Show More
@@ -1,944 +1,941 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Display formatters. |
|
2 | """Display formatters. | |
3 |
|
3 | |||
4 | Inheritance diagram: |
|
4 | Inheritance diagram: | |
5 |
|
5 | |||
6 | .. inheritance-diagram:: IPython.core.formatters |
|
6 | .. inheritance-diagram:: IPython.core.formatters | |
7 | :parts: 3 |
|
7 | :parts: 3 | |
8 | """ |
|
8 | """ | |
9 |
|
9 | |||
10 | # Copyright (c) IPython Development Team. |
|
10 | # Copyright (c) IPython Development Team. | |
11 | # Distributed under the terms of the Modified BSD License. |
|
11 | # Distributed under the terms of the Modified BSD License. | |
12 |
|
12 | |||
13 | import abc |
|
13 | import abc | |
14 | import json |
|
14 | import json | |
15 | import sys |
|
15 | import sys | |
16 | import traceback |
|
16 | import traceback | |
17 | import warnings |
|
17 | import warnings | |
|
18 | from io import StringIO | |||
18 |
|
19 | |||
19 | from decorator import decorator |
|
20 | from decorator import decorator | |
20 |
|
21 | |||
21 | from traitlets.config.configurable import Configurable |
|
22 | from traitlets.config.configurable import Configurable | |
22 | from IPython.core.getipython import get_ipython |
|
23 | from IPython.core.getipython import get_ipython | |
23 | from IPython.utils.sentinel import Sentinel |
|
24 | from IPython.utils.sentinel import Sentinel | |
24 | from IPython.utils.dir2 import get_real_method |
|
25 | from IPython.utils.dir2 import get_real_method | |
25 | from IPython.lib import pretty |
|
26 | from IPython.lib import pretty | |
26 | from traitlets import ( |
|
27 | from traitlets import ( | |
27 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
28 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, | |
28 | ForwardDeclaredInstance, |
|
29 | ForwardDeclaredInstance, | |
29 | default, observe, |
|
30 | default, observe, | |
30 | ) |
|
31 | ) | |
31 |
|
32 | |||
32 |
|
33 | |||
33 | class DisplayFormatter(Configurable): |
|
34 | class DisplayFormatter(Configurable): | |
34 |
|
35 | |||
35 | active_types = List(Unicode(), |
|
36 | active_types = List(Unicode(), | |
36 | help="""List of currently active mime-types to display. |
|
37 | help="""List of currently active mime-types to display. | |
37 | You can use this to set a white-list for formats to display. |
|
38 | You can use this to set a white-list for formats to display. | |
38 |
|
39 | |||
39 | Most users will not need to change this value. |
|
40 | Most users will not need to change this value. | |
40 | """).tag(config=True) |
|
41 | """).tag(config=True) | |
41 |
|
42 | |||
42 | @default('active_types') |
|
43 | @default('active_types') | |
43 | def _active_types_default(self): |
|
44 | def _active_types_default(self): | |
44 | return self.format_types |
|
45 | return self.format_types | |
45 |
|
46 | |||
46 | @observe('active_types') |
|
47 | @observe('active_types') | |
47 | def _active_types_changed(self, change): |
|
48 | def _active_types_changed(self, change): | |
48 | for key, formatter in self.formatters.items(): |
|
49 | for key, formatter in self.formatters.items(): | |
49 | if key in change['new']: |
|
50 | if key in change['new']: | |
50 | formatter.enabled = True |
|
51 | formatter.enabled = True | |
51 | else: |
|
52 | else: | |
52 | formatter.enabled = False |
|
53 | formatter.enabled = False | |
53 |
|
54 | |||
54 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') |
|
55 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') | |
55 | @default('ipython_display_formatter') |
|
56 | @default('ipython_display_formatter') | |
56 | def _default_formatter(self): |
|
57 | def _default_formatter(self): | |
57 | return IPythonDisplayFormatter(parent=self) |
|
58 | return IPythonDisplayFormatter(parent=self) | |
58 |
|
59 | |||
59 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
60 | # A dict of formatter whose keys are format types (MIME types) and whose | |
60 | # values are subclasses of BaseFormatter. |
|
61 | # values are subclasses of BaseFormatter. | |
61 | formatters = Dict() |
|
62 | formatters = Dict() | |
62 | @default('formatters') |
|
63 | @default('formatters') | |
63 | def _formatters_default(self): |
|
64 | def _formatters_default(self): | |
64 | """Activate the default formatters.""" |
|
65 | """Activate the default formatters.""" | |
65 | formatter_classes = [ |
|
66 | formatter_classes = [ | |
66 | PlainTextFormatter, |
|
67 | PlainTextFormatter, | |
67 | HTMLFormatter, |
|
68 | HTMLFormatter, | |
68 | MarkdownFormatter, |
|
69 | MarkdownFormatter, | |
69 | SVGFormatter, |
|
70 | SVGFormatter, | |
70 | PNGFormatter, |
|
71 | PNGFormatter, | |
71 | PDFFormatter, |
|
72 | PDFFormatter, | |
72 | JPEGFormatter, |
|
73 | JPEGFormatter, | |
73 | LatexFormatter, |
|
74 | LatexFormatter, | |
74 | JSONFormatter, |
|
75 | JSONFormatter, | |
75 | JavascriptFormatter |
|
76 | JavascriptFormatter | |
76 | ] |
|
77 | ] | |
77 | d = {} |
|
78 | d = {} | |
78 | for cls in formatter_classes: |
|
79 | for cls in formatter_classes: | |
79 | f = cls(parent=self) |
|
80 | f = cls(parent=self) | |
80 | d[f.format_type] = f |
|
81 | d[f.format_type] = f | |
81 | return d |
|
82 | return d | |
82 |
|
83 | |||
83 | def format(self, obj, include=None, exclude=None): |
|
84 | def format(self, obj, include=None, exclude=None): | |
84 | """Return a format data dict for an object. |
|
85 | """Return a format data dict for an object. | |
85 |
|
86 | |||
86 | By default all format types will be computed. |
|
87 | By default all format types will be computed. | |
87 |
|
88 | |||
88 | The following MIME types are currently implemented: |
|
89 | The following MIME types are currently implemented: | |
89 |
|
90 | |||
90 | * text/plain |
|
91 | * text/plain | |
91 | * text/html |
|
92 | * text/html | |
92 | * text/markdown |
|
93 | * text/markdown | |
93 | * text/latex |
|
94 | * text/latex | |
94 | * application/json |
|
95 | * application/json | |
95 | * application/javascript |
|
96 | * application/javascript | |
96 | * application/pdf |
|
97 | * application/pdf | |
97 | * image/png |
|
98 | * image/png | |
98 | * image/jpeg |
|
99 | * image/jpeg | |
99 | * image/svg+xml |
|
100 | * image/svg+xml | |
100 |
|
101 | |||
101 | Parameters |
|
102 | Parameters | |
102 | ---------- |
|
103 | ---------- | |
103 | obj : object |
|
104 | obj : object | |
104 | The Python object whose format data will be computed. |
|
105 | The Python object whose format data will be computed. | |
105 | include : list or tuple, optional |
|
106 | include : list or tuple, optional | |
106 | A list of format type strings (MIME types) to include in the |
|
107 | A list of format type strings (MIME types) to include in the | |
107 | format data dict. If this is set *only* the format types included |
|
108 | format data dict. If this is set *only* the format types included | |
108 | in this list will be computed. |
|
109 | in this list will be computed. | |
109 | exclude : list or tuple, optional |
|
110 | exclude : list or tuple, optional | |
110 | A list of format type string (MIME types) to exclude in the format |
|
111 | A list of format type string (MIME types) to exclude in the format | |
111 | data dict. If this is set all format types will be computed, |
|
112 | data dict. If this is set all format types will be computed, | |
112 | except for those included in this argument. |
|
113 | except for those included in this argument. | |
113 |
|
114 | |||
114 | Returns |
|
115 | Returns | |
115 | ------- |
|
116 | ------- | |
116 | (format_dict, metadata_dict) : tuple of two dicts |
|
117 | (format_dict, metadata_dict) : tuple of two dicts | |
117 |
|
118 | |||
118 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
119 | format_dict is a dictionary of key/value pairs, one of each format that was | |
119 | generated for the object. The keys are the format types, which |
|
120 | generated for the object. The keys are the format types, which | |
120 | will usually be MIME type strings and the values and JSON'able |
|
121 | will usually be MIME type strings and the values and JSON'able | |
121 | data structure containing the raw data for the representation in |
|
122 | data structure containing the raw data for the representation in | |
122 | that format. |
|
123 | that format. | |
123 |
|
124 | |||
124 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
125 | metadata_dict is a dictionary of metadata about each mime-type output. | |
125 | Its keys will be a strict subset of the keys in format_dict. |
|
126 | Its keys will be a strict subset of the keys in format_dict. | |
126 | """ |
|
127 | """ | |
127 | format_dict = {} |
|
128 | format_dict = {} | |
128 | md_dict = {} |
|
129 | md_dict = {} | |
129 |
|
130 | |||
130 | if self.ipython_display_formatter(obj): |
|
131 | if self.ipython_display_formatter(obj): | |
131 | # object handled itself, don't proceed |
|
132 | # object handled itself, don't proceed | |
132 | return {}, {} |
|
133 | return {}, {} | |
133 |
|
134 | |||
134 | for format_type, formatter in self.formatters.items(): |
|
135 | for format_type, formatter in self.formatters.items(): | |
135 | if include and format_type not in include: |
|
136 | if include and format_type not in include: | |
136 | continue |
|
137 | continue | |
137 | if exclude and format_type in exclude: |
|
138 | if exclude and format_type in exclude: | |
138 | continue |
|
139 | continue | |
139 |
|
140 | |||
140 | md = None |
|
141 | md = None | |
141 | try: |
|
142 | try: | |
142 | data = formatter(obj) |
|
143 | data = formatter(obj) | |
143 | except: |
|
144 | except: | |
144 | # FIXME: log the exception |
|
145 | # FIXME: log the exception | |
145 | raise |
|
146 | raise | |
146 |
|
147 | |||
147 | # formatters can return raw data or (data, metadata) |
|
148 | # formatters can return raw data or (data, metadata) | |
148 | if isinstance(data, tuple) and len(data) == 2: |
|
149 | if isinstance(data, tuple) and len(data) == 2: | |
149 | data, md = data |
|
150 | data, md = data | |
150 |
|
151 | |||
151 | if data is not None: |
|
152 | if data is not None: | |
152 | format_dict[format_type] = data |
|
153 | format_dict[format_type] = data | |
153 | if md is not None: |
|
154 | if md is not None: | |
154 | md_dict[format_type] = md |
|
155 | md_dict[format_type] = md | |
155 |
|
156 | |||
156 | return format_dict, md_dict |
|
157 | return format_dict, md_dict | |
157 |
|
158 | |||
158 | @property |
|
159 | @property | |
159 | def format_types(self): |
|
160 | def format_types(self): | |
160 | """Return the format types (MIME types) of the active formatters.""" |
|
161 | """Return the format types (MIME types) of the active formatters.""" | |
161 | return list(self.formatters.keys()) |
|
162 | return list(self.formatters.keys()) | |
162 |
|
163 | |||
163 |
|
164 | |||
164 | #----------------------------------------------------------------------------- |
|
165 | #----------------------------------------------------------------------------- | |
165 | # Formatters for specific format types (text, html, svg, etc.) |
|
166 | # Formatters for specific format types (text, html, svg, etc.) | |
166 | #----------------------------------------------------------------------------- |
|
167 | #----------------------------------------------------------------------------- | |
167 |
|
168 | |||
168 |
|
169 | |||
169 | def _safe_repr(obj): |
|
170 | def _safe_repr(obj): | |
170 | """Try to return a repr of an object |
|
171 | """Try to return a repr of an object | |
171 |
|
172 | |||
172 | always returns a string, at least. |
|
173 | always returns a string, at least. | |
173 | """ |
|
174 | """ | |
174 | try: |
|
175 | try: | |
175 | return repr(obj) |
|
176 | return repr(obj) | |
176 | except Exception as e: |
|
177 | except Exception as e: | |
177 | return "un-repr-able object (%r)" % e |
|
178 | return "un-repr-able object (%r)" % e | |
178 |
|
179 | |||
179 |
|
180 | |||
180 | class FormatterWarning(UserWarning): |
|
181 | class FormatterWarning(UserWarning): | |
181 | """Warning class for errors in formatters""" |
|
182 | """Warning class for errors in formatters""" | |
182 |
|
183 | |||
183 | @decorator |
|
184 | @decorator | |
184 | def catch_format_error(method, self, *args, **kwargs): |
|
185 | def catch_format_error(method, self, *args, **kwargs): | |
185 | """show traceback on failed format call""" |
|
186 | """show traceback on failed format call""" | |
186 | try: |
|
187 | try: | |
187 | r = method(self, *args, **kwargs) |
|
188 | r = method(self, *args, **kwargs) | |
188 | except NotImplementedError: |
|
189 | except NotImplementedError: | |
189 | # don't warn on NotImplementedErrors |
|
190 | # don't warn on NotImplementedErrors | |
190 | return None |
|
191 | return None | |
191 | except Exception: |
|
192 | except Exception: | |
192 | exc_info = sys.exc_info() |
|
193 | exc_info = sys.exc_info() | |
193 | ip = get_ipython() |
|
194 | ip = get_ipython() | |
194 | if ip is not None: |
|
195 | if ip is not None: | |
195 | ip.showtraceback(exc_info) |
|
196 | ip.showtraceback(exc_info) | |
196 | else: |
|
197 | else: | |
197 | traceback.print_exception(*exc_info) |
|
198 | traceback.print_exception(*exc_info) | |
198 | return None |
|
199 | return None | |
199 | return self._check_return(r, args[0]) |
|
200 | return self._check_return(r, args[0]) | |
200 |
|
201 | |||
201 |
|
202 | |||
202 | class FormatterABC(metaclass=abc.ABCMeta): |
|
203 | class FormatterABC(metaclass=abc.ABCMeta): | |
203 | """ Abstract base class for Formatters. |
|
204 | """ Abstract base class for Formatters. | |
204 |
|
205 | |||
205 | A formatter is a callable class that is responsible for computing the |
|
206 | A formatter is a callable class that is responsible for computing the | |
206 | raw format data for a particular format type (MIME type). For example, |
|
207 | raw format data for a particular format type (MIME type). For example, | |
207 | an HTML formatter would have a format type of `text/html` and would return |
|
208 | an HTML formatter would have a format type of `text/html` and would return | |
208 | the HTML representation of the object when called. |
|
209 | the HTML representation of the object when called. | |
209 | """ |
|
210 | """ | |
210 |
|
211 | |||
211 | # The format type of the data returned, usually a MIME type. |
|
212 | # The format type of the data returned, usually a MIME type. | |
212 | format_type = 'text/plain' |
|
213 | format_type = 'text/plain' | |
213 |
|
214 | |||
214 | # Is the formatter enabled... |
|
215 | # Is the formatter enabled... | |
215 | enabled = True |
|
216 | enabled = True | |
216 |
|
217 | |||
217 | @abc.abstractmethod |
|
218 | @abc.abstractmethod | |
218 | def __call__(self, obj): |
|
219 | def __call__(self, obj): | |
219 | """Return a JSON'able representation of the object. |
|
220 | """Return a JSON'able representation of the object. | |
220 |
|
221 | |||
221 | If the object cannot be formatted by this formatter, |
|
222 | If the object cannot be formatted by this formatter, | |
222 | warn and return None. |
|
223 | warn and return None. | |
223 | """ |
|
224 | """ | |
224 | return repr(obj) |
|
225 | return repr(obj) | |
225 |
|
226 | |||
226 |
|
227 | |||
227 | def _mod_name_key(typ): |
|
228 | def _mod_name_key(typ): | |
228 | """Return a (__module__, __name__) tuple for a type. |
|
229 | """Return a (__module__, __name__) tuple for a type. | |
229 |
|
230 | |||
230 | Used as key in Formatter.deferred_printers. |
|
231 | Used as key in Formatter.deferred_printers. | |
231 | """ |
|
232 | """ | |
232 | module = getattr(typ, '__module__', None) |
|
233 | module = getattr(typ, '__module__', None) | |
233 | name = getattr(typ, '__name__', None) |
|
234 | name = getattr(typ, '__name__', None) | |
234 | return (module, name) |
|
235 | return (module, name) | |
235 |
|
236 | |||
236 |
|
237 | |||
237 | def _get_type(obj): |
|
238 | def _get_type(obj): | |
238 | """Return the type of an instance (old and new-style)""" |
|
