Show More
@@ -0,0 +1,65 | |||||
|
1 | #!/usr/bin/env python | |||
|
2 | # encoding: utf-8 | |||
|
3 | """ | |||
|
4 | The main IPython application object | |||
|
5 | ||||
|
6 | Authors: | |||
|
7 | ||||
|
8 | * Brian Granger | |||
|
9 | * Fernando Perez | |||
|
10 | ||||
|
11 | Notes | |||
|
12 | ----- | |||
|
13 | """ | |||
|
14 | ||||
|
15 | #----------------------------------------------------------------------------- | |||
|
16 | # Copyright (C) 2008-2009 The IPython Development Team | |||
|
17 | # | |||
|
18 | # Distributed under the terms of the BSD License. The full license is in | |||
|
19 | # the file COPYING, distributed as part of this software. | |||
|
20 | #----------------------------------------------------------------------------- | |||
|
21 | ||||
|
22 | #----------------------------------------------------------------------------- | |||
|
23 | # Imports | |||
|
24 | #----------------------------------------------------------------------------- | |||
|
25 | ||||
|
26 | from IPython.core.application import Application | |||
|
27 | from IPython.core import release | |||
|
28 | from IPython.core.iplib import InteractiveShell | |||
|
29 | from IPython.config.loader import IPythonArgParseConfigLoader | |||
|
30 | ||||
|
31 | ipython_desc = """ | |||
|
32 | A Python shell with automatic history (input and output), dynamic object | |||
|
33 | introspection, easier configuration, command completion, access to the system | |||
|
34 | shell and more. | |||
|
35 | """ | |||
|
36 | ||||
|
37 | class IPythonAppCLConfigLoader(IPythonArgParseConfigLoader): | |||
|
38 | arguments = ( | |||
|
39 | () | |||
|
40 | ) | |||
|
41 | ||||
|
42 | class IPythonApp(Application): | |||
|
43 | name = 'ipython' | |||
|
44 | config_file_name = 'ipython_config.py' | |||
|
45 | ||||
|
46 | def create_command_line_config(self): | |||
|
47 | """Create and return a command line config loader.""" | |||
|
48 | return IPythonAppCLConfigLoader( | |||
|
49 | description=ipython_desc, | |||
|
50 | version=release.version) | |||
|
51 | ||||
|
52 | def construct(self): | |||
|
53 | self.shell = InteractiveShell( | |||
|
54 | name='__IP', | |||
|
55 | parent=None, | |||
|
56 | config=self.master_config | |||
|
57 | ) | |||
|
58 | ||||
|
59 | def start_app(self): | |||
|
60 | self.shell.mainloop() | |||
|
61 | ||||
|
62 | ||||
|
63 | if __name__ == '__main__': | |||
|
64 | app = IPythonApp() | |||
|
65 | app.start() No newline at end of file |
@@ -0,0 +1,219 | |||||
|
1 | # -*- coding: utf-8 -*- | |||
|
2 | """ | |||
|
3 | Main IPython Component | |||
|
4 | """ | |||
|
5 | ||||
|
6 | #----------------------------------------------------------------------------- | |||
|
7 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> | |||
|
8 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |||
|
9 | # Copyright (C) 2008-2009 The IPython Development Team | |||
|
10 | # | |||
|
11 | # Distributed under the terms of the BSD License. The full license is in | |||
|
12 | # the file COPYING, distributed as part of this software. | |||
|
13 | #----------------------------------------------------------------------------- | |||
|
14 | ||||
|
15 | #----------------------------------------------------------------------------- | |||
|
16 | # Imports | |||
|
17 | #----------------------------------------------------------------------------- | |||
|
18 | ||||
|
19 | import glob | |||
|
20 | import os | |||
|
21 | import shutil | |||
|
22 | import sys | |||
|
23 | ||||
|
24 | from IPython.utils.genutils import * | |||
|
25 | ||||
|
26 | def user_setup(ipythondir,rc_suffix,mode='install',interactive=True): | |||
|
27 | """Install or upgrade the user configuration directory. | |||
|
28 | ||||
|
29 | Can be called when running for the first time or to upgrade the user's | |||
|
30 | .ipython/ directory. | |||
|
31 | ||||
|
32 | Parameters | |||
|
33 | ---------- | |||
|
34 | ipythondir : path | |||
|
35 | The directory to be used for installation/upgrade. In 'install' mode, | |||
|
36 | if this path already exists, the function exits immediately. | |||
|
37 | ||||
|
38 | rc_suffix : str | |||
|
39 | Extension for the config files. On *nix platforms it is typically the | |||
|
40 | empty string, while Windows normally uses '.ini'. | |||
|
41 | ||||
|
42 | mode : str, optional | |||
|
43 | Valid modes are 'install' and 'upgrade'. | |||
|
44 | ||||
|
45 | interactive : bool, optional | |||
|
46 | If False, do not wait for user input on any errors. Normally after | |||
|
47 | printing its status information, this function waits for the user to | |||
|
48 | hit Return before proceeding. This is because the default use case is | |||
|
49 | when first installing the IPython configuration, so we want the user to | |||
|
50 | acknowledge the initial message, which contains some useful | |||
|
51 | information. | |||
|
52 | """ | |||
|
53 | ||||
|
54 | # For automatic use, deactivate all i/o | |||
|
55 | if interactive: | |||
|
56 | def wait(): | |||
|
57 | try: | |||
|
58 | raw_input("Please press <RETURN> to start IPython.") | |||
|
59 | except EOFError: | |||
|
60 | print >> Term.cout | |||
|
61 | print '*'*70 | |||
|
62 | ||||
|
63 | def printf(s): | |||
|
64 | print s | |||
|
65 | else: | |||
|
66 | wait = lambda : None | |||
|
67 | printf = lambda s : None | |||
|
68 | ||||
|
69 | # Install mode should be re-entrant: if the install dir already exists, | |||
|
70 | # bail out cleanly. | |||
|
71 | # XXX. This is too hasty to return. We need to check to make sure that | |||
|
72 | # all the expected config files and directories are actually there. We | |||
|
73 | # currently have a failure mode if someone deletes a needed config file | |||
|
74 | # but still has the ipythondir. | |||
|
75 | if mode == 'install' and os.path.isdir(ipythondir): | |||
|
76 | return | |||
|
77 | ||||
|
78 | cwd = os.getcwd() # remember where we started | |||
|
79 | glb = glob.glob | |||
|
80 | ||||
|
81 | printf('*'*70) | |||
|
82 | if mode == 'install': | |||
|
83 | printf( | |||
|
84 | """Welcome to IPython. I will try to create a personal configuration directory | |||
|
85 | where you can customize many aspects of IPython's functionality in:\n""") | |||
|
86 | else: | |||
|
87 | printf('I am going to upgrade your configuration in:') | |||
|
88 | ||||
|
89 | printf(ipythondir) | |||
|
90 | ||||
|
91 | rcdirend = os.path.join('IPython','config','userconfig') | |||
|
92 | cfg = lambda d: os.path.join(d,rcdirend) | |||
|
93 | try: | |||
|
94 | rcdir = filter(os.path.isdir,map(cfg,sys.path))[0] | |||
|
95 | printf("Initializing from configuration: %s" % rcdir) | |||
|
96 | except IndexError: | |||
|
97 | warning = """ | |||
|
98 | Installation error. IPython's directory was not found. | |||
|
99 | ||||
|
100 | Check the following: | |||
|
101 | ||||
|
102 | The ipython/IPython directory should be in a directory belonging to your | |||
|
103 | PYTHONPATH environment variable (that is, it should be in a directory | |||
|
104 | belonging to sys.path). You can copy it explicitly there or just link to it. | |||
|
105 | ||||
|
106 | IPython will create a minimal default configuration for you. | |||
|
107 | ||||
|
108 | """ | |||
|
109 | warn(warning) | |||
|
110 | wait() | |||
|
111 | ||||
|
112 | if sys.platform =='win32': | |||
|
113 | inif = 'ipythonrc.ini' | |||
|
114 | else: | |||
|
115 | inif = 'ipythonrc' | |||
|
116 | minimal_setup = {'ipy_user_conf.py' : 'import ipy_defaults', | |||
|
117 | inif : '# intentionally left blank' } | |||
|
118 | os.makedirs(ipythondir, mode = 0777) | |||
|
119 | for f, cont in minimal_setup.items(): | |||
|
120 | # In 2.5, this can be more cleanly done using 'with' | |||
|
121 | fobj = file(ipythondir + '/' + f,'w') | |||
|
122 | fobj.write(cont) | |||
|
123 | fobj.close() | |||
|
124 | ||||
|
125 | return | |||
|
126 | ||||
|
127 | if mode == 'install': | |||
|
128 | try: | |||
|
129 | shutil.copytree(rcdir,ipythondir) | |||
|
130 | os.chdir(ipythondir) | |||
|
131 | rc_files = glb("ipythonrc*") | |||
|
132 | for rc_file in rc_files: | |||
|
133 | os.rename(rc_file,rc_file+rc_suffix) | |||
|
134 | except: | |||
|
135 | warning = """ | |||
|
136 | ||||
|
137 | There was a problem with the installation: | |||
|
138 | %s | |||
|
139 | Try to correct it or contact the developers if you think it's a bug. | |||
|
140 | IPython will proceed with builtin defaults.""" % sys.exc_info()[1] | |||
|
141 | warn(warning) | |||
|
142 | wait() | |||
|
143 | return | |||
|
144 | ||||
|
145 | elif mode == 'upgrade': | |||
|
146 | try: | |||
|
147 | os.chdir(ipythondir) | |||
|
148 | except: | |||
|
149 | printf(""" | |||
|
150 | Can not upgrade: changing to directory %s failed. Details: | |||
|
151 | %s | |||
|
152 | """ % (ipythondir,sys.exc_info()[1]) ) | |||
|
153 | wait() | |||
|
154 | return | |||
|
155 | else: | |||
|
156 | sources = glb(os.path.join(rcdir,'[A-Za-z]*')) | |||
|
157 | for new_full_path in sources: | |||
|
158 | new_filename = os.path.basename(new_full_path) | |||
|
159 | if new_filename.startswith('ipythonrc'): | |||
|
160 | new_filename = new_filename + rc_suffix | |||
|
161 | # The config directory should only contain files, skip any | |||
|
162 | # directories which may be there (like CVS) | |||
|
163 | if os.path.isdir(new_full_path): | |||
|
164 | continue | |||
|
165 | if os.path.exists(new_filename): | |||
|
166 | old_file = new_filename+'.old' | |||
|
167 | if os.path.exists(old_file): | |||
|
168 | os.remove(old_file) | |||
|
169 | os.rename(new_filename,old_file) | |||
|
170 | shutil.copy(new_full_path,new_filename) | |||
|
171 | else: | |||
|
172 | raise ValueError('unrecognized mode for install: %r' % mode) | |||
|
173 | ||||
|
174 | # Fix line-endings to those native to each platform in the config | |||
|
175 | # directory. | |||
|
176 | try: | |||
|
177 | os.chdir(ipythondir) | |||
|
178 | except: | |||
|
179 | printf(""" | |||
|
180 | Problem: changing to directory %s failed. | |||
|
181 | Details: | |||
|
182 | %s | |||
|
183 | ||||
|
184 | Some configuration files may have incorrect line endings. This should not | |||
|
185 | cause any problems during execution. """ % (ipythondir,sys.exc_info()[1]) ) | |||
|
186 | wait() | |||
|
187 | else: | |||
|
188 | for fname in glb('ipythonrc*'): | |||
|
189 | try: | |||
|
190 | native_line_ends(fname,backup=0) | |||
|
191 | except IOError: | |||
|
192 | pass | |||
|
193 | ||||
|
194 | if mode == 'install': | |||
|
195 | printf(""" | |||
|
196 | Successful installation! | |||
|
197 | ||||
|
198 | Please read the sections 'Initial Configuration' and 'Quick Tips' in the | |||
|
199 | IPython manual (there are both HTML and PDF versions supplied with the | |||
|
200 | distribution) to make sure that your system environment is properly configured | |||
|
201 | to take advantage of IPython's features. | |||
|
202 | ||||
|
203 | Important note: the configuration system has changed! The old system is | |||
|
204 | still in place, but its setting may be partly overridden by the settings in | |||
|
205 | "~/.ipython/ipy_user_conf.py" config file. Please take a look at the file | |||
|
206 | if some of the new settings bother you. | |||
|
207 | ||||
|
208 | """) | |||
|
209 | else: | |||
|
210 | printf(""" | |||
|
211 | Successful upgrade! | |||
|
212 | ||||
|
213 | All files in your directory: | |||
|
214 | %(ipythondir)s | |||
|
215 | which would have been overwritten by the upgrade were backed up with a .old | |||
|
216 | extension. If you had made particular customizations in those files you may | |||
|
217 | want to merge them back into the new files.""" % locals() ) | |||
|
218 | wait() | |||
|
219 | os.chdir(cwd) No newline at end of file |
@@ -163,7 +163,7 class ArgParseConfigLoader(CommandLineConfigLoader): | |||||
163 | self._add_arguments() |
|
163 | self._add_arguments() | |
164 | self._add_other_arguments() |
|
164 | self._add_other_arguments() | |
165 |
|
165 | |||
166 | def _add_other_arguments(): |
|
166 | def _add_other_arguments(self): | |
167 | pass |
|
167 | pass | |
168 |
|
168 | |||
169 | def _add_arguments(self): |
|
169 | def _add_arguments(self): |
@@ -241,7 +241,7 class IPCompleter(Completer): | |||||
241 | self.get_line_buffer = self.readline.get_line_buffer |
|
241 | self.get_line_buffer = self.readline.get_line_buffer | |
242 | self.get_endidx = self.readline.get_endidx |
|
242 | self.get_endidx = self.readline.get_endidx | |
243 | self.omit__names = omit__names |
|
243 | self.omit__names = omit__names | |
244 |
self.merge_completions = shell. |
|
244 | self.merge_completions = shell.readline_merge_completions | |
245 | if alias_table is None: |
|
245 | if alias_table is None: | |
246 | alias_table = {} |
|
246 | alias_table = {} | |
247 | self.alias_table = alias_table |
|
247 | self.alias_table = alias_table |
@@ -124,7 +124,7 $self.bug_tracker | |||||
124 | #color_scheme = 'Linux' # dbg |
|
124 | #color_scheme = 'Linux' # dbg | |
125 |
|
125 | |||
126 | try: |
|
126 | try: | |
127 |
rptdir = self.IP. |
|
127 | rptdir = self.IP.config.IPYTHONDIR | |
128 | except: |
|
128 | except: | |
129 | rptdir = os.getcwd() |
|
129 | rptdir = os.getcwd() | |
130 | if not os.path.isdir(rptdir): |
|
130 | if not os.path.isdir(rptdir): | |
@@ -171,7 +171,7 $self.bug_tracker | |||||
171 | rpt_add('Platform info : os.name -> %s, sys.platform -> %s' % |
|
171 | rpt_add('Platform info : os.name -> %s, sys.platform -> %s' % | |
172 | (os.name,sys.platform) ) |
|
172 | (os.name,sys.platform) ) | |
173 | rpt_add(sec_sep+'Current user configuration structure:\n\n') |
|
173 | rpt_add(sec_sep+'Current user configuration structure:\n\n') | |
174 |
rpt_add(pformat(self.IP. |
|
174 | rpt_add(pformat(self.IP.dict())) | |
175 | rpt_add(sec_sep+'Crash traceback:\n\n' + traceback) |
|
175 | rpt_add(sec_sep+'Crash traceback:\n\n' + traceback) | |
176 | try: |
|
176 | try: | |
177 | rpt_add(sec_sep+"History of session input:") |
|
177 | rpt_add(sec_sep+"History of session input:") | |
@@ -215,7 +215,7 class IPythonCrashHandler(CrashHandler): | |||||
215 | rpt_add('Platform info : os.name -> %s, sys.platform -> %s' % |
|
215 | rpt_add('Platform info : os.name -> %s, sys.platform -> %s' % | |
