Show More
@@ -1,325 +1,325 | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Displayhook for IPython. |
|
3 | 3 | |
|
4 | 4 | This defines a callable class that IPython uses for `sys.displayhook`. |
|
5 | 5 | """ |
|
6 | 6 | |
|
7 | 7 | # Copyright (c) IPython Development Team. |
|
8 | 8 | # Distributed under the terms of the Modified BSD License. |
|
9 | 9 | |
|
10 | 10 | import builtins as builtin_mod |
|
11 | 11 | import sys |
|
12 | 12 | import io as _io |
|
13 | 13 | import tokenize |
|
14 | 14 | |
|
15 | 15 | from traitlets.config.configurable import Configurable |
|
16 | 16 | from traitlets import Instance, Float |
|
17 | 17 | from warnings import warn |
|
18 | 18 | |
|
19 | 19 | # TODO: Move the various attributes (cache_size, [others now moved]). Some |
|
20 | 20 | # of these are also attributes of InteractiveShell. They should be on ONE object |
|
21 | 21 | # only and the other objects should ask that one object for their values. |
|
22 | 22 | |
|
23 | 23 | class DisplayHook(Configurable): |
|
24 | 24 | """The custom IPython displayhook to replace sys.displayhook. |
|
25 | 25 | |
|
26 | 26 | This class does many things, but the basic idea is that it is a callable |
|
27 | 27 | that gets called anytime user code returns a value. |
|
28 | 28 | """ |
|
29 | 29 | |
|
30 | 30 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', |
|
31 | 31 | allow_none=True) |
|
32 | 32 | exec_result = Instance('IPython.core.interactiveshell.ExecutionResult', |
|
33 | 33 | allow_none=True) |
|
34 | 34 | cull_fraction = Float(0.2) |
|
35 | 35 | |
|
36 | 36 | def __init__(self, shell=None, cache_size=1000, **kwargs): |
|
37 | 37 | super(DisplayHook, self).__init__(shell=shell, **kwargs) |
|
38 | 38 | cache_size_min = 3 |
|
39 | 39 | if cache_size <= 0: |
|
40 | 40 | self.do_full_cache = 0 |
|
41 | 41 | cache_size = 0 |
|
42 | 42 | elif cache_size < cache_size_min: |
|
43 | 43 | self.do_full_cache = 0 |
|
44 | 44 | cache_size = 0 |
|
45 | 45 | warn('caching was disabled (min value for cache size is %s).' % |
|
46 | 46 | cache_size_min,stacklevel=3) |
|
47 | 47 | else: |
|
48 | 48 | self.do_full_cache = 1 |
|
49 | 49 | |
|
50 | 50 | self.cache_size = cache_size |
|
51 | 51 | |
|
52 | 52 | # we need a reference to the user-level namespace |
|
53 | 53 | self.shell = shell |
|
54 | 54 | |
|
55 | 55 | self._,self.__,self.___ = '','','' |
|
56 | 56 | |
|
57 | 57 | # these are deliberately global: |
|
58 | 58 | to_user_ns = {'_':self._,'__':self.__,'___':self.___} |
|
59 | 59 | self.shell.user_ns.update(to_user_ns) |
|
60 | 60 | |
|
61 | 61 | @property |
|
62 | 62 | def prompt_count(self): |
|
63 | 63 | return self.shell.execution_count |
|
64 | 64 | |
|
65 | 65 | #------------------------------------------------------------------------- |
|
66 | 66 | # Methods used in __call__. Override these methods to modify the behavior |
|
67 | 67 | # of the displayhook. |
|
68 | 68 | #------------------------------------------------------------------------- |
|
69 | 69 | |
|
70 | 70 | def check_for_underscore(self): |
|
71 | 71 | """Check if the user has set the '_' variable by hand.""" |
|
72 | 72 | # If something injected a '_' variable in __builtin__, delete |
|
73 | 73 | # ipython's automatic one so we don't clobber that. gettext() in |
|
74 | 74 | # particular uses _, so we need to stay away from it. |
|
75 | 75 | if '_' in builtin_mod.__dict__: |
|
76 | 76 | try: |
|
77 | 77 | user_value = self.shell.user_ns['_'] |
|
78 | 78 | if user_value is not self._: |
|
79 | 79 | return |
|
80 | 80 | del self.shell.user_ns['_'] |
|
81 | 81 | except KeyError: |
|
82 | 82 | pass |
|
83 | 83 | |
|
84 | 84 | def quiet(self): |
|
85 | 85 | """Should we silence the display hook because of ';'?""" |
|
86 | 86 | # do not print output if input ends in ';' |
|
87 | 87 | |
|
88 | 88 | try: |
|
89 | 89 | cell = self.shell.history_manager.input_hist_parsed[-1] |
|
90 | 90 | except IndexError: |
|
91 | 91 | # some uses of ipshellembed may fail here |
|
92 | 92 | return False |
|
93 | 93 | |
|
94 | 94 | sio = _io.StringIO(cell) |
|
95 | 95 | tokens = list(tokenize.generate_tokens(sio.readline)) |
|
96 | 96 | |
|
97 | 97 | for token in reversed(tokens): |
|
98 | 98 | if token[0] in (tokenize.ENDMARKER, tokenize.NL, tokenize.NEWLINE, tokenize.COMMENT): |
|
99 | 99 | continue |
|
100 | 100 | if (token[0] == tokenize.OP) and (token[1] == ';'): |
|
101 | 101 | return True |
|
102 | 102 | else: |
|
103 | 103 | return False |
|
104 | 104 | |
|
105 | 105 | def start_displayhook(self): |
|
106 | 106 | """Start the displayhook, initializing resources.""" |
|
107 | 107 | pass |
|
108 | 108 | |
|
109 | 109 | def write_output_prompt(self): |
|
110 | 110 | """Write the output prompt. |
|
111 | 111 | |
|
112 | 112 | The default implementation simply writes the prompt to |
|
113 | 113 | ``sys.stdout``. |
|
114 | 114 | """ |
|
115 | 115 | # Use write, not print which adds an extra space. |
|
116 | 116 | sys.stdout.write(self.shell.separate_out) |
|
117 | 117 | outprompt = 'Out[{}]: '.format(self.shell.execution_count) |
|
118 | 118 | if self.do_full_cache: |
|
119 | 119 | sys.stdout.write(outprompt) |
|
120 | 120 | |
|
121 | 121 | def compute_format_data(self, result): |
|
122 | 122 | """Compute format data of the object to be displayed. |
|
123 | 123 | |
|
124 | 124 | The format data is a generalization of the :func:`repr` of an object. |
|
125 | 125 | In the default implementation the format data is a :class:`dict` of |
|
126 | 126 | key value pair where the keys are valid MIME types and the values |
|
127 | 127 | are JSON'able data structure containing the raw data for that MIME |
|
128 | 128 | type. It is up to frontends to determine pick a MIME to to use and |
|
129 | 129 | display that data in an appropriate manner. |
|
130 | 130 | |
|
131 | 131 | This method only computes the format data for the object and should |
|
132 | 132 | NOT actually print or write that to a stream. |
|
133 | 133 | |
|
134 | 134 | Parameters |
|
135 | 135 | ---------- |
|
136 | 136 | result : object |
|
137 | 137 | The Python object passed to the display hook, whose format will be |
|
138 | 138 | computed. |
|
139 | 139 | |
|
140 | 140 | Returns |
|
141 | 141 | ------- |
|
142 | 142 | (format_dict, md_dict) : dict |
|
143 | 143 | format_dict is a :class:`dict` whose keys are valid MIME types and values are |
|
144 | 144 | JSON'able raw data for that MIME type. It is recommended that |
|
145 | 145 | all return values of this should always include the "text/plain" |
|
146 | 146 | MIME type representation of the object. |
|
147 | 147 | md_dict is a :class:`dict` with the same MIME type keys |
|
148 | 148 | of metadata associated with each output. |
|
149 | ||
|
149 | ||
|
150 | 150 | """ |
|
151 | 151 | return self.shell.display_formatter.format(result) |
|
152 | 152 | |
|
153 | 153 | # This can be set to True by the write_output_prompt method in a subclass |
|
154 | 154 | prompt_end_newline = False |
|
155 | 155 | |
|
156 | 156 | def write_format_data(self, format_dict, md_dict=None) -> None: |
|
157 | 157 | """Write the format data dict to the frontend. |
|
158 | 158 | |
|
159 | 159 | This default version of this method simply writes the plain text |
|
160 | 160 | representation of the object to ``sys.stdout``. Subclasses should |
|
161 | 161 | override this method to send the entire `format_dict` to the |
|
162 | 162 | frontends. |
|
163 | 163 | |
|
164 | 164 | Parameters |
|
165 | 165 | ---------- |
|
166 | 166 | format_dict : dict |
|
167 | 167 | The format dict for the object passed to `sys.displayhook`. |
|
168 | 168 | md_dict : dict (optional) |
|
169 | 169 | The metadata dict to be associated with the display data. |
|
170 | 170 | """ |
|
171 | 171 | if 'text/plain' not in format_dict: |
|
172 | 172 | # nothing to do |
|
173 | 173 | return |
|
174 | 174 | # We want to print because we want to always make sure we have a |
|
175 | 175 | # newline, even if all the prompt separators are ''. This is the |
|
176 | 176 | # standard IPython behavior. |
|
177 | 177 | result_repr = format_dict['text/plain'] |
|
178 | 178 | if '\n' in result_repr: |
|
179 | 179 | # So that multi-line strings line up with the left column of |
|
180 | 180 | # the screen, instead of having the output prompt mess up |
|
181 | 181 | # their first line. |
|
182 | 182 | # We use the prompt template instead of the expanded prompt |
|
183 | 183 | # because the expansion may add ANSI escapes that will interfere |
|
184 | 184 | # with our ability to determine whether or not we should add |
|
185 | 185 | # a newline. |
|
186 | 186 | if not self.prompt_end_newline: |
|
187 | 187 | # But avoid extraneous empty lines. |
|
188 | 188 | result_repr = '\n' + result_repr |
|
189 | 189 | |
|
190 | 190 | try: |
|
191 | 191 | print(result_repr) |
|
192 | 192 | except UnicodeEncodeError: |
|
193 | 193 | # If a character is not supported by the terminal encoding replace |
|
194 | 194 | # it with its \u or \x representation |
|
195 | 195 | print(result_repr.encode(sys.stdout.encoding,'backslashreplace').decode(sys.stdout.encoding)) |
|
196 | 196 | |
|
197 | 197 | def update_user_ns(self, result): |
|
198 | 198 | """Update user_ns with various things like _, __, _1, etc.""" |
|
199 | 199 | |
|
200 | 200 | # Avoid recursive reference when displaying _oh/Out |
|
201 | 201 | if self.cache_size and result is not self.shell.user_ns['_oh']: |
|
202 | 202 | if len(self.shell.user_ns['_oh']) >= self.cache_size and self.do_full_cache: |
|
203 | 203 | self.cull_cache() |
|
204 | 204 | |
|
205 | 205 | # Don't overwrite '_' and friends if '_' is in __builtin__ |
|
206 | 206 | # (otherwise we cause buggy behavior for things like gettext). and |
|
207 | 207 | # do not overwrite _, __ or ___ if one of these has been assigned |
|
208 | 208 | # by the user. |
|
209 | 209 | update_unders = True |
|
210 | 210 | for unders in ['_'*i for i in range(1,4)]: |
|
211 | 211 | if not unders in self.shell.user_ns: |
