Show More
@@ -1,504 +1,557 | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Robert Kern |
|
8 | 8 | * Brian Granger |
|
9 | 9 | """ |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | # Copyright (c) 2010, IPython Development Team. |
|
12 | 12 | # |
|
13 | 13 | # Distributed under the terms of the Modified BSD License. |
|
14 | 14 | # |
|
15 | 15 | # The full license is in the file COPYING.txt, distributed with this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | # Stdlib imports |
|
23 | import sys | |
|
23 | 24 | import abc |
|
24 | 25 | # We must use StringIO, as cStringIO doesn't handle unicode properly. |
|
25 | 26 | from StringIO import StringIO |
|
26 | 27 | |
|
27 | 28 | # Our own imports |
|
28 | 29 | from IPython.config.configurable import Configurable |
|
29 | 30 | from IPython.external import pretty |
|
30 | from IPython.utils.traitlets import Bool, Dict, Int, Str | |
|
31 | from IPython.utils.traitlets import Bool, Dict, Int, Str, CStr | |
|
31 | 32 | |
|
32 | 33 | |
|
33 | 34 | #----------------------------------------------------------------------------- |
|
34 | 35 | # The main DisplayFormatter class |
|
35 | 36 | #----------------------------------------------------------------------------- |
|
36 | 37 | |
|
37 | 38 | |
|
38 | 39 | class DisplayFormatter(Configurable): |
|
39 | 40 | |
|
40 | 41 | # When set to true only the default plain text formatter will be used. |
|
41 | 42 | plain_text_only = Bool(False, config=True) |
|
42 | 43 | |
|
43 | 44 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
44 | 45 | # values are subclasses of BaseFormatter. |
|
45 | 46 | formatters = Dict(config=True) |
|
46 | 47 | def _formatters_default(self): |
|
47 | 48 | """Activate the default formatters.""" |
|
48 | 49 | formatter_classes = [ |
|
49 | 50 | PlainTextFormatter, |
|
50 | 51 | HTMLFormatter, |
|
51 | 52 | SVGFormatter, |
|
52 | 53 | PNGFormatter, |
|
53 | 54 | LatexFormatter, |
|
54 | 55 | JSONFormatter |
|
55 | 56 | ] |
|
56 | 57 | d = {} |
|
57 | 58 | for cls in formatter_classes: |
|
58 | 59 | f = cls(config=self.config) |
|
59 | 60 | d[f.format_type] = f |
|
60 | 61 | return d |
|
61 | 62 | |
|
62 | 63 | def format(self, obj, include=None, exclude=None): |
|
63 | 64 | """Return a format data dict for an object. |
|
64 | 65 | |
|
65 | 66 | By default all format types will be computed. |
|
66 | 67 | |
|
67 | 68 | The following MIME types are currently implemented: |
|
68 | 69 | |
|
69 | 70 | * text/plain |
|
70 | 71 | * text/html |
|
71 | 72 | * text/latex |
|
72 | 73 | * application/json |
|
73 | 74 | * image/png |
|
74 | 75 | * immage/svg+xml |
|
75 | 76 | |
|
76 | 77 | Parameters |
|
77 | 78 | ---------- |
|
78 | 79 | obj : object |
|
79 | 80 | The Python object whose format data will be computed. |
|
80 | 81 | include : list or tuple, optional |
|
81 | 82 | A list of format type strings (MIME types) to include in the |
|
82 | 83 | format data dict. If this is set *only* the format types included |
|
83 | 84 | in this list will be computed. |
|
84 | 85 | exclude : list or tuple, optional |
|
85 | 86 | A list of format type string (MIME types) to exclue in the format |
|
86 | 87 | data dict. If this is set all format types will be computed, |
|
87 | 88 | except for those included in this argument. |
|
88 | 89 | |
|
89 | 90 | Returns |
|
90 | 91 | ------- |
|
91 | 92 | format_dict : dict |
|
92 | 93 | A dictionary of key/value pairs, one or each format that was |
|
93 | 94 | generated for the object. The keys are the format types, which |
|
94 | 95 | will usually be MIME type strings and the values and JSON'able |
|
95 | 96 | data structure containing the raw data for the representation in |
|
96 | 97 | that format. |
|
97 | 98 | """ |
|
98 | 99 | format_dict = {} |
|
99 | 100 | |
|
100 | 101 | # If plain text only is active |
|
101 | 102 | if self.plain_text_only: |
|
102 | 103 | formatter = self.formatters['text/plain'] |
|
103 | 104 | try: |
|
104 | 105 | data = formatter(obj) |
|
105 | 106 | except: |
|
106 | 107 | # FIXME: log the exception |
|
107 | 108 | raise |
|
108 | 109 | if data is not None: |
|
109 | 110 | format_dict['text/plain'] = data |
|
110 | 111 | return format_dict |
|
111 | 112 | |
|
112 | 113 | for format_type, formatter in self.formatters.items(): |
|
113 | 114 | if include is not None: |
|
114 | 115 | if format_type not in include: |
|
115 | 116 | continue |
|
116 | 117 | if exclude is not None: |
|
117 | 118 | if format_type in exclude: |
|
118 | 119 | continue |
|
119 | 120 | try: |
|
120 | 121 | data = formatter(obj) |
|
121 | 122 | except: |
|
122 | 123 | # FIXME: log the exception |
|
123 | 124 | raise |
|
124 | 125 | if data is not None: |
|
125 | 126 | format_dict[format_type] = data |
|
126 | 127 | return format_dict |
|
127 | 128 | |
|
128 | 129 | @property |
|
129 | 130 | def format_types(self): |
|
130 | 131 | """Return the format types (MIME types) of the active formatters.""" |
|
131 | 132 | return self.formatters.keys() |
|
132 | 133 | |
|
133 | 134 | |
|
134 | 135 | #----------------------------------------------------------------------------- |
|
135 | 136 | # Formatters for specific format types (text, html, svg, etc.) |
|
136 | 137 | #----------------------------------------------------------------------------- |
|
137 | 138 | |
|
138 | 139 | |
|
139 | 140 | class FormatterABC(object): |
|
140 | 141 | """ Abstract base class for Formatters. |
|
141 | 142 | |
|
142 | 143 | A formatter is a callable class that is responsible for computing the |
|
143 | 144 | raw format data for a particular format type (MIME type). For example, |
|
144 | 145 | an HTML formatter would have a format type of `text/html` and would return |
|
145 | 146 | the HTML representation of the object when called. |
|
146 | 147 | """ |
|
147 | 148 | __metaclass__ = abc.ABCMeta |
|
148 | 149 | |
|
149 | 150 | # The format type of the data returned, usually a MIME type. |
|
150 | 151 | format_type = 'text/plain' |
|
151 | 152 | |
|
152 | 153 | # Is the formatter enabled... |
|
153 | 154 | enabled = True |
|
154 | 155 | |
|
155 | 156 | @abc.abstractmethod |
|
156 | 157 | def __call__(self, obj): |
|
157 | 158 | """Return a JSON'able representation of the object. |
|
158 | 159 | |
|
159 | 160 | If the object cannot be formatted by this formatter, then return None |
|
160 | 161 | """ |
|
161 | 162 | try: |
|
162 | 163 | return repr(obj) |
|
163 | 164 | except TypeError: |
|
164 | 165 | return None |
|
165 | 166 | |
|
166 | 167 | |
|
167 | 168 | class BaseFormatter(Configurable): |
|
168 | 169 | """A base formatter class that is configurable. |
|
169 | 170 | |
|
170 | 171 | This formatter should usually be used as the base class of all formatters. |
|
171 | 172 | It is a traited :class:`Configurable` class and includes an extensible |
|
172 | 173 | API for users to determine how their objects are formatted. The following |
|
173 | 174 | logic is used to find a function to format an given object. |
|
174 | 175 | |
|
175 | 176 | 1. The object is introspected to see if it has a method with the name |
|
176 | 177 | :attr:`print_method`. If is does, that object is passed to that method |
|
177 | 178 | for formatting. |
|
178 | 179 | 2. If no print method is found, three internal dictionaries are consulted |
|
179 | 180 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
180 | 181 | and :attr:`deferred_printers`. |
|
181 | 182 | |
|
182 | 183 | Users should use these dictionaries to register functions that will be |
|
183 | 184 | used to compute the format data for their objects (if those objects don't |
|
184 | 185 | have the special print methods). The easiest way of using these |
|
185 | 186 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
186 | 187 | methods. |
|
187 | 188 | |
|
188 | 189 | If no function/callable is found to compute the format data, ``None`` is |
|
189 | 190 | returned and this format type is not used. |
|
190 | 191 | """ |
|
191 | 192 | |
|
192 | 193 | format_type = Str('text/plain') |
|
193 | 194 | |
|
194 | 195 | enabled = Bool(True, config=True) |
|
195 | 196 | |
|
196 | 197 | print_method = Str('__repr__') |
|
197 | 198 | |
|
198 | 199 | # The singleton printers. |
|
199 | 200 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
200 | 201 | singleton_printers = Dict(config=True) |
|
201 | 202 | def _singleton_printers_default(self): |
|
202 | 203 | return {} |
|
203 | 204 | |
|
204 | 205 | # The type-specific printers. |
|
205 | 206 | # Map type objects to the format functions. |
|
206 | 207 | type_printers = Dict(config=True) |
|
207 | 208 | def _type_printers_default(self): |
|
208 | 209 | return {} |
|
209 | 210 | |
|
210 | 211 | # The deferred-import type-specific printers. |
|
211 | 212 | # Map (modulename, classname) pairs to the format functions. |
|
212 | 213 | deferred_printers = Dict(config=True) |
|
213 | 214 | def _deferred_printers_default(self): |
|
214 | 215 | return {} |
|
215 | 216 | |
|
216 | 217 | def __call__(self, obj): |
|
217 | 218 | """Compute the format for an object.""" |
|
218 | 219 | if self.enabled: |
|
219 | 220 | obj_id = id(obj) |
|
220 | 221 | try: |
|
221 | 222 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
222 | 223 | if hasattr(obj_class, self.print_method): |
|
223 | 224 | printer = getattr(obj_class, self.print_method) |
|
224 | 225 | return printer(obj) |
|
225 | 226 | try: |
|
226 | 227 | printer = self.singleton_printers[obj_id] |
|
227 | 228 | except (TypeError, KeyError): |
|
228 | 229 | pass |
|
229 | 230 | else: |
|
230 | 231 | return printer(obj) |
|
231 | 232 | for cls in pretty._get_mro(obj_class): |
|
232 | 233 | if cls in self.type_printers: |
|
233 | 234 | return self.type_printers[cls](obj) |
|
234 | 235 | else: |
|
235 | 236 | printer = self._in_deferred_types(cls) |
|
236 | 237 | if printer is not None: |
|
237 | 238 | return printer(obj) |
|
238 | 239 | return None |
|
239 | 240 | except Exception: |
|
240 | 241 | pass |
|
241 | 242 | else: |
|
242 | 243 | return None |
|
243 | 244 | |
|
244 | 245 | def for_type(self, typ, func): |
|
245 | 246 | """Add a format function for a given type. |
|
246 | 247 | |
|
247 | 248 | Parameters |
|
248 | 249 | ----------- |
|
249 | 250 | typ : class |
|
250 | 251 | The class of the object that will be formatted using `func`. |
|
251 | 252 | func : callable |
|
252 | 253 | The callable that will be called to compute the format data. The |
|
253 | 254 | call signature of this function is simple, it must take the |
|
254 | 255 | object to be formatted and return the raw data for the given |
|
255 | 256 | format. Subclasses may use a different call signature for the |
|
256 | 257 | `func` argument. |
|
257 | 258 | """ |
|
258 | 259 | oldfunc = self.type_printers.get(typ, None) |
|
259 | 260 | if func is not None: |
|
260 | 261 | # To support easy restoration of old printers, we need to ignore |
|
261 | 262 | # Nones. |
|
262 | 263 | self.type_printers[typ] = func |
|
263 | 264 | return oldfunc |
|
264 | 265 | |
|
265 | 266 | def for_type_by_name(self, type_module, type_name, func): |
|
266 | 267 | """Add a format function for a type specified by the full dotted |
|
267 | 268 | module and name of the type, rather than the type of the object. |
|
268 | 269 | |
|
269 | 270 | Parameters |
|
270 | 271 | ---------- |
|
271 | 272 | type_module : str |
|
272 | 273 | The full dotted name of the module the type is defined in, like |
|
273 | 274 | ``numpy``. |
|
274 | 275 | type_name : str |
|
275 | 276 | The name of the type (the class name), like ``dtype`` |
|
276 | 277 | func : callable |
|
277 | 278 | The callable that will be called to compute the format data. The |
|
278 | 279 | call signature of this function is simple, it must take the |
|
279 | 280 | object to be formatted and return the raw data for the given |
|
280 | 281 | format. Subclasses may use a different call signature for the |
|
281 | 282 | `func` argument. |
|
282 | 283 | """ |
|
283 | 284 | key = (type_module, type_name) |
|
284 | 285 | oldfunc = self.deferred_printers.get(key, None) |
|
285 | 286 | if func is not None: |
|
286 | 287 | # To support easy restoration of old printers, we need to ignore |
|
287 | 288 | # Nones. |
|
288 | 289 | self.deferred_printers[key] = func |
|
289 | 290 | return oldfunc |
|
290 | 291 | |
|
291 | 292 | def _in_deferred_types(self, cls): |
|
292 | 293 | """ |
|
293 | 294 | Check if the given class is specified in the deferred type registry. |
|
294 | 295 | |
|
295 | 296 | Returns the printer from the registry if it exists, and None if the |
|
296 | 297 | class is not in the registry. Successful matches will be moved to the |
|
297 | 298 | regular type registry for future use. |
|
298 | 299 | """ |
|
299 | 300 | mod = getattr(cls, '__module__', None) |
|
300 | 301 | name = getattr(cls, '__name__', None) |
|
301 | 302 | key = (mod, name) |
|
302 | 303 | printer = None |
|
303 | 304 | if key in self.deferred_printers: |
|
304 | 305 | # Move the printer over to the regular registry. |
|
305 | 306 | printer = self.deferred_printers.pop(key) |
|
306 | 307 | self.type_printers[cls] = printer |
|
307 | 308 | return printer |
|
308 | 309 | |
|
309 | 310 | |
|
310 | 311 | class PlainTextFormatter(BaseFormatter): |
|
311 | 312 | """The default pretty-printer. |
|
312 | 313 | |
|
313 | 314 | This uses :mod:`IPython.external.pretty` to compute the format data of |
|
314 | 315 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
315 | 316 | See the documentation of :mod:`IPython.external.pretty` for details on |
|
316 | 317 | how to write pretty printers. Here is a simple example:: |
|
317 | 318 | |
|
318 | 319 | def dtype_pprinter(obj, p, cycle): |
|
319 | 320 | if cycle: |
|
320 | 321 | return p.text('dtype(...)') |
|
321 | 322 | if hasattr(obj, 'fields'): |
|
322 | 323 | if obj.fields is None: |
|
323 | 324 | p.text(repr(obj)) |
|
324 | 325 | else: |
|
325 | 326 | p.begin_group(7, 'dtype([') |
|
326 | 327 | for i, field in enumerate(obj.descr): |
|
327 | 328 | if i > 0: |
|
328 | 329 | p.text(',') |
|
329 | 330 | p.breakable() |
|
330 | 331 | p.pretty(field) |
|
331 | 332 | p.end_group(7, '])') |
|
332 | 333 | """ |
|
333 | 334 | |
|
334 | 335 | # The format type of data returned. |
|
335 | 336 | format_type = Str('text/plain') |
|
336 | 337 | |
|
337 | 338 | # This subclass ignores this attribute as it always need to return |
|
338 | 339 | # something. |
|
339 | 340 | enabled = Bool(True, config=False) |
|
340 | 341 | |
|
341 | 342 | # Look for a __pretty__ methods to use for pretty printing. |
|
342 | 343 | print_method = Str('__pretty__') |
|
343 | 344 | |
|
344 | 345 | # Whether to pretty-print or not. |
|
345 | 346 | pprint = Bool(True, config=True) |
|
346 | 347 | |
|
347 | 348 | # Whether to be verbose or not. |
|
348 | 349 | verbose = Bool(False, config=True) |
|
349 | 350 | |
|
350 | 351 | # The maximum width. |
|
351 | 352 | max_width = Int(79, config=True) |
|
352 | 353 | |
|
353 | 354 | # The newline character. |
|
354 | 355 | newline = Str('\n', config=True) |
|
356 | ||
|
357 | # format-string for pprinting floats | |
|
358 | float_format = Str('%r') | |
|
359 | # setter for float precision, either int or direct format-string | |
|
360 | float_precision = CStr('', config=True) | |
|
361 | ||
|
362 | def _float_precision_changed(self, name, old, new): | |
|
363 | """float_precision changed, set float_format accordingly. | |
|
364 | ||
|
365 | float_precision can be set by int or str. | |
|
366 | This will set float_format, after interpreting input. | |
|
367 | If numpy has been imported, numpy print precision will also be set. | |
|
368 | ||
|
369 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
|
370 | ||
|
371 | An empty string returns to defaults (repr for float, 8 for numpy). | |
|
372 | ||
|
373 | This parameter can be set via the '%precision' magic. | |
|
374 | """ | |
|
375 | ||
|
376 | if '%' in new: | |
|
377 | # got explicit format string | |
|
378 | fmt = new | |
|
379 | try: | |
|
380 | fmt%3.14159 | |
|
381 | except Exception: | |
|
382 | raise ValueError("Precision must be int or format string, not %r"%new) | |
|
383 | elif new: | |
|
384 | # otherwise, should be an int | |
|
385 | try: | |
|
386 | i = int(new) | |
|
387 | assert i >= 0 | |
|
388 | except ValueError: | |
|
389 | raise ValueError("Precision must be int or format string, not %r"%new) | |
|
390 | except AssertionError: | |
|
391 | raise ValueError("int precision must be non-negative, not %r"%i) | |
|
392 | ||
|
393 | fmt = '%%.%if'%i | |
|
394 | if 'numpy' in sys.modules: | |
|
395 | # set numpy precision if it has been imported | |
|
396 | import numpy | |
|
397 | numpy.set_printoptions(precision=i) | |
|
398 | else: | |
|
399 | # default back to repr | |
|
400 | fmt = '%r' | |
|
401 | if 'numpy' in sys.modules: | |
|
402 | import numpy | |
|
403 | # numpy default is 8 | |
|
404 | numpy.set_printoptions(precision=8) | |
|
405 | self.float_format = fmt | |
|
355 | 406 | |
|
356 | 407 | # Use the default pretty printers from IPython.external.pretty. |
|
357 | 408 | def _singleton_printers_default(self): |
|
358 | 409 | return pretty._singleton_pprinters.copy() |
|
359 | 410 | |
|
360 | 411 | def _type_printers_default(self): |
|
361 |
|
|
|
412 | d = pretty._type_pprinters.copy() | |
|
413 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
|
414 | return d | |
|
362 | 415 | |
|
363 | 416 | def _deferred_printers_default(self): |
|
364 | 417 | return pretty._deferred_type_pprinters.copy() |
|
365 | 418 | |
|
366 | 419 | #### FormatterABC interface #### |
|
367 | 420 | |
|
368 | 421 | def __call__(self, obj): |
|
369 | 422 | """Compute the pretty representation of the object.""" |
|
370 | 423 | if not self.pprint: |
|
371 | 424 | try: |
|
372 | 425 | return repr(obj) |
|
373 | 426 | except TypeError: |
|
374 | 427 | return '' |
|
375 | 428 | else: |
|
376 | 429 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
377 | 430 | stream = StringIO() |
|
378 | 431 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
379 | 432 | self.max_width, self.newline, |
|
380 | 433 | singleton_pprinters=self.singleton_printers, |
|
381 | 434 | type_pprinters=self.type_printers, |
|
382 | 435 | deferred_pprinters=self.deferred_printers) |
|
383 | 436 | printer.pretty(obj) |
|
384 | 437 | printer.flush() |
|
385 | 438 | return stream.getvalue() |
|
386 | 439 | |
|
387 | 440 | |
|
388 | 441 | class HTMLFormatter(BaseFormatter): |
|
389 | 442 | """An HTML formatter. |
|
390 | 443 | |
|
391 | 444 | To define the callables that compute the HTML representation of your |
|
392 | 445 | objects, define a :meth:`__html__` method or use the :meth:`for_type` |
|
393 | 446 | or :meth:`for_type_by_name` methods to register functions that handle |
|
394 | 447 | this. |
|
395 | 448 | """ |
|
396 | 449 | format_type = Str('text/html') |
|
397 | 450 | |
|
398 | 451 | print_method = Str('__html__') |
|
399 | 452 | |
|
400 | 453 | |
|
401 | 454 | class SVGFormatter(BaseFormatter): |
|
402 | 455 | """An SVG formatter. |
|
403 | 456 | |
|
404 | 457 | To define the callables that compute the SVG representation of your |
|
405 | 458 | objects, define a :meth:`__svg__` method or use the :meth:`for_type` |
|
406 | 459 | or :meth:`for_type_by_name` methods to register functions that handle |
|
407 | 460 | this. |
|
408 | 461 | """ |
|
409 | 462 | format_type = Str('image/svg+xml') |
|
410 | 463 | |
|
411 | 464 | print_method = Str('__svg__') |
|
412 | 465 | |
|
413 | 466 | |
|
414 | 467 | class PNGFormatter(BaseFormatter): |
|
415 | 468 | """A PNG formatter. |
|
416 | 469 | |
|
417 | 470 | To define the callables that compute the PNG representation of your |
|
418 | 471 | objects, define a :meth:`__png__` method or use the :meth:`for_type` |
|
419 | 472 | or :meth:`for_type_by_name` methods to register functions that handle |
|
420 | 473 | this. The raw data should be the base64 encoded raw png data. |
|
421 | 474 | """ |
|
422 | 475 | format_type = Str('image/png') |
|
423 | 476 | |
|
424 | 477 | print_method = Str('__png__') |
|
425 | 478 | |
|
426 | 479 | |
|
427 | 480 | class LatexFormatter(BaseFormatter): |
|
428 | 481 | """A LaTeX formatter. |
|
429 | 482 | |
|
430 | 483 | To define the callables that compute the LaTeX representation of your |
|
431 | 484 | objects, define a :meth:`__latex__` method or use the :meth:`for_type` |
|
432 | 485 | or :meth:`for_type_by_name` methods to register functions that handle |
|
433 | 486 | this. |
|
434 | 487 | """ |
|
435 | 488 | format_type = Str('text/latex') |
|
436 | 489 | |
|
437 | 490 | print_method = Str('__latex__') |
|
438 | 491 | |
|
439 | 492 | |
|
440 | 493 | class JSONFormatter(BaseFormatter): |
|
441 | 494 | """A JSON string formatter. |
|
442 | 495 | |
|
443 | 496 | To define the callables that compute the JSON string representation of |
|
444 | 497 | your objects, define a :meth:`__json__` method or use the :meth:`for_type` |
|
445 | 498 | or :meth:`for_type_by_name` methods to register functions that handle |
|
446 | 499 | this. |
|
447 | 500 | """ |
|
448 | 501 | format_type = Str('application/json') |
|
449 | 502 | |
|
450 | 503 | print_method = Str('__json__') |
|
451 | 504 | |
|
452 | 505 | |
|
453 | 506 | FormatterABC.register(BaseFormatter) |
|
454 | 507 | FormatterABC.register(PlainTextFormatter) |
|
455 | 508 | FormatterABC.register(HTMLFormatter) |
|
456 | 509 | FormatterABC.register(SVGFormatter) |
|
457 | 510 | FormatterABC.register(PNGFormatter) |
|
458 | 511 | FormatterABC.register(LatexFormatter) |
|
459 | 512 | FormatterABC.register(JSONFormatter) |
|
460 | 513 | |
|
461 | 514 | |
|
462 | 515 | def format_display_data(obj, include=None, exclude=None): |
|
463 | 516 | """Return a format data dict for an object. |
|
464 | 517 | |
|
465 | 518 | By default all format types will be computed. |
|
466 | 519 | |
|
467 | 520 | The following MIME types are currently implemented: |
|
468 | 521 | |
|
469 | 522 | * text/plain |
|
470 | 523 | * text/html |
|
471 | 524 | * text/latex |
|
472 | 525 | * application/json |
|
473 | 526 | * image/png |
|
474 | 527 | * immage/svg+xml |
|
475 | 528 | |
|
476 | 529 | Parameters |
|
477 | 530 | ---------- |
|
478 | 531 | obj : object |
|
479 | 532 | The Python object whose format data will be computed. |
|
480 | 533 | |
|
481 | 534 | Returns |
|
482 | 535 | ------- |
|
483 | 536 | format_dict : dict |
|
484 | 537 | A dictionary of key/value pairs, one or each format that was |
|
485 | 538 | generated for the object. The keys are the format types, which |
|
486 | 539 | will usually be MIME type strings and the values and JSON'able |
|
487 | 540 | data structure containing the raw data for the representation in |
|
488 | 541 | that format. |
|
489 | 542 | include : list or tuple, optional |
|
490 | 543 | A list of format type strings (MIME types) to include in the |
|
491 | 544 | format data dict. If this is set *only* the format types included |
|
492 | 545 | in this list will be computed. |
|
493 | 546 | exclude : list or tuple, optional |
|
494 | 547 | A list of format type string (MIME types) to exclue in the format |
|
495 | 548 | data dict. If this is set all format types will be computed, |
|
496 | 549 | except for those included in this argument. |
|
497 | 550 | """ |
|
498 | 551 | from IPython.core.interactiveshell import InteractiveShell |
|
499 | 552 | |
|
500 | 553 | InteractiveShell.instance().display_formatter.format( |
|
501 | 554 | obj, |
|
502 | 555 | include, |
|
503 | 556 | exclude |
|
504 | 557 | ) |
@@ -1,3535 +1,3510 | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """Magic functions for InteractiveShell. |
|
3 | 3 | """ |
|
4 | 4 | |
|
5 | 5 | #----------------------------------------------------------------------------- |
|
6 | 6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and |
|
7 | 7 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> |
|
8 | 8 | # Copyright (C) 2008-2009 The IPython Development Team |
|
9 | 9 | |
|
10 | 10 | # Distributed under the terms of the BSD License. The full license is in |
|
11 | 11 | # the file COPYING, distributed as part of this software. |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | # Imports |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | import __builtin__ |
|
19 | 19 | import __future__ |
|
20 | 20 | import bdb |
|
21 | 21 | import inspect |
|
22 | 22 | import os |
|
23 | 23 | import sys |
|
24 | 24 | import shutil |
|
25 | 25 | import re |
|
26 | 26 | import time |
|
27 | 27 | import textwrap |
|
28 | 28 | import types |
|
29 | 29 | from cStringIO import StringIO |
|
30 | 30 | from getopt import getopt,GetoptError |
|
31 | 31 | from pprint import pformat |
|
32 | 32 | |
|
33 | 33 | # cProfile was added in Python2.5 |
|
34 | 34 | try: |
|
35 | 35 | import cProfile as profile |
|
36 | 36 | import pstats |
|
37 | 37 | except ImportError: |
|
38 | 38 | # profile isn't bundled by default in Debian for license reasons |
|
39 | 39 | try: |
|
40 | 40 | import profile,pstats |
|
41 | 41 | except ImportError: |
|
42 | 42 | profile = pstats = None |
|
43 | 43 | |
|
44 | 44 | import IPython |
|
45 | 45 | from IPython.core import debugger, oinspect |
|
46 | 46 | from IPython.core.error import TryNext |
|
47 | 47 | from IPython.core.error import UsageError |