239 | """Return the type of an instance (old and new-style)""" | |
239 | return getattr(obj, '__class__', None) or type(obj) |
|
240 | return getattr(obj, '__class__', None) or type(obj) | |
240 |
|
241 | |||
241 |
|
242 | |||
242 | _raise_key_error = Sentinel('_raise_key_error', __name__, |
|
243 | _raise_key_error = Sentinel('_raise_key_error', __name__, | |
243 | """ |
|
244 | """ | |
244 | Special value to raise a KeyError |
|
245 | Special value to raise a KeyError | |
245 |
|
246 | |||
246 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` |
|
247 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` | |
247 | """) |
|
248 | """) | |
248 |
|
249 | |||
249 |
|
250 | |||
250 | class BaseFormatter(Configurable): |
|
251 | class BaseFormatter(Configurable): | |
251 | """A base formatter class that is configurable. |
|
252 | """A base formatter class that is configurable. | |
252 |
|
253 | |||
253 | This formatter should usually be used as the base class of all formatters. |
|
254 | This formatter should usually be used as the base class of all formatters. | |
254 | It is a traited :class:`Configurable` class and includes an extensible |
|
255 | It is a traited :class:`Configurable` class and includes an extensible | |
255 | API for users to determine how their objects are formatted. The following |
|
256 | API for users to determine how their objects are formatted. The following | |
256 | logic is used to find a function to format an given object. |
|
257 | logic is used to find a function to format an given object. | |
257 |
|
258 | |||
258 | 1. The object is introspected to see if it has a method with the name |
|
259 | 1. The object is introspected to see if it has a method with the name | |
259 | :attr:`print_method`. If is does, that object is passed to that method |
|
260 | :attr:`print_method`. If is does, that object is passed to that method | |
260 | for formatting. |
|
261 | for formatting. | |
261 | 2. If no print method is found, three internal dictionaries are consulted |
|
262 | 2. If no print method is found, three internal dictionaries are consulted | |
262 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
263 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` | |
263 | and :attr:`deferred_printers`. |
|
264 | and :attr:`deferred_printers`. | |
264 |
|
265 | |||
265 | Users should use these dictionaries to register functions that will be |
|
266 | Users should use these dictionaries to register functions that will be | |
266 | used to compute the format data for their objects (if those objects don't |
|
267 | used to compute the format data for their objects (if those objects don't | |
267 | have the special print methods). The easiest way of using these |
|
268 | have the special print methods). The easiest way of using these | |
268 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
269 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` | |
269 | methods. |
|
270 | methods. | |
270 |
|
271 | |||
271 | If no function/callable is found to compute the format data, ``None`` is |
|
272 | If no function/callable is found to compute the format data, ``None`` is | |
272 | returned and this format type is not used. |
|
273 | returned and this format type is not used. | |
273 | """ |
|
274 | """ | |
274 |
|
275 | |||
275 | format_type = Unicode('text/plain') |
|
276 | format_type = Unicode('text/plain') | |
276 | _return_type = str |
|
277 | _return_type = str | |
277 |
|
278 | |||
278 | enabled = Bool(True).tag(config=True) |
|
279 | enabled = Bool(True).tag(config=True) | |
279 |
|
280 | |||
280 | print_method = ObjectName('__repr__') |
|
281 | print_method = ObjectName('__repr__') | |
281 |
|
282 | |||
282 | # The singleton printers. |
|
283 | # The singleton printers. | |
283 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
284 | # Maps the IDs of the builtin singleton objects to the format functions. | |
284 | singleton_printers = Dict().tag(config=True) |
|
285 | singleton_printers = Dict().tag(config=True) | |
285 |
|
286 | |||
286 | # The type-specific printers. |
|
287 | # The type-specific printers. | |
287 | # Map type objects to the format functions. |
|
288 | # Map type objects to the format functions. | |
288 | type_printers = Dict().tag(config=True) |
|
289 | type_printers = Dict().tag(config=True) | |
289 |
|
290 | |||
290 | # The deferred-import type-specific printers. |
|
291 | # The deferred-import type-specific printers. | |
291 | # Map (modulename, classname) pairs to the format functions. |
|
292 | # Map (modulename, classname) pairs to the format functions. | |
292 | deferred_printers = Dict().tag(config=True) |
|
293 | deferred_printers = Dict().tag(config=True) | |
293 |
|
294 | |||
294 | @catch_format_error |
|
295 | @catch_format_error | |
295 | def __call__(self, obj): |
|
296 | def __call__(self, obj): | |
296 | """Compute the format for an object.""" |
|
297 | """Compute the format for an object.""" | |
297 | if self.enabled: |
|
298 | if self.enabled: | |
298 | # lookup registered printer |
|
299 | # lookup registered printer | |
299 | try: |
|
300 | try: | |
300 | printer = self.lookup(obj) |
|
301 | printer = self.lookup(obj) | |
301 | except KeyError: |
|
302 | except KeyError: | |
302 | pass |
|
303 | pass | |
303 | else: |
|
304 | else: | |
304 | return printer(obj) |
|
305 | return printer(obj) | |
305 | # Finally look for special method names |
|
306 | # Finally look for special method names | |
306 | method = get_real_method(obj, self.print_method) |
|
307 | method = get_real_method(obj, self.print_method) | |
307 | if method is not None: |
|
308 | if method is not None: | |
308 | return method() |
|
309 | return method() | |
309 | return None |
|
310 | return None | |
310 | else: |
|
311 | else: | |
311 | return None |
|
312 | return None | |
312 |
|
313 | |||
313 | def __contains__(self, typ): |
|
314 | def __contains__(self, typ): | |
314 | """map in to lookup_by_type""" |
|
315 | """map in to lookup_by_type""" | |
315 | try: |
|
316 | try: | |
316 | self.lookup_by_type(typ) |
|
317 | self.lookup_by_type(typ) | |
317 | except KeyError: |
|
318 | except KeyError: | |
318 | return False |
|
319 | return False | |
319 | else: |
|
320 | else: | |
320 | return True |
|
321 | return True | |
321 |
|
322 | |||
322 | def _check_return(self, r, obj): |
|
323 | def _check_return(self, r, obj): | |
323 | """Check that a return value is appropriate |
|
324 | """Check that a return value is appropriate | |
324 |
|
325 | |||
325 | Return the value if so, None otherwise, warning if invalid. |
|
326 | Return the value if so, None otherwise, warning if invalid. | |
326 | """ |
|
327 | """ | |
327 | if r is None or isinstance(r, self._return_type) or \ |
|
328 | if r is None or isinstance(r, self._return_type) or \ | |
328 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
329 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): | |
329 | return r |
|
330 | return r | |
330 | else: |
|
331 | else: | |
331 | warnings.warn( |
|
332 | warnings.warn( | |
332 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
333 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ | |
333 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), |
|
334 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), | |
334 | FormatterWarning |
|
335 | FormatterWarning | |
335 | ) |
|
336 | ) | |
336 |
|
337 | |||
337 | def lookup(self, obj): |
|
338 | def lookup(self, obj): | |
338 | """Look up the formatter for a given instance. |
|
339 | """Look up the formatter for a given instance. | |
339 |
|
340 | |||
340 | Parameters |
|
341 | Parameters | |
341 | ---------- |
|
342 | ---------- | |
342 | obj : object instance |
|
343 | obj : object instance | |
343 |
|
344 | |||
344 | Returns |
|
345 | Returns | |
345 | ------- |
|
346 | ------- | |
346 | f : callable |
|
347 | f : callable | |
347 | The registered formatting callable for the type. |
|
348 | The registered formatting callable for the type. | |
348 |
|
349 | |||
349 | Raises |
|
350 | Raises | |
350 | ------ |
|
351 | ------ | |
351 | KeyError if the type has not been registered. |
|
352 | KeyError if the type has not been registered. | |
352 | """ |
|
353 | """ | |
353 | # look for singleton first |
|
354 | # look for singleton first | |
354 | obj_id = id(obj) |
|
355 | obj_id = id(obj) | |
355 | if obj_id in self.singleton_printers: |
|
356 | if obj_id in self.singleton_printers: | |
356 | return self.singleton_printers[obj_id] |
|
357 | return self.singleton_printers[obj_id] | |
357 | # then lookup by type |
|
358 | # then lookup by type | |
358 | return self.lookup_by_type(_get_type(obj)) |
|
359 | return self.lookup_by_type(_get_type(obj)) | |
359 |
|
360 | |||
360 | def lookup_by_type(self, typ): |
|
361 | def lookup_by_type(self, typ): | |
361 | """Look up the registered formatter for a type. |
|
362 | """Look up the registered formatter for a type. | |
362 |
|
363 | |||
363 | Parameters |
|
364 | Parameters | |
364 | ---------- |
|
365 | ---------- | |
365 | typ : type or '__module__.__name__' string for a type |
|
366 | typ : type or '__module__.__name__' string for a type | |
366 |
|
367 | |||
367 | Returns |
|
368 | Returns | |
368 | ------- |
|
369 | ------- | |
369 | f : callable |
|
370 | f : callable | |
370 | The registered formatting callable for the type. |
|
371 | The registered formatting callable for the type. | |
371 |
|
372 | |||
372 | Raises |
|
373 | Raises | |
373 | ------ |
|
374 | ------ | |
374 | KeyError if the type has not been registered. |
|
375 | KeyError if the type has not been registered. | |
375 | """ |
|
376 | """ | |
376 | if isinstance(typ, str): |
|
377 | if isinstance(typ, str): | |
377 | typ_key = tuple(typ.rsplit('.',1)) |
|
378 | typ_key = tuple(typ.rsplit('.',1)) | |
378 | if typ_key not in self.deferred_printers: |
|
379 | if typ_key not in self.deferred_printers: | |
379 | # We may have it cached in the type map. We will have to |
|
380 | # We may have it cached in the type map. We will have to | |
380 | # iterate over all of the types to check. |
|
381 | # iterate over all of the types to check. | |
381 | for cls in self.type_printers: |
|
382 | for cls in self.type_printers: | |
382 | if _mod_name_key(cls) == typ_key: |
|
383 | if _mod_name_key(cls) == typ_key: | |
383 | return self.type_printers[cls] |
|
384 | return self.type_printers[cls] | |
384 | else: |
|
385 | else: | |
385 | return self.deferred_printers[typ_key] |
|
386 | return self.deferred_printers[typ_key] | |
386 | else: |
|
387 | else: | |
387 | for cls in pretty._get_mro(typ): |
|
388 | for cls in pretty._get_mro(typ): | |
388 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
389 | if cls in self.type_printers or self._in_deferred_types(cls): | |
389 | return self.type_printers[cls] |
|
390 | return self.type_printers[cls] | |
390 |
|
391 | |||
391 | # If we have reached here, the lookup failed. |
|
392 | # If we have reached here, the lookup failed. | |
392 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
393 | raise KeyError("No registered printer for {0!r}".format(typ)) | |
393 |
|
394 | |||
394 | def for_type(self, typ, func=None): |
|
395 | def for_type(self, typ, func=None): | |
395 | """Add a format function for a given type. |
|
396 | """Add a format function for a given type. | |
396 |
|
397 | |||
397 | Parameters |
|
398 | Parameters | |
398 | ----------- |
|
399 | ----------- | |
399 | typ : type or '__module__.__name__' string for a type |
|
400 | typ : type or '__module__.__name__' string for a type | |
400 | The class of the object that will be formatted using `func`. |
|
401 | The class of the object that will be formatted using `func`. | |
401 | func : callable |
|
402 | func : callable | |
402 | A callable for computing the format data. |
|
403 | A callable for computing the format data. | |
403 | `func` will be called with the object to be formatted, |
|
404 | `func` will be called with the object to be formatted, | |
404 | and will return the raw data in this formatter's format. |
|
405 | and will return the raw data in this formatter's format. | |
405 | Subclasses may use a different call signature for the |
|
406 | Subclasses may use a different call signature for the | |
406 | `func` argument. |
|
407 | `func` argument. | |
407 |
|
408 | |||
408 | If `func` is None or not specified, there will be no change, |
|
409 | If `func` is None or not specified, there will be no change, | |
409 | only returning the current value. |
|
410 | only returning the current value. | |
410 |
|
411 | |||
411 | Returns |
|
412 | Returns | |
412 | ------- |
|
413 | ------- | |
413 | oldfunc : callable |
|
414 | oldfunc : callable | |
414 | The currently registered callable. |
|
415 | The currently registered callable. | |
415 | If you are registering a new formatter, |
|
416 | If you are registering a new formatter, | |
416 | this will be the previous value (to enable restoring later). |
|
417 | this will be the previous value (to enable restoring later). | |
417 | """ |
|
418 | """ | |
418 | # if string given, interpret as 'pkg.module.class_name' |
|
419 | # if string given, interpret as 'pkg.module.class_name' | |
419 | if isinstance(typ, str): |
|
420 | if isinstance(typ, str): | |
420 | type_module, type_name = typ.rsplit('.', 1) |
|
421 | type_module, type_name = typ.rsplit('.', 1) | |
421 | return self.for_type_by_name(type_module, type_name, func) |
|
422 | return self.for_type_by_name(type_module, type_name, func) | |
422 |
|
423 | |||
423 | try: |
|
424 | try: | |
424 | oldfunc = self.lookup_by_type(typ) |
|
425 | oldfunc = self.lookup_by_type(typ) | |
425 | except KeyError: |
|
426 | except KeyError: | |
426 | oldfunc = None |
|
427 | oldfunc = None | |
427 |
|
428 | |||
428 | if func is not None: |
|
429 | if func is not None: | |
429 | self.type_printers[typ] = func |
|
430 | self.type_printers[typ] = func | |
430 |
|
431 | |||
431 | return oldfunc |
|
432 | return oldfunc | |
432 |
|
433 | |||
433 | def for_type_by_name(self, type_module, type_name, func=None): |
|
434 | def for_type_by_name(self, type_module, type_name, func=None): | |
434 | """Add a format function for a type specified by the full dotted |
|
435 | """Add a format function for a type specified by the full dotted | |
435 | module and name of the type, rather than the type of the object. |
|
436 | module and name of the type, rather than the type of the object. | |
436 |
|
437 | |||
437 | Parameters |
|
438 | Parameters | |
438 | ---------- |
|
439 | ---------- | |
439 | type_module : str |
|
440 | type_module : str | |
440 | The full dotted name of the module the type is defined in, like |
|
441 | The full dotted name of the module the type is defined in, like | |
441 | ``numpy``. |
|
442 | ``numpy``. | |
442 | type_name : str |
|
443 | type_name : str | |
443 | The name of the type (the class name), like ``dtype`` |
|
444 | The name of the type (the class name), like ``dtype`` | |
444 | func : callable |
|
445 | func : callable | |
445 | A callable for computing the format data. |
|
446 | A callable for computing the format data. | |
446 | `func` will be called with the object to be formatted, |
|
447 | `func` will be called with the object to be formatted, | |
447 | and will return the raw data in this formatter's format. |
|
448 | and will return the raw data in this formatter's format. | |
448 | Subclasses may use a different call signature for the |
|
449 | Subclasses may use a different call signature for the | |
449 | `func` argument. |
|
450 | `func` argument. | |
450 |
|
451 | |||
451 | If `func` is None or unspecified, there will be no change, |
|
452 | If `func` is None or unspecified, there will be no change, | |
452 | only returning the current value. |
|
453 | only returning the current value. | |
453 |
|
454 | |||
454 | Returns |
|
455 | Returns | |
455 | ------- |
|
456 | ------- | |
456 | oldfunc : callable |
|
457 | oldfunc : callable | |
457 | The currently registered callable. |
|
458 | The currently registered callable. | |