|
212 | 212 | continue |
|
213 | 213 | if getattr(self, unders) is not self.shell.user_ns.get(unders): |
|
214 | 214 | update_unders = False |
|
215 | 215 | |
|
216 | 216 | self.___ = self.__ |
|
217 | 217 | self.__ = self._ |
|
218 | 218 | self._ = result |
|
219 | 219 | |
|
220 | 220 | if ('_' not in builtin_mod.__dict__) and (update_unders): |
|
221 | 221 | self.shell.push({'_':self._, |
|
222 | 222 | '__':self.__, |
|
223 | 223 | '___':self.___}, interactive=False) |
|
224 | 224 | |
|
225 | 225 | # hackish access to top-level namespace to create _1,_2... dynamically |
|
226 | 226 | to_main = {} |
|
227 | 227 | if self.do_full_cache: |
|
228 | 228 | new_result = '_%s' % self.prompt_count |
|
229 | 229 | to_main[new_result] = result |
|
230 | 230 | self.shell.push(to_main, interactive=False) |
|
231 | 231 | self.shell.user_ns['_oh'][self.prompt_count] = result |
|
232 | 232 | |
|
233 | 233 | def fill_exec_result(self, result): |
|
234 | 234 | if self.exec_result is not None: |
|
235 | 235 | self.exec_result.result = result |
|
236 | 236 | |
|
237 | 237 | def log_output(self, format_dict): |
|
238 | 238 | """Log the output.""" |
|
239 | 239 | if 'text/plain' not in format_dict: |
|
240 | 240 | # nothing to do |
|
241 | 241 | return |
|
242 | 242 | if self.shell.logger.log_output: |
|
243 | 243 | self.shell.logger.log_write(format_dict['text/plain'], 'output') |
|
244 | 244 | self.shell.history_manager.output_hist_reprs[self.prompt_count] = \ |
|
245 | 245 | format_dict['text/plain'] |
|
246 | 246 | |
|
247 | 247 | def finish_displayhook(self): |
|
248 | 248 | """Finish up all displayhook activities.""" |
|
249 | 249 | sys.stdout.write(self.shell.separate_out2) |
|
250 | 250 | sys.stdout.flush() |
|
251 | 251 | |
|
252 | 252 | def __call__(self, result=None): |
|
253 | 253 | """Printing with history cache management. |
|
254 | 254 | |
|
255 | 255 | This is invoked every time the interpreter needs to print, and is |
|
256 | 256 | activated by setting the variable sys.displayhook to it. |
|
257 | 257 | """ |
|
258 | 258 | self.check_for_underscore() |
|
259 | 259 | if result is not None and not self.quiet(): |
|
260 | 260 | self.start_displayhook() |
|
261 | 261 | self.write_output_prompt() |
|
262 | 262 | format_dict, md_dict = self.compute_format_data(result) |
|
263 | 263 | self.update_user_ns(result) |
|
264 | 264 | self.fill_exec_result(result) |
|
265 | 265 | if format_dict: |
|
266 | 266 | self.write_format_data(format_dict, md_dict) |
|
267 | 267 | self.log_output(format_dict) |
|
268 | 268 | self.finish_displayhook() |
|
269 | 269 | |
|
270 | 270 | def cull_cache(self): |
|
271 | 271 | """Output cache is full, cull the oldest entries""" |
|
272 | 272 | oh = self.shell.user_ns.get('_oh', {}) |
|
273 | 273 | sz = len(oh) |
|
274 | 274 | cull_count = max(int(sz * self.cull_fraction), 2) |
|
275 | 275 | warn('Output cache limit (currently {sz} entries) hit.\n' |
|
276 | 276 | 'Flushing oldest {cull_count} entries.'.format(sz=sz, cull_count=cull_count)) |
|
277 | 277 | |
|
278 | 278 | for i, n in enumerate(sorted(oh)): |
|
279 | 279 | if i >= cull_count: |
|
280 | 280 | break |
|
281 | 281 | self.shell.user_ns.pop('_%i' % n, None) |
|
282 | 282 | oh.pop(n, None) |
|
283 | 283 | |
|
284 | 284 | |
|
285 | 285 | def flush(self): |
|
286 | 286 | if not self.do_full_cache: |
|
287 | 287 | raise ValueError("You shouldn't have reached the cache flush " |
|
288 | 288 | "if full caching is not enabled!") |
|
289 | 289 | # delete auto-generated vars from global namespace |
|
290 | 290 | |
|
291 | 291 | for n in range(1,self.prompt_count + 1): |
|
292 | 292 | key = '_'+repr(n) |
|
293 | 293 | try: |
|
294 | 294 | del self.shell.user_ns[key] |
|
295 | 295 | except: pass |
|
296 | 296 | # In some embedded circumstances, the user_ns doesn't have the |
|
297 | 297 | # '_oh' key set up. |
|
298 | 298 | oh = self.shell.user_ns.get('_oh', None) |
|
299 | 299 | if oh is not None: |
|
300 | 300 | oh.clear() |
|
301 | 301 | |
|
302 | 302 | # Release our own references to objects: |
|
303 | 303 | self._, self.__, self.___ = '', '', '' |
|
304 | 304 | |
|
305 | 305 | if '_' not in builtin_mod.__dict__: |
|
306 | 306 | self.shell.user_ns.update({'_':self._,'__':self.__,'___':self.___}) |
|
307 | 307 | import gc |
|
308 | 308 | # TODO: Is this really needed? |
|
309 | 309 | # IronPython blocks here forever |
|
310 | 310 | if sys.platform != "cli": |
|
311 | 311 | gc.collect() |
|
312 | 312 | |
|
313 | 313 | |
|
314 | 314 | class CapturingDisplayHook(object): |
|
315 | 315 | def __init__(self, shell, outputs=None): |
|
316 | 316 | self.shell = shell |
|
317 | 317 | if outputs is None: |
|
318 | 318 | outputs = [] |
|
319 | 319 | self.outputs = outputs |
|
320 | 320 | |
|
321 | 321 | def __call__(self, result=None): |
|
322 | 322 | if result is None: |
|
323 | 323 | return |
|
324 | 324 | format_dict, md_dict = self.shell.display_formatter.format(result) |
|
325 | 325 | self.outputs.append({ 'data': format_dict, 'metadata': md_dict }) |
@@ -1,138 +1,138 | |||
|
1 | 1 | """An interface for publishing rich data to frontends. |
|
2 | 2 | |
|
3 | 3 | There are two components of the display system: |
|
4 | 4 | |
|
5 | 5 | * Display formatters, which take a Python object and compute the |
|
6 | 6 | representation of the object in various formats (text, HTML, SVG, etc.). |
|
7 | 7 | * The display publisher that is used to send the representation data to the |
|
8 | 8 | various frontends. |
|
9 | 9 | |
|
10 | 10 | This module defines the logic display publishing. The display publisher uses |
|
11 | 11 | the ``display_data`` message type that is defined in the IPython messaging |
|
12 | 12 | spec. |
|
13 | 13 | """ |
|
14 | 14 | |
|
15 | 15 | # Copyright (c) IPython Development Team. |
|
16 | 16 | # Distributed under the terms of the Modified BSD License. |
|
17 | 17 | |
|
18 | 18 | |
|
19 | 19 | import sys |
|
20 | 20 | |
|
21 | 21 | from traitlets.config.configurable import Configurable |
|
22 | 22 | from traitlets import List |
|
23 | 23 | |
|
24 | 24 | # This used to be defined here - it is imported for backwards compatibility |
|
25 | 25 | from .display_functions import publish_display_data |
|
26 | 26 | |
|
27 | 27 | #----------------------------------------------------------------------------- |
|
28 | 28 | # Main payload class |
|
29 | 29 | #----------------------------------------------------------------------------- |
|
30 | 30 | |
|
31 | 31 | |
|
32 | 32 | class DisplayPublisher(Configurable): |
|
33 | 33 | """A traited class that publishes display data to frontends. |
|
34 | 34 | |
|
35 | 35 | Instances of this class are created by the main IPython object and should |
|
36 | 36 | be accessed there. |
|
37 | 37 | """ |
|
38 | 38 | |
|
39 | 39 | def __init__(self, shell=None, *args, **kwargs): |
|
40 | 40 | self.shell = shell |
|
41 | 41 | super().__init__(*args, **kwargs) |
|
42 | 42 | |
|
43 | 43 | def _validate_data(self, data, metadata=None): |
|
44 | 44 | """Validate the display data. |
|
45 | 45 | |
|
46 | 46 | Parameters |
|
47 | 47 | ---------- |
|
48 | 48 | data : dict |
|
49 | 49 | The formata data dictionary. |
|
50 | 50 | metadata : dict |
|
51 | 51 | Any metadata for the data. |
|
52 | 52 | """ |
|
53 | 53 | |
|
54 | 54 | if not isinstance(data, dict): |
|
55 | 55 | raise TypeError('data must be a dict, got: %r' % data) |
|
56 | 56 | if metadata is not None: |
|
57 | 57 | if not isinstance(metadata, dict): |
|
58 | 58 | raise TypeError('metadata must be a dict, got: %r' % data) |
|
59 | 59 | |
|
60 | 60 | # use * to indicate transient, update are keyword-only |
|
61 | 61 | def publish(self, data, metadata=None, source=None, *, transient=None, update=False, **kwargs) -> None: |
|
62 | 62 | """Publish data and metadata to all frontends. |
|
63 | 63 | |
|
64 | 64 | See the ``display_data`` message in the messaging documentation for |
|
65 | 65 | more details about this message type. |
|
66 | 66 | |
|
67 | 67 | The following MIME types are currently implemented: |
|
68 | 68 | |
|
69 | 69 | * text/plain |
|
70 | 70 | * text/html |
|
71 | 71 | * text/markdown |
|
72 | 72 | * text/latex |
|
73 | 73 | * application/json |
|
74 | 74 | * application/javascript |
|
75 | 75 | * image/png |
|
76 | 76 | * image/jpeg |
|
77 | 77 | * image/svg+xml |
|
78 | 78 | |
|
79 | 79 | Parameters |
|
80 | 80 | ---------- |
|
81 | 81 | data : dict |
|
82 | 82 | A dictionary having keys that are valid MIME types (like |
|
83 | 83 | 'text/plain' or 'image/svg+xml') and values that are the data for |
|
84 | 84 | that MIME type. The data itself must be a JSON'able data |
|
85 | 85 | structure. Minimally all data should have the 'text/plain' data, |
|
86 | 86 | which can be displayed by all frontends. If more than the plain |
|
87 | 87 | text is given, it is up to the frontend to decide which |
|
88 | 88 | representation to use. |
|
89 | 89 | metadata : dict |
|
90 | 90 | A dictionary for metadata related to the data. This can contain |
|
91 | 91 | arbitrary key, value pairs that frontends can use to interpret |
|
92 | 92 | the data. Metadata specific to each mime-type can be specified |
|
93 | 93 | in the metadata dict with the same mime-type keys as |
|
94 | 94 | the data itself. |
|
95 | 95 | source : str, deprecated |
|
96 | 96 | Unused. |
|
97 | transient: dict, keyword-only | |
|
97 | transient : dict, keyword-only | |
|
98 | 98 | A dictionary for transient data. |
|
99 | 99 | Data in this dictionary should not be persisted as part of saving this output. |
|
100 | 100 | Examples include 'display_id'. |
|
101 | update: bool, keyword-only, default: False | |
|
101 | update : bool, keyword-only, default: False | |
|
102 | 102 | If True, only update existing outputs with the same display_id, |
|
103 | 103 | rather than creating a new output. |
|
104 | 104 | """ |
|
105 | 105 | |
|
106 | 106 | handlers = {} |
|
107 | 107 | if self.shell is not None: |
|