216 | (os.name,sys.platform) ) |
|
216 | (os.name,sys.platform) ) | |
217 | rpt_add(sec_sep+'Current user configuration structure:\n\n') |
|
217 | rpt_add(sec_sep+'Current user configuration structure:\n\n') | |
218 |
rpt_add(pformat(self.IP. |
|
218 | rpt_add(pformat(self.IP.dict())) | |
219 | rpt_add(sec_sep+'Crash traceback:\n\n' + traceback) |
|
219 | rpt_add(sec_sep+'Crash traceback:\n\n' + traceback) | |
220 | try: |
|
220 | try: | |
221 | rpt_add(sec_sep+"History of session input:") |
|
221 | rpt_add(sec_sep+"History of session input:") |
@@ -69,7 +69,7 def editor(self,filename, linenum=None): | |||||
69 |
|
69 | |||
70 | # IPython configures a default editor at startup by reading $EDITOR from |
|
70 | # IPython configures a default editor at startup by reading $EDITOR from | |
71 | # the environment, and falling back on vi (unix) or notepad (win32). |
|
71 | # the environment, and falling back on vi (unix) or notepad (win32). | |
72 |
editor = self. |
|
72 | editor = self.editor | |
73 |
|
73 | |||
74 | # marker for at which line to open the file (for existing objects) |
|
74 | # marker for at which line to open the file (for existing objects) | |
75 | if linenum is None or editor=='notepad': |
|
75 | if linenum is None or editor=='notepad': | |
@@ -99,7 +99,7 def fix_error_editor(self,filename,linenum,column,msg): | |||||
99 | t.write('%s:%d:%d:%s\n' % (filename,linenum,column,msg)) |
|
99 | t.write('%s:%d:%d:%s\n' % (filename,linenum,column,msg)) | |
100 | t.flush() |
|
100 | t.flush() | |
101 | return t |
|
101 | return t | |
102 |
if os.path.basename(self. |
|
102 | if os.path.basename(self.editor) != 'vim': | |
103 | self.hooks.editor(filename,linenum) |
|
103 | self.hooks.editor(filename,linenum) | |
104 | return |
|
104 | return | |
105 | t = vim_quickfix_file() |
|
105 | t = vim_quickfix_file() | |
@@ -167,7 +167,7 def result_display(self,arg): | |||||
167 | Called for displaying the result to the user. |
|
167 | Called for displaying the result to the user. | |
168 | """ |
|
168 | """ | |
169 |
|
169 | |||
170 |
if self. |
|
170 | if self.pprint: | |
171 | out = pformat(arg) |
|
171 | out = pformat(arg) | |
172 | if '\n' in out: |
|
172 | if '\n' in out: | |
173 | # So that multi-line strings line up with the left column of |
|
173 | # So that multi-line strings line up with the left column of | |
@@ -226,7 +226,7 def generate_output_prompt(self): | |||||
226 | def shell_hook(self,cmd): |
|
226 | def shell_hook(self,cmd): | |
227 | """ Run system/shell command a'la os.system() """ |
|
227 | """ Run system/shell command a'la os.system() """ | |
228 |
|
228 | |||
229 |
shell(cmd, header=self. |
|
229 | shell(cmd, header=self.system_header, verbose=self.system_verbose) | |
230 |
|
230 | |||
231 | def show_in_pager(self,s): |
|
231 | def show_in_pager(self,s): | |
232 | """ Run a string through pager """ |
|
232 | """ Run a string through pager """ |
@@ -219,8 +219,7 class IPApi(object): | |||||
219 | # is in fact wanted (e.g. when exposing new options), do |
|
219 | # is in fact wanted (e.g. when exposing new options), do | |
220 | # allow_new_attr(True) for the received rc struct. |
|
220 | # allow_new_attr(True) for the received rc struct. | |
221 |
|
221 | |||
222 | self.IP.rc.allow_new_attr(False) |
|
222 | return self.IP | |
223 | return self.IP.rc |
|
|||
224 |
|
223 | |||
225 | options = property(get_options,None,None,get_options.__doc__) |
|
224 | options = property(get_options,None,None,get_options.__doc__) | |
226 |
|
225 | |||
@@ -609,7 +608,7 _make_user_ns = make_user_ns | |||||
609 | _make_user_global_ns = make_user_global_ns |
|
608 | _make_user_global_ns = make_user_global_ns | |
610 |
|
609 | |||
611 |
|
610 | |||
612 | def make_user_namespaces(user_ns = None,user_global_ns = None): |
|
611 | def make_user_namespaces(user_ns = None, user_global_ns = None): | |
613 | """Return a valid local and global user interactive namespaces. |
|
612 | """Return a valid local and global user interactive namespaces. | |
614 |
|
613 | |||
615 | This builds a dict with the minimal information needed to operate as a |
|
614 | This builds a dict with the minimal information needed to operate as a |
This diff has been collapsed as it changes many lines, (862 lines changed) Show them Hide them | |||||
@@ -1,32 +1,21 | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ |
|
2 | """ | |
3 | IPython -- An enhanced Interactive Python |
|
3 | Main IPython Component | |
4 |
|
||||
5 | Requires Python 2.4 or newer. |
|
|||
6 |
|
||||
7 | This file contains all the classes and helper functions specific to IPython. |
|
|||
8 | """ |
|
4 | """ | |
9 |
|
5 | |||
10 | #***************************************************************************** |
|
6 | #----------------------------------------------------------------------------- | |
11 |
# |
|
7 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> | |
12 |
# |
|
8 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |
|
9 | # Copyright (C) 2008-2009 The IPython Development Team | |||
13 | # |
|
10 | # | |
14 | # Distributed under the terms of the BSD License. The full license is in |
|
11 | # Distributed under the terms of the BSD License. The full license is in | |
15 | # the file COPYING, distributed as part of this software. |
|
12 | # the file COPYING, distributed as part of this software. | |
16 | # |
|
13 | #----------------------------------------------------------------------------- | |
17 | # Note: this code originally subclassed code.InteractiveConsole from the |
|
14 | ||
18 | # Python standard library. Over time, all of that class has been copied |
|
15 | #----------------------------------------------------------------------------- | |
19 | # verbatim here for modifications which could not be accomplished by |
|
16 | # Imports | |
20 | # subclassing. At this point, there are no dependencies at all on the code |
|
17 | #----------------------------------------------------------------------------- | |
21 | # module anymore (it is not even imported). The Python License (sec. 2) |
|
18 | ||
22 | # allows for this, but it's always nice to acknowledge credit where credit is |
|
|||
23 | # due. |
|
|||
24 | #***************************************************************************** |
|
|||
25 |
|
||||
26 | #**************************************************************************** |
|
|||
27 | # Modules and globals |
|
|||
28 |
|
||||
29 | # Python standard modules |
|
|||
30 | import __main__ |
|
19 | import __main__ | |
31 | import __builtin__ |
|
20 | import __builtin__ | |
32 | import StringIO |
|
21 | import StringIO | |
@@ -43,26 +32,36 import string | |||||
43 | import sys |
|
32 | import sys | |
44 | import tempfile |
|
33 | import tempfile | |
45 |
|
34 | |||
46 | # IPython's own modules |
|
|||
47 | #import IPython |
|
|||
48 | from IPython.core import ultratb |
|
35 | from IPython.core import ultratb | |
49 | from IPython.utils import PyColorize |
|
|||
50 | from IPython.core import debugger, oinspect |
|
36 | from IPython.core import debugger, oinspect | |
51 |
from IPython. |
|
37 | from IPython.core import ipapi | |
|
38 | from IPython.core import shadowns | |||
|
39 | from IPython.core import history as ipcorehist | |||
|
40 | from IPython.core import prefilter | |||
52 | from IPython.core.fakemodule import FakeModule, init_fakemod_dict |
|
41 | from IPython.core.fakemodule import FakeModule, init_fakemod_dict | |
53 | from IPython.external.Itpl import ItplNS |
|
|||
54 | from IPython.core.logger import Logger |
|
42 | from IPython.core.logger import Logger | |
55 | from IPython.core.magic import Magic |
|
43 | from IPython.core.magic import Magic | |
56 | from IPython.core.prompts import CachedOutput |
|
44 | from IPython.core.prompts import CachedOutput | |
57 | from IPython.utils.ipstruct import Struct |
|
45 | from IPython.core.component import Component | |
|
46 | from IPython.core.oldusersetup import user_setup | |||
|
47 | from IPython.core.usage import interactive_usage, banner_parts | |||
|
48 | ||||
|
49 | from IPython.extensions import pickleshare | |||
|
50 | from IPython.external.Itpl import ItplNS | |||
58 | from IPython.lib.backgroundjobs import BackgroundJobManager |
|
51 | from IPython.lib.backgroundjobs import BackgroundJobManager | |
|
52 | from IPython.utils.ipstruct import Struct | |||
|
53 | from IPython.utils import PyColorize | |||
59 | from IPython.utils.genutils import * |
|
54 | from IPython.utils.genutils import * | |
60 | from IPython.utils.strdispatch import StrDispatch |
|
55 | from IPython.utils.strdispatch import StrDispatch | |
61 | from IPython.core import ipapi |
|
56 | ||
62 | import IPython.core.history |
|
57 | from IPython.utils.traitlets import ( | |
63 | import IPython.core.prefilter as prefilter |
|
58 | Int, Float, Str, Bool | |
64 | from IPython.core import shadowns |
|
59 | ) | |
|
60 | ||||
|
61 | #----------------------------------------------------------------------------- | |||
65 | # Globals |
|
62 | # Globals | |
|
63 | #----------------------------------------------------------------------------- | |||
|
64 | ||||
66 |
|
65 | |||
67 | # store the builtin raw_input globally, and use this always, in case user code |
|
66 | # store the builtin raw_input globally, and use this always, in case user code | |
68 | # overwrites it (like wx.py.PyShell does) |
|
67 | # overwrites it (like wx.py.PyShell does) | |
@@ -72,11 +71,14 raw_input_original = raw_input | |||||
72 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
71 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') | |
73 |
|
72 | |||
74 |
|
73 | |||
75 | #**************************************************************************** |
|
74 | #----------------------------------------------------------------------------- | |
76 | # Some utility function definitions |
|
75 | # Utilities | |
|
76 | #----------------------------------------------------------------------------- | |||
|
77 | ||||
77 |
|
78 | |||
78 | ini_spaces_re = re.compile(r'^(\s+)') |
|
79 | ini_spaces_re = re.compile(r'^(\s+)') | |
79 |
|
80 | |||
|
81 | ||||
80 | def num_ini_spaces(strng): |
|
82 | def num_ini_spaces(strng): | |
81 | """Return the number of initial spaces in a string""" |
|
83 | """Return the number of initial spaces in a string""" | |
82 |
|
84 | |||
@@ -86,6 +88,7 def num_ini_spaces(strng): | |||||
86 | else: |
|
88 | else: | |
87 | return 0 |
|
89 | return 0 | |
88 |
|
90 | |||
|
91 | ||||
89 | def softspace(file, newvalue): |
|
92 | def softspace(file, newvalue): | |
90 | """Copied from code.py, to remove the dependency""" |
|
93 | """Copied from code.py, to remove the dependency""" | |
91 |
|
94 | |||
@@ -102,208 +105,8 def softspace(file, newvalue): | |||||
102 | return oldvalue |
|
105 | return oldvalue | |
103 |
|
106 | |||
104 |
|
107 | |||
105 | def user_setup(ipythondir,rc_suffix,mode='install',interactive=True): |
|
|||
106 | """Install or upgrade the user configuration directory. |
|
|||
107 |
|
||||
108 | Can be called when running for the first time or to upgrade the user's |
|
|||
109 | .ipython/ directory. |
|
|||
110 |
|
||||
111 | Parameters |
|
|||
112 | ---------- |
|
|||
113 | ipythondir : path |
|
|||
114 | The directory to be used for installation/upgrade. In 'install' mode, |
|
|||
115 | if this path already exists, the function exits immediately. |
|
|||
116 |
|
||||
117 | rc_suffix : str |
|
|||
118 | Extension for the config files. On *nix platforms it is typically the |
|
|||
119 | empty string, while Windows normally uses '.ini'. |
|
|||
120 |
|
||||
121 | mode : str, optional |
|
|||
122 | Valid modes are 'install' and 'upgrade'. |
|
|||
123 |
|
||||
124 | interactive : bool, optional |
|
|||
125 | If False, do not wait for user input on any errors. Normally after |
|
|||
126 | printing its status information, this function waits for the user to |
|
|||
127 | hit Return before proceeding. This is because the default use case is |
|
|||
128 | when first installing the IPython configuration, so we want the user to |
|
|||
129 | acknowledge the initial message, which contains some useful |
|
|||
130 | information. |
|
|||
131 | """ |
|
|||
132 |
|
||||
133 | # For automatic use, deactivate all i/o |
|
|||
134 | if interactive: |
|
|||
135 | def wait(): |
|
|||
136 | try: |
|
|||
137 | raw_input("Please press <RETURN> to start IPython.") |
|
|||
138 | except EOFError: |
|
|||
139 | print >> Term.cout |
|
|||
140 | print '*'*70 |
|
|||
141 |
|
||||
142 | def printf(s): |
|
|||
143 | print s |
|
|||
144 | else: |
|
|||
145 | wait = lambda : None |
|
|||
146 | printf = lambda s : None |
|
|||
147 |
|
||||
148 | # Install mode should be re-entrant: if the install dir already exists, |
|
|||
149 | # bail out cleanly. |
|
|||
150 | # XXX. This is too hasty to return. We need to check to make sure that |
|
|||
151 | # all the expected config files and directories are actually there. We |
|
|||
152 | # currently have a failure mode if someone deletes a needed config file |
|
|||
153 | # but still has the ipythondir. |
|
|||
154 | if mode == 'install' and os.path.isdir(ipythondir): |
|
|||
155 | return |
|
|||
156 |
|
||||
157 | cwd = os.getcwd() # remember where we started |
|
|||
158 | glb = glob.glob |
|
|||
159 |
|
||||
160 | printf('*'*70) |
|
|||
161 | if mode == 'install': |
|
|||
162 | printf( |
|
|||
163 | """Welcome to IPython. I will try to create a personal configuration directory |
|
|||
164 | where you can customize many aspects of IPython's functionality in:\n""") |
|
|||
165 | else: |
|
|||
166 | printf('I am going to upgrade your configuration in:') |
|
|||
167 |
|
||||
168 | printf(ipythondir) |
|
|||
169 |
|
||||
170 | rcdirend = os.path.join('IPython','config','userconfig') |
|
|||
171 | cfg = lambda d: os.path.join(d,rcdirend) |
|
|||
172 | try: |
|
|||
173 | rcdir = filter(os.path.isdir,map(cfg,sys.path))[0] |
|
|||
174 | printf("Initializing from configuration: %s" % rcdir) |
|
|||
175 | except IndexError: |
|
|||
176 | warning = """ |
|
|||
177 | Installation error. IPython's directory was not found. |
|
|||
178 |
|
||||
179 | Check the following: |
|
|||
180 |
|
||||
181 | The ipython/IPython directory should be in a directory belonging to your |