458 | If you are registering a new formatter, |
|
459 | If you are registering a new formatter, | |
459 | this will be the previous value (to enable restoring later). |
|
460 | this will be the previous value (to enable restoring later). | |
460 | """ |
|
461 | """ | |
461 | key = (type_module, type_name) |
|
462 | key = (type_module, type_name) | |
462 |
|
463 | |||
463 | try: |
|
464 | try: | |
464 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
465 | oldfunc = self.lookup_by_type("%s.%s" % key) | |
465 | except KeyError: |
|
466 | except KeyError: | |
466 | oldfunc = None |
|
467 | oldfunc = None | |
467 |
|
468 | |||
468 | if func is not None: |
|
469 | if func is not None: | |
469 | self.deferred_printers[key] = func |
|
470 | self.deferred_printers[key] = func | |
470 | return oldfunc |
|
471 | return oldfunc | |
471 |
|
472 | |||
472 | def pop(self, typ, default=_raise_key_error): |
|
473 | def pop(self, typ, default=_raise_key_error): | |
473 | """Pop a formatter for the given type. |
|
474 | """Pop a formatter for the given type. | |
474 |
|
475 | |||
475 | Parameters |
|
476 | Parameters | |
476 | ---------- |
|
477 | ---------- | |
477 | typ : type or '__module__.__name__' string for a type |
|
478 | typ : type or '__module__.__name__' string for a type | |
478 | default : object |
|
479 | default : object | |
479 | value to be returned if no formatter is registered for typ. |
|
480 | value to be returned if no formatter is registered for typ. | |
480 |
|
481 | |||
481 | Returns |
|
482 | Returns | |
482 | ------- |
|
483 | ------- | |
483 | obj : object |
|
484 | obj : object | |
484 | The last registered object for the type. |
|
485 | The last registered object for the type. | |
485 |
|
486 | |||
486 | Raises |
|
487 | Raises | |
487 | ------ |
|
488 | ------ | |
488 | KeyError if the type is not registered and default is not specified. |
|
489 | KeyError if the type is not registered and default is not specified. | |
489 | """ |
|
490 | """ | |
490 |
|
491 | |||
491 | if isinstance(typ, str): |
|
492 | if isinstance(typ, str): | |
492 | typ_key = tuple(typ.rsplit('.',1)) |
|
493 | typ_key = tuple(typ.rsplit('.',1)) | |
493 | if typ_key not in self.deferred_printers: |
|
494 | if typ_key not in self.deferred_printers: | |
494 | # We may have it cached in the type map. We will have to |
|
495 | # We may have it cached in the type map. We will have to | |
495 | # iterate over all of the types to check. |
|
496 | # iterate over all of the types to check. | |
496 | for cls in self.type_printers: |
|
497 | for cls in self.type_printers: | |
497 | if _mod_name_key(cls) == typ_key: |
|
498 | if _mod_name_key(cls) == typ_key: | |
498 | old = self.type_printers.pop(cls) |
|
499 | old = self.type_printers.pop(cls) | |
499 | break |
|
500 | break | |
500 | else: |
|
501 | else: | |
501 | old = default |
|
502 | old = default | |
502 | else: |
|
503 | else: | |
503 | old = self.deferred_printers.pop(typ_key) |
|
504 | old = self.deferred_printers.pop(typ_key) | |
504 | else: |
|
505 | else: | |
505 | if typ in self.type_printers: |
|
506 | if typ in self.type_printers: | |
506 | old = self.type_printers.pop(typ) |
|
507 | old = self.type_printers.pop(typ) | |
507 | else: |
|
508 | else: | |
508 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
509 | old = self.deferred_printers.pop(_mod_name_key(typ), default) | |
509 | if old is _raise_key_error: |
|
510 | if old is _raise_key_error: | |
510 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
511 | raise KeyError("No registered value for {0!r}".format(typ)) | |
511 | return old |
|
512 | return old | |
512 |
|
513 | |||
513 | def _in_deferred_types(self, cls): |
|
514 | def _in_deferred_types(self, cls): | |
514 | """ |
|
515 | """ | |
515 | Check if the given class is specified in the deferred type registry. |
|
516 | Check if the given class is specified in the deferred type registry. | |
516 |
|
517 | |||
517 | Successful matches will be moved to the regular type registry for future use. |
|
518 | Successful matches will be moved to the regular type registry for future use. | |
518 | """ |
|
519 | """ | |
519 | mod = getattr(cls, '__module__', None) |
|
520 | mod = getattr(cls, '__module__', None) | |
520 | name = getattr(cls, '__name__', None) |
|
521 | name = getattr(cls, '__name__', None) | |
521 | key = (mod, name) |
|
522 | key = (mod, name) | |
522 | if key in self.deferred_printers: |
|
523 | if key in self.deferred_printers: | |
523 | # Move the printer over to the regular registry. |
|
524 | # Move the printer over to the regular registry. | |
524 | printer = self.deferred_printers.pop(key) |
|
525 | printer = self.deferred_printers.pop(key) | |
525 | self.type_printers[cls] = printer |
|
526 | self.type_printers[cls] = printer | |
526 | return True |
|
527 | return True | |
527 | return False |
|
528 | return False | |
528 |
|
529 | |||
529 |
|
530 | |||
530 | class PlainTextFormatter(BaseFormatter): |
|
531 | class PlainTextFormatter(BaseFormatter): | |
531 | """The default pretty-printer. |
|
532 | """The default pretty-printer. | |
532 |
|
533 | |||
533 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
534 | This uses :mod:`IPython.lib.pretty` to compute the format data of | |
534 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
535 | the object. If the object cannot be pretty printed, :func:`repr` is used. | |
535 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
536 | See the documentation of :mod:`IPython.lib.pretty` for details on | |
536 | how to write pretty printers. Here is a simple example:: |
|
537 | how to write pretty printers. Here is a simple example:: | |
537 |
|
538 | |||
538 | def dtype_pprinter(obj, p, cycle): |
|
539 | def dtype_pprinter(obj, p, cycle): | |
539 | if cycle: |
|
540 | if cycle: | |
540 | return p.text('dtype(...)') |
|
541 | return p.text('dtype(...)') | |
541 | if hasattr(obj, 'fields'): |
|
542 | if hasattr(obj, 'fields'): | |
542 | if obj.fields is None: |
|
543 | if obj.fields is None: | |
543 | p.text(repr(obj)) |
|
544 | p.text(repr(obj)) | |
544 | else: |
|
545 | else: | |
545 | p.begin_group(7, 'dtype([') |
|
546 | p.begin_group(7, 'dtype([') | |
546 | for i, field in enumerate(obj.descr): |
|
547 | for i, field in enumerate(obj.descr): | |
547 | if i > 0: |
|
548 | if i > 0: | |
548 | p.text(',') |
|
549 | p.text(',') | |
549 | p.breakable() |
|
550 | p.breakable() | |
550 | p.pretty(field) |
|
551 | p.pretty(field) | |
551 | p.end_group(7, '])') |
|
552 | p.end_group(7, '])') | |
552 | """ |
|
553 | """ | |
553 |
|
554 | |||
554 | # The format type of data returned. |
|
555 | # The format type of data returned. | |
555 | format_type = Unicode('text/plain') |
|
556 | format_type = Unicode('text/plain') | |
556 |
|
557 | |||
557 | # This subclass ignores this attribute as it always need to return |
|
558 | # This subclass ignores this attribute as it always need to return | |
558 | # something. |
|
559 | # something. | |
559 | enabled = Bool(True).tag(config=False) |
|
560 | enabled = Bool(True).tag(config=False) | |
560 |
|
561 | |||
561 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, |
|
562 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, | |
562 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
563 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. | |
563 |
|
564 | |||
564 | Set to 0 to disable truncation. |
|
565 | Set to 0 to disable truncation. | |
565 | """ |
|
566 | """ | |
566 | ).tag(config=True) |
|
567 | ).tag(config=True) | |
567 |
|
568 | |||
568 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
569 | # Look for a _repr_pretty_ methods to use for pretty printing. | |
569 | print_method = ObjectName('_repr_pretty_') |
|
570 | print_method = ObjectName('_repr_pretty_') | |
570 |
|
571 | |||
571 | # Whether to pretty-print or not. |
|
572 | # Whether to pretty-print or not. | |
572 | pprint = Bool(True).tag(config=True) |
|
573 | pprint = Bool(True).tag(config=True) | |
573 |
|
574 | |||
574 | # Whether to be verbose or not. |
|
575 | # Whether to be verbose or not. | |
575 | verbose = Bool(False).tag(config=True) |
|
576 | verbose = Bool(False).tag(config=True) | |
576 |
|
577 | |||
577 | # The maximum width. |
|
578 | # The maximum width. | |
578 | max_width = Integer(79).tag(config=True) |
|
579 | max_width = Integer(79).tag(config=True) | |
579 |
|
580 | |||
580 | # The newline character. |
|
581 | # The newline character. | |
581 | newline = Unicode('\n').tag(config=True) |
|
582 | newline = Unicode('\n').tag(config=True) | |
582 |
|
583 | |||
583 | # format-string for pprinting floats |
|
584 | # format-string for pprinting floats | |
584 | float_format = Unicode('%r') |
|
585 | float_format = Unicode('%r') | |
585 | # setter for float precision, either int or direct format-string |
|
586 | # setter for float precision, either int or direct format-string | |
586 | float_precision = CUnicode('').tag(config=True) |
|
587 | float_precision = CUnicode('').tag(config=True) | |
587 |
|
588 | |||
588 | @observe('float_precision') |
|
589 | @observe('float_precision') | |
589 | def _float_precision_changed(self, change): |
|
590 | def _float_precision_changed(self, change): | |
590 | """float_precision changed, set float_format accordingly. |
|
591 | """float_precision changed, set float_format accordingly. | |
591 |
|
592 | |||
592 | float_precision can be set by int or str. |
|
593 | float_precision can be set by int or str. | |
593 | This will set float_format, after interpreting input. |
|
594 | This will set float_format, after interpreting input. | |
594 | If numpy has been imported, numpy print precision will also be set. |
|
595 | If numpy has been imported, numpy print precision will also be set. | |
595 |
|
596 | |||
596 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
597 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
597 |
|
598 | |||
598 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
599 | An empty string returns to defaults (repr for float, 8 for numpy). | |
599 |
|
600 | |||
600 | This parameter can be set via the '%precision' magic. |
|
601 | This parameter can be set via the '%precision' magic. | |
601 | """ |
|
602 | """ | |
602 |
|
603 | |||
603 | new = change['new'] |
|
604 | new = change['new'] | |
604 | if '%' in new: |
|
605 | if '%' in new: | |
605 | # got explicit format string |
|
606 | # got explicit format string | |
606 | fmt = new |
|
607 | fmt = new | |
607 | try: |
|
608 | try: | |
608 | fmt%3.14159 |
|
609 | fmt%3.14159 | |
609 | except Exception: |
|
610 | except Exception: | |
610 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
611 | raise ValueError("Precision must be int or format string, not %r"%new) | |
611 | elif new: |
|
612 | elif new: | |
612 | # otherwise, should be an int |
|
613 | # otherwise, should be an int | |
613 | try: |
|
614 | try: | |
614 | i = int(new) |
|
615 | i = int(new) | |
615 | assert i >= 0 |
|
616 | assert i >= 0 | |
616 | except ValueError: |
|
617 | except ValueError: | |
617 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
618 | raise ValueError("Precision must be int or format string, not %r"%new) | |
618 | except AssertionError: |
|
619 | except AssertionError: | |
619 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
620 | raise ValueError("int precision must be non-negative, not %r"%i) | |
620 |
|
621 | |||
621 | fmt = '%%.%if'%i |
|
622 | fmt = '%%.%if'%i | |
622 | if 'numpy' in sys.modules: |
|
623 | if 'numpy' in sys.modules: | |
623 | # set numpy precision if it has been imported |
|
624 | # set numpy precision if it has been imported | |
624 | import numpy |
|
625 | import numpy | |
625 | numpy.set_printoptions(precision=i) |
|
626 | numpy.set_printoptions(precision=i) | |
626 | else: |
|
627 | else: | |
627 | # default back to repr |
|
628 | # default back to repr | |
628 | fmt = '%r' |
|
629 | fmt = '%r' | |
629 | if 'numpy' in sys.modules: |
|
630 | if 'numpy' in sys.modules: | |
630 | import numpy |
|
631 | import numpy | |
631 | # numpy default is 8 |
|
632 | # numpy default is 8 | |
632 | numpy.set_printoptions(precision=8) |
|
633 | numpy.set_printoptions(precision=8) | |
633 | self.float_format = fmt |
|
634 | self.float_format = fmt | |
634 |
|
635 | |||
635 | # Use the default pretty printers from IPython.lib.pretty. |
|
636 | # Use the default pretty printers from IPython.lib.pretty. | |
636 | @default('singleton_printers') |
|
637 | @default('singleton_printers') | |
637 | def _singleton_printers_default(self): |
|
638 | def _singleton_printers_default(self): | |
638 | return pretty._singleton_pprinters.copy() |
|
639 | return pretty._singleton_pprinters.copy() | |
639 |
|
640 | |||
640 | @default('type_printers') |
|
641 | @default('type_printers') | |
641 | def _type_printers_default(self): |
|
642 | def _type_printers_default(self): | |
642 | d = pretty._type_pprinters.copy() |
|
643 | d = pretty._type_pprinters.copy() | |
643 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
644 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
644 | return d |
|
645 | return d | |
645 |
|
646 | |||
646 | @default('deferred_printers') |
|
647 | @default('deferred_printers') | |
647 | def _deferred_printers_default(self): |
|
648 | def _deferred_printers_default(self): | |
648 | return pretty._deferred_type_pprinters.copy() |
|
649 | return pretty._deferred_type_pprinters.copy() | |
649 |
|
650 | |||
650 | #### FormatterABC interface #### |
|
651 | #### FormatterABC interface #### | |
651 |
|
652 | |||
652 | @catch_format_error |
|
653 | @catch_format_error | |
653 | def __call__(self, obj): |
|
654 | def __call__(self, obj): | |
654 | """Compute the pretty representation of the object.""" |
|
655 | """Compute the pretty representation of the object.""" | |
655 | if not self.pprint: |
|
656 | if not self.pprint: | |
656 | return repr(obj) |
|
657 | return repr(obj) | |
657 | else: |
|
658 | else: | |
658 | # handle str and unicode on Python 2 |
|
659 | stream = StringIO() | |
659 | # io.StringIO only accepts unicode, |
|
|||
660 | # cStringIO doesn't handle unicode on py2, |
|
|||
661 | # StringIO allows str, unicode but only ascii str |
|
|||
662 | stream = pretty.CUnicodeIO() |
|
|||
663 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
660 | printer = pretty.RepresentationPrinter(stream, self.verbose, | |
664 | self.max_width, self.newline, |
|
661 | self.max_width, self.newline, | |
665 | max_seq_length=self.max_seq_length, |
|
662 | max_seq_length=self.max_seq_length, | |
666 | singleton_pprinters=self.singleton_printers, |
|
663 | singleton_pprinters=self.singleton_printers, | |
667 | type_pprinters=self.type_printers, |
|
664 | type_pprinters=self.type_printers, | |
668 | deferred_pprinters=self.deferred_printers) |
|
665 | deferred_pprinters=self.deferred_printers) | |
669 | printer.pretty(obj) |
|
666 | printer.pretty(obj) | |
670 | printer.flush() |
|
667 | printer.flush() | |
671 | return stream.getvalue() |
|
668 | return stream.getvalue() | |
672 |
|
669 | |||
673 |
|
670 | |||
674 | class HTMLFormatter(BaseFormatter): |
|
671 | class HTMLFormatter(BaseFormatter): | |
675 | """An HTML formatter. |
|
672 | """An HTML formatter. | |
676 |
|
673 | |||
677 | To define the callables that compute the HTML representation of your |
|
674 | To define the callables that compute the HTML representation of your | |
678 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
675 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` | |
679 | or :meth:`for_type_by_name` methods to register functions that handle |
|
676 | or :meth:`for_type_by_name` methods to register functions that handle | |
680 | this. |
|
677 | this. | |
681 |
|
678 | |||
682 | The return value of this formatter should be a valid HTML snippet that |
|
679 | The return value of this formatter should be a valid HTML snippet that | |
683 | could be injected into an existing DOM. It should *not* include the |
|
680 | could be injected into an existing DOM. It should *not* include the | |