|
48 | 48 | from IPython.core.fakemodule import FakeModule |
|
49 | 49 | from IPython.core.macro import Macro |
|
50 | 50 | from IPython.core import page |
|
51 | 51 | from IPython.core.prefilter import ESC_MAGIC |
|
52 | 52 | from IPython.lib.pylabtools import mpl_runner |
|
53 | 53 | from IPython.external.Itpl import itpl, printpl |
|
54 | 54 | from IPython.testing import decorators as testdec |
|
55 | 55 | from IPython.utils.io import file_read, nlprint |
|
56 | 56 | import IPython.utils.io |
|
57 | 57 | from IPython.utils.path import get_py_filename |
|
58 | 58 | from IPython.utils.process import arg_split, abbrev_cwd |
|
59 | 59 | from IPython.utils.terminal import set_term_title |
|
60 | 60 | from IPython.utils.text import LSString, SList, StringTypes, format_screen |
|
61 | 61 | from IPython.utils.timing import clock, clock2 |
|
62 | 62 | from IPython.utils.warn import warn, error |
|
63 | 63 | from IPython.utils.ipstruct import Struct |
|
64 | 64 | import IPython.utils.generics |
|
65 | 65 | |
|
66 | 66 | #----------------------------------------------------------------------------- |
|
67 | 67 | # Utility functions |
|
68 | 68 | #----------------------------------------------------------------------------- |
|
69 | 69 | |
|
70 | 70 | def on_off(tag): |
|
71 | 71 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" |
|
72 | 72 | return ['OFF','ON'][tag] |
|
73 | 73 | |
|
74 | 74 | class Bunch: pass |
|
75 | 75 | |
|
76 | 76 | def compress_dhist(dh): |
|
77 | 77 | head, tail = dh[:-10], dh[-10:] |
|
78 | 78 | |
|
79 | 79 | newhead = [] |
|
80 | 80 | done = set() |
|
81 | 81 | for h in head: |
|
82 | 82 | if h in done: |
|
83 | 83 | continue |
|
84 | 84 | newhead.append(h) |
|
85 | 85 | done.add(h) |
|
86 | 86 | |
|
87 | 87 | return newhead + tail |
|
88 | 88 | |
|
89 | 89 | |
|
90 | 90 | #*************************************************************************** |
|
91 | 91 | # Main class implementing Magic functionality |
|
92 | 92 | |
|
93 | 93 | # XXX - for some odd reason, if Magic is made a new-style class, we get errors |
|
94 | 94 | # on construction of the main InteractiveShell object. Something odd is going |
|
95 | 95 | # on with super() calls, Configurable and the MRO... For now leave it as-is, but |
|
96 | 96 | # eventually this needs to be clarified. |
|
97 | 97 | # BG: This is because InteractiveShell inherits from this, but is itself a |
|
98 | 98 | # Configurable. This messes up the MRO in some way. The fix is that we need to |
|
99 | 99 | # make Magic a configurable that InteractiveShell does not subclass. |
|
100 | 100 | |
|
101 | 101 | class Magic: |
|
102 | 102 | """Magic functions for InteractiveShell. |
|
103 | 103 | |
|
104 | 104 | Shell functions which can be reached as %function_name. All magic |
|
105 | 105 | functions should accept a string, which they can parse for their own |
|
106 | 106 | needs. This can make some functions easier to type, eg `%cd ../` |
|
107 | 107 | vs. `%cd("../")` |
|
108 | 108 | |
|
109 | 109 | ALL definitions MUST begin with the prefix magic_. The user won't need it |
|
110 | 110 | at the command line, but it is is needed in the definition. """ |
|
111 | 111 | |
|
112 | 112 | # class globals |
|
113 | 113 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', |
|
114 | 114 | 'Automagic is ON, % prefix NOT needed for magic functions.'] |
|
115 | 115 | |
|
116 | 116 | #...................................................................... |
|
117 | 117 | # some utility functions |
|
118 | 118 | |
|
119 | 119 | def __init__(self,shell): |
|
120 | 120 | |
|
121 | 121 | self.options_table = {} |
|
122 | 122 | if profile is None: |
|
123 | 123 | self.magic_prun = self.profile_missing_notice |
|
124 | 124 | self.shell = shell |
|
125 | 125 | |
|
126 | 126 | # namespace for holding state we may need |
|
127 | 127 | self._magic_state = Bunch() |
|
128 | 128 | |
|
129 | 129 | def profile_missing_notice(self, *args, **kwargs): |
|
130 | 130 | error("""\ |
|
131 | 131 | The profile module could not be found. It has been removed from the standard |
|
132 | 132 | python packages because of its non-free license. To use profiling, install the |
|
133 | 133 | python-profiler package from non-free.""") |
|
134 | 134 | |
|
135 | 135 | def default_option(self,fn,optstr): |
|
136 | 136 | """Make an entry in the options_table for fn, with value optstr""" |
|
137 | 137 | |
|
138 | 138 | if fn not in self.lsmagic(): |
|
139 | 139 | error("%s is not a magic function" % fn) |
|
140 | 140 | self.options_table[fn] = optstr |
|
141 | 141 | |
|
142 | 142 | def lsmagic(self): |
|
143 | 143 | """Return a list of currently available magic functions. |
|
144 | 144 | |
|
145 | 145 | Gives a list of the bare names after mangling (['ls','cd', ...], not |
|
146 | 146 | ['magic_ls','magic_cd',...]""" |
|
147 | 147 | |
|
148 | 148 | # FIXME. This needs a cleanup, in the way the magics list is built. |
|
149 | 149 | |
|
150 | 150 | # magics in class definition |
|
151 | 151 | class_magic = lambda fn: fn.startswith('magic_') and \ |
|
152 | 152 | callable(Magic.__dict__[fn]) |
|
153 | 153 | # in instance namespace (run-time user additions) |
|
154 | 154 | inst_magic = lambda fn: fn.startswith('magic_') and \ |
|
155 | 155 | callable(self.__dict__[fn]) |
|
156 | 156 | # and bound magics by user (so they can access self): |
|
157 | 157 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ |
|
158 | 158 | callable(self.__class__.__dict__[fn]) |
|
159 | 159 | magics = filter(class_magic,Magic.__dict__.keys()) + \ |
|
160 | 160 | filter(inst_magic,self.__dict__.keys()) + \ |
|
161 | 161 | filter(inst_bound_magic,self.__class__.__dict__.keys()) |
|
162 | 162 | out = [] |
|
163 | 163 | for fn in set(magics): |
|
164 | 164 | out.append(fn.replace('magic_','',1)) |
|
165 | 165 | out.sort() |
|
166 | 166 | return out |
|
167 | 167 | |
|
168 | 168 | def extract_input_slices(self,slices,raw=False): |
|
169 | 169 | """Return as a string a set of input history slices. |
|
170 | 170 | |
|
171 | 171 | Inputs: |
|
172 | 172 | |
|
173 | 173 | - slices: the set of slices is given as a list of strings (like |
|
174 | 174 | ['1','4:8','9'], since this function is for use by magic functions |
|
175 | 175 | which get their arguments as strings. |
|
176 | 176 | |
|
177 | 177 | Optional inputs: |
|
178 | 178 | |
|
179 | 179 | - raw(False): by default, the processed input is used. If this is |
|
180 | 180 | true, the raw input history is used instead. |
|
181 | 181 | |
|
182 | 182 | Note that slices can be called with two notations: |
|
183 | 183 | |
|
184 | 184 | N:M -> standard python form, means including items N...(M-1). |
|
185 | 185 | |
|
186 | 186 | N-M -> include items N..M (closed endpoint).""" |
|
187 | 187 | |
|
188 | 188 | if raw: |
|
189 | 189 | hist = self.shell.history_manager.input_hist_raw |
|
190 | 190 | else: |
|
191 | 191 | hist = self.shell.history_manager.input_hist_parsed |
|
192 | 192 | |
|
193 | 193 | cmds = [] |
|
194 | 194 | for chunk in slices: |
|
195 | 195 | if ':' in chunk: |
|
196 | 196 | ini,fin = map(int,chunk.split(':')) |
|
197 | 197 | elif '-' in chunk: |
|
198 | 198 | ini,fin = map(int,chunk.split('-')) |
|
199 | 199 | fin += 1 |
|
200 | 200 | else: |
|
201 | 201 | ini = int(chunk) |
|
202 | 202 | fin = ini+1 |
|
203 | 203 | cmds.append(''.join(hist[ini:fin])) |
|
204 | 204 | return cmds |
|
205 | 205 | |
|
206 | 206 | def arg_err(self,func): |
|
207 | 207 | """Print docstring if incorrect arguments were passed""" |
|
208 | 208 | print 'Error in arguments:' |
|
209 | 209 | print oinspect.getdoc(func) |
|
210 | 210 | |
|
211 | 211 | def format_latex(self,strng): |
|
212 | 212 | """Format a string for latex inclusion.""" |
|
213 | 213 | |
|
214 | 214 | # Characters that need to be escaped for latex: |
|
215 | 215 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) |
|
216 | 216 | # Magic command names as headers: |
|
217 | 217 | cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC, |
|
218 | 218 | re.MULTILINE) |
|
219 | 219 | # Magic commands |
|
220 | 220 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC, |
|
221 | 221 | re.MULTILINE) |
|
222 | 222 | # Paragraph continue |
|
223 | 223 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
224 | 224 | |
|
225 | 225 | # The "\n" symbol |
|
226 | 226 | newline_re = re.compile(r'\\n') |
|
227 | 227 | |
|
228 | 228 | # Now build the string for output: |
|
229 | 229 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) |
|
230 | 230 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', |
|
231 | 231 | strng) |
|
232 | 232 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) |
|
233 | 233 | strng = par_re.sub(r'\\\\',strng) |
|
234 | 234 | strng = escape_re.sub(r'\\\1',strng) |
|
235 | 235 | strng = newline_re.sub(r'\\textbackslash{}n',strng) |
|
236 | 236 | return strng |
|
237 | 237 | |
|
238 | 238 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): |
|
239 | 239 | """Parse options passed to an argument string. |
|
240 | 240 | |
|
241 | 241 | The interface is similar to that of getopt(), but it returns back a |
|
242 | 242 | Struct with the options as keys and the stripped argument string still |
|
243 | 243 | as a string. |
|
244 | 244 | |
|
245 | 245 | arg_str is quoted as a true sys.argv vector by using shlex.split. |
|
246 | 246 | This allows us to easily expand variables, glob files, quote |
|
247 | 247 | arguments, etc. |
|
248 | 248 | |
|
249 | 249 | Options: |
|
250 | 250 | -mode: default 'string'. If given as 'list', the argument string is |
|
251 | 251 | returned as a list (split on whitespace) instead of a string. |
|
252 | 252 | |
|
253 | 253 | -list_all: put all option values in lists. Normally only options |
|
254 | 254 | appearing more than once are put in a list. |
|
255 | 255 | |
|
256 | 256 | -posix (True): whether to split the input line in POSIX mode or not, |
|
257 | 257 | as per the conventions outlined in the shlex module from the |
|
258 | 258 | standard library.""" |
|
259 | 259 | |
|
260 | 260 | # inject default options at the beginning of the input line |
|
261 | 261 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') |
|
262 | 262 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) |
|
263 | 263 | |
|
264 | 264 | mode = kw.get('mode','string') |
|
265 | 265 | if mode not in ['string','list']: |
|
266 | 266 | raise ValueError,'incorrect mode given: %s' % mode |
|
267 | 267 | # Get options |
|
268 | 268 | list_all = kw.get('list_all',0) |
|
269 | 269 | posix = kw.get('posix', os.name == 'posix') |
|
270 | 270 | |
|
271 | 271 | # Check if we have more than one argument to warrant extra processing: |
|
272 | 272 | odict = {} # Dictionary with options |
|
273 | 273 | args = arg_str.split() |
|
274 | 274 | if len(args) >= 1: |
|
275 | 275 | # If the list of inputs only has 0 or 1 thing in it, there's no |
|
276 | 276 | # need to look for options |
|
277 | 277 | argv = arg_split(arg_str,posix) |
|
278 | 278 | # Do regular option processing |
|
279 | 279 | try: |
|
280 | 280 | opts,args = getopt(argv,opt_str,*long_opts) |
|
281 | 281 | except GetoptError,e: |
|
282 | 282 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, |
|
283 | 283 | " ".join(long_opts))) |
|
284 | 284 | for o,a in opts: |
|
285 | 285 | if o.startswith('--'): |
|
286 | 286 | o = o[2:] |
|
287 | 287 | else: |
|
288 | 288 | o = o[1:] |
|
289 | 289 | try: |
|
290 | 290 | odict[o].append(a) |
|
291 | 291 | except AttributeError: |
|
292 | 292 | odict[o] = [odict[o],a] |
|
293 | 293 | except KeyError: |
|
294 | 294 | if list_all: |
|
295 | 295 | odict[o] = [a] |
|
296 | 296 | else: |
|
297 | 297 | odict[o] = a |
|
298 | 298 | |
|
299 | 299 | # Prepare opts,args for return |
|
300 | 300 | opts = Struct(odict) |
|
301 | 301 | if mode == 'string': |
|
302 | 302 | args = ' '.join(args) |
|
303 | 303 | |
|
304 | 304 | return opts,args |
|
305 | 305 | |
|
306 | 306 | #...................................................................... |
|
307 | 307 | # And now the actual magic functions |
|
308 | 308 | |
|
309 | 309 | # Functions for IPython shell work (vars,funcs, config, etc) |
|
310 | 310 | def magic_lsmagic(self, parameter_s = ''): |
|
311 | 311 | """List currently available magic functions.""" |
|
312 | 312 | mesc = ESC_MAGIC |
|
313 | 313 | print 'Available magic functions:\n'+mesc+\ |
|
314 | 314 | (' '+mesc).join(self.lsmagic()) |
|
315 | 315 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
316 | 316 | return None |
|
317 | 317 | |
|
318 | 318 | def magic_magic(self, parameter_s = ''): |
|
319 | 319 | """Print information about the magic function system. |
|
320 | 320 | |
|
321 | 321 | Supported formats: -latex, -brief, -rest |
|
322 | 322 | """ |
|
323 | 323 | |
|
324 | 324 | mode = '' |
|
325 | 325 | try: |
|
326 | 326 | if parameter_s.split()[0] == '-latex': |
|
327 | 327 | mode = 'latex' |
|
328 | 328 | if parameter_s.split()[0] == '-brief': |
|
329 | 329 | mode = 'brief' |
|
330 | 330 | if parameter_s.split()[0] == '-rest': |
|
331 | 331 | mode = 'rest' |
|
332 | 332 | rest_docs = [] |
|
333 | 333 | except: |
|
334 | 334 | pass |
|
335 | 335 | |
|
336 | 336 | magic_docs = [] |
|
337 | 337 | for fname in self.lsmagic(): |
|
338 | 338 | mname = 'magic_' + fname |
|
339 | 339 | for space in (Magic,self,self.__class__): |
|
340 | 340 | try: |
|
341 | 341 | fn = space.__dict__[mname] |
|
342 | 342 | except KeyError: |
|
343 | 343 | pass |
|
344 | 344 | else: |
|
345 | 345 | break |
|
346 | 346 | if mode == 'brief': |
|
347 | 347 | # only first line |
|
348 | 348 | if fn.__doc__: |
|
349 | 349 | fndoc = fn.__doc__.split('\n',1)[0] |
|
350 | 350 | else: |
|
351 | 351 | fndoc = 'No documentation' |
|
352 | 352 | else: |
|
353 | 353 | if fn.__doc__: |
|
354 | 354 | fndoc = fn.__doc__.rstrip() |
|
355 | 355 | else: |
|
356 | 356 | fndoc = 'No documentation' |
|
357 | 357 | |
|
358 | 358 | |
|
359 | 359 | if mode == 'rest': |
|
360 | 360 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC, |
|
361 | 361 | fname,fndoc)) |
|
362 | 362 | |
|
363 | 363 | else: |
|
364 | 364 | magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC, |
|
365 | 365 | fname,fndoc)) |
|
366 | 366 | |
|
367 | 367 | magic_docs = ''.join(magic_docs) |
|
368 | 368 | |
|
369 | 369 | if mode == 'rest': |
|
370 | 370 | return "".join(rest_docs) |
|
371 | 371 | |
|
372 | 372 | if mode == 'latex': |
|
373 | 373 | print self.format_latex(magic_docs) |
|
374 | 374 | return |
|
375 | 375 | else: |
|
376 | 376 | magic_docs = format_screen(magic_docs) |
|
377 | 377 | if mode == 'brief': |
|
378 | 378 | return magic_docs |
|
379 | 379 | |
|
380 | 380 | outmsg = """ |
|
381 | 381 | IPython's 'magic' functions |
|
382 | 382 | =========================== |
|
383 | 383 | |
|
384 | 384 | The magic function system provides a series of functions which allow you to |
|
385 | 385 | control the behavior of IPython itself, plus a lot of system-type |
|
386 | 386 | features. All these functions are prefixed with a % character, but parameters |
|
387 | 387 | are given without parentheses or quotes. |
|
388 | 388 | |
|
389 | 389 | NOTE: If you have 'automagic' enabled (via the command line option or with the |
|
390 | 390 | %automagic function), you don't need to type in the % explicitly. By default, |
|
391 | 391 | IPython ships with automagic on, so you should only rarely need the % escape. |
|
392 | 392 | |
|
393 | 393 | Example: typing '%cd mydir' (without the quotes) changes you working directory |
|
394 | 394 | to 'mydir', if it exists. |
|
395 | 395 | |
|
396 | 396 | You can define your own magic functions to extend the system. See the supplied |
|
397 | 397 | ipythonrc and example-magic.py files for details (in your ipython |
|
398 | 398 | configuration directory, typically $HOME/.ipython/). |
|
399 | 399 | |
|
400 | 400 | You can also define your own aliased names for magic functions. In your |
|
401 | 401 | ipythonrc file, placing a line like: |
|
402 | 402 | |
|
403 | 403 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile |
|
404 | 404 | |
|
405 | 405 | will define %pf as a new name for %profile. |
|
406 | 406 | |
|
407 | 407 | You can also call magics in code using the magic() function, which IPython |
|
408 | 408 | automatically adds to the builtin namespace. Type 'magic?' for details. |
|
409 | 409 | |
|
410 | 410 | For a list of the available magic functions, use %lsmagic. For a description |
|
411 | 411 | of any of them, type %magic_name?, e.g. '%cd?'. |
|
412 | 412 | |
|
413 | 413 | Currently the magic system has the following functions:\n""" |
|
414 | 414 | |
|
415 | 415 | mesc = ESC_MAGIC |
|
416 | 416 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" |
|
417 | 417 | "\n\n%s%s\n\n%s" % (outmsg, |
|
418 | 418 | magic_docs,mesc,mesc, |
|
419 | 419 | (' '+mesc).join(self.lsmagic()), |
|
420 | 420 | Magic.auto_status[self.shell.automagic] ) ) |
|
421 | 421 | page.page(outmsg) |
|
422 | 422 | |
|
423 | 423 | def magic_automagic(self, parameter_s = ''): |
|
424 | 424 | """Make magic functions callable without having to type the initial %. |
|
425 | 425 | |
|
426 | 426 | Without argumentsl toggles on/off (when off, you must call it as |
|
427 | 427 | %automagic, of course). With arguments it sets the value, and you can |
|
428 | 428 | use any of (case insensitive): |
|
429 | 429 | |
|
430 | 430 | - on,1,True: to activate |
|
431 | 431 | |
|
432 | 432 | - off,0,False: to deactivate. |
|
433 | 433 | |
|
434 | 434 | Note that magic functions have lowest priority, so if there's a |
|
435 | 435 | variable whose name collides with that of a magic fn, automagic won't |
|
436 | 436 | work for that function (you get the variable instead). However, if you |
|
437 | 437 | delete the variable (del var), the previously shadowed magic function |
|
438 | 438 | becomes visible to automagic again.""" |
|
439 | 439 | |
|
440 | 440 | arg = parameter_s.lower() |
|
441 | 441 | if parameter_s in ('on','1','true'): |
|
442 | 442 | self.shell.automagic = True |
|
443 | 443 | elif parameter_s in ('off','0','false'): |
|
444 | 444 | self.shell.automagic = False |
|
445 | 445 | else: |
|
446 | 446 | self.shell.automagic = not self.shell.automagic |
|
447 | 447 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
448 | 448 | |
|
449 | 449 | @testdec.skip_doctest |
|
450 | 450 | def magic_autocall(self, parameter_s = ''): |
|
451 | 451 | """Make functions callable without having to type parentheses. |
|
452 | 452 | |
|
453 | 453 | Usage: |
|
454 | 454 | |
|
455 | 455 | %autocall [mode] |
|
456 | 456 | |
|
457 | 457 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the |
|
458 | 458 | value is toggled on and off (remembering the previous state). |
|
459 | 459 | |
|
460 | 460 | In more detail, these values mean: |
|
461 | 461 | |
|
462 | 462 | 0 -> fully disabled |
|
463 | 463 | |
|
464 | 464 | 1 -> active, but do not apply if there are no arguments on the line. |
|
465 | 465 | |
|
466 | 466 | In this mode, you get: |
|
467 | 467 | |
|
468 | 468 | In [1]: callable |
|
469 | 469 | Out[1]: <built-in function callable> |
|
470 | 470 | |
|
471 | 471 | In [2]: callable 'hello' |
|
472 | 472 | ------> callable('hello') |
|
473 | 473 | Out[2]: False |
|
474 | 474 | |
|
475 | 475 | 2 -> Active always. Even if no arguments are present, the callable |
|
476 | 476 | object is called: |
|
477 | 477 | |
|
478 | 478 | In [2]: float |
|
479 | 479 | ------> float() |
|
480 | 480 | Out[2]: 0.0 |
|
481 | 481 | |
|
482 | 482 | Note that even with autocall off, you can still use '/' at the start of |
|
483 | 483 | a line to treat the first argument on the command line as a function |
|
484 | 484 | and add parentheses to it: |
|
485 | 485 | |
|
486 | 486 | In [8]: /str 43 |
|
487 | 487 | ------> str(43) |
|
488 | 488 | Out[8]: '43' |
|
489 | 489 | |
|
490 | 490 | # all-random (note for auto-testing) |
|
491 | 491 | """ |
|
492 | 492 | |
|
493 | 493 | if parameter_s: |
|
494 | 494 | arg = int(parameter_s) |
|
495 | 495 | else: |
|
496 | 496 | arg = 'toggle' |
|
497 | 497 | |
|
498 | 498 | if not arg in (0,1,2,'toggle'): |
|
499 | 499 | error('Valid modes: (0->Off, 1->Smart, 2->Full') |
|
500 | 500 | return |
|
501 | 501 | |
|
502 | 502 | if arg in (0,1,2): |
|
503 | 503 | self.shell.autocall = arg |
|
504 | 504 | else: # toggle |
|
505 | 505 | if self.shell.autocall: |
|
506 | 506 | self._magic_state.autocall_save = self.shell.autocall |
|
507 | 507 | self.shell.autocall = 0 |
|
508 | 508 | else: |
|
509 | 509 | try: |
|
510 | 510 | self.shell.autocall = self._magic_state.autocall_save |
|
511 | 511 | except AttributeError: |
|
512 | 512 | self.shell.autocall = self._magic_state.autocall_save = 1 |
|
513 | 513 | |
|
514 | 514 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] |
|
515 | 515 | |
|
516 | 516 | |
|
517 | 517 | def magic_page(self, parameter_s=''): |
|
518 | 518 | """Pretty print the object and display it through a pager. |
|
519 | 519 | |
|
520 | 520 | %page [options] OBJECT |
|
521 | 521 | |
|
522 | 522 | If no object is given, use _ (last output). |
|
523 | 523 | |
|
524 | 524 | Options: |
|
525 | 525 | |
|
526 | 526 | -r: page str(object), don't pretty-print it.""" |
|
527 | 527 | |
|
528 | 528 | # After a function contributed by Olivier Aubert, slightly modified. |
|
529 | 529 | |
|
530 | 530 | # Process options/args |
|
531 | 531 | opts,args = self.parse_options(parameter_s,'r') |
|
532 | 532 | raw = 'r' in opts |
|
533 | 533 | |
|
534 | 534 | oname = args and args or '_' |
|
535 | 535 | info = self._ofind(oname) |
|
536 | 536 | if info['found']: |
|
537 | 537 | txt = (raw and str or pformat)( info['obj'] ) |
|
538 | 538 | page.page(txt) |
|
539 | 539 | else: |
|
540 | 540 | print 'Object `%s` not found' % oname |
|
541 | 541 | |
|
542 | 542 | def magic_profile(self, parameter_s=''): |
|
543 | 543 | """Print your currently active IPython profile.""" |
|
544 | 544 | if self.shell.profile: |
|
545 | 545 | printpl('Current IPython profile: $self.shell.profile.') |
|
546 | 546 | else: |
|
547 | 547 | print 'No profile active.' |
|
548 | 548 | |
|
549 | 549 | def magic_pinfo(self, parameter_s='', namespaces=None): |
|
550 | 550 | """Provide detailed information about an object. |
|
551 | 551 | |
|
552 | 552 | '%pinfo object' is just a synonym for object? or ?object.""" |
|
553 | 553 | |
|
554 | 554 | #print 'pinfo par: <%s>' % parameter_s # dbg |
|
555 | 555 | |
|
556 | 556 | |
|
557 | 557 | # detail_level: 0 -> obj? , 1 -> obj?? |
|
558 | 558 | detail_level = 0 |
|
559 | 559 | # We need to detect if we got called as 'pinfo pinfo foo', which can |
|
560 | 560 | # happen if the user types 'pinfo foo?' at the cmd line. |
|
561 | 561 | pinfo,qmark1,oname,qmark2 = \ |
|
562 | 562 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() |
|
563 | 563 | if pinfo or qmark1 or qmark2: |
|
564 | 564 | detail_level = 1 |
|
565 | 565 | if "*" in oname: |
|
566 | 566 | self.magic_psearch(oname) |
|
567 | 567 | else: |
|
568 | 568 | self.shell._inspect('pinfo', oname, detail_level=detail_level, |
|
569 | 569 | namespaces=namespaces) |
|
570 | 570 | |
|
571 | 571 | def magic_pinfo2(self, parameter_s='', namespaces=None): |
|
572 | 572 | """Provide extra detailed information about an object. |
|
573 | 573 | |
|
574 | 574 | '%pinfo2 object' is just a synonym for object?? or ??object.""" |
|
575 | 575 | self.shell._inspect('pinfo', parameter_s, detail_level=1, |
|
576 | 576 | namespaces=namespaces) |
|
577 | 577 | |
|
578 | 578 | @testdec.skip_doctest |
|
579 | 579 | def magic_pdef(self, parameter_s='', namespaces=None): |
|
580 | 580 | """Print the definition header for any callable object. |
|
581 | 581 | |
|
582 | 582 | If the object is a class, print the constructor information. |
|
583 | 583 | |
|
584 | 584 | Examples |
|
585 | 585 | -------- |
|
586 | 586 | :: |
|
587 | 587 | |
|
588 | 588 | In [3]: %pdef urllib.urlopen |
|
589 | 589 | urllib.urlopen(url, data=None, proxies=None) |
|
590 | 590 | """ |
|
591 | 591 | self._inspect('pdef',parameter_s, namespaces) |
|
592 | 592 | |
|
593 | 593 | def magic_pdoc(self, parameter_s='', namespaces=None): |
|
594 | 594 | """Print the docstring for an object. |
|
595 | 595 | |
|
596 | 596 | If the given object is a class, it will print both the class and the |
|
597 | 597 | constructor docstrings.""" |
|
598 | 598 | self._inspect('pdoc',parameter_s, namespaces) |
|
599 | 599 | |
|
600 | 600 | def magic_psource(self, parameter_s='', namespaces=None): |
|
601 | 601 | """Print (or run through pager) the source code for an object.""" |
|
602 | 602 | self._inspect('psource',parameter_s, namespaces) |
|
603 | 603 | |
|
604 | 604 | def magic_pfile(self, parameter_s=''): |
|
605 | 605 | """Print (or run through pager) the file where an object is defined. |
|
606 | 606 | |
|
607 | 607 | The file opens at the line where the object definition begins. IPython |
|
608 | 608 | will honor the environment variable PAGER if set, and otherwise will |
|
609 | 609 | do its best to print the file in a convenient form. |
|
610 | 610 | |
|
611 | 611 | If the given argument is not an object currently defined, IPython will |
|
612 | 612 | try to interpret it as a filename (automatically adding a .py extension |
|
613 | 613 | if needed). You can thus use %pfile as a syntax highlighting code |