|
|||
182 | PYTHONPATH environment variable (that is, it should be in a directory |
|
|||
183 | belonging to sys.path). You can copy it explicitly there or just link to it. |
|
|||
184 |
|
||||
185 | IPython will create a minimal default configuration for you. |
|
|||
186 |
|
||||
187 | """ |
|
|||
188 | warn(warning) |
|
|||
189 | wait() |
|
|||
190 |
|
||||
191 | if sys.platform =='win32': |
|
|||
192 | inif = 'ipythonrc.ini' |
|
|||
193 | else: |
|
|||
194 | inif = 'ipythonrc' |
|
|||
195 | minimal_setup = {'ipy_user_conf.py' : 'import ipy_defaults', |
|
|||
196 | inif : '# intentionally left blank' } |
|
|||
197 | os.makedirs(ipythondir, mode = 0777) |
|
|||
198 | for f, cont in minimal_setup.items(): |
|
|||
199 | # In 2.5, this can be more cleanly done using 'with' |
|
|||
200 | fobj = file(ipythondir + '/' + f,'w') |
|
|||
201 | fobj.write(cont) |
|
|||
202 | fobj.close() |
|
|||
203 |
|
||||
204 | return |
|
|||
205 |
|
||||
206 | if mode == 'install': |
|
|||
207 | try: |
|
|||
208 | shutil.copytree(rcdir,ipythondir) |
|
|||
209 | os.chdir(ipythondir) |
|
|||
210 | rc_files = glb("ipythonrc*") |
|
|||
211 | for rc_file in rc_files: |
|
|||
212 | os.rename(rc_file,rc_file+rc_suffix) |
|
|||
213 | except: |
|
|||
214 | warning = """ |
|
|||
215 |
|
||||
216 | There was a problem with the installation: |
|
|||
217 | %s |
|
|||
218 | Try to correct it or contact the developers if you think it's a bug. |
|
|||
219 | IPython will proceed with builtin defaults.""" % sys.exc_info()[1] |
|
|||
220 | warn(warning) |
|
|||
221 | wait() |
|
|||
222 | return |
|
|||
223 |
|
||||
224 | elif mode == 'upgrade': |
|
|||
225 | try: |
|
|||
226 | os.chdir(ipythondir) |
|
|||
227 | except: |
|
|||
228 | printf(""" |
|
|||
229 | Can not upgrade: changing to directory %s failed. Details: |
|
|||
230 | %s |
|
|||
231 | """ % (ipythondir,sys.exc_info()[1]) ) |
|
|||
232 | wait() |
|
|||
233 | return |
|
|||
234 | else: |
|
|||
235 | sources = glb(os.path.join(rcdir,'[A-Za-z]*')) |
|
|||
236 | for new_full_path in sources: |
|
|||
237 | new_filename = os.path.basename(new_full_path) |
|
|||
238 | if new_filename.startswith('ipythonrc'): |
|
|||
239 | new_filename = new_filename + rc_suffix |
|
|||
240 | # The config directory should only contain files, skip any |
|
|||
241 | # directories which may be there (like CVS) |
|
|||
242 | if os.path.isdir(new_full_path): |
|
|||
243 | continue |
|
|||
244 | if os.path.exists(new_filename): |
|
|||
245 | old_file = new_filename+'.old' |
|
|||
246 | if os.path.exists(old_file): |
|
|||
247 | os.remove(old_file) |
|
|||
248 | os.rename(new_filename,old_file) |
|
|||
249 | shutil.copy(new_full_path,new_filename) |
|
|||
250 | else: |
|
|||
251 | raise ValueError('unrecognized mode for install: %r' % mode) |
|
|||
252 |
|
||||
253 | # Fix line-endings to those native to each platform in the config |
|
|||
254 | # directory. |
|
|||
255 | try: |
|
|||
256 | os.chdir(ipythondir) |
|
|||
257 | except: |
|
|||
258 | printf(""" |
|
|||
259 | Problem: changing to directory %s failed. |
|
|||
260 | Details: |
|
|||
261 | %s |
|
|||
262 |
|
||||
263 | Some configuration files may have incorrect line endings. This should not |
|
|||
264 | cause any problems during execution. """ % (ipythondir,sys.exc_info()[1]) ) |
|
|||
265 | wait() |
|
|||
266 | else: |
|
|||
267 | for fname in glb('ipythonrc*'): |
|
|||
268 | try: |
|
|||
269 | native_line_ends(fname,backup=0) |
|
|||
270 | except IOError: |
|
|||
271 | pass |
|
|||
272 |
|
||||
273 | if mode == 'install': |
|
|||
274 | printf(""" |
|
|||
275 | Successful installation! |
|
|||
276 |
|
||||
277 | Please read the sections 'Initial Configuration' and 'Quick Tips' in the |
|
|||
278 | IPython manual (there are both HTML and PDF versions supplied with the |
|
|||
279 | distribution) to make sure that your system environment is properly configured |
|
|||
280 | to take advantage of IPython's features. |
|
|||
281 |
|
||||
282 | Important note: the configuration system has changed! The old system is |
|
|||
283 | still in place, but its setting may be partly overridden by the settings in |
|
|||
284 | "~/.ipython/ipy_user_conf.py" config file. Please take a look at the file |
|
|||
285 | if some of the new settings bother you. |
|
|||
286 |
|
||||
287 | """) |
|
|||
288 | else: |
|
|||
289 | printf(""" |
|
|||
290 | Successful upgrade! |
|
|||
291 |
|
||||
292 | All files in your directory: |
|
|||
293 | %(ipythondir)s |
|
|||
294 | which would have been overwritten by the upgrade were backed up with a .old |
|
|||
295 | extension. If you had made particular customizations in those files you may |
|
|||
296 | want to merge them back into the new files.""" % locals() ) |
|
|||
297 | wait() |
|
|||
298 | os.chdir(cwd) |
|
|||
299 |
|
||||
300 | #**************************************************************************** |
|
|||
301 | # Local use exceptions |
|
|||
302 | class SpaceInInput(exceptions.Exception): pass |
|
108 | class SpaceInInput(exceptions.Exception): pass | |
303 |
|
109 | |||
304 |
|
||||
305 | #**************************************************************************** |
|
|||
306 | # Local use classes |
|
|||
307 | class Bunch: pass |
|
110 | class Bunch: pass | |
308 |
|
111 | |||
309 | class Undefined: pass |
|
112 | class Undefined: pass | |
@@ -357,8 +160,10 class SyntaxTB(ultratb.ListTB): | |||||
357 | self.last_syntax_error = None |
|
160 | self.last_syntax_error = None | |
358 | return e |
|
161 | return e | |
359 |
|
162 | |||
360 | #**************************************************************************** |
|
163 | ||
|
164 | #----------------------------------------------------------------------------- | |||
361 | # Main IPython class |
|
165 | # Main IPython class | |
|
166 | #----------------------------------------------------------------------------- | |||
362 |
|
167 | |||
363 | # FIXME: the Magic class is a mixin for now, and will unfortunately remain so |
|
168 | # FIXME: the Magic class is a mixin for now, and will unfortunately remain so | |
364 | # until a full rewrite is made. I've cleaned all cross-class uses of |
|
169 | # until a full rewrite is made. I've cleaned all cross-class uses of | |
@@ -378,34 +183,122 class SyntaxTB(ultratb.ListTB): | |||||
378 | # 'self.magic_', 'self.options_table', 'self.parse', 'self.shell', |
|
183 | # 'self.magic_', 'self.options_table', 'self.parse', 'self.shell', | |
379 | # 'self.value'] |
|
184 | # 'self.value'] | |
380 |
|
185 | |||
381 |
class InteractiveShell( |
|
186 | class InteractiveShell(Component, Magic): | |
382 | """An enhanced console for Python.""" |
|
187 | """An enhanced console for Python.""" | |
383 |
|
188 | |||
|
189 | alias = [] | |||
|
190 | autocall = Bool(True) | |||
|
191 | autoedit_syntax = Bool(False) | |||
|
192 | autoindent = Bool(False) | |||
|
193 | automagic = Bool(True) | |||
|
194 | autoexec = [] | |||
|
195 | display_banner = Bool(True) | |||
|
196 | banner = Str('') | |||
|
197 | c = Str('') | |||
|
198 | cache_size = Int(1000) | |||
|
199 | classic = Bool(False) | |||
|
200 | color_info = Int(0) | |||
|
201 | colors = Str('LightBG') | |||
|
202 | confirm_exit = Bool(True) | |||
|
203 | debug = Bool(False) | |||
|
204 | deep_reload = Bool(False) | |||
|
205 | embedded = Bool(False) | |||
|
206 | editor = Str('0') | |||
|
207 | filename = Str("<ipython console>") | |||
|
208 | help = Bool(False) | |||
|
209 | interactive = Bool(False) | |||
|
210 | logstart = Bool(False, config_key='LOGSTART') | |||
|
211 | logfile = Str('') | |||
|
212 | logplay = Str('') | |||
|
213 | messages = Bool(True) | |||
|
214 | multi_line_specials = Bool(True) | |||
|
215 | nosep = Bool(False) | |||
|
216 | object_info_string_level = Int(0) | |||
|
217 | pager = Str('less') | |||
|
218 | pdb = Bool(False) | |||
|
219 | pprint = Bool(True) | |||
|
220 | profile = Str('') | |||
|
221 | prompt_in1 = Str('In [\\#]: ') | |||
|
222 | prompt_in2 = Str(' .\\D.: ') | |||
|
223 | prompt_out = Str('Out[\\#]: ') | |||
|
224 | prompts_pad_left = Bool(True) | |||
|
225 | pydb = Bool(False) | |||
|
226 | quick = Bool(False) | |||
|
227 | quiet = Bool(False) | |||
|
228 | ||||
|
229 | readline_use = Bool(True) | |||
|
230 | readline_merge_completions = Bool(True) | |||
|
231 | readline_omit__names = Int(0) | |||
|
232 | readline_remove_delims = '-/~' | |||
|
233 | readline_parse_and_bind = [ | |||
|
234 | 'tab: complete', | |||
|
235 | '"\C-l": possible-completions', | |||
|
236 | 'set show-all-if-ambiguous on', | |||
|
237 | '"\C-o": tab-insert', | |||
|
238 | '"\M-i": " "', | |||
|
239 | '"\M-o": "\d\d\d\d"', | |||
|
240 | '"\M-I": "\d\d\d\d"', | |||
|
241 | '"\C-r": reverse-search-history', | |||
|
242 | '"\C-s": forward-search-history', | |||
|
243 | '"\C-p": history-search-backward', | |||
|
244 | '"\C-n": history-search-forward', | |||
|
245 | '"\e[A": history-search-backward', | |||
|
246 | '"\e[B": history-search-forward', | |||
|
247 | '"\C-k": kill-line', | |||
|
248 | '"\C-u": unix-line-discard', | |||
|
249 | ] | |||
|
250 | ||||
|
251 | screen_length = Int(0) | |||
|
252 | separate_in = Str('\n') | |||
|
253 | separate_out = Str('') | |||
|
254 | separate_out2 = Str('') | |||
|
255 | system_header = Str('IPython system call: ') | |||
|
256 | system_verbose = Bool(False) | |||
|
257 | term_title = Bool(True) | |||
|
258 | wildcards_case_sensitive = Bool(True) | |||
|
259 | xmode = Str('Context') | |||
|
260 | magic_docstrings = Bool(False) | |||
|
261 | ||||
384 | # class attribute to indicate whether the class supports threads or not. |
|
262 | # class attribute to indicate whether the class supports threads or not. | |
385 | # Subclasses with thread support should override this as needed. |
|
263 | # Subclasses with thread support should override this as needed. | |
386 | isthreaded = False |
|
264 | isthreaded = False | |
387 |
|
265 | |||
388 | def __init__(self,name,usage=None,rc=Struct(opts=None,args=None), |
|
266 | def __init__(self, name, parent=None, config=None, usage=None, | |
389 | user_ns=None,user_global_ns=None,banner2='', |
|
267 | user_ns=None, user_global_ns=None, banner2='', | |
390 | custom_exceptions=((),None),embedded=False): |
|
268 | custom_exceptions=((),None), embedded=False): | |
391 |
|
269 | |||
392 | # log system |
|
270 | super(InteractiveShell, self).__init__(parent, config=config, name=name) | |
393 | self.logger = Logger(self,logfname='ipython_log.py',logmode='rotate') |
|
|||
394 |
|
||||
395 | # Job manager (for jobs run as background threads) |
|
|||
396 | self.jobs = BackgroundJobManager() |
|
|||
397 |
|
271 | |||
398 | # Store the actual shell's name |
|
272 | self.init_instance_attrs() | |
399 |
self. |
|
273 | self.init_usage(usage) | |
400 | self.more = False |
|
274 | self.init_banner(banner2) | |
|
275 | self.init_embedded(embedded) | |||
|
276 | self.init_create_namespaces(user_ns, user_global_ns) | |||
|
277 | self.init_history() | |||
|
278 | self.init_encoding() | |||
|
279 | self.init_handlers() | |||
401 |
|
280 | |||
402 | # We need to know whether the instance is meant for embedding, since |
|
281 | Magic.__init__(self, self) | |
403 | # global/local namespaces need to be handled differently in that case |
|
282 | ||
404 | self.embedded = embedded |
|
283 | self.init_syntax_highlighting() | |
405 | if embedded: |
|
284 | self.init_hooks() | |
406 | # Control variable so users can, from within the embedded instance, |
|
285 | self.init_pushd_popd_magic() | |
407 | # permanently deactivate it. |
|
286 | self.init_traceback_handlers(custom_exceptions) | |
408 | self.embedded_active = True |
|
287 | ||
|
288 | # Produce a public API instance | |||
|
289 | self.api = ipapi.IPApi(self) | |||
|
290 | ||||
|
291 | self.init_namespaces() | |||
|
292 | self.init_logger() | |||
|
293 | self.init_aliases() | |||
|
294 | self.init_builtins() | |||
|
295 | self.init_shadow_hist() | |||
|
296 | self.init_logstart() | |||
|
297 | self.post_config_initialization() | |||
|
298 | ||||
|
299 | def init_instance_attrs(self): | |||
|
300 | self.jobs = BackgroundJobManager() | |||
|
301 | self.more = False | |||
409 |
|
302 | |||
410 | # command compiler |
|
303 | # command compiler | |
411 | self.compile = codeop.CommandCompiler() |
|
304 | self.compile = codeop.CommandCompiler() | |
@@ -413,14 +306,6 class InteractiveShell(object,Magic): | |||||
413 | # User input buffer |
|
306 | # User input buffer | |
414 | self.buffer = [] |
|
307 | self.buffer = [] | |
415 |
|
308 | |||
416 | # Default name given in compilation of code |
|
|||
417 | self.filename = '<ipython console>' |
|
|||
418 |
|
||||
419 | # Install our own quitter instead of the builtins. For python2.3-2.4, |
|
|||
420 | # this brings in behavior like 2.5, and for 2.5 it's identical. |
|
|||
421 | __builtin__.exit = Quitter(self,'exit') |
|
|||
422 | __builtin__.quit = Quitter(self,'quit') |
|
|||
423 |
|
||||
424 | # Make an empty namespace, which extension writers can rely on both |
|
309 | # Make an empty namespace, which extension writers can rely on both | |
425 | # existing and NEVER being used by ipython itself. This gives them a |
|
310 | # existing and NEVER being used by ipython itself. This gives them a | |
426 | # convenient location for storing additional information and state |
|
311 | # convenient location for storing additional information and state | |
@@ -428,6 +313,54 class InteractiveShell(object,Magic): | |||||
428 | # ipython names that may develop later. |
|
313 | # ipython names that may develop later. | |
429 | self.meta = Struct() |
|
314 | self.meta = Struct() | |
430 |
|
315 | |||
|
316 | # Object variable to store code object waiting execution. This is | |||
|
317 | # used mainly by the multithreaded shells, but it can come in handy in | |||
|
318 | # other situations. No need to use a Queue here, since it's a single | |||
|
319 | # item which gets cleared once run. | |||
|
320 | self.code_to_run = None | |||
|
321 | ||||
|
322 | # Flag to mark unconditional exit | |||
|
323 | self.exit_now = False | |||
|
324 | ||||
|
325 | # Temporary files used for various purposes. Deleted at exit. | |||
|