108 | 108 | handlers = getattr(self.shell, 'mime_renderers', {}) |
|
109 | 109 | |
|
110 | 110 | for mime, handler in handlers.items(): |
|
111 | 111 | if mime in data: |
|
112 | 112 | handler(data[mime], metadata.get(mime, None)) |
|
113 | 113 | return |
|
114 | 114 | |
|
115 | 115 | if 'text/plain' in data: |
|
116 | 116 | print(data['text/plain']) |
|
117 | 117 | |
|
118 | 118 | def clear_output(self, wait=False): |
|
119 | 119 | """Clear the output of the cell receiving output.""" |
|
120 | 120 | print('\033[2K\r', end='') |
|
121 | 121 | sys.stdout.flush() |
|
122 | 122 | print('\033[2K\r', end='') |
|
123 | 123 | sys.stderr.flush() |
|
124 | 124 | |
|
125 | 125 | |
|
126 | 126 | class CapturingDisplayPublisher(DisplayPublisher): |
|
127 | 127 | """A DisplayPublisher that stores""" |
|
128 | 128 | outputs = List() |
|
129 | 129 | |
|
130 | 130 | def publish(self, data, metadata=None, source=None, *, transient=None, update=False): |
|
131 | 131 | self.outputs.append({'data':data, 'metadata':metadata, |
|
132 | 132 | 'transient':transient, 'update':update}) |
|
133 | 133 | |
|
134 | 134 | def clear_output(self, wait=False): |
|
135 | 135 | super(CapturingDisplayPublisher, self).clear_output(wait) |
|
136 | 136 | |
|
137 | 137 | # empty the list, *do not* reassign a new list |
|
138 | 138 | self.outputs.clear() |
@@ -1,161 +1,161 | |||
|
1 | 1 | """Infrastructure for registering and firing callbacks on application events. |
|
2 | 2 | |
|
3 | 3 | Unlike :mod:`IPython.core.hooks`, which lets end users set single functions to |
|
4 | 4 | be called at specific times, or a collection of alternative methods to try, |
|
5 | 5 | callbacks are designed to be used by extension authors. A number of callbacks |
|
6 | 6 | can be registered for the same event without needing to be aware of one another. |
|
7 | 7 | |
|
8 | 8 | The functions defined in this module are no-ops indicating the names of available |
|
9 | 9 | events and the arguments which will be passed to them. |
|
10 | 10 | |
|
11 | 11 | .. note:: |
|
12 | 12 | |
|
13 | 13 | This API is experimental in IPython 2.0, and may be revised in future versions. |
|
14 | 14 | """ |
|
15 | 15 | |
|
16 | 16 | from backcall import callback_prototype |
|
17 | 17 | |
|
18 | 18 | |
|
19 | 19 | class EventManager(object): |
|
20 | 20 | """Manage a collection of events and a sequence of callbacks for each. |
|
21 | 21 | |
|
22 | 22 | This is attached to :class:`~IPython.core.interactiveshell.InteractiveShell` |
|
23 | 23 | instances as an ``events`` attribute. |
|
24 | 24 | |
|
25 | 25 | .. note:: |
|
26 | 26 | |
|
27 | 27 | This API is experimental in IPython 2.0, and may be revised in future versions. |
|
28 | 28 | """ |
|
29 | 29 | def __init__(self, shell, available_events): |
|
30 | 30 | """Initialise the :class:`CallbackManager`. |
|
31 | ||
|
31 | ||
|
32 | 32 | Parameters |
|
33 | 33 | ---------- |
|
34 | 34 | shell |
|
35 | The :class:`~IPython.core.interactiveshell.InteractiveShell` instance | |
|
36 |
available_ |
|
|
37 | An iterable of names for callback events. | |
|
35 | The :class:`~IPython.core.interactiveshell.InteractiveShell` instance | |
|
36 | available_events | |
|
37 | An iterable of names for callback events. | |
|
38 | 38 | """ |
|
39 | 39 | self.shell = shell |
|
40 | 40 | self.callbacks = {n:[] for n in available_events} |
|
41 | 41 | |
|
42 | 42 | def register(self, event, function): |
|
43 | 43 | """Register a new event callback. |
|
44 | ||
|
44 | ||
|
45 | 45 | Parameters |
|
46 | 46 | ---------- |
|
47 | 47 | event : str |
|
48 | The event for which to register this callback. | |
|
48 | The event for which to register this callback. | |
|
49 | 49 | function : callable |
|
50 | A function to be called on the given event. It should take the same | |
|
51 | parameters as the appropriate callback prototype. | |
|
52 | ||
|
50 | A function to be called on the given event. It should take the same | |
|
51 | parameters as the appropriate callback prototype. | |
|
52 | ||
|
53 | 53 | Raises |
|
54 | 54 | ------ |
|
55 | 55 | TypeError |
|
56 | If ``function`` is not callable. | |
|
56 | If ``function`` is not callable. | |
|
57 | 57 | KeyError |
|
58 | If ``event`` is not one of the known events. | |
|
58 | If ``event`` is not one of the known events. | |
|
59 | 59 | """ |
|
60 | 60 | if not callable(function): |
|
61 | 61 | raise TypeError('Need a callable, got %r' % function) |
|
62 | 62 | callback_proto = available_events.get(event) |
|
63 | 63 | if function not in self.callbacks[event]: |
|
64 | 64 | self.callbacks[event].append(callback_proto.adapt(function)) |
|
65 | 65 | |
|
66 | 66 | def unregister(self, event, function): |
|
67 | 67 | """Remove a callback from the given event.""" |
|
68 | 68 | if function in self.callbacks[event]: |
|
69 | 69 | return self.callbacks[event].remove(function) |
|
70 | 70 | |
|
71 | 71 | # Remove callback in case ``function`` was adapted by `backcall`. |
|
72 | 72 | for callback in self.callbacks[event]: |
|
73 | 73 | try: |
|
74 | 74 | if callback.__wrapped__ is function: |
|
75 | 75 | return self.callbacks[event].remove(callback) |
|
76 | 76 | except AttributeError: |
|
77 | 77 | pass |
|
78 | 78 | |
|
79 | 79 | raise ValueError('Function {!r} is not registered as a {} callback'.format(function, event)) |
|
80 | 80 | |
|
81 | 81 | def trigger(self, event, *args, **kwargs): |
|
82 | 82 | """Call callbacks for ``event``. |
|
83 | ||
|
83 | ||
|
84 | 84 | Any additional arguments are passed to all callbacks registered for this |
|
85 | 85 | event. Exceptions raised by callbacks are caught, and a message printed. |
|
86 | 86 | """ |
|
87 | 87 | for func in self.callbacks[event][:]: |
|
88 | 88 | try: |
|
89 | 89 | func(*args, **kwargs) |
|
90 | 90 | except (Exception, KeyboardInterrupt): |
|
91 | 91 | print("Error in callback {} (for {}):".format(func, event)) |
|
92 | 92 | self.shell.showtraceback() |
|
93 | 93 | |
|
94 | 94 | # event_name -> prototype mapping |
|
95 | 95 | available_events = {} |
|
96 | 96 | |
|
97 | 97 | def _define_event(callback_function): |
|
98 | 98 | callback_proto = callback_prototype(callback_function) |
|
99 | 99 | available_events[callback_function.__name__] = callback_proto |
|
100 | 100 | return callback_proto |
|
101 | 101 | |
|
102 | 102 | # ------------------------------------------------------------------------------ |
|
103 | 103 | # Callback prototypes |
|
104 | 104 | # |
|
105 | 105 | # No-op functions which describe the names of available events and the |
|
106 | 106 | # signatures of callbacks for those events. |
|
107 | 107 | # ------------------------------------------------------------------------------ |
|
108 | 108 | |
|
109 | 109 | @_define_event |
|
110 | 110 | def pre_execute(): |
|
111 | 111 | """Fires before code is executed in response to user/frontend action. |
|
112 | ||
|
112 | ||
|
113 | 113 | This includes comm and widget messages and silent execution, as well as user |
|
114 | 114 | code cells. |
|
115 | 115 | """ |
|
116 | 116 | pass |
|
117 | 117 | |
|
118 | 118 | @_define_event |
|
119 | 119 | def pre_run_cell(info): |
|
120 | 120 | """Fires before user-entered code runs. |
|
121 | 121 | |
|
122 | 122 | Parameters |
|
123 | 123 | ---------- |
|
124 | 124 | info : :class:`~IPython.core.interactiveshell.ExecutionInfo` |
|
125 | An object containing information used for the code execution. | |
|
125 | An object containing information used for the code execution. | |
|
126 | 126 | """ |
|
127 | 127 | pass |
|
128 | 128 | |
|
129 | 129 | @_define_event |
|
130 | 130 | def post_execute(): |
|
131 | 131 | """Fires after code is executed in response to user/frontend action. |
|
132 | ||
|
132 | ||
|
133 | 133 | This includes comm and widget messages and silent execution, as well as user |
|
134 | 134 | code cells. |
|
135 | 135 | """ |
|
136 | 136 | pass |
|
137 | 137 | |
|
138 | 138 | @_define_event |
|
139 | 139 | def post_run_cell(result): |
|
140 | 140 | """Fires after user-entered code runs. |
|
141 | 141 | |
|
142 | 142 | Parameters |
|
143 | 143 | ---------- |
|
144 | 144 | result : :class:`~IPython.core.interactiveshell.ExecutionResult` |
|
145 | The object which will be returned as the execution result. | |
|
145 | The object which will be returned as the execution result. | |
|
146 | 146 | """ |
|
147 | 147 | pass |
|
148 | 148 | |
|
149 | 149 | @_define_event |
|
150 | 150 | def shell_initialized(ip): |
|
151 | 151 | """Fires after initialisation of :class:`~IPython.core.interactiveshell.InteractiveShell`. |
|
152 | ||
|
152 | ||
|
153 | 153 | This is before extensions and startup scripts are loaded, so it can only be |
|
154 | 154 | set by subclassing. |
|
155 | ||
|
155 | ||
|
156 | 156 | Parameters |
|
157 | 157 | ---------- |
|
158 | 158 | ip : :class:`~IPython.core.interactiveshell.InteractiveShell` |
|
159 | The newly initialised shell. | |
|
159 | The newly initialised shell. | |
|
160 | 160 | """ |
|
161 | 161 | pass |
@@ -1,150 +1,150 | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """A class for managing IPython extensions.""" |
|
3 | 3 | |
|
4 | 4 | # Copyright (c) IPython Development Team. |
|
5 | 5 | # Distributed under the terms of the Modified BSD License. |
|
6 | 6 | |
|
7 | 7 | import os |
|
8 | 8 | import os.path |
|
9 | 9 | import sys |
|
10 | 10 | from importlib import import_module, reload |
|
11 | 11 | |
|
12 | 12 | from traitlets.config.configurable import Configurable |
|
13 | 13 | from IPython.utils.path import ensure_dir_exists, compress_user |
|
14 | 14 | from IPython.utils.decorators import undoc |
|
15 | 15 | from traitlets import Instance |
|
16 | 16 | |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Main class |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | class ExtensionManager(Configurable): |
|
23 | 23 | """A class to manage IPython extensions. |
|
24 | 24 | |
|
25 | 25 | An IPython extension is an importable Python module that has |
|
