Show More
@@ -0,0 +1,12 b'' | |||||
|
1 | try: | |||
|
2 | import argparse | |||
|
3 | # Workaround an argparse bug, FIXED in argparse 1.1.0 | |||
|
4 | if 'RawTextHelpFormatterArgumentDefaultsHelpFormatter' in argparse.__all__: | |||
|
5 | import itertools | |||
|
6 | argparse.__all__ = list(itertools.chain( [i for i in argparse.__all__ | |||
|
7 | if i != 'RawTextHelpFormatterArgumentDefaultsHelpFormatter'], | |||
|
8 | ['RawTextHelpFormatter', 'ArgumentDefaultsHelpFormatter'])) | |||
|
9 | argparse.__all__.append('SUPPRESS') | |||
|
10 | from argparse import * | |||
|
11 | except ImportError: | |||
|
12 | from _argparse import * |
@@ -0,0 +1,8 b'' | |||||
|
1 | try: | |||
|
2 | from decorator import * | |||
|
3 | from decorator import getinfo, new_wrapper | |||
|
4 | # the following funcion is deprecated so using the python own one | |||
|
5 | from functools import update_wrapper | |||
|
6 | except ImportError: | |||
|
7 | from _decorator import * | |||
|
8 | from _decorator import getinfo, update_wrapper, new_wrapper |
@@ -0,0 +1,4 b'' | |||||
|
1 | try: | |||
|
2 | from numpy.testing.decorators import * | |||
|
3 | except ImportError: | |||
|
4 | from _decorators import * |
@@ -0,0 +1,5 b'' | |||||
|
1 | try: | |||
|
2 | import pexpect | |||
|
3 | from pexpect import * | |||
|
4 | except ImportError: | |||
|
5 | from _pexpect import * |
@@ -0,0 +1,4 b'' | |||||
|
1 | try: | |||
|
2 | from simplegeneric import * | |||
|
3 | except ImportError: | |||
|
4 | from _simplegeneric import * |
@@ -0,0 +1,8 b'' | |||||
|
1 | try: | |||
|
2 | import validate | |||
|
3 | if '__docformat__' in validate.__all__ and validate.__version__.split('.') >= ['1', '0', '1']: | |||
|
4 | # __docformat__ was removed in 1.0.1 but | |||
|
5 | validate.__all__ = [i for i in validate.__all__ if i != '__docformat__'] | |||
|
6 | from validate import * | |||
|
7 | except ImportError: | |||
|
8 | from _validate import * |
@@ -1,557 +1,557 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Display formatters. |
|
2 | """Display formatters. | |
3 |
|
3 | |||
4 |
|
4 | |||
5 | Authors: |
|
5 | Authors: | |
6 |
|
6 | |||
7 | * Robert Kern |
|
7 | * Robert Kern | |
8 | * Brian Granger |
|
8 | * Brian Granger | |
9 | """ |
|
9 | """ | |
10 | #----------------------------------------------------------------------------- |
|
10 | #----------------------------------------------------------------------------- | |
11 | # Copyright (c) 2010, IPython Development Team. |
|
11 | # Copyright (c) 2010, IPython Development Team. | |
12 | # |
|
12 | # | |
13 | # Distributed under the terms of the Modified BSD License. |
|
13 | # Distributed under the terms of the Modified BSD License. | |
14 | # |
|
14 | # | |
15 | # The full license is in the file COPYING.txt, distributed with this software. |
|
15 | # The full license is in the file COPYING.txt, distributed with this software. | |
16 | #----------------------------------------------------------------------------- |
|
16 | #----------------------------------------------------------------------------- | |
17 |
|
17 | |||
18 | #----------------------------------------------------------------------------- |
|
18 | #----------------------------------------------------------------------------- | |
19 | # Imports |
|
19 | # Imports | |
20 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
21 |
|
21 | |||
22 | # Stdlib imports |
|
22 | # Stdlib imports | |
23 | import abc |
|
23 | import abc | |
24 | import sys |
|
24 | import sys | |
25 | # We must use StringIO, as cStringIO doesn't handle unicode properly. |
|
25 | # We must use StringIO, as cStringIO doesn't handle unicode properly. | |
26 | from StringIO import StringIO |
|
26 | from StringIO import StringIO | |
27 |
|
27 | |||
28 | # Our own imports |
|
28 | # Our own imports | |
29 | from IPython.config.configurable import Configurable |
|
29 | from IPython.config.configurable import Configurable | |
30 |
from IPython. |
|
30 | from IPython.lib import pretty | |
31 | from IPython.utils.traitlets import Bool, Dict, Int, Str, CStr |
|
31 | from IPython.utils.traitlets import Bool, Dict, Int, Str, CStr | |
32 |
|
32 | |||
33 |
|
33 | |||
34 | #----------------------------------------------------------------------------- |
|
34 | #----------------------------------------------------------------------------- | |
35 | # The main DisplayFormatter class |
|
35 | # The main DisplayFormatter class | |
36 | #----------------------------------------------------------------------------- |
|
36 | #----------------------------------------------------------------------------- | |
37 |
|
37 | |||
38 |
|
38 | |||
39 | class DisplayFormatter(Configurable): |
|
39 | class DisplayFormatter(Configurable): | |
40 |
|
40 | |||
41 | # When set to true only the default plain text formatter will be used. |
|
41 | # When set to true only the default plain text formatter will be used. | |
42 | plain_text_only = Bool(False, config=True) |
|
42 | plain_text_only = Bool(False, config=True) | |
43 |
|
43 | |||
44 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
44 | # A dict of formatter whose keys are format types (MIME types) and whose | |
45 | # values are subclasses of BaseFormatter. |
|
45 | # values are subclasses of BaseFormatter. | |
46 | formatters = Dict(config=True) |
|
46 | formatters = Dict(config=True) | |
47 | def _formatters_default(self): |
|
47 | def _formatters_default(self): | |
48 | """Activate the default formatters.""" |
|
48 | """Activate the default formatters.""" | |
49 | formatter_classes = [ |
|
49 | formatter_classes = [ | |
50 | PlainTextFormatter, |
|
50 | PlainTextFormatter, | |
51 | HTMLFormatter, |
|
51 | HTMLFormatter, | |
52 | SVGFormatter, |
|
52 | SVGFormatter, | |
53 | PNGFormatter, |
|
53 | PNGFormatter, | |
54 | LatexFormatter, |
|
54 | LatexFormatter, | |
55 | JSONFormatter |
|
55 | JSONFormatter | |
56 | ] |
|
56 | ] | |
57 | d = {} |
|
57 | d = {} | |
58 | for cls in formatter_classes: |
|
58 | for cls in formatter_classes: | |
59 | f = cls(config=self.config) |
|
59 | f = cls(config=self.config) | |
60 | d[f.format_type] = f |
|
60 | d[f.format_type] = f | |
61 | return d |
|
61 | return d | |
62 |
|
62 | |||
63 | def format(self, obj, include=None, exclude=None): |
|
63 | def format(self, obj, include=None, exclude=None): | |
64 | """Return a format data dict for an object. |
|
64 | """Return a format data dict for an object. | |
65 |
|
65 | |||
66 | By default all format types will be computed. |
|
66 | By default all format types will be computed. | |
67 |
|
67 | |||
68 | The following MIME types are currently implemented: |
|
68 | The following MIME types are currently implemented: | |
69 |
|
69 | |||
70 | * text/plain |
|
70 | * text/plain | |
71 | * text/html |
|
71 | * text/html | |
72 | * text/latex |
|
72 | * text/latex | |
73 | * application/json |
|
73 | * application/json | |
74 | * image/png |
|
74 | * image/png | |
75 | * immage/svg+xml |
|
75 | * immage/svg+xml | |
76 |
|
76 | |||
77 | Parameters |
|
77 | Parameters | |
78 | ---------- |
|
78 | ---------- | |
79 | obj : object |
|
79 | obj : object | |
80 | The Python object whose format data will be computed. |
|
80 | The Python object whose format data will be computed. | |
81 | include : list or tuple, optional |
|
81 | include : list or tuple, optional | |
82 | A list of format type strings (MIME types) to include in the |
|
82 | A list of format type strings (MIME types) to include in the | |
83 | format data dict. If this is set *only* the format types included |
|
83 | format data dict. If this is set *only* the format types included | |
84 | in this list will be computed. |
|
84 | in this list will be computed. | |
85 | exclude : list or tuple, optional |
|
85 | exclude : list or tuple, optional | |
86 | A list of format type string (MIME types) to exclue in the format |
|
86 | A list of format type string (MIME types) to exclue in the format | |
87 | data dict. If this is set all format types will be computed, |
|
87 | data dict. If this is set all format types will be computed, | |
88 | except for those included in this argument. |
|
88 | except for those included in this argument. | |
89 |
|
89 | |||
90 | Returns |
|
90 | Returns | |
91 | ------- |
|
91 | ------- | |
92 | format_dict : dict |
|
92 | format_dict : dict | |
93 | A dictionary of key/value pairs, one or each format that was |
|
93 | A dictionary of key/value pairs, one or each format that was | |
94 | generated for the object. The keys are the format types, which |
|
94 | generated for the object. The keys are the format types, which | |
95 | will usually be MIME type strings and the values and JSON'able |
|
95 | will usually be MIME type strings and the values and JSON'able | |
96 | data structure containing the raw data for the representation in |
|
96 | data structure containing the raw data for the representation in | |
97 | that format. |
|
97 | that format. | |
98 | """ |
|
98 | """ | |
99 | format_dict = {} |
|
99 | format_dict = {} | |
100 |
|
100 | |||
101 | # If plain text only is active |
|
101 | # If plain text only is active | |
102 | if self.plain_text_only: |
|
102 | if self.plain_text_only: | |
103 | formatter = self.formatters['text/plain'] |
|
103 | formatter = self.formatters['text/plain'] | |
104 | try: |
|
104 | try: | |
105 | data = formatter(obj) |
|
105 | data = formatter(obj) | |
106 | except: |
|
106 | except: | |
107 | # FIXME: log the exception |
|
107 | # FIXME: log the exception | |
108 | raise |
|
108 | raise | |
109 | if data is not None: |
|
109 | if data is not None: | |
110 | format_dict['text/plain'] = data |
|
110 | format_dict['text/plain'] = data | |
111 | return format_dict |
|
111 | return format_dict | |
112 |
|
112 | |||
113 | for format_type, formatter in self.formatters.items(): |
|
113 | for format_type, formatter in self.formatters.items(): | |
114 | if include is not None: |
|
114 | if include is not None: | |
115 | if format_type not in include: |
|
115 | if format_type not in include: | |
116 | continue |
|
116 | continue | |
117 | if exclude is not None: |
|
117 | if exclude is not None: | |
118 | if format_type in exclude: |
|
118 | if format_type in exclude: | |
119 | continue |
|
119 | continue | |
120 | try: |
|
120 | try: | |
121 | data = formatter(obj) |
|
121 | data = formatter(obj) | |
122 | except: |
|
122 | except: | |
123 | # FIXME: log the exception |
|
123 | # FIXME: log the exception | |
124 | raise |
|
124 | raise | |
125 | if data is not None: |
|
125 | if data is not None: | |
126 | format_dict[format_type] = data |
|
126 | format_dict[format_type] = data | |
127 | return format_dict |
|
127 | return format_dict | |
128 |
|
128 | |||
129 | @property |
|
129 | @property | |
130 | def format_types(self): |
|
130 | def format_types(self): | |
131 | """Return the format types (MIME types) of the active formatters.""" |
|
131 | """Return the format types (MIME types) of the active formatters.""" | |
132 | return self.formatters.keys() |
|
132 | return self.formatters.keys() | |
133 |
|
133 | |||
134 |
|
134 | |||
135 | #----------------------------------------------------------------------------- |
|
135 | #----------------------------------------------------------------------------- | |
136 | # Formatters for specific format types (text, html, svg, etc.) |
|
136 | # Formatters for specific format types (text, html, svg, etc.) | |
137 | #----------------------------------------------------------------------------- |
|
137 | #----------------------------------------------------------------------------- | |
138 |
|
138 | |||
139 |
|
139 | |||
140 | class FormatterABC(object): |
|
140 | class FormatterABC(object): | |
141 | """ Abstract base class for Formatters. |
|
141 | """ Abstract base class for Formatters. | |
142 |
|
142 | |||
143 | A formatter is a callable class that is responsible for computing the |
|
143 | A formatter is a callable class that is responsible for computing the | |
144 | raw format data for a particular format type (MIME type). For example, |
|
144 | raw format data for a particular format type (MIME type). For example, | |
145 | an HTML formatter would have a format type of `text/html` and would return |
|
145 | an HTML formatter would have a format type of `text/html` and would return | |
146 | the HTML representation of the object when called. |
|
146 | the HTML representation of the object when called. | |
147 | """ |
|
147 | """ | |
148 | __metaclass__ = abc.ABCMeta |
|
148 | __metaclass__ = abc.ABCMeta | |
149 |
|
149 | |||
150 | # The format type of the data returned, usually a MIME type. |
|
150 | # The format type of the data returned, usually a MIME type. | |
151 | format_type = 'text/plain' |
|
151 | format_type = 'text/plain' | |
152 |
|
152 | |||
153 | # Is the formatter enabled... |
|
153 | # Is the formatter enabled... | |
154 | enabled = True |
|
154 | enabled = True | |
155 |
|
155 | |||
156 | @abc.abstractmethod |
|
156 | @abc.abstractmethod | |
157 | def __call__(self, obj): |
|
157 | def __call__(self, obj): | |
158 | """Return a JSON'able representation of the object. |
|
158 | """Return a JSON'able representation of the object. | |
159 |
|
159 | |||
160 | If the object cannot be formatted by this formatter, then return None |
|
160 | If the object cannot be formatted by this formatter, then return None | |
161 | """ |
|
161 | """ | |
162 | try: |
|
162 | try: | |
163 | return repr(obj) |
|
163 | return repr(obj) | |
164 | except TypeError: |
|
164 | except TypeError: | |
165 | return None |
|
165 | return None | |
166 |
|
166 | |||
167 |
|
167 | |||
168 | class BaseFormatter(Configurable): |
|
168 | class BaseFormatter(Configurable): | |
169 | """A base formatter class that is configurable. |
|
169 | """A base formatter class that is configurable. | |
170 |
|
170 | |||
171 | This formatter should usually be used as the base class of all formatters. |
|
171 | This formatter should usually be used as the base class of all formatters. | |
172 | It is a traited :class:`Configurable` class and includes an extensible |
|
172 | It is a traited :class:`Configurable` class and includes an extensible | |
173 | API for users to determine how their objects are formatted. The following |
|
173 | API for users to determine how their objects are formatted. The following | |
174 | logic is used to find a function to format an given object. |
|
174 | logic is used to find a function to format an given object. | |
175 |
|
175 | |||
176 | 1. The object is introspected to see if it has a method with the name |
|
176 | 1. The object is introspected to see if it has a method with the name | |
177 | :attr:`print_method`. If is does, that object is passed to that method |
|
177 | :attr:`print_method`. If is does, that object is passed to that method | |
178 | for formatting. |
|
178 | for formatting. | |
179 | 2. If no print method is found, three internal dictionaries are consulted |
|
179 | 2. If no print method is found, three internal dictionaries are consulted | |
180 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
180 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` | |
181 | and :attr:`deferred_printers`. |
|
181 | and :attr:`deferred_printers`. | |
182 |
|
182 | |||
183 | Users should use these dictionaries to register functions that will be |
|
183 | Users should use these dictionaries to register functions that will be | |
184 | used to compute the format data for their objects (if those objects don't |
|
184 | used to compute the format data for their objects (if those objects don't | |
185 | have the special print methods). The easiest way of using these |
|
185 | have the special print methods). The easiest way of using these | |
186 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
186 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` | |
187 | methods. |
|
187 | methods. | |
188 |
|
188 | |||
189 | If no function/callable is found to compute the format data, ``None`` is |
|
189 | If no function/callable is found to compute the format data, ``None`` is | |
190 | returned and this format type is not used. |
|
190 | returned and this format type is not used. | |
191 | """ |
|
191 | """ | |
192 |
|
192 | |||
193 | format_type = Str('text/plain') |
|
193 | format_type = Str('text/plain') | |
194 |
|
194 | |||
195 | enabled = Bool(True, config=True) |
|
195 | enabled = Bool(True, config=True) | |
196 |
|
196 | |||
197 | print_method = Str('__repr__') |
|
197 | print_method = Str('__repr__') | |
198 |
|
198 | |||
199 | # The singleton printers. |
|
199 | # The singleton printers. | |
200 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
200 | # Maps the IDs of the builtin singleton objects to the format functions. | |
201 | singleton_printers = Dict(config=True) |
|
201 | singleton_printers = Dict(config=True) | |
202 | def _singleton_printers_default(self): |
|
202 | def _singleton_printers_default(self): | |
203 | return {} |
|
203 | return {} | |
204 |
|
204 | |||
205 | # The type-specific printers. |
|
205 | # The type-specific printers. | |
206 | # Map type objects to the format functions. |
|
206 | # Map type objects to the format functions. | |
207 | type_printers = Dict(config=True) |
|
207 | type_printers = Dict(config=True) | |
208 | def _type_printers_default(self): |
|
208 | def _type_printers_default(self): | |
209 | return {} |
|
209 | return {} | |
210 |
|
210 | |||
211 | # The deferred-import type-specific printers. |
|
211 | # The deferred-import type-specific printers. | |
212 | # Map (modulename, classname) pairs to the format functions. |
|
212 | # Map (modulename, classname) pairs to the format functions. | |
213 | deferred_printers = Dict(config=True) |
|
213 | deferred_printers = Dict(config=True) | |
214 | def _deferred_printers_default(self): |
|
214 | def _deferred_printers_default(self): | |
215 | return {} |
|
215 | return {} | |
216 |
|
216 | |||
217 | def __call__(self, obj): |
|
217 | def __call__(self, obj): | |
218 | """Compute the format for an object.""" |
|
218 | """Compute the format for an object.""" | |
219 | if self.enabled: |
|
219 | if self.enabled: | |
220 | obj_id = id(obj) |
|
220 | obj_id = id(obj) | |
221 | try: |
|
221 | try: | |
222 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
222 | obj_class = getattr(obj, '__class__', None) or type(obj) | |
223 | if hasattr(obj_class, self.print_method): |
|
223 | if hasattr(obj_class, self.print_method): | |
224 | printer = getattr(obj_class, self.print_method) |
|
224 | printer = getattr(obj_class, self.print_method) | |
225 | return printer(obj) |
|
225 | return printer(obj) | |
226 | try: |
|
226 | try: | |
227 | printer = self.singleton_printers[obj_id] |
|
227 | printer = self.singleton_printers[obj_id] | |
228 | except (TypeError, KeyError): |
|
228 | except (TypeError, KeyError): | |
229 | pass |
|
229 | pass | |
230 | else: |
|
230 | else: | |
231 | return printer(obj) |
|
231 | return printer(obj) | |
232 | for cls in pretty._get_mro(obj_class): |
|
232 | for cls in pretty._get_mro(obj_class): | |
233 | if cls in self.type_printers: |
|
233 | if cls in self.type_printers: | |
234 | return self.type_printers[cls](obj) |
|
234 | return self.type_printers[cls](obj) | |
235 | else: |
|
235 | else: | |
236 | printer = self._in_deferred_types(cls) |
|
236 | printer = self._in_deferred_types(cls) | |
237 | if printer is not None: |
|
237 | if printer is not None: | |
238 | return printer(obj) |
|
238 | return printer(obj) | |
239 | return None |
|
239 | return None | |
240 | except Exception: |
|
240 | except Exception: | |
241 | pass |
|
241 | pass | |
242 | else: |
|
242 | else: | |
243 | return None |
|
243 | return None | |
244 |
|
244 | |||
245 | def for_type(self, typ, func): |
|
245 | def for_type(self, typ, func): | |
246 | """Add a format function for a given type. |
|
246 | """Add a format function for a given type. | |
247 |
|
247 | |||
248 | Parameters |
|
248 | Parameters | |
249 | ----------- |
|
249 | ----------- | |
250 | typ : class |
|
250 | typ : class | |
251 | The class of the object that will be formatted using `func`. |
|
251 | The class of the object that will be formatted using `func`. | |
252 | func : callable |
|
252 | func : callable | |
253 | The callable that will be called to compute the format data. The |
|
253 | The callable that will be called to compute the format data. The | |
254 | call signature of this function is simple, it must take the |
|
254 | call signature of this function is simple, it must take the | |
255 | object to be formatted and return the raw data for the given |
|
255 | object to be formatted and return the raw data for the given | |
256 | format. Subclasses may use a different call signature for the |
|
256 | format. Subclasses may use a different call signature for the | |
257 | `func` argument. |
|
257 | `func` argument. | |
258 | """ |
|
258 | """ | |
259 | oldfunc = self.type_printers.get(typ, None) |
|
259 | oldfunc = self.type_printers.get(typ, None) | |
260 | if func is not None: |
|
260 | if func is not None: | |
261 | # To support easy restoration of old printers, we need to ignore |
|
261 | # To support easy restoration of old printers, we need to ignore | |
262 | # Nones. |
|
262 | # Nones. | |
263 | self.type_printers[typ] = func |
|
263 | self.type_printers[typ] = func | |
264 | return oldfunc |
|
264 | return oldfunc | |
265 |
|
265 | |||
266 | def for_type_by_name(self, type_module, type_name, func): |
|
266 | def for_type_by_name(self, type_module, type_name, func): | |
267 | """Add a format function for a type specified by the full dotted |