326 | self.tempfiles = [] | |||
|
327 | ||||
|
328 | # Keep track of readline usage (later set by init_readline) | |||
|
329 | self.has_readline = False | |||
|
330 | ||||
|
331 | # keep track of where we started running (mainly for crash post-mortem) | |||
|
332 | # This is not being used anywhere currently. | |||
|
333 | self.starting_dir = os.getcwd() | |||
|
334 | ||||
|
335 | # Indentation management | |||
|
336 | self.indent_current_nsp = 0 | |||
|
337 | ||||
|
338 | def init_usage(self, usage=None): | |||
|
339 | if usage is None: | |||
|
340 | self.usage = interactive_usage | |||
|
341 | else: | |||
|
342 | self.usage = usage | |||
|
343 | ||||
|
344 | def init_banner(self, banner2): | |||
|
345 | if self.c: # regular python doesn't print the banner with -c | |||
|
346 | self.display_banner = False | |||
|
347 | bp = banner_parts | |||
|
348 | if self.profile: | |||
|
349 | bp.append('IPython profile: %s\n' % self.profile) | |||
|
350 | if banner2 is not None: | |||
|
351 | bp.append(banner2) | |||
|
352 | self.banner = '\n'.join(bp) | |||
|
353 | ||||
|
354 | def init_embedded(self, embedded): | |||
|
355 | # We need to know whether the instance is meant for embedding, since | |||
|
356 | # global/local namespaces need to be handled differently in that case | |||
|
357 | self.embedded = embedded | |||
|
358 | if embedded: | |||
|
359 | # Control variable so users can, from within the embedded instance, | |||
|
360 | # permanently deactivate it. | |||
|
361 | self.embedded_active = True | |||
|
362 | ||||
|
363 | def init_create_namespaces(self, user_ns=None, user_global_ns=None): | |||
431 | # Create the namespace where the user will operate. user_ns is |
|
364 | # Create the namespace where the user will operate. user_ns is | |
432 | # normally the only one used, and it is passed to the exec calls as |
|
365 | # normally the only one used, and it is passed to the exec calls as | |
433 | # the locals argument. But we do carry a user_global_ns namespace |
|
366 | # the locals argument. But we do carry a user_global_ns namespace | |
@@ -547,16 +480,15 class InteractiveShell(object,Magic): | |||||
547 | # shouldn't overtake the execution environment of the script they're |
|
480 | # shouldn't overtake the execution environment of the script they're | |
548 | # embedded in). |
|
481 | # embedded in). | |
549 |
|
482 | |||
550 | if not embedded: |
|
483 | if not self.embedded: | |
551 | try: |
|
484 | try: | |
552 | main_name = self.user_ns['__name__'] |
|
485 | main_name = self.user_ns['__name__'] | |
553 | except KeyError: |
|
486 | except KeyError: | |
554 | raise KeyError,'user_ns dictionary MUST have a "__name__" key' |
|
487 | raise KeyError,'user_ns dictionary MUST have a "__name__" key' | |
555 | else: |
|
488 | else: | |
556 | #print "pickle hack in place" # dbg |
|
|||
557 | #print 'main_name:',main_name # dbg |
|
|||
558 | sys.modules[main_name] = FakeModule(self.user_ns) |
|
489 | sys.modules[main_name] = FakeModule(self.user_ns) | |
559 |
|
490 | |||
|
491 | def init_history(self): | |||
560 | # List of input with multi-line handling. |
|
492 | # List of input with multi-line handling. | |
561 | self.input_hist = InputList() |
|
493 | self.input_hist = InputList() | |
562 | # This one will hold the 'raw' input history, without any |
|
494 | # This one will hold the 'raw' input history, without any | |
@@ -573,6 +505,14 class InteractiveShell(object,Magic): | |||||
573 | # dict of output history |
|
505 | # dict of output history | |
574 | self.output_hist = {} |
|
506 | self.output_hist = {} | |
575 |
|
507 | |||
|
508 | # Now the history file | |||
|
509 | try: | |||
|
510 | histfname = 'history-%s' % self.config.PROFILE | |||
|
511 | except AttributeError: | |||
|
512 | histfname = 'history' | |||
|
513 | self.histfile = os.path.join(self.config.IPYTHONDIR, histfname) | |||
|
514 | ||||
|
515 | def init_encoding(self): | |||
576 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
516 | # Get system encoding at startup time. Certain terminals (like Emacs | |
577 | # under Win32 have it set to None, and we need to have a known valid |
|
517 | # under Win32 have it set to None, and we need to have a known valid | |
578 | # encoding to use in the raw_input() method |
|
518 | # encoding to use in the raw_input() method | |
@@ -581,20 +521,7 class InteractiveShell(object,Magic): | |||||
581 | except AttributeError: |
|
521 | except AttributeError: | |
582 | self.stdin_encoding = 'ascii' |
|
522 | self.stdin_encoding = 'ascii' | |
583 |
|
523 | |||
584 | # dict of things NOT to alias (keywords, builtins and some magics) |
|
524 | def init_handlers(self): | |
585 | no_alias = {} |
|
|||
586 | no_alias_magics = ['cd','popd','pushd','dhist','alias','unalias'] |
|
|||
587 | for key in keyword.kwlist + no_alias_magics: |
|
|||
588 | no_alias[key] = 1 |
|
|||
589 | no_alias.update(__builtin__.__dict__) |
|
|||
590 | self.no_alias = no_alias |
|
|||
591 |
|
||||
592 | # Object variable to store code object waiting execution. This is |
|
|||
593 | # used mainly by the multithreaded shells, but it can come in handy in |
|
|||
594 | # other situations. No need to use a Queue here, since it's a single |
|
|||
595 | # item which gets cleared once run. |
|
|||
596 | self.code_to_run = None |
|
|||
597 |
|
||||
598 | # escapes for automatic behavior on the command line |
|
525 | # escapes for automatic behavior on the command line | |
599 | self.ESC_SHELL = '!' |
|
526 | self.ESC_SHELL = '!' | |
600 | self.ESC_SH_CAP = '!!' |
|
527 | self.ESC_SH_CAP = '!!' | |
@@ -614,13 +541,12 class InteractiveShell(object,Magic): | |||||
614 | self.ESC_SH_CAP : self.handle_shell_escape, |
|
541 | self.ESC_SH_CAP : self.handle_shell_escape, | |
615 | } |
|
542 | } | |
616 |
|
543 | |||
617 | # class initializations |
|
544 | def init_syntax_highlighting(self): | |
618 | Magic.__init__(self,self) |
|
|||
619 |
|
||||
620 | # Python source parser/formatter for syntax highlighting |
|
545 | # Python source parser/formatter for syntax highlighting | |
621 | pyformat = PyColorize.Parser().format |
|
546 | pyformat = PyColorize.Parser().format | |
622 |
self.pycolorize = lambda src: pyformat(src,'str',self. |
|
547 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) | |
623 |
|
548 | |||
|
549 | def init_hooks(self): | |||
624 | # hooks holds pointers used for user-side customizations |
|
550 | # hooks holds pointers used for user-side customizations | |
625 | self.hooks = Struct() |
|
551 | self.hooks = Struct() | |
626 |
|
552 | |||
@@ -633,81 +559,17 class InteractiveShell(object,Magic): | |||||
633 | # default hooks have priority 100, i.e. low; user hooks should have |
|
559 | # default hooks have priority 100, i.e. low; user hooks should have | |
634 | # 0-100 priority |
|
560 | # 0-100 priority | |
635 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) |
|
561 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) | |
636 | #print "bound hook",hook_name |
|
|||
637 |
|
||||
638 | # Flag to mark unconditional exit |
|
|||
639 | self.exit_now = False |
|
|||
640 |
|
||||
641 | self.usage_min = """\ |
|
|||
642 | An enhanced console for Python. |
|
|||
643 | Some of its features are: |
|
|||
644 | - Readline support if the readline library is present. |
|
|||
645 | - Tab completion in the local namespace. |
|
|||
646 | - Logging of input, see command-line options. |
|
|||
647 | - System shell escape via ! , eg !ls. |
|
|||
648 | - Magic commands, starting with a % (like %ls, %pwd, %cd, etc.) |
|
|||
649 | - Keeps track of locally defined variables via %who, %whos. |
|
|||
650 | - Show object information with a ? eg ?x or x? (use ?? for more info). |
|
|||
651 | """ |
|
|||
652 | if usage: self.usage = usage |
|
|||
653 | else: self.usage = self.usage_min |
|
|||
654 |
|
||||
655 | # Storage |
|
|||
656 | self.rc = rc # This will hold all configuration information |
|
|||
657 | self.pager = 'less' |
|
|||
658 | # temporary files used for various purposes. Deleted at exit. |
|
|||
659 | self.tempfiles = [] |
|
|||
660 |
|
562 | |||
661 | # Keep track of readline usage (later set by init_readline) |
|
563 | def init_pushd_popd_magic(self): | |
662 | self.has_readline = False |
|
|||
663 |
|
||||
664 | # template for logfile headers. It gets resolved at runtime by the |
|
|||
665 | # logstart method. |
|
|||
666 | self.loghead_tpl = \ |
|
|||
667 | """#log# Automatic Logger file. *** THIS MUST BE THE FIRST LINE *** |
|
|||
668 | #log# DO NOT CHANGE THIS LINE OR THE TWO BELOW |
|
|||
669 | #log# opts = %s |
|
|||
670 | #log# args = %s |
|
|||
671 | #log# It is safe to make manual edits below here. |
|
|||
672 | #log#----------------------------------------------------------------------- |
|
|||
673 | """ |
|
|||
674 | # for pushd/popd management |
|
564 | # for pushd/popd management | |
675 | try: |
|
565 | try: | |
676 | self.home_dir = get_home_dir() |
|
566 | self.home_dir = get_home_dir() | |
677 | except HomeDirError,msg: |
|
567 | except HomeDirError, msg: | |
678 | fatal(msg) |
|
568 | fatal(msg) | |
679 |
|
569 | |||
680 | self.dir_stack = [] |
|
570 | self.dir_stack = [] | |
681 |
|
571 | |||
682 | # Functions to call the underlying shell. |
|
572 | def init_traceback_handlers(self, custom_exceptions): | |
683 |
|
||||
684 | # The first is similar to os.system, but it doesn't return a value, |
|
|||
685 | # and it allows interpolation of variables in the user's namespace. |
|
|||
686 | self.system = lambda cmd: \ |
|
|||
687 | self.hooks.shell_hook(self.var_expand(cmd,depth=2)) |
|
|||
688 |
|
||||
689 | # These are for getoutput and getoutputerror: |
|
|||
690 | self.getoutput = lambda cmd: \ |
|
|||
691 | getoutput(self.var_expand(cmd,depth=2), |
|
|||
692 | header=self.rc.system_header, |
|
|||
693 | verbose=self.rc.system_verbose) |
|
|||
694 |
|
||||
695 | self.getoutputerror = lambda cmd: \ |
|
|||
696 | getoutputerror(self.var_expand(cmd,depth=2), |
|
|||
697 | header=self.rc.system_header, |
|
|||
698 | verbose=self.rc.system_verbose) |
|
|||
699 |
|
||||
700 |
|
||||
701 | # keep track of where we started running (mainly for crash post-mortem) |
|
|||
702 | self.starting_dir = os.getcwd() |
|
|||
703 |
|
||||
704 | # Various switches which can be set |
|
|||
705 | self.CACHELENGTH = 5000 # this is cheap, it's just text |
|
|||
706 | self.BANNER = "Python %(version)s on %(platform)s\n" % sys.__dict__ |
|
|||
707 | self.banner2 = banner2 |
|
|||
708 |
|
||||
709 | # TraceBack handlers: |
|
|||
710 |
|
||||
711 | # Syntax error handler. |
|
573 | # Syntax error handler. | |
712 | self.SyntaxTB = SyntaxTB(color_scheme='NoColor') |
|
574 | self.SyntaxTB = SyntaxTB(color_scheme='NoColor') | |
713 |
|
575 | |||
@@ -734,9 +596,37 class InteractiveShell(object,Magic): | |||||
734 | # and add any custom exception handlers the user may have specified |
|
596 | # and add any custom exception handlers the user may have specified | |
735 | self.set_custom_exc(*custom_exceptions) |
|
597 | self.set_custom_exc(*custom_exceptions) | |
736 |
|
598 | |||
737 | # indentation management |
|
599 | def init_logger(self): | |
738 | self.autoindent = False |
|
600 | self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate') | |
739 | self.indent_current_nsp = 0 |
|
601 | # local shortcut, this is used a LOT | |
|
602 | self.log = self.logger.log | |||
|
603 | # template for logfile headers. It gets resolved at runtime by the | |||
|
604 | # logstart method. | |||
|
605 | self.loghead_tpl = \ | |||
|
606 | """#log# Automatic Logger file. *** THIS MUST BE THE FIRST LINE *** | |||
|
607 | #log# DO NOT CHANGE THIS LINE OR THE TWO BELOW | |||
|
608 | #log# opts = %s | |||
|
609 | #log# args = %s | |||
|
610 | #log# It is safe to make manual edits below here. | |||
|
611 | #log#----------------------------------------------------------------------- | |||
|
612 | """ | |||
|
613 | ||||
|
614 | def init_logstart(self): | |||
|
615 | if self.logplay: | |||
|
616 | IP.magic_logstart(self.logplay + ' append') | |||
|
617 | elif self.logfile: | |||
|
618 | IP.magic_logstart(self.logfile) | |||
|
619 | elif self.logstart: | |||
|
620 | self.magic_logstart() | |||
|
621 | ||||
|
622 | def init_aliases(self): | |||
|
623 | # dict of things NOT to alias (keywords, builtins and some magics) | |||
|
624 | no_alias = {} | |||
|
625 | no_alias_magics = ['cd','popd','pushd','dhist','alias','unalias'] | |||
|
626 | for key in keyword.kwlist + no_alias_magics: | |||
|
627 | no_alias[key] = 1 | |||
|
628 | no_alias.update(__builtin__.__dict__) | |||
|
629 | self.no_alias = no_alias | |||
740 |
|
630 | |||
741 | # Make some aliases automatically |
|
631 | # Make some aliases automatically | |
742 | # Prepare list of shell aliases to auto-define |
|
632 | # Prepare list of shell aliases to auto-define | |
@@ -783,15 +673,15 class InteractiveShell(object,Magic): | |||||
783 | auto_alias = () |
|
673 | auto_alias = () | |
784 | self.auto_alias = [s.split(None,1) for s in auto_alias] |
|
674 | self.auto_alias = [s.split(None,1) for s in auto_alias] | |
785 |
|
675 | |||
786 | # Produce a public API instance |
|
676 | # Load default aliases | |
787 | self.api = ipapi.IPApi(self) |
|
677 | for alias, cmd in self.auto_alias: | |
|
678 | self.define_alias(alias,cmd) | |||
788 |
|
679 | |||
789 | # Initialize all user-visible namespaces |
|
680 | # Load user aliases | |
790 | self.init_namespaces() |
|
681 | for alias in self.alias: | |
791 |
|
682 | self.magic_alias(alias) | ||
792 | # Call the actual (public) initializer |
|
|||
793 | self.init_auto_alias() |
|
|||
794 |
|
683 | |||
|
684 | def init_builtins(self): | |||
795 | # track which builtins we add, so we can clean up later |
|
685 | # track which builtins we add, so we can clean up later | |
796 | self.builtins_added = {} |
|
686 | self.builtins_added = {} | |
797 | # This method will add the necessary builtins for operation, but |
|
687 | # This method will add the necessary builtins for operation, but | |
@@ -799,42 +689,17 class InteractiveShell(object,Magic): | |||||
799 |
|
689 | |||
800 | #TODO: remove this, redundant |
|
690 | #TODO: remove this, redundant | |
801 | self.add_builtins() |
|