26 | 26 | a function with the signature:: |
|
27 | 27 | |
|
28 | 28 | def load_ipython_extension(ipython): |
|
29 | 29 | # Do things with ipython |
|
30 | 30 | |
|
31 | 31 | This function is called after your extension is imported and the |
|
32 | 32 | currently active :class:`InteractiveShell` instance is passed as |
|
33 | 33 | the only argument. You can do anything you want with IPython at |
|
34 | 34 | that point, including defining new magic and aliases, adding new |
|
35 | 35 | components, etc. |
|
36 | 36 | |
|
37 | 37 | You can also optionally define an :func:`unload_ipython_extension(ipython)` |
|
38 | 38 | function, which will be called if the user unloads or reloads the extension. |
|
39 | 39 | The extension manager will only call :func:`load_ipython_extension` again |
|
40 | 40 | if the extension is reloaded. |
|
41 | 41 | |
|
42 | 42 | You can put your extension modules anywhere you want, as long as |
|
43 | 43 | they can be imported by Python's standard import mechanism. However, |
|
44 | 44 | to make it easy to write extensions, you can also put your extensions |
|
45 | 45 | in ``os.path.join(self.ipython_dir, 'extensions')``. This directory |
|
46 | 46 | is added to ``sys.path`` automatically. |
|
47 | 47 | """ |
|
48 | 48 | |
|
49 | 49 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True) |
|
50 | 50 | |
|
51 | 51 | def __init__(self, shell=None, **kwargs): |
|
52 | 52 | super(ExtensionManager, self).__init__(shell=shell, **kwargs) |
|
53 | 53 | self.shell.observe( |
|
54 | 54 | self._on_ipython_dir_changed, names=('ipython_dir',) |
|
55 | 55 | ) |
|
56 | 56 | self.loaded = set() |
|
57 | 57 | |
|
58 | 58 | @property |
|
59 | 59 | def ipython_extension_dir(self): |
|
60 | 60 | return os.path.join(self.shell.ipython_dir, u'extensions') |
|
61 | 61 | |
|
62 | 62 | def _on_ipython_dir_changed(self, change): |
|
63 | 63 | ensure_dir_exists(self.ipython_extension_dir) |
|
64 | 64 | |
|
65 | 65 | def load_extension(self, module_str): |
|
66 | 66 | """Load an IPython extension by its module name. |
|
67 | 67 | |
|
68 | 68 | Returns the string "already loaded" if the extension is already loaded, |
|
69 | 69 | "no load function" if the module doesn't have a load_ipython_extension |
|
70 | 70 | function, or None if it succeeded. |
|
71 | 71 | """ |
|
72 | 72 | if module_str in self.loaded: |
|
73 | 73 | return "already loaded" |
|
74 | 74 | |
|
75 | 75 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
76 | 76 | |
|
77 | 77 | with self.shell.builtin_trap: |
|
78 | 78 | if module_str not in sys.modules: |
|
79 | 79 | with prepended_to_syspath(self.ipython_extension_dir): |
|
80 | 80 | mod = import_module(module_str) |
|
81 | 81 | if mod.__file__.startswith(self.ipython_extension_dir): |
|
82 | 82 | print(("Loading extensions from {dir} is deprecated. " |
|
83 | 83 | "We recommend managing extensions like any " |
|
84 | 84 | "other Python packages, in site-packages.").format( |
|
85 | 85 | dir=compress_user(self.ipython_extension_dir))) |
|
86 | 86 | mod = sys.modules[module_str] |
|
87 | 87 | if self._call_load_ipython_extension(mod): |
|
88 | 88 | self.loaded.add(module_str) |
|
89 | 89 | else: |
|
90 | 90 | return "no load function" |
|
91 | 91 | |
|
92 | 92 | def unload_extension(self, module_str): |
|
93 | 93 | """Unload an IPython extension by its module name. |
|
94 | 94 | |
|
95 | 95 | This function looks up the extension's name in ``sys.modules`` and |
|
96 | 96 | simply calls ``mod.unload_ipython_extension(self)``. |
|
97 | ||
|
97 | ||
|
98 | 98 | Returns the string "no unload function" if the extension doesn't define |
|
99 | 99 | a function to unload itself, "not loaded" if the extension isn't loaded, |
|
100 | 100 | otherwise None. |
|
101 | 101 | """ |
|
102 | 102 | if module_str not in self.loaded: |
|
103 | 103 | return "not loaded" |
|
104 | 104 | |
|
105 | 105 | if module_str in sys.modules: |
|
106 | 106 | mod = sys.modules[module_str] |
|
107 | 107 | if self._call_unload_ipython_extension(mod): |
|
108 | 108 | self.loaded.discard(module_str) |
|
109 | 109 | else: |
|
110 | 110 | return "no unload function" |
|
111 | 111 | |
|
112 | 112 | def reload_extension(self, module_str): |
|
113 | 113 | """Reload an IPython extension by calling reload. |
|
114 | 114 | |
|
115 | 115 | If the module has not been loaded before, |
|
116 | 116 | :meth:`InteractiveShell.load_extension` is called. Otherwise |
|
117 | 117 | :func:`reload` is called and then the :func:`load_ipython_extension` |
|
118 | 118 | function of the module, if it exists is called. |
|
119 | 119 | """ |
|
120 | 120 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
121 | 121 | |
|
122 | 122 | if (module_str in self.loaded) and (module_str in sys.modules): |
|
123 | 123 | self.unload_extension(module_str) |
|
124 | 124 | mod = sys.modules[module_str] |
|
125 | 125 | with prepended_to_syspath(self.ipython_extension_dir): |
|
126 | 126 | reload(mod) |
|
127 | 127 | if self._call_load_ipython_extension(mod): |
|
128 | 128 | self.loaded.add(module_str) |
|
129 | 129 | else: |
|
130 | 130 | self.load_extension(module_str) |
|
131 | 131 | |
|
132 | 132 | def _call_load_ipython_extension(self, mod): |
|
133 | 133 | if hasattr(mod, 'load_ipython_extension'): |
|
134 | 134 | mod.load_ipython_extension(self.shell) |
|
135 | 135 | return True |
|
136 | 136 | |
|
137 | 137 | def _call_unload_ipython_extension(self, mod): |
|
138 | 138 | if hasattr(mod, 'unload_ipython_extension'): |
|
139 | 139 | mod.unload_ipython_extension(self.shell) |
|
140 | 140 | return True |
|
141 | 141 | |
|
142 | 142 | @undoc |
|
143 | 143 | def install_extension(self, url, filename=None): |
|
144 | 144 | """ |
|
145 | 145 | Deprecated. |
|
146 | 146 | """ |
|
147 | 147 | # Ensure the extension directory exists |
|
148 | 148 | raise DeprecationWarning( |
|
149 | 149 | '`install_extension` and the `install_ext` magic have been deprecated since IPython 4.0' |
|
150 | 150 | 'Use pip or other package managers to manage ipython extensions.') |
@@ -1,1028 +1,1026 | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | # Copyright (c) IPython Development Team. |
|
11 | 11 | # Distributed under the terms of the Modified BSD License. |
|
12 | 12 | |
|
13 | 13 | import abc |
|
14 | 14 | import json |
|
15 | 15 | import sys |
|
16 | 16 | import traceback |
|
17 | 17 | import warnings |
|
18 | 18 | from io import StringIO |
|
19 | 19 | |
|
20 | 20 | from decorator import decorator |
|
21 | 21 | |
|
22 | 22 | from traitlets.config.configurable import Configurable |
|
23 | 23 | from .getipython import get_ipython |
|
24 | 24 | from ..utils.sentinel import Sentinel |
|
25 | 25 | from ..utils.dir2 import get_real_method |
|
26 | 26 | from ..lib import pretty |
|
27 | 27 | from traitlets import ( |
|
28 | 28 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
29 | 29 | ForwardDeclaredInstance, |
|
30 | 30 | default, observe, |
|
31 | 31 | ) |
|
32 | 32 | |
|
33 | 33 | |
|
34 | 34 | class DisplayFormatter(Configurable): |
|
35 | 35 | |
|
36 | 36 | active_types = List(Unicode(), |
|
37 | 37 | help="""List of currently active mime-types to display. |
|
38 | 38 | You can use this to set a white-list for formats to display. |
|
39 | 39 | |
|
40 | 40 | Most users will not need to change this value. |
|
41 | 41 | """).tag(config=True) |
|
42 | 42 | |
|
43 | 43 | @default('active_types') |
|
44 | 44 | def _active_types_default(self): |
|
45 | 45 | return self.format_types |
|
46 | 46 | |
|
47 | 47 | @observe('active_types') |
|
48 | 48 | def _active_types_changed(self, change): |
|
49 | 49 | for key, formatter in self.formatters.items(): |
|
50 | 50 | if key in change['new']: |
|
51 | 51 | formatter.enabled = True |
|
52 | 52 | else: |
|
53 | 53 | formatter.enabled = False |
|
54 | 54 | |
|
55 | 55 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') |
|
56 | 56 | @default('ipython_display_formatter') |
|
57 | 57 | def _default_formatter(self): |
|
58 | 58 | return IPythonDisplayFormatter(parent=self) |
|
59 | 59 | |
|
60 | 60 | mimebundle_formatter = ForwardDeclaredInstance('FormatterABC') |
|
61 | 61 | @default('mimebundle_formatter') |
|
62 | 62 | def _default_mime_formatter(self): |
|
63 | 63 | return MimeBundleFormatter(parent=self) |
|
64 | 64 | |
|
65 | 65 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
66 | 66 | # values are subclasses of BaseFormatter. |
|
67 | 67 | formatters = Dict() |
|
68 | 68 | @default('formatters') |
|
69 | 69 | def _formatters_default(self): |
|
70 | 70 | """Activate the default formatters.""" |
|
71 | 71 | formatter_classes = [ |
|
72 | 72 | PlainTextFormatter, |
|
73 | 73 | HTMLFormatter, |
|
74 | 74 | MarkdownFormatter, |
|
75 | 75 | SVGFormatter, |
|
76 | 76 | PNGFormatter, |
|
77 | 77 | PDFFormatter, |
|
78 | 78 | JPEGFormatter, |
|
79 | 79 | LatexFormatter, |
|
80 | 80 | JSONFormatter, |
|
81 | 81 | JavascriptFormatter |
|
82 | 82 | ] |
|
83 | 83 | d = {} |
|
84 | 84 | for cls in formatter_classes: |
|
85 | 85 | f = cls(parent=self) |
|
86 | 86 | d[f.format_type] = f |
|
87 | 87 | return d |
|
88 | 88 | |
|
89 | 89 | def format(self, obj, include=None, exclude=None): |
|
90 | 90 | """Return a format data dict for an object. |
|
91 | 91 | |
|
92 | 92 | By default all format types will be computed. |
|
93 | 93 | |
|
94 | 94 | The following MIME types are usually implemented: |
|
95 | 95 | |
|
96 | 96 | * text/plain |
|
97 | 97 | * text/html |
|
98 | 98 | * text/markdown |
|
99 | 99 | * text/latex |
|
100 | 100 | * application/json |
|
101 | 101 | * application/javascript |
|
102 | 102 | * application/pdf |
|
103 | 103 | * image/png |
|
104 | 104 | * image/jpeg |
|
105 | 105 | * image/svg+xml |
|
106 | 106 | |
|
107 | 107 | Parameters |
|
108 | 108 | ---------- |
|
109 | 109 | obj : object |
|
110 | 110 | The Python object whose format data will be computed. |
|
111 | 111 | include : list, tuple or set; optional |
|
112 | 112 | A list of format type strings (MIME types) to include in the |