|
267 | """Add a format function for a type specified by the full dotted | |
268 | module and name of the type, rather than the type of the object. |
|
268 | module and name of the type, rather than the type of the object. | |
269 |
|
269 | |||
270 | Parameters |
|
270 | Parameters | |
271 | ---------- |
|
271 | ---------- | |
272 | type_module : str |
|
272 | type_module : str | |
273 | The full dotted name of the module the type is defined in, like |
|
273 | The full dotted name of the module the type is defined in, like | |
274 | ``numpy``. |
|
274 | ``numpy``. | |
275 | type_name : str |
|
275 | type_name : str | |
276 | The name of the type (the class name), like ``dtype`` |
|
276 | The name of the type (the class name), like ``dtype`` | |
277 | func : callable |
|
277 | func : callable | |
278 | The callable that will be called to compute the format data. The |
|
278 | The callable that will be called to compute the format data. The | |
279 | call signature of this function is simple, it must take the |
|
279 | call signature of this function is simple, it must take the | |
280 | object to be formatted and return the raw data for the given |
|
280 | object to be formatted and return the raw data for the given | |
281 | format. Subclasses may use a different call signature for the |
|
281 | format. Subclasses may use a different call signature for the | |
282 | `func` argument. |
|
282 | `func` argument. | |
283 | """ |
|
283 | """ | |
284 | key = (type_module, type_name) |
|
284 | key = (type_module, type_name) | |
285 | oldfunc = self.deferred_printers.get(key, None) |
|
285 | oldfunc = self.deferred_printers.get(key, None) | |
286 | if func is not None: |
|
286 | if func is not None: | |
287 | # To support easy restoration of old printers, we need to ignore |
|
287 | # To support easy restoration of old printers, we need to ignore | |
288 | # Nones. |
|
288 | # Nones. | |
289 | self.deferred_printers[key] = func |
|
289 | self.deferred_printers[key] = func | |
290 | return oldfunc |
|
290 | return oldfunc | |
291 |
|
291 | |||
292 | def _in_deferred_types(self, cls): |
|
292 | def _in_deferred_types(self, cls): | |
293 | """ |
|
293 | """ | |
294 | Check if the given class is specified in the deferred type registry. |
|
294 | Check if the given class is specified in the deferred type registry. | |
295 |
|
295 | |||
296 | Returns the printer from the registry if it exists, and None if the |
|
296 | Returns the printer from the registry if it exists, and None if the | |
297 | class is not in the registry. Successful matches will be moved to the |
|
297 | class is not in the registry. Successful matches will be moved to the | |
298 | regular type registry for future use. |
|
298 | regular type registry for future use. | |
299 | """ |
|
299 | """ | |
300 | mod = getattr(cls, '__module__', None) |
|
300 | mod = getattr(cls, '__module__', None) | |
301 | name = getattr(cls, '__name__', None) |
|
301 | name = getattr(cls, '__name__', None) | |
302 | key = (mod, name) |
|
302 | key = (mod, name) | |
303 | printer = None |
|
303 | printer = None | |
304 | if key in self.deferred_printers: |
|
304 | if key in self.deferred_printers: | |
305 | # Move the printer over to the regular registry. |
|
305 | # Move the printer over to the regular registry. | |
306 | printer = self.deferred_printers.pop(key) |
|
306 | printer = self.deferred_printers.pop(key) | |
307 | self.type_printers[cls] = printer |
|
307 | self.type_printers[cls] = printer | |
308 | return printer |
|
308 | return printer | |
309 |
|
309 | |||
310 |
|
310 | |||
311 | class PlainTextFormatter(BaseFormatter): |
|
311 | class PlainTextFormatter(BaseFormatter): | |
312 | """The default pretty-printer. |
|
312 | """The default pretty-printer. | |
313 |
|
313 | |||
314 | This uses :mod:`IPython.external.pretty` to compute the format data of |
|
314 | This uses :mod:`IPython.external.pretty` to compute the format data of | |
315 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
315 | the object. If the object cannot be pretty printed, :func:`repr` is used. | |
316 | See the documentation of :mod:`IPython.external.pretty` for details on |
|
316 | See the documentation of :mod:`IPython.external.pretty` for details on | |
317 | how to write pretty printers. Here is a simple example:: |
|
317 | how to write pretty printers. Here is a simple example:: | |
318 |
|
318 | |||
319 | def dtype_pprinter(obj, p, cycle): |
|
319 | def dtype_pprinter(obj, p, cycle): | |
320 | if cycle: |
|
320 | if cycle: | |
321 | return p.text('dtype(...)') |
|
321 | return p.text('dtype(...)') | |
322 | if hasattr(obj, 'fields'): |
|
322 | if hasattr(obj, 'fields'): | |
323 | if obj.fields is None: |
|
323 | if obj.fields is None: | |
324 | p.text(repr(obj)) |
|
324 | p.text(repr(obj)) | |
325 | else: |
|
325 | else: | |
326 | p.begin_group(7, 'dtype([') |
|
326 | p.begin_group(7, 'dtype([') | |
327 | for i, field in enumerate(obj.descr): |
|
327 | for i, field in enumerate(obj.descr): | |
328 | if i > 0: |
|
328 | if i > 0: | |
329 | p.text(',') |
|
329 | p.text(',') | |
330 | p.breakable() |
|
330 | p.breakable() | |
331 | p.pretty(field) |
|
331 | p.pretty(field) | |
332 | p.end_group(7, '])') |
|
332 | p.end_group(7, '])') | |
333 | """ |
|
333 | """ | |
334 |
|
334 | |||
335 | # The format type of data returned. |
|
335 | # The format type of data returned. | |
336 | format_type = Str('text/plain') |
|
336 | format_type = Str('text/plain') | |
337 |
|
337 | |||
338 | # This subclass ignores this attribute as it always need to return |
|
338 | # This subclass ignores this attribute as it always need to return | |
339 | # something. |
|
339 | # something. | |
340 | enabled = Bool(True, config=False) |
|
340 | enabled = Bool(True, config=False) | |
341 |
|
341 | |||
342 | # Look for a __pretty__ methods to use for pretty printing. |
|
342 | # Look for a __pretty__ methods to use for pretty printing. | |
343 | print_method = Str('__pretty__') |
|
343 | print_method = Str('__pretty__') | |
344 |
|
344 | |||
345 | # Whether to pretty-print or not. |
|
345 | # Whether to pretty-print or not. | |
346 | pprint = Bool(True, config=True) |
|
346 | pprint = Bool(True, config=True) | |
347 |
|
347 | |||
348 | # Whether to be verbose or not. |
|
348 | # Whether to be verbose or not. | |
349 | verbose = Bool(False, config=True) |
|
349 | verbose = Bool(False, config=True) | |
350 |
|
350 | |||
351 | # The maximum width. |
|
351 | # The maximum width. | |
352 | max_width = Int(79, config=True) |
|
352 | max_width = Int(79, config=True) | |
353 |
|
353 | |||
354 | # The newline character. |
|
354 | # The newline character. | |
355 | newline = Str('\n', config=True) |
|
355 | newline = Str('\n', config=True) | |
356 |
|
356 | |||
357 | # format-string for pprinting floats |
|
357 | # format-string for pprinting floats | |
358 | float_format = Str('%r') |
|
358 | float_format = Str('%r') | |
359 | # setter for float precision, either int or direct format-string |
|
359 | # setter for float precision, either int or direct format-string | |
360 | float_precision = CStr('', config=True) |
|
360 | float_precision = CStr('', config=True) | |
361 |
|
361 | |||
362 | def _float_precision_changed(self, name, old, new): |
|
362 | def _float_precision_changed(self, name, old, new): | |
363 | """float_precision changed, set float_format accordingly. |
|
363 | """float_precision changed, set float_format accordingly. | |
364 |
|
364 | |||
365 | float_precision can be set by int or str. |
|
365 | float_precision can be set by int or str. | |
366 | This will set float_format, after interpreting input. |
|
366 | This will set float_format, after interpreting input. | |
367 | If numpy has been imported, numpy print precision will also be set. |
|
367 | If numpy has been imported, numpy print precision will also be set. | |
368 |
|
368 | |||
369 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
369 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
370 |
|
370 | |||
371 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
371 | An empty string returns to defaults (repr for float, 8 for numpy). | |
372 |
|
372 | |||
373 | This parameter can be set via the '%precision' magic. |
|
373 | This parameter can be set via the '%precision' magic. | |
374 | """ |
|
374 | """ | |
375 |
|
375 | |||
376 | if '%' in new: |
|
376 | if '%' in new: | |
377 | # got explicit format string |
|
377 | # got explicit format string | |
378 | fmt = new |
|
378 | fmt = new | |
379 | try: |
|
379 | try: | |
380 | fmt%3.14159 |
|
380 | fmt%3.14159 | |
381 | except Exception: |
|
381 | except Exception: | |
382 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
382 | raise ValueError("Precision must be int or format string, not %r"%new) | |
383 | elif new: |
|
383 | elif new: | |
384 | # otherwise, should be an int |
|
384 | # otherwise, should be an int | |
385 | try: |
|
385 | try: | |
386 | i = int(new) |
|
386 | i = int(new) | |
387 | assert i >= 0 |
|
387 | assert i >= 0 | |
388 | except ValueError: |
|
388 | except ValueError: | |
389 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
389 | raise ValueError("Precision must be int or format string, not %r"%new) | |
390 | except AssertionError: |
|
390 | except AssertionError: | |
391 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
391 | raise ValueError("int precision must be non-negative, not %r"%i) | |
392 |
|
392 | |||
393 | fmt = '%%.%if'%i |
|
393 | fmt = '%%.%if'%i | |
394 | if 'numpy' in sys.modules: |
|
394 | if 'numpy' in sys.modules: | |
395 | # set numpy precision if it has been imported |
|
395 | # set numpy precision if it has been imported | |
396 | import numpy |
|
396 | import numpy | |
397 | numpy.set_printoptions(precision=i) |
|
397 | numpy.set_printoptions(precision=i) | |
398 | else: |
|
398 | else: | |
399 | # default back to repr |
|
399 | # default back to repr | |
400 | fmt = '%r' |
|
400 | fmt = '%r' | |
401 | if 'numpy' in sys.modules: |
|
401 | if 'numpy' in sys.modules: | |
402 | import numpy |
|
402 | import numpy | |
403 | # numpy default is 8 |
|
403 | # numpy default is 8 | |
404 | numpy.set_printoptions(precision=8) |
|
404 | numpy.set_printoptions(precision=8) | |
405 | self.float_format = fmt |
|
405 | self.float_format = fmt | |
406 |
|
406 | |||
407 | # Use the default pretty printers from IPython.external.pretty. |
|
407 | # Use the default pretty printers from IPython.external.pretty. | |
408 | def _singleton_printers_default(self): |
|
408 | def _singleton_printers_default(self): | |
409 | return pretty._singleton_pprinters.copy() |
|
409 | return pretty._singleton_pprinters.copy() | |
410 |
|
410 | |||
411 | def _type_printers_default(self): |
|
411 | def _type_printers_default(self): | |
412 | d = pretty._type_pprinters.copy() |
|
412 | d = pretty._type_pprinters.copy() | |
413 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
413 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
414 | return d |
|
414 | return d | |
415 |
|
415 | |||
416 | def _deferred_printers_default(self): |
|
416 | def _deferred_printers_default(self): | |
417 | return pretty._deferred_type_pprinters.copy() |
|
417 | return pretty._deferred_type_pprinters.copy() | |
418 |
|
418 | |||
419 | #### FormatterABC interface #### |
|
419 | #### FormatterABC interface #### | |
420 |
|
420 | |||
421 | def __call__(self, obj): |
|
421 | def __call__(self, obj): | |
422 | """Compute the pretty representation of the object.""" |
|
422 | """Compute the pretty representation of the object.""" | |
423 | if not self.pprint: |
|
423 | if not self.pprint: | |
424 | try: |
|
424 | try: | |
425 | return repr(obj) |
|
425 | return repr(obj) | |
426 | except TypeError: |
|
426 | except TypeError: | |
427 | return '' |
|
427 | return '' | |
428 | else: |
|
428 | else: | |
429 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
429 | # This uses use StringIO, as cStringIO doesn't handle unicode. | |
430 | stream = StringIO() |
|
430 | stream = StringIO() | |
431 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
431 | printer = pretty.RepresentationPrinter(stream, self.verbose, | |
432 | self.max_width, self.newline, |
|
432 | self.max_width, self.newline, | |
433 | singleton_pprinters=self.singleton_printers, |
|
433 | singleton_pprinters=self.singleton_printers, | |
434 | type_pprinters=self.type_printers, |
|
434 | type_pprinters=self.type_printers, | |
435 | deferred_pprinters=self.deferred_printers) |
|
435 | deferred_pprinters=self.deferred_printers) | |
436 | printer.pretty(obj) |
|
436 | printer.pretty(obj) | |
437 | printer.flush() |
|
437 | printer.flush() | |
438 | return stream.getvalue() |
|
438 | return stream.getvalue() | |
439 |
|
439 | |||
440 |
|
440 | |||
441 | class HTMLFormatter(BaseFormatter): |
|
441 | class HTMLFormatter(BaseFormatter): | |
442 | """An HTML formatter. |
|
442 | """An HTML formatter. | |
443 |
|
443 | |||
444 | To define the callables that compute the HTML representation of your |
|
444 | To define the callables that compute the HTML representation of your | |
445 | objects, define a :meth:`__html__` method or use the :meth:`for_type` |
|
445 | objects, define a :meth:`__html__` method or use the :meth:`for_type` | |
446 | or :meth:`for_type_by_name` methods to register functions that handle |
|
446 | or :meth:`for_type_by_name` methods to register functions that handle | |
447 | this. |
|
447 | this. | |
448 | """ |
|
448 | """ | |
449 | format_type = Str('text/html') |
|
449 | format_type = Str('text/html') | |
450 |
|
450 | |||
451 | print_method = Str('__html__') |
|
451 | print_method = Str('__html__') | |
452 |
|
452 | |||
453 |
|
453 | |||
454 | class SVGFormatter(BaseFormatter): |
|
454 | class SVGFormatter(BaseFormatter): | |
455 | """An SVG formatter. |
|
455 | """An SVG formatter. | |
456 |
|
456 | |||
457 | To define the callables that compute the SVG representation of your |
|
457 | To define the callables that compute the SVG representation of your | |
458 | objects, define a :meth:`__svg__` method or use the :meth:`for_type` |
|
458 | objects, define a :meth:`__svg__` method or use the :meth:`for_type` | |
459 | or :meth:`for_type_by_name` methods to register functions that handle |
|
459 | or :meth:`for_type_by_name` methods to register functions that handle | |
460 | this. |
|
460 | this. | |
461 | """ |
|
461 | """ | |
462 | format_type = Str('image/svg+xml') |
|
462 | format_type = Str('image/svg+xml') | |
463 |
|
463 | |||
464 | print_method = Str('__svg__') |
|
464 | print_method = Str('__svg__') | |
465 |
|
465 | |||
466 |
|
466 | |||
467 | class PNGFormatter(BaseFormatter): |
|
467 | class PNGFormatter(BaseFormatter): | |
468 | """A PNG formatter. |
|
468 | """A PNG formatter. | |
469 |
|
469 | |||
470 | To define the callables that compute the PNG representation of your |
|
470 | To define the callables that compute the PNG representation of your | |
471 | objects, define a :meth:`__png__` method or use the :meth:`for_type` |
|
471 | objects, define a :meth:`__png__` method or use the :meth:`for_type` | |
472 | or :meth:`for_type_by_name` methods to register functions that handle |
|
472 | or :meth:`for_type_by_name` methods to register functions that handle | |
473 | this. The raw data should be the base64 encoded raw png data. |
|
473 | this. The raw data should be the base64 encoded raw png data. | |
474 | """ |
|
474 | """ | |
475 | format_type = Str('image/png') |
|
475 | format_type = Str('image/png') | |
476 |
|
476 | |||
477 | print_method = Str('__png__') |
|
477 | print_method = Str('__png__') | |
478 |
|
478 | |||
479 |
|
479 | |||
480 | class LatexFormatter(BaseFormatter): |
|
480 | class LatexFormatter(BaseFormatter): | |
481 | """A LaTeX formatter. |
|
481 | """A LaTeX formatter. | |
482 |
|
482 | |||
483 | To define the callables that compute the LaTeX representation of your |
|
483 | To define the callables that compute the LaTeX representation of your | |
484 | objects, define a :meth:`__latex__` method or use the :meth:`for_type` |
|
484 | objects, define a :meth:`__latex__` method or use the :meth:`for_type` | |
485 | or :meth:`for_type_by_name` methods to register functions that handle |
|
485 | or :meth:`for_type_by_name` methods to register functions that handle | |
486 | this. |
|
486 | this. | |
487 | """ |
|
487 | """ | |
488 | format_type = Str('text/latex') |
|
488 | format_type = Str('text/latex') | |
489 |
|
489 | |||
490 | print_method = Str('__latex__') |
|
490 | print_method = Str('__latex__') | |
491 |
|
491 | |||
492 |
|
492 | |||
493 | class JSONFormatter(BaseFormatter): |
|
493 | class JSONFormatter(BaseFormatter): | |
494 | """A JSON string formatter. |
|
494 | """A JSON string formatter. | |
495 |
|
495 | |||
496 | To define the callables that compute the JSON string representation of |
|
496 | To define the callables that compute the JSON string representation of | |
497 | your objects, define a :meth:`__json__` method or use the :meth:`for_type` |
|
497 | your objects, define a :meth:`__json__` method or use the :meth:`for_type` | |
498 | or :meth:`for_type_by_name` methods to register functions that handle |
|
498 | or :meth:`for_type_by_name` methods to register functions that handle | |
499 | this. |
|
499 | this. | |
500 | """ |
|
500 | """ | |
501 | format_type = Str('application/json') |
|
501 | format_type = Str('application/json') | |
502 |
|
502 | |||
503 | print_method = Str('__json__') |
|
503 | print_method = Str('__json__') | |
504 |
|
504 | |||
505 |
|
505 | |||
506 | FormatterABC.register(BaseFormatter) |
|
506 | FormatterABC.register(BaseFormatter) | |
507 | FormatterABC.register(PlainTextFormatter) |
|
507 | FormatterABC.register(PlainTextFormatter) | |
508 | FormatterABC.register(HTMLFormatter) |
|
508 | FormatterABC.register(HTMLFormatter) | |
509 | FormatterABC.register(SVGFormatter) |
|
509 | FormatterABC.register(SVGFormatter) | |
510 | FormatterABC.register(PNGFormatter) |
|
510 | FormatterABC.register(PNGFormatter) | |
511 | FormatterABC.register(LatexFormatter) |
|
511 | FormatterABC.register(LatexFormatter) | |
512 | FormatterABC.register(JSONFormatter) |
|
512 | FormatterABC.register(JSONFormatter) | |
513 |
|
513 | |||
514 |
|
514 | |||
515 | def format_display_data(obj, include=None, exclude=None): |
|
515 | def format_display_data(obj, include=None, exclude=None): | |
516 | """Return a format data dict for an object. |
|
516 | """Return a format data dict for an object. | |
517 |
|
517 | |||
518 | By default all format types will be computed. |
|
518 | By default all format types will be computed. | |
519 |
|
519 | |||
520 | The following MIME types are currently implemented: |
|
520 | The following MIME types are currently implemented: | |
521 |
|
521 | |||
522 | * text/plain |
|
522 | * text/plain | |
523 | * text/html |
|
523 | * text/html | |
524 | * text/latex |
|
524 | * text/latex | |
525 | * application/json |
|
525 | * application/json | |
526 | * image/png |
|
526 | * image/png | |
527 | * immage/svg+xml |
|
527 | * immage/svg+xml | |
528 |
|
528 | |||
529 | Parameters |
|
529 | Parameters | |
530 | ---------- |
|
530 | ---------- | |
531 | obj : object |
|
531 | obj : object | |
532 | The Python object whose format data will be computed. |
|
532 | The Python object whose format data will be computed. | |
533 |
|
533 | |||
534 | Returns |
|
534 | Returns | |
535 | ------- |
|
535 | ------- | |
536 | format_dict : dict |
|
536 | format_dict : dict | |
537 | A dictionary of key/value pairs, one or each format that was |
|
537 | A dictionary of key/value pairs, one or each format that was | |
538 | generated for the object. The keys are the format types, which |
|
538 | generated for the object. The keys are the format types, which | |
539 | will usually be MIME type strings and the values and JSON'able |
|
539 | will usually be MIME type strings and the values and JSON'able | |
540 | data structure containing the raw data for the representation in |
|
540 | data structure containing the raw data for the representation in | |
541 | that format. |
|
541 | that format. | |
542 | include : list or tuple, optional |
|
542 | include : list or tuple, optional | |
543 | A list of format type strings (MIME types) to include in the |
|
543 | A list of format type strings (MIME types) to include in the | |
544 | format data dict. If this is set *only* the format types included |
|
544 | format data dict. If this is set *only* the format types included | |
545 | in this list will be computed. |
|
545 | in this list will be computed. | |
546 | exclude : list or tuple, optional |
|
546 | exclude : list or tuple, optional | |
547 | A list of format type string (MIME types) to exclue in the format |
|
547 | A list of format type string (MIME types) to exclue in the format | |
548 | data dict. If this is set all format types will be computed, |
|
548 | data dict. If this is set all format types will be computed, | |
549 | except for those included in this argument. |
|
549 | except for those included in this argument. | |
550 | """ |
|
550 | """ | |
551 | from IPython.core.interactiveshell import InteractiveShell |
|
551 | from IPython.core.interactiveshell import InteractiveShell | |
552 |
|
552 | |||
553 | InteractiveShell.instance().display_formatter.format( |
|
553 | InteractiveShell.instance().display_formatter.format( | |
554 | obj, |
|
554 | obj, | |
555 | include, |
|
555 | include, | |
556 | exclude |
|
556 | exclude | |
557 | ) |
|
557 | ) |
1 | NO CONTENT: file renamed from IPython/external/Itpl.py to IPython/external/Itpl/_Itpl.py |
|