691 | self.add_builtins() | |
802 | # end __init__ |
|
|||
803 |
|
692 | |||
804 | def var_expand(self,cmd,depth=0): |
|
693 | def init_shadow_hist(self): | |
805 | """Expand python variables in a string. |
|
|||
806 |
|
||||
807 | The depth argument indicates how many frames above the caller should |
|
|||
808 | be walked to look for the local namespace where to expand variables. |
|
|||
809 |
|
||||
810 | The global namespace for expansion is always the user's interactive |
|
|||
811 | namespace. |
|
|||
812 | """ |
|
|||
813 |
|
||||
814 | return str(ItplNS(cmd, |
|
|||
815 | self.user_ns, # globals |
|
|||
816 | # Skip our own frame in searching for locals: |
|
|||
817 | sys._getframe(depth+1).f_locals # locals |
|
|||
818 | )) |
|
|||
819 |
|
||||
820 | def pre_config_initialization(self): |
|
|||
821 | """Pre-configuration init method |
|
|||
822 |
|
||||
823 | This is called before the configuration files are processed to |
|
|||
824 | prepare the services the config files might need. |
|
|||
825 |
|
||||
826 | self.rc already has reasonable default values at this point. |
|
|||
827 | """ |
|
|||
828 | rc = self.rc |
|
|||
829 | try: |
|
694 | try: | |
830 |
self.db = pickleshare.PickleShareDB( |
|
695 | self.db = pickleshare.PickleShareDB(self.config.IPYTHONDIR + "/db") | |
831 | except exceptions.UnicodeDecodeError: |
|
696 | except exceptions.UnicodeDecodeError: | |
832 | print "Your ipythondir can't be decoded to unicode!" |
|
697 | print "Your ipythondir can't be decoded to unicode!" | |
833 | print "Please set HOME environment variable to something that" |
|
698 | print "Please set HOME environment variable to something that" | |
834 | print r"only has ASCII characters, e.g. c:\home" |
|
699 | print r"only has ASCII characters, e.g. c:\home" | |
835 |
print "Now it is", |
|
700 | print "Now it is", self.config.IPYTHONDIR | |
836 | sys.exit() |
|
701 | sys.exit() | |
837 |
self.shadowhist = |
|
702 | self.shadowhist = ipcorehist.ShadowHist(self.db) | |
838 |
|
703 | |||
839 | def post_config_initialization(self): |
|
704 | def post_config_initialization(self): | |
840 | """Post configuration init method |
|
705 | """Post configuration init method | |
@@ -842,34 +707,29 class InteractiveShell(object,Magic): | |||||
842 | This is called after the configuration files have been processed to |
|
707 | This is called after the configuration files have been processed to | |
843 | 'finalize' the initialization.""" |
|
708 | 'finalize' the initialization.""" | |
844 |
|
709 | |||
845 | rc = self.rc |
|
|||
846 |
|
||||
847 | # Object inspector |
|
710 | # Object inspector | |
848 | self.inspector = oinspect.Inspector(oinspect.InspectColors, |
|
711 | self.inspector = oinspect.Inspector(oinspect.InspectColors, | |
849 | PyColorize.ANSICodeColors, |
|
712 | PyColorize.ANSICodeColors, | |
850 | 'NoColor', |
|
713 | 'NoColor', | |
851 |
|
|
714 | self.object_info_string_level) | |
852 |
|
715 | |||
853 | self.rl_next_input = None |
|
716 | self.rl_next_input = None | |
854 | self.rl_do_indent = False |
|
717 | self.rl_do_indent = False | |
855 | # Load readline proper |
|
718 | # Load readline proper | |
856 |
if |
|
719 | if self.readline_use: | |
857 | self.init_readline() |
|
720 | self.init_readline() | |
858 |
|
||||
859 | # local shortcut, this is used a LOT |
|
|||
860 | self.log = self.logger.log |
|
|||
861 |
|
721 | |||
862 | # Initialize cache, set in/out prompts and printing system |
|
722 | # Initialize cache, set in/out prompts and printing system | |
863 | self.outputcache = CachedOutput(self, |
|
723 | self.outputcache = CachedOutput(self, | |
864 |
|
|
724 | self.cache_size, | |
865 |
|
|
725 | self.pprint, | |
866 |
input_sep = |
|
726 | input_sep = self.separate_in, | |
867 |
output_sep = |
|
727 | output_sep = self.separate_out, | |
868 |
output_sep2 = |
|
728 | output_sep2 = self.separate_out2, | |
869 |
ps1 = |
|
729 | ps1 = self.prompt_in1, | |
870 |
ps2 = |
|
730 | ps2 = self.prompt_in2, | |
871 |
ps_out = |
|
731 | ps_out = self.prompt_out, | |
872 |
pad_left = |
|
732 | pad_left = self.prompts_pad_left) | |
873 |
|
733 | |||
874 | # user may have over-ridden the default print hook: |
|
734 | # user may have over-ridden the default print hook: | |
875 | try: |
|
735 | try: | |
@@ -894,31 +754,30 class InteractiveShell(object,Magic): | |||||
894 |
|
754 | |||
895 | # Set user colors (don't do it in the constructor above so that it |
|
755 | # Set user colors (don't do it in the constructor above so that it | |
896 | # doesn't crash if colors option is invalid) |
|
756 | # doesn't crash if colors option is invalid) | |
897 |
self.magic_colors( |
|
757 | self.magic_colors(self.colors) | |
898 |
|
758 | |||
899 | # Set calling of pdb on exceptions |
|
759 | # Set calling of pdb on exceptions | |
900 |
self.call_pdb = |
|
760 | self.call_pdb = self.pdb | |
|
761 | ||||
901 |
|
762 | |||
902 | # Load user aliases |
|
|||
903 | for alias in rc.alias: |
|
|||
904 | self.magic_alias(alias) |
|
|||
905 |
|
763 | |||
906 | self.hooks.late_startup_hook() |
|
764 | self.hooks.late_startup_hook() | |
907 |
|
765 | |||
908 |
for cmd in self. |
|
766 | for cmd in self.autoexec: | |
909 | #print "autoexec>",cmd #dbg |
|
767 | #print "autoexec>",cmd #dbg | |
910 | self.api.runlines(cmd) |
|
768 | self.api.runlines(cmd) | |
911 |
|
769 | |||
912 | batchrun = False |
|
770 | batchrun = False | |
913 | for batchfile in [path(arg) for arg in self.rc.args |
|
771 | if self.config.has_key('EXECFILE'): | |
914 | if arg.lower().endswith('.ipy')]: |
|
772 | for batchfile in [path(arg) for arg in self.config.EXECFILE | |
915 | if not batchfile.isfile(): |
|
773 | if arg.lower().endswith('.ipy')]: | |
916 |
|
|
774 | if not batchfile.isfile(): | |
917 | continue |
|
775 | print "No such batch file:", batchfile | |
918 | self.api.runlines(batchfile.text()) |
|
776 | continue | |
919 | batchrun = True |
|
777 | self.api.runlines(batchfile.text()) | |
|
778 | batchrun = True | |||
920 | # without -i option, exit after running the batch file |
|
779 | # without -i option, exit after running the batch file | |
921 |
if batchrun and not self. |
|
780 | if batchrun and not self.interactive: | |
922 | self.ask_exit() |
|
781 | self.ask_exit() | |
923 |
|
782 | |||
924 | def init_namespaces(self): |
|
783 | def init_namespaces(self): | |
@@ -960,7 +819,14 class InteractiveShell(object,Magic): | |||||
960 | Some parts of ipython operate via builtins injected here, which hold a |
|
819 | Some parts of ipython operate via builtins injected here, which hold a | |
961 | reference to IPython itself.""" |
|
820 | reference to IPython itself.""" | |
962 |
|
821 | |||
963 | # TODO: deprecate all of these, they are unsafe |
|
822 | # Install our own quitter instead of the builtins. | |
|
823 | # This used to be in the __init__ method, but this is a better | |||
|
824 | # place for it. These can be incorporated to the logic below | |||
|
825 | # when it is refactored. | |||
|
826 | __builtin__.exit = Quitter(self,'exit') | |||
|
827 | __builtin__.quit = Quitter(self,'quit') | |||
|
828 | ||||
|
829 | # TODO: deprecate all of these, they are unsafe. Why though? | |||
964 | builtins_new = dict(__IPYTHON__ = self, |
|
830 | builtins_new = dict(__IPYTHON__ = self, | |
965 | ip_set_hook = self.set_hook, |
|
831 | ip_set_hook = self.set_hook, | |
966 | jobs = self.jobs, |
|
832 | jobs = self.jobs, | |
@@ -1176,6 +1042,26 class InteractiveShell(object,Magic): | |||||
1176 | magic_args = self.var_expand(magic_args,1) |
|
1042 | magic_args = self.var_expand(magic_args,1) | |
1177 | return fn(magic_args) |
|
1043 | return fn(magic_args) | |
1178 |
|
1044 | |||
|
1045 | def define_alias(self, name, cmd): | |||
|
1046 | """ Define a new alias.""" | |||
|
1047 | ||||
|
1048 | if callable(cmd): | |||
|
1049 | self.alias_table[name] = cmd | |||
|
1050 | from IPython.core import shadowns | |||
|
1051 | setattr(shadowns, name, cmd) | |||
|
1052 | return | |||
|
1053 | ||||
|
1054 | if isinstance(cmd, basestring): | |||
|
1055 | nargs = cmd.count('%s') | |||
|
1056 | if nargs>0 and cmd.find('%l')>=0: | |||
|
1057 | raise Exception('The %s and %l specifiers are mutually ' | |||
|
1058 | 'exclusive in alias definitions.') | |||
|
1059 | ||||
|
1060 | self.alias_table[name] = (nargs,cmd) | |||
|
1061 | return | |||
|
1062 | ||||
|
1063 | self.alias_table[name] = cmd | |||
|
1064 | ||||
1179 | def ipalias(self,arg_s): |
|
1065 | def ipalias(self,arg_s): | |
1180 | """Call an alias by name. |
|
1066 | """Call an alias by name. | |
1181 |
|
1067 | |||
@@ -1205,10 +1091,21 class InteractiveShell(object,Magic): | |||||
1205 | else: |
|
1091 | else: | |
1206 | error("Alias `%s` not found." % alias_name) |
|
1092 | error("Alias `%s` not found." % alias_name) | |
1207 |
|
1093 | |||
1208 |
def |
|
1094 | def system(self, cmd): | |
1209 | """Make a system call, using IPython.""" |
|
1095 | """Make a system call, using IPython.""" | |
|
1096 | return self.hooks.shell_hook(self.var_expand(cmd, depth=2)) | |||
|
1097 | ||||
|
1098 | ipsystem = system | |||
1210 |
|
1099 | |||
1211 | self.system(arg_s) |
|
1100 | def getoutput(self, cmd): | |
|
1101 | return getoutput(self.var_expand(cmd,depth=2), | |||
|
1102 | header=self.system_header, | |||
|
1103 | verbose=self.system_verbose) | |||
|
1104 | ||||
|
1105 | def getoutputerror(self, cmd): | |||
|
1106 | return getoutputerror(self.var_expand(cmd,depth=2), | |||
|
1107 | header=self.system_header, | |||
|
1108 | verbose=self.system_verbose) | |||
1212 |
|
1109 | |||
1213 | def complete(self,text): |
|
1110 | def complete(self,text): | |
1214 | """Return a sorted list of all possible completions on text. |
|
1111 | """Return a sorted list of all possible completions on text. | |
@@ -1299,28 +1196,6 class InteractiveShell(object,Magic): | |||||
1299 | else: |
|
1196 | else: | |
1300 | self.autoindent = value |
|
1197 | self.autoindent = value | |
1301 |
|
1198 | |||
1302 | def rc_set_toggle(self,rc_field,value=None): |
|
|||
1303 | """Set or toggle a field in IPython's rc config. structure. |
|
|||
1304 |
|
||||
1305 | If called with no arguments, it acts as a toggle. |
|
|||
1306 |
|
||||
1307 | If called with a non-existent field, the resulting AttributeError |
|
|||
1308 | exception will propagate out.""" |
|
|||
1309 |
|
||||
1310 | rc_val = getattr(self.rc,rc_field) |
|
|||
1311 | if value is None: |
|
|||
1312 | value = not rc_val |
|
|||
1313 | setattr(self.rc,rc_field,value) |
|
|||
1314 |
|
||||
1315 | def user_setup(self,ipythondir,rc_suffix,mode='install'): |
|
|||
1316 | """Install the user configuration directory. |
|
|||
1317 |
|
||||
1318 | Notes |
|
|||
1319 | ----- |
|
|||
1320 | DEPRECATED: use the top-level user_setup() function instead. |
|
|||
1321 | """ |
|
|||
1322 | return user_setup(ipythondir,rc_suffix,mode) |
|
|||
1323 |
|
||||
1324 | def atexit_operations(self): |
|
1199 | def atexit_operations(self): | |
1325 | """This will be executed at the time of exit. |
|
1200 | """This will be executed at the time of exit. | |
1326 |
|
1201 | |||
@@ -1430,7 +1305,7 class InteractiveShell(object,Magic): | |||||
1430 | self.Completer = IPCompleter(self, |
|
1305 | self.Completer = IPCompleter(self, | |
1431 | self.user_ns, |
|
1306 | self.user_ns, | |
1432 | self.user_global_ns, |
|
1307 | self.user_global_ns, | |
1433 |
self. |
|
1308 | self.readline_omit__names, | |
1434 | self.alias_table) |
|
1309 | self.alias_table) | |
1435 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
1310 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) | |
1436 | self.strdispatchers['complete_command'] = sdisp |
|
1311 | self.strdispatchers['complete_command'] = sdisp | |
@@ -1469,7 +1344,7 class InteractiveShell(object,Magic): | |||||
1469 | # is being used (as on Leopard) the readline config is |
|
1344 | # is being used (as on Leopard) the readline config is | |
1470 | # not run as the syntax for libedit is different. |
|
1345 | # not run as the syntax for libedit is different. | |
1471 | if not readline.uses_libedit: |
|
1346 | if not readline.uses_libedit: | |
1472 |
for rlcommand in self. |
|
1347 | for rlcommand in self.readline_parse_and_bind: | |
1473 | #print "loading rl:",rlcommand # dbg |
|
1348 | #print "loading rl:",rlcommand # dbg | |
1474 | readline.parse_and_bind(rlcommand) |
|
1349 | readline.parse_and_bind(rlcommand) | |
1475 |
|
1350 | |||
@@ -1477,7 +1352,7 class InteractiveShell(object,Magic): | |||||
1477 | # unicode chars, discard them. |
|
1352 | # unicode chars, discard them. | |
1478 | delims = readline.get_completer_delims().encode("ascii", "ignore") |
|
1353 | delims = readline.get_completer_delims().encode("ascii", "ignore") | |
1479 | delims = delims.translate(string._idmap, |
|
1354 | delims = delims.translate(string._idmap, | |
1480 |
self. |
|
1355 | self.readline_remove_delims) | |
1481 | readline.set_completer_delims(delims) |
|
1356 | readline.set_completer_delims(delims) | |
1482 | # otherwise we end up with a monster history after a while: |
|
1357 | # otherwise we end up with a monster history after a while: | |
1483 | readline.set_history_length(1000) |
|
1358 | readline.set_history_length(1000) | |
@@ -1491,10 +1366,10 class InteractiveShell(object,Magic): | |||||
1491 | del atexit |
|
1366 | del atexit | |
1492 |
|
1367 | |||
1493 | # Configure auto-indent for all platforms |
|
1368 | # Configure auto-indent for all platforms | |
1494 |
self.set_autoindent(self. |
|
1369 | self.set_autoindent(self.autoindent) | |
1495 |
|
1370 | |||
1496 | def ask_yes_no(self,prompt,default=True): |
|
1371 | def ask_yes_no(self,prompt,default=True): | |
1497 |
if self. |
|
1372 | if self.quiet: | |
1498 | return True |
|
1373 | return True | |
1499 | return ask_yes_no(prompt,default) |
|
1374 | return ask_yes_no(prompt,default) | |
1500 |
|
1375 | |||
@@ -1577,7 +1452,7 class InteractiveShell(object,Magic): | |||||
1577 |
|
1452 | |||
1578 | return False |
|
1453 | return False | |
1579 | try: |
|
1454 | try: | |
1580 |
if (self. |
|
1455 | if (self.autoedit_syntax and | |
1581 | not self.ask_yes_no('Return to editor to correct syntax error? ' |
|
1456 | not self.ask_yes_no('Return to editor to correct syntax error? ' | |