684 | ```<html>`` or ```<body>`` tags. |
|
681 | ```<html>`` or ```<body>`` tags. | |
685 | """ |
|
682 | """ | |
686 | format_type = Unicode('text/html') |
|
683 | format_type = Unicode('text/html') | |
687 |
|
684 | |||
688 | print_method = ObjectName('_repr_html_') |
|
685 | print_method = ObjectName('_repr_html_') | |
689 |
|
686 | |||
690 |
|
687 | |||
691 | class MarkdownFormatter(BaseFormatter): |
|
688 | class MarkdownFormatter(BaseFormatter): | |
692 | """A Markdown formatter. |
|
689 | """A Markdown formatter. | |
693 |
|
690 | |||
694 | To define the callables that compute the Markdown representation of your |
|
691 | To define the callables that compute the Markdown representation of your | |
695 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
692 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` | |
696 | or :meth:`for_type_by_name` methods to register functions that handle |
|
693 | or :meth:`for_type_by_name` methods to register functions that handle | |
697 | this. |
|
694 | this. | |
698 |
|
695 | |||
699 | The return value of this formatter should be a valid Markdown. |
|
696 | The return value of this formatter should be a valid Markdown. | |
700 | """ |
|
697 | """ | |
701 | format_type = Unicode('text/markdown') |
|
698 | format_type = Unicode('text/markdown') | |
702 |
|
699 | |||
703 | print_method = ObjectName('_repr_markdown_') |
|
700 | print_method = ObjectName('_repr_markdown_') | |
704 |
|
701 | |||
705 | class SVGFormatter(BaseFormatter): |
|
702 | class SVGFormatter(BaseFormatter): | |
706 | """An SVG formatter. |
|
703 | """An SVG formatter. | |
707 |
|
704 | |||
708 | To define the callables that compute the SVG representation of your |
|
705 | To define the callables that compute the SVG representation of your | |
709 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
706 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` | |
710 | or :meth:`for_type_by_name` methods to register functions that handle |
|
707 | or :meth:`for_type_by_name` methods to register functions that handle | |
711 | this. |
|
708 | this. | |
712 |
|
709 | |||
713 | The return value of this formatter should be valid SVG enclosed in |
|
710 | The return value of this formatter should be valid SVG enclosed in | |
714 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
711 | ```<svg>``` tags, that could be injected into an existing DOM. It should | |
715 | *not* include the ```<html>`` or ```<body>`` tags. |
|
712 | *not* include the ```<html>`` or ```<body>`` tags. | |
716 | """ |
|
713 | """ | |
717 | format_type = Unicode('image/svg+xml') |
|
714 | format_type = Unicode('image/svg+xml') | |
718 |
|
715 | |||
719 | print_method = ObjectName('_repr_svg_') |
|
716 | print_method = ObjectName('_repr_svg_') | |
720 |
|
717 | |||
721 |
|
718 | |||
722 | class PNGFormatter(BaseFormatter): |
|
719 | class PNGFormatter(BaseFormatter): | |
723 | """A PNG formatter. |
|
720 | """A PNG formatter. | |
724 |
|
721 | |||
725 | To define the callables that compute the PNG representation of your |
|
722 | To define the callables that compute the PNG representation of your | |
726 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
723 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` | |
727 | or :meth:`for_type_by_name` methods to register functions that handle |
|
724 | or :meth:`for_type_by_name` methods to register functions that handle | |
728 | this. |
|
725 | this. | |
729 |
|
726 | |||
730 | The return value of this formatter should be raw PNG data, *not* |
|
727 | The return value of this formatter should be raw PNG data, *not* | |
731 | base64 encoded. |
|
728 | base64 encoded. | |
732 | """ |
|
729 | """ | |
733 | format_type = Unicode('image/png') |
|
730 | format_type = Unicode('image/png') | |
734 |
|
731 | |||
735 | print_method = ObjectName('_repr_png_') |
|
732 | print_method = ObjectName('_repr_png_') | |
736 |
|
733 | |||
737 | _return_type = (bytes, str) |
|
734 | _return_type = (bytes, str) | |
738 |
|
735 | |||
739 |
|
736 | |||
740 | class JPEGFormatter(BaseFormatter): |
|
737 | class JPEGFormatter(BaseFormatter): | |
741 | """A JPEG formatter. |
|
738 | """A JPEG formatter. | |
742 |
|
739 | |||
743 | To define the callables that compute the JPEG representation of your |
|
740 | To define the callables that compute the JPEG representation of your | |
744 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
741 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` | |
745 | or :meth:`for_type_by_name` methods to register functions that handle |
|
742 | or :meth:`for_type_by_name` methods to register functions that handle | |
746 | this. |
|
743 | this. | |
747 |
|
744 | |||
748 | The return value of this formatter should be raw JPEG data, *not* |
|
745 | The return value of this formatter should be raw JPEG data, *not* | |
749 | base64 encoded. |
|
746 | base64 encoded. | |
750 | """ |
|
747 | """ | |
751 | format_type = Unicode('image/jpeg') |
|
748 | format_type = Unicode('image/jpeg') | |
752 |
|
749 | |||
753 | print_method = ObjectName('_repr_jpeg_') |
|
750 | print_method = ObjectName('_repr_jpeg_') | |
754 |
|
751 | |||
755 | _return_type = (bytes, str) |
|
752 | _return_type = (bytes, str) | |
756 |
|
753 | |||
757 |
|
754 | |||
758 | class LatexFormatter(BaseFormatter): |
|
755 | class LatexFormatter(BaseFormatter): | |
759 | """A LaTeX formatter. |
|
756 | """A LaTeX formatter. | |
760 |
|
757 | |||
761 | To define the callables that compute the LaTeX representation of your |
|
758 | To define the callables that compute the LaTeX representation of your | |
762 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
759 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` | |
763 | or :meth:`for_type_by_name` methods to register functions that handle |
|
760 | or :meth:`for_type_by_name` methods to register functions that handle | |
764 | this. |
|
761 | this. | |
765 |
|
762 | |||
766 | The return value of this formatter should be a valid LaTeX equation, |
|
763 | The return value of this formatter should be a valid LaTeX equation, | |
767 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
764 | enclosed in either ```$```, ```$$``` or another LaTeX equation | |
768 | environment. |
|
765 | environment. | |
769 | """ |
|
766 | """ | |
770 | format_type = Unicode('text/latex') |
|
767 | format_type = Unicode('text/latex') | |
771 |
|
768 | |||
772 | print_method = ObjectName('_repr_latex_') |
|
769 | print_method = ObjectName('_repr_latex_') | |
773 |
|
770 | |||
774 |
|
771 | |||
775 | class JSONFormatter(BaseFormatter): |
|
772 | class JSONFormatter(BaseFormatter): | |
776 | """A JSON string formatter. |
|
773 | """A JSON string formatter. | |
777 |
|
774 | |||
778 | To define the callables that compute the JSONable representation of |
|
775 | To define the callables that compute the JSONable representation of | |
779 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
776 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` | |
780 | or :meth:`for_type_by_name` methods to register functions that handle |
|
777 | or :meth:`for_type_by_name` methods to register functions that handle | |
781 | this. |
|
778 | this. | |
782 |
|
779 | |||
783 | The return value of this formatter should be a JSONable list or dict. |
|
780 | The return value of this formatter should be a JSONable list or dict. | |
784 | JSON scalars (None, number, string) are not allowed, only dict or list containers. |
|
781 | JSON scalars (None, number, string) are not allowed, only dict or list containers. | |
785 | """ |
|
782 | """ | |
786 | format_type = Unicode('application/json') |
|
783 | format_type = Unicode('application/json') | |
787 | _return_type = (list, dict) |
|
784 | _return_type = (list, dict) | |
788 |
|
785 | |||
789 | print_method = ObjectName('_repr_json_') |
|
786 | print_method = ObjectName('_repr_json_') | |
790 |
|
787 | |||
791 | def _check_return(self, r, obj): |
|
788 | def _check_return(self, r, obj): | |
792 | """Check that a return value is appropriate |
|
789 | """Check that a return value is appropriate | |
793 |
|
790 | |||
794 | Return the value if so, None otherwise, warning if invalid. |
|
791 | Return the value if so, None otherwise, warning if invalid. | |
795 | """ |
|
792 | """ | |
796 | if r is None: |
|
793 | if r is None: | |
797 | return |
|
794 | return | |
798 | md = None |
|
795 | md = None | |
799 | if isinstance(r, tuple): |
|
796 | if isinstance(r, tuple): | |
800 | # unpack data, metadata tuple for type checking on first element |
|
797 | # unpack data, metadata tuple for type checking on first element | |
801 | r, md = r |
|
798 | r, md = r | |
802 |
|
799 | |||
803 | # handle deprecated JSON-as-string form from IPython < 3 |
|
800 | # handle deprecated JSON-as-string form from IPython < 3 | |
804 | if isinstance(r, str): |
|
801 | if isinstance(r, str): | |
805 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", |
|
802 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", | |
806 | FormatterWarning) |
|
803 | FormatterWarning) | |
807 | r = json.loads(r) |
|
804 | r = json.loads(r) | |
808 |
|
805 | |||
809 | if md is not None: |
|
806 | if md is not None: | |
810 | # put the tuple back together |
|
807 | # put the tuple back together | |
811 | r = (r, md) |
|
808 | r = (r, md) | |
812 | return super(JSONFormatter, self)._check_return(r, obj) |
|
809 | return super(JSONFormatter, self)._check_return(r, obj) | |
813 |
|
810 | |||
814 |
|
811 | |||
815 | class JavascriptFormatter(BaseFormatter): |
|
812 | class JavascriptFormatter(BaseFormatter): | |
816 | """A Javascript formatter. |
|
813 | """A Javascript formatter. | |
817 |
|
814 | |||
818 | To define the callables that compute the Javascript representation of |
|
815 | To define the callables that compute the Javascript representation of | |
819 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
816 | your objects, define a :meth:`_repr_javascript_` method or use the | |
820 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
817 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions | |
821 | that handle this. |
|
818 | that handle this. | |
822 |
|
819 | |||
823 | The return value of this formatter should be valid Javascript code and |
|
820 | The return value of this formatter should be valid Javascript code and | |
824 | should *not* be enclosed in ```<script>``` tags. |
|
821 | should *not* be enclosed in ```<script>``` tags. | |
825 | """ |
|
822 | """ | |
826 | format_type = Unicode('application/javascript') |
|
823 | format_type = Unicode('application/javascript') | |
827 |
|
824 | |||
828 | print_method = ObjectName('_repr_javascript_') |
|
825 | print_method = ObjectName('_repr_javascript_') | |
829 |
|
826 | |||
830 |
|
827 | |||
831 | class PDFFormatter(BaseFormatter): |
|
828 | class PDFFormatter(BaseFormatter): | |
832 | """A PDF formatter. |
|
829 | """A PDF formatter. | |
833 |
|
830 | |||
834 | To define the callables that compute the PDF representation of your |
|
831 | To define the callables that compute the PDF representation of your | |
835 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
832 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` | |
836 | or :meth:`for_type_by_name` methods to register functions that handle |
|
833 | or :meth:`for_type_by_name` methods to register functions that handle | |
837 | this. |
|
834 | this. | |
838 |
|
835 | |||
839 | The return value of this formatter should be raw PDF data, *not* |
|
836 | The return value of this formatter should be raw PDF data, *not* | |
840 | base64 encoded. |
|
837 | base64 encoded. | |
841 | """ |
|
838 | """ | |
842 | format_type = Unicode('application/pdf') |
|
839 | format_type = Unicode('application/pdf') | |
843 |
|
840 | |||
844 | print_method = ObjectName('_repr_pdf_') |
|
841 | print_method = ObjectName('_repr_pdf_') | |
845 |
|
842 | |||
846 | _return_type = (bytes, str) |
|
843 | _return_type = (bytes, str) | |
847 |
|
844 | |||
848 | class IPythonDisplayFormatter(BaseFormatter): |
|
845 | class IPythonDisplayFormatter(BaseFormatter): | |
849 | """A Formatter for objects that know how to display themselves. |
|
846 | """A Formatter for objects that know how to display themselves. | |
850 |
|
847 | |||
851 | To define the callables that compute the representation of your |
|
848 | To define the callables that compute the representation of your | |
852 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` |
|
849 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` | |
853 | or :meth:`for_type_by_name` methods to register functions that handle |
|
850 | or :meth:`for_type_by_name` methods to register functions that handle | |
854 | this. Unlike mime-type displays, this method should not return anything, |
|
851 | this. Unlike mime-type displays, this method should not return anything, | |
855 | instead calling any appropriate display methods itself. |
|
852 | instead calling any appropriate display methods itself. | |
856 |
|
853 | |||
857 | This display formatter has highest priority. |
|
854 | This display formatter has highest priority. | |
858 | If it fires, no other display formatter will be called. |
|
855 | If it fires, no other display formatter will be called. | |
859 | """ |
|
856 | """ | |
860 | print_method = ObjectName('_ipython_display_') |
|
857 | print_method = ObjectName('_ipython_display_') | |
861 | _return_type = (type(None), bool) |
|
858 | _return_type = (type(None), bool) | |
862 |
|
859 | |||
863 |
|
860 | |||
864 | @catch_format_error |
|
861 | @catch_format_error | |
865 | def __call__(self, obj): |
|
862 | def __call__(self, obj): | |
866 | """Compute the format for an object.""" |
|
863 | """Compute the format for an object.""" | |
867 | if self.enabled: |
|
864 | if self.enabled: | |
868 | # lookup registered printer |
|
865 | # lookup registered printer | |
869 | try: |
|
866 | try: | |
870 | printer = self.lookup(obj) |
|
867 | printer = self.lookup(obj) | |
871 | except KeyError: |
|
868 | except KeyError: | |
872 | pass |
|
869 | pass | |
873 | else: |
|
870 | else: | |
874 | printer(obj) |
|
871 | printer(obj) | |
875 | return True |
|
872 | return True | |
876 | # Finally look for special method names |
|
873 | # Finally look for special method names | |
877 | method = get_real_method(obj, self.print_method) |
|
874 | method = get_real_method(obj, self.print_method) | |
878 | if method is not None: |
|
875 | if method is not None: | |
879 | method() |
|
876 | method() | |
880 | return True |
|
877 | return True | |
881 |
|
878 | |||
882 |
|
879 | |||
883 | FormatterABC.register(BaseFormatter) |
|
880 | FormatterABC.register(BaseFormatter) | |
884 | FormatterABC.register(PlainTextFormatter) |
|
881 | FormatterABC.register(PlainTextFormatter) | |
885 | FormatterABC.register(HTMLFormatter) |
|
882 | FormatterABC.register(HTMLFormatter) | |
886 | FormatterABC.register(MarkdownFormatter) |
|
883 | FormatterABC.register(MarkdownFormatter) | |
887 | FormatterABC.register(SVGFormatter) |
|
884 | FormatterABC.register(SVGFormatter) | |
888 | FormatterABC.register(PNGFormatter) |
|
885 | FormatterABC.register(PNGFormatter) | |
889 | FormatterABC.register(PDFFormatter) |
|
886 | FormatterABC.register(PDFFormatter) | |
890 | FormatterABC.register(JPEGFormatter) |
|
887 | FormatterABC.register(JPEGFormatter) | |
891 | FormatterABC.register(LatexFormatter) |
|
888 | FormatterABC.register(LatexFormatter) | |
892 | FormatterABC.register(JSONFormatter) |
|
889 | FormatterABC.register(JSONFormatter) | |
893 | FormatterABC.register(JavascriptFormatter) |
|
890 | FormatterABC.register(JavascriptFormatter) | |
894 | FormatterABC.register(IPythonDisplayFormatter) |
|
891 | FormatterABC.register(IPythonDisplayFormatter) | |
895 |
|
892 | |||
896 |
|
893 | |||
897 | def format_display_data(obj, include=None, exclude=None): |
|
894 | def format_display_data(obj, include=None, exclude=None): | |
898 | """Return a format data dict for an object. |
|