|
113 | 113 | format data dict. If this is set *only* the format types included |
|
114 | 114 | in this list will be computed. |
|
115 | 115 | exclude : list, tuple or set; optional |
|
116 | 116 | A list of format type string (MIME types) to exclude in the format |
|
117 | 117 | data dict. If this is set all format types will be computed, |
|
118 | 118 | except for those included in this argument. |
|
119 | 119 | Mimetypes present in exclude will take precedence over the ones in include |
|
120 | 120 | |
|
121 | 121 | Returns |
|
122 | 122 | ------- |
|
123 | 123 | (format_dict, metadata_dict) : tuple of two dicts |
|
124 | ||
|
125 | 124 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
126 | 125 | generated for the object. The keys are the format types, which |
|
127 | 126 | will usually be MIME type strings and the values and JSON'able |
|
128 | 127 | data structure containing the raw data for the representation in |
|
129 | 128 | that format. |
|
130 | ||
|
129 | ||
|
131 | 130 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
132 | 131 | Its keys will be a strict subset of the keys in format_dict. |
|
133 | 132 | |
|
134 | 133 | Notes |
|
135 | 134 | ----- |
|
136 | ||
|
137 | 135 | If an object implement `_repr_mimebundle_` as well as various |
|
138 | 136 | `_repr_*_`, the data returned by `_repr_mimebundle_` will take |
|
139 | 137 | precedence and the corresponding `_repr_*_` for this mimetype will |
|
140 | 138 | not be called. |
|
141 | 139 | |
|
142 | 140 | """ |
|
143 | 141 | format_dict = {} |
|
144 | 142 | md_dict = {} |
|
145 | 143 | |
|
146 | 144 | if self.ipython_display_formatter(obj): |
|
147 | 145 | # object handled itself, don't proceed |
|
148 | 146 | return {}, {} |
|
149 | 147 | |
|
150 | 148 | format_dict, md_dict = self.mimebundle_formatter(obj, include=include, exclude=exclude) |
|
151 | 149 | |
|
152 | 150 | if format_dict or md_dict: |
|
153 | 151 | if include: |
|
154 | 152 | format_dict = {k:v for k,v in format_dict.items() if k in include} |
|
155 | 153 | md_dict = {k:v for k,v in md_dict.items() if k in include} |
|
156 | 154 | if exclude: |
|
157 | 155 | format_dict = {k:v for k,v in format_dict.items() if k not in exclude} |
|
158 | 156 | md_dict = {k:v for k,v in md_dict.items() if k not in exclude} |
|
159 | 157 | |
|
160 | 158 | for format_type, formatter in self.formatters.items(): |
|
161 | 159 | if format_type in format_dict: |
|
162 | 160 | # already got it from mimebundle, maybe don't render again. |
|
163 | 161 | # exception: manually registered per-mime renderer |
|
164 | 162 | # check priority: |
|
165 | 163 | # 1. user-registered per-mime formatter |
|
166 | 164 | # 2. mime-bundle (user-registered or repr method) |
|
167 | 165 | # 3. default per-mime formatter (e.g. repr method) |
|
168 | 166 | try: |
|
169 | 167 | formatter.lookup(obj) |
|
170 | 168 | except KeyError: |
|
171 | 169 | # no special formatter, use mime-bundle-provided value |
|
172 | 170 | continue |
|
173 | 171 | if include and format_type not in include: |
|
174 | 172 | continue |
|
175 | 173 | if exclude and format_type in exclude: |
|
176 | 174 | continue |
|
177 | 175 | |
|
178 | 176 | md = None |
|
179 | 177 | try: |
|
180 | 178 | data = formatter(obj) |
|
181 | 179 | except: |
|
182 | 180 | # FIXME: log the exception |
|
183 | 181 | raise |
|
184 | 182 | |
|
185 | 183 | # formatters can return raw data or (data, metadata) |
|
186 | 184 | if isinstance(data, tuple) and len(data) == 2: |
|
187 | 185 | data, md = data |
|
188 | 186 | |
|
189 | 187 | if data is not None: |
|
190 | 188 | format_dict[format_type] = data |
|
191 | 189 | if md is not None: |
|
192 | 190 | md_dict[format_type] = md |
|
193 | 191 | return format_dict, md_dict |
|
194 | 192 | |
|
195 | 193 | @property |
|
196 | 194 | def format_types(self): |
|
197 | 195 | """Return the format types (MIME types) of the active formatters.""" |
|
198 | 196 | return list(self.formatters.keys()) |
|
199 | 197 | |
|
200 | 198 | |
|
201 | 199 | #----------------------------------------------------------------------------- |
|
202 | 200 | # Formatters for specific format types (text, html, svg, etc.) |
|
203 | 201 | #----------------------------------------------------------------------------- |
|
204 | 202 | |
|
205 | 203 | |
|
206 | 204 | def _safe_repr(obj): |
|
207 | 205 | """Try to return a repr of an object |
|
208 | 206 | |
|
209 | 207 | always returns a string, at least. |
|
210 | 208 | """ |
|
211 | 209 | try: |
|
212 | 210 | return repr(obj) |
|
213 | 211 | except Exception as e: |
|
214 | 212 | return "un-repr-able object (%r)" % e |
|
215 | 213 | |
|
216 | 214 | |
|
217 | 215 | class FormatterWarning(UserWarning): |
|
218 | 216 | """Warning class for errors in formatters""" |
|
219 | 217 | |
|
220 | 218 | @decorator |
|
221 | 219 | def catch_format_error(method, self, *args, **kwargs): |
|
222 | 220 | """show traceback on failed format call""" |
|
223 | 221 | try: |
|
224 | 222 | r = method(self, *args, **kwargs) |
|
225 | 223 | except NotImplementedError: |
|
226 | 224 | # don't warn on NotImplementedErrors |
|
227 | 225 | return self._check_return(None, args[0]) |
|
228 | 226 | except Exception: |
|
229 | 227 | exc_info = sys.exc_info() |
|
230 | 228 | ip = get_ipython() |
|
231 | 229 | if ip is not None: |
|
232 | 230 | ip.showtraceback(exc_info) |
|
233 | 231 | else: |
|
234 | 232 | traceback.print_exception(*exc_info) |
|
235 | 233 | return self._check_return(None, args[0]) |
|
236 | 234 | return self._check_return(r, args[0]) |
|
237 | 235 | |
|
238 | 236 | |
|
239 | 237 | class FormatterABC(metaclass=abc.ABCMeta): |
|
240 | 238 | """ Abstract base class for Formatters. |
|
241 | 239 | |
|
242 | 240 | A formatter is a callable class that is responsible for computing the |
|
243 | 241 | raw format data for a particular format type (MIME type). For example, |
|
244 | 242 | an HTML formatter would have a format type of `text/html` and would return |
|
245 | 243 | the HTML representation of the object when called. |
|
246 | 244 | """ |
|
247 | 245 | |
|
248 | 246 | # The format type of the data returned, usually a MIME type. |
|
249 | 247 | format_type = 'text/plain' |
|
250 | 248 | |
|
251 | 249 | # Is the formatter enabled... |
|
252 | 250 | enabled = True |
|
253 | 251 | |
|
254 | 252 | @abc.abstractmethod |
|
255 | 253 | def __call__(self, obj): |
|
256 | 254 | """Return a JSON'able representation of the object. |
|
257 | 255 | |
|
258 | 256 | If the object cannot be formatted by this formatter, |
|
259 | 257 | warn and return None. |
|
260 | 258 | """ |
|
261 | 259 | return repr(obj) |
|
262 | 260 | |
|
263 | 261 | |
|
264 | 262 | def _mod_name_key(typ): |
|
265 | 263 | """Return a (__module__, __name__) tuple for a type. |
|
266 | ||
|
264 | ||
|
267 | 265 | Used as key in Formatter.deferred_printers. |
|
268 | 266 | """ |
|
269 | 267 | module = getattr(typ, '__module__', None) |
|
270 | 268 | name = getattr(typ, '__name__', None) |
|
271 | 269 | return (module, name) |
|
272 | 270 | |
|
273 | 271 | |
|
274 | 272 | def _get_type(obj): |
|
275 | 273 | """Return the type of an instance (old and new-style)""" |
|
276 | 274 | return getattr(obj, '__class__', None) or type(obj) |
|
277 | 275 | |
|
278 | 276 | |
|
279 | 277 | _raise_key_error = Sentinel('_raise_key_error', __name__, |
|
280 | 278 | """ |
|
281 | 279 | Special value to raise a KeyError |
|
282 | 280 | |
|
283 | 281 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` |
|
284 | 282 | """) |
|
285 | 283 | |
|
286 | 284 | |
|
287 | 285 | class BaseFormatter(Configurable): |
|
288 | 286 | """A base formatter class that is configurable. |
|
289 | 287 | |
|
290 | 288 | This formatter should usually be used as the base class of all formatters. |
|
291 | 289 | It is a traited :class:`Configurable` class and includes an extensible |
|
292 | 290 | API for users to determine how their objects are formatted. The following |
|
293 | 291 | logic is used to find a function to format an given object. |
|
294 | 292 | |
|
295 | 293 | 1. The object is introspected to see if it has a method with the name |
|
296 | 294 | :attr:`print_method`. If is does, that object is passed to that method |
|
297 | 295 | for formatting. |
|
298 | 296 | 2. If no print method is found, three internal dictionaries are consulted |
|
299 | 297 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
300 | 298 | and :attr:`deferred_printers`. |
|
301 | 299 | |
|
302 | 300 | Users should use these dictionaries to register functions that will be |
|
303 | 301 | used to compute the format data for their objects (if those objects don't |
|
304 | 302 | have the special print methods). The easiest way of using these |
|
305 | 303 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
306 | 304 | methods. |
|
307 | 305 | |
|
308 | 306 | If no function/callable is found to compute the format data, ``None`` is |
|
309 | 307 | returned and this format type is not used. |
|
310 | 308 | """ |
|
311 | 309 | |
|
312 | 310 | format_type = Unicode('text/plain') |
|
313 | 311 | _return_type = str |
|
314 | 312 | |
|
315 | 313 | enabled = Bool(True).tag(config=True) |
|
316 | 314 | |
|
317 | 315 | print_method = ObjectName('__repr__') |
|
318 | 316 | |
|
319 | 317 | # The singleton printers. |
|
320 | 318 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
321 | 319 | singleton_printers = Dict().tag(config=True) |
|
322 | 320 | |
|
323 | 321 | # The type-specific printers. |
|
324 | 322 | # Map type objects to the format functions. |
|
325 | 323 | type_printers = Dict().tag(config=True) |
|
326 | 324 | |
|
327 | 325 | # The deferred-import type-specific printers. |
|
328 | 326 | # Map (modulename, classname) pairs to the format functions. |
|
329 | 327 | deferred_printers = Dict().tag(config=True) |
|
330 | 328 | |
|
331 | 329 | @catch_format_error |
|
332 | 330 | def __call__(self, obj): |
|
333 | 331 | """Compute the format for an object.""" |
|