NO CONTENT: file renamed from IPython/external/Itpl.py to IPython/external/Itpl/_Itpl.py |
@@ -1,2329 +1,2311 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # Author: Steven J. Bethard <steven.bethard@gmail.com>. | |
2 |
|
||||
3 | # Copyright © 2006-2009 Steven J. Bethard <steven.bethard@gmail.com>. |
|
|||
4 | # |
|
|||
5 | # Licensed under the Apache License, Version 2.0 (the "License"); you may not |
|
|||
6 | # use this file except in compliance with the License. You may obtain a copy |
|
|||
7 | # of the License at |
|
|||
8 | # |
|
|||
9 | # http://www.apache.org/licenses/LICENSE-2.0 |
|
|||
10 | # |
|
|||
11 | # Unless required by applicable law or agreed to in writing, software |
|
|||
12 | # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT |
|
|||
13 | # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the |
|
|||
14 | # License for the specific language governing permissions and limitations |
|
|||
15 | # under the License. |
|
|||
16 |
|
2 | |||
17 | """Command-line parsing library |
|
3 | """Command-line parsing library | |
18 |
|
4 | |||
19 | This module is an optparse-inspired command-line parsing library that: |
|
5 | This module is an optparse-inspired command-line parsing library that: | |
20 |
|
6 | |||
21 | - handles both optional and positional arguments |
|
7 | - handles both optional and positional arguments | |
22 | - produces highly informative usage messages |
|
8 | - produces highly informative usage messages | |
23 | - supports parsers that dispatch to sub-parsers |
|
9 | - supports parsers that dispatch to sub-parsers | |
24 |
|
10 | |||
25 | The following is a simple usage example that sums integers from the |
|
11 | The following is a simple usage example that sums integers from the | |
26 | command-line and writes the result to a file:: |
|
12 | command-line and writes the result to a file:: | |
27 |
|
13 | |||
28 | parser = argparse.ArgumentParser( |
|
14 | parser = argparse.ArgumentParser( | |
29 | description='sum the integers at the command line') |
|
15 | description='sum the integers at the command line') | |
30 | parser.add_argument( |
|
16 | parser.add_argument( | |
31 | 'integers', metavar='int', nargs='+', type=int, |
|
17 | 'integers', metavar='int', nargs='+', type=int, | |
32 | help='an integer to be summed') |
|
18 | help='an integer to be summed') | |
33 | parser.add_argument( |
|
19 | parser.add_argument( | |
34 | '--log', default=sys.stdout, type=argparse.FileType('w'), |
|
20 | '--log', default=sys.stdout, type=argparse.FileType('w'), | |
35 | help='the file where the sum should be written') |
|
21 | help='the file where the sum should be written') | |
36 | args = parser.parse_args() |
|
22 | args = parser.parse_args() | |
37 | args.log.write('%s' % sum(args.integers)) |
|
23 | args.log.write('%s' % sum(args.integers)) | |
38 | args.log.close() |
|
24 | args.log.close() | |
39 |
|
25 | |||
40 | The module contains the following public classes: |
|
26 | The module contains the following public classes: | |
41 |
|
27 | |||
42 | - ArgumentParser -- The main entry point for command-line parsing. As the |
|
28 | - ArgumentParser -- The main entry point for command-line parsing. As the | |
43 | example above shows, the add_argument() method is used to populate |
|
29 | example above shows, the add_argument() method is used to populate | |
44 | the parser with actions for optional and positional arguments. Then |
|
30 | the parser with actions for optional and positional arguments. Then | |
45 | the parse_args() method is invoked to convert the args at the |
|
31 | the parse_args() method is invoked to convert the args at the | |
46 | command-line into an object with attributes. |
|
32 | command-line into an object with attributes. | |
47 |
|
33 | |||
48 | - ArgumentError -- The exception raised by ArgumentParser objects when |
|
34 | - ArgumentError -- The exception raised by ArgumentParser objects when | |
49 | there are errors with the parser's actions. Errors raised while |
|
35 | there are errors with the parser's actions. Errors raised while | |
50 | parsing the command-line are caught by ArgumentParser and emitted |
|
36 | parsing the command-line are caught by ArgumentParser and emitted | |
51 | as command-line messages. |
|
37 | as command-line messages. | |
52 |
|
38 | |||
53 | - FileType -- A factory for defining types of files to be created. As the |
|
39 | - FileType -- A factory for defining types of files to be created. As the | |
54 | example above shows, instances of FileType are typically passed as |
|
40 | example above shows, instances of FileType are typically passed as | |
55 | the type= argument of add_argument() calls. |
|
41 | the type= argument of add_argument() calls. | |
56 |
|
42 | |||
57 | - Action -- The base class for parser actions. Typically actions are |
|
43 | - Action -- The base class for parser actions. Typically actions are | |
58 | selected by passing strings like 'store_true' or 'append_const' to |
|
44 | selected by passing strings like 'store_true' or 'append_const' to | |
59 | the action= argument of add_argument(). However, for greater |
|
45 | the action= argument of add_argument(). However, for greater | |
60 | customization of ArgumentParser actions, subclasses of Action may |
|
46 | customization of ArgumentParser actions, subclasses of Action may | |
61 | be defined and passed as the action= argument. |
|
47 | be defined and passed as the action= argument. | |
62 |
|
48 | |||
63 | - HelpFormatter, RawDescriptionHelpFormatter, RawTextHelpFormatter, |
|
49 | - HelpFormatter, RawDescriptionHelpFormatter, RawTextHelpFormatter, | |
64 | ArgumentDefaultsHelpFormatter -- Formatter classes which |
|
50 | ArgumentDefaultsHelpFormatter -- Formatter classes which | |
65 | may be passed as the formatter_class= argument to the |
|
51 | may be passed as the formatter_class= argument to the | |
66 | ArgumentParser constructor. HelpFormatter is the default, |
|
52 | ArgumentParser constructor. HelpFormatter is the default, | |
67 | RawDescriptionHelpFormatter and RawTextHelpFormatter tell the parser |
|
53 | RawDescriptionHelpFormatter and RawTextHelpFormatter tell the parser | |
68 | not to change the formatting for help text, and |
|
54 | not to change the formatting for help text, and | |
69 | ArgumentDefaultsHelpFormatter adds information about argument defaults |
|
55 | ArgumentDefaultsHelpFormatter adds information about argument defaults | |
70 | to the help. |
|
56 | to the help. | |
71 |
|
57 | |||
72 | All other classes in this module are considered implementation details. |
|
58 | All other classes in this module are considered implementation details. | |
73 | (Also note that HelpFormatter and RawDescriptionHelpFormatter are only |
|
59 | (Also note that HelpFormatter and RawDescriptionHelpFormatter are only | |
74 | considered public as object names -- the API of the formatter objects is |
|
60 | considered public as object names -- the API of the formatter objects is | |
75 | still considered an implementation detail.) |
|
61 | still considered an implementation detail.) | |
76 | """ |
|
62 | """ | |
77 |
|
63 | |||
78 |
__version__ = '1.1 |
|
64 | __version__ = '1.1' | |
79 | __all__ = [ |
|
65 | __all__ = [ | |
80 | 'ArgumentParser', |
|
66 | 'ArgumentParser', | |
81 | 'ArgumentError', |
|
67 | 'ArgumentError', | |
82 | 'Namespace', |
|
68 | 'Namespace', | |
83 | 'Action', |
|
69 | 'Action', | |
84 | 'FileType', |
|
70 | 'FileType', | |
85 | 'HelpFormatter', |
|
71 | 'HelpFormatter', | |
86 | 'RawDescriptionHelpFormatter', |
|
72 | 'RawDescriptionHelpFormatter', | |
87 | 'RawTextHelpFormatter', |
|
73 | 'RawTextHelpFormatter', | |
88 | 'ArgumentDefaultsHelpFormatter', |
|
74 | 'ArgumentDefaultsHelpFormatter', | |
89 | ] |
|
75 | ] | |
90 |
|
76 | |||
91 |
|
77 | |||
92 | import copy as _copy |
|
78 | import copy as _copy | |
93 | import os as _os |
|
79 | import os as _os | |
94 | import re as _re |
|
80 | import re as _re | |
95 | import sys as _sys |
|
81 | import sys as _sys | |
96 | import textwrap as _textwrap |
|
82 | import textwrap as _textwrap | |
97 |
|
83 | |||
98 | from gettext import gettext as _ |
|
84 | from gettext import gettext as _ | |
99 |
|
85 | |||
100 | try: |
|
|||
101 | _set = set |
|
|||
102 | except NameError: |
|
|||
103 | from sets import Set as _set |
|
|||
104 |
|
||||
105 | try: |
|
|||
106 | _basestring = basestring |
|
|||
107 | except NameError: |
|
|||
108 | _basestring = str |
|
|||
109 |
|
||||
110 | try: |
|
|||
111 | _sorted = sorted |
|
|||
112 | except NameError: |
|
|||
113 |
|
||||
114 | def _sorted(iterable, reverse=False): |
|
|||
115 | result = list(iterable) |
|
|||
116 | result.sort() |
|
|||
117 | if reverse: |
|
|||
118 | result.reverse() |
|
|||
119 | return result |
|
|||
120 |
|
||||
121 |
|
86 | |||
122 | def _callable(obj): |
|
87 | def _callable(obj): | |
123 | return hasattr(obj, '__call__') or hasattr(obj, '__bases__') |
|
88 | return hasattr(obj, '__call__') or hasattr(obj, '__bases__') | |
124 |
|
89 | |||
125 | # silence Python 2.6 buggy warnings about Exception.message |
|
|||
126 | if _sys.version_info[:2] == (2, 6): |
|
|||
127 | import warnings |
|
|||
128 | warnings.filterwarnings( |
|
|||
129 | action='ignore', |
|
|||
130 | message='BaseException.message has been deprecated as of Python 2.6', |
|
|||
131 | category=DeprecationWarning, |
|
|||
132 | module='argparse') |
|
|||
133 |
|
||||
134 |
|
90 | |||
135 | SUPPRESS = '==SUPPRESS==' |
|
91 | SUPPRESS = '==SUPPRESS==' | |
136 |
|
92 | |||
137 | OPTIONAL = '?' |
|
93 | OPTIONAL = '?' | |
138 | ZERO_OR_MORE = '*' |
|
94 | ZERO_OR_MORE = '*' | |
139 | ONE_OR_MORE = '+' |
|
95 | ONE_OR_MORE = '+' | |
140 | PARSER = 'A...' |
|
96 | PARSER = 'A...' | |
141 | REMAINDER = '...' |
|
97 | REMAINDER = '...' | |
142 |
|
98 | |||
143 | # ============================= |
|
99 | # ============================= | |
144 | # Utility functions and classes |
|
100 | # Utility functions and classes | |
145 | # ============================= |
|
101 | # ============================= | |
146 |
|
102 | |||
147 | class _AttributeHolder(object): |
|
103 | class _AttributeHolder(object): | |
148 | """Abstract base class that provides __repr__. |
|
104 | """Abstract base class that provides __repr__. | |
149 |
|
105 | |||
150 | The __repr__ method returns a string in the format:: |
|
106 | The __repr__ method returns a string in the format:: | |
151 | ClassName(attr=name, attr=name, ...) |
|
107 | ClassName(attr=name, attr=name, ...) | |
152 | The attributes are determined either by a class-level attribute, |
|
108 | The attributes are determined either by a class-level attribute, | |
153 | '_kwarg_names', or by inspecting the instance __dict__. |
|
109 | '_kwarg_names', or by inspecting the instance __dict__. | |
154 | """ |
|
110 | """ | |
155 |
|
111 | |||
156 | def __repr__(self): |
|
112 | def __repr__(self): | |
157 | type_name = type(self).__name__ |
|
113 | type_name = type(self).__name__ | |
158 | arg_strings = [] |
|
114 | arg_strings = [] | |
159 | for arg in self._get_args(): |
|
115 | for arg in self._get_args(): | |
160 | arg_strings.append(repr(arg)) |
|
116 | arg_strings.append(repr(arg)) | |
161 | for name, value in self._get_kwargs(): |
|
117 | for name, value in self._get_kwargs(): | |
162 | arg_strings.append('%s=%r' % (name, value)) |
|
118 | arg_strings.append('%s=%r' % (name, value)) | |
163 | return '%s(%s)' % (type_name, ', '.join(arg_strings)) |
|
119 | return '%s(%s)' % (type_name, ', '.join(arg_strings)) | |
164 |
|
120 | |||
165 | def _get_kwargs(self): |
|
121 | def _get_kwargs(self): | |
166 |
return |
|
122 | return sorted(self.__dict__.items()) | |
167 |
|
123 | |||
168 | def _get_args(self): |
|
124 | def _get_args(self): | |
169 | return [] |
|
125 | return [] | |
170 |
|
126 | |||
171 |
|
127 | |||
172 | def _ensure_value(namespace, name, value): |
|
128 | def _ensure_value(namespace, name, value): | |
173 | if getattr(namespace, name, None) is None: |
|
129 | if getattr(namespace, name, None) is None: | |
174 | setattr(namespace, name, value) |
|
130 | setattr(namespace, name, value) | |
175 | return getattr(namespace, name) |
|
131 | return getattr(namespace, name) | |
176 |
|
132 | |||
177 |
|
133 | |||
178 | # =============== |
|
134 | # =============== | |
179 | # Formatting Help |
|
135 | # Formatting Help | |
180 | # =============== |
|
136 | # =============== | |
181 |
|
137 | |||
182 | class HelpFormatter(object): |
|
138 | class HelpFormatter(object): | |
183 | """Formatter for generating usage messages and argument help strings. |
|
139 | """Formatter for generating usage messages and argument help strings. | |
184 |
|
140 | |||
185 | Only the name of this class is considered a public API. All the methods |
|
141 | Only the name of this class is considered a public API. All the methods | |
186 | provided by the class are considered an implementation detail. |
|
142 | provided by the class are considered an implementation detail. | |
187 | """ |
|
143 | """ | |
188 |
|
144 | |||
189 | def __init__(self, |
|
145 | def __init__(self, | |
190 | prog, |
|
146 | prog, | |
191 | indent_increment=2, |
|
147 | indent_increment=2, | |
192 | max_help_position=24, |
|
148 | max_help_position=24, | |
193 | width=None): |
|
149 | width=None): | |
194 |
|
150 | |||
195 | # default setting for width |
|
151 | # default setting for width | |
196 | if width is None: |
|
152 | if width is None: | |
197 | try: |
|
153 | try: | |
198 | width = int(_os.environ['COLUMNS']) |
|
154 | width = int(_os.environ['COLUMNS']) | |
199 | except (KeyError, ValueError): |
|
155 | except (KeyError, ValueError): | |
200 | width = 80 |
|
156 | width = 80 | |
201 | width -= 2 |
|
157 | width -= 2 | |
202 |
|
158 | |||
203 | self._prog = prog |
|
159 | self._prog = prog | |
204 | self._indent_increment = indent_increment |
|
160 | self._indent_increment = indent_increment | |
205 | self._max_help_position = max_help_position |
|
161 | self._max_help_position = max_help_position | |
206 | self._width = width |
|
162 | self._width = width | |
207 |
|
163 | |||
208 | self._current_indent = 0 |
|
164 | self._current_indent = 0 | |
209 | self._level = 0 |
|
165 | self._level = 0 | |
210 | self._action_max_length = 0 |
|
166 | self._action_max_length = 0 | |
211 |
|
167 | |||
212 | self._root_section = self._Section(self, None) |
|
168 | self._root_section = self._Section(self, None) | |
213 | self._current_section = self._root_section |
|
169 | self._current_section = self._root_section | |
214 |
|
170 | |||
215 | self._whitespace_matcher = _re.compile(r'\s+') |
|
171 | self._whitespace_matcher = _re.compile(r'\s+') | |
216 | self._long_break_matcher = _re.compile(r'\n\n\n+') |
|
172 | self._long_break_matcher = _re.compile(r'\n\n\n+') | |
217 |
|
173 | |||
218 | # =============================== |
|
174 | # =============================== | |
219 | # Section and indentation methods |
|
175 | # Section and indentation methods | |
220 | # =============================== |
|
176 | # =============================== | |
221 | def _indent(self): |
|
177 | def _indent(self): | |
222 | self._current_indent += self._indent_increment |
|
178 | self._current_indent += self._indent_increment | |
223 | self._level += 1 |
|
179 | self._level += 1 | |
224 |
|
180 | |||
225 | def _dedent(self): |
|
181 | def _dedent(self): | |
226 | self._current_indent -= self._indent_increment |
|
182 | self._current_indent -= self._indent_increment | |
227 | assert self._current_indent >= 0, 'Indent decreased below 0.' |
|
183 | assert self._current_indent >= 0, 'Indent decreased below 0.' | |
228 | self._level -= 1 |
|
184 | self._level -= 1 | |
229 |
|
185 | |||
230 | class _Section(object): |
|
186 | class _Section(object): | |
231 |
|
187 | |||
232 | def __init__(self, formatter, parent, heading=None): |
|
188 | def __init__(self, formatter, parent, heading=None): | |
233 | self.formatter = formatter |
|
189 | self.formatter = formatter | |
234 | self.parent = parent |
|
190 | self.parent = parent | |
235 | self.heading = heading |
|
191 | self.heading = heading | |
236 | self.items = [] |
|
192 | self.items = [] | |
237 |
|
193 | |||
238 | def format_help(self): |
|
194 | def format_help(self): | |
239 | # format the indented section |
|
195 | # format the indented section | |
240 | if self.parent is not None: |
|
196 | if self.parent is not None: | |
241 | self.formatter._indent() |
|
197 | self.formatter._indent() | |
242 | join = self.formatter._join_parts |
|
198 | join = self.formatter._join_parts | |
243 | for func, args in self.items: |
|
199 | for func, args in self.items: | |
244 | func(*args) |
|
200 | func(*args) | |
245 | item_help = join([func(*args) for func, args in self.items]) |
|
201 | item_help = join([func(*args) for func, args in self.items]) | |
246 | if self.parent is not None: |
|
202 | if self.parent is not None: | |
247 | self.formatter._dedent() |
|
203 | self.formatter._dedent() | |
248 |
|
204 | |||
249 | # return nothing if the section was empty |
|
205 | # return nothing if the section was empty | |
250 | if not item_help: |
|
206 | if not item_help: | |
251 | return '' |
|
207 | return '' | |
252 |
|
208 | |||
253 | # add the heading if the section was non-empty |
|
209 | # add the heading if the section was non-empty | |
254 | if self.heading is not SUPPRESS and self.heading is not None: |
|
210 | if self.heading is not SUPPRESS and self.heading is not None: | |
255 | current_indent = self.formatter._current_indent |
|
211 | current_indent = self.formatter._current_indent | |
256 | heading = '%*s%s:\n' % (current_indent, '', self.heading) |
|
212 | heading = '%*s%s:\n' % (current_indent, '', self.heading) | |
257 | else: |
|
213 | else: | |
258 | heading = '' |
|
214 | heading = '' | |
259 |
|
215 | |||
260 | # join the section-initial newline, the heading and the help |
|
216 | # join the section-initial newline, the heading and the help | |
261 | return join(['\n', heading, item_help, '\n']) |
|
217 | return join(['\n', heading, item_help, '\n']) | |
262 |
|
218 | |||
263 | def _add_item(self, func, args): |
|
219 | def _add_item(self, func, args): | |
264 | self._current_section.items.append((func, args)) |
|
220 | self._current_section.items.append((func, args)) | |
265 |
|
221 | |||
266 | # ======================== |
|
222 | # ======================== | |
267 | # Message building methods |
|
223 | # Message building methods | |
268 | # ======================== |
|
224 | # ======================== | |
269 | def start_section(self, heading): |
|
225 | def start_section(self, heading): | |
270 | self._indent() |
|
226 | self._indent() | |
271 | section = self._Section(self, self._current_section, heading) |
|
227 | section = self._Section(self, self._current_section, heading) | |
272 | self._add_item(section.format_help, []) |
|
228 | self._add_item(section.format_help, []) | |
273 | self._current_section = section |
|
229 | self._current_section = section | |
274 |
|
230 | |||
275 | def end_section(self): |
|
231 | def end_section(self): | |
276 | self._current_section = self._current_section.parent |
|
232 | self._current_section = self._current_section.parent | |
277 | self._dedent() |
|
233 | self._dedent() | |
278 |
|
234 | |||
279 | def add_text(self, text): |
|
235 | def add_text(self, text): | |
280 | if text is not SUPPRESS and text is not None: |
|
236 | if text is not SUPPRESS and text is not None: | |
281 | self._add_item(self._format_text, [text]) |
|
237 | self._add_item(self._format_text, [text]) | |
282 |
|
238 | |||
283 | def add_usage(self, usage, actions, groups, prefix=None): |
|
239 | def add_usage(self, usage, actions, groups, prefix=None): | |
284 | if usage is not SUPPRESS: |
|
240 | if usage is not SUPPRESS: | |
285 | args = usage, actions, groups, prefix |
|
241 | args = usage, actions, groups, prefix | |
286 | self._add_item(self._format_usage, args) |
|
242 | self._add_item(self._format_usage, args) | |
287 |
|
243 | |||
288 | def add_argument(self, action): |
|
244 | def add_argument(self, action): | |
289 | if action.help is not SUPPRESS: |
|
245 | if action.help is not SUPPRESS: | |
290 |
|
246 | |||
291 | # find all invocations |
|
247 | # find all invocations | |
292 | get_invocation = self._format_action_invocation |
|
248 | get_invocation = self._format_action_invocation | |
293 | invocations = [get_invocation(action)] |
|
249 | invocations = [get_invocation(action)] | |
294 | for subaction in self._iter_indented_subactions(action): |
|
250 | for subaction in self._iter_indented_subactions(action): | |
295 | invocations.append(get_invocation(subaction)) |
|
251 | invocations.append(get_invocation(subaction)) | |
296 |
|
252 | |||
297 | # update the maximum item length |
|
253 | # update the maximum item length | |
298 | invocation_length = max([len(s) for s in invocations]) |
|
254 | invocation_length = max([len(s) for s in invocations]) | |
299 | action_length = invocation_length + self._current_indent |
|
255 | action_length = invocation_length + self._current_indent | |
300 | self._action_max_length = max(self._action_max_length, |
|
256 | self._action_max_length = max(self._action_max_length, | |
301 | action_length) |
|
257 | action_length) | |
302 |
|
258 | |||
303 | # add the item to the list |
|
259 | # add the item to the list | |
304 | self._add_item(self._format_action, [action]) |
|
260 | self._add_item(self._format_action, [action]) | |
305 |
|
261 | |||
306 | def add_arguments(self, actions): |
|
262 | def add_arguments(self, actions): | |
307 | for action in actions: |
|