895 | """Return a format data dict for an object. | |
899 |
|
896 | |||
900 | By default all format types will be computed. |
|
897 | By default all format types will be computed. | |
901 |
|
898 | |||
902 | The following MIME types are currently implemented: |
|
899 | The following MIME types are currently implemented: | |
903 |
|
900 | |||
904 | * text/plain |
|
901 | * text/plain | |
905 | * text/html |
|
902 | * text/html | |
906 | * text/markdown |
|
903 | * text/markdown | |
907 | * text/latex |
|
904 | * text/latex | |
908 | * application/json |
|
905 | * application/json | |
909 | * application/javascript |
|
906 | * application/javascript | |
910 | * application/pdf |
|
907 | * application/pdf | |
911 | * image/png |
|
908 | * image/png | |
912 | * image/jpeg |
|
909 | * image/jpeg | |
913 | * image/svg+xml |
|
910 | * image/svg+xml | |
914 |
|
911 | |||
915 | Parameters |
|
912 | Parameters | |
916 | ---------- |
|
913 | ---------- | |
917 | obj : object |
|
914 | obj : object | |
918 | The Python object whose format data will be computed. |
|
915 | The Python object whose format data will be computed. | |
919 |
|
916 | |||
920 | Returns |
|
917 | Returns | |
921 | ------- |
|
918 | ------- | |
922 | format_dict : dict |
|
919 | format_dict : dict | |
923 | A dictionary of key/value pairs, one or each format that was |
|
920 | A dictionary of key/value pairs, one or each format that was | |
924 | generated for the object. The keys are the format types, which |
|
921 | generated for the object. The keys are the format types, which | |
925 | will usually be MIME type strings and the values and JSON'able |
|
922 | will usually be MIME type strings and the values and JSON'able | |
926 | data structure containing the raw data for the representation in |
|
923 | data structure containing the raw data for the representation in | |
927 | that format. |
|
924 | that format. | |
928 | include : list or tuple, optional |
|
925 | include : list or tuple, optional | |
929 | A list of format type strings (MIME types) to include in the |
|
926 | A list of format type strings (MIME types) to include in the | |
930 | format data dict. If this is set *only* the format types included |
|
927 | format data dict. If this is set *only* the format types included | |
931 | in this list will be computed. |
|
928 | in this list will be computed. | |
932 | exclude : list or tuple, optional |
|
929 | exclude : list or tuple, optional | |
933 | A list of format type string (MIME types) to exclue in the format |
|
930 | A list of format type string (MIME types) to exclue in the format | |
934 | data dict. If this is set all format types will be computed, |
|
931 | data dict. If this is set all format types will be computed, | |
935 | except for those included in this argument. |
|
932 | except for those included in this argument. | |
936 | """ |
|
933 | """ | |
937 | from IPython.core.interactiveshell import InteractiveShell |
|
934 | from IPython.core.interactiveshell import InteractiveShell | |
938 |
|
935 | |||
939 | return InteractiveShell.instance().display_formatter.format( |
|
936 | return InteractiveShell.instance().display_formatter.format( | |
940 | obj, |
|
937 | obj, | |
941 | include, |
|
938 | include, | |
942 | exclude |
|
939 | exclude | |
943 | ) |
|
940 | ) | |
944 |
|
941 |
@@ -1,858 +1,857 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ |
|
2 | """ | |
3 | Python advanced pretty printer. This pretty printer is intended to |
|
3 | Python advanced pretty printer. This pretty printer is intended to | |
4 | replace the old `pprint` python module which does not allow developers |
|
4 | replace the old `pprint` python module which does not allow developers | |
5 | to provide their own pretty print callbacks. |
|
5 | to provide their own pretty print callbacks. | |
6 |
|
6 | |||
7 | This module is based on ruby's `prettyprint.rb` library by `Tanaka Akira`. |
|
7 | This module is based on ruby's `prettyprint.rb` library by `Tanaka Akira`. | |
8 |
|
8 | |||
9 |
|
9 | |||
10 | Example Usage |
|
10 | Example Usage | |
11 | ------------- |
|
11 | ------------- | |
12 |
|
12 | |||
13 | To directly print the representation of an object use `pprint`:: |
|
13 | To directly print the representation of an object use `pprint`:: | |
14 |
|
14 | |||
15 | from pretty import pprint |
|
15 | from pretty import pprint | |
16 | pprint(complex_object) |
|
16 | pprint(complex_object) | |
17 |
|
17 | |||
18 | To get a string of the output use `pretty`:: |
|
18 | To get a string of the output use `pretty`:: | |
19 |
|
19 | |||
20 | from pretty import pretty |
|
20 | from pretty import pretty | |
21 | string = pretty(complex_object) |
|
21 | string = pretty(complex_object) | |
22 |
|
22 | |||
23 |
|
23 | |||
24 | Extending |
|
24 | Extending | |
25 | --------- |
|
25 | --------- | |
26 |
|
26 | |||
27 | The pretty library allows developers to add pretty printing rules for their |
|
27 | The pretty library allows developers to add pretty printing rules for their | |
28 | own objects. This process is straightforward. All you have to do is to |
|
28 | own objects. This process is straightforward. All you have to do is to | |
29 | add a `_repr_pretty_` method to your object and call the methods on the |
|
29 | add a `_repr_pretty_` method to your object and call the methods on the | |
30 | pretty printer passed:: |
|
30 | pretty printer passed:: | |
31 |
|
31 | |||
32 | class MyObject(object): |
|
32 | class MyObject(object): | |
33 |
|
33 | |||
34 | def _repr_pretty_(self, p, cycle): |
|
34 | def _repr_pretty_(self, p, cycle): | |
35 | ... |
|
35 | ... | |
36 |
|
36 | |||
37 | Here is an example implementation of a `_repr_pretty_` method for a list |
|
37 | Here is an example implementation of a `_repr_pretty_` method for a list | |
38 | subclass:: |
|
38 | subclass:: | |
39 |
|
39 | |||
40 | class MyList(list): |
|
40 | class MyList(list): | |
41 |
|
41 | |||
42 | def _repr_pretty_(self, p, cycle): |
|
42 | def _repr_pretty_(self, p, cycle): | |
43 | if cycle: |
|
43 | if cycle: | |
44 | p.text('MyList(...)') |
|
44 | p.text('MyList(...)') | |
45 | else: |
|
45 | else: | |
46 | with p.group(8, 'MyList([', '])'): |
|
46 | with p.group(8, 'MyList([', '])'): | |
47 | for idx, item in enumerate(self): |
|
47 | for idx, item in enumerate(self): | |
48 | if idx: |
|
48 | if idx: | |
49 | p.text(',') |
|
49 | p.text(',') | |
50 | p.breakable() |
|
50 | p.breakable() | |
51 | p.pretty(item) |
|
51 | p.pretty(item) | |
52 |
|
52 | |||
53 | The `cycle` parameter is `True` if pretty detected a cycle. You *have* to |
|
53 | The `cycle` parameter is `True` if pretty detected a cycle. You *have* to | |
54 | react to that or the result is an infinite loop. `p.text()` just adds |
|
54 | react to that or the result is an infinite loop. `p.text()` just adds | |
55 | non breaking text to the output, `p.breakable()` either adds a whitespace |
|
55 | non breaking text to the output, `p.breakable()` either adds a whitespace | |
56 | or breaks here. If you pass it an argument it's used instead of the |
|
56 | or breaks here. If you pass it an argument it's used instead of the | |
57 | default space. `p.pretty` prettyprints another object using the pretty print |
|
57 | default space. `p.pretty` prettyprints another object using the pretty print | |
58 | method. |
|
58 | method. | |
59 |
|
59 | |||
60 | The first parameter to the `group` function specifies the extra indentation |
|
60 | The first parameter to the `group` function specifies the extra indentation | |
61 | of the next line. In this example the next item will either be on the same |
|
61 | of the next line. In this example the next item will either be on the same | |
62 | line (if the items are short enough) or aligned with the right edge of the |
|
62 | line (if the items are short enough) or aligned with the right edge of the | |
63 | opening bracket of `MyList`. |
|
63 | opening bracket of `MyList`. | |
64 |
|
64 | |||
65 | If you just want to indent something you can use the group function |
|
65 | If you just want to indent something you can use the group function | |
66 | without open / close parameters. You can also use this code:: |
|
66 | without open / close parameters. You can also use this code:: | |
67 |
|
67 | |||
68 | with p.indent(2): |
|
68 | with p.indent(2): | |
69 | ... |
|
69 | ... | |
70 |
|
70 | |||
71 | Inheritance diagram: |
|
71 | Inheritance diagram: | |
72 |
|
72 | |||
73 | .. inheritance-diagram:: IPython.lib.pretty |
|
73 | .. inheritance-diagram:: IPython.lib.pretty | |
74 | :parts: 3 |
|
74 | :parts: 3 | |
75 |
|
75 | |||
76 | :copyright: 2007 by Armin Ronacher. |
|
76 | :copyright: 2007 by Armin Ronacher. | |
77 | Portions (c) 2009 by Robert Kern. |
|
77 | Portions (c) 2009 by Robert Kern. | |
78 | :license: BSD License. |
|
78 | :license: BSD License. | |
79 | """ |
|
79 | """ | |
80 | from contextlib import contextmanager |
|
80 | from contextlib import contextmanager | |
81 | import sys |
|
81 | import sys | |
82 | import types |
|
82 | import types | |
83 | import re |
|
83 | import re | |
84 | import datetime |
|
84 | import datetime | |
85 | from collections import deque |
|
85 | from collections import deque | |
|
86 | from io import StringIO | |||
86 |
|
87 | |||
87 | from IPython.utils.py3compat import PYPY, cast_unicode |
|
88 | from IPython.utils.py3compat import PYPY, cast_unicode | |
88 | from IPython.utils.encoding import get_stream_enc |
|
89 | from IPython.utils.encoding import get_stream_enc | |
89 |
|
90 | |||
90 | from io import StringIO |
|
|||
91 |
|
||||
92 |
|
91 | |||
93 | __all__ = ['pretty', 'pprint', 'PrettyPrinter', 'RepresentationPrinter', |
|
92 | __all__ = ['pretty', 'pprint', 'PrettyPrinter', 'RepresentationPrinter', | |
94 | 'for_type', 'for_type_by_name'] |
|
93 | 'for_type', 'for_type_by_name'] | |
95 |
|
94 | |||
96 |
|
95 | |||
97 | MAX_SEQ_LENGTH = 1000 |
|
96 | MAX_SEQ_LENGTH = 1000 | |
98 | _re_pattern_type = type(re.compile('')) |
|
97 | _re_pattern_type = type(re.compile('')) | |
99 |
|
98 | |||
100 | def _safe_getattr(obj, attr, default=None): |
|
99 | def _safe_getattr(obj, attr, default=None): | |
101 | """Safe version of getattr. |
|
100 | """Safe version of getattr. | |
102 |
|
101 | |||
103 | Same as getattr, but will return ``default`` on any Exception, |
|
102 | Same as getattr, but will return ``default`` on any Exception, | |
104 | rather than raising. |
|
103 | rather than raising. | |
105 | """ |
|
104 | """ | |
106 | try: |
|
105 | try: | |
107 | return getattr(obj, attr, default) |
|
106 | return getattr(obj, attr, default) | |
108 | except Exception: |
|
107 | except Exception: | |
109 | return default |
|
108 | return default | |
110 |
|
109 | |||
111 | CUnicodeIO = StringIO |
|
110 | CUnicodeIO = StringIO | |
112 |
|
111 | |||
113 | def pretty(obj, verbose=False, max_width=79, newline='\n', max_seq_length=MAX_SEQ_LENGTH): |
|
112 | def pretty(obj, verbose=False, max_width=79, newline='\n', max_seq_length=MAX_SEQ_LENGTH): | |
114 | """ |
|
113 | """ | |
115 | Pretty print the object's representation. |
|
114 | Pretty print the object's representation. | |
116 | """ |
|
115 | """ | |
117 |
stream = |
|
116 | stream = StringIO() | |
118 | printer = RepresentationPrinter(stream, verbose, max_width, newline, max_seq_length=max_seq_length) |
|
117 | printer = RepresentationPrinter(stream, verbose, max_width, newline, max_seq_length=max_seq_length) | |
119 | printer.pretty(obj) |
|
118 | printer.pretty(obj) | |
120 | printer.flush() |
|
119 | printer.flush() | |
121 | return stream.getvalue() |
|
120 | return stream.getvalue() | |
122 |
|
121 | |||
123 |
|
122 | |||
124 | def pprint(obj, verbose=False, max_width=79, newline='\n', max_seq_length=MAX_SEQ_LENGTH): |
|
123 | def pprint(obj, verbose=False, max_width=79, newline='\n', max_seq_length=MAX_SEQ_LENGTH): | |
125 | """ |
|
124 | """ | |
126 | Like `pretty` but print to stdout. |
|
125 | Like `pretty` but print to stdout. | |
127 | """ |
|
126 | """ | |
128 | printer = RepresentationPrinter(sys.stdout, verbose, max_width, newline, max_seq_length=max_seq_length) |
|
127 | printer = RepresentationPrinter(sys.stdout, verbose, max_width, newline, max_seq_length=max_seq_length) | |
129 | printer.pretty(obj) |
|
128 | printer.pretty(obj) | |
130 | printer.flush() |
|
129 | printer.flush() | |
131 | sys.stdout.write(newline) |
|
130 | sys.stdout.write(newline) | |
132 | sys.stdout.flush() |
|
131 | sys.stdout.flush() | |
133 |
|
132 | |||
134 | class _PrettyPrinterBase(object): |
|
133 | class _PrettyPrinterBase(object): | |
135 |
|
134 | |||
136 | @contextmanager |
|
135 | @contextmanager | |
137 | def indent(self, indent): |
|
136 | def indent(self, indent): | |
138 | """with statement support for indenting/dedenting.""" |
|
137 | """with statement support for indenting/dedenting.""" | |
139 | self.indentation += indent |
|
138 | self.indentation += indent | |
140 | try: |
|
139 | try: | |
141 | yield |
|
140 | yield | |
142 | finally: |
|
141 | finally: | |
143 | self.indentation -= indent |
|
142 | self.indentation -= indent | |
144 |
|
143 | |||
145 | @contextmanager |
|
144 | @contextmanager | |
146 | def group(self, indent=0, open='', close=''): |
|
145 | def group(self, indent=0, open='', close=''): | |
147 | """like begin_group / end_group but for the with statement.""" |
|
146 | """like begin_group / end_group but for the with statement.""" | |
148 | self.begin_group(indent, open) |
|
147 | self.begin_group(indent, open) | |
149 | try: |
|
148 | try: | |
150 | yield |
|
149 | yield | |
151 | finally: |
|
150 | finally: | |
152 | self.end_group(indent, close) |
|
151 | self.end_group(indent, close) | |
153 |
|
152 | |||
154 | class PrettyPrinter(_PrettyPrinterBase): |
|
153 | class PrettyPrinter(_PrettyPrinterBase): | |
155 | """ |
|
154 | """ | |
156 | Baseclass for the `RepresentationPrinter` prettyprinter that is used to |
|
155 | Baseclass for the `RepresentationPrinter` prettyprinter that is used to | |
157 | generate pretty reprs of objects. Contrary to the `RepresentationPrinter` |
|
156 | generate pretty reprs of objects. Contrary to the `RepresentationPrinter` | |
158 | this printer knows nothing about the default pprinters or the `_repr_pretty_` |
|
157 | this printer knows nothing about the default pprinters or the `_repr_pretty_` | |
159 | callback method. |
|
158 | callback method. | |
160 | """ |
|
159 | """ | |
161 |
|
160 | |||
162 | def __init__(self, output, max_width=79, newline='\n', max_seq_length=MAX_SEQ_LENGTH): |
|
161 | def __init__(self, output, max_width=79, newline='\n', max_seq_length=MAX_SEQ_LENGTH): | |
163 | self.output = output |
|
162 | self.output = output | |
164 | self.max_width = max_width |
|
163 | self.max_width = max_width | |
165 | self.newline = newline |
|
164 | self.newline = newline | |
166 | self.max_seq_length = max_seq_length |
|
165 | self.max_seq_length = max_seq_length | |
167 | self.output_width = 0 |
|
166 | self.output_width = 0 | |
168 | self.buffer_width = 0 |
|
167 | self.buffer_width = 0 | |
169 | self.buffer = deque() |
|
168 | self.buffer = deque() | |
170 |
|
169 | |||
171 | root_group = Group(0) |
|
170 | root_group = Group(0) | |
172 | self.group_stack = [root_group] |
|
171 | self.group_stack = [root_group] | |
173 | self.group_queue = GroupQueue(root_group) |
|
172 | self.group_queue = GroupQueue(root_group) | |
174 | self.indentation = 0 |
|
173 | self.indentation = 0 | |
175 |
|
174 | |||
176 | def _break_outer_groups(self): |
|
175 | def _break_outer_groups(self): | |
177 | while self.max_width < self.output_width + self.buffer_width: |
|
176 | while self.max_width < self.output_width + self.buffer_width: | |
178 | group = self.group_queue.deq() |
|
177 | group = self.group_queue.deq() | |
179 | if not group: |
|
178 | if not group: | |
180 | return |
|
179 | return | |
181 | while group.breakables: |
|
180 | while group.breakables: | |
182 | x = self.buffer.popleft() |
|
181 | x = self.buffer.popleft() | |