1582 | '[Y/n] ','y')): |
|
1457 | '[Y/n] ','y')): | |
1583 | return False |
|
1458 | return False | |
@@ -1728,22 +1603,18 class InteractiveShell(object,Magic): | |||||
1728 | except KeyboardInterrupt: |
|
1603 | except KeyboardInterrupt: | |
1729 | self.write("\nKeyboardInterrupt\n") |
|
1604 | self.write("\nKeyboardInterrupt\n") | |
1730 |
|
1605 | |||
1731 | def mainloop(self,banner=None): |
|
1606 | def mainloop(self, banner=None): | |
1732 |
""" |
|
1607 | """Start the mainloop. | |
1733 |
|
1608 | |||
1734 | If an optional banner argument is given, it will override the |
|
1609 | If an optional banner argument is given, it will override the | |
1735 |
internally created default banner. |
|
1610 | internally created default banner. | |
1736 |
|
1611 | """ | ||
1737 |
if self. |
|
1612 | if self.c: # Emulate Python's -c option | |
1738 | self.exec_init_cmd() |
|
1613 | self.exec_init_cmd() | |
1739 | if banner is None: |
|
1614 | ||
1740 |
|
|
1615 | if self.display_banner: | |
1741 |
|
|
1616 | if banner is None: | |
1742 | # banner is string? Use it directly! |
|
1617 | banner = self.banner | |
1743 | elif isinstance(self.rc.banner,basestring): |
|
|||
1744 | banner = self.rc.banner |
|
|||
1745 | else: |
|
|||
1746 | banner = self.BANNER+self.banner2 |
|
|||
1747 |
|
1618 | |||
1748 | # if you run stuff with -c <cmd>, raw hist is not updated |
|
1619 | # if you run stuff with -c <cmd>, raw hist is not updated | |
1749 | # ensure that it's in sync |
|
1620 | # ensure that it's in sync | |
@@ -1752,12 +1623,10 class InteractiveShell(object,Magic): | |||||
1752 |
|
1623 | |||
1753 | while 1: |
|
1624 | while 1: | |
1754 | try: |
|
1625 | try: | |
1755 |
self.interact( |
|
1626 | self.interact() | |
1756 | #self.interact_with_readline() |
|
1627 | #self.interact_with_readline() | |
1757 |
|
||||
1758 | # XXX for testing of a readline-decoupled repl loop, call |
|
1628 | # XXX for testing of a readline-decoupled repl loop, call | |
1759 | # interact_with_readline above |
|
1629 | # interact_with_readline above | |
1760 |
|
||||
1761 | break |
|
1630 | break | |
1762 | except KeyboardInterrupt: |
|
1631 | except KeyboardInterrupt: | |
1763 | # this should not be necessary, but KeyboardInterrupt |
|
1632 | # this should not be necessary, but KeyboardInterrupt | |
@@ -1770,8 +1639,8 class InteractiveShell(object,Magic): | |||||
1770 | This emulates Python's -c option.""" |
|
1639 | This emulates Python's -c option.""" | |
1771 |
|
1640 | |||
1772 | #sys.argv = ['-c'] |
|
1641 | #sys.argv = ['-c'] | |
1773 |
self.push(self.prefilter(self. |
|
1642 | self.push(self.prefilter(self.c, False)) | |
1774 |
if not self. |
|
1643 | if not self.interactive: | |
1775 | self.ask_exit() |
|
1644 | self.ask_exit() | |
1776 |
|
1645 | |||
1777 | def embed_mainloop(self,header='',local_ns=None,global_ns=None,stack_depth=0): |
|
1646 | def embed_mainloop(self,header='',local_ns=None,global_ns=None,stack_depth=0): | |
@@ -1885,7 +1754,7 class InteractiveShell(object,Magic): | |||||
1885 |
|
1754 | |||
1886 | self.more = self.push(lineout) |
|
1755 | self.more = self.push(lineout) | |
1887 | if (self.SyntaxTB.last_syntax_error and |
|
1756 | if (self.SyntaxTB.last_syntax_error and | |
1888 |
self |
|
1757 | self.autoedit_syntax): | |
1889 | self.edit_syntax_error() |
|
1758 | self.edit_syntax_error() | |
1890 |
|
1759 | |||
1891 | def interact_with_readline(self): |
|
1760 | def interact_with_readline(self): | |
@@ -1904,28 +1773,16 class InteractiveShell(object,Magic): | |||||
1904 | line = raw_input_original().decode(self.stdin_encoding) |
|
1773 | line = raw_input_original().decode(self.stdin_encoding) | |
1905 | self.interact_handle_input(line) |
|
1774 | self.interact_handle_input(line) | |
1906 |
|
1775 | |||
1907 |
|
||||
1908 | def interact(self, banner=None): |
|
1776 | def interact(self, banner=None): | |
1909 | """Closely emulate the interactive Python console. |
|
1777 | """Closely emulate the interactive Python console.""" | |
1910 |
|
1778 | |||
1911 | The optional banner argument specify the banner to print |
|
1779 | # batch run -> do not interact | |
1912 | before the first interaction; by default it prints a banner |
|
|||
1913 | similar to the one printed by the real Python interpreter, |
|
|||
1914 | followed by the current class name in parentheses (so as not |
|
|||
1915 | to confuse this with the real interpreter -- since it's so |
|
|||
1916 | close!). |
|
|||
1917 |
|
||||
1918 | """ |
|
|||
1919 |
|
||||
1920 | if self.exit_now: |
|
1780 | if self.exit_now: | |
1921 | # batch run -> do not interact |
|
|||
1922 | return |
|
1781 | return | |
1923 | cprt = 'Type "copyright", "credits" or "license" for more information.' |
|
1782 | ||
1924 |
if banner |
|
1783 | if self.display_banner: | |
1925 | self.write("Python %s on %s\n%s\n(%s)\n" % |
|
1784 | if banner is None: | |
1926 | (sys.version, sys.platform, cprt, |
|
1785 | banner = self.banner | |
1927 | self.__class__.__name__)) |
|
|||
1928 | else: |
|
|||
1929 | self.write(banner) |
|
1786 | self.write(banner) | |
1930 |
|
1787 | |||
1931 | more = 0 |
|
1788 | more = 0 | |
@@ -1954,7 +1811,7 class InteractiveShell(object,Magic): | |||||
1954 | except: |
|
1811 | except: | |
1955 | self.showtraceback() |
|
1812 | self.showtraceback() | |
1956 | try: |
|
1813 | try: | |
1957 | line = self.raw_input(prompt,more) |
|
1814 | line = self.raw_input(prompt, more) | |
1958 | if self.exit_now: |
|
1815 | if self.exit_now: | |
1959 | # quick exit on sys.std[in|out] close |
|
1816 | # quick exit on sys.std[in|out] close | |
1960 | break |
|
1817 | break | |
@@ -1992,7 +1849,7 class InteractiveShell(object,Magic): | |||||
1992 | else: |
|
1849 | else: | |
1993 | more = self.push(line) |
|
1850 | more = self.push(line) | |
1994 | if (self.SyntaxTB.last_syntax_error and |
|
1851 | if (self.SyntaxTB.last_syntax_error and | |
1995 |
self |
|
1852 | self.autoedit_syntax): | |
1996 | self.edit_syntax_error() |
|
1853 | self.edit_syntax_error() | |
1997 |
|
1854 | |||
1998 | # We are off again... |
|
1855 | # We are off again... | |
@@ -2419,7 +2276,7 class InteractiveShell(object,Magic): | |||||
2419 |
|
2276 | |||
2420 | # print '***cont',continue_prompt # dbg |
|
2277 | # print '***cont',continue_prompt # dbg | |
2421 | # special handlers are only allowed for single line statements |
|
2278 | # special handlers are only allowed for single line statements | |
2422 |
if continue_prompt and not self. |
|
2279 | if continue_prompt and not self.multi_line_specials: | |
2423 | return self.handle_normal(line_info) |
|
2280 | return self.handle_normal(line_info) | |
2424 |
|
2281 | |||
2425 |
|
2282 | |||
@@ -2565,7 +2422,7 class InteractiveShell(object,Magic): | |||||
2565 | # We only apply it to argument-less calls if the autocall |
|
2422 | # We only apply it to argument-less calls if the autocall | |
2566 | # parameter is set to 2. We only need to check that autocall is < |
|
2423 | # parameter is set to 2. We only need to check that autocall is < | |
2567 | # 2, since this function isn't called unless it's at least 1. |
|
2424 | # 2, since this function isn't called unless it's at least 1. | |
2568 |
if not theRest and (self |
|
2425 | if not theRest and (self.autocall < 2) and not force_auto: | |
2569 | newcmd = '%s %s' % (iFun,theRest) |
|
2426 | newcmd = '%s %s' % (iFun,theRest) | |
2570 | auto_rewrite = False |
|
2427 | auto_rewrite = False | |
2571 | else: |
|
2428 | else: | |
@@ -2623,7 +2480,7 class InteractiveShell(object,Magic): | |||||
2623 | #print 'line:<%r>' % line # dbg |
|
2480 | #print 'line:<%r>' % line # dbg | |
2624 | self.magic_pinfo(line) |
|
2481 | self.magic_pinfo(line) | |
2625 | else: |
|
2482 | else: | |
2626 |
page(self.usage,screen_lines=self. |
|
2483 | page(self.usage,screen_lines=self.screen_length) | |
2627 | return '' # Empty string is needed here! |
|
2484 | return '' # Empty string is needed here! | |
2628 | except: |
|
2485 | except: | |
2629 | # Pass any other exceptions through to the normal handler |
|
2486 | # Pass any other exceptions through to the normal handler | |
@@ -2653,6 +2510,21 class InteractiveShell(object,Magic): | |||||
2653 | # The input cache shouldn't be updated |
|
2510 | # The input cache shouldn't be updated | |
2654 | return line_info.line |
|
2511 | return line_info.line | |
2655 |
|
2512 | |||
|
2513 | def var_expand(self,cmd,depth=0): | |||
|
2514 | """Expand python variables in a string. | |||
|
2515 | ||||
|
2516 | The depth argument indicates how many frames above the caller should | |||
|
2517 | be walked to look for the local namespace where to expand variables. | |||
|
2518 | ||||
|
2519 | The global namespace for expansion is always the user's interactive | |||
|
2520 | namespace. | |||
|
2521 | """ | |||
|
2522 | ||||
|
2523 | return str(ItplNS(cmd, | |||
|
2524 | self.user_ns, # globals | |||
|
2525 | # Skip our own frame in searching for locals: | |||
|
2526 | sys._getframe(depth+1).f_locals # locals | |||
|
2527 | )) | |||
2656 |
|
2528 | |||
2657 | def mktempfile(self,data=None): |
|
2529 | def mktempfile(self,data=None): | |
2658 | """Make a new tempfile and return its filename. |
|
2530 | """Make a new tempfile and return its filename. | |
@@ -2690,8 +2562,8 class InteractiveShell(object,Magic): | |||||
2690 | """Handle interactive exit. |
|
2562 | """Handle interactive exit. | |
2691 |
|
2563 | |||
2692 | This method calls the ask_exit callback.""" |
|
2564 | This method calls the ask_exit callback.""" | |
2693 |
|
2565 | print "IN self.exit", self.confirm_exit | ||
2694 |
if self. |
|
2566 | if self.confirm_exit: | |
2695 | if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'): |
|
2567 | if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'): | |
2696 | self.ask_exit() |
|
2568 | self.ask_exit() | |
2697 | else: |
|
2569 | else: |
@@ -47,6 +47,7 import warnings | |||||
47 | # Our own |
|
47 | # Our own | |
48 | from IPython.utils import DPyGetOpt |
|
48 | from IPython.utils import DPyGetOpt | |
49 | from IPython.core import release |
|
49 | from IPython.core import release | |
|
50 | from IPython.core.oldusersetup import user_setup | |||
50 | from IPython.utils.ipstruct import Struct |
|
51 | from IPython.utils.ipstruct import Struct | |
51 | from IPython.core.outputtrap import OutputTrap |
|
52 | from IPython.core.outputtrap import OutputTrap | |
52 | from IPython.config.configloader import ConfigLoader |
|
53 | from IPython.config.configloader import ConfigLoader | |
@@ -356,11 +357,11 object? -> Details about 'object'. ?object also works, ?? prints more. | |||||
356 | # Create user config directory if it doesn't exist. This must be done |
|
357 | # Create user config directory if it doesn't exist. This must be done | |
357 | # *after* getting the cmd line options. |
|
358 | # *after* getting the cmd line options. | |
358 | if not os.path.isdir(opts_all.ipythondir): |
|
359 | if not os.path.isdir(opts_all.ipythondir): | |
359 |
|
|
360 | user_setup(opts_all.ipythondir,rc_suffix,'install') | |
360 |
|
361 | |||
361 | # upgrade user config files while preserving a copy of the originals |
|
362 | # upgrade user config files while preserving a copy of the originals | |
362 | if opts_all.upgrade: |
|
363 | if opts_all.upgrade: | |
363 |
|
|
364 | user_setup(opts_all.ipythondir,rc_suffix,'upgrade') | |
364 |
|
365 | |||
365 | # check mutually exclusive options in the *original* command line |
|
366 | # check mutually exclusive options in the *original* command line | |
366 | mutex_opts(opts,[qw('log logfile'),qw('rcfile profile'), |
|
367 | mutex_opts(opts,[qw('log logfile'),qw('rcfile profile'), |
@@ -378,7 +378,7 python-profiler package from non-free.""") | |||||
378 | mesc = self.shell.ESC_MAGIC |
|
378 | mesc = self.shell.ESC_MAGIC | |
379 | print 'Available magic functions:\n'+mesc+\ |
|
379 | print 'Available magic functions:\n'+mesc+\ | |
380 | (' '+mesc).join(self.lsmagic()) |
|
380 | (' '+mesc).join(self.lsmagic()) | |
381 |
print '\n' + Magic.auto_status[self.shell. |
|
381 | print '\n' + Magic.auto_status[self.shell.automagic] | |
382 | return None |
|
382 | return None | |
383 |
|
383 | |||
384 | def magic_magic(self, parameter_s = ''): |
|
384 | def magic_magic(self, parameter_s = ''): | |
@@ -483,9 +483,9 Currently the magic system has the following functions:\n""" | |||||
483 | "\n\n%s%s\n\n%s" % (outmsg, |
|
483 | "\n\n%s%s\n\n%s" % (outmsg, | |
484 | magic_docs,mesc,mesc, |
|
484 | magic_docs,mesc,mesc, | |
485 | (' '+mesc).join(self.lsmagic()), |
|
485 | (' '+mesc).join(self.lsmagic()), | |
486 |
Magic.auto_status[self.shell. |
|
486 | Magic.auto_status[self.shell.automagic] ) ) | |
487 |
|
487 | |||
488 |
page(outmsg,screen_lines=self.shell. |
|
488 | page(outmsg,screen_lines=self.shell.screen_length) | |
489 |
|
489 | |||
490 |
|
490 | |||
491 | def magic_autoindent(self, parameter_s = ''): |
|
491 | def magic_autoindent(self, parameter_s = ''): | |
@@ -512,15 +512,14 Currently the magic system has the following functions:\n""" | |||||
512 | delete the variable (del var), the previously shadowed magic function |
|
512 | delete the variable (del var), the previously shadowed magic function | |
513 | becomes visible to automagic again.""" |
|
513 | becomes visible to automagic again.""" | |
514 |
|
514 | |||
515 | rc = self.shell.rc |
|
|||
516 | arg = parameter_s.lower() |
|
515 | arg = parameter_s.lower() | |
517 | if parameter_s in ('on','1','true'): |
|
516 | if parameter_s in ('on','1','true'): | |
518 |
|
|
517 | self.shell.automagic = True | |
519 | elif parameter_s in ('off','0','false'): |
|
518 | elif parameter_s in ('off','0','false'): | |
520 |
|
|
519 | self.shell.automagic = False | |
521 | else: |
|
520 | else: | |
522 |
|
|
521 | self.shell.automagic = not self.shell.automagic | |
523 |
print '\n' + Magic.auto_status[ |
|
522 | print '\n' + Magic.auto_status[self.shell.automagic] | |
524 |
|
523 | |||
525 | @testdec.skip_doctest |
|
524 | @testdec.skip_doctest | |
526 | def magic_autocall(self, parameter_s = ''): |
|
525 | def magic_autocall(self, parameter_s = ''): | |
@@ -566,8 +565,6 Currently the magic system has the following functions:\n""" | |||||