|
614 | 614 | viewer.""" |
|
615 | 615 | |
|
616 | 616 | # first interpret argument as an object name |
|
617 | 617 | out = self._inspect('pfile',parameter_s) |
|
618 | 618 | # if not, try the input as a filename |
|
619 | 619 | if out == 'not found': |
|
620 | 620 | try: |
|
621 | 621 | filename = get_py_filename(parameter_s) |
|
622 | 622 | except IOError,msg: |
|
623 | 623 | print msg |
|
624 | 624 | return |
|
625 | 625 | page.page(self.shell.inspector.format(file(filename).read())) |
|
626 | 626 | |
|
627 | 627 | def magic_psearch(self, parameter_s=''): |
|
628 | 628 | """Search for object in namespaces by wildcard. |
|
629 | 629 | |
|
630 | 630 | %psearch [options] PATTERN [OBJECT TYPE] |
|
631 | 631 | |
|
632 | 632 | Note: ? can be used as a synonym for %psearch, at the beginning or at |
|
633 | 633 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the |
|
634 | 634 | rest of the command line must be unchanged (options come first), so |
|
635 | 635 | for example the following forms are equivalent |
|
636 | 636 | |
|
637 | 637 | %psearch -i a* function |
|
638 | 638 | -i a* function? |
|
639 | 639 | ?-i a* function |
|
640 | 640 | |
|
641 | 641 | Arguments: |
|
642 | 642 | |
|
643 | 643 | PATTERN |
|
644 | 644 | |
|
645 | 645 | where PATTERN is a string containing * as a wildcard similar to its |
|
646 | 646 | use in a shell. The pattern is matched in all namespaces on the |
|
647 | 647 | search path. By default objects starting with a single _ are not |
|
648 | 648 | matched, many IPython generated objects have a single |
|
649 | 649 | underscore. The default is case insensitive matching. Matching is |
|
650 | 650 | also done on the attributes of objects and not only on the objects |
|
651 | 651 | in a module. |
|
652 | 652 | |
|
653 | 653 | [OBJECT TYPE] |
|
654 | 654 | |
|
655 | 655 | Is the name of a python type from the types module. The name is |
|
656 | 656 | given in lowercase without the ending type, ex. StringType is |
|
657 | 657 | written string. By adding a type here only objects matching the |
|
658 | 658 | given type are matched. Using all here makes the pattern match all |
|
659 | 659 | types (this is the default). |
|
660 | 660 | |
|
661 | 661 | Options: |
|
662 | 662 | |
|
663 | 663 | -a: makes the pattern match even objects whose names start with a |
|
664 | 664 | single underscore. These names are normally ommitted from the |
|
665 | 665 | search. |
|
666 | 666 | |
|
667 | 667 | -i/-c: make the pattern case insensitive/sensitive. If neither of |
|
668 | 668 | these options is given, the default is read from your ipythonrc |
|
669 | 669 | file. The option name which sets this value is |
|
670 | 670 | 'wildcards_case_sensitive'. If this option is not specified in your |
|
671 | 671 | ipythonrc file, IPython's internal default is to do a case sensitive |
|
672 | 672 | search. |
|
673 | 673 | |
|
674 | 674 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you |
|
675 | 675 | specifiy can be searched in any of the following namespaces: |
|
676 | 676 | 'builtin', 'user', 'user_global','internal', 'alias', where |
|
677 | 677 | 'builtin' and 'user' are the search defaults. Note that you should |
|
678 | 678 | not use quotes when specifying namespaces. |
|
679 | 679 | |
|
680 | 680 | 'Builtin' contains the python module builtin, 'user' contains all |
|
681 | 681 | user data, 'alias' only contain the shell aliases and no python |
|
682 | 682 | objects, 'internal' contains objects used by IPython. The |
|
683 | 683 | 'user_global' namespace is only used by embedded IPython instances, |
|
684 | 684 | and it contains module-level globals. You can add namespaces to the |
|
685 | 685 | search with -s or exclude them with -e (these options can be given |
|
686 | 686 | more than once). |
|
687 | 687 | |
|
688 | 688 | Examples: |
|
689 | 689 | |
|
690 | 690 | %psearch a* -> objects beginning with an a |
|
691 | 691 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a |
|
692 | 692 | %psearch a* function -> all functions beginning with an a |
|
693 | 693 | %psearch re.e* -> objects beginning with an e in module re |
|
694 | 694 | %psearch r*.e* -> objects that start with e in modules starting in r |
|
695 | 695 | %psearch r*.* string -> all strings in modules beginning with r |
|
696 | 696 | |
|
697 | 697 | Case sensitve search: |
|
698 | 698 | |
|
699 | 699 | %psearch -c a* list all object beginning with lower case a |
|
700 | 700 | |
|
701 | 701 | Show objects beginning with a single _: |
|
702 | 702 | |
|
703 | 703 | %psearch -a _* list objects beginning with a single underscore""" |
|
704 | 704 | try: |
|
705 | 705 | parameter_s = parameter_s.encode('ascii') |
|
706 | 706 | except UnicodeEncodeError: |
|
707 | 707 | print 'Python identifiers can only contain ascii characters.' |
|
708 | 708 | return |
|
709 | 709 | |
|
710 | 710 | # default namespaces to be searched |
|
711 | 711 | def_search = ['user','builtin'] |
|
712 | 712 | |
|
713 | 713 | # Process options/args |
|
714 | 714 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) |
|
715 | 715 | opt = opts.get |
|
716 | 716 | shell = self.shell |
|
717 | 717 | psearch = shell.inspector.psearch |
|
718 | 718 | |
|
719 | 719 | # select case options |
|
720 | 720 | if opts.has_key('i'): |
|
721 | 721 | ignore_case = True |
|
722 | 722 | elif opts.has_key('c'): |
|
723 | 723 | ignore_case = False |
|
724 | 724 | else: |
|
725 | 725 | ignore_case = not shell.wildcards_case_sensitive |
|
726 | 726 | |
|
727 | 727 | # Build list of namespaces to search from user options |
|
728 | 728 | def_search.extend(opt('s',[])) |
|
729 | 729 | ns_exclude = ns_exclude=opt('e',[]) |
|
730 | 730 | ns_search = [nm for nm in def_search if nm not in ns_exclude] |
|
731 | 731 | |
|
732 | 732 | # Call the actual search |
|
733 | 733 | try: |
|
734 | 734 | psearch(args,shell.ns_table,ns_search, |
|
735 | 735 | show_all=opt('a'),ignore_case=ignore_case) |
|
736 | 736 | except: |
|
737 | 737 | shell.showtraceback() |
|
738 | 738 | |
|
739 | 739 | @testdec.skip_doctest |
|
740 | 740 | def magic_who_ls(self, parameter_s=''): |
|
741 | 741 | """Return a sorted list of all interactive variables. |
|
742 | 742 | |
|
743 | 743 | If arguments are given, only variables of types matching these |
|
744 | 744 | arguments are returned. |
|
745 | 745 | |
|
746 | 746 | Examples |
|
747 | 747 | -------- |
|
748 | 748 | |
|
749 | 749 | Define two variables and list them with who_ls:: |
|
750 | 750 | |
|
751 | 751 | In [1]: alpha = 123 |
|
752 | 752 | |
|
753 | 753 | In [2]: beta = 'test' |
|
754 | 754 | |
|
755 | 755 | In [3]: %who_ls |
|
756 | 756 | Out[3]: ['alpha', 'beta'] |
|
757 | 757 | |
|
758 | 758 | In [4]: %who_ls int |
|
759 | 759 | Out[4]: ['alpha'] |
|
760 | 760 | |
|
761 | 761 | In [5]: %who_ls str |
|
762 | 762 | Out[5]: ['beta'] |
|
763 | 763 | """ |
|
764 | 764 | |
|
765 | 765 | user_ns = self.shell.user_ns |
|
766 | 766 | internal_ns = self.shell.internal_ns |
|
767 | 767 | user_ns_hidden = self.shell.user_ns_hidden |
|
768 | 768 | out = [ i for i in user_ns |
|
769 | 769 | if not i.startswith('_') \ |
|
770 | 770 | and not (i in internal_ns or i in user_ns_hidden) ] |
|
771 | 771 | |
|
772 | 772 | typelist = parameter_s.split() |
|
773 | 773 | if typelist: |
|
774 | 774 | typeset = set(typelist) |
|
775 | 775 | out = [i for i in out if type(user_ns[i]).__name__ in typeset] |
|
776 | 776 | |
|
777 | 777 | out.sort() |
|
778 | 778 | return out |
|
779 | 779 | |
|
780 | 780 | @testdec.skip_doctest |
|
781 | 781 | def magic_who(self, parameter_s=''): |
|
782 | 782 | """Print all interactive variables, with some minimal formatting. |
|
783 | 783 | |
|
784 | 784 | If any arguments are given, only variables whose type matches one of |
|
785 | 785 | these are printed. For example: |
|
786 | 786 | |
|
787 | 787 | %who function str |
|
788 | 788 | |
|
789 | 789 | will only list functions and strings, excluding all other types of |
|
790 | 790 | variables. To find the proper type names, simply use type(var) at a |
|
791 | 791 | command line to see how python prints type names. For example: |
|
792 | 792 | |
|
793 | 793 | In [1]: type('hello')\\ |
|
794 | 794 | Out[1]: <type 'str'> |
|
795 | 795 | |
|
796 | 796 | indicates that the type name for strings is 'str'. |
|
797 | 797 | |
|
798 | 798 | %who always excludes executed names loaded through your configuration |
|
799 | 799 | file and things which are internal to IPython. |
|
800 | 800 | |
|
801 | 801 | This is deliberate, as typically you may load many modules and the |
|
802 | 802 | purpose of %who is to show you only what you've manually defined. |
|
803 | 803 | |
|
804 | 804 | Examples |
|
805 | 805 | -------- |
|
806 | 806 | |
|
807 | 807 | Define two variables and list them with who:: |
|
808 | 808 | |
|
809 | 809 | In [1]: alpha = 123 |
|
810 | 810 | |
|
811 | 811 | In [2]: beta = 'test' |
|
812 | 812 | |
|
813 | 813 | In [3]: %who |
|
814 | 814 | alpha beta |
|
815 | 815 | |
|
816 | 816 | In [4]: %who int |
|
817 | 817 | alpha |
|
818 | 818 | |
|
819 | 819 | In [5]: %who str |
|
820 | 820 | beta |
|
821 | 821 | """ |
|
822 | 822 | |
|
823 | 823 | varlist = self.magic_who_ls(parameter_s) |
|
824 | 824 | if not varlist: |
|
825 | 825 | if parameter_s: |
|
826 | 826 | print 'No variables match your requested type.' |
|
827 | 827 | else: |
|
828 | 828 | print 'Interactive namespace is empty.' |
|
829 | 829 | return |
|
830 | 830 | |
|
831 | 831 | # if we have variables, move on... |
|
832 | 832 | count = 0 |
|
833 | 833 | for i in varlist: |
|
834 | 834 | print i+'\t', |
|
835 | 835 | count += 1 |
|
836 | 836 | if count > 8: |
|
837 | 837 | count = 0 |
|
838 | 838 | |
|
839 | 839 | |
|
840 | 840 | |
|
841 | 841 | @testdec.skip_doctest |
|
842 | 842 | def magic_whos(self, parameter_s=''): |
|
843 | 843 | """Like %who, but gives some extra information about each variable. |
|
844 | 844 | |
|
845 | 845 | The same type filtering of %who can be applied here. |
|
846 | 846 | |
|
847 | 847 | For all variables, the type is printed. Additionally it prints: |
|
848 | 848 | |
|
849 | 849 | - For {},[],(): their length. |
|
850 | 850 | |
|
851 | 851 | - For numpy and Numeric arrays, a summary with shape, number of |
|
852 | 852 | elements, typecode and size in memory. |
|
853 | 853 | |
|
854 | 854 | - Everything else: a string representation, snipping their middle if |
|
855 | 855 | too long. |
|
856 | 856 | |
|
857 | 857 | Examples |
|
858 | 858 | -------- |
|
859 | 859 | |
|
860 | 860 | Define two variables and list them with whos:: |
|
861 | 861 | |
|
862 | 862 | In [1]: alpha = 123 |
|
863 | 863 | |
|
864 | 864 | In [2]: beta = 'test' |
|
865 | 865 | |
|
866 | 866 | In [3]: %whos |
|
867 | 867 | Variable Type Data/Info |
|
868 | 868 | -------------------------------- |
|
869 | 869 | alpha int 123 |
|
870 | 870 | beta str test |
|
871 | 871 | """ |
|
872 | 872 | |
|
873 | 873 | varnames = self.magic_who_ls(parameter_s) |
|
874 | 874 | if not varnames: |
|
875 | 875 | if parameter_s: |
|
876 | 876 | print 'No variables match your requested type.' |
|
877 | 877 | else: |
|
878 | 878 | print 'Interactive namespace is empty.' |
|
879 | 879 | return |
|
880 | 880 | |
|
881 | 881 | # if we have variables, move on... |
|
882 | 882 | |
|
883 | 883 | # for these types, show len() instead of data: |
|
884 | 884 | seq_types = [types.DictType,types.ListType,types.TupleType] |
|
885 | 885 | |
|
886 | 886 | # for numpy/Numeric arrays, display summary info |
|
887 | 887 | try: |
|
888 | 888 | import numpy |
|
889 | 889 | except ImportError: |
|
890 | 890 | ndarray_type = None |
|
891 | 891 | else: |
|
892 | 892 | ndarray_type = numpy.ndarray.__name__ |
|
893 | 893 | try: |
|
894 | 894 | import Numeric |
|
895 | 895 | except ImportError: |
|
896 | 896 | array_type = None |
|
897 | 897 | else: |
|
898 | 898 | array_type = Numeric.ArrayType.__name__ |
|
899 | 899 | |
|
900 | 900 | # Find all variable names and types so we can figure out column sizes |
|
901 | 901 | def get_vars(i): |
|
902 | 902 | return self.shell.user_ns[i] |
|
903 | 903 | |
|
904 | 904 | # some types are well known and can be shorter |
|
905 | 905 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} |
|
906 | 906 | def type_name(v): |
|
907 | 907 | tn = type(v).__name__ |
|
908 | 908 | return abbrevs.get(tn,tn) |
|
909 | 909 | |
|
910 | 910 | varlist = map(get_vars,varnames) |
|
911 | 911 | |
|
912 | 912 | typelist = [] |
|
913 | 913 | for vv in varlist: |
|
914 | 914 | tt = type_name(vv) |
|
915 | 915 | |
|
916 | 916 | if tt=='instance': |
|
917 | 917 | typelist.append( abbrevs.get(str(vv.__class__), |
|
918 | 918 | str(vv.__class__))) |
|
919 | 919 | else: |
|
920 | 920 | typelist.append(tt) |
|
921 | 921 | |
|
922 | 922 | # column labels and # of spaces as separator |
|
923 | 923 | varlabel = 'Variable' |
|
924 | 924 | typelabel = 'Type' |
|
925 | 925 | datalabel = 'Data/Info' |
|
926 | 926 | colsep = 3 |
|
927 | 927 | # variable format strings |
|
928 | 928 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" |
|
929 | 929 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' |
|
930 | 930 | aformat = "%s: %s elems, type `%s`, %s bytes" |
|
931 | 931 | # find the size of the columns to format the output nicely |
|
932 | 932 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep |
|
933 | 933 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep |
|
934 | 934 | # table header |
|
935 | 935 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ |
|
936 | 936 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) |
|
937 | 937 | # and the table itself |
|
938 | 938 | kb = 1024 |
|
939 | 939 | Mb = 1048576 # kb**2 |
|
940 | 940 | for vname,var,vtype in zip(varnames,varlist,typelist): |
|
941 | 941 | print itpl(vformat), |
|
942 | 942 | if vtype in seq_types: |
|
943 | 943 | print len(var) |
|
944 | 944 | elif vtype in [array_type,ndarray_type]: |
|
945 | 945 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] |
|
946 | 946 | if vtype==ndarray_type: |
|
947 | 947 | # numpy |
|
948 | 948 | vsize = var.size |
|
949 | 949 | vbytes = vsize*var.itemsize |
|
950 | 950 | vdtype = var.dtype |
|
951 | 951 | else: |
|
952 | 952 | # Numeric |
|
953 | 953 | vsize = Numeric.size(var) |
|
954 | 954 | vbytes = vsize*var.itemsize() |
|
955 | 955 | vdtype = var.typecode() |
|
956 | 956 | |
|
957 | 957 | if vbytes < 100000: |
|
958 | 958 | print aformat % (vshape,vsize,vdtype,vbytes) |
|
959 | 959 | else: |
|
960 | 960 | print aformat % (vshape,vsize,vdtype,vbytes), |
|
961 | 961 | if vbytes < Mb: |
|
962 | 962 | print '(%s kb)' % (vbytes/kb,) |
|
963 | 963 | else: |
|
964 | 964 | print '(%s Mb)' % (vbytes/Mb,) |
|
965 | 965 | else: |
|
966 | 966 | try: |
|
967 | 967 | vstr = str(var) |
|
968 | 968 | except UnicodeEncodeError: |
|
969 | 969 | vstr = unicode(var).encode(sys.getdefaultencoding(), |
|
970 | 970 | 'backslashreplace') |
|
971 | 971 | vstr = vstr.replace('\n','\\n') |
|
972 | 972 | if len(vstr) < 50: |
|
973 | 973 | print vstr |
|
974 | 974 | else: |
|
975 | 975 | printpl(vfmt_short) |
|
976 | 976 | |
|
977 | 977 | def magic_reset(self, parameter_s=''): |
|
978 | 978 | """Resets the namespace by removing all names defined by the user. |
|
979 | 979 | |
|
980 | 980 | Input/Output history are left around in case you need them. |
|
981 | 981 | |
|
982 | 982 | Parameters |
|
983 | 983 | ---------- |
|
984 | 984 | -y : force reset without asking for confirmation. |
|
985 | 985 | |
|
986 | 986 | Examples |
|
987 | 987 | -------- |
|
988 | 988 | In [6]: a = 1 |
|
989 | 989 | |
|
990 | 990 | In [7]: a |
|
991 | 991 | Out[7]: 1 |
|
992 | 992 | |
|
993 | 993 | In [8]: 'a' in _ip.user_ns |
|
994 | 994 | Out[8]: True |
|
995 | 995 | |
|
996 | 996 | In [9]: %reset -f |
|
997 | 997 | |
|
998 | 998 | In [10]: 'a' in _ip.user_ns |
|
999 | 999 | Out[10]: False |
|
1000 | 1000 | """ |
|
1001 | 1001 | |
|
1002 | 1002 | if parameter_s == '-f': |
|
1003 | 1003 | ans = True |
|
1004 | 1004 | else: |
|
1005 | 1005 | ans = self.shell.ask_yes_no( |
|
1006 | 1006 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") |
|
1007 | 1007 | if not ans: |
|
1008 | 1008 | print 'Nothing done.' |
|
1009 | 1009 | return |
|
1010 | 1010 | user_ns = self.shell.user_ns |
|
1011 | 1011 | for i in self.magic_who_ls(): |
|
1012 | 1012 | del(user_ns[i]) |
|
1013 | 1013 | |
|
1014 | 1014 | # Also flush the private list of module references kept for script |
|
1015 | 1015 | # execution protection |
|
1016 | 1016 | self.shell.clear_main_mod_cache() |
|
1017 | 1017 | |
|
1018 | 1018 | def magic_reset_selective(self, parameter_s=''): |
|
1019 | 1019 | """Resets the namespace by removing names defined by the user. |
|
1020 | 1020 | |
|
1021 | 1021 | Input/Output history are left around in case you need them. |
|
1022 | 1022 | |
|
1023 | 1023 | %reset_selective [-f] regex |
|
1024 | 1024 | |
|
1025 | 1025 | No action is taken if regex is not included |
|
1026 | 1026 | |
|
1027 | 1027 | Options |
|
1028 | 1028 | -f : force reset without asking for confirmation. |
|
1029 | 1029 | |
|
1030 | 1030 | Examples |
|
1031 | 1031 | -------- |
|
1032 | 1032 | |
|
1033 | 1033 | We first fully reset the namespace so your output looks identical to |
|
1034 | 1034 | this example for pedagogical reasons; in practice you do not need a |
|
1035 | 1035 | full reset. |
|
1036 | 1036 | |
|
1037 | 1037 | In [1]: %reset -f |
|
1038 | 1038 | |
|
1039 | 1039 | Now, with a clean namespace we can make a few variables and use |
|
1040 | 1040 | %reset_selective to only delete names that match our regexp: |
|
1041 | 1041 | |
|
1042 | 1042 | In [2]: a=1; b=2; c=3; b1m=4; b2m=5; b3m=6; b4m=7; b2s=8 |
|
1043 | 1043 | |
|
1044 | 1044 | In [3]: who_ls |
|
1045 | 1045 | Out[3]: ['a', 'b', 'b1m', 'b2m', 'b2s', 'b3m', 'b4m', 'c'] |
|
1046 | 1046 | |
|
1047 | 1047 | In [4]: %reset_selective -f b[2-3]m |
|
1048 | 1048 | |
|
1049 | 1049 | In [5]: who_ls |
|
1050 | 1050 | Out[5]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] |
|
1051 | 1051 | |
|
1052 | 1052 | In [6]: %reset_selective -f d |
|
1053 | 1053 | |
|
1054 | 1054 | In [7]: who_ls |
|
1055 | 1055 | Out[7]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] |
|
1056 | 1056 | |
|
1057 | 1057 | In [8]: %reset_selective -f c |
|
1058 | 1058 | |
|
1059 | 1059 | In [9]: who_ls |
|
1060 | 1060 | Out[9]: ['a', 'b', 'b1m', 'b2s', 'b4m'] |
|
1061 | 1061 | |
|
1062 | 1062 | In [10]: %reset_selective -f b |
|
1063 | 1063 | |
|
1064 | 1064 | In [11]: who_ls |
|
1065 | 1065 | Out[11]: ['a'] |
|
1066 | 1066 | """ |
|
1067 | 1067 | |
|
1068 | 1068 | opts, regex = self.parse_options(parameter_s,'f') |
|
1069 | 1069 | |
|
1070 | 1070 | if opts.has_key('f'): |
|
1071 | 1071 | ans = True |
|
1072 | 1072 | else: |
|
1073 | 1073 | ans = self.shell.ask_yes_no( |
|
1074 | 1074 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") |
|
1075 | 1075 | if not ans: |
|
1076 | 1076 | print 'Nothing done.' |
|
1077 | 1077 | return |
|
1078 | 1078 | user_ns = self.shell.user_ns |
|
1079 | 1079 | if not regex: |
|
1080 | 1080 | print 'No regex pattern specified. Nothing done.' |
|
1081 | 1081 | return |
|
1082 | 1082 | else: |
|
1083 | 1083 | try: |
|
1084 | 1084 | m = re.compile(regex) |
|
1085 | 1085 | except TypeError: |
|
1086 | 1086 | raise TypeError('regex must be a string or compiled pattern') |
|
1087 | 1087 | for i in self.magic_who_ls(): |
|
1088 | 1088 | if m.search(i): |
|
1089 | 1089 | del(user_ns[i]) |
|
1090 | 1090 | |
|
1091 | 1091 | def magic_logstart(self,parameter_s=''): |
|
1092 | 1092 | """Start logging anywhere in a session. |
|
1093 | 1093 | |
|
1094 | 1094 | %logstart [-o|-r|-t] [log_name [log_mode]] |
|
1095 | 1095 | |
|
1096 | 1096 | If no name is given, it defaults to a file named 'ipython_log.py' in your |
|
1097 | 1097 | current directory, in 'rotate' mode (see below). |
|
1098 | 1098 | |
|
1099 | 1099 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your |
|
1100 | 1100 | history up to that point and then continues logging. |
|
1101 | 1101 | |
|
1102 | 1102 | %logstart takes a second optional parameter: logging mode. This can be one |
|
1103 | 1103 | of (note that the modes are given unquoted):\\ |
|
1104 | 1104 | append: well, that says it.\\ |
|
1105 | 1105 | backup: rename (if exists) to name~ and start name.\\ |
|
1106 | 1106 | global: single logfile in your home dir, appended to.\\ |
|
1107 | 1107 | over : overwrite existing log.\\ |
|
1108 | 1108 | rotate: create rotating logs name.1~, name.2~, etc. |
|
1109 | 1109 | |
|
1110 | 1110 | Options: |
|
1111 | 1111 | |
|
1112 | 1112 | -o: log also IPython's output. In this mode, all commands which |
|
1113 | 1113 | generate an Out[NN] prompt are recorded to the logfile, right after |
|
1114 | 1114 | their corresponding input line. The output lines are always |
|
1115 | 1115 | prepended with a '#[Out]# ' marker, so that the log remains valid |
|
1116 | 1116 | Python code. |
|
1117 | 1117 | |
|
1118 | 1118 | Since this marker is always the same, filtering only the output from |
|
1119 | 1119 | a log is very easy, using for example a simple awk call: |
|
1120 | 1120 | |
|
1121 | 1121 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py |
|
1122 | 1122 | |
|
1123 | 1123 | -r: log 'raw' input. Normally, IPython's logs contain the processed |
|
1124 | 1124 | input, so that user lines are logged in their final form, converted |
|
1125 | 1125 | into valid Python. For example, %Exit is logged as |
|
1126 | 1126 | '_ip.magic("Exit"). If the -r flag is given, all input is logged |
|
1127 | 1127 | exactly as typed, with no transformations applied. |
|
1128 | 1128 | |
|
1129 | 1129 | -t: put timestamps before each input line logged (these are put in |
|
1130 | 1130 | comments).""" |
|
1131 | 1131 | |
|
1132 | 1132 | opts,par = self.parse_options(parameter_s,'ort') |
|
1133 | 1133 | log_output = 'o' in opts |
|
1134 | 1134 | log_raw_input = 'r' in opts |
|
1135 | 1135 | timestamp = 't' in opts |
|
1136 | 1136 | |
|
1137 | 1137 | logger = self.shell.logger |
|
1138 | 1138 | |
|
1139 | 1139 | # if no args are given, the defaults set in the logger constructor by |
|
1140 | 1140 | # ipytohn remain valid |
|
1141 | 1141 | if par: |
|
1142 | 1142 | try: |
|
1143 | 1143 | logfname,logmode = par.split() |
|
1144 | 1144 | except: |
|
1145 | 1145 | logfname = par |
|
1146 | 1146 | logmode = 'backup' |
|
1147 | 1147 | else: |
|
1148 | 1148 | logfname = logger.logfname |
|
1149 | 1149 | logmode = logger.logmode |
|
1150 | 1150 | # put logfname into rc struct as if it had been called on the command |
|
1151 | 1151 | # line, so it ends up saved in the log header Save it in case we need |
|
1152 | 1152 | # to restore it... |
|
1153 | 1153 | old_logfile = self.shell.logfile |
|
1154 | 1154 | if logfname: |
|
1155 | 1155 | logfname = os.path.expanduser(logfname) |
|
1156 | 1156 | self.shell.logfile = logfname |
|
1157 | 1157 | |
|
1158 | 1158 | loghead = '# IPython log file\n\n' |
|
1159 | 1159 | try: |
|
1160 | 1160 | started = logger.logstart(logfname,loghead,logmode, |
|
1161 | 1161 | log_output,timestamp,log_raw_input) |
|
1162 | 1162 | except: |
|
1163 | 1163 | self.shell.logfile = old_logfile |
|
1164 | 1164 | warn("Couldn't start log: %s" % sys.exc_info()[1]) |
|
1165 | 1165 | else: |
|
1166 | 1166 | # log input history up to this point, optionally interleaving |
|
1167 | 1167 | # output if requested |
|
1168 | 1168 | |
|
1169 | 1169 | if timestamp: |
|
1170 | 1170 | # disable timestamping for the previous history, since we've |
|
1171 | 1171 | # lost those already (no time machine here). |
|
1172 | 1172 | logger.timestamp = False |
|
1173 | 1173 | |
|
1174 | 1174 | if log_raw_input: |
|
1175 | 1175 | input_hist = self.shell.history_manager.input_hist_raw |
|
1176 | 1176 | else: |
|
1177 | 1177 | input_hist = self.shell.history_manager.input_hist_parsed |
|
1178 | 1178 | |
|
1179 | 1179 | if log_output: |
|
1180 | 1180 | log_write = logger.log_write |
|
1181 | 1181 | output_hist = self.shell.history_manager.output_hist |
|
1182 | 1182 | for n in range(1,len(input_hist)-1): |
|
1183 | 1183 | log_write(input_hist[n].rstrip()) |
|
1184 | 1184 | if n in output_hist: |
|
1185 | 1185 | log_write(repr(output_hist[n]),'output') |
|
1186 | 1186 | else: |
|
1187 | 1187 | logger.log_write(''.join(input_hist[1:])) |
|
1188 | 1188 | if timestamp: |
|
1189 | 1189 | # re-enable timestamping |
|
1190 | 1190 | logger.timestamp = True |
|
1191 | 1191 | |
|
1192 | 1192 | print ('Activating auto-logging. ' |
|
1193 | 1193 | 'Current session state plus future input saved.') |
|
1194 | 1194 | logger.logstate() |
|
1195 | 1195 | |
|
1196 | 1196 | def magic_logstop(self,parameter_s=''): |
|
1197 | 1197 | """Fully stop logging and close log file. |
|
1198 | 1198 | |
|
1199 | 1199 | In order to start logging again, a new %logstart call needs to be made, |
|
1200 | 1200 | possibly (though not necessarily) with a new filename, mode and other |
|
1201 | 1201 | options.""" |
|
1202 | 1202 | self.logger.logstop() |
|
1203 | 1203 | |
|
1204 | 1204 | def magic_logoff(self,parameter_s=''): |
|
1205 | 1205 | """Temporarily stop logging. |
|
1206 | 1206 | |
|
1207 | 1207 | You must have previously started logging.""" |
|
1208 | 1208 | self.shell.logger.switch_log(0) |
