ["blub", "blah", self] |
|
799 | self.list = ["blub", "blah", self] | |
793 |
|
800 | |||
794 | def get_foo(self): |
|
801 | def get_foo(self): | |
795 | print("foo") |
|
802 | print("foo") | |
796 |
|
803 | |||
797 | pprint(Foo(), verbose=True) |
|
804 | pprint(Foo(), verbose=True) |
General Comments 0
You need to be logged in to leave comments.
Login now