566 | # all-random (note for auto-testing) |
|
565 | # all-random (note for auto-testing) | |
567 | """ |
|
566 | """ | |
568 |
|
567 | |||
569 | rc = self.shell.rc |
|
|||
570 |
|
||||
571 | if parameter_s: |
|
568 | if parameter_s: | |
572 | arg = int(parameter_s) |
|
569 | arg = int(parameter_s) | |
573 | else: |
|
570 | else: | |
@@ -578,18 +575,18 Currently the magic system has the following functions:\n""" | |||||
578 | return |
|
575 | return | |
579 |
|
576 | |||
580 | if arg in (0,1,2): |
|
577 | if arg in (0,1,2): | |
581 |
|
|
578 | self.shell.autocall = arg | |
582 | else: # toggle |
|
579 | else: # toggle | |
583 |
if |
|
580 | if self.shell.autocall: | |
584 |
self._magic_state.autocall_save = |
|
581 | self._magic_state.autocall_save = self.shell.autocall | |
585 |
|
|
582 | self.shell.autocall = 0 | |
586 | else: |
|
583 | else: | |
587 | try: |
|
584 | try: | |
588 |
|
|
585 | self.shell.autocall = self._magic_state.autocall_save | |
589 | except AttributeError: |
|
586 | except AttributeError: | |
590 |
|
|
587 | self.shell.autocall = self._magic_state.autocall_save = 1 | |
591 |
|
588 | |||
592 |
print "Automatic calling is:",['OFF','Smart','Full'][ |
|
589 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] | |
593 |
|
590 | |||
594 | def magic_system_verbose(self, parameter_s = ''): |
|
591 | def magic_system_verbose(self, parameter_s = ''): | |
595 | """Set verbose printing of system calls. |
|
592 | """Set verbose printing of system calls. | |
@@ -600,10 +597,13 Currently the magic system has the following functions:\n""" | |||||
600 | val = bool(eval(parameter_s)) |
|
597 | val = bool(eval(parameter_s)) | |
601 | else: |
|
598 | else: | |
602 | val = None |
|
599 | val = None | |
603 |
|
600 | |||
604 |
self.shell. |
|
601 | if self.shell.system_verbose: | |
|
602 | self.shell.system_verbose = False | |||
|
603 | else: | |||
|
604 | self.shell.system_verbose = True | |||
605 | print "System verbose printing is:",\ |
|
605 | print "System verbose printing is:",\ | |
606 |
['OFF','ON'][self.shell. |
|
606 | ['OFF','ON'][self.shell.system_verbose] | |
607 |
|
607 | |||
608 |
|
608 | |||
609 | def magic_page(self, parameter_s=''): |
|
609 | def magic_page(self, parameter_s=''): | |
@@ -633,8 +633,8 Currently the magic system has the following functions:\n""" | |||||
633 |
|
633 | |||
634 | def magic_profile(self, parameter_s=''): |
|
634 | def magic_profile(self, parameter_s=''): | |
635 | """Print your currently active IPyhton profile.""" |
|
635 | """Print your currently active IPyhton profile.""" | |
636 |
if self.shell. |
|
636 | if self.shell.profile: | |
637 |
printpl('Current IPython profile: $self.shell. |
|
637 | printpl('Current IPython profile: $self.shell.profile.') | |
638 | else: |
|
638 | else: | |
639 | print 'No profile active.' |
|
639 | print 'No profile active.' | |
640 |
|
640 | |||
@@ -848,7 +848,7 Currently the magic system has the following functions:\n""" | |||||
848 | elif opts.has_key('c'): |
|
848 | elif opts.has_key('c'): | |
849 | ignore_case = False |
|
849 | ignore_case = False | |
850 | else: |
|
850 | else: | |
851 |
ignore_case = not shell. |
|
851 | ignore_case = not shell.wildcards_case_sensitive | |
852 |
|
852 | |||
853 | # Build list of namespaces to search from user options |
|
853 | # Build list of namespaces to search from user options | |
854 | def_search.extend(opt('s',[])) |
|
854 | def_search.extend(opt('s',[])) | |
@@ -1132,7 +1132,6 Currently the magic system has the following functions:\n""" | |||||
1132 | log_raw_input = 'r' in opts |
|
1132 | log_raw_input = 'r' in opts | |
1133 | timestamp = 't' in opts |
|
1133 | timestamp = 't' in opts | |
1134 |
|
1134 | |||
1135 | rc = self.shell.rc |
|
|||
1136 | logger = self.shell.logger |
|
1135 | logger = self.shell.logger | |
1137 |
|
1136 | |||
1138 | # if no args are given, the defaults set in the logger constructor by |
|
1137 | # if no args are given, the defaults set in the logger constructor by | |
@@ -1149,11 +1148,14 Currently the magic system has the following functions:\n""" | |||||
1149 | # put logfname into rc struct as if it had been called on the command |
|
1148 | # put logfname into rc struct as if it had been called on the command | |
1150 | # line, so it ends up saved in the log header Save it in case we need |
|
1149 | # line, so it ends up saved in the log header Save it in case we need | |
1151 | # to restore it... |
|
1150 | # to restore it... | |
1152 |
old_logfile = |
|
1151 | old_logfile = self.shell.logfile | |
1153 | if logfname: |
|
1152 | if logfname: | |
1154 | logfname = os.path.expanduser(logfname) |
|
1153 | logfname = os.path.expanduser(logfname) | |
1155 |
|
|
1154 | self.shell.logfile = logfname | |
1156 | loghead = self.shell.loghead_tpl % (rc.opts,rc.args) |
|
1155 | # TODO: we need to re-think how logs with args/opts are replayed | |
|
1156 | # and tracked. | |||
|
1157 | # loghead = self.shell.loghead_tpl % (rc.opts,rc.args) | |||
|
1158 | loghead = self.shell.loghead_tpl % ('','') | |||
1157 | try: |
|
1159 | try: | |
1158 | started = logger.logstart(logfname,loghead,logmode, |
|
1160 | started = logger.logstart(logfname,loghead,logmode, | |
1159 | log_output,timestamp,log_raw_input) |
|
1161 | log_output,timestamp,log_raw_input) | |
@@ -1421,7 +1423,7 Currently the magic system has the following functions:\n""" | |||||
1421 | output = stdout_trap.getvalue() |
|
1423 | output = stdout_trap.getvalue() | |
1422 | output = output.rstrip() |
|
1424 | output = output.rstrip() | |
1423 |
|
1425 | |||
1424 |
page(output,screen_lines=self.shell. |
|
1426 | page(output,screen_lines=self.shell.screen_length) | |
1425 | print sys_exit, |
|
1427 | print sys_exit, | |
1426 |
|
1428 | |||
1427 | dump_file = opts.D[0] |
|
1429 | dump_file = opts.D[0] | |
@@ -1622,7 +1624,7 Currently the magic system has the following functions:\n""" | |||||
1622 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) |
|
1624 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) | |
1623 | else: |
|
1625 | else: | |
1624 | if opts.has_key('d'): |
|
1626 | if opts.has_key('d'): | |
1625 |
deb = debugger.Pdb(self.shell. |
|
1627 | deb = debugger.Pdb(self.shell.colors) | |
1626 | # reset Breakpoint state, which is moronically kept |
|
1628 | # reset Breakpoint state, which is moronically kept | |
1627 | # in a class |
|
1629 | # in a class | |
1628 | bdb.Breakpoint.next = 1 |
|
1630 | bdb.Breakpoint.next = 1 | |
@@ -2492,7 +2494,7 Defaulting color scheme to 'NoColor'""" | |||||
2492 | except: |
|
2494 | except: | |
2493 | color_switch_err('prompt') |
|
2495 | color_switch_err('prompt') | |
2494 | else: |
|
2496 | else: | |
2495 |
shell |
|
2497 | shell.colors = \ | |
2496 | shell.outputcache.color_table.active_scheme_name |
|
2498 | shell.outputcache.color_table.active_scheme_name | |
2497 | # Set exception colors |
|
2499 | # Set exception colors | |
2498 | try: |
|
2500 | try: | |
@@ -2509,7 +2511,7 Defaulting color scheme to 'NoColor'""" | |||||
2509 | color_switch_err('system exception handler') |
|
2511 | color_switch_err('system exception handler') | |
2510 |
|
2512 | |||
2511 | # Set info (for 'object?') colors |
|
2513 | # Set info (for 'object?') colors | |
2512 |
if shell. |
|
2514 | if shell.color_info: | |
2513 | try: |
|
2515 | try: | |
2514 | shell.inspector.set_active_scheme(new_scheme) |
|
2516 | shell.inspector.set_active_scheme(new_scheme) | |
2515 | except: |
|
2517 | except: | |
@@ -2528,17 +2530,17 Defaulting color scheme to 'NoColor'""" | |||||
2528 | than more) in your system, using colored object information displays |
|
2530 | than more) in your system, using colored object information displays | |
2529 | will not work properly. Test it and see.""" |
|
2531 | will not work properly. Test it and see.""" | |
2530 |
|
2532 | |||
2531 |
self.shell |
|
2533 | self.shell.color_info = 1 - self.shell.color_info | |
2532 |
self.magic_colors(self.shell. |
|
2534 | self.magic_colors(self.shell.colors) | |
2533 | print 'Object introspection functions have now coloring:', |
|
2535 | print 'Object introspection functions have now coloring:', | |
2534 |
print ['OFF','ON'][self.shell. |
|
2536 | print ['OFF','ON'][self.shell.color_info] | |
2535 |
|
2537 | |||
2536 | def magic_Pprint(self, parameter_s=''): |
|
2538 | def magic_Pprint(self, parameter_s=''): | |
2537 | """Toggle pretty printing on/off.""" |
|
2539 | """Toggle pretty printing on/off.""" | |
2538 |
|
2540 | |||
2539 |
self.shell |
|
2541 | self.shell.pprint = 1 - self.shell.pprint | |
2540 | print 'Pretty printing has been turned', \ |
|
2542 | print 'Pretty printing has been turned', \ | |
2541 |
['OFF','ON'][self.shell. |
|
2543 | ['OFF','ON'][self.shell.pprint] | |
2542 |
|
2544 | |||
2543 | def magic_exit(self, parameter_s=''): |
|
2545 | def magic_exit(self, parameter_s=''): | |
2544 | """Exit IPython, confirming if configured to do so. |
|
2546 | """Exit IPython, confirming if configured to do so. | |
@@ -2853,8 +2855,8 Defaulting color scheme to 'NoColor'""" | |||||
2853 | if ps: |
|
2855 | if ps: | |
2854 | try: |
|
2856 | try: | |
2855 | os.chdir(os.path.expanduser(ps)) |
|
2857 | os.chdir(os.path.expanduser(ps)) | |
2856 |
if self.shell. |
|
2858 | if self.shell.term_title: | |
2857 |
#print 'set term title:',self.shell. |
|
2859 | #print 'set term title:',self.shell.term_title # dbg | |
2858 | platutils.set_term_title('IPy ' + abbrev_cwd()) |
|
2860 | platutils.set_term_title('IPy ' + abbrev_cwd()) | |
2859 | except OSError: |
|
2861 | except OSError: | |
2860 | print sys.exc_info()[1] |
|
2862 | print sys.exc_info()[1] | |
@@ -2867,7 +2869,7 Defaulting color scheme to 'NoColor'""" | |||||
2867 |
|
2869 | |||
2868 | else: |
|
2870 | else: | |
2869 | os.chdir(self.shell.home_dir) |
|
2871 | os.chdir(self.shell.home_dir) | |
2870 |
if self.shell. |
|
2872 | if self.shell.term_title: | |
2871 | platutils.set_term_title("IPy ~") |
|
2873 | platutils.set_term_title("IPy ~") | |
2872 | cwd = os.getcwd() |
|
2874 | cwd = os.getcwd() | |
2873 | dhist = self.shell.user_ns['_dh'] |
|
2875 | dhist = self.shell.user_ns['_dh'] | |
@@ -3171,7 +3173,7 Defaulting color scheme to 'NoColor'""" | |||||
3171 | esc_magic = self.shell.ESC_MAGIC |
|
3173 | esc_magic = self.shell.ESC_MAGIC | |
3172 | # Identify magic commands even if automagic is on (which means |
|
3174 | # Identify magic commands even if automagic is on (which means | |
3173 | # the in-memory version is different from that typed by the user). |
|
3175 | # the in-memory version is different from that typed by the user). | |
3174 |
if self.shell. |
|
3176 | if self.shell.automagic: | |
3175 | start_magic = esc_magic+start |
|
3177 | start_magic = esc_magic+start | |
3176 | else: |
|
3178 | else: | |
3177 | start_magic = start |
|
3179 | start_magic = start | |
@@ -3265,7 +3267,7 Defaulting color scheme to 'NoColor'""" | |||||
3265 | return |
|
3267 | return | |
3266 |
|
3268 | |||
3267 | page(self.shell.pycolorize(cont), |
|
3269 | page(self.shell.pycolorize(cont), | |
3268 |
screen_lines=self.shell. |
|
3270 | screen_lines=self.shell.screen_length) | |
3269 |
|
3271 | |||
3270 | def _rerun_pasted(self): |
|
3272 | def _rerun_pasted(self): | |
3271 | """ Rerun a previously pasted command. |
|
3273 | """ Rerun a previously pasted command. | |
@@ -3438,7 +3440,7 Defaulting color scheme to 'NoColor'""" | |||||
3438 | ipinstallation = path(IPython.__file__).dirname() |
|
3440 | ipinstallation = path(IPython.__file__).dirname() | |
3439 | upgrade_script = '%s "%s"' % (sys.executable,ipinstallation / 'utils' / 'upgradedir.py') |
|
3441 | upgrade_script = '%s "%s"' % (sys.executable,ipinstallation / 'utils' / 'upgradedir.py') | |
3440 | src_config = ipinstallation / 'config' / 'userconfig' |
|
3442 | src_config = ipinstallation / 'config' / 'userconfig' | |
3441 |
userdir = path(ip.options. |
|
3443 | userdir = path(ip.options.IPYTHONDIR) | |
3442 | cmd = '%s "%s" "%s"' % (upgrade_script, src_config, userdir) |
|
3444 | cmd = '%s "%s" "%s"' % (upgrade_script, src_config, userdir) | |
3443 | print ">",cmd |
|
3445 | print ">",cmd | |
3444 | shell(cmd) |
|
3446 | shell(cmd) | |
@@ -3478,7 +3480,6 Defaulting color scheme to 'NoColor'""" | |||||
3478 | # Shorthands |
|
3480 | # Shorthands | |
3479 | shell = self.shell |
|
3481 | shell = self.shell | |
3480 | oc = shell.outputcache |
|
3482 | oc = shell.outputcache | |
3481 | rc = shell.rc |
|
|||
3482 | meta = shell.meta |
|
3483 | meta = shell.meta | |
3483 | # dstore is a data store kept in the instance metadata bag to track any |
|
3484 | # dstore is a data store kept in the instance metadata bag to track any | |
3484 | # changes we make, so we can undo them later. |
|
3485 | # changes we make, so we can undo them later. | |
@@ -3487,12 +3488,12 Defaulting color scheme to 'NoColor'""" | |||||
3487 |
|
3488 | |||
3488 | # save a few values we'll need to recover later |
|
3489 | # save a few values we'll need to recover later | |
3489 | mode = save_dstore('mode',False) |
|
3490 | mode = save_dstore('mode',False) | |
3490 |
save_dstore('rc_pprint', |
|
3491 | save_dstore('rc_pprint',shell.pprint) | |
3491 | save_dstore('xmode',shell.InteractiveTB.mode) |
|
3492 | save_dstore('xmode',shell.InteractiveTB.mode) | |
3492 |
save_dstore('rc_separate_out', |
|
3493 | save_dstore('rc_separate_out',shell.separate_out) | |
3493 |
save_dstore('rc_separate_out2', |
|
3494 | save_dstore('rc_separate_out2',shell.separate_out2) | |
3494 |
save_dstore('rc_prompts_pad_left', |
|
3495 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) | |
3495 |
save_dstore('rc_separate_in', |
|
3496 | save_dstore('rc_separate_in',shell.separate_in) | |
3496 |
|
3497 | |||
3497 | if mode == False: |
|
3498 | if mode == False: | |
3498 | # turn on |
|
3499 | # turn on | |
@@ -3510,7 +3511,7 Defaulting color scheme to 'NoColor'""" | |||||
3510 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3511 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ | |
3511 | oc.prompt_out.pad_left = False |
|
3512 | oc.prompt_out.pad_left = False | |
3512 |
|
3513 | |||
3513 |
|
|
3514 | shell.pprint = False | |
3514 |
|
3515 | |||