263 | for action in actions: | |
308 | self.add_argument(action) |
|
264 | self.add_argument(action) | |
309 |
|
265 | |||
310 | # ======================= |
|
266 | # ======================= | |
311 | # Help-formatting methods |
|
267 | # Help-formatting methods | |
312 | # ======================= |
|
268 | # ======================= | |
313 | def format_help(self): |
|
269 | def format_help(self): | |
314 | help = self._root_section.format_help() |
|
270 | help = self._root_section.format_help() | |
315 | if help: |
|
271 | if help: | |
316 | help = self._long_break_matcher.sub('\n\n', help) |
|
272 | help = self._long_break_matcher.sub('\n\n', help) | |
317 | help = help.strip('\n') + '\n' |
|
273 | help = help.strip('\n') + '\n' | |
318 | return help |
|
274 | return help | |
319 |
|
275 | |||
320 | def _join_parts(self, part_strings): |
|
276 | def _join_parts(self, part_strings): | |
321 | return ''.join([part |
|
277 | return ''.join([part | |
322 | for part in part_strings |
|
278 | for part in part_strings | |
323 | if part and part is not SUPPRESS]) |
|
279 | if part and part is not SUPPRESS]) | |
324 |
|
280 | |||
325 | def _format_usage(self, usage, actions, groups, prefix): |
|
281 | def _format_usage(self, usage, actions, groups, prefix): | |
326 | if prefix is None: |
|
282 | if prefix is None: | |
327 | prefix = _('usage: ') |
|
283 | prefix = _('usage: ') | |
328 |
|
284 | |||
329 | # if usage is specified, use that |
|
285 | # if usage is specified, use that | |
330 | if usage is not None: |
|
286 | if usage is not None: | |
331 | usage = usage % dict(prog=self._prog) |
|
287 | usage = usage % dict(prog=self._prog) | |
332 |
|
288 | |||
333 | # if no optionals or positionals are available, usage is just prog |
|
289 | # if no optionals or positionals are available, usage is just prog | |
334 | elif usage is None and not actions: |
|
290 | elif usage is None and not actions: | |
335 | usage = '%(prog)s' % dict(prog=self._prog) |
|
291 | usage = '%(prog)s' % dict(prog=self._prog) | |
336 |
|
292 | |||
337 | # if optionals and positionals are available, calculate usage |
|
293 | # if optionals and positionals are available, calculate usage | |
338 | elif usage is None: |
|
294 | elif usage is None: | |
339 | prog = '%(prog)s' % dict(prog=self._prog) |
|
295 | prog = '%(prog)s' % dict(prog=self._prog) | |
340 |
|
296 | |||
341 | # split optionals from positionals |
|
297 | # split optionals from positionals | |
342 | optionals = [] |
|
298 | optionals = [] | |
343 | positionals = [] |
|
299 | positionals = [] | |
344 | for action in actions: |
|
300 | for action in actions: | |
345 | if action.option_strings: |
|
301 | if action.option_strings: | |
346 | optionals.append(action) |
|
302 | optionals.append(action) | |
347 | else: |
|
303 | else: | |
348 | positionals.append(action) |
|
304 | positionals.append(action) | |
349 |
|
305 | |||
350 | # build full usage string |
|
306 | # build full usage string | |
351 | format = self._format_actions_usage |
|
307 | format = self._format_actions_usage | |
352 | action_usage = format(optionals + positionals, groups) |
|
308 | action_usage = format(optionals + positionals, groups) | |
353 | usage = ' '.join([s for s in [prog, action_usage] if s]) |
|
309 | usage = ' '.join([s for s in [prog, action_usage] if s]) | |
354 |
|
310 | |||
355 | # wrap the usage parts if it's too long |
|
311 | # wrap the usage parts if it's too long | |
356 | text_width = self._width - self._current_indent |
|
312 | text_width = self._width - self._current_indent | |
357 | if len(prefix) + len(usage) > text_width: |
|
313 | if len(prefix) + len(usage) > text_width: | |
358 |
|
314 | |||
359 | # break usage into wrappable parts |
|
315 | # break usage into wrappable parts | |
360 | part_regexp = r'\(.*?\)+|\[.*?\]+|\S+' |
|
316 | part_regexp = r'\(.*?\)+|\[.*?\]+|\S+' | |
361 | opt_usage = format(optionals, groups) |
|
317 | opt_usage = format(optionals, groups) | |
362 | pos_usage = format(positionals, groups) |
|
318 | pos_usage = format(positionals, groups) | |
363 | opt_parts = _re.findall(part_regexp, opt_usage) |
|
319 | opt_parts = _re.findall(part_regexp, opt_usage) | |
364 | pos_parts = _re.findall(part_regexp, pos_usage) |
|
320 | pos_parts = _re.findall(part_regexp, pos_usage) | |
365 | assert ' '.join(opt_parts) == opt_usage |
|
321 | assert ' '.join(opt_parts) == opt_usage | |
366 | assert ' '.join(pos_parts) == pos_usage |
|
322 | assert ' '.join(pos_parts) == pos_usage | |
367 |
|
323 | |||
368 | # helper for wrapping lines |
|
324 | # helper for wrapping lines | |
369 | def get_lines(parts, indent, prefix=None): |
|
325 | def get_lines(parts, indent, prefix=None): | |
370 | lines = [] |
|
326 | lines = [] | |
371 | line = [] |
|
327 | line = [] | |
372 | if prefix is not None: |
|
328 | if prefix is not None: | |
373 | line_len = len(prefix) - 1 |
|
329 | line_len = len(prefix) - 1 | |
374 | else: |
|
330 | else: | |
375 | line_len = len(indent) - 1 |
|
331 | line_len = len(indent) - 1 | |
376 | for part in parts: |
|
332 | for part in parts: | |
377 | if line_len + 1 + len(part) > text_width: |
|
333 | if line_len + 1 + len(part) > text_width: | |
378 | lines.append(indent + ' '.join(line)) |
|
334 | lines.append(indent + ' '.join(line)) | |
379 | line = [] |
|
335 | line = [] | |
380 | line_len = len(indent) - 1 |
|
336 | line_len = len(indent) - 1 | |
381 | line.append(part) |
|
337 | line.append(part) | |
382 | line_len += len(part) + 1 |
|
338 | line_len += len(part) + 1 | |
383 | if line: |
|
339 | if line: | |
384 | lines.append(indent + ' '.join(line)) |
|
340 | lines.append(indent + ' '.join(line)) | |
385 | if prefix is not None: |
|
341 | if prefix is not None: | |
386 | lines[0] = lines[0][len(indent):] |
|
342 | lines[0] = lines[0][len(indent):] | |
387 | return lines |
|
343 | return lines | |
388 |
|
344 | |||
389 | # if prog is short, follow it with optionals or positionals |
|
345 | # if prog is short, follow it with optionals or positionals | |
390 | if len(prefix) + len(prog) <= 0.75 * text_width: |
|
346 | if len(prefix) + len(prog) <= 0.75 * text_width: | |
391 | indent = ' ' * (len(prefix) + len(prog) + 1) |
|
347 | indent = ' ' * (len(prefix) + len(prog) + 1) | |
392 | if opt_parts: |
|
348 | if opt_parts: | |
393 | lines = get_lines([prog] + opt_parts, indent, prefix) |
|
349 | lines = get_lines([prog] + opt_parts, indent, prefix) | |
394 | lines.extend(get_lines(pos_parts, indent)) |
|
350 | lines.extend(get_lines(pos_parts, indent)) | |
395 | elif pos_parts: |
|
351 | elif pos_parts: | |
396 | lines = get_lines([prog] + pos_parts, indent, prefix) |
|
352 | lines = get_lines([prog] + pos_parts, indent, prefix) | |
397 | else: |
|
353 | else: | |
398 | lines = [prog] |
|
354 | lines = [prog] | |
399 |
|
355 | |||
400 | # if prog is long, put it on its own line |
|
356 | # if prog is long, put it on its own line | |
401 | else: |
|
357 | else: | |
402 | indent = ' ' * len(prefix) |
|
358 | indent = ' ' * len(prefix) | |
403 | parts = opt_parts + pos_parts |
|
359 | parts = opt_parts + pos_parts | |
404 | lines = get_lines(parts, indent) |
|
360 | lines = get_lines(parts, indent) | |
405 | if len(lines) > 1: |
|
361 | if len(lines) > 1: | |
406 | lines = [] |
|
362 | lines = [] | |
407 | lines.extend(get_lines(opt_parts, indent)) |
|
363 | lines.extend(get_lines(opt_parts, indent)) | |
408 | lines.extend(get_lines(pos_parts, indent)) |
|
364 | lines.extend(get_lines(pos_parts, indent)) | |
409 | lines = [prog] + lines |
|
365 | lines = [prog] + lines | |
410 |
|
366 | |||
411 | # join lines into usage |
|
367 | # join lines into usage | |
412 | usage = '\n'.join(lines) |
|
368 | usage = '\n'.join(lines) | |
413 |
|
369 | |||
414 | # prefix with 'usage:' |
|
370 | # prefix with 'usage:' | |
415 | return '%s%s\n\n' % (prefix, usage) |
|
371 | return '%s%s\n\n' % (prefix, usage) | |
416 |
|
372 | |||
417 | def _format_actions_usage(self, actions, groups): |
|
373 | def _format_actions_usage(self, actions, groups): | |
418 | # find group indices and identify actions in groups |
|
374 | # find group indices and identify actions in groups | |
419 |
group_actions = |
|
375 | group_actions = set() | |
420 | inserts = {} |
|
376 | inserts = {} | |
421 | for group in groups: |
|
377 | for group in groups: | |
422 | try: |
|
378 | try: | |
423 | start = actions.index(group._group_actions[0]) |
|
379 | start = actions.index(group._group_actions[0]) | |
424 | except ValueError: |
|
380 | except ValueError: | |
425 | continue |
|
381 | continue | |
426 | else: |
|
382 | else: | |
427 | end = start + len(group._group_actions) |
|
383 | end = start + len(group._group_actions) | |
428 | if actions[start:end] == group._group_actions: |
|
384 | if actions[start:end] == group._group_actions: | |
429 | for action in group._group_actions: |
|
385 | for action in group._group_actions: | |
430 | group_actions.add(action) |
|
386 | group_actions.add(action) | |
431 | if not group.required: |
|
387 | if not group.required: | |
432 | inserts[start] = '[' |
|
388 | inserts[start] = '[' | |
433 | inserts[end] = ']' |
|
389 | inserts[end] = ']' | |
434 | else: |
|
390 | else: | |
435 | inserts[start] = '(' |
|
391 | inserts[start] = '(' | |
436 | inserts[end] = ')' |
|
392 | inserts[end] = ')' | |
437 | for i in range(start + 1, end): |
|
393 | for i in range(start + 1, end): | |
438 | inserts[i] = '|' |
|
394 | inserts[i] = '|' | |
439 |
|
395 | |||
440 | # collect all actions format strings |
|
396 | # collect all actions format strings | |
441 | parts = [] |
|
397 | parts = [] | |
442 | for i, action in enumerate(actions): |
|
398 | for i, action in enumerate(actions): | |
443 |
|
399 | |||
444 | # suppressed arguments are marked with None |
|
400 | # suppressed arguments are marked with None | |
445 | # remove | separators for suppressed arguments |
|
401 | # remove | separators for suppressed arguments | |
446 | if action.help is SUPPRESS: |
|
402 | if action.help is SUPPRESS: | |
447 | parts.append(None) |
|
403 | parts.append(None) | |
448 | if inserts.get(i) == '|': |
|
404 | if inserts.get(i) == '|': | |
449 | inserts.pop(i) |
|
405 | inserts.pop(i) | |
450 | elif inserts.get(i + 1) == '|': |
|
406 | elif inserts.get(i + 1) == '|': | |
451 | inserts.pop(i + 1) |
|
407 | inserts.pop(i + 1) | |
452 |
|
408 | |||
453 | # produce all arg strings |
|
409 | # produce all arg strings | |
454 | elif not action.option_strings: |
|
410 | elif not action.option_strings: | |
455 | part = self._format_args(action, action.dest) |
|
411 | part = self._format_args(action, action.dest) | |
456 |
|
412 | |||
457 | # if it's in a group, strip the outer [] |
|
413 | # if it's in a group, strip the outer [] | |
458 | if action in group_actions: |
|
414 | if action in group_actions: | |
459 | if part[0] == '[' and part[-1] == ']': |
|
415 | if part[0] == '[' and part[-1] == ']': | |
460 | part = part[1:-1] |
|
416 | part = part[1:-1] | |
461 |
|
417 | |||
462 | # add the action string to the list |
|
418 | # add the action string to the list | |
463 | parts.append(part) |
|
419 | parts.append(part) | |
464 |
|
420 | |||
465 | # produce the first way to invoke the option in brackets |
|
421 | # produce the first way to invoke the option in brackets | |
466 | else: |
|
422 | else: | |
467 | option_string = action.option_strings[0] |
|
423 | option_string = action.option_strings[0] | |
468 |
|
424 | |||
469 | # if the Optional doesn't take a value, format is: |
|
425 | # if the Optional doesn't take a value, format is: | |
470 | # -s or --long |
|
426 | # -s or --long | |
471 | if action.nargs == 0: |
|
427 | if action.nargs == 0: | |
472 | part = '%s' % option_string |
|
428 | part = '%s' % option_string | |
473 |
|
429 | |||
474 | # if the Optional takes a value, format is: |
|
430 | # if the Optional takes a value, format is: | |
475 | # -s ARGS or --long ARGS |
|
431 | # -s ARGS or --long ARGS | |
476 | else: |
|
432 | else: | |
477 | default = action.dest.upper() |
|
433 | default = action.dest.upper() | |
478 | args_string = self._format_args(action, default) |
|
434 | args_string = self._format_args(action, default) | |
479 | part = '%s %s' % (option_string, args_string) |
|
435 | part = '%s %s' % (option_string, args_string) | |
480 |
|
436 | |||
481 | # make it look optional if it's not required or in a group |
|
437 | # make it look optional if it's not required or in a group | |
482 | if not action.required and action not in group_actions: |
|
438 | if not action.required and action not in group_actions: | |
483 | part = '[%s]' % part |
|
439 | part = '[%s]' % part | |
484 |
|
440 | |||
485 | # add the action string to the list |
|
441 | # add the action string to the list | |
486 | parts.append(part) |
|
442 | parts.append(part) | |
487 |
|
443 | |||
488 | # insert things at the necessary indices |
|
444 | # insert things at the necessary indices | |
489 |
for i in |
|
445 | for i in sorted(inserts, reverse=True): | |
490 | parts[i:i] = [inserts[i]] |
|
446 | parts[i:i] = [inserts[i]] | |
491 |
|
447 | |||
492 | # join all the action items with spaces |
|
448 | # join all the action items with spaces | |
493 | text = ' '.join([item for item in parts if item is not None]) |
|
449 | text = ' '.join([item for item in parts if item is not None]) | |
494 |
|
450 | |||
495 | # clean up separators for mutually exclusive groups |
|
451 | # clean up separators for mutually exclusive groups | |
496 | open = r'[\[(]' |
|
452 | open = r'[\[(]' | |
497 | close = r'[\])]' |
|
453 | close = r'[\])]' | |
498 | text = _re.sub(r'(%s) ' % open, r'\1', text) |
|
454 | text = _re.sub(r'(%s) ' % open, r'\1', text) | |
499 | text = _re.sub(r' (%s)' % close, r'\1', text) |
|
455 | text = _re.sub(r' (%s)' % close, r'\1', text) | |
500 | text = _re.sub(r'%s *%s' % (open, close), r'', text) |
|
456 | text = _re.sub(r'%s *%s' % (open, close), r'', text) | |
501 | text = _re.sub(r'\(([^|]*)\)', r'\1', text) |
|
457 | text = _re.sub(r'\(([^|]*)\)', r'\1', text) | |
502 | text = text.strip() |
|
458 | text = text.strip() | |
503 |
|
459 | |||
504 | # return the text |
|
460 | # return the text | |
505 | return text |
|
461 | return text | |
506 |
|
462 | |||
507 | def _format_text(self, text): |
|
463 | def _format_text(self, text): | |
508 | if '%(prog)' in text: |
|
464 | if '%(prog)' in text: | |
509 | text = text % dict(prog=self._prog) |
|
465 | text = text % dict(prog=self._prog) | |
510 | text_width = self._width - self._current_indent |
|
466 | text_width = self._width - self._current_indent | |
511 | indent = ' ' * self._current_indent |
|
467 | indent = ' ' * self._current_indent | |
512 | return self._fill_text(text, text_width, indent) + '\n\n' |
|
468 | return self._fill_text(text, text_width, indent) + '\n\n' | |
513 |
|
469 | |||
514 | def _format_action(self, action): |
|
470 | def _format_action(self, action): | |
515 | # determine the required width and the entry label |
|
471 | # determine the required width and the entry label | |
516 | help_position = min(self._action_max_length + 2, |
|
472 | help_position = min(self._action_max_length + 2, | |
517 | self._max_help_position) |
|
473 | self._max_help_position) | |
518 | help_width = self._width - help_position |
|
474 | help_width = self._width - help_position | |
519 | action_width = help_position - self._current_indent - 2 |
|
475 | action_width = help_position - self._current_indent - 2 | |
520 | action_header = self._format_action_invocation(action) |
|
476 | action_header = self._format_action_invocation(action) | |
521 |
|
477 | |||
522 | # ho nelp; start on same line and add a final newline |
|
478 | # ho nelp; start on same line and add a final newline | |
523 | if not action.help: |
|
479 | if not action.help: | |
524 | tup = self._current_indent, '', action_header |
|
480 | tup = self._current_indent, '', action_header | |
525 | action_header = '%*s%s\n' % tup |
|
481 | action_header = '%*s%s\n' % tup | |
526 |
|
482 | |||
527 | # short action name; start on the same line and pad two spaces |
|
483 | # short action name; start on the same line and pad two spaces | |
528 | elif len(action_header) <= action_width: |
|
484 | elif len(action_header) <= action_width: | |
529 | tup = self._current_indent, '', action_width, action_header |
|
485 | tup = self._current_indent, '', action_width, action_header | |
530 | action_header = '%*s%-*s ' % tup |
|
486 | action_header = '%*s%-*s ' % tup | |
531 | indent_first = 0 |
|
487 | indent_first = 0 | |
532 |
|
488 | |||
533 | # long action name; start on the next line |
|
489 | # long action name; start on the next line | |
534 | else: |
|
490 | else: | |
535 | tup = self._current_indent, '', action_header |
|
491 | tup = self._current_indent, '', action_header | |
536 | action_header = '%*s%s\n' % tup |
|
492 | action_header = '%*s%s\n' % tup | |
537 | indent_first = help_position |
|
493 | indent_first = help_position | |
538 |
|
494 | |||
539 | # collect the pieces of the action help |
|
495 | # collect the pieces of the action help | |
540 | parts = [action_header] |
|
496 | parts = [action_header] | |
541 |
|
497 | |||
542 | # if there was help for the action, add lines of help text |
|
498 | # if there was help for the action, add lines of help text | |
543 | if action.help: |
|
499 | if action.help: | |
544 | help_text = self._expand_help(action) |
|
500 | help_text = self._expand_help(action) | |
545 | help_lines = self._split_lines(help_text, help_width) |
|
501 | help_lines = self._split_lines(help_text, help_width) | |
546 | parts.append('%*s%s\n' % (indent_first, '', help_lines[0])) |
|
502 | parts.append('%*s%s\n' % (indent_first, '', help_lines[0])) | |
547 | for line in help_lines[1:]: |
|
503 | for line in help_lines[1:]: | |
548 | parts.append('%*s%s\n' % (help_position, '', line)) |
|
504 | parts.append('%*s%s\n' % (help_position, '', line)) | |
549 |
|
505 | |||
550 | # or add a newline if the description doesn't end with one |
|
506 | # or add a newline if the description doesn't end with one | |
551 | elif not action_header.endswith('\n'): |
|
507 | elif not action_header.endswith('\n'): | |
552 | parts.append('\n') |
|
508 | parts.append('\n') | |
553 |
|
509 | |||
554 | # if there are any sub-actions, add their help as well |
|
510 | # if there are any sub-actions, add their help as well | |
555 | for subaction in self._iter_indented_subactions(action): |
|
511 | for subaction in self._iter_indented_subactions(action): | |
556 | parts.append(self._format_action(subaction)) |
|
512 | parts.append(self._format_action(subaction)) | |
557 |
|
513 | |||
558 | # return a single string |
|
514 | # return a single string | |
559 | return self._join_parts(parts) |
|
515 | return self._join_parts(parts) | |
560 |
|
516 | |||
561 | def _format_action_invocation(self, action): |
|
517 | def _format_action_invocation(self, action): | |
562 | if not action.option_strings: |
|
518 | if not action.option_strings: | |
563 | metavar, = self._metavar_formatter(action, action.dest)(1) |
|
519 | metavar, = self._metavar_formatter(action, action.dest)(1) | |
564 | return metavar |
|
520 | return metavar | |
565 |
|
521 | |||
566 | else: |
|
522 | else: | |
567 | parts = [] |
|
523 | parts = [] | |
568 |
|
524 | |||
569 | # if the Optional doesn't take a value, format is: |
|
525 | # if the Optional doesn't take a value, format is: | |
570 | # -s, --long |
|
526 | # -s, --long | |
571 | if action.nargs == 0: |
|
527 | if action.nargs == 0: | |
572 | parts.extend(action.option_strings) |
|
528 | parts.extend(action.option_strings) | |
573 |
|
529 | |||
574 | # if the Optional takes a value, format is: |
|
530 | # if the Optional takes a value, format is: | |
575 | # -s ARGS, --long ARGS |
|
531 | # -s ARGS, --long ARGS | |
576 | else: |
|
532 | else: | |
577 | default = action.dest.upper() |
|
533 | default = action.dest.upper() | |
578 | args_string = self._format_args(action, default) |
|
534 | args_string = self._format_args(action, default) | |
579 | for option_string in action.option_strings: |
|
535 | for option_string in action.option_strings: | |
580 | parts.append('%s %s' % (option_string, args_string)) |
|
536 | parts.append('%s %s' % (option_string, args_string)) | |
581 |
|
537 | |||
582 | return ', '.join(parts) |
|
538 | return ', '.join(parts) | |
583 |
|
539 | |||
584 | def _metavar_formatter(self, action, default_metavar): |
|
540 | def _metavar_formatter(self, action, default_metavar): | |
585 | if action.metavar is not None: |
|
541 | if action.metavar is not None: | |
586 | result = action.metavar |
|
542 | result = action.metavar | |
587 | elif action.choices is not None: |
|
543 | elif action.choices is not None: | |
588 | choice_strs = [str(choice) for choice in action.choices] |
|
544 | choice_strs = [str(choice) for choice in action.choices] | |
589 | result = '{%s}' % ','.join(choice_strs) |
|
545 | result = '{%s}' % ','.join(choice_strs) | |
590 | else: |
|
546 | else: | |
591 | result = default_metavar |
|
547 | result = default_metavar | |
592 |
|
548 | |||
593 | def format(tuple_size): |
|
549 | def format(tuple_size): | |
594 | if isinstance(result, tuple): |
|
550 | if isinstance(result, tuple): | |
595 | return result |
|
551 | return result | |
596 | else: |
|
552 | else: | |
597 | return (result, ) * tuple_size |
|
553 | return (result, ) * tuple_size | |
598 | return format |
|
554 | return format | |
599 |
|
555 | |||
600 | def _format_args(self, action, default_metavar): |
|
556 | def _format_args(self, action, default_metavar): | |
601 | get_metavar = self._metavar_formatter(action, default_metavar) |