|
1209 | 1209 | |
|
1210 | 1210 | def magic_logon(self,parameter_s=''): |
|
1211 | 1211 | """Restart logging. |
|
1212 | 1212 | |
|
1213 | 1213 | This function is for restarting logging which you've temporarily |
|
1214 | 1214 | stopped with %logoff. For starting logging for the first time, you |
|
1215 | 1215 | must use the %logstart function, which allows you to specify an |
|
1216 | 1216 | optional log filename.""" |
|
1217 | 1217 | |
|
1218 | 1218 | self.shell.logger.switch_log(1) |
|
1219 | 1219 | |
|
1220 | 1220 | def magic_logstate(self,parameter_s=''): |
|
1221 | 1221 | """Print the status of the logging system.""" |
|
1222 | 1222 | |
|
1223 | 1223 | self.shell.logger.logstate() |
|
1224 | 1224 | |
|
1225 | 1225 | def magic_pdb(self, parameter_s=''): |
|
1226 | 1226 | """Control the automatic calling of the pdb interactive debugger. |
|
1227 | 1227 | |
|
1228 | 1228 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without |
|
1229 | 1229 | argument it works as a toggle. |
|
1230 | 1230 | |
|
1231 | 1231 | When an exception is triggered, IPython can optionally call the |
|
1232 | 1232 | interactive pdb debugger after the traceback printout. %pdb toggles |
|
1233 | 1233 | this feature on and off. |
|
1234 | 1234 | |
|
1235 | 1235 | The initial state of this feature is set in your ipythonrc |
|
1236 | 1236 | configuration file (the variable is called 'pdb'). |
|
1237 | 1237 | |
|
1238 | 1238 | If you want to just activate the debugger AFTER an exception has fired, |
|
1239 | 1239 | without having to type '%pdb on' and rerunning your code, you can use |
|
1240 | 1240 | the %debug magic.""" |
|
1241 | 1241 | |
|
1242 | 1242 | par = parameter_s.strip().lower() |
|
1243 | 1243 | |
|
1244 | 1244 | if par: |
|
1245 | 1245 | try: |
|
1246 | 1246 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] |
|
1247 | 1247 | except KeyError: |
|
1248 | 1248 | print ('Incorrect argument. Use on/1, off/0, ' |
|
1249 | 1249 | 'or nothing for a toggle.') |
|
1250 | 1250 | return |
|
1251 | 1251 | else: |
|
1252 | 1252 | # toggle |
|
1253 | 1253 | new_pdb = not self.shell.call_pdb |
|
1254 | 1254 | |
|
1255 | 1255 | # set on the shell |
|
1256 | 1256 | self.shell.call_pdb = new_pdb |
|
1257 | 1257 | print 'Automatic pdb calling has been turned',on_off(new_pdb) |
|
1258 | 1258 | |
|
1259 | 1259 | def magic_debug(self, parameter_s=''): |
|
1260 | 1260 | """Activate the interactive debugger in post-mortem mode. |
|
1261 | 1261 | |
|
1262 | 1262 | If an exception has just occurred, this lets you inspect its stack |
|
1263 | 1263 | frames interactively. Note that this will always work only on the last |
|
1264 | 1264 | traceback that occurred, so you must call this quickly after an |
|
1265 | 1265 | exception that you wish to inspect has fired, because if another one |
|
1266 | 1266 | occurs, it clobbers the previous one. |
|
1267 | 1267 | |
|
1268 | 1268 | If you want IPython to automatically do this on every exception, see |
|
1269 | 1269 | the %pdb magic for more details. |
|
1270 | 1270 | """ |
|
1271 | 1271 | self.shell.debugger(force=True) |
|
1272 | 1272 | |
|
1273 | 1273 | @testdec.skip_doctest |
|
1274 | 1274 | def magic_prun(self, parameter_s ='',user_mode=1, |
|
1275 | 1275 | opts=None,arg_lst=None,prog_ns=None): |
|
1276 | 1276 | |
|
1277 | 1277 | """Run a statement through the python code profiler. |
|
1278 | 1278 | |
|
1279 | 1279 | Usage: |
|
1280 | 1280 | %prun [options] statement |
|
1281 | 1281 | |
|
1282 | 1282 | The given statement (which doesn't require quote marks) is run via the |
|
1283 | 1283 | python profiler in a manner similar to the profile.run() function. |
|
1284 | 1284 | Namespaces are internally managed to work correctly; profile.run |
|
1285 | 1285 | cannot be used in IPython because it makes certain assumptions about |
|
1286 | 1286 | namespaces which do not hold under IPython. |
|
1287 | 1287 | |
|
1288 | 1288 | Options: |
|
1289 | 1289 | |
|
1290 | 1290 | -l <limit>: you can place restrictions on what or how much of the |
|
1291 | 1291 | profile gets printed. The limit value can be: |
|
1292 | 1292 | |
|
1293 | 1293 | * A string: only information for function names containing this string |
|
1294 | 1294 | is printed. |
|
1295 | 1295 | |
|
1296 | 1296 | * An integer: only these many lines are printed. |
|
1297 | 1297 | |
|
1298 | 1298 | * A float (between 0 and 1): this fraction of the report is printed |
|
1299 | 1299 | (for example, use a limit of 0.4 to see the topmost 40% only). |
|
1300 | 1300 | |
|
1301 | 1301 | You can combine several limits with repeated use of the option. For |
|
1302 | 1302 | example, '-l __init__ -l 5' will print only the topmost 5 lines of |
|
1303 | 1303 | information about class constructors. |
|
1304 | 1304 | |
|
1305 | 1305 | -r: return the pstats.Stats object generated by the profiling. This |
|
1306 | 1306 | object has all the information about the profile in it, and you can |
|
1307 | 1307 | later use it for further analysis or in other functions. |
|
1308 | 1308 | |
|
1309 | 1309 | -s <key>: sort profile by given key. You can provide more than one key |
|
1310 | 1310 | by using the option several times: '-s key1 -s key2 -s key3...'. The |
|
1311 | 1311 | default sorting key is 'time'. |
|
1312 | 1312 | |
|
1313 | 1313 | The following is copied verbatim from the profile documentation |
|
1314 | 1314 | referenced below: |
|
1315 | 1315 | |
|
1316 | 1316 | When more than one key is provided, additional keys are used as |
|
1317 | 1317 | secondary criteria when the there is equality in all keys selected |
|
1318 | 1318 | before them. |
|
1319 | 1319 | |
|
1320 | 1320 | Abbreviations can be used for any key names, as long as the |
|
1321 | 1321 | abbreviation is unambiguous. The following are the keys currently |
|
1322 | 1322 | defined: |
|
1323 | 1323 | |
|
1324 | 1324 | Valid Arg Meaning |
|
1325 | 1325 | "calls" call count |
|
1326 | 1326 | "cumulative" cumulative time |
|
1327 | 1327 | "file" file name |
|
1328 | 1328 | "module" file name |
|
1329 | 1329 | "pcalls" primitive call count |
|
1330 | 1330 | "line" line number |
|
1331 | 1331 | "name" function name |
|
1332 | 1332 | "nfl" name/file/line |
|
1333 | 1333 | "stdname" standard name |
|
1334 | 1334 | "time" internal time |
|
1335 | 1335 | |
|
1336 | 1336 | Note that all sorts on statistics are in descending order (placing |
|
1337 | 1337 | most time consuming items first), where as name, file, and line number |
|
1338 | 1338 | searches are in ascending order (i.e., alphabetical). The subtle |
|
1339 | 1339 | distinction between "nfl" and "stdname" is that the standard name is a |
|
1340 | 1340 | sort of the name as printed, which means that the embedded line |
|
1341 | 1341 | numbers get compared in an odd way. For example, lines 3, 20, and 40 |
|
1342 | 1342 | would (if the file names were the same) appear in the string order |
|
1343 | 1343 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the |
|
1344 | 1344 | line numbers. In fact, sort_stats("nfl") is the same as |
|
1345 | 1345 | sort_stats("name", "file", "line"). |
|
1346 | 1346 | |
|
1347 | 1347 | -T <filename>: save profile results as shown on screen to a text |
|
1348 | 1348 | file. The profile is still shown on screen. |
|
1349 | 1349 | |
|
1350 | 1350 | -D <filename>: save (via dump_stats) profile statistics to given |
|
1351 | 1351 | filename. This data is in a format understod by the pstats module, and |
|
1352 | 1352 | is generated by a call to the dump_stats() method of profile |
|
1353 | 1353 | objects. The profile is still shown on screen. |
|
1354 | 1354 | |
|
1355 | 1355 | If you want to run complete programs under the profiler's control, use |
|
1356 | 1356 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts |
|
1357 | 1357 | contains profiler specific options as described here. |
|
1358 | 1358 | |
|
1359 | 1359 | You can read the complete documentation for the profile module with:: |
|
1360 | 1360 | |
|
1361 | 1361 | In [1]: import profile; profile.help() |
|
1362 | 1362 | """ |
|
1363 | 1363 | |
|
1364 | 1364 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) |
|
1365 | 1365 | # protect user quote marks |
|
1366 | 1366 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") |
|
1367 | 1367 | |
|
1368 | 1368 | if user_mode: # regular user call |
|
1369 | 1369 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', |
|
1370 | 1370 | list_all=1) |
|
1371 | 1371 | namespace = self.shell.user_ns |
|
1372 | 1372 | else: # called to run a program by %run -p |
|
1373 | 1373 | try: |
|
1374 | 1374 | filename = get_py_filename(arg_lst[0]) |
|
1375 | 1375 | except IOError,msg: |
|
1376 | 1376 | error(msg) |
|
1377 | 1377 | return |
|
1378 | 1378 | |
|
1379 | 1379 | arg_str = 'execfile(filename,prog_ns)' |
|
1380 | 1380 | namespace = locals() |
|
1381 | 1381 | |
|
1382 | 1382 | opts.merge(opts_def) |
|
1383 | 1383 | |
|
1384 | 1384 | prof = profile.Profile() |
|
1385 | 1385 | try: |
|
1386 | 1386 | prof = prof.runctx(arg_str,namespace,namespace) |
|
1387 | 1387 | sys_exit = '' |
|
1388 | 1388 | except SystemExit: |
|
1389 | 1389 | sys_exit = """*** SystemExit exception caught in code being profiled.""" |
|
1390 | 1390 | |
|
1391 | 1391 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) |
|
1392 | 1392 | |
|
1393 | 1393 | lims = opts.l |
|
1394 | 1394 | if lims: |
|
1395 | 1395 | lims = [] # rebuild lims with ints/floats/strings |
|
1396 | 1396 | for lim in opts.l: |
|
1397 | 1397 | try: |
|
1398 | 1398 | lims.append(int(lim)) |
|
1399 | 1399 | except ValueError: |
|
1400 | 1400 | try: |
|
1401 | 1401 | lims.append(float(lim)) |
|
1402 | 1402 | except ValueError: |
|
1403 | 1403 | lims.append(lim) |
|
1404 | 1404 | |
|
1405 | 1405 | # Trap output. |
|
1406 | 1406 | stdout_trap = StringIO() |
|
1407 | 1407 | |
|
1408 | 1408 | if hasattr(stats,'stream'): |
|
1409 | 1409 | # In newer versions of python, the stats object has a 'stream' |
|
1410 | 1410 | # attribute to write into. |
|
1411 | 1411 | stats.stream = stdout_trap |
|
1412 | 1412 | stats.print_stats(*lims) |
|
1413 | 1413 | else: |
|
1414 | 1414 | # For older versions, we manually redirect stdout during printing |
|
1415 | 1415 | sys_stdout = sys.stdout |
|
1416 | 1416 | try: |
|
1417 | 1417 | sys.stdout = stdout_trap |
|
1418 | 1418 | stats.print_stats(*lims) |
|
1419 | 1419 | finally: |
|
1420 | 1420 | sys.stdout = sys_stdout |
|
1421 | 1421 | |
|
1422 | 1422 | output = stdout_trap.getvalue() |
|
1423 | 1423 | output = output.rstrip() |
|
1424 | 1424 | |
|
1425 | 1425 | page.page(output) |
|
1426 | 1426 | print sys_exit, |
|
1427 | 1427 | |
|
1428 | 1428 | dump_file = opts.D[0] |
|
1429 | 1429 | text_file = opts.T[0] |
|
1430 | 1430 | if dump_file: |
|
1431 | 1431 | prof.dump_stats(dump_file) |
|
1432 | 1432 | print '\n*** Profile stats marshalled to file',\ |
|
1433 | 1433 | `dump_file`+'.',sys_exit |
|
1434 | 1434 | if text_file: |
|
1435 | 1435 | pfile = file(text_file,'w') |
|
1436 | 1436 | pfile.write(output) |
|
1437 | 1437 | pfile.close() |
|
1438 | 1438 | print '\n*** Profile printout saved to text file',\ |
|
1439 | 1439 | `text_file`+'.',sys_exit |
|
1440 | 1440 | |
|
1441 | 1441 | if opts.has_key('r'): |
|
1442 | 1442 | return stats |
|
1443 | 1443 | else: |
|
1444 | 1444 | return None |
|
1445 | 1445 | |
|
1446 | 1446 | @testdec.skip_doctest |
|
1447 | 1447 | def magic_run(self, parameter_s ='',runner=None, |
|
1448 | 1448 | file_finder=get_py_filename): |
|
1449 | 1449 | """Run the named file inside IPython as a program. |
|
1450 | 1450 | |
|
1451 | 1451 | Usage:\\ |
|
1452 | 1452 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] |
|
1453 | 1453 | |
|
1454 | 1454 | Parameters after the filename are passed as command-line arguments to |
|
1455 | 1455 | the program (put in sys.argv). Then, control returns to IPython's |
|
1456 | 1456 | prompt. |
|
1457 | 1457 | |
|
1458 | 1458 | This is similar to running at a system prompt:\\ |
|
1459 | 1459 | $ python file args\\ |
|
1460 | 1460 | but with the advantage of giving you IPython's tracebacks, and of |
|
1461 | 1461 | loading all variables into your interactive namespace for further use |
|
1462 | 1462 | (unless -p is used, see below). |
|
1463 | 1463 | |
|
1464 | 1464 | The file is executed in a namespace initially consisting only of |
|
1465 | 1465 | __name__=='__main__' and sys.argv constructed as indicated. It thus |
|
1466 | 1466 | sees its environment as if it were being run as a stand-alone program |
|
1467 | 1467 | (except for sharing global objects such as previously imported |
|
1468 | 1468 | modules). But after execution, the IPython interactive namespace gets |
|
1469 | 1469 | updated with all variables defined in the program (except for __name__ |
|
1470 | 1470 | and sys.argv). This allows for very convenient loading of code for |
|
1471 | 1471 | interactive work, while giving each program a 'clean sheet' to run in. |
|
1472 | 1472 | |
|
1473 | 1473 | Options: |
|
1474 | 1474 | |
|
1475 | 1475 | -n: __name__ is NOT set to '__main__', but to the running file's name |
|
1476 | 1476 | without extension (as python does under import). This allows running |
|
1477 | 1477 | scripts and reloading the definitions in them without calling code |
|
1478 | 1478 | protected by an ' if __name__ == "__main__" ' clause. |
|
1479 | 1479 | |
|
1480 | 1480 | -i: run the file in IPython's namespace instead of an empty one. This |
|
1481 | 1481 | is useful if you are experimenting with code written in a text editor |
|
1482 | 1482 | which depends on variables defined interactively. |
|
1483 | 1483 | |
|
1484 | 1484 | -e: ignore sys.exit() calls or SystemExit exceptions in the script |
|
1485 | 1485 | being run. This is particularly useful if IPython is being used to |
|
1486 | 1486 | run unittests, which always exit with a sys.exit() call. In such |
|
1487 | 1487 | cases you are interested in the output of the test results, not in |
|
1488 | 1488 | seeing a traceback of the unittest module. |
|
1489 | 1489 | |
|
1490 | 1490 | -t: print timing information at the end of the run. IPython will give |
|
1491 | 1491 | you an estimated CPU time consumption for your script, which under |
|
1492 | 1492 | Unix uses the resource module to avoid the wraparound problems of |
|
1493 | 1493 | time.clock(). Under Unix, an estimate of time spent on system tasks |
|
1494 | 1494 | is also given (for Windows platforms this is reported as 0.0). |
|
1495 | 1495 | |
|
1496 | 1496 | If -t is given, an additional -N<N> option can be given, where <N> |
|
1497 | 1497 | must be an integer indicating how many times you want the script to |
|
1498 | 1498 | run. The final timing report will include total and per run results. |
|
1499 | 1499 | |
|
1500 | 1500 | For example (testing the script uniq_stable.py): |
|
1501 | 1501 | |
|
1502 | 1502 | In [1]: run -t uniq_stable |
|
1503 | 1503 | |
|
1504 | 1504 | IPython CPU timings (estimated):\\ |
|
1505 | 1505 | User : 0.19597 s.\\ |
|
1506 | 1506 | System: 0.0 s.\\ |
|
1507 | 1507 | |
|
1508 | 1508 | In [2]: run -t -N5 uniq_stable |
|
1509 | 1509 | |
|
1510 | 1510 | IPython CPU timings (estimated):\\ |
|
1511 | 1511 | Total runs performed: 5\\ |
|
1512 | 1512 | Times : Total Per run\\ |
|
1513 | 1513 | User : 0.910862 s, 0.1821724 s.\\ |
|
1514 | 1514 | System: 0.0 s, 0.0 s. |
|
1515 | 1515 | |
|
1516 | 1516 | -d: run your program under the control of pdb, the Python debugger. |
|
1517 | 1517 | This allows you to execute your program step by step, watch variables, |
|
1518 | 1518 | etc. Internally, what IPython does is similar to calling: |
|
1519 | 1519 | |
|
1520 | 1520 | pdb.run('execfile("YOURFILENAME")') |
|
1521 | 1521 | |
|
1522 | 1522 | with a breakpoint set on line 1 of your file. You can change the line |
|
1523 | 1523 | number for this automatic breakpoint to be <N> by using the -bN option |
|
1524 | 1524 | (where N must be an integer). For example: |
|
1525 | 1525 | |
|
1526 | 1526 | %run -d -b40 myscript |
|
1527 | 1527 | |
|
1528 | 1528 | will set the first breakpoint at line 40 in myscript.py. Note that |
|
1529 | 1529 | the first breakpoint must be set on a line which actually does |
|
1530 | 1530 | something (not a comment or docstring) for it to stop execution. |
|
1531 | 1531 | |
|
1532 | 1532 | When the pdb debugger starts, you will see a (Pdb) prompt. You must |
|
1533 | 1533 | first enter 'c' (without qoutes) to start execution up to the first |
|
1534 | 1534 | breakpoint. |
|
1535 | 1535 | |
|
1536 | 1536 | Entering 'help' gives information about the use of the debugger. You |
|
1537 | 1537 | can easily see pdb's full documentation with "import pdb;pdb.help()" |
|
1538 | 1538 | at a prompt. |
|
1539 | 1539 | |
|
1540 | 1540 | -p: run program under the control of the Python profiler module (which |
|
1541 | 1541 | prints a detailed report of execution times, function calls, etc). |
|
1542 | 1542 | |
|
1543 | 1543 | You can pass other options after -p which affect the behavior of the |
|
1544 | 1544 | profiler itself. See the docs for %prun for details. |
|
1545 | 1545 | |
|
1546 | 1546 | In this mode, the program's variables do NOT propagate back to the |
|
1547 | 1547 | IPython interactive namespace (because they remain in the namespace |
|
1548 | 1548 | where the profiler executes them). |
|
1549 | 1549 | |
|
1550 | 1550 | Internally this triggers a call to %prun, see its documentation for |
|
1551 | 1551 | details on the options available specifically for profiling. |
|
1552 | 1552 | |
|
1553 | 1553 | There is one special usage for which the text above doesn't apply: |
|
1554 | 1554 | if the filename ends with .ipy, the file is run as ipython script, |
|
1555 | 1555 | just as if the commands were written on IPython prompt. |
|
1556 | 1556 | """ |
|
1557 | 1557 | |
|
1558 | 1558 | # get arguments and set sys.argv for program to be run. |
|
1559 | 1559 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', |
|
1560 | 1560 | mode='list',list_all=1) |
|
1561 | 1561 | |
|
1562 | 1562 | try: |
|
1563 | 1563 | filename = file_finder(arg_lst[0]) |
|
1564 | 1564 | except IndexError: |
|
1565 | 1565 | warn('you must provide at least a filename.') |
|
1566 | 1566 | print '\n%run:\n',oinspect.getdoc(self.magic_run) |
|
1567 | 1567 | return |
|
1568 | 1568 | except IOError,msg: |
|
1569 | 1569 | error(msg) |
|
1570 | 1570 | return |
|
1571 | 1571 | |
|
1572 | 1572 | if filename.lower().endswith('.ipy'): |
|
1573 | 1573 | self.shell.safe_execfile_ipy(filename) |
|
1574 | 1574 | return |
|
1575 | 1575 | |
|
1576 | 1576 | # Control the response to exit() calls made by the script being run |
|
1577 | 1577 | exit_ignore = opts.has_key('e') |
|
1578 | 1578 | |
|
1579 | 1579 | # Make sure that the running script gets a proper sys.argv as if it |
|
1580 | 1580 | # were run from a system shell. |
|
1581 | 1581 | save_argv = sys.argv # save it for later restoring |
|
1582 | 1582 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename |
|
1583 | 1583 | |
|
1584 | 1584 | if opts.has_key('i'): |
|
1585 | 1585 | # Run in user's interactive namespace |
|
1586 | 1586 | prog_ns = self.shell.user_ns |
|
1587 | 1587 | __name__save = self.shell.user_ns['__name__'] |
|
1588 | 1588 | prog_ns['__name__'] = '__main__' |
|
1589 | 1589 | main_mod = self.shell.new_main_mod(prog_ns) |
|
1590 | 1590 | else: |
|
1591 | 1591 | # Run in a fresh, empty namespace |
|
1592 | 1592 | if opts.has_key('n'): |
|
1593 | 1593 | name = os.path.splitext(os.path.basename(filename))[0] |
|
1594 | 1594 | else: |
|
1595 | 1595 | name = '__main__' |
|
1596 | 1596 | |
|
1597 | 1597 | main_mod = self.shell.new_main_mod() |
|
1598 | 1598 | prog_ns = main_mod.__dict__ |
|
1599 | 1599 | prog_ns['__name__'] = name |
|
1600 | 1600 | |
|
1601 | 1601 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must |
|
1602 | 1602 | # set the __file__ global in the script's namespace |
|
1603 | 1603 | prog_ns['__file__'] = filename |
|
1604 | 1604 | |
|
1605 | 1605 | # pickle fix. See interactiveshell for an explanation. But we need to make sure |
|
1606 | 1606 | # that, if we overwrite __main__, we replace it at the end |
|
1607 | 1607 | main_mod_name = prog_ns['__name__'] |
|
1608 | 1608 | |
|
1609 | 1609 | if main_mod_name == '__main__': |
|
1610 | 1610 | restore_main = sys.modules['__main__'] |
|
1611 | 1611 | else: |
|
1612 | 1612 | restore_main = False |
|
1613 | 1613 | |
|
1614 | 1614 | # This needs to be undone at the end to prevent holding references to |
|
1615 | 1615 | # every single object ever created. |
|
1616 | 1616 | sys.modules[main_mod_name] = main_mod |
|
1617 | 1617 | |
|
1618 | 1618 | stats = None |
|
1619 | 1619 | try: |
|
1620 | 1620 | self.shell.save_history() |
|
1621 | 1621 | |
|
1622 | 1622 | if opts.has_key('p'): |
|
1623 | 1623 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) |
|
1624 | 1624 | else: |
|
1625 | 1625 | if opts.has_key('d'): |
|
1626 | 1626 | deb = debugger.Pdb(self.shell.colors) |
|
1627 | 1627 | # reset Breakpoint state, which is moronically kept |
|
1628 | 1628 | # in a class |
|
1629 | 1629 | bdb.Breakpoint.next = 1 |
|
1630 | 1630 | bdb.Breakpoint.bplist = {} |
|
1631 | 1631 | bdb.Breakpoint.bpbynumber = [None] |
|
1632 | 1632 | # Set an initial breakpoint to stop execution |
|
1633 | 1633 | maxtries = 10 |
|
1634 | 1634 | bp = int(opts.get('b',[1])[0]) |
|
1635 | 1635 | checkline = deb.checkline(filename,bp) |
|
1636 | 1636 | if not checkline: |
|
1637 | 1637 | for bp in range(bp+1,bp+maxtries+1): |
|
1638 | 1638 | if deb.checkline(filename,bp): |
|
1639 | 1639 | break |
|
1640 | 1640 | else: |
|
1641 | 1641 | msg = ("\nI failed to find a valid line to set " |
|
1642 | 1642 | "a breakpoint\n" |
|
1643 | 1643 | "after trying up to line: %s.\n" |
|
1644 | 1644 | "Please set a valid breakpoint manually " |
|
1645 | 1645 | "with the -b option." % bp) |
|
1646 | 1646 | error(msg) |
|
1647 | 1647 | return |
|
1648 | 1648 | # if we find a good linenumber, set the breakpoint |
|
1649 | 1649 | deb.do_break('%s:%s' % (filename,bp)) |
|
1650 | 1650 | # Start file run |
|
1651 | 1651 | print "NOTE: Enter 'c' at the", |
|
1652 | 1652 | print "%s prompt to start your script." % deb.prompt |
|
1653 | 1653 | try: |
|
1654 | 1654 | deb.run('execfile("%s")' % filename,prog_ns) |
|
1655 | 1655 | |
|
1656 | 1656 | except: |
|
1657 | 1657 | etype, value, tb = sys.exc_info() |
|
1658 | 1658 | # Skip three frames in the traceback: the %run one, |
|
1659 | 1659 | # one inside bdb.py, and the command-line typed by the |
|
1660 | 1660 | # user (run by exec in pdb itself). |
|
1661 | 1661 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) |
|
1662 | 1662 | else: |
|
1663 | 1663 | if runner is None: |
|
1664 | 1664 | runner = self.shell.safe_execfile |
|
1665 | 1665 | if opts.has_key('t'): |
|
1666 | 1666 | # timed execution |
|
1667 | 1667 | try: |
|
1668 | 1668 | nruns = int(opts['N'][0]) |
|
1669 | 1669 | if nruns < 1: |
|
1670 | 1670 | error('Number of runs must be >=1') |
|
1671 | 1671 | return |
|
1672 | 1672 | except (KeyError): |
|
1673 | 1673 | nruns = 1 |
|
1674 | 1674 | if nruns == 1: |
|
1675 | 1675 | t0 = clock2() |
|
1676 | 1676 | runner(filename,prog_ns,prog_ns, |
|
1677 | 1677 | exit_ignore=exit_ignore) |
|
1678 | 1678 | t1 = clock2() |
|
1679 | 1679 | t_usr = t1[0]-t0[0] |
|
1680 | 1680 | t_sys = t1[1]-t0[1] |
|
1681 | 1681 | print "\nIPython CPU timings (estimated):" |
|
1682 | 1682 | print " User : %10s s." % t_usr |
|
1683 | 1683 | print " System: %10s s." % t_sys |
|
1684 | 1684 | else: |
|
1685 | 1685 | runs = range(nruns) |
|
1686 | 1686 | t0 = clock2() |
|
1687 | 1687 | for nr in runs: |
|
1688 | 1688 | runner(filename,prog_ns,prog_ns, |
|
1689 | 1689 | exit_ignore=exit_ignore) |
|
1690 | 1690 | t1 = clock2() |
|
1691 | 1691 | t_usr = t1[0]-t0[0] |
|
1692 | 1692 | t_sys = t1[1]-t0[1] |
|
1693 | 1693 | print "\nIPython CPU timings (estimated):" |
|
1694 | 1694 | print "Total runs performed:",nruns |
|
1695 | 1695 | print " Times : %10s %10s" % ('Total','Per run') |
|
1696 | 1696 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) |
|
1697 | 1697 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) |
|
1698 | 1698 | |
|
1699 | 1699 | else: |
|
1700 | 1700 | # regular execution |
|
1701 | 1701 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) |
|
1702 | 1702 | |
|
1703 | 1703 | if opts.has_key('i'): |
|
1704 | 1704 | self.shell.user_ns['__name__'] = __name__save |
|
1705 | 1705 | else: |
|
1706 | 1706 | # The shell MUST hold a reference to prog_ns so after %run |
|
1707 | 1707 | # exits, the python deletion mechanism doesn't zero it out |
|
1708 | 1708 | # (leaving dangling references). |
|
1709 | 1709 | self.shell.cache_main_mod(prog_ns,filename) |
|
1710 | 1710 | # update IPython interactive namespace |
|
1711 | 1711 | |
|
1712 | 1712 | # Some forms of read errors on the file may mean the |
|
1713 | 1713 | # __name__ key was never set; using pop we don't have to |
|
1714 | 1714 | # worry about a possible KeyError. |
|
1715 | 1715 | prog_ns.pop('__name__', None) |
|
1716 | 1716 | |
|
1717 | 1717 | self.shell.user_ns.update(prog_ns) |
|
1718 | 1718 | finally: |
|
1719 | 1719 | # It's a bit of a mystery why, but __builtins__ can change from |
|
1720 | 1720 | # being a module to becoming a dict missing some key data after |