334 | 332 | if self.enabled: |
|
335 | 333 | # lookup registered printer |
|
336 | 334 | try: |
|
337 | 335 | printer = self.lookup(obj) |
|
338 | 336 | except KeyError: |
|
339 | 337 | pass |
|
340 | 338 | else: |
|
341 | 339 | return printer(obj) |
|
342 | 340 | # Finally look for special method names |
|
343 | 341 | method = get_real_method(obj, self.print_method) |
|
344 | 342 | if method is not None: |
|
345 | 343 | return method() |
|
346 | 344 | return None |
|
347 | 345 | else: |
|
348 | 346 | return None |
|
349 | 347 | |
|
350 | 348 | def __contains__(self, typ): |
|
351 | 349 | """map in to lookup_by_type""" |
|
352 | 350 | try: |
|
353 | 351 | self.lookup_by_type(typ) |
|
354 | 352 | except KeyError: |
|
355 | 353 | return False |
|
356 | 354 | else: |
|
357 | 355 | return True |
|
358 | 356 | |
|
359 | 357 | def _check_return(self, r, obj): |
|
360 | 358 | """Check that a return value is appropriate |
|
361 | ||
|
359 | ||
|
362 | 360 | Return the value if so, None otherwise, warning if invalid. |
|
363 | 361 | """ |
|
364 | 362 | if r is None or isinstance(r, self._return_type) or \ |
|
365 | 363 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
366 | 364 | return r |
|
367 | 365 | else: |
|
368 | 366 | warnings.warn( |
|
369 | 367 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
370 | 368 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), |
|
371 | 369 | FormatterWarning |
|
372 | 370 | ) |
|
373 | 371 | |
|
374 | 372 | def lookup(self, obj): |
|
375 | 373 | """Look up the formatter for a given instance. |
|
376 | ||
|
374 | ||
|
377 | 375 | Parameters |
|
378 | 376 | ---------- |
|
379 |
obj |
|
|
377 | obj : object instance | |
|
380 | 378 | |
|
381 | 379 | Returns |
|
382 | 380 | ------- |
|
383 | 381 | f : callable |
|
384 | 382 | The registered formatting callable for the type. |
|
385 | 383 | |
|
386 | 384 | Raises |
|
387 | 385 | ------ |
|
388 | 386 | KeyError if the type has not been registered. |
|
389 | 387 | """ |
|
390 | 388 | # look for singleton first |
|
391 | 389 | obj_id = id(obj) |
|
392 | 390 | if obj_id in self.singleton_printers: |
|
393 | 391 | return self.singleton_printers[obj_id] |
|
394 | 392 | # then lookup by type |
|
395 | 393 | return self.lookup_by_type(_get_type(obj)) |
|
396 | 394 | |
|
397 | 395 | def lookup_by_type(self, typ): |
|
398 | 396 | """Look up the registered formatter for a type. |
|
399 | 397 | |
|
400 | 398 | Parameters |
|
401 | 399 | ---------- |
|
402 |
typ |
|
|
400 | typ : type or '__module__.__name__' string for a type | |
|
403 | 401 | |
|
404 | 402 | Returns |
|
405 | 403 | ------- |
|
406 | 404 | f : callable |
|
407 | 405 | The registered formatting callable for the type. |
|
408 | 406 | |
|
409 | 407 | Raises |
|
410 | 408 | ------ |
|
411 | 409 | KeyError if the type has not been registered. |
|
412 | 410 | """ |
|
413 | 411 | if isinstance(typ, str): |
|
414 | 412 | typ_key = tuple(typ.rsplit('.',1)) |
|
415 | 413 | if typ_key not in self.deferred_printers: |
|
416 | 414 | # We may have it cached in the type map. We will have to |
|
417 | 415 | # iterate over all of the types to check. |
|
418 | 416 | for cls in self.type_printers: |
|
419 | 417 | if _mod_name_key(cls) == typ_key: |
|
420 | 418 | return self.type_printers[cls] |
|
421 | 419 | else: |
|
422 | 420 | return self.deferred_printers[typ_key] |
|
423 | 421 | else: |
|
424 | 422 | for cls in pretty._get_mro(typ): |
|
425 | 423 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
426 | 424 | return self.type_printers[cls] |
|
427 | 425 | |
|
428 | 426 | # If we have reached here, the lookup failed. |
|
429 | 427 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
430 | 428 | |
|
431 | 429 | def for_type(self, typ, func=None): |
|
432 | 430 | """Add a format function for a given type. |
|
433 | ||
|
431 | ||
|
434 | 432 | Parameters |
|
435 | 433 | ---------- |
|
436 | 434 | typ : type or '__module__.__name__' string for a type |
|
437 | 435 | The class of the object that will be formatted using `func`. |
|
438 | 436 | func : callable |
|
439 | 437 | A callable for computing the format data. |
|
440 | 438 | `func` will be called with the object to be formatted, |
|
441 | 439 | and will return the raw data in this formatter's format. |
|
442 | 440 | Subclasses may use a different call signature for the |
|
443 | 441 | `func` argument. |
|
444 | ||
|
442 | ||
|
445 | 443 | If `func` is None or not specified, there will be no change, |
|
446 | 444 | only returning the current value. |
|
447 | ||
|
445 | ||
|
448 | 446 | Returns |
|
449 | 447 | ------- |
|
450 | 448 | oldfunc : callable |
|
451 | 449 | The currently registered callable. |
|
452 | 450 | If you are registering a new formatter, |
|
453 | 451 | this will be the previous value (to enable restoring later). |
|
454 | 452 | """ |
|
455 | 453 | # if string given, interpret as 'pkg.module.class_name' |
|
456 | 454 | if isinstance(typ, str): |
|
457 | 455 | type_module, type_name = typ.rsplit('.', 1) |
|
458 | 456 | return self.for_type_by_name(type_module, type_name, func) |
|
459 | 457 | |
|
460 | 458 | try: |
|
461 | 459 | oldfunc = self.lookup_by_type(typ) |
|
462 | 460 | except KeyError: |
|
463 | 461 | oldfunc = None |
|
464 | 462 | |
|
465 | 463 | if func is not None: |
|
466 | 464 | self.type_printers[typ] = func |
|
467 | 465 | |
|
468 | 466 | return oldfunc |
|
469 | 467 | |
|
470 | 468 | def for_type_by_name(self, type_module, type_name, func=None): |
|
471 | 469 | """Add a format function for a type specified by the full dotted |
|
472 | 470 | module and name of the type, rather than the type of the object. |
|
473 | 471 | |
|
474 | 472 | Parameters |
|
475 | 473 | ---------- |
|
476 | 474 | type_module : str |
|
477 | 475 | The full dotted name of the module the type is defined in, like |
|
478 | 476 | ``numpy``. |
|
479 | 477 | type_name : str |
|
480 | 478 | The name of the type (the class name), like ``dtype`` |
|
481 | 479 | func : callable |
|
482 | 480 | A callable for computing the format data. |
|
483 | 481 | `func` will be called with the object to be formatted, |
|
484 | 482 | and will return the raw data in this formatter's format. |
|
485 | 483 | Subclasses may use a different call signature for the |
|
486 | 484 | `func` argument. |
|
487 | ||
|
485 | ||
|
488 | 486 | If `func` is None or unspecified, there will be no change, |
|
489 | 487 | only returning the current value. |
|
490 | ||
|
488 | ||
|
491 | 489 | Returns |
|
492 | 490 | ------- |
|
493 | 491 | oldfunc : callable |
|
494 | 492 | The currently registered callable. |
|
495 | 493 | If you are registering a new formatter, |
|
496 | 494 | this will be the previous value (to enable restoring later). |
|
497 | 495 | """ |
|
498 | 496 | key = (type_module, type_name) |
|
499 | 497 | |
|
500 | 498 | try: |
|
501 | 499 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
502 | 500 | except KeyError: |
|
503 | 501 | oldfunc = None |
|
504 | 502 | |
|
505 | 503 | if func is not None: |
|
506 | 504 | self.deferred_printers[key] = func |
|
507 | 505 | return oldfunc |
|
508 | 506 | |
|
509 | 507 | def pop(self, typ, default=_raise_key_error): |
|
510 | 508 | """Pop a formatter for the given type. |
|
511 | 509 | |
|
512 | 510 | Parameters |
|
513 | 511 | ---------- |
|
514 | 512 | typ : type or '__module__.__name__' string for a type |
|
515 | 513 | default : object |
|
516 | 514 | value to be returned if no formatter is registered for typ. |
|
517 | 515 | |
|
518 | 516 | Returns |
|
519 | 517 | ------- |
|
520 | 518 | obj : object |
|
521 | 519 | The last registered object for the type. |
|
522 | 520 | |
|
523 | 521 | Raises |
|
524 | 522 | ------ |
|
525 | 523 | KeyError if the type is not registered and default is not specified. |
|
526 | 524 | """ |
|
527 | 525 | |
|
528 | 526 | if isinstance(typ, str): |
|
529 | 527 | typ_key = tuple(typ.rsplit('.',1)) |
|
530 | 528 | if typ_key not in self.deferred_printers: |
|
531 | 529 | # We may have it cached in the type map. We will have to |
|
532 | 530 | # iterate over all of the types to check. |
|
533 | 531 | for cls in self.type_printers: |
|
534 | 532 | if _mod_name_key(cls) == typ_key: |
|
535 | 533 | old = self.type_printers.pop(cls) |
|
536 | 534 | break |
|
537 | 535 | else: |
|
538 | 536 | old = default |
|
539 | 537 | else: |
|
540 | 538 | old = self.deferred_printers.pop(typ_key) |
|
541 | 539 | else: |
|
542 | 540 | if typ in self.type_printers: |
|
543 | 541 | old = self.type_printers.pop(typ) |
|
544 | 542 | else: |
|
545 | 543 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
546 | 544 | if old is _raise_key_error: |
|
547 | 545 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
548 | 546 | return old |
|
549 | 547 | |
|
550 | 548 | def _in_deferred_types(self, cls): |
|
551 | 549 | """ |
|
552 | 550 | Check if the given class is specified in the deferred type registry. |
|
553 | 551 | |
|
554 | 552 | Successful matches will be moved to the regular type registry for future use. |
|
555 | 553 | """ |
|
556 | 554 | mod = getattr(cls, '__module__', None) |
|
557 | 555 | name = getattr(cls, '__name__', None) |
|
558 | 556 | key = (mod, name) |
|
559 | 557 | if key in self.deferred_printers: |
|
560 | 558 | # Move the printer over to the regular registry. |
|
561 | 559 | printer = self.deferred_printers.pop(key) |
|
562 | 560 | self.type_printers[cls] = printer |
|
563 | 561 | return True |
|
564 | 562 | return False |
|
565 | 563 | |
|
566 | 564 | |
|
567 | 565 | class PlainTextFormatter(BaseFormatter): |
|
568 | 566 | """The default pretty-printer. |
|
569 | 567 | |
|
570 | 568 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
571 | 569 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
572 | 570 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
573 | 571 | how to write pretty printers. Here is a simple example:: |
|
574 | 572 | |
|
575 | 573 | def dtype_pprinter(obj, p, cycle): |
|