|
557 | get_metavar = self._metavar_formatter(action, default_metavar) | |
602 | if action.nargs is None: |
|
558 | if action.nargs is None: | |
603 | result = '%s' % get_metavar(1) |
|
559 | result = '%s' % get_metavar(1) | |
604 | elif action.nargs == OPTIONAL: |
|
560 | elif action.nargs == OPTIONAL: | |
605 | result = '[%s]' % get_metavar(1) |
|
561 | result = '[%s]' % get_metavar(1) | |
606 | elif action.nargs == ZERO_OR_MORE: |
|
562 | elif action.nargs == ZERO_OR_MORE: | |
607 | result = '[%s [%s ...]]' % get_metavar(2) |
|
563 | result = '[%s [%s ...]]' % get_metavar(2) | |
608 | elif action.nargs == ONE_OR_MORE: |
|
564 | elif action.nargs == ONE_OR_MORE: | |
609 | result = '%s [%s ...]' % get_metavar(2) |
|
565 | result = '%s [%s ...]' % get_metavar(2) | |
610 | elif action.nargs == REMAINDER: |
|
566 | elif action.nargs == REMAINDER: | |
611 | result = '...' |
|
567 | result = '...' | |
612 | elif action.nargs == PARSER: |
|
568 | elif action.nargs == PARSER: | |
613 | result = '%s ...' % get_metavar(1) |
|
569 | result = '%s ...' % get_metavar(1) | |
614 | else: |
|
570 | else: | |
615 | formats = ['%s' for _ in range(action.nargs)] |
|
571 | formats = ['%s' for _ in range(action.nargs)] | |
616 | result = ' '.join(formats) % get_metavar(action.nargs) |
|
572 | result = ' '.join(formats) % get_metavar(action.nargs) | |
617 | return result |
|
573 | return result | |
618 |
|
574 | |||
619 | def _expand_help(self, action): |
|
575 | def _expand_help(self, action): | |
620 | params = dict(vars(action), prog=self._prog) |
|
576 | params = dict(vars(action), prog=self._prog) | |
621 | for name in list(params): |
|
577 | for name in list(params): | |
622 | if params[name] is SUPPRESS: |
|
578 | if params[name] is SUPPRESS: | |
623 | del params[name] |
|
579 | del params[name] | |
|
580 | for name in list(params): | |||
|
581 | if hasattr(params[name], '__name__'): | |||
|
582 | params[name] = params[name].__name__ | |||
624 | if params.get('choices') is not None: |
|
583 | if params.get('choices') is not None: | |
625 | choices_str = ', '.join([str(c) for c in params['choices']]) |
|
584 | choices_str = ', '.join([str(c) for c in params['choices']]) | |
626 | params['choices'] = choices_str |
|
585 | params['choices'] = choices_str | |
627 | return self._get_help_string(action) % params |
|
586 | return self._get_help_string(action) % params | |
628 |
|
587 | |||
629 | def _iter_indented_subactions(self, action): |
|
588 | def _iter_indented_subactions(self, action): | |
630 | try: |
|
589 | try: | |
631 | get_subactions = action._get_subactions |
|
590 | get_subactions = action._get_subactions | |
632 | except AttributeError: |
|
591 | except AttributeError: | |
633 | pass |
|
592 | pass | |
634 | else: |
|
593 | else: | |
635 | self._indent() |
|
594 | self._indent() | |
636 | for subaction in get_subactions(): |
|
595 | for subaction in get_subactions(): | |
637 | yield subaction |
|
596 | yield subaction | |
638 | self._dedent() |
|
597 | self._dedent() | |
639 |
|
598 | |||
640 | def _split_lines(self, text, width): |
|
599 | def _split_lines(self, text, width): | |
641 | text = self._whitespace_matcher.sub(' ', text).strip() |
|
600 | text = self._whitespace_matcher.sub(' ', text).strip() | |
642 | return _textwrap.wrap(text, width) |
|
601 | return _textwrap.wrap(text, width) | |
643 |
|
602 | |||
644 | def _fill_text(self, text, width, indent): |
|
603 | def _fill_text(self, text, width, indent): | |
645 | text = self._whitespace_matcher.sub(' ', text).strip() |
|
604 | text = self._whitespace_matcher.sub(' ', text).strip() | |
646 | return _textwrap.fill(text, width, initial_indent=indent, |
|
605 | return _textwrap.fill(text, width, initial_indent=indent, | |
647 | subsequent_indent=indent) |
|
606 | subsequent_indent=indent) | |
648 |
|
607 | |||
649 | def _get_help_string(self, action): |
|
608 | def _get_help_string(self, action): | |
650 | return action.help |
|
609 | return action.help | |
651 |
|
610 | |||
652 |
|
611 | |||
653 | class RawDescriptionHelpFormatter(HelpFormatter): |
|
612 | class RawDescriptionHelpFormatter(HelpFormatter): | |
654 | """Help message formatter which retains any formatting in descriptions. |
|
613 | """Help message formatter which retains any formatting in descriptions. | |
655 |
|
614 | |||
656 | Only the name of this class is considered a public API. All the methods |
|
615 | Only the name of this class is considered a public API. All the methods | |
657 | provided by the class are considered an implementation detail. |
|
616 | provided by the class are considered an implementation detail. | |
658 | """ |
|
617 | """ | |
659 |
|
618 | |||
660 | def _fill_text(self, text, width, indent): |
|
619 | def _fill_text(self, text, width, indent): | |
661 | return ''.join([indent + line for line in text.splitlines(True)]) |
|
620 | return ''.join([indent + line for line in text.splitlines(True)]) | |
662 |
|
621 | |||
663 |
|
622 | |||
664 | class RawTextHelpFormatter(RawDescriptionHelpFormatter): |
|
623 | class RawTextHelpFormatter(RawDescriptionHelpFormatter): | |
665 | """Help message formatter which retains formatting of all help text. |
|
624 | """Help message formatter which retains formatting of all help text. | |
666 |
|
625 | |||
667 | Only the name of this class is considered a public API. All the methods |
|
626 | Only the name of this class is considered a public API. All the methods | |
668 | provided by the class are considered an implementation detail. |
|
627 | provided by the class are considered an implementation detail. | |
669 | """ |
|
628 | """ | |
670 |
|
629 | |||
671 | def _split_lines(self, text, width): |
|
630 | def _split_lines(self, text, width): | |
672 | return text.splitlines() |
|
631 | return text.splitlines() | |
673 |
|
632 | |||
674 |
|
633 | |||
675 | class ArgumentDefaultsHelpFormatter(HelpFormatter): |
|
634 | class ArgumentDefaultsHelpFormatter(HelpFormatter): | |
676 | """Help message formatter which adds default values to argument help. |
|
635 | """Help message formatter which adds default values to argument help. | |
677 |
|
636 | |||
678 | Only the name of this class is considered a public API. All the methods |
|
637 | Only the name of this class is considered a public API. All the methods | |
679 | provided by the class are considered an implementation detail. |
|
638 | provided by the class are considered an implementation detail. | |
680 | """ |
|
639 | """ | |
681 |
|
640 | |||
682 | def _get_help_string(self, action): |
|
641 | def _get_help_string(self, action): | |
683 | help = action.help |
|
642 | help = action.help | |
684 | if '%(default)' not in action.help: |
|
643 | if '%(default)' not in action.help: | |
685 | if action.default is not SUPPRESS: |
|
644 | if action.default is not SUPPRESS: | |
686 | defaulting_nargs = [OPTIONAL, ZERO_OR_MORE] |
|
645 | defaulting_nargs = [OPTIONAL, ZERO_OR_MORE] | |
687 | if action.option_strings or action.nargs in defaulting_nargs: |
|
646 | if action.option_strings or action.nargs in defaulting_nargs: | |
688 | help += ' (default: %(default)s)' |
|
647 | help += ' (default: %(default)s)' | |
689 | return help |
|
648 | return help | |
690 |
|
649 | |||
691 |
|
650 | |||
692 | # ===================== |
|
651 | # ===================== | |
693 | # Options and Arguments |
|
652 | # Options and Arguments | |
694 | # ===================== |
|
653 | # ===================== | |
695 |
|
654 | |||
696 | def _get_action_name(argument): |
|
655 | def _get_action_name(argument): | |
697 | if argument is None: |
|
656 | if argument is None: | |
698 | return None |
|
657 | return None | |
699 | elif argument.option_strings: |
|
658 | elif argument.option_strings: | |
700 | return '/'.join(argument.option_strings) |
|
659 | return '/'.join(argument.option_strings) | |
701 | elif argument.metavar not in (None, SUPPRESS): |
|
660 | elif argument.metavar not in (None, SUPPRESS): | |
702 | return argument.metavar |
|
661 | return argument.metavar | |
703 | elif argument.dest not in (None, SUPPRESS): |
|
662 | elif argument.dest not in (None, SUPPRESS): | |
704 | return argument.dest |
|
663 | return argument.dest | |
705 | else: |
|
664 | else: | |
706 | return None |
|
665 | return None | |
707 |
|
666 | |||
708 |
|
667 | |||
709 | class ArgumentError(Exception): |
|
668 | class ArgumentError(Exception): | |
710 | """An error from creating or using an argument (optional or positional). |
|
669 | """An error from creating or using an argument (optional or positional). | |
711 |
|
670 | |||
712 | The string value of this exception is the message, augmented with |
|
671 | The string value of this exception is the message, augmented with | |
713 | information about the argument that caused it. |
|
672 | information about the argument that caused it. | |
714 | """ |
|
673 | """ | |
715 |
|
674 | |||
716 | def __init__(self, argument, message): |
|
675 | def __init__(self, argument, message): | |
717 | self.argument_name = _get_action_name(argument) |
|
676 | self.argument_name = _get_action_name(argument) | |
718 | self.message = message |
|
677 | self.message = message | |
719 |
|
678 | |||
720 | def __str__(self): |
|
679 | def __str__(self): | |
721 | if self.argument_name is None: |
|
680 | if self.argument_name is None: | |
722 | format = '%(message)s' |
|
681 | format = '%(message)s' | |
723 | else: |
|
682 | else: | |
724 | format = 'argument %(argument_name)s: %(message)s' |
|
683 | format = 'argument %(argument_name)s: %(message)s' | |
725 | return format % dict(message=self.message, |
|
684 | return format % dict(message=self.message, | |
726 | argument_name=self.argument_name) |
|
685 | argument_name=self.argument_name) | |
727 |
|
686 | |||
728 |
|
687 | |||
729 | class ArgumentTypeError(Exception): |
|
688 | class ArgumentTypeError(Exception): | |
730 | """An error from trying to convert a command line string to a type.""" |
|
689 | """An error from trying to convert a command line string to a type.""" | |
731 | pass |
|
690 | pass | |
732 |
|
691 | |||
733 |
|
692 | |||
734 | # ============== |
|
693 | # ============== | |
735 | # Action classes |
|
694 | # Action classes | |
736 | # ============== |
|
695 | # ============== | |
737 |
|
696 | |||
738 | class Action(_AttributeHolder): |
|
697 | class Action(_AttributeHolder): | |
739 | """Information about how to convert command line strings to Python objects. |
|
698 | """Information about how to convert command line strings to Python objects. | |
740 |
|
699 | |||
741 | Action objects are used by an ArgumentParser to represent the information |
|
700 | Action objects are used by an ArgumentParser to represent the information | |
742 | needed to parse a single argument from one or more strings from the |
|
701 | needed to parse a single argument from one or more strings from the | |
743 | command line. The keyword arguments to the Action constructor are also |
|
702 | command line. The keyword arguments to the Action constructor are also | |
744 | all attributes of Action instances. |
|
703 | all attributes of Action instances. | |
745 |
|
704 | |||
746 | Keyword Arguments: |
|
705 | Keyword Arguments: | |
747 |
|
706 | |||
748 | - option_strings -- A list of command-line option strings which |
|
707 | - option_strings -- A list of command-line option strings which | |
749 | should be associated with this action. |
|
708 | should be associated with this action. | |
750 |
|
709 | |||
751 | - dest -- The name of the attribute to hold the created object(s) |
|
710 | - dest -- The name of the attribute to hold the created object(s) | |
752 |
|
711 | |||
753 | - nargs -- The number of command-line arguments that should be |
|
712 | - nargs -- The number of command-line arguments that should be | |
754 | consumed. By default, one argument will be consumed and a single |
|
713 | consumed. By default, one argument will be consumed and a single | |
755 | value will be produced. Other values include: |
|
714 | value will be produced. Other values include: | |
756 | - N (an integer) consumes N arguments (and produces a list) |
|
715 | - N (an integer) consumes N arguments (and produces a list) | |
757 | - '?' consumes zero or one arguments |
|
716 | - '?' consumes zero or one arguments | |
758 | - '*' consumes zero or more arguments (and produces a list) |
|
717 | - '*' consumes zero or more arguments (and produces a list) | |
759 | - '+' consumes one or more arguments (and produces a list) |
|
718 | - '+' consumes one or more arguments (and produces a list) | |
760 | Note that the difference between the default and nargs=1 is that |
|
719 | Note that the difference between the default and nargs=1 is that | |
761 | with the default, a single value will be produced, while with |
|
720 | with the default, a single value will be produced, while with | |
762 | nargs=1, a list containing a single value will be produced. |
|
721 | nargs=1, a list containing a single value will be produced. | |
763 |
|
722 | |||
764 | - const -- The value to be produced if the option is specified and the |
|
723 | - const -- The value to be produced if the option is specified and the | |
765 | option uses an action that takes no values. |
|
724 | option uses an action that takes no values. | |
766 |
|
725 | |||
767 | - default -- The value to be produced if the option is not specified. |
|
726 | - default -- The value to be produced if the option is not specified. | |
768 |
|
727 | |||
769 | - type -- The type which the command-line arguments should be converted |
|
728 | - type -- The type which the command-line arguments should be converted | |
770 | to, should be one of 'string', 'int', 'float', 'complex' or a |
|
729 | to, should be one of 'string', 'int', 'float', 'complex' or a | |
771 | callable object that accepts a single string argument. If None, |
|
730 | callable object that accepts a single string argument. If None, | |
772 | 'string' is assumed. |
|
731 | 'string' is assumed. | |
773 |
|
732 | |||
774 | - choices -- A container of values that should be allowed. If not None, |
|
733 | - choices -- A container of values that should be allowed. If not None, | |
775 | after a command-line argument has been converted to the appropriate |
|
734 | after a command-line argument has been converted to the appropriate | |
776 | type, an exception will be raised if it is not a member of this |
|
735 | type, an exception will be raised if it is not a member of this | |
777 | collection. |
|
736 | collection. | |
778 |
|
737 | |||
779 | - required -- True if the action must always be specified at the |
|
738 | - required -- True if the action must always be specified at the | |
780 | command line. This is only meaningful for optional command-line |
|
739 | command line. This is only meaningful for optional command-line | |
781 | arguments. |
|
740 | arguments. | |
782 |
|
741 | |||
783 | - help -- The help string describing the argument. |
|
742 | - help -- The help string describing the argument. | |
784 |
|
743 | |||
785 | - metavar -- The name to be used for the option's argument with the |
|
744 | - metavar -- The name to be used for the option's argument with the | |
786 | help string. If None, the 'dest' value will be used as the name. |
|
745 | help string. If None, the 'dest' value will be used as the name. | |
787 | """ |
|
746 | """ | |
788 |
|
747 | |||
789 | def __init__(self, |
|
748 | def __init__(self, | |
790 | option_strings, |
|
749 | option_strings, | |
791 | dest, |
|
750 | dest, | |
792 | nargs=None, |
|
751 | nargs=None, | |
793 | const=None, |
|
752 | const=None, | |
794 | default=None, |
|
753 | default=None, | |
795 | type=None, |
|
754 | type=None, | |
796 | choices=None, |
|
755 | choices=None, | |
797 | required=False, |
|
756 | required=False, | |
798 | help=None, |
|
757 | help=None, | |
799 | metavar=None): |
|
758 | metavar=None): | |
800 | self.option_strings = option_strings |
|
759 | self.option_strings = option_strings | |
801 | self.dest = dest |
|
760 | self.dest = dest | |
802 | self.nargs = nargs |
|
761 | self.nargs = nargs | |
803 | self.const = const |
|
762 | self.const = const | |
804 | self.default = default |
|
763 | self.default = default | |
805 | self.type = type |
|
764 | self.type = type | |
806 | self.choices = choices |
|
765 | self.choices = choices | |
807 | self.required = required |
|
766 | self.required = required | |
808 | self.help = help |
|
767 | self.help = help | |
809 | self.metavar = metavar |
|
768 | self.metavar = metavar | |
810 |
|
769 | |||
811 | def _get_kwargs(self): |
|
770 | def _get_kwargs(self): | |
812 | names = [ |
|
771 | names = [ | |
813 | 'option_strings', |
|
772 | 'option_strings', | |
814 | 'dest', |
|
773 | 'dest', | |
815 | 'nargs', |
|
774 | 'nargs', | |
816 | 'const', |
|
775 | 'const', | |
817 | 'default', |
|
776 | 'default', | |
818 | 'type', |
|
777 | 'type', | |
819 | 'choices', |
|
778 | 'choices', | |
820 | 'help', |
|
779 | 'help', | |
821 | 'metavar', |
|
780 | 'metavar', | |
822 | ] |
|
781 | ] | |
823 | return [(name, getattr(self, name)) for name in names] |
|
782 | return [(name, getattr(self, name)) for name in names] | |
824 |
|
783 | |||
825 | def __call__(self, parser, namespace, values, option_string=None): |
|
784 | def __call__(self, parser, namespace, values, option_string=None): | |
826 | raise NotImplementedError(_('.__call__() not defined')) |
|
785 | raise NotImplementedError(_('.__call__() not defined')) | |
827 |
|
786 | |||
828 |
|
787 | |||
829 | class _StoreAction(Action): |
|
788 | class _StoreAction(Action): | |
830 |
|
789 | |||
831 | def __init__(self, |
|
790 | def __init__(self, | |
832 | option_strings, |
|
791 | option_strings, | |
833 | dest, |
|
792 | dest, | |
834 | nargs=None, |
|
793 | nargs=None, | |
835 | const=None, |
|
794 | const=None, | |
836 | default=None, |
|
795 | default=None, | |
837 | type=None, |
|
796 | type=None, | |
838 | choices=None, |
|
797 | choices=None, | |
839 | required=False, |
|
798 | required=False, | |
840 | help=None, |
|
799 | help=None, | |
841 | metavar=None): |
|
800 | metavar=None): | |
842 | if nargs == 0: |
|
801 | if nargs == 0: | |
843 | raise ValueError('nargs for store actions must be > 0; if you ' |
|
802 | raise ValueError('nargs for store actions must be > 0; if you ' | |
844 | 'have nothing to store, actions such as store ' |
|
803 | 'have nothing to store, actions such as store ' | |
845 | 'true or store const may be more appropriate') |
|
804 | 'true or store const may be more appropriate') | |
846 | if const is not None and nargs != OPTIONAL: |
|
805 | if const is not None and nargs != OPTIONAL: | |
847 | raise ValueError('nargs must be %r to supply const' % OPTIONAL) |
|
806 | raise ValueError('nargs must be %r to supply const' % OPTIONAL) | |
848 | super(_StoreAction, self).__init__( |
|
807 | super(_StoreAction, self).__init__( | |
849 | option_strings=option_strings, |
|
808 | option_strings=option_strings, | |
850 | dest=dest, |
|
809 | dest=dest, | |
851 | nargs=nargs, |
|
810 | nargs=nargs, | |
852 | const=const, |
|
811 | const=const, | |
853 | default=default, |
|
812 | default=default, | |
854 | type=type, |
|
813 | type=type, | |
855 | choices=choices, |
|
814 | choices=choices, | |
856 | required=required, |
|
815 | required=required, | |
857 | help=help, |
|
816 | help=help, | |
858 | metavar=metavar) |
|
817 | metavar=metavar) | |
859 |
|
818 | |||
860 | def __call__(self, parser, namespace, values, option_string=None): |
|
819 | def __call__(self, parser, namespace, values, option_string=None): | |
861 | setattr(namespace, self.dest, values) |
|
820 | setattr(namespace, self.dest, values) | |
862 |
|
821 | |||
863 |
|
822 | |||
864 | class _StoreConstAction(Action): |
|
823 | class _StoreConstAction(Action): | |
865 |
|
824 | |||
866 | def __init__(self, |
|
825 | def __init__(self, | |
867 | option_strings, |
|
826 | option_strings, | |
868 | dest, |
|
827 | dest, | |
869 | const, |
|
828 | const, | |
870 | default=None, |
|
829 | default=None, | |
871 | required=False, |
|
830 | required=False, | |
872 | help=None, |
|
831 | help=None, | |
873 | metavar=None): |
|
832 | metavar=None): | |
874 | super(_StoreConstAction, self).__init__( |
|
833 | super(_StoreConstAction, self).__init__( | |
875 | option_strings=option_strings, |
|
834 | option_strings=option_strings, | |
876 | dest=dest, |
|
835 | dest=dest, | |
877 | nargs=0, |
|
836 | nargs=0, | |
878 | const=const, |
|
837 | const=const, | |
879 | default=default, |
|
838 | default=default, | |
880 | required=required, |
|
839 | required=required, | |
881 | help=help) |
|
840 | help=help) | |
882 |
|
841 | |||
883 | def __call__(self, parser, namespace, values, option_string=None): |
|
842 | def __call__(self, parser, namespace, values, option_string=None): | |
884 | setattr(namespace, self.dest, self.const) |
|
843 | setattr(namespace, self.dest, self.const) | |
885 |
|
844 | |||
886 |
|
845 | |||
887 | class _StoreTrueAction(_StoreConstAction): |
|
846 | class _StoreTrueAction(_StoreConstAction): | |
888 |
|
847 | |||
889 | def __init__(self, |
|
848 | def __init__(self, | |
890 | option_strings, |
|
849 | option_strings, | |
891 | dest, |
|
850 | dest, | |
892 | default=False, |
|
851 | default=False, | |
893 | required=False, |
|
852 | required=False, | |
894 | help=None): |
|
853 | help=None): | |
895 | super(_StoreTrueAction, self).__init__( |
|
854 | super(_StoreTrueAction, self).__init__( | |
896 | option_strings=option_strings, |
|
855 | option_strings=option_strings, | |
897 | dest=dest, |
|