|
1721 | 1721 | # %run. As best I can see, this is NOT something IPython is doing |
|
1722 | 1722 | # at all, and similar problems have been reported before: |
|
1723 | 1723 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html |
|
1724 | 1724 | # Since this seems to be done by the interpreter itself, the best |
|
1725 | 1725 | # we can do is to at least restore __builtins__ for the user on |
|
1726 | 1726 | # exit. |
|
1727 | 1727 | self.shell.user_ns['__builtins__'] = __builtin__ |
|
1728 | 1728 | |
|
1729 | 1729 | # Ensure key global structures are restored |
|
1730 | 1730 | sys.argv = save_argv |
|
1731 | 1731 | if restore_main: |
|
1732 | 1732 | sys.modules['__main__'] = restore_main |
|
1733 | 1733 | else: |
|
1734 | 1734 | # Remove from sys.modules the reference to main_mod we'd |
|
1735 | 1735 | # added. Otherwise it will trap references to objects |
|
1736 | 1736 | # contained therein. |
|
1737 | 1737 | del sys.modules[main_mod_name] |
|
1738 | 1738 | |
|
1739 | 1739 | self.shell.reload_history() |
|
1740 | 1740 | |
|
1741 | 1741 | return stats |
|
1742 | 1742 | |
|
1743 | 1743 | @testdec.skip_doctest |
|
1744 | 1744 | def magic_timeit(self, parameter_s =''): |
|
1745 | 1745 | """Time execution of a Python statement or expression |
|
1746 | 1746 | |
|
1747 | 1747 | Usage:\\ |
|
1748 | 1748 | %timeit [-n<N> -r<R> [-t|-c]] statement |
|
1749 | 1749 | |
|
1750 | 1750 | Time execution of a Python statement or expression using the timeit |
|
1751 | 1751 | module. |
|
1752 | 1752 | |
|
1753 | 1753 | Options: |
|
1754 | 1754 | -n<N>: execute the given statement <N> times in a loop. If this value |
|
1755 | 1755 | is not given, a fitting value is chosen. |
|
1756 | 1756 | |
|
1757 | 1757 | -r<R>: repeat the loop iteration <R> times and take the best result. |
|
1758 | 1758 | Default: 3 |
|
1759 | 1759 | |
|
1760 | 1760 | -t: use time.time to measure the time, which is the default on Unix. |
|
1761 | 1761 | This function measures wall time. |
|
1762 | 1762 | |
|
1763 | 1763 | -c: use time.clock to measure the time, which is the default on |
|
1764 | 1764 | Windows and measures wall time. On Unix, resource.getrusage is used |
|
1765 | 1765 | instead and returns the CPU user time. |
|
1766 | 1766 | |
|
1767 | 1767 | -p<P>: use a precision of <P> digits to display the timing result. |
|
1768 | 1768 | Default: 3 |
|
1769 | 1769 | |
|
1770 | 1770 | |
|
1771 | 1771 | Examples: |
|
1772 | 1772 | |
|
1773 | 1773 | In [1]: %timeit pass |
|
1774 | 1774 | 10000000 loops, best of 3: 53.3 ns per loop |
|
1775 | 1775 | |
|
1776 | 1776 | In [2]: u = None |
|
1777 | 1777 | |
|
1778 | 1778 | In [3]: %timeit u is None |
|
1779 | 1779 | 10000000 loops, best of 3: 184 ns per loop |
|
1780 | 1780 | |
|
1781 | 1781 | In [4]: %timeit -r 4 u == None |
|
1782 | 1782 | 1000000 loops, best of 4: 242 ns per loop |
|
1783 | 1783 | |
|
1784 | 1784 | In [5]: import time |
|
1785 | 1785 | |
|
1786 | 1786 | In [6]: %timeit -n1 time.sleep(2) |
|
1787 | 1787 | 1 loops, best of 3: 2 s per loop |
|
1788 | 1788 | |
|
1789 | 1789 | |
|
1790 | 1790 | The times reported by %timeit will be slightly higher than those |
|
1791 | 1791 | reported by the timeit.py script when variables are accessed. This is |
|
1792 | 1792 | due to the fact that %timeit executes the statement in the namespace |
|
1793 | 1793 | of the shell, compared with timeit.py, which uses a single setup |
|
1794 | 1794 | statement to import function or create variables. Generally, the bias |
|
1795 | 1795 | does not matter as long as results from timeit.py are not mixed with |
|
1796 | 1796 | those from %timeit.""" |
|
1797 | 1797 | |
|
1798 | 1798 | import timeit |
|
1799 | 1799 | import math |
|
1800 | 1800 | |
|
1801 | 1801 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in |
|
1802 | 1802 | # certain terminals. Until we figure out a robust way of |
|
1803 | 1803 | # auto-detecting if the terminal can deal with it, use plain 'us' for |
|
1804 | 1804 | # microseconds. I am really NOT happy about disabling the proper |
|
1805 | 1805 | # 'micro' prefix, but crashing is worse... If anyone knows what the |
|
1806 | 1806 | # right solution for this is, I'm all ears... |
|
1807 | 1807 | # |
|
1808 | 1808 | # Note: using |
|
1809 | 1809 | # |
|
1810 | 1810 | # s = u'\xb5' |
|
1811 | 1811 | # s.encode(sys.getdefaultencoding()) |
|
1812 | 1812 | # |
|
1813 | 1813 | # is not sufficient, as I've seen terminals where that fails but |
|
1814 | 1814 | # print s |
|
1815 | 1815 | # |
|
1816 | 1816 | # succeeds |
|
1817 | 1817 | # |
|
1818 | 1818 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 |
|
1819 | 1819 | |
|
1820 | 1820 | #units = [u"s", u"ms",u'\xb5',"ns"] |
|
1821 | 1821 | units = [u"s", u"ms",u'us',"ns"] |
|
1822 | 1822 | |
|
1823 | 1823 | scaling = [1, 1e3, 1e6, 1e9] |
|
1824 | 1824 | |
|
1825 | 1825 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', |
|
1826 | 1826 | posix=False) |
|
1827 | 1827 | if stmt == "": |
|
1828 | 1828 | return |
|
1829 | 1829 | timefunc = timeit.default_timer |
|
1830 | 1830 | number = int(getattr(opts, "n", 0)) |
|
1831 | 1831 | repeat = int(getattr(opts, "r", timeit.default_repeat)) |
|
1832 | 1832 | precision = int(getattr(opts, "p", 3)) |
|
1833 | 1833 | if hasattr(opts, "t"): |
|
1834 | 1834 | timefunc = time.time |
|
1835 | 1835 | if hasattr(opts, "c"): |
|
1836 | 1836 | timefunc = clock |
|
1837 | 1837 | |
|
1838 | 1838 | timer = timeit.Timer(timer=timefunc) |
|
1839 | 1839 | # this code has tight coupling to the inner workings of timeit.Timer, |
|
1840 | 1840 | # but is there a better way to achieve that the code stmt has access |
|
1841 | 1841 | # to the shell namespace? |
|
1842 | 1842 | |
|
1843 | 1843 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), |
|
1844 | 1844 | 'setup': "pass"} |
|
1845 | 1845 | # Track compilation time so it can be reported if too long |
|
1846 | 1846 | # Minimum time above which compilation time will be reported |
|
1847 | 1847 | tc_min = 0.1 |
|
1848 | 1848 | |
|
1849 | 1849 | t0 = clock() |
|
1850 | 1850 | code = compile(src, "<magic-timeit>", "exec") |
|
1851 | 1851 | tc = clock()-t0 |
|
1852 | 1852 | |
|
1853 | 1853 | ns = {} |
|
1854 | 1854 | exec code in self.shell.user_ns, ns |
|
1855 | 1855 | timer.inner = ns["inner"] |
|
1856 | 1856 | |
|
1857 | 1857 | if number == 0: |
|
1858 | 1858 | # determine number so that 0.2 <= total time < 2.0 |
|
1859 | 1859 | number = 1 |
|
1860 | 1860 | for i in range(1, 10): |
|
1861 | 1861 | if timer.timeit(number) >= 0.2: |
|
1862 | 1862 | break |
|
1863 | 1863 | number *= 10 |
|
1864 | 1864 | |
|
1865 | 1865 | best = min(timer.repeat(repeat, number)) / number |
|
1866 | 1866 | |
|
1867 | 1867 | if best > 0.0 and best < 1000.0: |
|
1868 | 1868 | order = min(-int(math.floor(math.log10(best)) // 3), 3) |
|
1869 | 1869 | elif best >= 1000.0: |
|
1870 | 1870 | order = 0 |
|
1871 | 1871 | else: |
|
1872 | 1872 | order = 3 |
|
1873 | 1873 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, |
|
1874 | 1874 | precision, |
|
1875 | 1875 | best * scaling[order], |
|
1876 | 1876 | units[order]) |
|
1877 | 1877 | if tc > tc_min: |
|
1878 | 1878 | print "Compiler time: %.2f s" % tc |
|
1879 | 1879 | |
|
1880 | 1880 | @testdec.skip_doctest |
|
1881 | 1881 | def magic_time(self,parameter_s = ''): |
|
1882 | 1882 | """Time execution of a Python statement or expression. |
|
1883 | 1883 | |
|
1884 | 1884 | The CPU and wall clock times are printed, and the value of the |
|
1885 | 1885 | expression (if any) is returned. Note that under Win32, system time |
|
1886 | 1886 | is always reported as 0, since it can not be measured. |
|
1887 | 1887 | |
|
1888 | 1888 | This function provides very basic timing functionality. In Python |
|
1889 | 1889 | 2.3, the timeit module offers more control and sophistication, so this |
|
1890 | 1890 | could be rewritten to use it (patches welcome). |
|
1891 | 1891 | |
|
1892 | 1892 | Some examples: |
|
1893 | 1893 | |
|
1894 | 1894 | In [1]: time 2**128 |
|
1895 | 1895 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1896 | 1896 | Wall time: 0.00 |
|
1897 | 1897 | Out[1]: 340282366920938463463374607431768211456L |
|
1898 | 1898 | |
|
1899 | 1899 | In [2]: n = 1000000 |
|
1900 | 1900 | |
|
1901 | 1901 | In [3]: time sum(range(n)) |
|
1902 | 1902 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s |
|
1903 | 1903 | Wall time: 1.37 |
|
1904 | 1904 | Out[3]: 499999500000L |
|
1905 | 1905 | |
|
1906 | 1906 | In [4]: time print 'hello world' |
|
1907 | 1907 | hello world |
|
1908 | 1908 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1909 | 1909 | Wall time: 0.00 |
|
1910 | 1910 | |
|
1911 | 1911 | Note that the time needed by Python to compile the given expression |
|
1912 | 1912 | will be reported if it is more than 0.1s. In this example, the |
|
1913 | 1913 | actual exponentiation is done by Python at compilation time, so while |
|
1914 | 1914 | the expression can take a noticeable amount of time to compute, that |
|
1915 | 1915 | time is purely due to the compilation: |
|
1916 | 1916 | |
|
1917 | 1917 | In [5]: time 3**9999; |
|
1918 | 1918 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1919 | 1919 | Wall time: 0.00 s |
|
1920 | 1920 | |
|
1921 | 1921 | In [6]: time 3**999999; |
|
1922 | 1922 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1923 | 1923 | Wall time: 0.00 s |
|
1924 | 1924 | Compiler : 0.78 s |
|
1925 | 1925 | """ |
|
1926 | 1926 | |
|
1927 | 1927 | # fail immediately if the given expression can't be compiled |
|
1928 | 1928 | |
|
1929 | 1929 | expr = self.shell.prefilter(parameter_s,False) |
|
1930 | 1930 | |
|
1931 | 1931 | # Minimum time above which compilation time will be reported |
|
1932 | 1932 | tc_min = 0.1 |
|
1933 | 1933 | |
|
1934 | 1934 | try: |
|
1935 | 1935 | mode = 'eval' |
|
1936 | 1936 | t0 = clock() |
|
1937 | 1937 | code = compile(expr,'<timed eval>',mode) |
|
1938 | 1938 | tc = clock()-t0 |
|
1939 | 1939 | except SyntaxError: |
|
1940 | 1940 | mode = 'exec' |
|
1941 | 1941 | t0 = clock() |
|
1942 | 1942 | code = compile(expr,'<timed exec>',mode) |
|
1943 | 1943 | tc = clock()-t0 |
|
1944 | 1944 | # skew measurement as little as possible |
|
1945 | 1945 | glob = self.shell.user_ns |
|
1946 | 1946 | clk = clock2 |
|
1947 | 1947 | wtime = time.time |
|
1948 | 1948 | # time execution |
|
1949 | 1949 | wall_st = wtime() |
|
1950 | 1950 | if mode=='eval': |
|
1951 | 1951 | st = clk() |
|
1952 | 1952 | out = eval(code,glob) |
|
1953 | 1953 | end = clk() |
|
1954 | 1954 | else: |
|
1955 | 1955 | st = clk() |
|
1956 | 1956 | exec code in glob |
|
1957 | 1957 | end = clk() |
|
1958 | 1958 | out = None |
|
1959 | 1959 | wall_end = wtime() |
|
1960 | 1960 | # Compute actual times and report |
|
1961 | 1961 | wall_time = wall_end-wall_st |
|
1962 | 1962 | cpu_user = end[0]-st[0] |
|
1963 | 1963 | cpu_sys = end[1]-st[1] |
|
1964 | 1964 | cpu_tot = cpu_user+cpu_sys |
|
1965 | 1965 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ |
|
1966 | 1966 | (cpu_user,cpu_sys,cpu_tot) |
|
1967 | 1967 | print "Wall time: %.2f s" % wall_time |
|
1968 | 1968 | if tc > tc_min: |
|
1969 | 1969 | print "Compiler : %.2f s" % tc |
|
1970 | 1970 | return out |
|
1971 | 1971 | |
|
1972 | 1972 | @testdec.skip_doctest |
|
1973 | 1973 | def magic_macro(self,parameter_s = ''): |
|
1974 | 1974 | """Define a set of input lines as a macro for future re-execution. |
|
1975 | 1975 | |
|
1976 | 1976 | Usage:\\ |
|
1977 | 1977 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... |
|
1978 | 1978 | |
|
1979 | 1979 | Options: |
|
1980 | 1980 | |
|
1981 | 1981 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
1982 | 1982 | so that magics are loaded in their transformed version to valid |
|
1983 | 1983 | Python. If this option is given, the raw input as typed as the |
|
1984 | 1984 | command line is used instead. |
|
1985 | 1985 | |
|
1986 | 1986 | This will define a global variable called `name` which is a string |
|
1987 | 1987 | made of joining the slices and lines you specify (n1,n2,... numbers |
|
1988 | 1988 | above) from your input history into a single string. This variable |
|
1989 | 1989 | acts like an automatic function which re-executes those lines as if |
|
1990 | 1990 | you had typed them. You just type 'name' at the prompt and the code |
|
1991 | 1991 | executes. |
|
1992 | 1992 | |
|
1993 | 1993 | The notation for indicating number ranges is: n1-n2 means 'use line |
|
1994 | 1994 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means |
|
1995 | 1995 | using the lines numbered 5,6 and 7. |
|
1996 | 1996 | |
|
1997 | 1997 | Note: as a 'hidden' feature, you can also use traditional python slice |
|
1998 | 1998 | notation, where N:M means numbers N through M-1. |
|
1999 | 1999 | |
|
2000 | 2000 | For example, if your history contains (%hist prints it): |
|
2001 | 2001 | |
|
2002 | 2002 | 44: x=1 |
|
2003 | 2003 | 45: y=3 |
|
2004 | 2004 | 46: z=x+y |
|
2005 | 2005 | 47: print x |
|
2006 | 2006 | 48: a=5 |
|
2007 | 2007 | 49: print 'x',x,'y',y |
|
2008 | 2008 | |
|
2009 | 2009 | you can create a macro with lines 44 through 47 (included) and line 49 |
|
2010 | 2010 | called my_macro with: |
|
2011 | 2011 | |
|
2012 | 2012 | In [55]: %macro my_macro 44-47 49 |
|
2013 | 2013 | |
|
2014 | 2014 | Now, typing `my_macro` (without quotes) will re-execute all this code |
|
2015 | 2015 | in one pass. |
|
2016 | 2016 | |
|
2017 | 2017 | You don't need to give the line-numbers in order, and any given line |
|
2018 | 2018 | number can appear multiple times. You can assemble macros with any |
|
2019 | 2019 | lines from your input history in any order. |
|
2020 | 2020 | |
|
2021 | 2021 | The macro is a simple object which holds its value in an attribute, |
|
2022 | 2022 | but IPython's display system checks for macros and executes them as |
|
2023 | 2023 | code instead of printing them when you type their name. |
|
2024 | 2024 | |
|
2025 | 2025 | You can view a macro's contents by explicitly printing it with: |
|
2026 | 2026 | |
|
2027 | 2027 | 'print macro_name'. |
|
2028 | 2028 | |
|
2029 | 2029 | For one-off cases which DON'T contain magic function calls in them you |
|
2030 | 2030 | can obtain similar results by explicitly executing slices from your |
|
2031 | 2031 | input history with: |
|
2032 | 2032 | |
|
2033 | 2033 | In [60]: exec In[44:48]+In[49]""" |
|
2034 | 2034 | |
|
2035 | 2035 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2036 | 2036 | if not args: |
|
2037 | 2037 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] |
|
2038 | 2038 | macs.sort() |
|
2039 | 2039 | return macs |
|
2040 | 2040 | if len(args) == 1: |
|
2041 | 2041 | raise UsageError( |
|
2042 | 2042 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") |
|
2043 | 2043 | name,ranges = args[0], args[1:] |
|
2044 | 2044 | |
|
2045 | 2045 | #print 'rng',ranges # dbg |
|
2046 | 2046 | lines = self.extract_input_slices(ranges,opts.has_key('r')) |
|
2047 | 2047 | macro = Macro(lines) |
|
2048 | 2048 | self.shell.define_macro(name, macro) |
|
2049 | 2049 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name |
|
2050 | 2050 | print 'Macro contents:' |
|
2051 | 2051 | print macro, |
|
2052 | 2052 | |
|
2053 | 2053 | def magic_save(self,parameter_s = ''): |
|
2054 | 2054 | """Save a set of lines to a given filename. |
|
2055 | 2055 | |
|
2056 | 2056 | Usage:\\ |
|
2057 | 2057 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... |
|
2058 | 2058 | |
|
2059 | 2059 | Options: |
|
2060 | 2060 | |
|
2061 | 2061 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
2062 | 2062 | so that magics are loaded in their transformed version to valid |
|
2063 | 2063 | Python. If this option is given, the raw input as typed as the |
|
2064 | 2064 | command line is used instead. |
|
2065 | 2065 | |
|
2066 | 2066 | This function uses the same syntax as %macro for line extraction, but |
|
2067 | 2067 | instead of creating a macro it saves the resulting string to the |
|
2068 | 2068 | filename you specify. |
|
2069 | 2069 | |
|
2070 | 2070 | It adds a '.py' extension to the file if you don't do so yourself, and |
|
2071 | 2071 | it asks for confirmation before overwriting existing files.""" |
|
2072 | 2072 | |
|
2073 | 2073 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2074 | 2074 | fname,ranges = args[0], args[1:] |
|
2075 | 2075 | if not fname.endswith('.py'): |
|
2076 | 2076 | fname += '.py' |
|
2077 | 2077 | if os.path.isfile(fname): |
|
2078 | 2078 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) |
|
2079 | 2079 | if ans.lower() not in ['y','yes']: |
|
2080 | 2080 | print 'Operation cancelled.' |
|
2081 | 2081 | return |
|
2082 | 2082 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) |
|
2083 | 2083 | f = file(fname,'w') |
|
2084 | 2084 | f.write(cmds) |
|
2085 | 2085 | f.close() |
|
2086 | 2086 | print 'The following commands were written to file `%s`:' % fname |
|
2087 | 2087 | print cmds |
|
2088 | 2088 | |
|
2089 | 2089 | def _edit_macro(self,mname,macro): |
|
2090 | 2090 | """open an editor with the macro data in a file""" |
|
2091 | 2091 | filename = self.shell.mktempfile(macro.value) |
|
2092 | 2092 | self.shell.hooks.editor(filename) |
|
2093 | 2093 | |
|
2094 | 2094 | # and make a new macro object, to replace the old one |
|
2095 | 2095 | mfile = open(filename) |
|
2096 | 2096 | mvalue = mfile.read() |
|
2097 | 2097 | mfile.close() |
|
2098 | 2098 | self.shell.user_ns[mname] = Macro(mvalue) |
|
2099 | 2099 | |
|
2100 | 2100 | def magic_ed(self,parameter_s=''): |
|
2101 | 2101 | """Alias to %edit.""" |
|
2102 | 2102 | return self.magic_edit(parameter_s) |
|
2103 | 2103 | |
|
2104 | 2104 | @testdec.skip_doctest |
|
2105 | 2105 | def magic_edit(self,parameter_s='',last_call=['','']): |
|
2106 | 2106 | """Bring up an editor and execute the resulting code. |
|
2107 | 2107 | |
|
2108 | 2108 | Usage: |
|
2109 | 2109 | %edit [options] [args] |
|
2110 | 2110 | |
|
2111 | 2111 | %edit runs IPython's editor hook. The default version of this hook is |
|
2112 | 2112 | set to call the __IPYTHON__.rc.editor command. This is read from your |
|
2113 | 2113 | environment variable $EDITOR. If this isn't found, it will default to |
|
2114 | 2114 | vi under Linux/Unix and to notepad under Windows. See the end of this |
|
2115 | 2115 | docstring for how to change the editor hook. |
|
2116 | 2116 | |
|
2117 | 2117 | You can also set the value of this editor via the command line option |
|
2118 | 2118 | '-editor' or in your ipythonrc file. This is useful if you wish to use |
|
2119 | 2119 | specifically for IPython an editor different from your typical default |
|
2120 | 2120 | (and for Windows users who typically don't set environment variables). |
|
2121 | 2121 | |
|
2122 | 2122 | This command allows you to conveniently edit multi-line code right in |
|
2123 | 2123 | your IPython session. |
|
2124 | 2124 | |
|
2125 | 2125 | If called without arguments, %edit opens up an empty editor with a |
|
2126 | 2126 | temporary file and will execute the contents of this file when you |
|
2127 | 2127 | close it (don't forget to save it!). |
|
2128 | 2128 | |
|
2129 | 2129 | |
|
2130 | 2130 | Options: |
|
2131 | 2131 | |
|
2132 | 2132 | -n <number>: open the editor at a specified line number. By default, |
|
2133 | 2133 | the IPython editor hook uses the unix syntax 'editor +N filename', but |
|
2134 | 2134 | you can configure this by providing your own modified hook if your |
|
2135 | 2135 | favorite editor supports line-number specifications with a different |
|
2136 | 2136 | syntax. |
|
2137 | 2137 | |
|
2138 | 2138 | -p: this will call the editor with the same data as the previous time |
|
2139 | 2139 | it was used, regardless of how long ago (in your current session) it |
|
2140 | 2140 | was. |
|
2141 | 2141 | |
|
2142 | 2142 | -r: use 'raw' input. This option only applies to input taken from the |
|
2143 | 2143 | user's history. By default, the 'processed' history is used, so that |
|
2144 | 2144 | magics are loaded in their transformed version to valid Python. If |
|
2145 | 2145 | this option is given, the raw input as typed as the command line is |
|
2146 | 2146 | used instead. When you exit the editor, it will be executed by |
|
2147 | 2147 | IPython's own processor. |
|
2148 | 2148 | |
|
2149 | 2149 | -x: do not execute the edited code immediately upon exit. This is |
|
2150 | 2150 | mainly useful if you are editing programs which need to be called with |
|
2151 | 2151 | command line arguments, which you can then do using %run. |
|
2152 | 2152 | |
|
2153 | 2153 | |
|
2154 | 2154 | Arguments: |
|
2155 | 2155 | |
|
2156 | 2156 | If arguments are given, the following possibilites exist: |
|
2157 | 2157 | |
|
2158 | 2158 | - The arguments are numbers or pairs of colon-separated numbers (like |
|
2159 | 2159 | 1 4:8 9). These are interpreted as lines of previous input to be |
|
2160 | 2160 | loaded into the editor. The syntax is the same of the %macro command. |
|
2161 | 2161 | |
|
2162 | 2162 | - If the argument doesn't start with a number, it is evaluated as a |
|
2163 | 2163 | variable and its contents loaded into the editor. You can thus edit |
|
2164 | 2164 | any string which contains python code (including the result of |
|
2165 | 2165 | previous edits). |
|
2166 | 2166 | |
|
2167 | 2167 | - If the argument is the name of an object (other than a string), |
|
2168 | 2168 | IPython will try to locate the file where it was defined and open the |
|
2169 | 2169 | editor at the point where it is defined. You can use `%edit function` |
|
2170 | 2170 | to load an editor exactly at the point where 'function' is defined, |
|
2171 | 2171 | edit it and have the file be executed automatically. |
|
2172 | 2172 | |
|
2173 | 2173 | If the object is a macro (see %macro for details), this opens up your |
|
2174 | 2174 | specified editor with a temporary file containing the macro's data. |
|
2175 | 2175 | Upon exit, the macro is reloaded with the contents of the file. |
|
2176 | 2176 | |
|
2177 | 2177 | Note: opening at an exact line is only supported under Unix, and some |
|
2178 | 2178 | editors (like kedit and gedit up to Gnome 2.8) do not understand the |
|
2179 | 2179 | '+NUMBER' parameter necessary for this feature. Good editors like |
|
2180 | 2180 | (X)Emacs, vi, jed, pico and joe all do. |
|
2181 | 2181 | |
|
2182 | 2182 | - If the argument is not found as a variable, IPython will look for a |
|
2183 | 2183 | file with that name (adding .py if necessary) and load it into the |
|
2184 | 2184 | editor. It will execute its contents with execfile() when you exit, |
|
2185 | 2185 | loading any code in the file into your interactive namespace. |
|
2186 | 2186 | |
|
2187 | 2187 | After executing your code, %edit will return as output the code you |
|
2188 | 2188 | typed in the editor (except when it was an existing file). This way |
|
2189 | 2189 | you can reload the code in further invocations of %edit as a variable, |
|
2190 | 2190 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of |
|
2191 | 2191 | the output. |
|
2192 | 2192 | |
|
2193 | 2193 | Note that %edit is also available through the alias %ed. |
|
2194 | 2194 | |
|
2195 | 2195 | This is an example of creating a simple function inside the editor and |
|
2196 | 2196 | then modifying it. First, start up the editor: |
|
2197 | 2197 | |
|
2198 | 2198 | In [1]: ed |
|
2199 | 2199 | Editing... done. Executing edited code... |
|
2200 | 2200 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' |
|
2201 | 2201 | |
|
2202 | 2202 | We can then call the function foo(): |
|
2203 | 2203 | |
|
2204 | 2204 | In [2]: foo() |
|
2205 | 2205 | foo() was defined in an editing session |
|
2206 | 2206 | |
|
2207 | 2207 | Now we edit foo. IPython automatically loads the editor with the |
|
2208 | 2208 | (temporary) file where foo() was previously defined: |
|
2209 | 2209 | |
|
2210 | 2210 | In [3]: ed foo |
|
2211 | 2211 | Editing... done. Executing edited code... |
|
2212 | 2212 | |
|
2213 | 2213 | And if we call foo() again we get the modified version: |
|
2214 | 2214 | |
|
2215 | 2215 | In [4]: foo() |
|
2216 | 2216 | foo() has now been changed! |
|
2217 | 2217 | |
|
2218 | 2218 | Here is an example of how to edit a code snippet successive |
|
2219 | 2219 | times. First we call the editor: |
|
2220 | 2220 | |
|
2221 | 2221 | In [5]: ed |
|
2222 | 2222 | Editing... done. Executing edited code... |
|
2223 | 2223 | hello |
|
2224 | 2224 | Out[5]: "print 'hello'n" |
|
2225 | 2225 | |
|
2226 | 2226 | Now we call it again with the previous output (stored in _): |
|
2227 | 2227 | |
|
2228 | 2228 | In [6]: ed _ |
|
2229 | 2229 | Editing... done. Executing edited code... |
|
2230 | 2230 | hello world |
|
2231 | 2231 | Out[6]: "print 'hello world'n" |
|
2232 | 2232 | |
|
2233 | 2233 | Now we call it with the output #8 (stored in _8, also as Out[8]): |
|
2234 | 2234 | |
|
2235 | 2235 | In [7]: ed _8 |
|
2236 | 2236 | Editing... done. Executing edited code... |
|
2237 | 2237 | hello again |
|
2238 | 2238 | Out[7]: "print 'hello again'n" |
|
2239 | 2239 | |
|
2240 | 2240 | |
|
2241 | 2241 | Changing the default editor hook: |
|
2242 | 2242 | |
|
2243 | 2243 | If you wish to write your own editor hook, you can put it in a |