576 | 574 | if cycle: |
|
577 | 575 | return p.text('dtype(...)') |
|
578 | 576 | if hasattr(obj, 'fields'): |
|
579 | 577 | if obj.fields is None: |
|
580 | 578 | p.text(repr(obj)) |
|
581 | 579 | else: |
|
582 | 580 | p.begin_group(7, 'dtype([') |
|
583 | 581 | for i, field in enumerate(obj.descr): |
|
584 | 582 | if i > 0: |
|
585 | 583 | p.text(',') |
|
586 | 584 | p.breakable() |
|
587 | 585 | p.pretty(field) |
|
588 | 586 | p.end_group(7, '])') |
|
589 | 587 | """ |
|
590 | 588 | |
|
591 | 589 | # The format type of data returned. |
|
592 | 590 | format_type = Unicode('text/plain') |
|
593 | 591 | |
|
594 | 592 | # This subclass ignores this attribute as it always need to return |
|
595 | 593 | # something. |
|
596 | 594 | enabled = Bool(True).tag(config=False) |
|
597 | 595 | |
|
598 | 596 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, |
|
599 | 597 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
600 | 598 | |
|
601 | 599 | Set to 0 to disable truncation. |
|
602 | 600 | """ |
|
603 | 601 | ).tag(config=True) |
|
604 | 602 | |
|
605 | 603 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
606 | 604 | print_method = ObjectName('_repr_pretty_') |
|
607 | 605 | |
|
608 | 606 | # Whether to pretty-print or not. |
|
609 | 607 | pprint = Bool(True).tag(config=True) |
|
610 | 608 | |
|
611 | 609 | # Whether to be verbose or not. |
|
612 | 610 | verbose = Bool(False).tag(config=True) |
|
613 | 611 | |
|
614 | 612 | # The maximum width. |
|
615 | 613 | max_width = Integer(79).tag(config=True) |
|
616 | 614 | |
|
617 | 615 | # The newline character. |
|
618 | 616 | newline = Unicode('\n').tag(config=True) |
|
619 | 617 | |
|
620 | 618 | # format-string for pprinting floats |
|
621 | 619 | float_format = Unicode('%r') |
|
622 | 620 | # setter for float precision, either int or direct format-string |
|
623 | 621 | float_precision = CUnicode('').tag(config=True) |
|
624 | 622 | |
|
625 | 623 | @observe('float_precision') |
|
626 | 624 | def _float_precision_changed(self, change): |
|
627 | 625 | """float_precision changed, set float_format accordingly. |
|
628 | 626 | |
|
629 | 627 | float_precision can be set by int or str. |
|
630 | 628 | This will set float_format, after interpreting input. |
|
631 | 629 | If numpy has been imported, numpy print precision will also be set. |
|
632 | 630 | |
|
633 | 631 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
634 | 632 | |
|
635 | 633 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
636 | 634 | |
|
637 | 635 | This parameter can be set via the '%precision' magic. |
|
638 | 636 | """ |
|
639 | 637 | new = change['new'] |
|
640 | 638 | if '%' in new: |
|
641 | 639 | # got explicit format string |
|
642 | 640 | fmt = new |
|
643 | 641 | try: |
|
644 | 642 | fmt%3.14159 |
|
645 | 643 | except Exception as e: |
|
646 | 644 | raise ValueError("Precision must be int or format string, not %r"%new) from e |
|
647 | 645 | elif new: |
|
648 | 646 | # otherwise, should be an int |
|
649 | 647 | try: |
|
650 | 648 | i = int(new) |
|
651 | 649 | assert i >= 0 |
|
652 | 650 | except ValueError as e: |
|
653 | 651 | raise ValueError("Precision must be int or format string, not %r"%new) from e |
|
654 | 652 | except AssertionError as e: |
|
655 | 653 | raise ValueError("int precision must be non-negative, not %r"%i) from e |
|
656 | 654 | |
|
657 | 655 | fmt = '%%.%if'%i |
|
658 | 656 | if 'numpy' in sys.modules: |
|
659 | 657 | # set numpy precision if it has been imported |
|
660 | 658 | import numpy |
|
661 | 659 | numpy.set_printoptions(precision=i) |
|
662 | 660 | else: |
|
663 | 661 | # default back to repr |
|
664 | 662 | fmt = '%r' |
|
665 | 663 | if 'numpy' in sys.modules: |
|
666 | 664 | import numpy |
|
667 | 665 | # numpy default is 8 |
|
668 | 666 | numpy.set_printoptions(precision=8) |
|
669 | 667 | self.float_format = fmt |
|
670 | 668 | |
|
671 | 669 | # Use the default pretty printers from IPython.lib.pretty. |
|
672 | 670 | @default('singleton_printers') |
|
673 | 671 | def _singleton_printers_default(self): |
|
674 | 672 | return pretty._singleton_pprinters.copy() |
|
675 | 673 | |
|
676 | 674 | @default('type_printers') |
|
677 | 675 | def _type_printers_default(self): |
|
678 | 676 | d = pretty._type_pprinters.copy() |
|
679 | 677 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
680 | 678 | # if NumPy is used, set precision for its float64 type |
|
681 | 679 | if "numpy" in sys.modules: |
|
682 | 680 | import numpy |
|
683 | 681 | |
|
684 | 682 | d[numpy.float64] = lambda obj, p, cycle: p.text(self.float_format % obj) |
|
685 | 683 | return d |
|
686 | 684 | |
|
687 | 685 | @default('deferred_printers') |
|
688 | 686 | def _deferred_printers_default(self): |
|
689 | 687 | return pretty._deferred_type_pprinters.copy() |
|
690 | 688 | |
|
691 | 689 | #### FormatterABC interface #### |
|
692 | 690 | |
|
693 | 691 | @catch_format_error |
|
694 | 692 | def __call__(self, obj): |
|
695 | 693 | """Compute the pretty representation of the object.""" |
|
696 | 694 | if not self.pprint: |
|
697 | 695 | return repr(obj) |
|
698 | 696 | else: |
|
699 | 697 | stream = StringIO() |
|
700 | 698 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
701 | 699 | self.max_width, self.newline, |
|
702 | 700 | max_seq_length=self.max_seq_length, |
|
703 | 701 | singleton_pprinters=self.singleton_printers, |
|
704 | 702 | type_pprinters=self.type_printers, |
|
705 | 703 | deferred_pprinters=self.deferred_printers) |
|
706 | 704 | printer.pretty(obj) |
|
707 | 705 | printer.flush() |
|
708 | 706 | return stream.getvalue() |
|
709 | 707 | |
|
710 | 708 | |
|
711 | 709 | class HTMLFormatter(BaseFormatter): |
|
712 | 710 | """An HTML formatter. |
|
713 | 711 | |
|
714 | 712 | To define the callables that compute the HTML representation of your |
|
715 | 713 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
716 | 714 | or :meth:`for_type_by_name` methods to register functions that handle |
|
717 | 715 | this. |
|
718 | 716 | |
|
719 | 717 | The return value of this formatter should be a valid HTML snippet that |
|
720 | 718 | could be injected into an existing DOM. It should *not* include the |
|
721 | 719 | ```<html>`` or ```<body>`` tags. |
|
722 | 720 | """ |
|
723 | 721 | format_type = Unicode('text/html') |
|
724 | 722 | |
|
725 | 723 | print_method = ObjectName('_repr_html_') |
|
726 | 724 | |
|
727 | 725 | |
|
728 | 726 | class MarkdownFormatter(BaseFormatter): |
|
729 | 727 | """A Markdown formatter. |
|
730 | 728 | |
|
731 | 729 | To define the callables that compute the Markdown representation of your |
|
732 | 730 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
733 | 731 | or :meth:`for_type_by_name` methods to register functions that handle |
|
734 | 732 | this. |
|
735 | 733 | |
|
736 | 734 | The return value of this formatter should be a valid Markdown. |
|
737 | 735 | """ |
|
738 | 736 | format_type = Unicode('text/markdown') |
|
739 | 737 | |
|
740 | 738 | print_method = ObjectName('_repr_markdown_') |
|
741 | 739 | |
|
742 | 740 | class SVGFormatter(BaseFormatter): |
|
743 | 741 | """An SVG formatter. |
|
744 | 742 | |
|
745 | 743 | To define the callables that compute the SVG representation of your |
|
746 | 744 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
747 | 745 | or :meth:`for_type_by_name` methods to register functions that handle |
|
748 | 746 | this. |
|
749 | 747 | |
|
750 | 748 | The return value of this formatter should be valid SVG enclosed in |
|
751 | 749 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
752 | 750 | *not* include the ```<html>`` or ```<body>`` tags. |
|
753 | 751 | """ |
|
754 | 752 | format_type = Unicode('image/svg+xml') |
|
755 | 753 | |
|
756 | 754 | print_method = ObjectName('_repr_svg_') |
|
757 | 755 | |
|
758 | 756 | |
|
759 | 757 | class PNGFormatter(BaseFormatter): |
|
760 | 758 | """A PNG formatter. |
|
761 | 759 | |
|
762 | 760 | To define the callables that compute the PNG representation of your |
|
763 | 761 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
764 | 762 | or :meth:`for_type_by_name` methods to register functions that handle |
|
765 | 763 | this. |
|
766 | 764 | |
|
767 | 765 | The return value of this formatter should be raw PNG data, *not* |
|
768 | 766 | base64 encoded. |
|
769 | 767 | """ |
|
770 | 768 | format_type = Unicode('image/png') |
|
771 | 769 | |
|
772 | 770 | print_method = ObjectName('_repr_png_') |
|
773 | 771 | |
|
774 | 772 | _return_type = (bytes, str) |
|
775 | 773 | |
|
776 | 774 | |
|
777 | 775 | class JPEGFormatter(BaseFormatter): |
|
778 | 776 | """A JPEG formatter. |
|
779 | 777 | |
|
780 | 778 | To define the callables that compute the JPEG representation of your |
|
781 | 779 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
782 | 780 | or :meth:`for_type_by_name` methods to register functions that handle |
|
783 | 781 | this. |
|
784 | 782 | |
|
785 | 783 | The return value of this formatter should be raw JPEG data, *not* |
|
786 | 784 | base64 encoded. |
|
787 | 785 | """ |
|
788 | 786 | format_type = Unicode('image/jpeg') |
|
789 | 787 | |
|
790 | 788 | print_method = ObjectName('_repr_jpeg_') |
|
791 | 789 | |
|
792 | 790 | _return_type = (bytes, str) |
|
793 | 791 | |
|
794 | 792 | |
|
795 | 793 | class LatexFormatter(BaseFormatter): |
|
796 | 794 | """A LaTeX formatter. |
|
797 | 795 | |
|
798 | 796 | To define the callables that compute the LaTeX representation of your |
|
799 | 797 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
800 | 798 | or :meth:`for_type_by_name` methods to register functions that handle |
|
801 | 799 | this. |
|
802 | 800 | |
|
803 | 801 | The return value of this formatter should be a valid LaTeX equation, |
|
804 | 802 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
805 | 803 | environment. |
|
806 | 804 | """ |
|
807 | 805 | format_type = Unicode('text/latex') |
|
808 | 806 | |
|
809 | 807 | print_method = ObjectName('_repr_latex_') |