183 | self.output_width = x.output(self.output, self.output_width) |
|
182 | self.output_width = x.output(self.output, self.output_width) | |
184 | self.buffer_width -= x.width |
|
183 | self.buffer_width -= x.width | |
185 | while self.buffer and isinstance(self.buffer[0], Text): |
|
184 | while self.buffer and isinstance(self.buffer[0], Text): | |
186 | x = self.buffer.popleft() |
|
185 | x = self.buffer.popleft() | |
187 | self.output_width = x.output(self.output, self.output_width) |
|
186 | self.output_width = x.output(self.output, self.output_width) | |
188 | self.buffer_width -= x.width |
|
187 | self.buffer_width -= x.width | |
189 |
|
188 | |||
190 | def text(self, obj): |
|
189 | def text(self, obj): | |
191 | """Add literal text to the output.""" |
|
190 | """Add literal text to the output.""" | |
192 | width = len(obj) |
|
191 | width = len(obj) | |
193 | if self.buffer: |
|
192 | if self.buffer: | |
194 | text = self.buffer[-1] |
|
193 | text = self.buffer[-1] | |
195 | if not isinstance(text, Text): |
|
194 | if not isinstance(text, Text): | |
196 | text = Text() |
|
195 | text = Text() | |
197 | self.buffer.append(text) |
|
196 | self.buffer.append(text) | |
198 | text.add(obj, width) |
|
197 | text.add(obj, width) | |
199 | self.buffer_width += width |
|
198 | self.buffer_width += width | |
200 | self._break_outer_groups() |
|
199 | self._break_outer_groups() | |
201 | else: |
|
200 | else: | |
202 | self.output.write(obj) |
|
201 | self.output.write(obj) | |
203 | self.output_width += width |
|
202 | self.output_width += width | |
204 |
|
203 | |||
205 | def breakable(self, sep=' '): |
|
204 | def breakable(self, sep=' '): | |
206 | """ |
|
205 | """ | |
207 | Add a breakable separator to the output. This does not mean that it |
|
206 | Add a breakable separator to the output. This does not mean that it | |
208 | will automatically break here. If no breaking on this position takes |
|
207 | will automatically break here. If no breaking on this position takes | |
209 | place the `sep` is inserted which default to one space. |
|
208 | place the `sep` is inserted which default to one space. | |
210 | """ |
|
209 | """ | |
211 | width = len(sep) |
|
210 | width = len(sep) | |
212 | group = self.group_stack[-1] |
|
211 | group = self.group_stack[-1] | |
213 | if group.want_break: |
|
212 | if group.want_break: | |
214 | self.flush() |
|
213 | self.flush() | |
215 | self.output.write(self.newline) |
|
214 | self.output.write(self.newline) | |
216 | self.output.write(' ' * self.indentation) |
|
215 | self.output.write(' ' * self.indentation) | |
217 | self.output_width = self.indentation |
|
216 | self.output_width = self.indentation | |
218 | self.buffer_width = 0 |
|
217 | self.buffer_width = 0 | |
219 | else: |
|
218 | else: | |
220 | self.buffer.append(Breakable(sep, width, self)) |
|
219 | self.buffer.append(Breakable(sep, width, self)) | |
221 | self.buffer_width += width |
|
220 | self.buffer_width += width | |
222 | self._break_outer_groups() |
|
221 | self._break_outer_groups() | |
223 |
|
222 | |||
224 | def break_(self): |
|
223 | def break_(self): | |
225 | """ |
|
224 | """ | |
226 | Explicitly insert a newline into the output, maintaining correct indentation. |
|
225 | Explicitly insert a newline into the output, maintaining correct indentation. | |
227 | """ |
|
226 | """ | |
228 | self.flush() |
|
227 | self.flush() | |
229 | self.output.write(self.newline) |
|
228 | self.output.write(self.newline) | |
230 | self.output.write(' ' * self.indentation) |
|
229 | self.output.write(' ' * self.indentation) | |
231 | self.output_width = self.indentation |
|
230 | self.output_width = self.indentation | |
232 | self.buffer_width = 0 |
|
231 | self.buffer_width = 0 | |
233 |
|
232 | |||
234 |
|
233 | |||
235 | def begin_group(self, indent=0, open=''): |
|
234 | def begin_group(self, indent=0, open=''): | |
236 | """ |
|
235 | """ | |
237 | Begin a group. If you want support for python < 2.5 which doesn't has |
|
236 | Begin a group. If you want support for python < 2.5 which doesn't has | |
238 | the with statement this is the preferred way: |
|
237 | the with statement this is the preferred way: | |
239 |
|
238 | |||
240 | p.begin_group(1, '{') |
|
239 | p.begin_group(1, '{') | |
241 | ... |
|
240 | ... | |
242 | p.end_group(1, '}') |
|
241 | p.end_group(1, '}') | |
243 |
|
242 | |||
244 | The python 2.5 expression would be this: |
|
243 | The python 2.5 expression would be this: | |
245 |
|
244 | |||
246 | with p.group(1, '{', '}'): |
|
245 | with p.group(1, '{', '}'): | |
247 | ... |
|
246 | ... | |
248 |
|
247 | |||
249 | The first parameter specifies the indentation for the next line (usually |
|
248 | The first parameter specifies the indentation for the next line (usually | |
250 | the width of the opening text), the second the opening text. All |
|
249 | the width of the opening text), the second the opening text. All | |
251 | parameters are optional. |
|
250 | parameters are optional. | |
252 | """ |
|
251 | """ | |
253 | if open: |
|
252 | if open: | |
254 | self.text(open) |
|
253 | self.text(open) | |
255 | group = Group(self.group_stack[-1].depth + 1) |
|
254 | group = Group(self.group_stack[-1].depth + 1) | |
256 | self.group_stack.append(group) |
|
255 | self.group_stack.append(group) | |
257 | self.group_queue.enq(group) |
|
256 | self.group_queue.enq(group) | |
258 | self.indentation += indent |
|
257 | self.indentation += indent | |
259 |
|
258 | |||
260 | def _enumerate(self, seq): |
|
259 | def _enumerate(self, seq): | |
261 | """like enumerate, but with an upper limit on the number of items""" |
|
260 | """like enumerate, but with an upper limit on the number of items""" | |
262 | for idx, x in enumerate(seq): |
|
261 | for idx, x in enumerate(seq): | |
263 | if self.max_seq_length and idx >= self.max_seq_length: |
|
262 | if self.max_seq_length and idx >= self.max_seq_length: | |
264 | self.text(',') |
|
263 | self.text(',') | |
265 | self.breakable() |
|
264 | self.breakable() | |
266 | self.text('...') |
|
265 | self.text('...') | |
267 | return |
|
266 | return | |
268 | yield idx, x |
|
267 | yield idx, x | |
269 |
|
268 | |||
270 | def end_group(self, dedent=0, close=''): |
|
269 | def end_group(self, dedent=0, close=''): | |
271 | """End a group. See `begin_group` for more details.""" |
|
270 | """End a group. See `begin_group` for more details.""" | |
272 | self.indentation -= dedent |
|
271 | self.indentation -= dedent | |
273 | group = self.group_stack.pop() |
|
272 | group = self.group_stack.pop() | |
274 | if not group.breakables: |
|
273 | if not group.breakables: | |
275 | self.group_queue.remove(group) |
|
274 | self.group_queue.remove(group) | |
276 | if close: |
|
275 | if close: | |
277 | self.text(close) |
|
276 | self.text(close) | |
278 |
|
277 | |||
279 | def flush(self): |
|
278 | def flush(self): | |
280 | """Flush data that is left in the buffer.""" |
|
279 | """Flush data that is left in the buffer.""" | |
281 | for data in self.buffer: |
|
280 | for data in self.buffer: | |
282 | self.output_width += data.output(self.output, self.output_width) |
|
281 | self.output_width += data.output(self.output, self.output_width) | |
283 | self.buffer.clear() |
|
282 | self.buffer.clear() | |
284 | self.buffer_width = 0 |
|
283 | self.buffer_width = 0 | |
285 |
|
284 | |||
286 |
|
285 | |||
287 | def _get_mro(obj_class): |
|
286 | def _get_mro(obj_class): | |
288 | """ Get a reasonable method resolution order of a class and its superclasses |
|
287 | """ Get a reasonable method resolution order of a class and its superclasses | |
289 | for both old-style and new-style classes. |
|
288 | for both old-style and new-style classes. | |
290 | """ |
|
289 | """ | |
291 | if not hasattr(obj_class, '__mro__'): |
|
290 | if not hasattr(obj_class, '__mro__'): | |
292 | # Old-style class. Mix in object to make a fake new-style class. |
|
291 | # Old-style class. Mix in object to make a fake new-style class. | |
293 | try: |
|
292 | try: | |
294 | obj_class = type(obj_class.__name__, (obj_class, object), {}) |
|
293 | obj_class = type(obj_class.__name__, (obj_class, object), {}) | |
295 | except TypeError: |
|
294 | except TypeError: | |
296 | # Old-style extension type that does not descend from object. |
|
295 | # Old-style extension type that does not descend from object. | |
297 | # FIXME: try to construct a more thorough MRO. |
|
296 | # FIXME: try to construct a more thorough MRO. | |
298 | mro = [obj_class] |
|
297 | mro = [obj_class] | |
299 | else: |
|
298 | else: | |
300 | mro = obj_class.__mro__[1:-1] |
|
299 | mro = obj_class.__mro__[1:-1] | |
301 | else: |
|
300 | else: | |
302 | mro = obj_class.__mro__ |
|
301 | mro = obj_class.__mro__ | |
303 | return mro |
|
302 | return mro | |
304 |
|
303 | |||
305 |
|
304 | |||
306 | class RepresentationPrinter(PrettyPrinter): |
|
305 | class RepresentationPrinter(PrettyPrinter): | |
307 | """ |
|
306 | """ | |
308 | Special pretty printer that has a `pretty` method that calls the pretty |
|
307 | Special pretty printer that has a `pretty` method that calls the pretty | |
309 | printer for a python object. |
|
308 | printer for a python object. | |
310 |
|
309 | |||
311 | This class stores processing data on `self` so you must *never* use |
|
310 | This class stores processing data on `self` so you must *never* use | |
312 | this class in a threaded environment. Always lock it or reinstanciate |
|
311 | this class in a threaded environment. Always lock it or reinstanciate | |
313 | it. |
|
312 | it. | |
314 |
|
313 | |||
315 | Instances also have a verbose flag callbacks can access to control their |
|
314 | Instances also have a verbose flag callbacks can access to control their | |
316 | output. For example the default instance repr prints all attributes and |
|
315 | output. For example the default instance repr prints all attributes and | |
317 | methods that are not prefixed by an underscore if the printer is in |
|
316 | methods that are not prefixed by an underscore if the printer is in | |
318 | verbose mode. |
|
317 | verbose mode. | |
319 | """ |
|
318 | """ | |
320 |
|
319 | |||
321 | def __init__(self, output, verbose=False, max_width=79, newline='\n', |
|
320 | def __init__(self, output, verbose=False, max_width=79, newline='\n', | |
322 | singleton_pprinters=None, type_pprinters=None, deferred_pprinters=None, |
|
321 | singleton_pprinters=None, type_pprinters=None, deferred_pprinters=None, | |
323 | max_seq_length=MAX_SEQ_LENGTH): |
|
322 | max_seq_length=MAX_SEQ_LENGTH): | |
324 |
|
323 | |||
325 | PrettyPrinter.__init__(self, output, max_width, newline, max_seq_length=max_seq_length) |
|
324 | PrettyPrinter.__init__(self, output, max_width, newline, max_seq_length=max_seq_length) | |
326 | self.verbose = verbose |
|
325 | self.verbose = verbose | |
327 | self.stack = [] |
|
326 | self.stack = [] | |
328 | if singleton_pprinters is None: |
|
327 | if singleton_pprinters is None: | |
329 | singleton_pprinters = _singleton_pprinters.copy() |
|
328 | singleton_pprinters = _singleton_pprinters.copy() | |
330 | self.singleton_pprinters = singleton_pprinters |
|
329 | self.singleton_pprinters = singleton_pprinters | |
331 | if type_pprinters is None: |
|
330 | if type_pprinters is None: | |
332 | type_pprinters = _type_pprinters.copy() |
|
331 | type_pprinters = _type_pprinters.copy() | |
333 | self.type_pprinters = type_pprinters |
|
332 | self.type_pprinters = type_pprinters | |
334 | if deferred_pprinters is None: |
|
333 | if deferred_pprinters is None: | |
335 | deferred_pprinters = _deferred_type_pprinters.copy() |
|
334 | deferred_pprinters = _deferred_type_pprinters.copy() | |
336 | self.deferred_pprinters = deferred_pprinters |
|
335 | self.deferred_pprinters = deferred_pprinters | |
337 |
|
336 | |||
338 | def pretty(self, obj): |
|
337 | def pretty(self, obj): | |
339 | """Pretty print the given object.""" |
|
338 | """Pretty print the given object.""" | |
340 | obj_id = id(obj) |
|
339 | obj_id = id(obj) | |
341 | cycle = obj_id in self.stack |
|
340 | cycle = obj_id in self.stack | |
342 | self.stack.append(obj_id) |
|
341 | self.stack.append(obj_id) | |
343 | self.begin_group() |
|
342 | self.begin_group() | |
344 | try: |
|
343 | try: | |
345 | obj_class = _safe_getattr(obj, '__class__', None) or type(obj) |
|
344 | obj_class = _safe_getattr(obj, '__class__', None) or type(obj) | |
346 | # First try to find registered singleton printers for the type. |
|
345 | # First try to find registered singleton printers for the type. | |
347 | try: |
|
346 | try: | |
348 | printer = self.singleton_pprinters[obj_id] |
|
347 | printer = self.singleton_pprinters[obj_id] | |
349 | except (TypeError, KeyError): |
|
348 | except (TypeError, KeyError): | |
350 | pass |
|
349 | pass | |
351 | else: |
|
350 | else: | |
352 | return printer(obj, self, cycle) |
|
351 | return printer(obj, self, cycle) | |
353 | # Next walk the mro and check for either: |
|
352 | # Next walk the mro and check for either: | |
354 | # 1) a registered printer |
|
353 | # 1) a registered printer | |
355 | # 2) a _repr_pretty_ method |
|
354 | # 2) a _repr_pretty_ method | |
356 | for cls in _get_mro(obj_class): |
|
355 | for cls in _get_mro(obj_class): | |
357 | if cls in self.type_pprinters: |
|
356 | if cls in self.type_pprinters: | |
358 | # printer registered in self.type_pprinters |
|
357 | # printer registered in self.type_pprinters | |
359 | return self.type_pprinters[cls](obj, self, cycle) |
|
358 | return self.type_pprinters[cls](obj, self, cycle) | |
360 | else: |
|
359 | else: | |
361 | # deferred printer |
|
360 | # deferred printer | |
362 | printer = self._in_deferred_types(cls) |
|
361 | printer = self._in_deferred_types(cls) | |
363 | if printer is not None: |
|
362 | if printer is not None: | |
364 | return printer(obj, self, cycle) |
|
363 | return printer(obj, self, cycle) | |
365 | else: |
|
364 | else: | |
366 | # Finally look for special method names. |
|
365 | # Finally look for special method names. | |
367 | # Some objects automatically create any requested |
|
366 | # Some objects automatically create any requested | |
368 | # attribute. Try to ignore most of them by checking for |
|
367 | # attribute. Try to ignore most of them by checking for | |
369 | # callability. |
|
368 | # callability. | |
370 | if '_repr_pretty_' in cls.__dict__: |
|
369 | if '_repr_pretty_' in cls.__dict__: | |
371 | meth = cls._repr_pretty_ |
|
370 | meth = cls._repr_pretty_ | |
372 | if callable(meth): |
|
371 | if callable(meth): | |
373 | return meth(obj, self, cycle) |
|
372 | return meth(obj, self, cycle) | |
374 | return _default_pprint(obj, self, cycle) |
|
373 | return _default_pprint(obj, self, cycle) | |
375 | finally: |
|
374 | finally: | |
376 | self.end_group() |
|
375 | self.end_group() | |
377 | self.stack.pop() |
|
376 | self.stack.pop() | |
378 |
|
377 | |||
379 | def _in_deferred_types(self, cls): |
|
378 | def _in_deferred_types(self, cls): | |
380 | """ |
|
379 | """ | |
381 | Check if the given class is specified in the deferred type registry. |
|
380 | Check if the given class is specified in the deferred type registry. | |
382 |
|
381 | |||
383 | Returns the printer from the registry if it exists, and None if the |
|
382 | Returns the printer from the registry if it exists, and None if the | |
384 | class is not in the registry. Successful matches will be moved to the |
|
383 | class is not in the registry. Successful matches will be moved to the | |
385 | regular type registry for future use. |
|
384 | regular type registry for future use. | |
386 | """ |
|
385 | """ | |
387 | mod = _safe_getattr(cls, '__module__', None) |
|
386 | mod = _safe_getattr(cls, '__module__', None) | |
388 | name = _safe_getattr(cls, '__name__', None) |
|
387 | name = _safe_getattr(cls, '__name__', None) | |
389 | key = (mod, name) |
|
388 | key = (mod, name) | |
390 | printer = None |
|
389 | printer = None | |
391 | if key in self.deferred_pprinters: |