|
2244 | 2244 | configuration file which you load at startup time. The default hook |
|
2245 | 2245 | is defined in the IPython.core.hooks module, and you can use that as a |
|
2246 | 2246 | starting example for further modifications. That file also has |
|
2247 | 2247 | general instructions on how to set a new hook for use once you've |
|
2248 | 2248 | defined it.""" |
|
2249 | 2249 | |
|
2250 | 2250 | # FIXME: This function has become a convoluted mess. It needs a |
|
2251 | 2251 | # ground-up rewrite with clean, simple logic. |
|
2252 | 2252 | |
|
2253 | 2253 | def make_filename(arg): |
|
2254 | 2254 | "Make a filename from the given args" |
|
2255 | 2255 | try: |
|
2256 | 2256 | filename = get_py_filename(arg) |
|
2257 | 2257 | except IOError: |
|
2258 | 2258 | if args.endswith('.py'): |
|
2259 | 2259 | filename = arg |
|
2260 | 2260 | else: |
|
2261 | 2261 | filename = None |
|
2262 | 2262 | return filename |
|
2263 | 2263 | |
|
2264 | 2264 | # custom exceptions |
|
2265 | 2265 | class DataIsObject(Exception): pass |
|
2266 | 2266 | |
|
2267 | 2267 | opts,args = self.parse_options(parameter_s,'prxn:') |
|
2268 | 2268 | # Set a few locals from the options for convenience: |
|
2269 | 2269 | opts_p = opts.has_key('p') |
|
2270 | 2270 | opts_r = opts.has_key('r') |
|
2271 | 2271 | |
|
2272 | 2272 | # Default line number value |
|
2273 | 2273 | lineno = opts.get('n',None) |
|
2274 | 2274 | |
|
2275 | 2275 | if opts_p: |
|
2276 | 2276 | args = '_%s' % last_call[0] |
|
2277 | 2277 | if not self.shell.user_ns.has_key(args): |
|
2278 | 2278 | args = last_call[1] |
|
2279 | 2279 | |
|
2280 | 2280 | # use last_call to remember the state of the previous call, but don't |
|
2281 | 2281 | # let it be clobbered by successive '-p' calls. |
|
2282 | 2282 | try: |
|
2283 | 2283 | last_call[0] = self.shell.displayhook.prompt_count |
|
2284 | 2284 | if not opts_p: |
|
2285 | 2285 | last_call[1] = parameter_s |
|
2286 | 2286 | except: |
|
2287 | 2287 | pass |
|
2288 | 2288 | |
|
2289 | 2289 | # by default this is done with temp files, except when the given |
|
2290 | 2290 | # arg is a filename |
|
2291 | 2291 | use_temp = 1 |
|
2292 | 2292 | |
|
2293 | 2293 | if re.match(r'\d',args): |
|
2294 | 2294 | # Mode where user specifies ranges of lines, like in %macro. |
|
2295 | 2295 | # This means that you can't edit files whose names begin with |
|
2296 | 2296 | # numbers this way. Tough. |
|
2297 | 2297 | ranges = args.split() |
|
2298 | 2298 | data = ''.join(self.extract_input_slices(ranges,opts_r)) |
|
2299 | 2299 | elif args.endswith('.py'): |
|
2300 | 2300 | filename = make_filename(args) |
|
2301 | 2301 | data = '' |
|
2302 | 2302 | use_temp = 0 |
|
2303 | 2303 | elif args: |
|
2304 | 2304 | try: |
|
2305 | 2305 | # Load the parameter given as a variable. If not a string, |
|
2306 | 2306 | # process it as an object instead (below) |
|
2307 | 2307 | |
|
2308 | 2308 | #print '*** args',args,'type',type(args) # dbg |
|
2309 | 2309 | data = eval(args,self.shell.user_ns) |
|
2310 | 2310 | if not type(data) in StringTypes: |
|
2311 | 2311 | raise DataIsObject |
|
2312 | 2312 | |
|
2313 | 2313 | except (NameError,SyntaxError): |
|
2314 | 2314 | # given argument is not a variable, try as a filename |
|
2315 | 2315 | filename = make_filename(args) |
|
2316 | 2316 | if filename is None: |
|
2317 | 2317 | warn("Argument given (%s) can't be found as a variable " |
|
2318 | 2318 | "or as a filename." % args) |
|
2319 | 2319 | return |
|
2320 | 2320 | |
|
2321 | 2321 | data = '' |
|
2322 | 2322 | use_temp = 0 |
|
2323 | 2323 | except DataIsObject: |
|
2324 | 2324 | |
|
2325 | 2325 | # macros have a special edit function |
|
2326 | 2326 | if isinstance(data,Macro): |
|
2327 | 2327 | self._edit_macro(args,data) |
|
2328 | 2328 | return |
|
2329 | 2329 | |
|
2330 | 2330 | # For objects, try to edit the file where they are defined |
|
2331 | 2331 | try: |
|
2332 | 2332 | filename = inspect.getabsfile(data) |
|
2333 | 2333 | if 'fakemodule' in filename.lower() and inspect.isclass(data): |
|
2334 | 2334 | # class created by %edit? Try to find source |
|
2335 | 2335 | # by looking for method definitions instead, the |
|
2336 | 2336 | # __module__ in those classes is FakeModule. |
|
2337 | 2337 | attrs = [getattr(data, aname) for aname in dir(data)] |
|
2338 | 2338 | for attr in attrs: |
|
2339 | 2339 | if not inspect.ismethod(attr): |
|
2340 | 2340 | continue |
|
2341 | 2341 | filename = inspect.getabsfile(attr) |
|
2342 | 2342 | if filename and 'fakemodule' not in filename.lower(): |
|
2343 | 2343 | # change the attribute to be the edit target instead |
|
2344 | 2344 | data = attr |
|
2345 | 2345 | break |
|
2346 | 2346 | |
|
2347 | 2347 | datafile = 1 |
|
2348 | 2348 | except TypeError: |
|
2349 | 2349 | filename = make_filename(args) |
|
2350 | 2350 | datafile = 1 |
|
2351 | 2351 | warn('Could not find file where `%s` is defined.\n' |
|
2352 | 2352 | 'Opening a file named `%s`' % (args,filename)) |
|
2353 | 2353 | # Now, make sure we can actually read the source (if it was in |
|
2354 | 2354 | # a temp file it's gone by now). |
|
2355 | 2355 | if datafile: |
|
2356 | 2356 | try: |
|
2357 | 2357 | if lineno is None: |
|
2358 | 2358 | lineno = inspect.getsourcelines(data)[1] |
|
2359 | 2359 | except IOError: |
|
2360 | 2360 | filename = make_filename(args) |
|
2361 | 2361 | if filename is None: |
|
2362 | 2362 | warn('The file `%s` where `%s` was defined cannot ' |
|
2363 | 2363 | 'be read.' % (filename,data)) |
|
2364 | 2364 | return |
|
2365 | 2365 | use_temp = 0 |
|
2366 | 2366 | else: |
|
2367 | 2367 | data = '' |
|
2368 | 2368 | |
|
2369 | 2369 | if use_temp: |
|
2370 | 2370 | filename = self.shell.mktempfile(data) |
|
2371 | 2371 | print 'IPython will make a temporary file named:',filename |
|
2372 | 2372 | |
|
2373 | 2373 | # do actual editing here |
|
2374 | 2374 | print 'Editing...', |
|
2375 | 2375 | sys.stdout.flush() |
|
2376 | 2376 | try: |
|
2377 | 2377 | # Quote filenames that may have spaces in them |
|
2378 | 2378 | if ' ' in filename: |
|
2379 | 2379 | filename = "%s" % filename |
|
2380 | 2380 | self.shell.hooks.editor(filename,lineno) |
|
2381 | 2381 | except TryNext: |
|
2382 | 2382 | warn('Could not open editor') |
|
2383 | 2383 | return |
|
2384 | 2384 | |
|
2385 | 2385 | # XXX TODO: should this be generalized for all string vars? |
|
2386 | 2386 | # For now, this is special-cased to blocks created by cpaste |
|
2387 | 2387 | if args.strip() == 'pasted_block': |
|
2388 | 2388 | self.shell.user_ns['pasted_block'] = file_read(filename) |
|
2389 | 2389 | |
|
2390 | 2390 | if opts.has_key('x'): # -x prevents actual execution |
|
2391 | 2391 | |
|
2392 | 2392 | else: |
|
2393 | 2393 | print 'done. Executing edited code...' |
|
2394 | 2394 | if opts_r: |
|
2395 | 2395 | self.shell.run_cell(file_read(filename)) |
|
2396 | 2396 | else: |
|
2397 | 2397 | self.shell.safe_execfile(filename,self.shell.user_ns, |
|
2398 | 2398 | self.shell.user_ns) |
|
2399 | 2399 | |
|
2400 | 2400 | |
|
2401 | 2401 | if use_temp: |
|
2402 | 2402 | try: |
|
2403 | 2403 | return open(filename).read() |
|
2404 | 2404 | except IOError,msg: |
|
2405 | 2405 | if msg.filename == filename: |
|
2406 | 2406 | warn('File not found. Did you forget to save?') |
|
2407 | 2407 | return |
|
2408 | 2408 | else: |
|
2409 | 2409 | self.shell.showtraceback() |
|
2410 | 2410 | |
|
2411 | 2411 | def magic_xmode(self,parameter_s = ''): |
|
2412 | 2412 | """Switch modes for the exception handlers. |
|
2413 | 2413 | |
|
2414 | 2414 | Valid modes: Plain, Context and Verbose. |
|
2415 | 2415 | |
|
2416 | 2416 | If called without arguments, acts as a toggle.""" |
|
2417 | 2417 | |
|
2418 | 2418 | def xmode_switch_err(name): |
|
2419 | 2419 | warn('Error changing %s exception modes.\n%s' % |
|
2420 | 2420 | (name,sys.exc_info()[1])) |
|
2421 | 2421 | |
|
2422 | 2422 | shell = self.shell |
|
2423 | 2423 | new_mode = parameter_s.strip().capitalize() |
|
2424 | 2424 | try: |
|
2425 | 2425 | shell.InteractiveTB.set_mode(mode=new_mode) |
|
2426 | 2426 | print 'Exception reporting mode:',shell.InteractiveTB.mode |
|
2427 | 2427 | except: |
|
2428 | 2428 | xmode_switch_err('user') |
|
2429 | 2429 | |
|
2430 | 2430 | def magic_colors(self,parameter_s = ''): |
|
2431 | 2431 | """Switch color scheme for prompts, info system and exception handlers. |
|
2432 | 2432 | |
|
2433 | 2433 | Currently implemented schemes: NoColor, Linux, LightBG. |
|
2434 | 2434 | |
|
2435 | 2435 | Color scheme names are not case-sensitive. |
|
2436 | 2436 | |
|
2437 | 2437 | Examples |
|
2438 | 2438 | -------- |
|
2439 | 2439 | To get a plain black and white terminal:: |
|
2440 | 2440 | |
|
2441 | 2441 | %colors nocolor |
|
2442 | 2442 | """ |
|
2443 | 2443 | |
|
2444 | 2444 | def color_switch_err(name): |
|
2445 | 2445 | warn('Error changing %s color schemes.\n%s' % |
|
2446 | 2446 | (name,sys.exc_info()[1])) |
|
2447 | 2447 | |
|
2448 | 2448 | |
|
2449 | 2449 | new_scheme = parameter_s.strip() |
|
2450 | 2450 | if not new_scheme: |
|
2451 | 2451 | raise UsageError( |
|
2452 | 2452 | "%colors: you must specify a color scheme. See '%colors?'") |
|
2453 | 2453 | return |
|
2454 | 2454 | # local shortcut |
|
2455 | 2455 | shell = self.shell |
|
2456 | 2456 | |
|
2457 | 2457 | import IPython.utils.rlineimpl as readline |
|
2458 | 2458 | |
|
2459 | 2459 | if not readline.have_readline and sys.platform == "win32": |
|
2460 | 2460 | msg = """\ |
|
2461 | 2461 | Proper color support under MS Windows requires the pyreadline library. |
|
2462 | 2462 | You can find it at: |
|
2463 | 2463 | http://ipython.scipy.org/moin/PyReadline/Intro |
|
2464 | 2464 | Gary's readline needs the ctypes module, from: |
|
2465 | 2465 | http://starship.python.net/crew/theller/ctypes |
|
2466 | 2466 | (Note that ctypes is already part of Python versions 2.5 and newer). |
|
2467 | 2467 | |
|
2468 | 2468 | Defaulting color scheme to 'NoColor'""" |
|
2469 | 2469 | new_scheme = 'NoColor' |
|
2470 | 2470 | warn(msg) |
|
2471 | 2471 | |
|
2472 | 2472 | # readline option is 0 |
|
2473 | 2473 | if not shell.has_readline: |
|
2474 | 2474 | new_scheme = 'NoColor' |
|
2475 | 2475 | |
|
2476 | 2476 | # Set prompt colors |
|
2477 | 2477 | try: |
|
2478 | 2478 | shell.displayhook.set_colors(new_scheme) |
|
2479 | 2479 | except: |
|
2480 | 2480 | color_switch_err('prompt') |
|
2481 | 2481 | else: |
|
2482 | 2482 | shell.colors = \ |
|
2483 | 2483 | shell.displayhook.color_table.active_scheme_name |
|
2484 | 2484 | # Set exception colors |
|
2485 | 2485 | try: |
|
2486 | 2486 | shell.InteractiveTB.set_colors(scheme = new_scheme) |
|
2487 | 2487 | shell.SyntaxTB.set_colors(scheme = new_scheme) |
|
2488 | 2488 | except: |
|
2489 | 2489 | color_switch_err('exception') |
|
2490 | 2490 | |
|
2491 | 2491 | # Set info (for 'object?') colors |
|
2492 | 2492 | if shell.color_info: |
|
2493 | 2493 | try: |
|
2494 | 2494 | shell.inspector.set_active_scheme(new_scheme) |
|
2495 | 2495 | except: |
|
2496 | 2496 | color_switch_err('object inspector') |
|
2497 | 2497 | else: |
|
2498 | 2498 | shell.inspector.set_active_scheme('NoColor') |
|
2499 | 2499 | |
|
2500 | 2500 | def magic_pprint(self, parameter_s=''): |
|
2501 | 2501 | """Toggle pretty printing on/off.""" |
|
2502 | 2502 | ptformatter = self.shell.display_formatter.formatters['text/plain'] |
|
2503 | 2503 | ptformatter.pprint = bool(1 - ptformatter.pprint) |
|
2504 | 2504 | print 'Pretty printing has been turned', \ |
|
2505 | 2505 | ['OFF','ON'][ptformatter.pprint] |
|
2506 | 2506 | |
|
2507 | 2507 | def magic_Exit(self, parameter_s=''): |
|
2508 | 2508 | """Exit IPython.""" |
|
2509 | 2509 | |
|
2510 | 2510 | self.shell.ask_exit() |
|
2511 | 2511 | |
|
2512 | 2512 | # Add aliases as magics so all common forms work: exit, quit, Exit, Quit. |
|
2513 | 2513 | magic_exit = magic_quit = magic_Quit = magic_Exit |
|
2514 | 2514 | |
|
2515 | 2515 | #...................................................................... |
|
2516 | 2516 | # Functions to implement unix shell-type things |
|
2517 | 2517 | |
|
2518 | 2518 | @testdec.skip_doctest |
|
2519 | 2519 | def magic_alias(self, parameter_s = ''): |
|
2520 | 2520 | """Define an alias for a system command. |
|
2521 | 2521 | |
|
2522 | 2522 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' |
|
2523 | 2523 | |
|
2524 | 2524 | Then, typing 'alias_name params' will execute the system command 'cmd |
|
2525 | 2525 | params' (from your underlying operating system). |
|
2526 | 2526 | |
|
2527 | 2527 | Aliases have lower precedence than magic functions and Python normal |
|
2528 | 2528 | variables, so if 'foo' is both a Python variable and an alias, the |
|
2529 | 2529 | alias can not be executed until 'del foo' removes the Python variable. |
|
2530 | 2530 | |
|
2531 | 2531 | You can use the %l specifier in an alias definition to represent the |
|
2532 | 2532 | whole line when the alias is called. For example: |
|
2533 | 2533 | |
|
2534 | 2534 | In [2]: alias bracket echo "Input in brackets: <%l>" |
|
2535 | 2535 | In [3]: bracket hello world |
|
2536 | 2536 | Input in brackets: <hello world> |
|
2537 | 2537 | |
|
2538 | 2538 | You can also define aliases with parameters using %s specifiers (one |
|
2539 | 2539 | per parameter): |
|
2540 | 2540 | |
|
2541 | 2541 | In [1]: alias parts echo first %s second %s |
|
2542 | 2542 | In [2]: %parts A B |
|
2543 | 2543 | first A second B |
|
2544 | 2544 | In [3]: %parts A |
|
2545 | 2545 | Incorrect number of arguments: 2 expected. |
|
2546 | 2546 | parts is an alias to: 'echo first %s second %s' |
|
2547 | 2547 | |
|
2548 | 2548 | Note that %l and %s are mutually exclusive. You can only use one or |
|
2549 | 2549 | the other in your aliases. |
|
2550 | 2550 | |
|
2551 | 2551 | Aliases expand Python variables just like system calls using ! or !! |
|
2552 | 2552 | do: all expressions prefixed with '$' get expanded. For details of |
|
2553 | 2553 | the semantic rules, see PEP-215: |
|
2554 | 2554 | http://www.python.org/peps/pep-0215.html. This is the library used by |
|
2555 | 2555 | IPython for variable expansion. If you want to access a true shell |
|
2556 | 2556 | variable, an extra $ is necessary to prevent its expansion by IPython: |
|
2557 | 2557 | |
|
2558 | 2558 | In [6]: alias show echo |
|
2559 | 2559 | In [7]: PATH='A Python string' |
|
2560 | 2560 | In [8]: show $PATH |
|
2561 | 2561 | A Python string |
|
2562 | 2562 | In [9]: show $$PATH |
|
2563 | 2563 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... |
|
2564 | 2564 | |
|
2565 | 2565 | You can use the alias facility to acess all of $PATH. See the %rehash |
|
2566 | 2566 | and %rehashx functions, which automatically create aliases for the |
|
2567 | 2567 | contents of your $PATH. |
|
2568 | 2568 | |
|
2569 | 2569 | If called with no parameters, %alias prints the current alias table.""" |
|
2570 | 2570 | |
|
2571 | 2571 | par = parameter_s.strip() |
|
2572 | 2572 | if not par: |
|
2573 | 2573 | stored = self.db.get('stored_aliases', {} ) |
|
2574 | 2574 | aliases = sorted(self.shell.alias_manager.aliases) |
|
2575 | 2575 | # for k, v in stored: |
|
2576 | 2576 | # atab.append(k, v[0]) |
|
2577 | 2577 | |
|
2578 | 2578 | print "Total number of aliases:", len(aliases) |
|
2579 | 2579 | sys.stdout.flush() |
|
2580 | 2580 | return aliases |
|
2581 | 2581 | |
|
2582 | 2582 | # Now try to define a new one |
|
2583 | 2583 | try: |
|
2584 | 2584 | alias,cmd = par.split(None, 1) |
|
2585 | 2585 | except: |
|
2586 | 2586 | print oinspect.getdoc(self.magic_alias) |
|
2587 | 2587 | else: |
|
2588 | 2588 | self.shell.alias_manager.soft_define_alias(alias, cmd) |
|
2589 | 2589 | # end magic_alias |
|
2590 | 2590 | |
|
2591 | 2591 | def magic_unalias(self, parameter_s = ''): |
|
2592 | 2592 | """Remove an alias""" |
|
2593 | 2593 | |
|
2594 | 2594 | aname = parameter_s.strip() |
|
2595 | 2595 | self.shell.alias_manager.undefine_alias(aname) |
|
2596 | 2596 | stored = self.db.get('stored_aliases', {} ) |
|
2597 | 2597 | if aname in stored: |
|
2598 | 2598 | print "Removing %stored alias",aname |
|
2599 | 2599 | del stored[aname] |
|
2600 | 2600 | self.db['stored_aliases'] = stored |
|
2601 | 2601 | |
|
2602 | 2602 | def magic_rehashx(self, parameter_s = ''): |
|
2603 | 2603 | """Update the alias table with all executable files in $PATH. |
|
2604 | 2604 | |
|
2605 | 2605 | This version explicitly checks that every entry in $PATH is a file |
|
2606 | 2606 | with execute access (os.X_OK), so it is much slower than %rehash. |
|
2607 | 2607 | |
|
2608 | 2608 | Under Windows, it checks executability as a match agains a |
|
2609 | 2609 | '|'-separated string of extensions, stored in the IPython config |
|
2610 | 2610 | variable win_exec_ext. This defaults to 'exe|com|bat'. |
|
2611 | 2611 | |
|
2612 | 2612 | This function also resets the root module cache of module completer, |
|
2613 | 2613 | used on slow filesystems. |
|
2614 | 2614 | """ |
|
2615 | 2615 | from IPython.core.alias import InvalidAliasError |
|
2616 | 2616 | |
|
2617 | 2617 | # for the benefit of module completer in ipy_completers.py |
|
2618 | 2618 | del self.db['rootmodules'] |
|
2619 | 2619 | |
|
2620 | 2620 | path = [os.path.abspath(os.path.expanduser(p)) for p in |
|
2621 | 2621 | os.environ.get('PATH','').split(os.pathsep)] |
|
2622 | 2622 | path = filter(os.path.isdir,path) |
|
2623 | 2623 | |
|
2624 | 2624 | syscmdlist = [] |
|
2625 | 2625 | # Now define isexec in a cross platform manner. |
|
2626 | 2626 | if os.name == 'posix': |
|
2627 | 2627 | isexec = lambda fname:os.path.isfile(fname) and \ |
|
2628 | 2628 | os.access(fname,os.X_OK) |
|
2629 | 2629 | else: |
|
2630 | 2630 | try: |
|
2631 | 2631 | winext = os.environ['pathext'].replace(';','|').replace('.','') |
|
2632 | 2632 | except KeyError: |
|
2633 | 2633 | winext = 'exe|com|bat|py' |
|
2634 | 2634 | if 'py' not in winext: |
|
2635 | 2635 | winext += '|py' |
|
2636 | 2636 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) |
|
2637 | 2637 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) |
|
2638 | 2638 | savedir = os.getcwd() |
|
2639 | 2639 | |
|
2640 | 2640 | # Now walk the paths looking for executables to alias. |
|
2641 | 2641 | try: |
|
2642 | 2642 | # write the whole loop for posix/Windows so we don't have an if in |
|
2643 | 2643 | # the innermost part |
|
2644 | 2644 | if os.name == 'posix': |
|
2645 | 2645 | for pdir in path: |
|
2646 | 2646 | os.chdir(pdir) |
|
2647 | 2647 | for ff in os.listdir(pdir): |
|
2648 | 2648 | if isexec(ff): |
|
2649 | 2649 | try: |
|
2650 | 2650 | # Removes dots from the name since ipython |
|
2651 | 2651 | # will assume names with dots to be python. |
|
2652 | 2652 | self.shell.alias_manager.define_alias( |
|
2653 | 2653 | ff.replace('.',''), ff) |
|
2654 | 2654 | except InvalidAliasError: |
|
2655 | 2655 | pass |
|
2656 | 2656 | else: |
|
2657 | 2657 | syscmdlist.append(ff) |
|
2658 | 2658 | else: |
|
2659 | 2659 | no_alias = self.shell.alias_manager.no_alias |
|
2660 | 2660 | for pdir in path: |
|
2661 | 2661 | os.chdir(pdir) |
|
2662 | 2662 | for ff in os.listdir(pdir): |
|
2663 | 2663 | base, ext = os.path.splitext(ff) |
|
2664 | 2664 | if isexec(ff) and base.lower() not in no_alias: |
|
2665 | 2665 | if ext.lower() == '.exe': |
|
2666 | 2666 | ff = base |
|
2667 | 2667 | try: |
|
2668 | 2668 | # Removes dots from the name since ipython |
|
2669 | 2669 | # will assume names with dots to be python. |
|
2670 | 2670 | self.shell.alias_manager.define_alias( |
|
2671 | 2671 | base.lower().replace('.',''), ff) |
|
2672 | 2672 | except InvalidAliasError: |
|
2673 | 2673 | pass |
|
2674 | 2674 | syscmdlist.append(ff) |
|
2675 | 2675 | db = self.db |
|
2676 | 2676 | db['syscmdlist'] = syscmdlist |
|
2677 | 2677 | finally: |
|
2678 | 2678 | os.chdir(savedir) |
|
2679 | 2679 | |
|
2680 | 2680 | @testdec.skip_doctest |
|
2681 | 2681 | def magic_pwd(self, parameter_s = ''): |
|
2682 | 2682 | """Return the current working directory path. |
|
2683 | 2683 | |
|
2684 | 2684 | Examples |
|
2685 | 2685 | -------- |
|
2686 | 2686 | :: |
|
2687 | 2687 | |
|
2688 | 2688 | In [9]: pwd |
|
2689 | 2689 | Out[9]: '/home/tsuser/sprint/ipython' |
|
2690 | 2690 | """ |
|
2691 | 2691 | return os.getcwd() |
|
2692 | 2692 | |
|
2693 | 2693 | @testdec.skip_doctest |
|
2694 | 2694 | def magic_cd(self, parameter_s=''): |
|
2695 | 2695 | """Change the current working directory. |
|
2696 | 2696 | |
|
2697 | 2697 | This command automatically maintains an internal list of directories |
|
2698 | 2698 | you visit during your IPython session, in the variable _dh. The |
|
2699 | 2699 | command %dhist shows this history nicely formatted. You can also |
|
2700 | 2700 | do 'cd -<tab>' to see directory history conveniently. |
|
2701 | 2701 | |
|
2702 | 2702 | Usage: |
|
2703 | 2703 | |
|
2704 | 2704 | cd 'dir': changes to directory 'dir'. |
|
2705 | 2705 | |
|
2706 | 2706 | cd -: changes to the last visited directory. |
|
2707 | 2707 | |
|
2708 | 2708 | cd -<n>: changes to the n-th directory in the directory history. |
|
2709 | 2709 | |
|
2710 | 2710 | cd --foo: change to directory that matches 'foo' in history |
|
2711 | 2711 | |
|
2712 | 2712 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark |
|
2713 | 2713 | (note: cd <bookmark_name> is enough if there is no |
|
2714 | 2714 | directory <bookmark_name>, but a bookmark with the name exists.) |
|
2715 | 2715 | 'cd -b <tab>' allows you to tab-complete bookmark names. |
|
2716 | 2716 | |
|
2717 | 2717 | Options: |
|
2718 | 2718 | |
|
2719 | 2719 | -q: quiet. Do not print the working directory after the cd command is |
|
2720 | 2720 | executed. By default IPython's cd command does print this directory, |
|
2721 | 2721 | since the default prompts do not display path information. |
|
2722 | 2722 | |
|
2723 | 2723 | Note that !cd doesn't work for this purpose because the shell where |
|
2724 | 2724 | !command runs is immediately discarded after executing 'command'. |
|
2725 | 2725 | |
|
2726 | 2726 | Examples |
|
2727 | 2727 | -------- |
|
2728 | 2728 | :: |
|
2729 | 2729 | |
|
2730 | 2730 | In [10]: cd parent/child |
|
2731 | 2731 | /home/tsuser/parent/child |
|
2732 | 2732 | """ |
|
2733 | 2733 | |
|
2734 | 2734 | parameter_s = parameter_s.strip() |
|
2735 | 2735 | #bkms = self.shell.persist.get("bookmarks",{}) |
|
2736 | 2736 | |
|
2737 | 2737 | oldcwd = os.getcwd() |
|
2738 | 2738 | numcd = re.match(r'(-)(\d+)$',parameter_s) |
|
2739 | 2739 | # jump in directory history by number |
|
2740 | 2740 | if numcd: |
|
2741 | 2741 | nn = int(numcd.group(2)) |
|
2742 | 2742 | try: |
|
2743 | 2743 | ps = self.shell.user_ns['_dh'][nn] |
|
2744 | 2744 | except IndexError: |
|
2745 | 2745 | print 'The requested directory does not exist in history.' |
|
2746 | 2746 | return |
|
2747 | 2747 | else: |
|
2748 | 2748 | opts = {} |
|
2749 | 2749 | elif parameter_s.startswith('--'): |
|
2750 | 2750 | ps = None |
|
2751 | 2751 | fallback = None |
|
2752 | 2752 | pat = parameter_s[2:] |
|
2753 | 2753 | dh = self.shell.user_ns['_dh'] |
|
2754 | 2754 | # first search only by basename (last component) |
|
2755 | 2755 | for ent in reversed(dh): |
|
2756 | 2756 | if pat in os.path.basename(ent) and os.path.isdir(ent): |
|
2757 | 2757 | ps = ent |
|
2758 | 2758 | break |
|
2759 | 2759 | |
|
2760 | 2760 | if fallback is None and pat in ent and os.path.isdir(ent): |
|
2761 | 2761 | fallback = ent |
|
2762 | 2762 | |
|
2763 | 2763 | # if we have no last part match, pick the first full path match |
|
2764 | 2764 | if ps is None: |
|
2765 | 2765 | ps = fallback |
|
2766 | 2766 | |
|
2767 | 2767 | if ps is None: |
|
2768 | 2768 | print "No matching entry in directory history" |
|
2769 | 2769 | return |
|
2770 | 2770 | else: |
|
2771 | 2771 | opts = {} |
|
2772 | 2772 | |
|
2773 | 2773 | |
|
2774 | 2774 | else: |
|
2775 | 2775 | #turn all non-space-escaping backslashes to slashes, |
|
2776 | 2776 | # for c:\windows\directory\names\ |
|
2777 | 2777 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) |
|
2778 | 2778 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') |
|
2779 | 2779 | # jump to previous |
|
2780 | 2780 | if ps == '-': |
|
2781 | 2781 | try: |
|
2782 | 2782 | ps = self.shell.user_ns['_dh'][-2] |
|
2783 | 2783 | except IndexError: |
|
2784 | 2784 | raise UsageError('%cd -: No previous directory to change to.') |
|
2785 | 2785 | # jump to bookmark if needed |
|
2786 | 2786 | else: |
|
2787 | 2787 | if not os.path.isdir(ps) or opts.has_key('b'): |
|
2788 | 2788 | bkms = self.db.get('bookmarks', {}) |
|
2789 | 2789 | |
|
2790 | 2790 | if bkms.has_key(ps): |
|
2791 | 2791 | target = bkms[ps] |
|
2792 | 2792 | print '(bookmark:%s) -> %s' % (ps,target) |
|
2793 | 2793 | ps = target |
|
2794 | 2794 | else: |
|
2795 | 2795 | if opts.has_key('b'): |
|
2796 | 2796 | raise UsageError("Bookmark '%s' not found. " |
|
2797 | 2797 | "Use '%%bookmark -l' to see your bookmarks." % ps) |
|
2798 | 2798 | |
|
2799 | 2799 | # at this point ps should point to the target dir |
|
2800 | 2800 | if ps: |
|
2801 | 2801 | try: |
|
2802 | 2802 | os.chdir(os.path.expanduser(ps)) |
|
2803 | 2803 | if hasattr(self.shell, 'term_title') and self.shell.term_title: |
|
2804 | 2804 | set_term_title('IPython: ' + abbrev_cwd()) |
|