856 | dest=dest, | |
898 | const=True, |
|
857 | const=True, | |
899 | default=default, |
|
858 | default=default, | |
900 | required=required, |
|
859 | required=required, | |
901 | help=help) |
|
860 | help=help) | |
902 |
|
861 | |||
903 |
|
862 | |||
904 | class _StoreFalseAction(_StoreConstAction): |
|
863 | class _StoreFalseAction(_StoreConstAction): | |
905 |
|
864 | |||
906 | def __init__(self, |
|
865 | def __init__(self, | |
907 | option_strings, |
|
866 | option_strings, | |
908 | dest, |
|
867 | dest, | |
909 | default=True, |
|
868 | default=True, | |
910 | required=False, |
|
869 | required=False, | |
911 | help=None): |
|
870 | help=None): | |
912 | super(_StoreFalseAction, self).__init__( |
|
871 | super(_StoreFalseAction, self).__init__( | |
913 | option_strings=option_strings, |
|
872 | option_strings=option_strings, | |
914 | dest=dest, |
|
873 | dest=dest, | |
915 | const=False, |
|
874 | const=False, | |
916 | default=default, |
|
875 | default=default, | |
917 | required=required, |
|
876 | required=required, | |
918 | help=help) |
|
877 | help=help) | |
919 |
|
878 | |||
920 |
|
879 | |||
921 | class _AppendAction(Action): |
|
880 | class _AppendAction(Action): | |
922 |
|
881 | |||
923 | def __init__(self, |
|
882 | def __init__(self, | |
924 | option_strings, |
|
883 | option_strings, | |
925 | dest, |
|
884 | dest, | |
926 | nargs=None, |
|
885 | nargs=None, | |
927 | const=None, |
|
886 | const=None, | |
928 | default=None, |
|
887 | default=None, | |
929 | type=None, |
|
888 | type=None, | |
930 | choices=None, |
|
889 | choices=None, | |
931 | required=False, |
|
890 | required=False, | |
932 | help=None, |
|
891 | help=None, | |
933 | metavar=None): |
|
892 | metavar=None): | |
934 | if nargs == 0: |
|
893 | if nargs == 0: | |
935 | raise ValueError('nargs for append actions must be > 0; if arg ' |
|
894 | raise ValueError('nargs for append actions must be > 0; if arg ' | |
936 | 'strings are not supplying the value to append, ' |
|
895 | 'strings are not supplying the value to append, ' | |
937 | 'the append const action may be more appropriate') |
|
896 | 'the append const action may be more appropriate') | |
938 | if const is not None and nargs != OPTIONAL: |
|
897 | if const is not None and nargs != OPTIONAL: | |
939 | raise ValueError('nargs must be %r to supply const' % OPTIONAL) |
|
898 | raise ValueError('nargs must be %r to supply const' % OPTIONAL) | |
940 | super(_AppendAction, self).__init__( |
|
899 | super(_AppendAction, self).__init__( | |
941 | option_strings=option_strings, |
|
900 | option_strings=option_strings, | |
942 | dest=dest, |
|
901 | dest=dest, | |
943 | nargs=nargs, |
|
902 | nargs=nargs, | |
944 | const=const, |
|
903 | const=const, | |
945 | default=default, |
|
904 | default=default, | |
946 | type=type, |
|
905 | type=type, | |
947 | choices=choices, |
|
906 | choices=choices, | |
948 | required=required, |
|
907 | required=required, | |
949 | help=help, |
|
908 | help=help, | |
950 | metavar=metavar) |
|
909 | metavar=metavar) | |
951 |
|
910 | |||
952 | def __call__(self, parser, namespace, values, option_string=None): |
|
911 | def __call__(self, parser, namespace, values, option_string=None): | |
953 | items = _copy.copy(_ensure_value(namespace, self.dest, [])) |
|
912 | items = _copy.copy(_ensure_value(namespace, self.dest, [])) | |
954 | items.append(values) |
|
913 | items.append(values) | |
955 | setattr(namespace, self.dest, items) |
|
914 | setattr(namespace, self.dest, items) | |
956 |
|
915 | |||
957 |
|
916 | |||
958 | class _AppendConstAction(Action): |
|
917 | class _AppendConstAction(Action): | |
959 |
|
918 | |||
960 | def __init__(self, |
|
919 | def __init__(self, | |
961 | option_strings, |
|
920 | option_strings, | |
962 | dest, |
|
921 | dest, | |
963 | const, |
|
922 | const, | |
964 | default=None, |
|
923 | default=None, | |
965 | required=False, |
|
924 | required=False, | |
966 | help=None, |
|
925 | help=None, | |
967 | metavar=None): |
|
926 | metavar=None): | |
968 | super(_AppendConstAction, self).__init__( |
|
927 | super(_AppendConstAction, self).__init__( | |
969 | option_strings=option_strings, |
|
928 | option_strings=option_strings, | |
970 | dest=dest, |
|
929 | dest=dest, | |
971 | nargs=0, |
|
930 | nargs=0, | |
972 | const=const, |
|
931 | const=const, | |
973 | default=default, |
|
932 | default=default, | |
974 | required=required, |
|
933 | required=required, | |
975 | help=help, |
|
934 | help=help, | |
976 | metavar=metavar) |
|
935 | metavar=metavar) | |
977 |
|
936 | |||
978 | def __call__(self, parser, namespace, values, option_string=None): |
|
937 | def __call__(self, parser, namespace, values, option_string=None): | |
979 | items = _copy.copy(_ensure_value(namespace, self.dest, [])) |
|
938 | items = _copy.copy(_ensure_value(namespace, self.dest, [])) | |
980 | items.append(self.const) |
|
939 | items.append(self.const) | |
981 | setattr(namespace, self.dest, items) |
|
940 | setattr(namespace, self.dest, items) | |
982 |
|
941 | |||
983 |
|
942 | |||
984 | class _CountAction(Action): |
|
943 | class _CountAction(Action): | |
985 |
|
944 | |||
986 | def __init__(self, |
|
945 | def __init__(self, | |
987 | option_strings, |
|
946 | option_strings, | |
988 | dest, |
|
947 | dest, | |
989 | default=None, |
|
948 | default=None, | |
990 | required=False, |
|
949 | required=False, | |
991 | help=None): |
|
950 | help=None): | |
992 | super(_CountAction, self).__init__( |
|
951 | super(_CountAction, self).__init__( | |
993 | option_strings=option_strings, |
|
952 | option_strings=option_strings, | |
994 | dest=dest, |
|
953 | dest=dest, | |
995 | nargs=0, |
|
954 | nargs=0, | |
996 | default=default, |
|
955 | default=default, | |
997 | required=required, |
|
956 | required=required, | |
998 | help=help) |
|
957 | help=help) | |
999 |
|
958 | |||
1000 | def __call__(self, parser, namespace, values, option_string=None): |
|
959 | def __call__(self, parser, namespace, values, option_string=None): | |
1001 | new_count = _ensure_value(namespace, self.dest, 0) + 1 |
|
960 | new_count = _ensure_value(namespace, self.dest, 0) + 1 | |
1002 | setattr(namespace, self.dest, new_count) |
|
961 | setattr(namespace, self.dest, new_count) | |
1003 |
|
962 | |||
1004 |
|
963 | |||
1005 | class _HelpAction(Action): |
|
964 | class _HelpAction(Action): | |
1006 |
|
965 | |||
1007 | def __init__(self, |
|
966 | def __init__(self, | |
1008 | option_strings, |
|
967 | option_strings, | |
1009 | dest=SUPPRESS, |
|
968 | dest=SUPPRESS, | |
1010 | default=SUPPRESS, |
|
969 | default=SUPPRESS, | |
1011 | help=None): |
|
970 | help=None): | |
1012 | super(_HelpAction, self).__init__( |
|
971 | super(_HelpAction, self).__init__( | |
1013 | option_strings=option_strings, |
|
972 | option_strings=option_strings, | |
1014 | dest=dest, |
|
973 | dest=dest, | |
1015 | default=default, |
|
974 | default=default, | |
1016 | nargs=0, |
|
975 | nargs=0, | |
1017 | help=help) |
|
976 | help=help) | |
1018 |
|
977 | |||
1019 | def __call__(self, parser, namespace, values, option_string=None): |
|
978 | def __call__(self, parser, namespace, values, option_string=None): | |
1020 | parser.print_help() |
|
979 | parser.print_help() | |
1021 | parser.exit() |
|
980 | parser.exit() | |
1022 |
|
981 | |||
1023 |
|
982 | |||
1024 | class _VersionAction(Action): |
|
983 | class _VersionAction(Action): | |
1025 |
|
984 | |||
1026 | def __init__(self, |
|
985 | def __init__(self, | |
1027 | option_strings, |
|
986 | option_strings, | |
1028 | version=None, |
|
987 | version=None, | |
1029 | dest=SUPPRESS, |
|
988 | dest=SUPPRESS, | |
1030 | default=SUPPRESS, |
|
989 | default=SUPPRESS, | |
1031 | help=None): |
|
990 | help="show program's version number and exit"): | |
1032 | super(_VersionAction, self).__init__( |
|
991 | super(_VersionAction, self).__init__( | |
1033 | option_strings=option_strings, |
|
992 | option_strings=option_strings, | |
1034 | dest=dest, |
|
993 | dest=dest, | |
1035 | default=default, |
|
994 | default=default, | |
1036 | nargs=0, |
|
995 | nargs=0, | |
1037 | help=help) |
|
996 | help=help) | |
1038 | self.version = version |
|
997 | self.version = version | |
1039 |
|
998 | |||
1040 | def __call__(self, parser, namespace, values, option_string=None): |
|
999 | def __call__(self, parser, namespace, values, option_string=None): | |
1041 | version = self.version |
|
1000 | version = self.version | |
1042 | if version is None: |
|
1001 | if version is None: | |
1043 | version = parser.version |
|
1002 | version = parser.version | |
1044 | formatter = parser._get_formatter() |
|
1003 | formatter = parser._get_formatter() | |
1045 | formatter.add_text(version) |
|
1004 | formatter.add_text(version) | |
1046 | parser.exit(message=formatter.format_help()) |
|
1005 | parser.exit(message=formatter.format_help()) | |
1047 |
|
1006 | |||
1048 |
|
1007 | |||
1049 | class _SubParsersAction(Action): |
|
1008 | class _SubParsersAction(Action): | |
1050 |
|
1009 | |||
1051 | class _ChoicesPseudoAction(Action): |
|
1010 | class _ChoicesPseudoAction(Action): | |
1052 |
|
1011 | |||
1053 | def __init__(self, name, help): |
|
1012 | def __init__(self, name, help): | |
1054 | sup = super(_SubParsersAction._ChoicesPseudoAction, self) |
|
1013 | sup = super(_SubParsersAction._ChoicesPseudoAction, self) | |
1055 | sup.__init__(option_strings=[], dest=name, help=help) |
|
1014 | sup.__init__(option_strings=[], dest=name, help=help) | |
1056 |
|
1015 | |||
1057 | def __init__(self, |
|
1016 | def __init__(self, | |
1058 | option_strings, |
|
1017 | option_strings, | |
1059 | prog, |
|
1018 | prog, | |
1060 | parser_class, |
|
1019 | parser_class, | |
1061 | dest=SUPPRESS, |
|
1020 | dest=SUPPRESS, | |
1062 | help=None, |
|
1021 | help=None, | |
1063 | metavar=None): |
|
1022 | metavar=None): | |
1064 |
|
1023 | |||
1065 | self._prog_prefix = prog |
|
1024 | self._prog_prefix = prog | |
1066 | self._parser_class = parser_class |
|
1025 | self._parser_class = parser_class | |
1067 | self._name_parser_map = {} |
|
1026 | self._name_parser_map = {} | |
1068 | self._choices_actions = [] |
|
1027 | self._choices_actions = [] | |
1069 |
|
1028 | |||
1070 | super(_SubParsersAction, self).__init__( |
|
1029 | super(_SubParsersAction, self).__init__( | |
1071 | option_strings=option_strings, |
|
1030 | option_strings=option_strings, | |
1072 | dest=dest, |
|
1031 | dest=dest, | |
1073 | nargs=PARSER, |
|
1032 | nargs=PARSER, | |
1074 | choices=self._name_parser_map, |
|
1033 | choices=self._name_parser_map, | |
1075 | help=help, |
|
1034 | help=help, | |
1076 | metavar=metavar) |
|
1035 | metavar=metavar) | |
1077 |
|
1036 | |||
1078 | def add_parser(self, name, **kwargs): |
|
1037 | def add_parser(self, name, **kwargs): | |
1079 | # set prog from the existing prefix |
|
1038 | # set prog from the existing prefix | |
1080 | if kwargs.get('prog') is None: |
|
1039 | if kwargs.get('prog') is None: | |
1081 | kwargs['prog'] = '%s %s' % (self._prog_prefix, name) |
|
1040 | kwargs['prog'] = '%s %s' % (self._prog_prefix, name) | |
1082 |
|
1041 | |||
1083 | # create a pseudo-action to hold the choice help |
|
1042 | # create a pseudo-action to hold the choice help | |
1084 | if 'help' in kwargs: |
|
1043 | if 'help' in kwargs: | |
1085 | help = kwargs.pop('help') |
|
1044 | help = kwargs.pop('help') | |
1086 | choice_action = self._ChoicesPseudoAction(name, help) |
|
1045 | choice_action = self._ChoicesPseudoAction(name, help) | |
1087 | self._choices_actions.append(choice_action) |
|
1046 | self._choices_actions.append(choice_action) | |
1088 |
|
1047 | |||
1089 | # create the parser and add it to the map |
|
1048 | # create the parser and add it to the map | |
1090 | parser = self._parser_class(**kwargs) |
|
1049 | parser = self._parser_class(**kwargs) | |
1091 | self._name_parser_map[name] = parser |
|
1050 | self._name_parser_map[name] = parser | |
1092 | return parser |
|
1051 | return parser | |
1093 |
|
1052 | |||
1094 | def _get_subactions(self): |
|
1053 | def _get_subactions(self): | |
1095 | return self._choices_actions |
|
1054 | return self._choices_actions | |
1096 |
|
1055 | |||
1097 | def __call__(self, parser, namespace, values, option_string=None): |
|
1056 | def __call__(self, parser, namespace, values, option_string=None): | |
1098 | parser_name = values[0] |
|
1057 | parser_name = values[0] | |
1099 | arg_strings = values[1:] |
|
1058 | arg_strings = values[1:] | |
1100 |
|
1059 | |||
1101 | # set the parser name if requested |
|
1060 | # set the parser name if requested | |
1102 | if self.dest is not SUPPRESS: |
|
1061 | if self.dest is not SUPPRESS: | |
1103 | setattr(namespace, self.dest, parser_name) |
|
1062 | setattr(namespace, self.dest, parser_name) | |
1104 |
|
1063 | |||
1105 | # select the parser |
|
1064 | # select the parser | |
1106 | try: |
|
1065 | try: | |
1107 | parser = self._name_parser_map[parser_name] |
|
1066 | parser = self._name_parser_map[parser_name] | |
1108 | except KeyError: |
|
1067 | except KeyError: | |
1109 | tup = parser_name, ', '.join(self._name_parser_map) |
|
1068 | tup = parser_name, ', '.join(self._name_parser_map) | |
1110 | msg = _('unknown parser %r (choices: %s)' % tup) |
|
1069 | msg = _('unknown parser %r (choices: %s)' % tup) | |
1111 | raise ArgumentError(self, msg) |
|
1070 | raise ArgumentError(self, msg) | |
1112 |
|
1071 | |||
1113 | # parse all the remaining options into the namespace |
|
1072 | # parse all the remaining options into the namespace | |
1114 | parser.parse_args(arg_strings, namespace) |
|
1073 | parser.parse_args(arg_strings, namespace) | |
1115 |
|
1074 | |||
1116 |
|
1075 | |||
1117 | # ============== |
|
1076 | # ============== | |
1118 | # Type classes |
|
1077 | # Type classes | |
1119 | # ============== |
|
1078 | # ============== | |
1120 |
|
1079 | |||
1121 | class FileType(object): |
|
1080 | class FileType(object): | |
1122 | """Factory for creating file object types |
|
1081 | """Factory for creating file object types | |
1123 |
|
1082 | |||
1124 | Instances of FileType are typically passed as type= arguments to the |
|
1083 | Instances of FileType are typically passed as type= arguments to the | |
1125 | ArgumentParser add_argument() method. |
|
1084 | ArgumentParser add_argument() method. | |
1126 |
|
1085 | |||
1127 | Keyword Arguments: |
|
1086 | Keyword Arguments: | |
1128 | - mode -- A string indicating how the file is to be opened. Accepts the |
|
1087 | - mode -- A string indicating how the file is to be opened. Accepts the | |
1129 | same values as the builtin open() function. |
|
1088 | same values as the builtin open() function. | |
1130 | - bufsize -- The file's desired buffer size. Accepts the same values as |
|
1089 | - bufsize -- The file's desired buffer size. Accepts the same values as | |
1131 | the builtin open() function. |
|
1090 | the builtin open() function. | |
1132 | """ |
|
1091 | """ | |
1133 |
|
1092 | |||
1134 | def __init__(self, mode='r', bufsize=None): |
|
1093 | def __init__(self, mode='r', bufsize=None): | |
1135 | self._mode = mode |
|
1094 | self._mode = mode | |
1136 | self._bufsize = bufsize |
|
1095 | self._bufsize = bufsize | |
1137 |
|
1096 | |||
1138 | def __call__(self, string): |
|
1097 | def __call__(self, string): | |
1139 | # the special argument "-" means sys.std{in,out} |
|
1098 | # the special argument "-" means sys.std{in,out} | |
1140 | if string == '-': |
|
1099 | if string == '-': | |
1141 | if 'r' in self._mode: |
|
1100 | if 'r' in self._mode: | |
1142 | return _sys.stdin |
|
1101 | return _sys.stdin | |
1143 | elif 'w' in self._mode: |
|
1102 | elif 'w' in self._mode: | |
1144 | return _sys.stdout |
|
1103 | return _sys.stdout | |
1145 | else: |
|
1104 | else: | |
1146 | msg = _('argument "-" with mode %r' % self._mode) |
|
1105 | msg = _('argument "-" with mode %r' % self._mode) | |
1147 | raise ValueError(msg) |
|
1106 | raise ValueError(msg) | |
1148 |
|
1107 | |||
1149 | # all other arguments are used as file names |
|
1108 | # all other arguments are used as file names | |
1150 | if self._bufsize: |
|
1109 | if self._bufsize: | |
1151 | return open(string, self._mode, self._bufsize) |
|
1110 | return open(string, self._mode, self._bufsize) | |
1152 | else: |
|
1111 | else: | |
1153 | return open(string, self._mode) |
|
1112 | return open(string, self._mode) | |
1154 |
|
1113 | |||
1155 | def __repr__(self): |
|
1114 | def __repr__(self): | |
1156 | args = [self._mode, self._bufsize] |
|
1115 | args = [self._mode, self._bufsize] | |
1157 | args_str = ', '.join([repr(arg) for arg in args if arg is not None]) |
|
1116 | args_str = ', '.join([repr(arg) for arg in args if arg is not None]) | |
1158 | return '%s(%s)' % (type(self).__name__, args_str) |
|
1117 | return '%s(%s)' % (type(self).__name__, args_str) | |
1159 |
|
1118 | |||
1160 | # =========================== |
|
1119 | # =========================== | |
1161 | # Optional and Positional Parsing |
|
1120 | # Optional and Positional Parsing | |
1162 | # =========================== |
|
1121 | # =========================== | |
1163 |
|
1122 | |||
1164 | class Namespace(_AttributeHolder): |
|
1123 | class Namespace(_AttributeHolder): | |
1165 | """Simple object for storing attributes. |
|
1124 | """Simple object for storing attributes. | |
1166 |
|
1125 | |||
1167 | Implements equality by attribute names and values, and provides a simple |
|
1126 | Implements equality by attribute names and values, and provides a simple | |
1168 | string representation. |
|
1127 | string representation. | |
1169 | """ |
|
1128 | """ | |
1170 |
|
1129 | |||
1171 | def __init__(self, **kwargs): |
|
1130 | def __init__(self, **kwargs): | |
1172 | self.__dict__.update(**kwargs) |
|
1131 | for name in kwargs: | |
|
1132 | setattr(self, name, kwargs[name]) | |||
|
1133 | ||||
|
1134 | __hash__ = None | |||
1173 |
|
1135 | |||
1174 | def __eq__(self, other): |
|
1136 | def __eq__(self, other): | |
1175 | return vars(self) == vars(other) |
|
1137 | return vars(self) == vars(other) | |
1176 |
|
1138 | |||
1177 | def __ne__(self, other): |
|
1139 | def __ne__(self, other): | |
1178 | return not (self == other) |
|
1140 | return not (self == other) | |
1179 |
|
1141 | |||
1180 | def __contains__(self, key): |
|
1142 | def __contains__(self, key): | |
1181 | return key in self.__dict__ |
|
1143 | return key in self.__dict__ | |
1182 |
|
1144 | |||
1183 |
|
1145 | |||
1184 | class _ActionsContainer(object): |
|
1146 | class _ActionsContainer(object): | |
1185 |
|
1147 | |||
1186 | def __init__(self, |
|
1148 | def __init__(self, | |
1187 | description, |
|
1149 | description, | |
1188 | prefix_chars, |
|
1150 | prefix_chars, | |
1189 | argument_default, |
|
1151 | argument_default, | |
1190 | conflict_handler): |
|
1152 | conflict_handler): | |
1191 | super(_ActionsContainer, self).__init__() |
|
1153 | super(_ActionsContainer, self).__init__() | |
1192 |
|
1154 | |||
1193 | self.description = description |
|
1155 | self.description = description | |
1194 | self.argument_default = argument_default |
|
1156 | self.argument_default = argument_default | |
1195 | self.prefix_chars = prefix_chars |
|
1157 | self.prefix_chars = prefix_chars | |
1196 | self.conflict_handler = conflict_handler |
|
1158 | self.conflict_handler = conflict_handler | |
1197 |
|
1159 | |||
1198 | # set up registries |
|
1160 | # set up registries | |
1199 | self._registries = {} |
|
1161 | self._registries = {} | |
1200 |
|
1162 | |||
1201 | # register actions |
|
1163 | # register actions | |
1202 | self.register('action', None, _StoreAction) |
|
1164 | self.register('action', None, _StoreAction) | |
1203 | self.register('action', 'store', _StoreAction) |
|
1165 | self.register('action', 'store', _StoreAction) | |
1204 | self.register('action', 'store_const', _StoreConstAction) |
|
1166 | self.register('action', 'store_const', _StoreConstAction) | |
1205 | self.register('action', 'store_true', _StoreTrueAction) |
|
1167 | self.register('action', 'store_true', _StoreTrueAction) | |
1206 | self.register('action', 'store_false', _StoreFalseAction) |
|
1168 | self.register('action', 'store_false', _StoreFalseAction) | |
1207 | self.register('action', 'append', _AppendAction) |
|
1169 | self.register('action', 'append', _AppendAction) | |
1208 | self.register('action', 'append_const', _AppendConstAction) |
|
1170 | self.register('action', 'append_const', _AppendConstAction) | |
1209 | self.register('action', 'count', _CountAction) |
|
1171 | self.register('action', 'count', _CountAction) | |
1210 | self.register('action', 'help', _HelpAction) |
|
1172 | self.register('action', 'help', _HelpAction) | |
1211 | self.register('action', 'version', _VersionAction) |
|
1173 | self.register('action', 'version', _VersionAction) | |
1212 | self.register('action', 'parsers', _SubParsersAction) |
|
1174 | self.register('action', 'parsers', _SubParsersAction) | |
1213 |
|
1175 | |||
1214 | # raise an exception if the conflict handler is invalid |
|
1176 | # raise an exception if the conflict handler is invalid | |
1215 | self._get_handler() |
|
1177 | self._get_handler() | |
1216 |
|
1178 | |||
1217 | # action storage |
|
1179 | # action storage | |
1218 | self._actions = [] |
|
1180 | self._actions = [] | |
1219 | self._option_string_actions = {} |
|
1181 | self._option_string_actions = {} | |
1220 |
|
1182 | |||
1221 | # groups |
|
1183 | # groups | |
1222 | self._action_groups = [] |
|
1184 | self._action_groups = [] | |
1223 | self._mutually_exclusive_groups = [] |
|
1185 | self._mutually_exclusive_groups = [] | |
1224 |
|
1186 | |||
1225 | # defaults storage |