|
390 | if key in self.deferred_pprinters: | |
392 | # Move the printer over to the regular registry. |
|
391 | # Move the printer over to the regular registry. | |
393 | printer = self.deferred_pprinters.pop(key) |
|
392 | printer = self.deferred_pprinters.pop(key) | |
394 | self.type_pprinters[cls] = printer |
|
393 | self.type_pprinters[cls] = printer | |
395 | return printer |
|
394 | return printer | |
396 |
|
395 | |||
397 |
|
396 | |||
398 | class Printable(object): |
|
397 | class Printable(object): | |
399 |
|
398 | |||
400 | def output(self, stream, output_width): |
|
399 | def output(self, stream, output_width): | |
401 | return output_width |
|
400 | return output_width | |
402 |
|
401 | |||
403 |
|
402 | |||
404 | class Text(Printable): |
|
403 | class Text(Printable): | |
405 |
|
404 | |||
406 | def __init__(self): |
|
405 | def __init__(self): | |
407 | self.objs = [] |
|
406 | self.objs = [] | |
408 | self.width = 0 |
|
407 | self.width = 0 | |
409 |
|
408 | |||
410 | def output(self, stream, output_width): |
|
409 | def output(self, stream, output_width): | |
411 | for obj in self.objs: |
|
410 | for obj in self.objs: | |
412 | stream.write(obj) |
|
411 | stream.write(obj) | |
413 | return output_width + self.width |
|
412 | return output_width + self.width | |
414 |
|
413 | |||
415 | def add(self, obj, width): |
|
414 | def add(self, obj, width): | |
416 | self.objs.append(obj) |
|
415 | self.objs.append(obj) | |
417 | self.width += width |
|
416 | self.width += width | |
418 |
|
417 | |||
419 |
|
418 | |||
420 | class Breakable(Printable): |
|
419 | class Breakable(Printable): | |
421 |
|
420 | |||
422 | def __init__(self, seq, width, pretty): |
|
421 | def __init__(self, seq, width, pretty): | |
423 | self.obj = seq |
|
422 | self.obj = seq | |
424 | self.width = width |
|
423 | self.width = width | |
425 | self.pretty = pretty |
|
424 | self.pretty = pretty | |
426 | self.indentation = pretty.indentation |
|
425 | self.indentation = pretty.indentation | |
427 | self.group = pretty.group_stack[-1] |
|
426 | self.group = pretty.group_stack[-1] | |
428 | self.group.breakables.append(self) |
|
427 | self.group.breakables.append(self) | |
429 |
|
428 | |||
430 | def output(self, stream, output_width): |
|
429 | def output(self, stream, output_width): | |
431 | self.group.breakables.popleft() |
|
430 | self.group.breakables.popleft() | |
432 | if self.group.want_break: |
|
431 | if self.group.want_break: | |
433 | stream.write(self.pretty.newline) |
|
432 | stream.write(self.pretty.newline) | |
434 | stream.write(' ' * self.indentation) |
|
433 | stream.write(' ' * self.indentation) | |
435 | return self.indentation |
|
434 | return self.indentation | |
436 | if not self.group.breakables: |
|
435 | if not self.group.breakables: | |
437 | self.pretty.group_queue.remove(self.group) |
|
436 | self.pretty.group_queue.remove(self.group) | |
438 | stream.write(self.obj) |
|
437 | stream.write(self.obj) | |
439 | return output_width + self.width |
|
438 | return output_width + self.width | |
440 |
|
439 | |||
441 |
|
440 | |||
442 | class Group(Printable): |
|
441 | class Group(Printable): | |
443 |
|
442 | |||
444 | def __init__(self, depth): |
|
443 | def __init__(self, depth): | |
445 | self.depth = depth |
|
444 | self.depth = depth | |
446 | self.breakables = deque() |
|
445 | self.breakables = deque() | |
447 | self.want_break = False |
|
446 | self.want_break = False | |
448 |
|
447 | |||
449 |
|
448 | |||
450 | class GroupQueue(object): |
|
449 | class GroupQueue(object): | |
451 |
|
450 | |||
452 | def __init__(self, *groups): |
|
451 | def __init__(self, *groups): | |
453 | self.queue = [] |
|
452 | self.queue = [] | |
454 | for group in groups: |
|
453 | for group in groups: | |
455 | self.enq(group) |
|
454 | self.enq(group) | |
456 |
|
455 | |||
457 | def enq(self, group): |
|
456 | def enq(self, group): | |
458 | depth = group.depth |
|
457 | depth = group.depth | |
459 | while depth > len(self.queue) - 1: |
|
458 | while depth > len(self.queue) - 1: | |
460 | self.queue.append([]) |
|
459 | self.queue.append([]) | |
461 | self.queue[depth].append(group) |
|
460 | self.queue[depth].append(group) | |
462 |
|
461 | |||
463 | def deq(self): |
|
462 | def deq(self): | |
464 | for stack in self.queue: |
|
463 | for stack in self.queue: | |
465 | for idx, group in enumerate(reversed(stack)): |
|
464 | for idx, group in enumerate(reversed(stack)): | |
466 | if group.breakables: |
|
465 | if group.breakables: | |
467 | del stack[idx] |
|
466 | del stack[idx] | |
468 | group.want_break = True |
|
467 | group.want_break = True | |
469 | return group |
|
468 | return group | |
470 | for group in stack: |
|
469 | for group in stack: | |
471 | group.want_break = True |
|
470 | group.want_break = True | |
472 | del stack[:] |
|
471 | del stack[:] | |
473 |
|
472 | |||
474 | def remove(self, group): |
|
473 | def remove(self, group): | |
475 | try: |
|
474 | try: | |
476 | self.queue[group.depth].remove(group) |
|
475 | self.queue[group.depth].remove(group) | |
477 | except ValueError: |
|
476 | except ValueError: | |
478 | pass |
|
477 | pass | |
479 |
|
478 | |||
480 | try: |
|
479 | try: | |
481 | _baseclass_reprs = (object.__repr__, types.InstanceType.__repr__) |
|
480 | _baseclass_reprs = (object.__repr__, types.InstanceType.__repr__) | |
482 | except AttributeError: # Python 3 |
|
481 | except AttributeError: # Python 3 | |
483 | _baseclass_reprs = (object.__repr__,) |
|
482 | _baseclass_reprs = (object.__repr__,) | |
484 |
|
483 | |||
485 |
|
484 | |||
486 | def _default_pprint(obj, p, cycle): |
|
485 | def _default_pprint(obj, p, cycle): | |
487 | """ |
|
486 | """ | |
488 | The default print function. Used if an object does not provide one and |
|
487 | The default print function. Used if an object does not provide one and | |
489 | it's none of the builtin objects. |
|
488 | it's none of the builtin objects. | |
490 | """ |
|
489 | """ | |
491 | klass = _safe_getattr(obj, '__class__', None) or type(obj) |
|
490 | klass = _safe_getattr(obj, '__class__', None) or type(obj) | |
492 | if _safe_getattr(klass, '__repr__', None) not in _baseclass_reprs: |
|
491 | if _safe_getattr(klass, '__repr__', None) not in _baseclass_reprs: | |
493 | # A user-provided repr. Find newlines and replace them with p.break_() |
|
492 | # A user-provided repr. Find newlines and replace them with p.break_() | |
494 | _repr_pprint(obj, p, cycle) |
|
493 | _repr_pprint(obj, p, cycle) | |
495 | return |
|
494 | return | |
496 | p.begin_group(1, '<') |
|
495 | p.begin_group(1, '<') | |
497 | p.pretty(klass) |
|
496 | p.pretty(klass) | |
498 | p.text(' at 0x%x' % id(obj)) |
|
497 | p.text(' at 0x%x' % id(obj)) | |
499 | if cycle: |
|
498 | if cycle: | |
500 | p.text(' ...') |
|
499 | p.text(' ...') | |
501 | elif p.verbose: |
|
500 | elif p.verbose: | |
502 | first = True |
|
501 | first = True | |
503 | for key in dir(obj): |
|
502 | for key in dir(obj): | |
504 | if not key.startswith('_'): |
|
503 | if not key.startswith('_'): | |
505 | try: |
|
504 | try: | |
506 | value = getattr(obj, key) |
|
505 | value = getattr(obj, key) | |
507 | except AttributeError: |
|
506 | except AttributeError: | |
508 | continue |
|
507 | continue | |
509 | if isinstance(value, types.MethodType): |
|
508 | if isinstance(value, types.MethodType): | |
510 | continue |
|
509 | continue | |
511 | if not first: |
|
510 | if not first: | |
512 | p.text(',') |
|
511 | p.text(',') | |
513 | p.breakable() |
|
512 | p.breakable() | |
514 | p.text(key) |
|
513 | p.text(key) | |
515 | p.text('=') |
|
514 | p.text('=') | |
516 | step = len(key) + 1 |
|
515 | step = len(key) + 1 | |
517 | p.indentation += step |
|
516 | p.indentation += step | |
518 | p.pretty(value) |
|
517 | p.pretty(value) | |
519 | p.indentation -= step |
|
518 | p.indentation -= step | |
520 | first = False |
|
519 | first = False | |
521 | p.end_group(1, '>') |
|
520 | p.end_group(1, '>') | |
522 |
|
521 | |||
523 |
|
522 | |||
524 | def _seq_pprinter_factory(start, end, basetype): |
|
523 | def _seq_pprinter_factory(start, end, basetype): | |
525 | """ |
|
524 | """ | |
526 | Factory that returns a pprint function useful for sequences. Used by |
|
525 | Factory that returns a pprint function useful for sequences. Used by | |
527 | the default pprint for tuples, dicts, and lists. |
|
526 | the default pprint for tuples, dicts, and lists. | |
528 | """ |
|
527 | """ | |
529 | def inner(obj, p, cycle): |
|
528 | def inner(obj, p, cycle): | |
530 | typ = type(obj) |
|
529 | typ = type(obj) | |
531 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: |
|
530 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: | |
532 | # If the subclass provides its own repr, use it instead. |
|
531 | # If the subclass provides its own repr, use it instead. | |
533 | return p.text(typ.__repr__(obj)) |
|
532 | return p.text(typ.__repr__(obj)) | |
534 |
|
533 | |||
535 | if cycle: |
|
534 | if cycle: | |
536 | return p.text(start + '...' + end) |
|
535 | return p.text(start + '...' + end) | |
537 | step = len(start) |
|
536 | step = len(start) | |
538 | p.begin_group(step, start) |
|
537 | p.begin_group(step, start) | |
539 | for idx, x in p._enumerate(obj): |
|
538 | for idx, x in p._enumerate(obj): | |
540 | if idx: |
|
539 | if idx: | |
541 | p.text(',') |
|
540 | p.text(',') | |
542 | p.breakable() |
|
541 | p.breakable() | |
543 | p.pretty(x) |
|
542 | p.pretty(x) | |
544 | if len(obj) == 1 and type(obj) is tuple: |
|
543 | if len(obj) == 1 and type(obj) is tuple: | |
545 | # Special case for 1-item tuples. |
|
544 | # Special case for 1-item tuples. | |
546 | p.text(',') |
|
545 | p.text(',') | |
547 | p.end_group(step, end) |
|
546 | p.end_group(step, end) | |
548 | return inner |
|
547 | return inner | |
549 |
|
548 | |||
550 |
|
549 | |||
551 | def _set_pprinter_factory(start, end, basetype): |
|
550 | def _set_pprinter_factory(start, end, basetype): | |
552 | """ |
|
551 | """ | |
553 | Factory that returns a pprint function useful for sets and frozensets. |
|
552 | Factory that returns a pprint function useful for sets and frozensets. | |
554 | """ |
|
553 | """ | |
555 | def inner(obj, p, cycle): |
|
554 | def inner(obj, p, cycle): | |
556 | typ = type(obj) |
|
555 | typ = type(obj) | |
557 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: |
|
556 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: | |
558 | # If the subclass provides its own repr, use it instead. |
|
557 | # If the subclass provides its own repr, use it instead. | |
559 | return p.text(typ.__repr__(obj)) |
|
558 | return p.text(typ.__repr__(obj)) | |
560 |
|
559 | |||
561 | if cycle: |
|
560 | if cycle: | |
562 | return p.text(start + '...' + end) |
|
561 | return p.text(start + '...' + end) | |
563 | if len(obj) == 0: |
|
562 | if len(obj) == 0: | |
564 | # Special case. |
|
563 | # Special case. | |
565 | p.text(basetype.__name__ + '()') |
|
564 | p.text(basetype.__name__ + '()') | |
566 | else: |
|
565 | else: | |
567 | step = len(start) |
|
566 | step = len(start) | |
568 | p.begin_group(step, start) |
|
567 | p.begin_group(step, start) | |
569 | # Like dictionary keys, we will try to sort the items if there aren't too many |
|
568 | # Like dictionary keys, we will try to sort the items if there aren't too many | |
570 | items = obj |
|
569 | items = obj | |
571 | if not (p.max_seq_length and len(obj) >= p.max_seq_length): |
|
570 | if not (p.max_seq_length and len(obj) >= p.max_seq_length): | |
572 | try: |
|
571 | try: | |
573 | items = sorted(obj) |
|
572 | items = sorted(obj) | |
574 | except Exception: |
|
573 | except Exception: | |
575 | # Sometimes the items don't sort. |
|
574 | # Sometimes the items don't sort. | |
576 | pass |
|
575 | pass | |
577 | for idx, x in p._enumerate(items): |
|
576 | for idx, x in p._enumerate(items): | |
578 | if idx: |
|
577 | if idx: | |
579 | p.text(',') |
|
578 | p.text(',') | |
580 | p.breakable() |
|
579 | p.breakable() | |
581 | p.pretty(x) |
|
580 | p.pretty(x) | |
582 | p.end_group(step, end) |
|
581 | p.end_group(step, end) | |
583 | return inner |
|
582 | return inner | |
584 |
|
583 | |||
585 |
|
584 | |||
586 | def _dict_pprinter_factory(start, end, basetype=None): |
|
585 | def _dict_pprinter_factory(start, end, basetype=None): | |
587 | """ |
|
586 | """ | |
588 | Factory that returns a pprint function used by the default pprint of |
|
587 | Factory that returns a pprint function used by the default pprint of | |
589 | dicts and dict proxies. |
|
588 | dicts and dict proxies. | |
590 | """ |
|
589 | """ | |
591 | def inner(obj, p, cycle): |
|
590 | def inner(obj, p, cycle): | |
592 | typ = type(obj) |
|
591 | typ = type(obj) | |
593 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: |
|
592 | if basetype is not None and typ is not basetype and typ.__repr__ != basetype.__repr__: | |
594 | # If the subclass provides its own repr, use it instead. |
|
593 | # If the subclass provides its own repr, use it instead. | |
595 | return p.text(typ.__repr__(obj)) |
|
594 | return p.text(typ.__repr__(obj)) | |
596 |
|
595 | |||
597 | if cycle: |
|
596 | if cycle: | |
598 | return p.text('{...}') |
|
597 | return p.text('{...}') | |
599 | step = len(start) |
|
598 | step = len(start) | |
600 | p.begin_group(step, start) |
|
599 | p.begin_group(step, start) | |
601 | keys = obj.keys() |
|
600 | keys = obj.keys() | |
602 | # if dict isn't large enough to be truncated, sort keys before displaying |
|
601 | # if dict isn't large enough to be truncated, sort keys before displaying | |
603 | if not (p.max_seq_length and len(obj) >= p.max_seq_length): |
|
602 | if not (p.max_seq_length and len(obj) >= p.max_seq_length): | |
604 | try: |
|
603 | try: | |
605 | keys = sorted(keys) |
|
604 | keys = sorted(keys) | |
606 | except Exception: |
|
605 | except Exception: | |
607 | # Sometimes the keys don't sort. |
|
606 | # Sometimes the keys don't sort. | |
608 | pass |
|
607 | pass | |
609 | for idx, key in p._enumerate(keys): |
|
608 | for idx, key in p._enumerate(keys): | |
610 | if idx: |
|
609 | if idx: | |
611 | p.text(',') |
|
610 | p.text(',') | |
612 | p.breakable() |
|
611 | p.breakable() | |
613 | p.pretty(key) |
|
612 | p.pretty(key) | |
614 | p.text(': ') |
|
613 | p.text(': ') | |
615 | p.pretty(obj[key]) |
|
614 | p.pretty(obj[key]) | |
616 | p.end_group(step, end) |
|
615 | p.end_group(step, end) | |
617 | return inner |
|
616 | return inner | |
618 |
|
617 | |||
619 |
|
618 | |||
620 | def _super_pprint(obj, p, cycle): |
|
619 | def _super_pprint(obj, p, cycle): | |
621 | """The pprint for the super type.""" |
|
620 | """The pprint for the super type.""" | |
622 | p.begin_group(8, '<super: ') |
|
621 | p.begin_group(8, '<super: ') | |
623 | p.pretty(obj.__thisclass__) |
|
622 | p.pretty(obj.__thisclass__) | |
624 | p.text(',') |
|
623 | p.text(',') | |
625 | p.breakable() |
|
624 | p.breakable() | |
626 | if PYPY: # In PyPy, super() objects don't have __self__ attributes |
|
625 | if PYPY: # In PyPy, super() objects don't have __self__ attributes | |
627 | dself = obj.__repr__.__self__ |
|
626 | dself = obj.__repr__.__self__ | |
628 | p.pretty(None if dself is obj else dself) |
|
627 | p.pretty(None if dself is obj else dself) | |
629 | else: |
|
628 | else: | |
630 | p.pretty(obj.__self__) |
|
629 | p.pretty(obj.__self__) | |
631 | p.end_group(8, '>') |
|
630 | p.end_group(8, '>') | |
632 |
|
631 | |||
633 |
|
632 | |||
634 | def _re_pattern_pprint(obj, p, cycle): |
|
633 | def _re_pattern_pprint(obj, p, cycle): | |
635 | """The pprint function for regular expression patterns.""" |
|
634 | """The pprint function for regular expression patterns.""" | |
636 | p.text('re.compile(') |
|
635 | p.text('re.compile(') | |
637 | pattern = repr(obj.pattern) |
|
636 | pattern = repr(obj.pattern) | |
638 | if pattern[:1] in 'uU': |
|
637 | if pattern[:1] in 'uU': | |
639 | pattern = pattern[1:] |
|
638 | pattern = pattern[1:] | |
640 | prefix = 'ur' |
|
639 | prefix = 'ur' | |