|
810 | 808 | |
|
811 | 809 | |
|
812 | 810 | class JSONFormatter(BaseFormatter): |
|
813 | 811 | """A JSON string formatter. |
|
814 | 812 | |
|
815 | 813 | To define the callables that compute the JSONable representation of |
|
816 | 814 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
817 | 815 | or :meth:`for_type_by_name` methods to register functions that handle |
|
818 | 816 | this. |
|
819 | 817 | |
|
820 | 818 | The return value of this formatter should be a JSONable list or dict. |
|
821 | 819 | JSON scalars (None, number, string) are not allowed, only dict or list containers. |
|
822 | 820 | """ |
|
823 | 821 | format_type = Unicode('application/json') |
|
824 | 822 | _return_type = (list, dict) |
|
825 | 823 | |
|
826 | 824 | print_method = ObjectName('_repr_json_') |
|
827 | 825 | |
|
828 | 826 | def _check_return(self, r, obj): |
|
829 | 827 | """Check that a return value is appropriate |
|
830 | ||
|
828 | ||
|
831 | 829 | Return the value if so, None otherwise, warning if invalid. |
|
832 | 830 | """ |
|
833 | 831 | if r is None: |
|
834 | 832 | return |
|
835 | 833 | md = None |
|
836 | 834 | if isinstance(r, tuple): |
|
837 | 835 | # unpack data, metadata tuple for type checking on first element |
|
838 | 836 | r, md = r |
|
839 | 837 | |
|
840 | 838 | # handle deprecated JSON-as-string form from IPython < 3 |
|
841 | 839 | if isinstance(r, str): |
|
842 | 840 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", |
|
843 | 841 | FormatterWarning) |
|
844 | 842 | r = json.loads(r) |
|
845 | 843 | |
|
846 | 844 | if md is not None: |
|
847 | 845 | # put the tuple back together |
|
848 | 846 | r = (r, md) |
|
849 | 847 | return super(JSONFormatter, self)._check_return(r, obj) |
|
850 | 848 | |
|
851 | 849 | |
|
852 | 850 | class JavascriptFormatter(BaseFormatter): |
|
853 | 851 | """A Javascript formatter. |
|
854 | 852 | |
|
855 | 853 | To define the callables that compute the Javascript representation of |
|
856 | 854 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
857 | 855 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
858 | 856 | that handle this. |
|
859 | 857 | |
|
860 | 858 | The return value of this formatter should be valid Javascript code and |
|
861 | 859 | should *not* be enclosed in ```<script>``` tags. |
|
862 | 860 | """ |
|
863 | 861 | format_type = Unicode('application/javascript') |
|
864 | 862 | |
|
865 | 863 | print_method = ObjectName('_repr_javascript_') |
|
866 | 864 | |
|
867 | 865 | |
|
868 | 866 | class PDFFormatter(BaseFormatter): |
|
869 | 867 | """A PDF formatter. |
|
870 | 868 | |
|
871 | 869 | To define the callables that compute the PDF representation of your |
|
872 | 870 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
873 | 871 | or :meth:`for_type_by_name` methods to register functions that handle |
|
874 | 872 | this. |
|
875 | 873 | |
|
876 | 874 | The return value of this formatter should be raw PDF data, *not* |
|
877 | 875 | base64 encoded. |
|
878 | 876 | """ |
|
879 | 877 | format_type = Unicode('application/pdf') |
|
880 | 878 | |
|
881 | 879 | print_method = ObjectName('_repr_pdf_') |
|
882 | 880 | |
|
883 | 881 | _return_type = (bytes, str) |
|
884 | 882 | |
|
885 | 883 | class IPythonDisplayFormatter(BaseFormatter): |
|
886 | 884 | """An escape-hatch Formatter for objects that know how to display themselves. |
|
887 | 885 | |
|
888 | 886 | To define the callables that compute the representation of your |
|
889 | 887 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` |
|
890 | 888 | or :meth:`for_type_by_name` methods to register functions that handle |
|
891 | 889 | this. Unlike mime-type displays, this method should not return anything, |
|
892 | 890 | instead calling any appropriate display methods itself. |
|
893 | 891 | |
|
894 | 892 | This display formatter has highest priority. |
|
895 | 893 | If it fires, no other display formatter will be called. |
|
896 | 894 | |
|
897 | 895 | Prior to IPython 6.1, `_ipython_display_` was the only way to display custom mime-types |
|
898 | 896 | without registering a new Formatter. |
|
899 | 897 | |
|
900 | 898 | IPython 6.1 introduces `_repr_mimebundle_` for displaying custom mime-types, |
|
901 | 899 | so `_ipython_display_` should only be used for objects that require unusual |
|
902 | 900 | display patterns, such as multiple display calls. |
|
903 | 901 | """ |
|
904 | 902 | print_method = ObjectName('_ipython_display_') |
|
905 | 903 | _return_type = (type(None), bool) |
|
906 | 904 | |
|
907 | 905 | @catch_format_error |
|
908 | 906 | def __call__(self, obj): |
|
909 | 907 | """Compute the format for an object.""" |
|
910 | 908 | if self.enabled: |
|
911 | 909 | # lookup registered printer |
|
912 | 910 | try: |
|
913 | 911 | printer = self.lookup(obj) |
|
914 | 912 | except KeyError: |
|
915 | 913 | pass |
|
916 | 914 | else: |
|
917 | 915 | printer(obj) |
|
918 | 916 | return True |
|
919 | 917 | # Finally look for special method names |
|
920 | 918 | method = get_real_method(obj, self.print_method) |
|
921 | 919 | if method is not None: |
|
922 | 920 | method() |
|
923 | 921 | return True |
|
924 | 922 | |
|
925 | 923 | |
|
926 | 924 | class MimeBundleFormatter(BaseFormatter): |
|
927 | 925 | """A Formatter for arbitrary mime-types. |
|
928 | 926 | |
|
929 | 927 | Unlike other `_repr_<mimetype>_` methods, |
|
930 | 928 | `_repr_mimebundle_` should return mime-bundle data, |
|
931 | 929 | either the mime-keyed `data` dictionary or the tuple `(data, metadata)`. |
|
932 | 930 | Any mime-type is valid. |
|
933 | 931 | |
|
934 | 932 | To define the callables that compute the mime-bundle representation of your |
|
935 | 933 | objects, define a :meth:`_repr_mimebundle_` method or use the :meth:`for_type` |
|
936 | 934 | or :meth:`for_type_by_name` methods to register functions that handle |
|
937 | 935 | this. |
|
938 | 936 | |
|
939 | 937 | .. versionadded:: 6.1 |
|
940 | 938 | """ |
|
941 | 939 | print_method = ObjectName('_repr_mimebundle_') |
|
942 | 940 | _return_type = dict |
|
943 | 941 | |
|
944 | 942 | def _check_return(self, r, obj): |
|
945 | 943 | r = super(MimeBundleFormatter, self)._check_return(r, obj) |
|
946 | 944 | # always return (data, metadata): |
|
947 | 945 | if r is None: |
|
948 | 946 | return {}, {} |
|
949 | 947 | if not isinstance(r, tuple): |
|
950 | 948 | return r, {} |
|
951 | 949 | return r |
|
952 | 950 | |
|
953 | 951 | @catch_format_error |
|
954 | 952 | def __call__(self, obj, include=None, exclude=None): |
|
955 | 953 | """Compute the format for an object. |
|
956 | 954 | |
|
957 | 955 | Identical to parent's method but we pass extra parameters to the method. |
|
958 | 956 | |
|
959 | 957 | Unlike other _repr_*_ `_repr_mimebundle_` should allow extra kwargs, in |
|
960 | 958 | particular `include` and `exclude`. |
|
961 | 959 | """ |
|
962 | 960 | if self.enabled: |
|
963 | 961 | # lookup registered printer |
|
964 | 962 | try: |
|
965 | 963 | printer = self.lookup(obj) |
|
966 | 964 | except KeyError: |
|
967 | 965 | pass |
|
968 | 966 | else: |
|
969 | 967 | return printer(obj) |
|
970 | 968 | # Finally look for special method names |
|
971 | 969 | method = get_real_method(obj, self.print_method) |
|
972 | 970 | |
|
973 | 971 | if method is not None: |
|
974 | 972 | return method(include=include, exclude=exclude) |
|
975 | 973 | return None |
|
976 | 974 | else: |
|
977 | 975 | return None |
|
978 | 976 | |
|
979 | 977 | |
|
980 | 978 | FormatterABC.register(BaseFormatter) |
|
981 | 979 | FormatterABC.register(PlainTextFormatter) |
|
982 | 980 | FormatterABC.register(HTMLFormatter) |
|
983 | 981 | FormatterABC.register(MarkdownFormatter) |
|
984 | 982 | FormatterABC.register(SVGFormatter) |
|
985 | 983 | FormatterABC.register(PNGFormatter) |
|
986 | 984 | FormatterABC.register(PDFFormatter) |
|
987 | 985 | FormatterABC.register(JPEGFormatter) |
|
988 | 986 | FormatterABC.register(LatexFormatter) |
|
989 | 987 | FormatterABC.register(JSONFormatter) |
|
990 | 988 | FormatterABC.register(JavascriptFormatter) |
|
991 | 989 | FormatterABC.register(IPythonDisplayFormatter) |
|
992 | 990 | FormatterABC.register(MimeBundleFormatter) |
|
993 | 991 | |
|
994 | 992 | |
|
995 | 993 | def format_display_data(obj, include=None, exclude=None): |
|
996 | 994 | """Return a format data dict for an object. |
|
997 | 995 | |
|
998 | 996 | By default all format types will be computed. |
|
999 | 997 | |
|
1000 | 998 | Parameters |
|
1001 | 999 | ---------- |
|
1002 | 1000 | obj : object |
|
1003 | 1001 | The Python object whose format data will be computed. |
|
1004 | 1002 | |
|
1005 | 1003 | Returns |
|
1006 | 1004 | ------- |
|
1007 | 1005 | format_dict : dict |
|
1008 | 1006 | A dictionary of key/value pairs, one or each format that was |
|
1009 | 1007 | generated for the object. The keys are the format types, which |
|
1010 | 1008 | will usually be MIME type strings and the values and JSON'able |
|
1011 | 1009 | data structure containing the raw data for the representation in |
|
1012 | 1010 | that format. |
|
1013 | 1011 | include : list or tuple, optional |
|
1014 | 1012 | A list of format type strings (MIME types) to include in the |
|
1015 | 1013 | format data dict. If this is set *only* the format types included |
|
1016 | 1014 | in this list will be computed. |
|
1017 | 1015 | exclude : list or tuple, optional |
|
1018 | 1016 | A list of format type string (MIME types) to exclude in the format |
|
1019 | 1017 | data dict. If this is set all format types will be computed, |
|
1020 | 1018 | except for those included in this argument. |
|
1021 | 1019 | """ |
|
1022 | 1020 | from .interactiveshell import InteractiveShell |
|
1023 | 1021 | |
|
1024 | 1022 | return InteractiveShell.instance().display_formatter.format( |
|
1025 | 1023 | obj, |
|
1026 | 1024 | include, |
|
1027 | 1025 | exclude |
|
1028 | 1026 | ) |
General Comments 0
You need to be logged in to leave comments.
Login now