|
1187 | # defaults storage | |
1226 | self._defaults = {} |
|
1188 | self._defaults = {} | |
1227 |
|
1189 | |||
1228 | # determines whether an "option" looks like a negative number |
|
1190 | # determines whether an "option" looks like a negative number | |
1229 | self._negative_number_matcher = _re.compile(r'^-\d+$|^-\d*\.\d+$') |
|
1191 | self._negative_number_matcher = _re.compile(r'^-\d+$|^-\d*\.\d+$') | |
1230 |
|
1192 | |||
1231 | # whether or not there are any optionals that look like negative |
|
1193 | # whether or not there are any optionals that look like negative | |
1232 | # numbers -- uses a list so it can be shared and edited |
|
1194 | # numbers -- uses a list so it can be shared and edited | |
1233 | self._has_negative_number_optionals = [] |
|
1195 | self._has_negative_number_optionals = [] | |
1234 |
|
1196 | |||
1235 | # ==================== |
|
1197 | # ==================== | |
1236 | # Registration methods |
|
1198 | # Registration methods | |
1237 | # ==================== |
|
1199 | # ==================== | |
1238 | def register(self, registry_name, value, object): |
|
1200 | def register(self, registry_name, value, object): | |
1239 | registry = self._registries.setdefault(registry_name, {}) |
|
1201 | registry = self._registries.setdefault(registry_name, {}) | |
1240 | registry[value] = object |
|
1202 | registry[value] = object | |
1241 |
|
1203 | |||
1242 | def _registry_get(self, registry_name, value, default=None): |
|
1204 | def _registry_get(self, registry_name, value, default=None): | |
1243 | return self._registries[registry_name].get(value, default) |
|
1205 | return self._registries[registry_name].get(value, default) | |
1244 |
|
1206 | |||
1245 | # ================================== |
|
1207 | # ================================== | |
1246 | # Namespace default accessor methods |
|
1208 | # Namespace default accessor methods | |
1247 | # ================================== |
|
1209 | # ================================== | |
1248 | def set_defaults(self, **kwargs): |
|
1210 | def set_defaults(self, **kwargs): | |
1249 | self._defaults.update(kwargs) |
|
1211 | self._defaults.update(kwargs) | |
1250 |
|
1212 | |||
1251 | # if these defaults match any existing arguments, replace |
|
1213 | # if these defaults match any existing arguments, replace | |
1252 | # the previous default on the object with the new one |
|
1214 | # the previous default on the object with the new one | |
1253 | for action in self._actions: |
|
1215 | for action in self._actions: | |
1254 | if action.dest in kwargs: |
|
1216 | if action.dest in kwargs: | |
1255 | action.default = kwargs[action.dest] |
|
1217 | action.default = kwargs[action.dest] | |
1256 |
|
1218 | |||
1257 | def get_default(self, dest): |
|
1219 | def get_default(self, dest): | |
1258 | for action in self._actions: |
|
1220 | for action in self._actions: | |
1259 | if action.dest == dest and action.default is not None: |
|
1221 | if action.dest == dest and action.default is not None: | |
1260 | return action.default |
|
1222 | return action.default | |
1261 | return self._defaults.get(dest, None) |
|
1223 | return self._defaults.get(dest, None) | |
1262 |
|
1224 | |||
1263 |
|
1225 | |||
1264 | # ======================= |
|
1226 | # ======================= | |
1265 | # Adding argument actions |
|
1227 | # Adding argument actions | |
1266 | # ======================= |
|
1228 | # ======================= | |
1267 | def add_argument(self, *args, **kwargs): |
|
1229 | def add_argument(self, *args, **kwargs): | |
1268 | """ |
|
1230 | """ | |
1269 | add_argument(dest, ..., name=value, ...) |
|
1231 | add_argument(dest, ..., name=value, ...) | |
1270 | add_argument(option_string, option_string, ..., name=value, ...) |
|
1232 | add_argument(option_string, option_string, ..., name=value, ...) | |
1271 | """ |
|
1233 | """ | |
1272 |
|
1234 | |||
1273 | # if no positional args are supplied or only one is supplied and |
|
1235 | # if no positional args are supplied or only one is supplied and | |
1274 | # it doesn't look like an option string, parse a positional |
|
1236 | # it doesn't look like an option string, parse a positional | |
1275 | # argument |
|
1237 | # argument | |
1276 | chars = self.prefix_chars |
|
1238 | chars = self.prefix_chars | |
1277 | if not args or len(args) == 1 and args[0][0] not in chars: |
|
1239 | if not args or len(args) == 1 and args[0][0] not in chars: | |
1278 | if args and 'dest' in kwargs: |
|
1240 | if args and 'dest' in kwargs: | |
1279 | raise ValueError('dest supplied twice for positional argument') |
|
1241 | raise ValueError('dest supplied twice for positional argument') | |
1280 | kwargs = self._get_positional_kwargs(*args, **kwargs) |
|
1242 | kwargs = self._get_positional_kwargs(*args, **kwargs) | |
1281 |
|
1243 | |||
1282 | # otherwise, we're adding an optional argument |
|
1244 | # otherwise, we're adding an optional argument | |
1283 | else: |
|
1245 | else: | |
1284 | kwargs = self._get_optional_kwargs(*args, **kwargs) |
|
1246 | kwargs = self._get_optional_kwargs(*args, **kwargs) | |
1285 |
|
1247 | |||
1286 | # if no default was supplied, use the parser-level default |
|
1248 | # if no default was supplied, use the parser-level default | |
1287 | if 'default' not in kwargs: |
|
1249 | if 'default' not in kwargs: | |
1288 | dest = kwargs['dest'] |
|
1250 | dest = kwargs['dest'] | |
1289 | if dest in self._defaults: |
|
1251 | if dest in self._defaults: | |
1290 | kwargs['default'] = self._defaults[dest] |
|
1252 | kwargs['default'] = self._defaults[dest] | |
1291 | elif self.argument_default is not None: |
|
1253 | elif self.argument_default is not None: | |
1292 | kwargs['default'] = self.argument_default |
|
1254 | kwargs['default'] = self.argument_default | |
1293 |
|
1255 | |||
1294 | # create the action object, and add it to the parser |
|
1256 | # create the action object, and add it to the parser | |
1295 | action_class = self._pop_action_class(kwargs) |
|
1257 | action_class = self._pop_action_class(kwargs) | |
1296 | if not _callable(action_class): |
|
1258 | if not _callable(action_class): | |
1297 | raise ValueError('unknown action "%s"' % action_class) |
|
1259 | raise ValueError('unknown action "%s"' % action_class) | |
1298 | action = action_class(**kwargs) |
|
1260 | action = action_class(**kwargs) | |
|
1261 | ||||
|
1262 | # raise an error if the action type is not callable | |||
|
1263 | type_func = self._registry_get('type', action.type, action.type) | |||
|
1264 | if not _callable(type_func): | |||
|
1265 | raise ValueError('%r is not callable' % type_func) | |||
|
1266 | ||||
1299 | return self._add_action(action) |
|
1267 | return self._add_action(action) | |
1300 |
|
1268 | |||
1301 | def add_argument_group(self, *args, **kwargs): |
|
1269 | def add_argument_group(self, *args, **kwargs): | |
1302 | group = _ArgumentGroup(self, *args, **kwargs) |
|
1270 | group = _ArgumentGroup(self, *args, **kwargs) | |
1303 | self._action_groups.append(group) |
|
1271 | self._action_groups.append(group) | |
1304 | return group |
|
1272 | return group | |
1305 |
|
1273 | |||
1306 | def add_mutually_exclusive_group(self, **kwargs): |
|
1274 | def add_mutually_exclusive_group(self, **kwargs): | |
1307 | group = _MutuallyExclusiveGroup(self, **kwargs) |
|
1275 | group = _MutuallyExclusiveGroup(self, **kwargs) | |
1308 | self._mutually_exclusive_groups.append(group) |
|
1276 | self._mutually_exclusive_groups.append(group) | |
1309 | return group |
|
1277 | return group | |
1310 |
|
1278 | |||
1311 | def _add_action(self, action): |
|
1279 | def _add_action(self, action): | |
1312 | # resolve any conflicts |
|
1280 | # resolve any conflicts | |
1313 | self._check_conflict(action) |
|
1281 | self._check_conflict(action) | |
1314 |
|
1282 | |||
1315 | # add to actions list |
|
1283 | # add to actions list | |
1316 | self._actions.append(action) |
|
1284 | self._actions.append(action) | |
1317 | action.container = self |
|
1285 | action.container = self | |
1318 |
|
1286 | |||
1319 | # index the action by any option strings it has |
|
1287 | # index the action by any option strings it has | |
1320 | for option_string in action.option_strings: |
|
1288 | for option_string in action.option_strings: | |
1321 | self._option_string_actions[option_string] = action |
|
1289 | self._option_string_actions[option_string] = action | |
1322 |
|
1290 | |||
1323 | # set the flag if any option strings look like negative numbers |
|
1291 | # set the flag if any option strings look like negative numbers | |
1324 | for option_string in action.option_strings: |
|
1292 | for option_string in action.option_strings: | |
1325 | if self._negative_number_matcher.match(option_string): |
|
1293 | if self._negative_number_matcher.match(option_string): | |
1326 | if not self._has_negative_number_optionals: |
|
1294 | if not self._has_negative_number_optionals: | |
1327 | self._has_negative_number_optionals.append(True) |
|
1295 | self._has_negative_number_optionals.append(True) | |
1328 |
|
1296 | |||
1329 | # return the created action |
|
1297 | # return the created action | |
1330 | return action |
|
1298 | return action | |
1331 |
|
1299 | |||
1332 | def _remove_action(self, action): |
|
1300 | def _remove_action(self, action): | |
1333 | self._actions.remove(action) |
|
1301 | self._actions.remove(action) | |
1334 |
|
1302 | |||
1335 | def _add_container_actions(self, container): |
|
1303 | def _add_container_actions(self, container): | |
1336 | # collect groups by titles |
|
1304 | # collect groups by titles | |
1337 | title_group_map = {} |
|
1305 | title_group_map = {} | |
1338 | for group in self._action_groups: |
|
1306 | for group in self._action_groups: | |
1339 | if group.title in title_group_map: |
|
1307 | if group.title in title_group_map: | |
1340 | msg = _('cannot merge actions - two groups are named %r') |
|
1308 | msg = _('cannot merge actions - two groups are named %r') | |
1341 | raise ValueError(msg % (group.title)) |
|
1309 | raise ValueError(msg % (group.title)) | |
1342 | title_group_map[group.title] = group |
|
1310 | title_group_map[group.title] = group | |
1343 |
|
1311 | |||
1344 | # map each action to its group |
|
1312 | # map each action to its group | |
1345 | group_map = {} |
|
1313 | group_map = {} | |
1346 | for group in container._action_groups: |
|
1314 | for group in container._action_groups: | |
1347 |
|
1315 | |||
1348 | # if a group with the title exists, use that, otherwise |
|
1316 | # if a group with the title exists, use that, otherwise | |
1349 | # create a new group matching the container's group |
|
1317 | # create a new group matching the container's group | |
1350 | if group.title not in title_group_map: |
|
1318 | if group.title not in title_group_map: | |
1351 | title_group_map[group.title] = self.add_argument_group( |
|
1319 | title_group_map[group.title] = self.add_argument_group( | |
1352 | title=group.title, |
|
1320 | title=group.title, | |
1353 | description=group.description, |
|
1321 | description=group.description, | |
1354 | conflict_handler=group.conflict_handler) |
|
1322 | conflict_handler=group.conflict_handler) | |
1355 |
|
1323 | |||
1356 | # map the actions to their new group |
|
1324 | # map the actions to their new group | |
1357 | for action in group._group_actions: |
|
1325 | for action in group._group_actions: | |
1358 | group_map[action] = title_group_map[group.title] |
|
1326 | group_map[action] = title_group_map[group.title] | |
1359 |
|
1327 | |||
1360 | # add container's mutually exclusive groups |
|
1328 | # add container's mutually exclusive groups | |
1361 | # NOTE: if add_mutually_exclusive_group ever gains title= and |
|
1329 | # NOTE: if add_mutually_exclusive_group ever gains title= and | |
1362 | # description= then this code will need to be expanded as above |
|
1330 | # description= then this code will need to be expanded as above | |
1363 | for group in container._mutually_exclusive_groups: |
|
1331 | for group in container._mutually_exclusive_groups: | |
1364 | mutex_group = self.add_mutually_exclusive_group( |
|
1332 | mutex_group = self.add_mutually_exclusive_group( | |
1365 | required=group.required) |
|
1333 | required=group.required) | |
1366 |
|
1334 | |||
1367 | # map the actions to their new mutex group |
|
1335 | # map the actions to their new mutex group | |
1368 | for action in group._group_actions: |
|
1336 | for action in group._group_actions: | |
1369 | group_map[action] = mutex_group |
|
1337 | group_map[action] = mutex_group | |
1370 |
|
1338 | |||
1371 | # add all actions to this container or their group |
|
1339 | # add all actions to this container or their group | |
1372 | for action in container._actions: |
|
1340 | for action in container._actions: | |
1373 | group_map.get(action, self)._add_action(action) |
|
1341 | group_map.get(action, self)._add_action(action) | |
1374 |
|
1342 | |||
1375 | def _get_positional_kwargs(self, dest, **kwargs): |
|
1343 | def _get_positional_kwargs(self, dest, **kwargs): | |
1376 | # make sure required is not specified |
|
1344 | # make sure required is not specified | |
1377 | if 'required' in kwargs: |
|
1345 | if 'required' in kwargs: | |
1378 | msg = _("'required' is an invalid argument for positionals") |
|
1346 | msg = _("'required' is an invalid argument for positionals") | |
1379 | raise TypeError(msg) |
|
1347 | raise TypeError(msg) | |
1380 |
|
1348 | |||
1381 | # mark positional arguments as required if at least one is |
|
1349 | # mark positional arguments as required if at least one is | |
1382 | # always required |
|
1350 | # always required | |
1383 | if kwargs.get('nargs') not in [OPTIONAL, ZERO_OR_MORE]: |
|
1351 | if kwargs.get('nargs') not in [OPTIONAL, ZERO_OR_MORE]: | |
1384 | kwargs['required'] = True |
|
1352 | kwargs['required'] = True | |
1385 | if kwargs.get('nargs') == ZERO_OR_MORE and 'default' not in kwargs: |
|
1353 | if kwargs.get('nargs') == ZERO_OR_MORE and 'default' not in kwargs: | |
1386 | kwargs['required'] = True |
|
1354 | kwargs['required'] = True | |
1387 |
|
1355 | |||
1388 | # return the keyword arguments with no option strings |
|
1356 | # return the keyword arguments with no option strings | |
1389 | return dict(kwargs, dest=dest, option_strings=[]) |
|
1357 | return dict(kwargs, dest=dest, option_strings=[]) | |
1390 |
|
1358 | |||
1391 | def _get_optional_kwargs(self, *args, **kwargs): |
|
1359 | def _get_optional_kwargs(self, *args, **kwargs): | |
1392 | # determine short and long option strings |
|
1360 | # determine short and long option strings | |
1393 | option_strings = [] |
|
1361 | option_strings = [] | |
1394 | long_option_strings = [] |
|
1362 | long_option_strings = [] | |
1395 | for option_string in args: |
|
1363 | for option_string in args: | |
1396 | # error on one-or-fewer-character option strings |
|
|||
1397 | if len(option_string) < 2: |
|
|||
1398 | msg = _('invalid option string %r: ' |
|
|||
1399 | 'must be at least two characters long') |
|
|||
1400 | raise ValueError(msg % option_string) |
|
|||
1401 |
|
||||
1402 | # error on strings that don't start with an appropriate prefix |
|
1364 | # error on strings that don't start with an appropriate prefix | |
1403 | if not option_string[0] in self.prefix_chars: |
|
1365 | if not option_string[0] in self.prefix_chars: | |
1404 | msg = _('invalid option string %r: ' |
|
1366 | msg = _('invalid option string %r: ' | |
1405 | 'must start with a character %r') |
|
1367 | 'must start with a character %r') | |
1406 | tup = option_string, self.prefix_chars |
|
1368 | tup = option_string, self.prefix_chars | |
1407 | raise ValueError(msg % tup) |
|
1369 | raise ValueError(msg % tup) | |
1408 |
|
1370 | |||
1409 | # error on strings that are all prefix characters |
|
|||
1410 | if not (_set(option_string) - _set(self.prefix_chars)): |
|
|||
1411 | msg = _('invalid option string %r: ' |
|
|||
1412 | 'must contain characters other than %r') |
|
|||
1413 | tup = option_string, self.prefix_chars |
|
|||
1414 | raise ValueError(msg % tup) |
|
|||
1415 |
|
||||
1416 | # strings starting with two prefix characters are long options |
|
1371 | # strings starting with two prefix characters are long options | |
1417 | option_strings.append(option_string) |
|
1372 | option_strings.append(option_string) | |
1418 | if option_string[0] in self.prefix_chars: |
|
1373 | if option_string[0] in self.prefix_chars: | |
1419 |
if option_string |
|
1374 | if len(option_string) > 1: | |
1420 | long_option_strings.append(option_string) |
|
1375 | if option_string[1] in self.prefix_chars: | |
|
1376 | long_option_strings.append(option_string) | |||
1421 |
|
1377 | |||
1422 | # infer destination, '--foo-bar' -> 'foo_bar' and '-x' -> 'x' |
|
1378 | # infer destination, '--foo-bar' -> 'foo_bar' and '-x' -> 'x' | |
1423 | dest = kwargs.pop('dest', None) |
|
1379 | dest = kwargs.pop('dest', None) | |
1424 | if dest is None: |
|
1380 | if dest is None: | |
1425 | if long_option_strings: |
|
1381 | if long_option_strings: | |
1426 | dest_option_string = long_option_strings[0] |
|
1382 | dest_option_string = long_option_strings[0] | |
1427 | else: |
|
1383 | else: | |
1428 | dest_option_string = option_strings[0] |
|
1384 | dest_option_string = option_strings[0] | |
1429 | dest = dest_option_string.lstrip(self.prefix_chars) |
|
1385 | dest = dest_option_string.lstrip(self.prefix_chars) | |
|
1386 | if not dest: | |||
|
1387 | msg = _('dest= is required for options like %r') | |||
|
1388 | raise ValueError(msg % option_string) | |||
1430 | dest = dest.replace('-', '_') |
|
1389 | dest = dest.replace('-', '_') | |
1431 |
|
1390 | |||
1432 | # return the updated keyword arguments |
|
1391 | # return the updated keyword arguments | |
1433 | return dict(kwargs, dest=dest, option_strings=option_strings) |
|
1392 | return dict(kwargs, dest=dest, option_strings=option_strings) | |
1434 |
|
1393 | |||
1435 | def _pop_action_class(self, kwargs, default=None): |
|
1394 | def _pop_action_class(self, kwargs, default=None): | |
1436 | action = kwargs.pop('action', default) |
|
1395 | action = kwargs.pop('action', default) | |
1437 | return self._registry_get('action', action, action) |
|
1396 | return self._registry_get('action', action, action) | |
1438 |
|
1397 | |||
1439 | def _get_handler(self): |
|
1398 | def _get_handler(self): | |
1440 | # determine function from conflict handler string |
|
1399 | # determine function from conflict handler string | |
1441 | handler_func_name = '_handle_conflict_%s' % self.conflict_handler |
|
1400 | handler_func_name = '_handle_conflict_%s' % self.conflict_handler | |
1442 | try: |
|
1401 | try: | |
1443 | return getattr(self, handler_func_name) |
|
1402 | return getattr(self, handler_func_name) | |
1444 | except AttributeError: |
|
1403 | except AttributeError: | |
1445 | msg = _('invalid conflict_resolution value: %r') |
|
1404 | msg = _('invalid conflict_resolution value: %r') | |
1446 | raise ValueError(msg % self.conflict_handler) |
|
1405 | raise ValueError(msg % self.conflict_handler) | |
1447 |
|
1406 | |||
1448 | def _check_conflict(self, action): |
|
1407 | def _check_conflict(self, action): | |
1449 |
|
1408 | |||
1450 | # find all options that conflict with this option |
|
1409 | # find all options that conflict with this option | |
1451 | confl_optionals = [] |
|
1410 | confl_optionals = [] | |
1452 | for option_string in action.option_strings: |
|
1411 | for option_string in action.option_strings: | |
1453 | if option_string in self._option_string_actions: |
|
1412 | if option_string in self._option_string_actions: | |
1454 | confl_optional = self._option_string_actions[option_string] |
|
1413 | confl_optional = self._option_string_actions[option_string] | |
1455 | confl_optionals.append((option_string, confl_optional)) |
|
1414 | confl_optionals.append((option_string, confl_optional)) | |
1456 |
|
1415 | |||
1457 | # resolve any conflicts |
|
1416 | # resolve any conflicts | |
1458 | if confl_optionals: |
|
1417 | if confl_optionals: | |
1459 | conflict_handler = self._get_handler() |
|
1418 | conflict_handler = self._get_handler() | |
1460 | conflict_handler(action, confl_optionals) |
|
1419 | conflict_handler(action, confl_optionals) | |
1461 |
|
1420 | |||
1462 | def _handle_conflict_error(self, action, conflicting_actions): |
|
1421 | def _handle_conflict_error(self, action, conflicting_actions): | |
1463 | message = _('conflicting option string(s): %s') |
|
1422 | message = _('conflicting option string(s): %s') | |
1464 | conflict_string = ', '.join([option_string |
|
1423 | conflict_string = ', '.join([option_string | |
1465 | for option_string, action |
|
1424 | for option_string, action | |
1466 | in conflicting_actions]) |
|
1425 | in conflicting_actions]) | |
1467 | raise ArgumentError(action, message % conflict_string) |
|
1426 | raise ArgumentError(action, message % conflict_string) | |
1468 |
|
1427 | |||
1469 | def _handle_conflict_resolve(self, action, conflicting_actions): |
|
1428 | def _handle_conflict_resolve(self, action, conflicting_actions): | |
1470 |
|
1429 | |||
1471 | # remove all conflicting options |
|
1430 | # remove all conflicting options | |
1472 | for option_string, action in conflicting_actions: |
|
1431 | for option_string, action in conflicting_actions: | |
1473 |
|
1432 | |||
1474 | # remove the conflicting option |
|
1433 | # remove the conflicting option | |
1475 | action.option_strings.remove(option_string) |
|
1434 | action.option_strings.remove(option_string) | |
1476 | self._option_string_actions.pop(option_string, None) |
|