3515 | shell.magic_xmode('Plain') |
|
3516 | shell.magic_xmode('Plain') | |
3516 |
|
3517 | |||
@@ -3518,9 +3519,9 Defaulting color scheme to 'NoColor'""" | |||||
3518 | # turn off |
|
3519 | # turn off | |
3519 | ipaste.deactivate_prefilter() |
|
3520 | ipaste.deactivate_prefilter() | |
3520 |
|
3521 | |||
3521 |
oc.prompt1.p_template = |
|
3522 | oc.prompt1.p_template = shell.prompt_in1 | |
3522 |
oc.prompt2.p_template = |
|
3523 | oc.prompt2.p_template = shell.prompt_in2 | |
3523 |
oc.prompt_out.p_template = |
|
3524 | oc.prompt_out.p_template = shell.prompt_out | |
3524 |
|
3525 | |||
3525 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in |
|
3526 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in | |
3526 |
|
3527 |
@@ -191,7 +191,7 def checkMultiLineMagic(l_info,ip): | |||||
191 | # iFun and *not* the preChar. Also note that the below test matches |
|
191 | # iFun and *not* the preChar. Also note that the below test matches | |
192 | # both ! and !!. |
|
192 | # both ! and !!. | |
193 | if l_info.continue_prompt \ |
|
193 | if l_info.continue_prompt \ | |
194 |
and ip. |
|
194 | and ip.multi_line_specials: | |
195 | if l_info.iFun.startswith(ip.ESC_MAGIC): |
|
195 | if l_info.iFun.startswith(ip.ESC_MAGIC): | |
196 | return ip.handle_magic |
|
196 | return ip.handle_magic | |
197 | else: |
|
197 | else: | |
@@ -231,11 +231,11 def checkAutomagic(l_info,ip): | |||||
231 | check_esc_chars. This just checks for automagic. Also, before |
|
231 | check_esc_chars. This just checks for automagic. Also, before | |
232 | triggering the magic handler, make sure that there is nothing in the |
|
232 | triggering the magic handler, make sure that there is nothing in the | |
233 | user namespace which could shadow it.""" |
|
233 | user namespace which could shadow it.""" | |
234 |
if not ip |
|
234 | if not ip.automagic or not hasattr(ip,'magic_'+l_info.iFun): | |
235 | return None |
|
235 | return None | |
236 |
|
236 | |||
237 | # We have a likely magic method. Make sure we should actually call it. |
|
237 | # We have a likely magic method. Make sure we should actually call it. | |
238 |
if l_info.continue_prompt and not ip. |
|
238 | if l_info.continue_prompt and not ip.multi_line_specials: | |
239 | return None |
|
239 | return None | |
240 |
|
240 | |||
241 | head = l_info.iFun.split('.',1)[0] |
|
241 | head = l_info.iFun.split('.',1)[0] | |
@@ -271,7 +271,7 def checkPythonOps(l_info,ip): | |||||
271 |
|
271 | |||
272 | def checkAutocall(l_info,ip): |
|
272 | def checkAutocall(l_info,ip): | |
273 | "Check if the initial word/function is callable and autocall is on." |
|
273 | "Check if the initial word/function is callable and autocall is on." | |
274 |
if not ip. |
|
274 | if not ip.autocall: | |
275 | return None |
|
275 | return None | |
276 |
|
276 | |||
277 | oinfo = l_info.ofind(ip) # This can mutate state via getattr |
|
277 | oinfo = l_info.ofind(ip) # This can mutate state via getattr |
@@ -159,9 +159,9 class IPShellEmbed: | |||||
159 | sys.displayhook = self.sys_displayhook_ori |
|
159 | sys.displayhook = self.sys_displayhook_ori | |
160 | # don't use the ipython crash handler so that user exceptions aren't |
|
160 | # don't use the ipython crash handler so that user exceptions aren't | |
161 | # trapped |
|
161 | # trapped | |
162 |
sys.excepthook = ultratb.FormattedTB(color_scheme = self.IP. |
|
162 | sys.excepthook = ultratb.FormattedTB(color_scheme = self.IP.colors, | |
163 |
mode = self.IP. |
|
163 | mode = self.IP.xmode, | |
164 |
call_pdb = self.IP. |
|
164 | call_pdb = self.IP.pdb) | |
165 | self.restore_system_completer() |
|
165 | self.restore_system_completer() | |
166 |
|
166 | |||
167 | def restore_system_completer(self): |
|
167 | def restore_system_completer(self): |
@@ -15,6 +15,7 import nose.tools as nt | |||||
15 | # our own packages |
|
15 | # our own packages | |
16 | from IPython.core import iplib |
|
16 | from IPython.core import iplib | |
17 | from IPython.core import ipapi |
|
17 | from IPython.core import ipapi | |
|
18 | from IPython.core.oldusersetup import user_setup | |||
18 |
|
19 | |||
19 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
20 | # Globals |
|
21 | # Globals | |
@@ -59,12 +60,12 def test_reset(): | |||||
59 | # make sure that user_setup can be run re-entrantly in 'install' mode. |
|
60 | # make sure that user_setup can be run re-entrantly in 'install' mode. | |
60 | def test_user_setup(): |
|
61 | def test_user_setup(): | |
61 | # use a lambda to pass kwargs to the generator |
|
62 | # use a lambda to pass kwargs to the generator | |
62 |
user_setup = lambda a,k: |
|
63 | user_setup = lambda a,k: user_setup(*a,**k) | |
63 | kw = dict(mode='install', interactive=False) |
|
64 | kw = dict(mode='install', interactive=False) | |
64 |
|
65 | |||
65 | # Call the user setup and verify that the directory exists |
|
66 | # Call the user setup and verify that the directory exists | |
66 |
yield user_setup, (ip.options. |
|
67 | yield user_setup, (ip.options.IPYTHONDIR,''), kw | |
67 |
yield os.path.isdir, ip.options. |
|
68 | yield os.path.isdir, ip.options.IPYTHONDIR | |
68 |
|
69 | |||
69 | # Now repeat the operation with a non-existent directory. Check both that |
|
70 | # Now repeat the operation with a non-existent directory. Check both that | |
70 | # the call succeeds and that the directory is created. |
|
71 | # the call succeeds and that the directory is created. |
@@ -270,7 +270,7 def _formatTracebackLines(lnum, index, lines, Colors, lvals=None,scheme=None): | |||||
270 | if scheme is None: |
|
270 | if scheme is None: | |
271 | ipinst = ipapi.get() |
|
271 | ipinst = ipapi.get() | |
272 | if ipinst is not None: |
|
272 | if ipinst is not None: | |
273 |
scheme = ipinst.IP. |
|
273 | scheme = ipinst.IP.colors | |
274 | else: |
|
274 | else: | |
275 | scheme = DEFAULT_SCHEME |
|
275 | scheme = DEFAULT_SCHEME | |
276 |
|
276 |
@@ -6,6 +6,9 | |||||
6 | # the file COPYING, distributed as part of this software. |
|
6 | # the file COPYING, distributed as part of this software. | |
7 | #***************************************************************************** |
|
7 | #***************************************************************************** | |
8 |
|
8 | |||
|
9 | import sys | |||
|
10 | from IPython.core import release | |||
|
11 | ||||
9 | __doc__ = """ |
|
12 | __doc__ = """ | |
10 | IPython -- An enhanced Interactive Python |
|
13 | IPython -- An enhanced Interactive Python | |
11 | ========================================= |
|
14 | ========================================= | |
@@ -504,6 +507,18 MAIN FEATURES | |||||
504 | >>> x = ,my_function /home/me # syntax error |
|
507 | >>> x = ,my_function /home/me # syntax error | |
505 | """ |
|
508 | """ | |
506 |
|
509 | |||
|
510 | interactive_usage_min = """\ | |||
|
511 | An enhanced console for Python. | |||
|
512 | Some of its features are: | |||
|
513 | - Readline support if the readline library is present. | |||
|
514 | - Tab completion in the local namespace. | |||
|
515 | - Logging of input, see command-line options. | |||
|
516 | - System shell escape via ! , eg !ls. | |||
|
517 | - Magic commands, starting with a % (like %ls, %pwd, %cd, etc.) | |||
|
518 | - Keeps track of locally defined variables via %who, %whos. | |||
|
519 | - Show object information with a ? eg ?x or x? (use ?? for more info). | |||
|
520 | """ | |||
|
521 | ||||
507 | quick_reference = r""" |
|
522 | quick_reference = r""" | |
508 | IPython -- An enhanced Interactive Python - Quick Reference Card |
|
523 | IPython -- An enhanced Interactive Python - Quick Reference Card | |
509 | ================================================================ |
|
524 | ================================================================ | |
@@ -556,3 +571,16 or python names. | |||||
556 | The following magic functions are currently available: |
|
571 | The following magic functions are currently available: | |
557 |
|
572 | |||
558 | """ |
|
573 | """ | |
|
574 | ||||
|
575 | quick_guide = """\ | |||
|
576 | ? -> Introduction and overview of IPython's features. | |||
|
577 | %quickref -> Quick reference. | |||
|
578 | help -> Python's own help system. | |||
|
579 | object? -> Details about 'object'. ?object also works, ?? prints more.""" | |||
|
580 | ||||
|
581 | banner_parts = [ | |||
|
582 | 'Python %s' % (sys.version.split('\n')[0],), | |||
|
583 | 'Type "copyright", "credits" or "license" for more information.\n', | |||
|
584 | 'IPython %s -- An enhanced Interactive Python.' % (release.version,), | |||
|
585 | quick_guide | |||
|
586 | ] |
@@ -140,7 +140,7 def collect(ip,arg): | |||||
140 | Without args, try to open ~/_ipython/collect dir (in win32 at least). |
|
140 | Without args, try to open ~/_ipython/collect dir (in win32 at least). | |
141 | """ |
|
141 | """ | |
142 | from IPython.external.path import path |
|
142 | from IPython.external.path import path | |
143 |
basedir = path(ip.options. |
|
143 | basedir = path(ip.options.IPYTHONDIR + '/collect') | |
144 | try: |
|
144 | try: | |
145 | fs = mglob.expand(arg.split(None,1)[1]) |
|
145 | fs = mglob.expand(arg.split(None,1)[1]) | |
146 | except IndexError: |
|
146 | except IndexError: | |
@@ -169,7 +169,7 def inote(ip,arg): | |||||
169 | Without args, opens notes.txt for editing. |
|
169 | Without args, opens notes.txt for editing. | |
170 | """ |
|
170 | """ | |
171 | import time |
|
171 | import time | |
172 |
fname = ip.options. |
|
172 | fname = ip.options.IPYTHONDIR + '/notes.txt' | |
173 |
|
173 | |||
174 | try: |
|
174 | try: | |
175 | entry = " === " + time.asctime() + ': ===\n' + arg.split(None,1)[1] + '\n' |
|
175 | entry = " === " + time.asctime() + ': ===\n' + arg.split(None,1)[1] + '\n' |
@@ -18,7 +18,7 def call_pydb(self, args): | |||||
18 | argl = arg_split(args) |
|
18 | argl = arg_split(args) | |
19 | # print argl # dbg |
|
19 | # print argl # dbg | |
20 | if len(inspect.getargspec(pydb.runv)[0]) == 2: |
|
20 | if len(inspect.getargspec(pydb.runv)[0]) == 2: | |
21 |
pdb = debugger.Pdb(color_scheme=self. |
|
21 | pdb = debugger.Pdb(color_scheme=self.colors) | |
22 | ip.IP.history_saving_wrapper( lambda : pydb.runv(argl, pdb) )() |
|
22 | ip.IP.history_saving_wrapper( lambda : pydb.runv(argl, pdb) )() | |
23 | else: |
|
23 | else: | |
24 | ip.IP.history_saving_wrapper( lambda : pydb.runv(argl) )() |
|
24 | ip.IP.history_saving_wrapper( lambda : pydb.runv(argl) )() |
@@ -494,7 +494,7 class NonBlockingIPShell(object): | |||||
494 | self._IP.write(str(self._IP.outputcache.prompt_out).strip()) |
|
494 | self._IP.write(str(self._IP.outputcache.prompt_out).strip()) | |
495 | self._iter_more = self._IP.push(line) |
|
495 | self._iter_more = self._IP.push(line) | |
496 | if (self._IP.SyntaxTB.last_syntax_error and \ |
|
496 | if (self._IP.SyntaxTB.last_syntax_error and \ | |
497 |
self._IP. |
|
497 | self._IP.autoedit_syntax): | |
498 | self._IP.edit_syntax_error() |
|
498 | self._IP.edit_syntax_error() | |
499 | if self._iter_more: |
|
499 | if self._iter_more: | |
500 | self._prompt = str(self._IP.outputcache.prompt2).strip() |
|
500 | self._prompt = str(self._IP.outputcache.prompt2).strip() |
@@ -109,7 +109,7 class MyFrame(wx.Frame): | |||||
109 |
|
109 | |||
110 | def optionSave(self, name, value): |
|
110 | def optionSave(self, name, value): | |
111 | ip = get() |
|
111 | ip = get() | |
112 |
path = ip.IP. |
|
112 | path = ip.IP.config.IPYTHONDIR | |
113 | opt = open(path + '/options.conf','w') |
|
113 | opt = open(path + '/options.conf','w') | |
114 |
|
114 | |||
115 | try: |
|
115 | try: | |
@@ -126,7 +126,7 class MyFrame(wx.Frame): | |||||
126 | def optionLoad(self): |
|
126 | def optionLoad(self): | |
127 | try: |
|
127 | try: | |
128 | ip = get() |
|
128 | ip = get() | |
129 |
path = ip.IP. |
|
129 | path = ip.IP.config.IPYTHONDIR | |
130 | opt = open(path + '/options.conf','r') |
|
130 | opt = open(path + '/options.conf','r') | |
131 | lines = opt.readlines() |
|
131 | lines = opt.readlines() | |
132 | opt.close() |
|
132 | opt.close() |
@@ -39,7 +39,7 from IPython.kernel.fcutil import have_crypto | |||||
39 |
|
39 | |||
40 | # Create various ipython directories if they don't exist. |
|
40 | # Create various ipython directories if they don't exist. | |
41 | # This must be done before IPython.kernel.config is imported. |
|
41 | # This must be done before IPython.kernel.config is imported. | |
42 |
from IPython.core. |
|
42 | from IPython.core.oldusersetup import user_setup | |
43 | if os.name == 'posix': |
|
43 | if os.name == 'posix': | |
44 | rc_suffix = '' |
|
44 | rc_suffix = '' | |
45 | else: |
|
45 | else: |
@@ -41,7 +41,7 from IPython.kernel.fcutil import check_furl_file_security | |||||
41 |
|
41 | |||
42 | # Create various ipython directories if they don't exist. |
|
42 | # Create various ipython directories if they don't exist. | |
43 | # This must be done before IPython.kernel.config is imported. |
|
43 | # This must be done before IPython.kernel.config is imported. | |
44 |
from IPython.core. |
|
44 | from IPython.core.oldusersetup import user_setup | |
45 | from IPython.utils.genutils import get_ipython_dir, get_log_dir, get_security_dir |
|
45 | from IPython.utils.genutils import get_ipython_dir, get_log_dir, get_security_dir | |
46 | if os.name == 'posix': |
|
46 | if os.name == 'posix': | |
47 | rc_suffix = '' |
|
47 | rc_suffix = '' |
@@ -36,7 +36,7 from IPython.kernel.engineservice import EngineService | |||||
36 |
|
36 | |||
37 | # Create various ipython directories if they don't exist. |
|
37 | # Create various ipython directories if they don't exist. | |
38 | # This must be done before IPython.kernel.config is imported. |
|
38 | # This must be done before IPython.kernel.config is imported. | |
39 |
from IPython.core. |
|
39 | from IPython.core.oldusersetup import user_setup | |
40 | from IPython.utils.genutils import get_ipython_dir, get_log_dir, get_security_dir |
|
40 | from IPython.utils.genutils import get_ipython_dir, get_log_dir, get_security_dir | |
41 | if os.name == 'posix': |
|
41 | if os.name == 'posix': | |
42 | rc_suffix = '' |
|
42 | rc_suffix = '' |
General Comments 0
You need to be logged in to leave comments.
Login now