641 | else: |
|
640 | else: | |
642 | prefix = 'r' |
|
641 | prefix = 'r' | |
643 | pattern = prefix + pattern.replace('\\\\', '\\') |
|
642 | pattern = prefix + pattern.replace('\\\\', '\\') | |
644 | p.text(pattern) |
|
643 | p.text(pattern) | |
645 | if obj.flags: |
|
644 | if obj.flags: | |
646 | p.text(',') |
|
645 | p.text(',') | |
647 | p.breakable() |
|
646 | p.breakable() | |
648 | done_one = False |
|
647 | done_one = False | |
649 | for flag in ('TEMPLATE', 'IGNORECASE', 'LOCALE', 'MULTILINE', 'DOTALL', |
|
648 | for flag in ('TEMPLATE', 'IGNORECASE', 'LOCALE', 'MULTILINE', 'DOTALL', | |
650 | 'UNICODE', 'VERBOSE', 'DEBUG'): |
|
649 | 'UNICODE', 'VERBOSE', 'DEBUG'): | |
651 | if obj.flags & getattr(re, flag): |
|
650 | if obj.flags & getattr(re, flag): | |
652 | if done_one: |
|
651 | if done_one: | |
653 | p.text('|') |
|
652 | p.text('|') | |
654 | p.text('re.' + flag) |
|
653 | p.text('re.' + flag) | |
655 | done_one = True |
|
654 | done_one = True | |
656 | p.text(')') |
|
655 | p.text(')') | |
657 |
|
656 | |||
658 |
|
657 | |||
659 | def _type_pprint(obj, p, cycle): |
|
658 | def _type_pprint(obj, p, cycle): | |
660 | """The pprint for classes and types.""" |
|
659 | """The pprint for classes and types.""" | |
661 | # Heap allocated types might not have the module attribute, |
|
660 | # Heap allocated types might not have the module attribute, | |
662 | # and others may set it to None. |
|
661 | # and others may set it to None. | |
663 |
|
662 | |||
664 | # Checks for a __repr__ override in the metaclass. Can't compare the |
|
663 | # Checks for a __repr__ override in the metaclass. Can't compare the | |
665 | # type(obj).__repr__ directly because in PyPy the representation function |
|
664 | # type(obj).__repr__ directly because in PyPy the representation function | |
666 | # inherited from type isn't the same type.__repr__ |
|
665 | # inherited from type isn't the same type.__repr__ | |
667 | if [m for m in _get_mro(type(obj)) if "__repr__" in vars(m)][:1] != [type]: |
|
666 | if [m for m in _get_mro(type(obj)) if "__repr__" in vars(m)][:1] != [type]: | |
668 | _repr_pprint(obj, p, cycle) |
|
667 | _repr_pprint(obj, p, cycle) | |
669 | return |
|
668 | return | |
670 |
|
669 | |||
671 | mod = _safe_getattr(obj, '__module__', None) |
|
670 | mod = _safe_getattr(obj, '__module__', None) | |
672 | try: |
|
671 | try: | |
673 | name = obj.__qualname__ |
|
672 | name = obj.__qualname__ | |
674 | if not isinstance(name, str): |
|
673 | if not isinstance(name, str): | |
675 | # This can happen if the type implements __qualname__ as a property |
|
674 | # This can happen if the type implements __qualname__ as a property | |
676 | # or other descriptor in Python 2. |
|
675 | # or other descriptor in Python 2. | |
677 | raise Exception("Try __name__") |
|
676 | raise Exception("Try __name__") | |
678 | except Exception: |
|
677 | except Exception: | |
679 | name = obj.__name__ |
|
678 | name = obj.__name__ | |
680 | if not isinstance(name, str): |
|
679 | if not isinstance(name, str): | |
681 | name = '<unknown type>' |
|
680 | name = '<unknown type>' | |
682 |
|
681 | |||
683 | if mod in (None, '__builtin__', 'builtins', 'exceptions'): |
|
682 | if mod in (None, '__builtin__', 'builtins', 'exceptions'): | |
684 | p.text(name) |
|
683 | p.text(name) | |
685 | else: |
|
684 | else: | |
686 | p.text(mod + '.' + name) |
|
685 | p.text(mod + '.' + name) | |
687 |
|
686 | |||
688 |
|
687 | |||
689 | def _repr_pprint(obj, p, cycle): |
|
688 | def _repr_pprint(obj, p, cycle): | |
690 | """A pprint that just redirects to the normal repr function.""" |
|
689 | """A pprint that just redirects to the normal repr function.""" | |
691 | # Find newlines and replace them with p.break_() |
|
690 | # Find newlines and replace them with p.break_() | |
692 | output = repr(obj) |
|
691 | output = repr(obj) | |
693 | for idx,output_line in enumerate(output.splitlines()): |
|
692 | for idx,output_line in enumerate(output.splitlines()): | |
694 | if idx: |
|
693 | if idx: | |
695 | p.break_() |
|
694 | p.break_() | |
696 | p.text(output_line) |
|
695 | p.text(output_line) | |
697 |
|
696 | |||
698 |
|
697 | |||
699 | def _function_pprint(obj, p, cycle): |
|
698 | def _function_pprint(obj, p, cycle): | |
700 | """Base pprint for all functions and builtin functions.""" |
|
699 | """Base pprint for all functions and builtin functions.""" | |
701 | name = _safe_getattr(obj, '__qualname__', obj.__name__) |
|
700 | name = _safe_getattr(obj, '__qualname__', obj.__name__) | |
702 | mod = obj.__module__ |
|
701 | mod = obj.__module__ | |
703 | if mod and mod not in ('__builtin__', 'builtins', 'exceptions'): |
|
702 | if mod and mod not in ('__builtin__', 'builtins', 'exceptions'): | |
704 | name = mod + '.' + name |
|
703 | name = mod + '.' + name | |
705 | p.text('<function %s>' % name) |
|
704 | p.text('<function %s>' % name) | |
706 |
|
705 | |||
707 |
|
706 | |||
708 | def _exception_pprint(obj, p, cycle): |
|
707 | def _exception_pprint(obj, p, cycle): | |
709 | """Base pprint for all exceptions.""" |
|
708 | """Base pprint for all exceptions.""" | |
710 | name = getattr(obj.__class__, '__qualname__', obj.__class__.__name__) |
|
709 | name = getattr(obj.__class__, '__qualname__', obj.__class__.__name__) | |
711 | if obj.__class__.__module__ not in ('exceptions', 'builtins'): |
|
710 | if obj.__class__.__module__ not in ('exceptions', 'builtins'): | |
712 | name = '%s.%s' % (obj.__class__.__module__, name) |
|
711 | name = '%s.%s' % (obj.__class__.__module__, name) | |
713 | step = len(name) + 1 |
|
712 | step = len(name) + 1 | |
714 | p.begin_group(step, name + '(') |
|
713 | p.begin_group(step, name + '(') | |
715 | for idx, arg in enumerate(getattr(obj, 'args', ())): |
|
714 | for idx, arg in enumerate(getattr(obj, 'args', ())): | |
716 | if idx: |
|
715 | if idx: | |
717 | p.text(',') |
|
716 | p.text(',') | |
718 | p.breakable() |
|
717 | p.breakable() | |
719 | p.pretty(arg) |
|
718 | p.pretty(arg) | |
720 | p.end_group(step, ')') |
|
719 | p.end_group(step, ')') | |
721 |
|
720 | |||
722 |
|
721 | |||
723 | #: the exception base |
|
722 | #: the exception base | |
724 | try: |
|
723 | try: | |
725 | _exception_base = BaseException |
|
724 | _exception_base = BaseException | |
726 | except NameError: |
|
725 | except NameError: | |
727 | _exception_base = Exception |
|
726 | _exception_base = Exception | |
728 |
|
727 | |||
729 |
|
728 | |||
730 | #: printers for builtin types |
|
729 | #: printers for builtin types | |
731 | _type_pprinters = { |
|
730 | _type_pprinters = { | |
732 | int: _repr_pprint, |
|
731 | int: _repr_pprint, | |
733 | float: _repr_pprint, |
|
732 | float: _repr_pprint, | |
734 | str: _repr_pprint, |
|
733 | str: _repr_pprint, | |
735 | tuple: _seq_pprinter_factory('(', ')', tuple), |
|
734 | tuple: _seq_pprinter_factory('(', ')', tuple), | |
736 | list: _seq_pprinter_factory('[', ']', list), |
|
735 | list: _seq_pprinter_factory('[', ']', list), | |
737 | dict: _dict_pprinter_factory('{', '}', dict), |
|
736 | dict: _dict_pprinter_factory('{', '}', dict), | |
738 |
|
737 | |||
739 | set: _set_pprinter_factory('{', '}', set), |
|
738 | set: _set_pprinter_factory('{', '}', set), | |
740 | frozenset: _set_pprinter_factory('frozenset({', '})', frozenset), |
|
739 | frozenset: _set_pprinter_factory('frozenset({', '})', frozenset), | |
741 | super: _super_pprint, |
|
740 | super: _super_pprint, | |
742 | _re_pattern_type: _re_pattern_pprint, |
|
741 | _re_pattern_type: _re_pattern_pprint, | |
743 | type: _type_pprint, |
|
742 | type: _type_pprint, | |
744 | types.FunctionType: _function_pprint, |
|
743 | types.FunctionType: _function_pprint, | |
745 | types.BuiltinFunctionType: _function_pprint, |
|
744 | types.BuiltinFunctionType: _function_pprint, | |
746 | types.MethodType: _repr_pprint, |
|
745 | types.MethodType: _repr_pprint, | |
747 |
|
746 | |||
748 | datetime.datetime: _repr_pprint, |
|
747 | datetime.datetime: _repr_pprint, | |
749 | datetime.timedelta: _repr_pprint, |
|
748 | datetime.timedelta: _repr_pprint, | |
750 | _exception_base: _exception_pprint |
|
749 | _exception_base: _exception_pprint | |
751 | } |
|
750 | } | |
752 |
|
751 | |||
753 | try: |
|
752 | try: | |
754 | # In PyPy, types.DictProxyType is dict, setting the dictproxy printer |
|
753 | # In PyPy, types.DictProxyType is dict, setting the dictproxy printer | |
755 | # using dict.setdefault avoids overwritting the dict printer |
|
754 | # using dict.setdefault avoids overwritting the dict printer | |
756 | _type_pprinters.setdefault(types.DictProxyType, |
|
755 | _type_pprinters.setdefault(types.DictProxyType, | |
757 | _dict_pprinter_factory('dict_proxy({', '})')) |
|
756 | _dict_pprinter_factory('dict_proxy({', '})')) | |
758 | _type_pprinters[types.ClassType] = _type_pprint |
|
757 | _type_pprinters[types.ClassType] = _type_pprint | |
759 | _type_pprinters[types.SliceType] = _repr_pprint |
|
758 | _type_pprinters[types.SliceType] = _repr_pprint | |
760 | except AttributeError: # Python 3 |
|
759 | except AttributeError: # Python 3 | |
761 | _type_pprinters[types.MappingProxyType] = \ |
|
760 | _type_pprinters[types.MappingProxyType] = \ | |
762 | _dict_pprinter_factory('mappingproxy({', '})') |
|
761 | _dict_pprinter_factory('mappingproxy({', '})') | |
763 | _type_pprinters[slice] = _repr_pprint |
|
762 | _type_pprinters[slice] = _repr_pprint | |
764 |
|
763 | |||
765 | try: |
|
764 | try: | |
766 | _type_pprinters[long] = _repr_pprint |
|
765 | _type_pprinters[long] = _repr_pprint | |
767 | _type_pprinters[unicode] = _repr_pprint |
|
766 | _type_pprinters[unicode] = _repr_pprint | |
768 | except NameError: |
|
767 | except NameError: | |
769 | _type_pprinters[range] = _repr_pprint |
|
768 | _type_pprinters[range] = _repr_pprint | |
770 | _type_pprinters[bytes] = _repr_pprint |
|
769 | _type_pprinters[bytes] = _repr_pprint | |
771 |
|
770 | |||
772 | #: printers for types specified by name |
|
771 | #: printers for types specified by name | |
773 | _deferred_type_pprinters = { |
|
772 | _deferred_type_pprinters = { | |
774 | } |
|
773 | } | |
775 |
|
774 | |||
776 | def for_type(typ, func): |
|
775 | def for_type(typ, func): | |
777 | """ |
|
776 | """ | |
778 | Add a pretty printer for a given type. |
|
777 | Add a pretty printer for a given type. | |
779 | """ |
|
778 | """ | |
780 | oldfunc = _type_pprinters.get(typ, None) |
|
779 | oldfunc = _type_pprinters.get(typ, None) | |
781 | if func is not None: |
|
780 | if func is not None: | |
782 | # To support easy restoration of old pprinters, we need to ignore Nones. |
|
781 | # To support easy restoration of old pprinters, we need to ignore Nones. | |
783 | _type_pprinters[typ] = func |
|
782 | _type_pprinters[typ] = func | |
784 | return oldfunc |
|
783 | return oldfunc | |
785 |
|
784 | |||
786 | def for_type_by_name(type_module, type_name, func): |
|
785 | def for_type_by_name(type_module, type_name, func): | |
787 | """ |
|
786 | """ | |
788 | Add a pretty printer for a type specified by the module and name of a type |
|
787 | Add a pretty printer for a type specified by the module and name of a type | |
789 | rather than the type object itself. |
|
788 | rather than the type object itself. | |
790 | """ |
|
789 | """ | |
791 | key = (type_module, type_name) |
|
790 | key = (type_module, type_name) | |
792 | oldfunc = _deferred_type_pprinters.get(key, None) |
|
791 | oldfunc = _deferred_type_pprinters.get(key, None) | |
793 | if func is not None: |
|
792 | if func is not None: | |
794 | # To support easy restoration of old pprinters, we need to ignore Nones. |
|
793 | # To support easy restoration of old pprinters, we need to ignore Nones. | |
795 | _deferred_type_pprinters[key] = func |
|
794 | _deferred_type_pprinters[key] = func | |
796 | return oldfunc |
|
795 | return oldfunc | |
797 |
|
796 | |||
798 |
|
797 | |||
799 | #: printers for the default singletons |
|
798 | #: printers for the default singletons | |
800 | _singleton_pprinters = dict.fromkeys(map(id, [None, True, False, Ellipsis, |
|
799 | _singleton_pprinters = dict.fromkeys(map(id, [None, True, False, Ellipsis, | |
801 | NotImplemented]), _repr_pprint) |
|
800 | NotImplemented]), _repr_pprint) | |
802 |
|
801 | |||
803 |
|
802 | |||
804 | def _defaultdict_pprint(obj, p, cycle): |
|
803 | def _defaultdict_pprint(obj, p, cycle): | |
805 | name = obj.__class__.__name__ |
|
804 | name = obj.__class__.__name__ | |
806 | with p.group(len(name) + 1, name + '(', ')'): |
|
805 | with p.group(len(name) + 1, name + '(', ')'): | |
807 | if cycle: |
|
806 | if cycle: | |
808 | p.text('...') |
|
807 | p.text('...') | |
809 | else: |
|
808 | else: | |
810 | p.pretty(obj.default_factory) |
|
809 | p.pretty(obj.default_factory) | |
811 | p.text(',') |
|
810 | p.text(',') | |
812 | p.breakable() |
|
811 | p.breakable() | |
813 | p.pretty(dict(obj)) |
|
812 | p.pretty(dict(obj)) | |
814 |
|
813 | |||
815 | def _ordereddict_pprint(obj, p, cycle): |
|
814 | def _ordereddict_pprint(obj, p, cycle): | |
816 | name = obj.__class__.__name__ |
|
815 | name = obj.__class__.__name__ | |
817 | with p.group(len(name) + 1, name + '(', ')'): |
|
816 | with p.group(len(name) + 1, name + '(', ')'): | |
818 | if cycle: |
|
817 | if cycle: | |
819 | p.text('...') |
|
818 | p.text('...') | |
820 | elif len(obj): |
|
819 | elif len(obj): | |
821 | p.pretty(list(obj.items())) |
|
820 | p.pretty(list(obj.items())) | |
822 |
|
821 | |||
823 | def _deque_pprint(obj, p, cycle): |
|
822 | def _deque_pprint(obj, p, cycle): | |
824 | name = obj.__class__.__name__ |
|
823 | name = obj.__class__.__name__ | |
825 | with p.group(len(name) + 1, name + '(', ')'): |
|
824 | with p.group(len(name) + 1, name + '(', ')'): | |
826 | if cycle: |
|
825 | if cycle: | |
827 | p.text('...') |
|
826 | p.text('...') | |
828 | else: |
|
827 | else: | |
829 | p.pretty(list(obj)) |
|
828 | p.pretty(list(obj)) | |
830 |
|
829 | |||
831 |
|
830 | |||
832 | def _counter_pprint(obj, p, cycle): |
|
831 | def _counter_pprint(obj, p, cycle): | |
833 | name = obj.__class__.__name__ |
|
832 | name = obj.__class__.__name__ | |
834 | with p.group(len(name) + 1, name + '(', ')'): |
|
833 | with p.group(len(name) + 1, name + '(', ')'): | |
835 | if cycle: |
|
834 | if cycle: | |
836 | p.text('...') |
|
835 | p.text('...') | |
837 | elif len(obj): |
|
836 | elif len(obj): | |
838 | p.pretty(dict(obj)) |
|
837 | p.pretty(dict(obj)) | |
839 |
|
838 | |||
840 | for_type_by_name('collections', 'defaultdict', _defaultdict_pprint) |
|
839 | for_type_by_name('collections', 'defaultdict', _defaultdict_pprint) | |
841 | for_type_by_name('collections', 'OrderedDict', _ordereddict_pprint) |
|
840 | for_type_by_name('collections', 'OrderedDict', _ordereddict_pprint) | |
842 | for_type_by_name('collections', 'deque', _deque_pprint) |
|
841 | for_type_by_name('collections', 'deque', _deque_pprint) | |
843 | for_type_by_name('collections', 'Counter', _counter_pprint) |
|
842 | for_type_by_name('collections', 'Counter', _counter_pprint) | |
844 |
|
843 | |||
845 | if __name__ == '__main__': |
|
844 | if __name__ == '__main__': | |
846 | from random import randrange |
|
845 | from random import randrange | |
847 | class Foo(object): |
|
846 | class Foo(object): | |
848 | def __init__(self): |
|
847 | def __init__(self): | |
849 | self.foo = 1 |
|
848 | self.foo = 1 | |
850 | self.bar = re.compile(r'\s+') |
|
849 | self.bar = re.compile(r'\s+') | |
851 | self.blub = dict.fromkeys(range(30), randrange(1, 40)) |
|
850 | self.blub = dict.fromkeys(range(30), randrange(1, 40)) | |
852 | self.hehe = 23424.234234 |
|
851 | self.hehe = 23424.234234 | |
853 | self.list = ["blub", "blah", self] |
|
852 | self.list = ["blub", "blah", self] | |
854 |
|
853 | |||
855 | def get_foo(self): |
|
854 | def get_foo(self): | |
856 | print("foo") |
|
855 | print("foo") | |
857 |
|
856 | |||
858 | pprint(Foo(), verbose=True) |
|
857 | pprint(Foo(), verbose=True) |
General Comments 0
You need to be logged in to leave comments.
Login now