2805 | 2805 | except OSError: |
|
2806 | 2806 | print sys.exc_info()[1] |
|
2807 | 2807 | else: |
|
2808 | 2808 | cwd = os.getcwd() |
|
2809 | 2809 | dhist = self.shell.user_ns['_dh'] |
|
2810 | 2810 | if oldcwd != cwd: |
|
2811 | 2811 | dhist.append(cwd) |
|
2812 | 2812 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2813 | 2813 | |
|
2814 | 2814 | else: |
|
2815 | 2815 | os.chdir(self.shell.home_dir) |
|
2816 | 2816 | if hasattr(self.shell, 'term_title') and self.shell.term_title: |
|
2817 | 2817 | set_term_title('IPython: ' + '~') |
|
2818 | 2818 | cwd = os.getcwd() |
|
2819 | 2819 | dhist = self.shell.user_ns['_dh'] |
|
2820 | 2820 | |
|
2821 | 2821 | if oldcwd != cwd: |
|
2822 | 2822 | dhist.append(cwd) |
|
2823 | 2823 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2824 | 2824 | if not 'q' in opts and self.shell.user_ns['_dh']: |
|
2825 | 2825 | print self.shell.user_ns['_dh'][-1] |
|
2826 | 2826 | |
|
2827 | 2827 | |
|
2828 | 2828 | def magic_env(self, parameter_s=''): |
|
2829 | 2829 | """List environment variables.""" |
|
2830 | 2830 | |
|
2831 | 2831 | return os.environ.data |
|
2832 | 2832 | |
|
2833 | 2833 | def magic_pushd(self, parameter_s=''): |
|
2834 | 2834 | """Place the current dir on stack and change directory. |
|
2835 | 2835 | |
|
2836 | 2836 | Usage:\\ |
|
2837 | 2837 | %pushd ['dirname'] |
|
2838 | 2838 | """ |
|
2839 | 2839 | |
|
2840 | 2840 | dir_s = self.shell.dir_stack |
|
2841 | 2841 | tgt = os.path.expanduser(parameter_s) |
|
2842 | 2842 | cwd = os.getcwd().replace(self.home_dir,'~') |
|
2843 | 2843 | if tgt: |
|
2844 | 2844 | self.magic_cd(parameter_s) |
|
2845 | 2845 | dir_s.insert(0,cwd) |
|
2846 | 2846 | return self.magic_dirs() |
|
2847 | 2847 | |
|
2848 | 2848 | def magic_popd(self, parameter_s=''): |
|
2849 | 2849 | """Change to directory popped off the top of the stack. |
|
2850 | 2850 | """ |
|
2851 | 2851 | if not self.shell.dir_stack: |
|
2852 | 2852 | raise UsageError("%popd on empty stack") |
|
2853 | 2853 | top = self.shell.dir_stack.pop(0) |
|
2854 | 2854 | self.magic_cd(top) |
|
2855 | 2855 | print "popd ->",top |
|
2856 | 2856 | |
|
2857 | 2857 | def magic_dirs(self, parameter_s=''): |
|
2858 | 2858 | """Return the current directory stack.""" |
|
2859 | 2859 | |
|
2860 | 2860 | return self.shell.dir_stack |
|
2861 | 2861 | |
|
2862 | 2862 | def magic_dhist(self, parameter_s=''): |
|
2863 | 2863 | """Print your history of visited directories. |
|
2864 | 2864 | |
|
2865 | 2865 | %dhist -> print full history\\ |
|
2866 | 2866 | %dhist n -> print last n entries only\\ |
|
2867 | 2867 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ |
|
2868 | 2868 | |
|
2869 | 2869 | This history is automatically maintained by the %cd command, and |
|
2870 | 2870 | always available as the global list variable _dh. You can use %cd -<n> |
|
2871 | 2871 | to go to directory number <n>. |
|
2872 | 2872 | |
|
2873 | 2873 | Note that most of time, you should view directory history by entering |
|
2874 | 2874 | cd -<TAB>. |
|
2875 | 2875 | |
|
2876 | 2876 | """ |
|
2877 | 2877 | |
|
2878 | 2878 | dh = self.shell.user_ns['_dh'] |
|
2879 | 2879 | if parameter_s: |
|
2880 | 2880 | try: |
|
2881 | 2881 | args = map(int,parameter_s.split()) |
|
2882 | 2882 | except: |
|
2883 | 2883 | self.arg_err(Magic.magic_dhist) |
|
2884 | 2884 | return |
|
2885 | 2885 | if len(args) == 1: |
|
2886 | 2886 | ini,fin = max(len(dh)-(args[0]),0),len(dh) |
|
2887 | 2887 | elif len(args) == 2: |
|
2888 | 2888 | ini,fin = args |
|
2889 | 2889 | else: |
|
2890 | 2890 | self.arg_err(Magic.magic_dhist) |
|
2891 | 2891 | return |
|
2892 | 2892 | else: |
|
2893 | 2893 | ini,fin = 0,len(dh) |
|
2894 | 2894 | nlprint(dh, |
|
2895 | 2895 | header = 'Directory history (kept in _dh)', |
|
2896 | 2896 | start=ini,stop=fin) |
|
2897 | 2897 | |
|
2898 | 2898 | @testdec.skip_doctest |
|
2899 | 2899 | def magic_sc(self, parameter_s=''): |
|
2900 | 2900 | """Shell capture - execute a shell command and capture its output. |
|
2901 | 2901 | |
|
2902 | 2902 | DEPRECATED. Suboptimal, retained for backwards compatibility. |
|
2903 | 2903 | |
|
2904 | 2904 | You should use the form 'var = !command' instead. Example: |
|
2905 | 2905 | |
|
2906 | 2906 | "%sc -l myfiles = ls ~" should now be written as |
|
2907 | 2907 | |
|
2908 | 2908 | "myfiles = !ls ~" |
|
2909 | 2909 | |
|
2910 | 2910 | myfiles.s, myfiles.l and myfiles.n still apply as documented |
|
2911 | 2911 | below. |
|
2912 | 2912 | |
|
2913 | 2913 | -- |
|
2914 | 2914 | %sc [options] varname=command |
|
2915 | 2915 | |
|
2916 | 2916 | IPython will run the given command using commands.getoutput(), and |
|
2917 | 2917 | will then update the user's interactive namespace with a variable |
|
2918 | 2918 | called varname, containing the value of the call. Your command can |
|
2919 | 2919 | contain shell wildcards, pipes, etc. |
|
2920 | 2920 | |
|
2921 | 2921 | The '=' sign in the syntax is mandatory, and the variable name you |
|
2922 | 2922 | supply must follow Python's standard conventions for valid names. |
|
2923 | 2923 | |
|
2924 | 2924 | (A special format without variable name exists for internal use) |
|
2925 | 2925 | |
|
2926 | 2926 | Options: |
|
2927 | 2927 | |
|
2928 | 2928 | -l: list output. Split the output on newlines into a list before |
|
2929 | 2929 | assigning it to the given variable. By default the output is stored |
|
2930 | 2930 | as a single string. |
|
2931 | 2931 | |
|
2932 | 2932 | -v: verbose. Print the contents of the variable. |
|
2933 | 2933 | |
|
2934 | 2934 | In most cases you should not need to split as a list, because the |
|
2935 | 2935 | returned value is a special type of string which can automatically |
|
2936 | 2936 | provide its contents either as a list (split on newlines) or as a |
|
2937 | 2937 | space-separated string. These are convenient, respectively, either |
|
2938 | 2938 | for sequential processing or to be passed to a shell command. |
|
2939 | 2939 | |
|
2940 | 2940 | For example: |
|
2941 | 2941 | |
|
2942 | 2942 | # all-random |
|
2943 | 2943 | |
|
2944 | 2944 | # Capture into variable a |
|
2945 | 2945 | In [1]: sc a=ls *py |
|
2946 | 2946 | |
|
2947 | 2947 | # a is a string with embedded newlines |
|
2948 | 2948 | In [2]: a |
|
2949 | 2949 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' |
|
2950 | 2950 | |
|
2951 | 2951 | # which can be seen as a list: |
|
2952 | 2952 | In [3]: a.l |
|
2953 | 2953 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] |
|
2954 | 2954 | |
|
2955 | 2955 | # or as a whitespace-separated string: |
|
2956 | 2956 | In [4]: a.s |
|
2957 | 2957 | Out[4]: 'setup.py win32_manual_post_install.py' |
|
2958 | 2958 | |
|
2959 | 2959 | # a.s is useful to pass as a single command line: |
|
2960 | 2960 | In [5]: !wc -l $a.s |
|
2961 | 2961 | 146 setup.py |
|
2962 | 2962 | 130 win32_manual_post_install.py |
|
2963 | 2963 | 276 total |
|
2964 | 2964 | |
|
2965 | 2965 | # while the list form is useful to loop over: |
|
2966 | 2966 | In [6]: for f in a.l: |
|
2967 | 2967 | ...: !wc -l $f |
|
2968 | 2968 | ...: |
|
2969 | 2969 | 146 setup.py |
|
2970 | 2970 | 130 win32_manual_post_install.py |
|
2971 | 2971 | |
|
2972 | 2972 | Similiarly, the lists returned by the -l option are also special, in |
|
2973 | 2973 | the sense that you can equally invoke the .s attribute on them to |
|
2974 | 2974 | automatically get a whitespace-separated string from their contents: |
|
2975 | 2975 | |
|
2976 | 2976 | In [7]: sc -l b=ls *py |
|
2977 | 2977 | |
|
2978 | 2978 | In [8]: b |
|
2979 | 2979 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] |
|
2980 | 2980 | |
|
2981 | 2981 | In [9]: b.s |
|
2982 | 2982 | Out[9]: 'setup.py win32_manual_post_install.py' |
|
2983 | 2983 | |
|
2984 | 2984 | In summary, both the lists and strings used for ouptut capture have |
|
2985 | 2985 | the following special attributes: |
|
2986 | 2986 | |
|
2987 | 2987 | .l (or .list) : value as list. |
|
2988 | 2988 | .n (or .nlstr): value as newline-separated string. |
|
2989 | 2989 | .s (or .spstr): value as space-separated string. |
|
2990 | 2990 | """ |
|
2991 | 2991 | |
|
2992 | 2992 | opts,args = self.parse_options(parameter_s,'lv') |
|
2993 | 2993 | # Try to get a variable name and command to run |
|
2994 | 2994 | try: |
|
2995 | 2995 | # the variable name must be obtained from the parse_options |
|
2996 | 2996 | # output, which uses shlex.split to strip options out. |
|
2997 | 2997 | var,_ = args.split('=',1) |
|
2998 | 2998 | var = var.strip() |
|
2999 | 2999 | # But the the command has to be extracted from the original input |
|
3000 | 3000 | # parameter_s, not on what parse_options returns, to avoid the |
|
3001 | 3001 | # quote stripping which shlex.split performs on it. |
|
3002 | 3002 | _,cmd = parameter_s.split('=',1) |
|
3003 | 3003 | except ValueError: |
|
3004 | 3004 | var,cmd = '','' |
|
3005 | 3005 | # If all looks ok, proceed |
|
3006 | 3006 | split = 'l' in opts |
|
3007 | 3007 | out = self.shell.getoutput(cmd, split=split) |
|
3008 | 3008 | if opts.has_key('v'): |
|
3009 | 3009 | print '%s ==\n%s' % (var,pformat(out)) |
|
3010 | 3010 | if var: |
|
3011 | 3011 | self.shell.user_ns.update({var:out}) |
|
3012 | 3012 | else: |
|
3013 | 3013 | return out |
|
3014 | 3014 | |
|
3015 | 3015 | def magic_sx(self, parameter_s=''): |
|
3016 | 3016 | """Shell execute - run a shell command and capture its output. |
|
3017 | 3017 | |
|
3018 | 3018 | %sx command |
|
3019 | 3019 | |
|
3020 | 3020 | IPython will run the given command using commands.getoutput(), and |
|
3021 | 3021 | return the result formatted as a list (split on '\\n'). Since the |
|
3022 | 3022 | output is _returned_, it will be stored in ipython's regular output |
|
3023 | 3023 | cache Out[N] and in the '_N' automatic variables. |
|
3024 | 3024 | |
|
3025 | 3025 | Notes: |
|
3026 | 3026 | |
|
3027 | 3027 | 1) If an input line begins with '!!', then %sx is automatically |
|
3028 | 3028 | invoked. That is, while: |
|
3029 | 3029 | !ls |
|
3030 | 3030 | causes ipython to simply issue system('ls'), typing |
|
3031 | 3031 | !!ls |
|
3032 | 3032 | is a shorthand equivalent to: |
|
3033 | 3033 | %sx ls |
|
3034 | 3034 | |
|
3035 | 3035 | 2) %sx differs from %sc in that %sx automatically splits into a list, |
|
3036 | 3036 | like '%sc -l'. The reason for this is to make it as easy as possible |
|
3037 | 3037 | to process line-oriented shell output via further python commands. |
|
3038 | 3038 | %sc is meant to provide much finer control, but requires more |
|
3039 | 3039 | typing. |
|
3040 | 3040 | |
|
3041 | 3041 | 3) Just like %sc -l, this is a list with special attributes: |
|
3042 | 3042 | |
|
3043 | 3043 | .l (or .list) : value as list. |
|
3044 | 3044 | .n (or .nlstr): value as newline-separated string. |
|
3045 | 3045 | .s (or .spstr): value as whitespace-separated string. |
|
3046 | 3046 | |
|
3047 | 3047 | This is very useful when trying to use such lists as arguments to |
|
3048 | 3048 | system commands.""" |
|
3049 | 3049 | |
|
3050 | 3050 | if parameter_s: |
|
3051 | 3051 | return self.shell.getoutput(parameter_s) |
|
3052 | 3052 | |
|
3053 | 3053 | def magic_r(self, parameter_s=''): |
|
3054 | 3054 | """Repeat previous input. |
|
3055 | 3055 | |
|
3056 | 3056 | Note: Consider using the more powerfull %rep instead! |
|
3057 | 3057 | |
|
3058 | 3058 | If given an argument, repeats the previous command which starts with |
|
3059 | 3059 | the same string, otherwise it just repeats the previous input. |
|
3060 | 3060 | |
|
3061 | 3061 | Shell escaped commands (with ! as first character) are not recognized |
|
3062 | 3062 | by this system, only pure python code and magic commands. |
|
3063 | 3063 | """ |
|
3064 | 3064 | |
|
3065 | 3065 | start = parameter_s.strip() |
|
3066 | 3066 | esc_magic = ESC_MAGIC |
|
3067 | 3067 | # Identify magic commands even if automagic is on (which means |
|
3068 | 3068 | # the in-memory version is different from that typed by the user). |
|
3069 | 3069 | if self.shell.automagic: |
|
3070 | 3070 | start_magic = esc_magic+start |
|
3071 | 3071 | else: |
|
3072 | 3072 | start_magic = start |
|
3073 | 3073 | # Look through the input history in reverse |
|
3074 | 3074 | for n in range(len(self.shell.history_manager.input_hist_parsed)-2,0,-1): |
|
3075 | 3075 | input = self.shell.history_manager.input_hist_parsed[n] |
|
3076 | 3076 | # skip plain 'r' lines so we don't recurse to infinity |
|
3077 | 3077 | if input != '_ip.magic("r")\n' and \ |
|
3078 | 3078 | (input.startswith(start) or input.startswith(start_magic)): |
|
3079 | 3079 | #print 'match',`input` # dbg |
|
3080 | 3080 | print 'Executing:',input, |
|
3081 | 3081 | self.shell.run_cell(input) |
|
3082 | 3082 | return |
|
3083 | 3083 | print 'No previous input matching `%s` found.' % start |
|
3084 | 3084 | |
|
3085 | 3085 | |
|
3086 | 3086 | def magic_bookmark(self, parameter_s=''): |
|
3087 | 3087 | """Manage IPython's bookmark system. |
|
3088 | 3088 | |
|
3089 | 3089 | %bookmark <name> - set bookmark to current dir |
|
3090 | 3090 | %bookmark <name> <dir> - set bookmark to <dir> |
|
3091 | 3091 | %bookmark -l - list all bookmarks |
|
3092 | 3092 | %bookmark -d <name> - remove bookmark |
|
3093 | 3093 | %bookmark -r - remove all bookmarks |
|
3094 | 3094 | |
|
3095 | 3095 | You can later on access a bookmarked folder with: |
|
3096 | 3096 | %cd -b <name> |
|
3097 | 3097 | or simply '%cd <name>' if there is no directory called <name> AND |
|
3098 | 3098 | there is such a bookmark defined. |
|
3099 | 3099 | |
|
3100 | 3100 | Your bookmarks persist through IPython sessions, but they are |
|
3101 | 3101 | associated with each profile.""" |
|
3102 | 3102 | |
|
3103 | 3103 | opts,args = self.parse_options(parameter_s,'drl',mode='list') |
|
3104 | 3104 | if len(args) > 2: |
|
3105 | 3105 | raise UsageError("%bookmark: too many arguments") |
|
3106 | 3106 | |
|
3107 | 3107 | bkms = self.db.get('bookmarks',{}) |
|
3108 | 3108 | |
|
3109 | 3109 | if opts.has_key('d'): |
|
3110 | 3110 | try: |
|
3111 | 3111 | todel = args[0] |
|
3112 | 3112 | except IndexError: |
|
3113 | 3113 | raise UsageError( |
|
3114 | 3114 | "%bookmark -d: must provide a bookmark to delete") |
|
3115 | 3115 | else: |
|
3116 | 3116 | try: |
|
3117 | 3117 | del bkms[todel] |
|
3118 | 3118 | except KeyError: |
|
3119 | 3119 | raise UsageError( |
|
3120 | 3120 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) |
|
3121 | 3121 | |
|
3122 | 3122 | elif opts.has_key('r'): |
|
3123 | 3123 | bkms = {} |
|
3124 | 3124 | elif opts.has_key('l'): |
|
3125 | 3125 | bks = bkms.keys() |
|
3126 | 3126 | bks.sort() |
|
3127 | 3127 | if bks: |
|
3128 | 3128 | size = max(map(len,bks)) |
|
3129 | 3129 | else: |
|
3130 | 3130 | size = 0 |
|
3131 | 3131 | fmt = '%-'+str(size)+'s -> %s' |
|
3132 | 3132 | print 'Current bookmarks:' |
|
3133 | 3133 | for bk in bks: |
|
3134 | 3134 | print fmt % (bk,bkms[bk]) |
|
3135 | 3135 | else: |
|
3136 | 3136 | if not args: |
|
3137 | 3137 | raise UsageError("%bookmark: You must specify the bookmark name") |
|
3138 | 3138 | elif len(args)==1: |
|
3139 | 3139 | bkms[args[0]] = os.getcwd() |
|
3140 | 3140 | elif len(args)==2: |
|
3141 | 3141 | bkms[args[0]] = args[1] |
|
3142 | 3142 | self.db['bookmarks'] = bkms |
|
3143 | 3143 | |
|
3144 | 3144 | def magic_pycat(self, parameter_s=''): |
|
3145 | 3145 | """Show a syntax-highlighted file through a pager. |
|
3146 | 3146 | |
|
3147 | 3147 | This magic is similar to the cat utility, but it will assume the file |
|
3148 | 3148 | to be Python source and will show it with syntax highlighting. """ |
|
3149 | 3149 | |
|
3150 | 3150 | try: |
|
3151 | 3151 | filename = get_py_filename(parameter_s) |
|
3152 | 3152 | cont = file_read(filename) |
|
3153 | 3153 | except IOError: |
|
3154 | 3154 | try: |
|
3155 | 3155 | cont = eval(parameter_s,self.user_ns) |
|
3156 | 3156 | except NameError: |
|
3157 | 3157 | cont = None |
|
3158 | 3158 | if cont is None: |
|
3159 | 3159 | print "Error: no such file or variable" |
|
3160 | 3160 | return |
|
3161 | 3161 | |
|
3162 | 3162 | page.page(self.shell.pycolorize(cont)) |
|
3163 | 3163 | |
|
3164 | 3164 | def _rerun_pasted(self): |
|
3165 | 3165 | """ Rerun a previously pasted command. |
|
3166 | 3166 | """ |
|
3167 | 3167 | b = self.user_ns.get('pasted_block', None) |
|
3168 | 3168 | if b is None: |
|
3169 | 3169 | raise UsageError('No previous pasted block available') |
|
3170 | 3170 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) |
|
3171 | 3171 | exec b in self.user_ns |
|
3172 | 3172 | |
|
3173 | 3173 | def _get_pasted_lines(self, sentinel): |
|
3174 | 3174 | """ Yield pasted lines until the user enters the given sentinel value. |
|
3175 | 3175 | """ |
|
3176 | 3176 | from IPython.core import interactiveshell |
|
3177 | 3177 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel |
|
3178 | 3178 | while True: |
|
3179 | 3179 | l = interactiveshell.raw_input_original(':') |
|
3180 | 3180 | if l == sentinel: |
|
3181 | 3181 | return |
|
3182 | 3182 | else: |
|
3183 | 3183 | yield l |
|
3184 | 3184 | |
|
3185 | 3185 | def _strip_pasted_lines_for_code(self, raw_lines): |
|
3186 | 3186 | """ Strip non-code parts of a sequence of lines to return a block of |
|
3187 | 3187 | code. |
|
3188 | 3188 | """ |
|
3189 | 3189 | # Regular expressions that declare text we strip from the input: |
|
3190 | 3190 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt |
|
3191 | 3191 | r'^\s*(\s?>)+', # Python input prompt |
|
3192 | 3192 | r'^\s*\.{3,}', # Continuation prompts |
|
3193 | 3193 | r'^\++', |
|
3194 | 3194 | ] |
|
3195 | 3195 | |
|
3196 | 3196 | strip_from_start = map(re.compile,strip_re) |
|
3197 | 3197 | |
|
3198 | 3198 | lines = [] |
|
3199 | 3199 | for l in raw_lines: |
|
3200 | 3200 | for pat in strip_from_start: |
|
3201 | 3201 | l = pat.sub('',l) |
|
3202 | 3202 | lines.append(l) |
|
3203 | 3203 | |
|
3204 | 3204 | block = "\n".join(lines) + '\n' |
|
3205 | 3205 | #print "block:\n",block |
|
3206 | 3206 | return block |
|
3207 | 3207 | |
|
3208 | 3208 | def _execute_block(self, block, par): |
|
3209 | 3209 | """ Execute a block, or store it in a variable, per the user's request. |
|
3210 | 3210 | """ |
|
3211 | 3211 | if not par: |
|
3212 | 3212 | b = textwrap.dedent(block) |
|
3213 | 3213 | self.user_ns['pasted_block'] = b |
|
3214 | 3214 | exec b in self.user_ns |
|
3215 | 3215 | else: |
|
3216 | 3216 | self.user_ns[par] = SList(block.splitlines()) |
|
3217 | 3217 | print "Block assigned to '%s'" % par |
|
3218 | 3218 | |
|
3219 | 3219 | def magic_quickref(self,arg): |
|
3220 | 3220 | """ Show a quick reference sheet """ |
|
3221 | 3221 | import IPython.core.usage |
|
3222 | 3222 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') |
|
3223 | 3223 | |
|
3224 | 3224 | page.page(qr) |
|
3225 | 3225 | |
|
3226 | 3226 | def magic_doctest_mode(self,parameter_s=''): |
|
3227 | 3227 | """Toggle doctest mode on and off. |
|
3228 | 3228 | |
|
3229 | 3229 | This mode is intended to make IPython behave as much as possible like a |
|
3230 | 3230 | plain Python shell, from the perspective of how its prompts, exceptions |
|
3231 | 3231 | and output look. This makes it easy to copy and paste parts of a |
|
3232 | 3232 | session into doctests. It does so by: |
|
3233 | 3233 | |
|
3234 | 3234 | - Changing the prompts to the classic ``>>>`` ones. |
|
3235 | 3235 | - Changing the exception reporting mode to 'Plain'. |
|
3236 | 3236 | - Disabling pretty-printing of output. |
|
3237 | 3237 | |
|
3238 | 3238 | Note that IPython also supports the pasting of code snippets that have |
|
3239 | 3239 | leading '>>>' and '...' prompts in them. This means that you can paste |
|
3240 | 3240 | doctests from files or docstrings (even if they have leading |
|
3241 | 3241 | whitespace), and the code will execute correctly. You can then use |
|
3242 | 3242 | '%history -t' to see the translated history; this will give you the |
|
3243 | 3243 | input after removal of all the leading prompts and whitespace, which |
|
3244 | 3244 | can be pasted back into an editor. |
|
3245 | 3245 | |
|
3246 | 3246 | With these features, you can switch into this mode easily whenever you |
|
3247 | 3247 | need to do testing and changes to doctests, without having to leave |
|
3248 | 3248 | your existing IPython session. |
|
3249 | 3249 | """ |
|
3250 | 3250 | |
|
3251 | 3251 | from IPython.utils.ipstruct import Struct |
|
3252 | 3252 | |
|
3253 | 3253 | # Shorthands |
|
3254 | 3254 | shell = self.shell |
|
3255 | 3255 | oc = shell.displayhook |
|
3256 | 3256 | meta = shell.meta |
|
3257 | 3257 | disp_formatter = self.shell.display_formatter |
|
3258 | 3258 | ptformatter = disp_formatter.formatters['text/plain'] |
|
3259 | 3259 | # dstore is a data store kept in the instance metadata bag to track any |
|
3260 | 3260 | # changes we make, so we can undo them later. |
|
3261 | 3261 | dstore = meta.setdefault('doctest_mode',Struct()) |
|
3262 | 3262 | save_dstore = dstore.setdefault |
|
3263 | 3263 | |
|
3264 | 3264 | # save a few values we'll need to recover later |
|
3265 | 3265 | mode = save_dstore('mode',False) |
|
3266 | 3266 | save_dstore('rc_pprint',ptformatter.pprint) |
|
3267 | 3267 | save_dstore('xmode',shell.InteractiveTB.mode) |
|
3268 | 3268 | save_dstore('rc_separate_out',shell.separate_out) |
|
3269 | 3269 | save_dstore('rc_separate_out2',shell.separate_out2) |
|
3270 | 3270 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) |
|
3271 | 3271 | save_dstore('rc_separate_in',shell.separate_in) |
|
3272 | 3272 | save_dstore('rc_plain_text_only',disp_formatter.plain_text_only) |
|
3273 | 3273 | |
|
3274 | 3274 | if mode == False: |
|
3275 | 3275 | # turn on |
|
3276 | 3276 | oc.prompt1.p_template = '>>> ' |
|
3277 | 3277 | oc.prompt2.p_template = '... ' |
|
3278 | 3278 | oc.prompt_out.p_template = '' |
|
3279 | 3279 | |
|
3280 | 3280 | # Prompt separators like plain python |
|
3281 | 3281 | oc.input_sep = oc.prompt1.sep = '' |
|
3282 | 3282 | oc.output_sep = '' |
|
3283 | 3283 | oc.output_sep2 = '' |
|
3284 | 3284 | |
|
3285 | 3285 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3286 | 3286 | oc.prompt_out.pad_left = False |
|
3287 | 3287 | |
|
3288 | 3288 | ptformatter.pprint = False |
|
3289 | 3289 | disp_formatter.plain_text_only = True |
|
3290 | 3290 | |
|
3291 | 3291 | shell.magic_xmode('Plain') |
|
3292 | 3292 | else: |
|
3293 | 3293 | # turn off |
|
3294 | 3294 | oc.prompt1.p_template = shell.prompt_in1 |
|
3295 | 3295 | oc.prompt2.p_template = shell.prompt_in2 |
|
3296 | 3296 | oc.prompt_out.p_template = shell.prompt_out |
|
3297 | 3297 | |
|
3298 | 3298 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in |
|
3299 | 3299 | |
|
3300 | 3300 | oc.output_sep = dstore.rc_separate_out |
|
3301 | 3301 | oc.output_sep2 = dstore.rc_separate_out2 |
|
3302 | 3302 | |
|
3303 | 3303 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3304 | 3304 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left |
|
3305 | 3305 | |
|
3306 | 3306 | ptformatter.pprint = dstore.rc_pprint |
|
3307 | 3307 | disp_formatter.plain_text_only = dstore.rc_plain_text_only |
|
3308 | 3308 | |
|
3309 | 3309 | shell.magic_xmode(dstore.xmode) |
|
3310 | 3310 | |
|
3311 | 3311 | # Store new mode and inform |
|
3312 | 3312 | dstore.mode = bool(1-int(mode)) |
|
3313 | 3313 | mode_label = ['OFF','ON'][dstore.mode] |
|
3314 | 3314 | print 'Doctest mode is:', mode_label |
|
3315 | 3315 | |
|
3316 | 3316 | def magic_gui(self, parameter_s=''): |
|
3317 | 3317 | """Enable or disable IPython GUI event loop integration. |
|
3318 | 3318 | |
|
3319 | 3319 | %gui [GUINAME] |
|
3320 | 3320 | |
|
3321 | 3321 | This magic replaces IPython's threaded shells that were activated |
|
3322 | 3322 | using the (pylab/wthread/etc.) command line flags. GUI toolkits |
|
3323 | 3323 | can now be enabled, disabled and swtiched at runtime and keyboard |
|
3324 | 3324 | interrupts should work without any problems. The following toolkits |
|
3325 | 3325 | are supported: wxPython, PyQt4, PyGTK, and Tk:: |
|
3326 | 3326 | |
|
3327 | 3327 | %gui wx # enable wxPython event loop integration |
|
3328 | 3328 | %gui qt4|qt # enable PyQt4 event loop integration |
|
3329 | 3329 | %gui gtk # enable PyGTK event loop integration |
|
3330 | 3330 | %gui tk # enable Tk event loop integration |
|
3331 | 3331 | %gui # disable all event loop integration |
|
3332 | 3332 | |
|
3333 | 3333 | WARNING: after any of these has been called you can simply create |
|
3334 | 3334 | an application object, but DO NOT start the event loop yourself, as |
|
3335 | 3335 | we have already handled that. |
|
3336 | 3336 | """ |
|
3337 | 3337 | from IPython.lib.inputhook import enable_gui |
|
3338 | 3338 | opts, arg = self.parse_options(parameter_s, '') |
|
3339 | 3339 | if arg=='': arg = None |
|
3340 | 3340 | return enable_gui(arg) |
|
3341 | 3341 | |
|
3342 | 3342 | def magic_load_ext(self, module_str): |
|
3343 | 3343 | """Load an IPython extension by its module name.""" |
|
3344 | 3344 | return self.extension_manager.load_extension(module_str) |
|
3345 | 3345 | |
|
3346 | 3346 | def magic_unload_ext(self, module_str): |
|
3347 | 3347 | """Unload an IPython extension by its module name.""" |
|
3348 | 3348 | self.extension_manager.unload_extension(module_str) |
|
3349 | 3349 | |
|
3350 | 3350 | def magic_reload_ext(self, module_str): |
|
3351 | 3351 | """Reload an IPython extension by its module name.""" |
|
3352 | 3352 | self.extension_manager.reload_extension(module_str) |
|
3353 | 3353 | |
|
3354 | 3354 | @testdec.skip_doctest |
|
3355 | 3355 | def magic_install_profiles(self, s): |
|
3356 | 3356 | """Install the default IPython profiles into the .ipython dir. |
|
3357 | 3357 | |
|
3358 | 3358 | If the default profiles have already been installed, they will not |
|
3359 | 3359 | be overwritten. You can force overwriting them by using the ``-o`` |
|
3360 | 3360 | option:: |
|
3361 | 3361 | |
|
3362 | 3362 | In [1]: %install_profiles -o |
|
3363 | 3363 | """ |
|
3364 | 3364 | if '-o' in s: |
|
3365 | 3365 | overwrite = True |
|
3366 | 3366 | else: |
|
3367 | 3367 | overwrite = False |
|
3368 | 3368 | from IPython.config import profile |
|
3369 | 3369 | profile_dir = os.path.split(profile.__file__)[0] |
|
3370 | 3370 | ipython_dir = self.ipython_dir |
|
3371 | 3371 | files = os.listdir(profile_dir) |
|
3372 | 3372 | |
|
3373 | 3373 | to_install = [] |
|
3374 | 3374 | for f in files: |
|
3375 | 3375 | if f.startswith('ipython_config'): |
|
3376 | 3376 | src = os.path.join(profile_dir, f) |
|
3377 | 3377 | dst = os.path.join(ipython_dir, f) |
|
3378 | 3378 | if (not os.path.isfile(dst)) or overwrite: |
|
3379 | 3379 | to_install.append((f, src, dst)) |
|
3380 | 3380 | if len(to_install)>0: |
|
3381 | 3381 | print "Installing profiles to: ", ipython_dir |
|
3382 | 3382 | for (f, src, dst) in to_install: |
|
3383 | 3383 | shutil.copy(src, dst) |
|
3384 | 3384 | print " %s" % f |
|
3385 | 3385 | |
|
3386 | 3386 | def magic_install_default_config(self, s): |
|
3387 | 3387 | """Install IPython's default config file into the .ipython dir. |
|
3388 | 3388 | |
|
3389 | 3389 | If the default config file (:file:`ipython_config.py`) is already |
|
3390 | 3390 | installed, it will not be overwritten. You can force overwriting |
|
3391 | 3391 | by using the ``-o`` option:: |
|
3392 | 3392 | |
|
3393 | 3393 | In [1]: %install_default_config |
|
3394 | 3394 | """ |
|
3395 | 3395 | if '-o' in s: |
|
3396 | 3396 | overwrite = True |
|
3397 | 3397 | else: |
|
3398 | 3398 | overwrite = False |
|
3399 | 3399 | from IPython.config import default |
|
3400 | 3400 | config_dir = os.path.split(default.__file__)[0] |
|
3401 | 3401 | ipython_dir = self.ipython_dir |
|
3402 | 3402 | default_config_file_name = 'ipython_config.py' |
|
3403 | 3403 | src = os.path.join(config_dir, default_config_file_name) |
|
3404 | 3404 | dst = os.path.join(ipython_dir, default_config_file_name) |
|
3405 | 3405 | if (not os.path.isfile(dst)) or overwrite: |
|
3406 | 3406 | shutil.copy(src, dst) |
|
3407 | 3407 | print "Installing default config file: %s" % dst |
|
3408 | 3408 | |
|
3409 | 3409 | # Pylab support: simple wrappers that activate pylab, load gui input |
|
3410 | 3410 | # handling and modify slightly %run |
|
3411 | 3411 | |
|
3412 | 3412 | @testdec.skip_doctest |
|
3413 | 3413 | def _pylab_magic_run(self, parameter_s=''): |
|
3414 | 3414 | Magic.magic_run(self, parameter_s, |
|
3415 | 3415 | runner=mpl_runner(self.shell.safe_execfile)) |
|
3416 | 3416 | |
|
3417 | 3417 | _pylab_magic_run.__doc__ = magic_run.__doc__ |
|
3418 | 3418 | |
|
3419 | 3419 | @testdec.skip_doctest |
|
3420 | 3420 | def magic_pylab(self, s): |
|
3421 | 3421 | """Load numpy and matplotlib to work interactively. |
|
3422 | 3422 | |
|
3423 | 3423 | %pylab [GUINAME] |
|
3424 | 3424 | |
|
3425 | 3425 | This function lets you activate pylab (matplotlib, numpy and |
|
3426 | 3426 | interactive support) at any point during an IPython session. |
|
3427 | 3427 | |
|
3428 | 3428 | It will import at the top level numpy as np, pyplot as plt, matplotlib, |
|
3429 | 3429 | pylab and mlab, as well as all names from numpy and pylab. |
|
3430 | 3430 | |
|
3431 | 3431 | Parameters |
|
3432 | 3432 | ---------- |
|
3433 | 3433 | guiname : optional |
|
3434 | 3434 | One of the valid arguments to the %gui magic ('qt', 'wx', 'gtk' or |
|
3435 | 3435 | 'tk'). If given, the corresponding Matplotlib backend is used, |
|
3436 | 3436 | otherwise matplotlib's default (which you can override in your |
|
3437 | 3437 | matplotlib config file) is used. |
|
3438 | 3438 | |
|
3439 | 3439 | Examples |
|
3440 | 3440 | -------- |
|
3441 | 3441 | In this case, where the MPL default is TkAgg: |
|
3442 | 3442 | In [2]: %pylab |
|
3443 | 3443 | |
|
3444 | 3444 | Welcome to pylab, a matplotlib-based Python environment. |
|
3445 | 3445 | Backend in use: TkAgg |
|
3446 | 3446 | For more information, type 'help(pylab)'. |
|
3447 | 3447 | |
|
3448 | 3448 | But you can explicitly request a different backend: |
|
3449 | 3449 | In [3]: %pylab qt |
|
3450 | 3450 | |
|
3451 | 3451 | Welcome to pylab, a matplotlib-based Python environment. |
|
3452 | 3452 | Backend in use: Qt4Agg |
|
3453 | 3453 | For more information, type 'help(pylab)'. |
|
3454 | 3454 | """ |
|
3455 | 3455 | self.shell.enable_pylab(s) |
|
3456 | 3456 | |
|
3457 | 3457 | def magic_tb(self, s): |
|
3458 | 3458 | """Print the last traceback with the currently active exception mode. |
|
3459 | 3459 | |
|
3460 | 3460 | See %xmode for changing exception reporting modes.""" |
|
3461 | 3461 | self.shell.showtraceback() |
|
3462 | 3462 | |
|
3463 | 3463 | @testdec.skip_doctest |
|
3464 | 3464 | def magic_precision(self, s=''): |
|
3465 | 3465 | """Set floating point precision for pretty printing. |
|
3466 | 3466 | |
|
3467 | 3467 | Can set either integer precision or a format string. |
|
3468 | 3468 | |
|
3469 | 3469 | If numpy has been imported and precision is an int, |
|
3470 | 3470 | numpy display precision will also be set, via ``numpy.set_printoptions``. |
|
3471 | 3471 | |
|
3472 | 3472 | If no argument is given, defaults will be restored. |
|
3473 | 3473 | |
|
3474 | 3474 | Examples |
|
3475 | 3475 | -------- |
|
3476 | 3476 | :: |
|
3477 | 3477 | |
|
3478 | 3478 | In [1]: from math import pi |
|
3479 | 3479 | |
|
3480 | 3480 | In [2]: %precision 3 |
|
3481 | Out[2]: '%.3f' | |
|
3481 | 3482 | |
|
3482 | 3483 | In [3]: pi |
|
3483 | 3484 | Out[3]: 3.142 |
|
3484 | 3485 | |
|
3485 | 3486 | In [4]: %precision %i |
|
3487 | Out[4]: '%i' | |
|
3486 | 3488 | |
|
3487 | 3489 | In [5]: pi |
|
3488 | 3490 | Out[5]: 3 |
|
3489 | 3491 | |
|
3490 | 3492 | In [6]: %precision %e |
|
3493 | Out[6]: '%e' | |
|
3491 | 3494 | |
|
3492 | 3495 | In [7]: pi**10 |
|
3493 | 3496 | Out[7]: 9.364805e+04 |
|
3494 | 3497 | |
|
3495 | 3498 | In [8]: %precision |
|
3499 | Out[8]: '%r' | |
|
3496 | 3500 | |
|
3497 | 3501 | In [9]: pi**10 |
|
3498 | 3502 | Out[9]: 93648.047476082982 |
|
3499 | 3503 | |
|
3500 | 3504 | """ |
|
3501 | 3505 | |
|
3502 | if '%' in s: | |
|
3503 | # got explicit format string | |
|
3504 | fmt = s | |
|
3505 | try: | |
|
3506 | fmt%3.14159 | |
|
3507 | except Exception: | |
|
3508 | raise ValueError("Precision must be int or format string, not %r"%s) | |
|
3509 | elif s: | |
|
3510 | # otherwise, should be an int | |
|
3511 | try: | |
|
3512 | i = int(s) | |
|
3513 | assert i >= 0 | |
|
3514 | except (ValueError, AssertionError): | |
|
3515 | raise ValueError("Precision must be non-negative int or format string, not %r"%s) | |
|
3516 | ||
|
3517 | fmt = '%%.%if'%i | |
|
3518 | if 'numpy' in sys.modules: | |
|
3519 | import numpy | |
|
3520 | numpy.set_printoptions(precision=i) | |
|
3521 | else: | |
|
3522 | # default back to repr | |
|
3523 | fmt = '%r' | |
|
3524 | if 'numpy' in sys.modules: | |
|
3525 | import numpy | |
|
3526 | # numpy default is 8 | |
|
3527 | numpy.set_printoptions(precision=8) | |
|
3528 | ||
|
3529 | def _pretty_float(obj,p,cycle): | |
|
3530 | p.text(fmt%obj) | |
|
3531 | ||
|
3532 | 3506 | ptformatter = self.shell.display_formatter.formatters['text/plain'] |
|
3533 |
ptformatter.f |
|
|
3507 | ptformatter.float_precision = s | |
|
3508 | return ptformatter.float_format | |
|
3534 | 3509 | |
|
3535 | 3510 | # end Magic |
@@ -1,30 +1,74 | |||
|
1 | 1 | """Tests for the Formatters. |
|
2 | 2 | """ |
|
3 | 3 | |
|
4 | from math import pi | |
|
5 | ||
|
6 | try: | |
|
7 | import numpy | |
|
8 | except: | |
|
9 | numpy = None | |
|
4 | 10 | import nose.tools as nt |
|
5 | 11 | |
|
6 |
from IPython.core.formatters import FormatterABC, |
|
|
12 | from IPython.core.formatters import FormatterABC, PlainTextFormatter | |
|
7 | 13 | |
|
8 | 14 | class A(object): |
|
9 | 15 | def __repr__(self): |
|
10 | 16 | return 'A()' |
|
11 | 17 | |
|
12 | 18 | class B(A): |
|
13 | 19 | def __repr__(self): |
|
14 | 20 | return 'B()' |
|
15 | 21 | |
|
16 | 22 | def foo_printer(obj, pp, cycle): |
|
17 | 23 | pp.text('foo') |
|
18 | 24 | |
|
19 | 25 | def test_pretty(): |
|
20 |
f = |
|
|
26 | f = PlainTextFormatter() | |
|
21 | 27 | f.for_type(A, foo_printer) |
|
22 | 28 | nt.assert_equals(f(A()), 'foo') |
|
23 | 29 | nt.assert_equals(f(B()), 'foo') |
|
24 | 30 | f.pprint = False |
|
25 | 31 | nt.assert_equals(f(A()), 'A()') |
|
26 | 32 | nt.assert_equals(f(B()), 'B()') |
|
27 | 33 | |
|
28 | 34 | def test_deferred(): |
|
29 |
f = |
|
|
35 | f = PlainTextFormatter() | |
|
36 | ||
|
37 | def test_precision(): | |
|
38 | """test various values for float_precision.""" | |
|
39 | f = PlainTextFormatter() | |
|
40 | nt.assert_equals(f(pi), repr(pi)) | |
|
41 | f.float_precision = 0 | |
|
42 | if numpy: | |
|
43 | po = numpy.get_printoptions() | |
|
44 | nt.assert_equals(po['precision'], 0) | |
|
45 | nt.assert_equals(f(pi), '3') | |
|
46 | f.float_precision = 2 | |
|
47 | if numpy: | |
|
48 | po = numpy.get_printoptions() | |
|
49 | nt.assert_equals(po['precision'], 2) | |
|
50 | nt.assert_equals(f(pi), '3.14') | |
|
51 | f.float_precision = '%g' | |
|
52 | if numpy: | |
|
53 | po = numpy.get_printoptions() | |
|
54 | nt.assert_equals(po['precision'], 2) | |
|
55 | nt.assert_equals(f(pi), '3.14159') | |
|
56 | f.float_precision = '%e' | |
|
57 | nt.assert_equals(f(pi), '3.141593e+00') | |
|
58 | f.float_precision = '' | |
|
59 | if numpy: | |
|
60 | po = numpy.get_printoptions() | |
|
61 | nt.assert_equals(po['precision'], 8) | |
|
62 | nt.assert_equals(f(pi), repr(pi)) | |
|
63 | ||
|
64 | def test_bad_precision(): | |
|
65 | """test various invalid values for float_precision.""" | |
|
66 | f = PlainTextFormatter() | |
|
67 | def set_fp(p): | |
|
68 | f.float_precision=p | |
|
69 | nt.assert_raises(ValueError, set_fp, '%') | |
|
70 | nt.assert_raises(ValueError, set_fp, '%.3f%i') | |
|
71 | nt.assert_raises(ValueError, set_fp, 'foo') | |
|
72 | nt.assert_raises(ValueError, set_fp, -1) | |
|
73 | ||
|
30 | 74 |
@@ -1,389 +1,408 | |||
|
1 | 1 | """Tests for various magic functions. |
|
2 | 2 | |
|
3 | 3 | Needs to be run by nose (to make ipython session available). |
|
4 | 4 | """ |
|
5 | 5 | from __future__ import absolute_import |
|
6 | 6 | |
|
7 | 7 | #----------------------------------------------------------------------------- |
|
8 | 8 | # Imports |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 | 10 | |
|
11 | 11 | import os |
|
12 | 12 | import sys |
|
13 | 13 | import tempfile |
|
14 | 14 | import types |
|
15 | 15 | from cStringIO import StringIO |
|
16 | 16 | |
|
17 | 17 | import nose.tools as nt |
|
18 | 18 | |
|
19 | 19 | from IPython.utils.path import get_long_path_name |
|
20 | 20 | from IPython.testing import decorators as dec |
|
21 | 21 | from IPython.testing import tools as tt |
|
22 | 22 | |
|
23 | 23 | #----------------------------------------------------------------------------- |
|
24 | 24 | # Test functions begin |
|
25 | 25 | #----------------------------------------------------------------------------- |
|
26 | 26 | def test_rehashx(): |
|
27 | 27 | # clear up everything |
|
28 | 28 | _ip = get_ipython() |
|
29 | 29 | _ip.alias_manager.alias_table.clear() |
|
30 | 30 | del _ip.db['syscmdlist'] |
|
31 | 31 | |
|
32 | 32 | _ip.magic('rehashx') |
|
33 | 33 | # Practically ALL ipython development systems will have more than 10 aliases |
|
34 | 34 | |
|
35 | 35 | yield (nt.assert_true, len(_ip.alias_manager.alias_table) > 10) |
|
36 | 36 | for key, val in _ip.alias_manager.alias_table.iteritems(): |
|
37 | 37 | # we must strip dots from alias names |
|
38 | 38 | nt.assert_true('.' not in key) |
|
39 | 39 | |
|
40 | 40 | # rehashx must fill up syscmdlist |
|
41 | 41 | scoms = _ip.db['syscmdlist'] |
|
42 | 42 | yield (nt.assert_true, len(scoms) > 10) |
|
43 | 43 | |
|
44 | 44 | |
|
45 | 45 | def test_magic_parse_options(): |
|
46 | 46 | """Test that we don't mangle paths when parsing magic options.""" |
|
47 | 47 | ip = get_ipython() |
|
48 | 48 | path = 'c:\\x' |
|
49 | 49 | opts = ip.parse_options('-f %s' % path,'f:')[0] |
|
50 | 50 | # argv splitting is os-dependent |
|
51 | 51 | if os.name == 'posix': |
|
52 | 52 | expected = 'c:x' |
|
53 | 53 | else: |
|
54 | 54 | expected = path |
|
55 | 55 | nt.assert_equals(opts['f'], expected) |
|
56 | 56 | |
|
57 | 57 | |
|
58 | 58 | def doctest_hist_f(): |
|
59 | 59 | """Test %hist -f with temporary filename. |
|
60 | 60 | |
|
61 | 61 | In [9]: import tempfile |
|
62 | 62 | |
|
63 | 63 | In [10]: tfile = tempfile.mktemp('.py','tmp-ipython-') |
|
64 | 64 | |
|
65 | 65 | In [11]: %hist -n -f $tfile 3 |
|
66 | 66 | |
|
67 | 67 | In [13]: import os; os.unlink(tfile) |
|
68 | 68 | """ |
|
69 | 69 | |
|
70 | 70 | |
|
71 | 71 | def doctest_hist_r(): |
|
72 | 72 | """Test %hist -r |
|
73 | 73 | |
|
74 | 74 | XXX - This test is not recording the output correctly. For some reason, in |
|
75 | 75 | testing mode the raw history isn't getting populated. No idea why. |
|
76 | 76 | Disabling the output checking for now, though at least we do run it. |
|
77 | 77 | |
|
78 | 78 | In [1]: 'hist' in _ip.lsmagic() |
|
79 | 79 | Out[1]: True |
|
80 | 80 | |
|
81 | 81 | In [2]: x=1 |
|
82 | 82 | |
|
83 | 83 | In [3]: %hist -r 2 |
|
84 | 84 | x=1 # random |
|
85 | 85 | %hist -r 2 |
|
86 | 86 | """ |
|
87 | 87 | |
|
88 | 88 | def doctest_hist_op(): |
|
89 | 89 | """Test %hist -op |
|
90 | 90 | |
|
91 | 91 | In [1]: class b: |
|
92 | 92 | ...: pass |
|
93 | 93 | ...: |
|
94 | 94 | |
|
95 | 95 | In [2]: class s(b): |
|
96 | 96 | ...: def __str__(self): |
|
97 | 97 | ...: return 's' |
|
98 | 98 | ...: |
|
99 | 99 | |
|
100 | 100 | In [3]: |
|
101 | 101 | |
|
102 | 102 | In [4]: class r(b): |
|
103 | 103 | ...: def __repr__(self): |
|
104 | 104 | ...: return 'r' |
|
105 | 105 | ...: |
|
106 | 106 | |
|
107 | 107 | In [5]: class sr(s,r): pass |
|
108 | 108 | ...: |
|
109 | 109 | |
|
110 | 110 | In [6]: |
|
111 | 111 | |
|
112 | 112 | In [7]: bb=b() |
|
113 | 113 | |
|
114 | 114 | In [8]: ss=s() |
|
115 | 115 | |
|
116 | 116 | In [9]: rr=r() |
|
117 | 117 | |
|
118 | 118 | In [10]: ssrr=sr() |
|
119 | 119 | |
|
120 | 120 | In [11]: bb |
|
121 | 121 | Out[11]: <...b instance at ...> |
|
122 | 122 | |
|
123 | 123 | In [12]: ss |
|
124 | 124 | Out[12]: <...s instance at ...> |
|
125 | 125 | |
|
126 | 126 | In [13]: |
|
127 | 127 | |
|
128 | 128 | In [14]: %hist -op |
|
129 | 129 | >>> class b: |
|
130 | 130 | ... pass |
|
131 | 131 | ... |
|
132 | 132 | >>> class s(b): |
|
133 | 133 | ... def __str__(self): |
|
134 | 134 | ... return 's' |
|
135 | 135 | ... |
|
136 | 136 | >>> |
|
137 | 137 | >>> class r(b): |
|
138 | 138 | ... def __repr__(self): |
|
139 | 139 | ... return 'r' |
|
140 | 140 | ... |
|
141 | 141 | >>> class sr(s,r): pass |
|
142 | 142 | >>> |
|
143 | 143 | >>> bb=b() |
|
144 | 144 | >>> ss=s() |
|
145 | 145 | >>> rr=r() |
|
146 | 146 | >>> ssrr=sr() |
|
147 | 147 | >>> bb |
|
148 | 148 | <...b instance at ...> |
|
149 | 149 | >>> ss |
|
150 | 150 | <...s instance at ...> |
|
151 | 151 | >>> |
|
152 | 152 | """ |
|
153 | 153 | |
|
154 | 154 | def test_shist(): |
|
155 | 155 | # Simple tests of ShadowHist class - test generator. |
|
156 | 156 | import os, shutil, tempfile |
|
157 | 157 | |
|
158 | 158 | from IPython.utils import pickleshare |
|
159 | 159 | from IPython.core.history import ShadowHist |
|
160 | 160 | |
|
161 | 161 | tfile = tempfile.mktemp('','tmp-ipython-') |
|
162 | 162 | |
|
163 | 163 | db = pickleshare.PickleShareDB(tfile) |
|
164 | 164 | s = ShadowHist(db, get_ipython()) |
|
165 | 165 | s.add('hello') |
|
166 | 166 | s.add('world') |
|
167 | 167 | s.add('hello') |
|
168 | 168 | s.add('hello') |
|
169 | 169 | s.add('karhu') |
|
170 | 170 | |
|
171 | 171 | yield nt.assert_equals,s.all(),[(1, 'hello'), (2, 'world'), (3, 'karhu')] |
|
172 | 172 | |
|
173 | 173 | yield nt.assert_equal,s.get(2),'world' |
|
174 | 174 | |
|
175 | 175 | shutil.rmtree(tfile) |
|
176 | 176 | |
|
177 | 177 | |
|
178 | 178 | # XXX failing for now, until we get clearcmd out of quarantine. But we should |
|
179 | 179 | # fix this and revert the skip to happen only if numpy is not around. |
|
180 | 180 | #@dec.skipif_not_numpy |
|
181 | 181 | @dec.skip_known_failure |
|
182 | 182 | def test_numpy_clear_array_undec(): |
|
183 | 183 | from IPython.extensions import clearcmd |
|
184 | 184 | |
|
185 | 185 | _ip.ex('import numpy as np') |
|
186 | 186 | _ip.ex('a = np.empty(2)') |
|
187 | 187 | yield (nt.assert_true, 'a' in _ip.user_ns) |
|
188 | 188 | _ip.magic('clear array') |
|
189 | 189 | yield (nt.assert_false, 'a' in _ip.user_ns) |
|
190 | 190 | |
|
191 | 191 | |
|
192 | 192 | # Multiple tests for clipboard pasting |
|
193 | 193 | @dec.parametric |
|
194 | 194 | def test_paste(): |
|
195 | 195 | _ip = get_ipython() |
|
196 | 196 | def paste(txt, flags='-q'): |
|
197 | 197 | """Paste input text, by default in quiet mode""" |
|
198 | 198 | hooks.clipboard_get = lambda : txt |
|
199 | 199 | _ip.magic('paste '+flags) |
|
200 | 200 | |
|
201 | 201 | # Inject fake clipboard hook but save original so we can restore it later |
|
202 | 202 | hooks = _ip.hooks |
|
203 | 203 | user_ns = _ip.user_ns |
|
204 | 204 | original_clip = hooks.clipboard_get |
|
205 | 205 | |
|
206 | 206 | try: |
|
207 | 207 | # This try/except with an emtpy except clause is here only because |
|
208 | 208 | # try/yield/finally is invalid syntax in Python 2.4. This will be |
|
209 | 209 | # removed when we drop 2.4-compatibility, and the emtpy except below |
|
210 | 210 | # will be changed to a finally. |
|
211 | 211 | |
|
212 | 212 | # Run tests with fake clipboard function |
|
213 | 213 | user_ns.pop('x', None) |
|
214 | 214 | paste('x=1') |
|
215 | 215 | yield nt.assert_equal(user_ns['x'], 1) |
|
216 | 216 | |
|
217 | 217 | user_ns.pop('x', None) |
|
218 | 218 | paste('>>> x=2') |
|
219 | 219 | yield nt.assert_equal(user_ns['x'], 2) |
|
220 | 220 | |
|
221 | 221 | paste(""" |
|
222 | 222 | >>> x = [1,2,3] |
|
223 | 223 | >>> y = [] |
|
224 | 224 | >>> for i in x: |
|
225 | 225 | ... y.append(i**2) |
|
226 | 226 | ... |
|
227 | 227 | """) |
|
228 | 228 | yield nt.assert_equal(user_ns['x'], [1,2,3]) |
|
229 | 229 | yield nt.assert_equal(user_ns['y'], [1,4,9]) |
|
230 | 230 | |
|
231 | 231 | # Now, test that paste -r works |
|
232 | 232 | user_ns.pop('x', None) |
|
233 | 233 | yield nt.assert_false('x' in user_ns) |
|
234 | 234 | _ip.magic('paste -r') |
|
235 | 235 | yield nt.assert_equal(user_ns['x'], [1,2,3]) |
|
236 | 236 | |
|
237 | 237 | # Also test paste echoing, by temporarily faking the writer |
|
238 | 238 | w = StringIO() |
|
239 | 239 | writer = _ip.write |
|
240 | 240 | _ip.write = w.write |
|
241 | 241 | code = """ |
|
242 | 242 | a = 100 |
|
243 | 243 | b = 200""" |
|
244 | 244 | try: |
|
245 | 245 | paste(code,'') |
|
246 | 246 | out = w.getvalue() |
|
247 | 247 | finally: |
|
248 | 248 | _ip.write = writer |
|
249 | 249 | yield nt.assert_equal(user_ns['a'], 100) |
|
250 | 250 | yield nt.assert_equal(user_ns['b'], 200) |
|
251 | 251 | yield nt.assert_equal(out, code+"\n## -- End pasted text --\n") |
|
252 | 252 | |
|
253 | 253 | finally: |
|
254 | 254 | # This should be in a finally clause, instead of the bare except above. |
|
255 | 255 | # Restore original hook |
|
256 | 256 | hooks.clipboard_get = original_clip |
|
257 | 257 | |
|
258 | 258 | |
|
259 | 259 | def test_time(): |
|
260 | 260 | _ip.magic('time None') |
|
261 | 261 | |
|
262 | 262 | |
|
263 | 263 | def doctest_time(): |
|
264 | 264 | """ |
|
265 | 265 | In [10]: %time None |
|
266 | 266 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
267 | 267 | Wall time: 0.00 s |
|
268 | 268 | """ |
|
269 | 269 | |
|
270 | 270 | |
|
271 | 271 | def test_doctest_mode(): |
|
272 | 272 | "Toggle doctest_mode twice, it should be a no-op and run without error" |
|
273 | 273 | _ip.magic('doctest_mode') |
|
274 | 274 | _ip.magic('doctest_mode') |
|
275 | 275 | |
|
276 | 276 | |
|
277 | 277 | def test_parse_options(): |
|
278 | 278 | """Tests for basic options parsing in magics.""" |
|
279 | 279 | # These are only the most minimal of tests, more should be added later. At |
|
280 | 280 | # the very least we check that basic text/unicode calls work OK. |
|
281 | 281 | nt.assert_equal(_ip.parse_options('foo', '')[1], 'foo') |
|
282 | 282 | nt.assert_equal(_ip.parse_options(u'foo', '')[1], u'foo') |
|
283 | 283 | |
|
284 | 284 | |
|
285 | 285 | def test_dirops(): |
|
286 | 286 | """Test various directory handling operations.""" |
|
287 | 287 | curpath = lambda :os.path.splitdrive(os.getcwd())[1].replace('\\','/') |
|
288 | 288 | |
|
289 | 289 | startdir = os.getcwd() |
|
290 | 290 | ipdir = _ip.ipython_dir |
|
291 | 291 | try: |
|
292 | 292 | _ip.magic('cd "%s"' % ipdir) |
|
293 | 293 | nt.assert_equal(curpath(), ipdir) |
|
294 | 294 | _ip.magic('cd -') |
|
295 | 295 | nt.assert_equal(curpath(), startdir) |
|
296 | 296 | _ip.magic('pushd "%s"' % ipdir) |
|
297 | 297 | nt.assert_equal(curpath(), ipdir) |
|
298 | 298 | _ip.magic('popd') |
|
299 | 299 | nt.assert_equal(curpath(), startdir) |
|
300 | 300 | finally: |
|
301 | 301 | os.chdir(startdir) |
|
302 | 302 | |
|
303 | 303 | |
|
304 | 304 | def check_cpaste(code, should_fail=False): |
|
305 | 305 | """Execute code via 'cpaste' and ensure it was executed, unless |
|
306 | 306 | should_fail is set. |
|
307 | 307 | """ |
|
308 | 308 | _ip.user_ns['code_ran'] = False |
|
309 | 309 | |
|
310 | 310 | src = StringIO() |
|
311 | 311 | src.write('\n') |
|
312 | 312 | src.write(code) |
|
313 | 313 | src.write('\n--\n') |
|
314 | 314 | src.seek(0) |
|
315 | 315 | |
|
316 | 316 | stdin_save = sys.stdin |
|
317 | 317 | sys.stdin = src |
|
318 | 318 | |
|
319 | 319 | try: |
|
320 | 320 | _ip.magic('cpaste') |
|
321 | 321 | except: |
|
322 | 322 | if not should_fail: |
|
323 | 323 | raise AssertionError("Failure not expected : '%s'" % |
|
324 | 324 | code) |
|
325 | 325 | else: |
|
326 | 326 | assert _ip.user_ns['code_ran'] |
|
327 | 327 | if should_fail: |
|
328 | 328 | raise AssertionError("Failure expected : '%s'" % code) |
|
329 | 329 | finally: |
|
330 | 330 | sys.stdin = stdin_save |
|
331 | 331 | |
|
332 | 332 | |
|
333 | 333 | def test_cpaste(): |
|
334 | 334 | """Test cpaste magic""" |
|
335 | 335 | |
|
336 | 336 | def run(): |
|
337 | 337 | """Marker function: sets a flag when executed. |
|
338 | 338 | """ |
|
339 | 339 | _ip.user_ns['code_ran'] = True |
|
340 | 340 | return 'run' # return string so '+ run()' doesn't result in success |
|
341 | 341 | |
|
342 | 342 | tests = {'pass': ["> > > run()", |
|
343 | 343 | ">>> > run()", |
|
344 | 344 | "+++ run()", |
|
345 | 345 | "++ run()", |
|
346 | 346 | " >>> run()"], |
|
347 | 347 | |
|
348 | 348 | 'fail': ["+ + run()", |
|
349 | 349 | " ++ run()"]} |
|
350 | 350 | |
|
351 | 351 | _ip.user_ns['run'] = run |
|
352 | 352 | |
|
353 | 353 | for code in tests['pass']: |
|
354 | 354 | check_cpaste(code) |
|
355 | 355 | |
|
356 | 356 | for code in tests['fail']: |
|
357 | 357 | check_cpaste(code, should_fail=True) |
|
358 | 358 | |
|
359 | 359 | def test_xmode(): |
|
360 | 360 | # Calling xmode three times should be a no-op |
|
361 | 361 | xmode = _ip.InteractiveTB.mode |
|
362 | 362 | for i in range(3): |
|
363 | 363 | _ip.magic("xmode") |
|
364 | 364 | nt.assert_equal(_ip.InteractiveTB.mode, xmode) |
|
365 | 365 | |
|
366 | 366 | def doctest_who(): |
|
367 | 367 | """doctest for %who |
|
368 | 368 | |
|
369 | 369 | In [1]: %reset -f |
|
370 | 370 | |
|
371 | 371 | In [2]: alpha = 123 |
|
372 | 372 | |
|
373 | 373 | In [3]: beta = 'beta' |
|
374 | 374 | |
|
375 | 375 | In [4]: %who int |
|
376 | 376 | alpha |
|
377 | 377 | |
|
378 | 378 | In [5]: %who str |
|
379 | 379 | beta |
|
380 | 380 | |
|
381 | 381 | In [6]: %whos |
|
382 | 382 | Variable Type Data/Info |
|
383 | 383 | ---------------------------- |
|
384 | 384 | alpha int 123 |
|
385 | 385 | beta str beta |
|
386 | 386 | |
|
387 | 387 | In [7]: %who_ls |
|
388 | 388 | Out[7]: ['alpha', 'beta'] |
|
389 | """ No newline at end of file | |
|
389 | """ | |
|
390 | ||
|
391 | def doctest_precision(): | |
|
392 | """doctest for %precision | |
|
393 | ||
|
394 | In [1]: f = get_ipython().shell.display_formatter.formatters['text/plain'] | |
|
395 | ||
|
396 | In [2]: %precision 5 | |
|
397 | Out[2]: '%.5f' | |
|
398 | ||
|
399 | In [3]: f.float_format | |
|
400 | Out[3]: '%.5f' | |
|
401 | ||
|
402 | In [4]: %precision %e | |
|
403 | Out[4]: '%e' | |
|
404 | ||
|
405 | In [5]: f(3.1415927) | |
|
406 | Out[5]: '3.141593e+00' | |
|
407 | """ | |
|
408 |
General Comments 0
You need to be logged in to leave comments.
Login now