1435 | self._option_string_actions.pop(option_string, None) | |
1477 |
|
1436 | |||
1478 | # if the option now has no option string, remove it from the |
|
1437 | # if the option now has no option string, remove it from the | |
1479 | # container holding it |
|
1438 | # container holding it | |
1480 | if not action.option_strings: |
|
1439 | if not action.option_strings: | |
1481 | action.container._remove_action(action) |
|
1440 | action.container._remove_action(action) | |
1482 |
|
1441 | |||
1483 |
|
1442 | |||
1484 | class _ArgumentGroup(_ActionsContainer): |
|
1443 | class _ArgumentGroup(_ActionsContainer): | |
1485 |
|
1444 | |||
1486 | def __init__(self, container, title=None, description=None, **kwargs): |
|
1445 | def __init__(self, container, title=None, description=None, **kwargs): | |
1487 | # add any missing keyword arguments by checking the container |
|
1446 | # add any missing keyword arguments by checking the container | |
1488 | update = kwargs.setdefault |
|
1447 | update = kwargs.setdefault | |
1489 | update('conflict_handler', container.conflict_handler) |
|
1448 | update('conflict_handler', container.conflict_handler) | |
1490 | update('prefix_chars', container.prefix_chars) |
|
1449 | update('prefix_chars', container.prefix_chars) | |
1491 | update('argument_default', container.argument_default) |
|
1450 | update('argument_default', container.argument_default) | |
1492 | super_init = super(_ArgumentGroup, self).__init__ |
|
1451 | super_init = super(_ArgumentGroup, self).__init__ | |
1493 | super_init(description=description, **kwargs) |
|
1452 | super_init(description=description, **kwargs) | |
1494 |
|
1453 | |||
1495 | # group attributes |
|
1454 | # group attributes | |
1496 | self.title = title |
|
1455 | self.title = title | |
1497 | self._group_actions = [] |
|
1456 | self._group_actions = [] | |
1498 |
|
1457 | |||
1499 | # share most attributes with the container |
|
1458 | # share most attributes with the container | |
1500 | self._registries = container._registries |
|
1459 | self._registries = container._registries | |
1501 | self._actions = container._actions |
|
1460 | self._actions = container._actions | |
1502 | self._option_string_actions = container._option_string_actions |
|
1461 | self._option_string_actions = container._option_string_actions | |
1503 | self._defaults = container._defaults |
|
1462 | self._defaults = container._defaults | |
1504 | self._has_negative_number_optionals = \ |
|
1463 | self._has_negative_number_optionals = \ | |
1505 | container._has_negative_number_optionals |
|
1464 | container._has_negative_number_optionals | |
1506 |
|
1465 | |||
1507 | def _add_action(self, action): |
|
1466 | def _add_action(self, action): | |
1508 | action = super(_ArgumentGroup, self)._add_action(action) |
|
1467 | action = super(_ArgumentGroup, self)._add_action(action) | |
1509 | self._group_actions.append(action) |
|
1468 | self._group_actions.append(action) | |
1510 | return action |
|
1469 | return action | |
1511 |
|
1470 | |||
1512 | def _remove_action(self, action): |
|
1471 | def _remove_action(self, action): | |
1513 | super(_ArgumentGroup, self)._remove_action(action) |
|
1472 | super(_ArgumentGroup, self)._remove_action(action) | |
1514 | self._group_actions.remove(action) |
|
1473 | self._group_actions.remove(action) | |
1515 |
|
1474 | |||
1516 |
|
1475 | |||
1517 | class _MutuallyExclusiveGroup(_ArgumentGroup): |
|
1476 | class _MutuallyExclusiveGroup(_ArgumentGroup): | |
1518 |
|
1477 | |||
1519 | def __init__(self, container, required=False): |
|
1478 | def __init__(self, container, required=False): | |
1520 | super(_MutuallyExclusiveGroup, self).__init__(container) |
|
1479 | super(_MutuallyExclusiveGroup, self).__init__(container) | |
1521 | self.required = required |
|
1480 | self.required = required | |
1522 | self._container = container |
|
1481 | self._container = container | |
1523 |
|
1482 | |||
1524 | def _add_action(self, action): |
|
1483 | def _add_action(self, action): | |
1525 | if action.required: |
|
1484 | if action.required: | |
1526 | msg = _('mutually exclusive arguments must be optional') |
|
1485 | msg = _('mutually exclusive arguments must be optional') | |
1527 | raise ValueError(msg) |
|
1486 | raise ValueError(msg) | |
1528 | action = self._container._add_action(action) |
|
1487 | action = self._container._add_action(action) | |
1529 | self._group_actions.append(action) |
|
1488 | self._group_actions.append(action) | |
1530 | return action |
|
1489 | return action | |
1531 |
|
1490 | |||
1532 | def _remove_action(self, action): |
|
1491 | def _remove_action(self, action): | |
1533 | self._container._remove_action(action) |
|
1492 | self._container._remove_action(action) | |
1534 | self._group_actions.remove(action) |
|
1493 | self._group_actions.remove(action) | |
1535 |
|
1494 | |||
1536 |
|
1495 | |||
1537 | class ArgumentParser(_AttributeHolder, _ActionsContainer): |
|
1496 | class ArgumentParser(_AttributeHolder, _ActionsContainer): | |
1538 | """Object for parsing command line strings into Python objects. |
|
1497 | """Object for parsing command line strings into Python objects. | |
1539 |
|
1498 | |||
1540 | Keyword Arguments: |
|
1499 | Keyword Arguments: | |
1541 | - prog -- The name of the program (default: sys.argv[0]) |
|
1500 | - prog -- The name of the program (default: sys.argv[0]) | |
1542 | - usage -- A usage message (default: auto-generated from arguments) |
|
1501 | - usage -- A usage message (default: auto-generated from arguments) | |
1543 | - description -- A description of what the program does |
|
1502 | - description -- A description of what the program does | |
1544 | - epilog -- Text following the argument descriptions |
|
1503 | - epilog -- Text following the argument descriptions | |
1545 | - version -- Add a -v/--version option with the given version string |
|
|||
1546 | - parents -- Parsers whose arguments should be copied into this one |
|
1504 | - parents -- Parsers whose arguments should be copied into this one | |
1547 | - formatter_class -- HelpFormatter class for printing help messages |
|
1505 | - formatter_class -- HelpFormatter class for printing help messages | |
1548 | - prefix_chars -- Characters that prefix optional arguments |
|
1506 | - prefix_chars -- Characters that prefix optional arguments | |
1549 | - fromfile_prefix_chars -- Characters that prefix files containing |
|
1507 | - fromfile_prefix_chars -- Characters that prefix files containing | |
1550 | additional arguments |
|
1508 | additional arguments | |
1551 | - argument_default -- The default value for all arguments |
|
1509 | - argument_default -- The default value for all arguments | |
1552 | - conflict_handler -- String indicating how to handle conflicts |
|
1510 | - conflict_handler -- String indicating how to handle conflicts | |
1553 | - add_help -- Add a -h/-help option |
|
1511 | - add_help -- Add a -h/-help option | |
1554 | """ |
|
1512 | """ | |
1555 |
|
1513 | |||
1556 | def __init__(self, |
|
1514 | def __init__(self, | |
1557 | prog=None, |
|
1515 | prog=None, | |
1558 | usage=None, |
|
1516 | usage=None, | |
1559 | description=None, |
|
1517 | description=None, | |
1560 | epilog=None, |
|
1518 | epilog=None, | |
1561 | version=None, |
|
1519 | version=None, | |
1562 | parents=[], |
|
1520 | parents=[], | |
1563 | formatter_class=HelpFormatter, |
|
1521 | formatter_class=HelpFormatter, | |
1564 | prefix_chars='-', |
|
1522 | prefix_chars='-', | |
1565 | fromfile_prefix_chars=None, |
|
1523 | fromfile_prefix_chars=None, | |
1566 | argument_default=None, |
|
1524 | argument_default=None, | |
1567 | conflict_handler='error', |
|
1525 | conflict_handler='error', | |
1568 | add_help=True): |
|
1526 | add_help=True): | |
1569 |
|
1527 | |||
|
1528 | if version is not None: | |||
|
1529 | import warnings | |||
|
1530 | warnings.warn( | |||
|
1531 | """The "version" argument to ArgumentParser is deprecated. """ | |||
|
1532 | """Please use """ | |||
|
1533 | """"add_argument(..., action='version', version="N", ...)" """ | |||
|
1534 | """instead""", DeprecationWarning) | |||
|
1535 | ||||
1570 | superinit = super(ArgumentParser, self).__init__ |
|
1536 | superinit = super(ArgumentParser, self).__init__ | |
1571 | superinit(description=description, |
|
1537 | superinit(description=description, | |
1572 | prefix_chars=prefix_chars, |
|
1538 | prefix_chars=prefix_chars, | |
1573 | argument_default=argument_default, |
|
1539 | argument_default=argument_default, | |
1574 | conflict_handler=conflict_handler) |
|
1540 | conflict_handler=conflict_handler) | |
1575 |
|
1541 | |||
1576 | # default setting for prog |
|
1542 | # default setting for prog | |
1577 | if prog is None: |
|
1543 | if prog is None: | |
1578 | prog = _os.path.basename(_sys.argv[0]) |
|
1544 | prog = _os.path.basename(_sys.argv[0]) | |
1579 |
|
1545 | |||
1580 | self.prog = prog |
|
1546 | self.prog = prog | |
1581 | self.usage = usage |
|
1547 | self.usage = usage | |
1582 | self.epilog = epilog |
|
1548 | self.epilog = epilog | |
1583 | self.version = version |
|
1549 | self.version = version | |
1584 | self.formatter_class = formatter_class |
|
1550 | self.formatter_class = formatter_class | |
1585 | self.fromfile_prefix_chars = fromfile_prefix_chars |
|
1551 | self.fromfile_prefix_chars = fromfile_prefix_chars | |
1586 | self.add_help = add_help |
|
1552 | self.add_help = add_help | |
1587 |
|
1553 | |||
1588 | add_group = self.add_argument_group |
|
1554 | add_group = self.add_argument_group | |
1589 | self._positionals = add_group(_('positional arguments')) |
|
1555 | self._positionals = add_group(_('positional arguments')) | |
1590 | self._optionals = add_group(_('optional arguments')) |
|
1556 | self._optionals = add_group(_('optional arguments')) | |
1591 | self._subparsers = None |
|
1557 | self._subparsers = None | |
1592 |
|
1558 | |||
1593 | # register types |
|
1559 | # register types | |
1594 | def identity(string): |
|
1560 | def identity(string): | |
1595 | return string |
|
1561 | return string | |
1596 | self.register('type', None, identity) |
|
1562 | self.register('type', None, identity) | |
1597 |
|
1563 | |||
1598 | # add help and version arguments if necessary |
|
1564 | # add help and version arguments if necessary | |
1599 | # (using explicit default to override global argument_default) |
|
1565 | # (using explicit default to override global argument_default) | |
1600 | if self.add_help: |
|
1566 | if self.add_help: | |
1601 | self.add_argument( |
|
1567 | self.add_argument( | |
1602 | '-h', '--help', action='help', default=SUPPRESS, |
|
1568 | '-h', '--help', action='help', default=SUPPRESS, | |
1603 | help=_('show this help message and exit')) |
|
1569 | help=_('show this help message and exit')) | |
1604 | if self.version: |
|
1570 | if self.version: | |
1605 | self.add_argument( |
|
1571 | self.add_argument( | |
1606 | '-v', '--version', action='version', default=SUPPRESS, |
|
1572 | '-v', '--version', action='version', default=SUPPRESS, | |
1607 | version=self.version, |
|
1573 | version=self.version, | |
1608 | help=_("show program's version number and exit")) |
|
1574 | help=_("show program's version number and exit")) | |
1609 |
|
1575 | |||
1610 | # add parent arguments and defaults |
|
1576 | # add parent arguments and defaults | |
1611 | for parent in parents: |
|
1577 | for parent in parents: | |
1612 | self._add_container_actions(parent) |
|
1578 | self._add_container_actions(parent) | |
1613 | try: |
|
1579 | try: | |
1614 | defaults = parent._defaults |
|
1580 | defaults = parent._defaults | |
1615 | except AttributeError: |
|
1581 | except AttributeError: | |
1616 | pass |
|
1582 | pass | |
1617 | else: |
|
1583 | else: | |
1618 | self._defaults.update(defaults) |
|
1584 | self._defaults.update(defaults) | |
1619 |
|
1585 | |||
1620 | # ======================= |
|
1586 | # ======================= | |
1621 | # Pretty __repr__ methods |
|
1587 | # Pretty __repr__ methods | |
1622 | # ======================= |
|
1588 | # ======================= | |
1623 | def _get_kwargs(self): |
|
1589 | def _get_kwargs(self): | |
1624 | names = [ |
|
1590 | names = [ | |
1625 | 'prog', |
|
1591 | 'prog', | |
1626 | 'usage', |
|
1592 | 'usage', | |
1627 | 'description', |
|
1593 | 'description', | |
1628 | 'version', |
|
1594 | 'version', | |
1629 | 'formatter_class', |
|
1595 | 'formatter_class', | |
1630 | 'conflict_handler', |
|
1596 | 'conflict_handler', | |
1631 | 'add_help', |
|
1597 | 'add_help', | |
1632 | ] |
|
1598 | ] | |
1633 | return [(name, getattr(self, name)) for name in names] |
|
1599 | return [(name, getattr(self, name)) for name in names] | |
1634 |
|
1600 | |||
1635 | # ================================== |
|
1601 | # ================================== | |
1636 | # Optional/Positional adding methods |
|
1602 | # Optional/Positional adding methods | |
1637 | # ================================== |
|
1603 | # ================================== | |
1638 | def add_subparsers(self, **kwargs): |
|
1604 | def add_subparsers(self, **kwargs): | |
1639 | if self._subparsers is not None: |
|
1605 | if self._subparsers is not None: | |
1640 | self.error(_('cannot have multiple subparser arguments')) |
|
1606 | self.error(_('cannot have multiple subparser arguments')) | |
1641 |
|
1607 | |||
1642 | # add the parser class to the arguments if it's not present |
|
1608 | # add the parser class to the arguments if it's not present | |
1643 | kwargs.setdefault('parser_class', type(self)) |
|
1609 | kwargs.setdefault('parser_class', type(self)) | |
1644 |
|
1610 | |||
1645 | if 'title' in kwargs or 'description' in kwargs: |
|
1611 | if 'title' in kwargs or 'description' in kwargs: | |
1646 | title = _(kwargs.pop('title', 'subcommands')) |
|
1612 | title = _(kwargs.pop('title', 'subcommands')) | |
1647 | description = _(kwargs.pop('description', None)) |
|
1613 | description = _(kwargs.pop('description', None)) | |
1648 | self._subparsers = self.add_argument_group(title, description) |
|
1614 | self._subparsers = self.add_argument_group(title, description) | |
1649 | else: |
|
1615 | else: | |
1650 | self._subparsers = self._positionals |
|
1616 | self._subparsers = self._positionals | |
1651 |
|
1617 | |||
1652 | # prog defaults to the usage message of this parser, skipping |
|
1618 | # prog defaults to the usage message of this parser, skipping | |
1653 | # optional arguments and with no "usage:" prefix |
|
1619 | # optional arguments and with no "usage:" prefix | |
1654 | if kwargs.get('prog') is None: |
|
1620 | if kwargs.get('prog') is None: | |
1655 | formatter = self._get_formatter() |
|
1621 | formatter = self._get_formatter() | |
1656 | positionals = self._get_positional_actions() |
|
1622 | positionals = self._get_positional_actions() | |
1657 | groups = self._mutually_exclusive_groups |
|
1623 | groups = self._mutually_exclusive_groups | |
1658 | formatter.add_usage(self.usage, positionals, groups, '') |
|
1624 | formatter.add_usage(self.usage, positionals, groups, '') | |
1659 | kwargs['prog'] = formatter.format_help().strip() |
|
1625 | kwargs['prog'] = formatter.format_help().strip() | |
1660 |
|
1626 | |||
1661 | # create the parsers action and add it to the positionals list |
|
1627 | # create the parsers action and add it to the positionals list | |
1662 | parsers_class = self._pop_action_class(kwargs, 'parsers') |
|
1628 | parsers_class = self._pop_action_class(kwargs, 'parsers') | |
1663 | action = parsers_class(option_strings=[], **kwargs) |
|
1629 | action = parsers_class(option_strings=[], **kwargs) | |
1664 | self._subparsers._add_action(action) |
|
1630 | self._subparsers._add_action(action) | |
1665 |
|
1631 | |||
1666 | # return the created parsers action |
|
1632 | # return the created parsers action | |
1667 | return action |
|
1633 | return action | |
1668 |
|
1634 | |||
1669 | def _add_action(self, action): |
|
1635 | def _add_action(self, action): | |
1670 | if action.option_strings: |
|
1636 | if action.option_strings: | |
1671 | self._optionals._add_action(action) |
|
1637 | self._optionals._add_action(action) | |
1672 | else: |
|
1638 | else: | |
1673 | self._positionals._add_action(action) |
|
1639 | self._positionals._add_action(action) | |
1674 | return action |
|
1640 | return action | |
1675 |
|
1641 | |||
1676 | def _get_optional_actions(self): |
|
1642 | def _get_optional_actions(self): | |
1677 | return [action |
|
1643 | return [action | |
1678 | for action in self._actions |
|
1644 | for action in self._actions | |
1679 | if action.option_strings] |
|
1645 | if action.option_strings] | |
1680 |
|
1646 | |||
1681 | def _get_positional_actions(self): |
|
1647 | def _get_positional_actions(self): | |
1682 | return [action |
|
1648 | return [action | |
1683 | for action in self._actions |
|
1649 | for action in self._actions | |
1684 | if not action.option_strings] |
|
1650 | if not action.option_strings] | |
1685 |
|
1651 | |||
1686 | # ===================================== |
|
1652 | # ===================================== | |
1687 | # Command line argument parsing methods |
|
1653 | # Command line argument parsing methods | |
1688 | # ===================================== |
|
1654 | # ===================================== | |
1689 | def parse_args(self, args=None, namespace=None): |
|
1655 | def parse_args(self, args=None, namespace=None): | |
1690 | args, argv = self.parse_known_args(args, namespace) |
|
1656 | args, argv = self.parse_known_args(args, namespace) | |
1691 | if argv: |
|
1657 | if argv: | |
1692 | msg = _('unrecognized arguments: %s') |
|
1658 | msg = _('unrecognized arguments: %s') | |
1693 | self.error(msg % ' '.join(argv)) |
|
1659 | self.error(msg % ' '.join(argv)) | |
1694 | return args |
|
1660 | return args | |
1695 |
|
1661 | |||
1696 | def parse_known_args(self, args=None, namespace=None): |
|
1662 | def parse_known_args(self, args=None, namespace=None): | |
1697 | # args default to the system args |
|
1663 | # args default to the system args | |
1698 | if args is None: |
|
1664 | if args is None: | |
1699 | args = _sys.argv[1:] |
|
1665 | args = _sys.argv[1:] | |
1700 |
|
1666 | |||
1701 | # default Namespace built from parser defaults |
|
1667 | # default Namespace built from parser defaults | |
1702 | if namespace is None: |
|
1668 | if namespace is None: | |
1703 | namespace = Namespace() |
|
1669 | namespace = Namespace() | |
1704 |
|
1670 | |||
1705 | # add any action defaults that aren't present |
|
1671 | # add any action defaults that aren't present | |
1706 | for action in self._actions: |
|
1672 | for action in self._actions: | |
1707 | if action.dest is not SUPPRESS: |
|
1673 | if action.dest is not SUPPRESS: | |
1708 | if not hasattr(namespace, action.dest): |
|
1674 | if not hasattr(namespace, action.dest): | |
1709 | if action.default is not SUPPRESS: |
|
1675 | if action.default is not SUPPRESS: | |
1710 | default = action.default |
|
1676 | default = action.default | |
1711 |
if isinstance(action.default, |
|
1677 | if isinstance(action.default, basestring): | |
1712 | default = self._get_value(action, default) |
|
1678 | default = self._get_value(action, default) | |
1713 | setattr(namespace, action.dest, default) |
|
1679 | setattr(namespace, action.dest, default) | |
1714 |
|
1680 | |||
1715 | # add any parser defaults that aren't present |
|
1681 | # add any parser defaults that aren't present | |
1716 | for dest in self._defaults: |
|
1682 | for dest in self._defaults: | |
1717 | if not hasattr(namespace, dest): |
|
1683 | if not hasattr(namespace, dest): | |
1718 | setattr(namespace, dest, self._defaults[dest]) |
|
1684 | setattr(namespace, dest, self._defaults[dest]) | |
1719 |
|
1685 | |||
1720 | # parse the arguments and exit if there are any errors |
|
1686 | # parse the arguments and exit if there are any errors | |
1721 | try: |
|
1687 | try: | |
1722 | return self._parse_known_args(args, namespace) |
|
1688 | return self._parse_known_args(args, namespace) | |
1723 | except ArgumentError: |
|
1689 | except ArgumentError: | |
1724 | err = _sys.exc_info()[1] |
|
1690 | err = _sys.exc_info()[1] | |
1725 | self.error(str(err)) |
|
1691 | self.error(str(err)) | |
1726 |
|
1692 | |||
1727 | def _parse_known_args(self, arg_strings, namespace): |
|
1693 | def _parse_known_args(self, arg_strings, namespace): | |
1728 | # replace arg strings that are file references |
|
1694 | # replace arg strings that are file references | |
1729 | if self.fromfile_prefix_chars is not None: |
|
1695 | if self.fromfile_prefix_chars is not None: | |
1730 | arg_strings = self._read_args_from_files(arg_strings) |
|
1696 | arg_strings = self._read_args_from_files(arg_strings) | |
1731 |
|
1697 | |||
1732 | # map all mutually exclusive arguments to the other arguments |
|
1698 | # map all mutually exclusive arguments to the other arguments | |
1733 | # they can't occur with |
|
1699 | # they can't occur with | |
1734 | action_conflicts = {} |
|
1700 | action_conflicts = {} | |
1735 | for mutex_group in self._mutually_exclusive_groups: |
|
1701 | for mutex_group in self._mutually_exclusive_groups: | |
1736 | group_actions = mutex_group._group_actions |
|
1702 | group_actions = mutex_group._group_actions | |
1737 | for i, mutex_action in enumerate(mutex_group._group_actions): |
|
1703 | for i, mutex_action in enumerate(mutex_group._group_actions): | |
1738 | conflicts = action_conflicts.setdefault(mutex_action, []) |
|
1704 | conflicts = action_conflicts.setdefault(mutex_action, []) | |
1739 | conflicts.extend(group_actions[:i]) |
|
1705 | conflicts.extend(group_actions[:i]) | |
1740 | conflicts.extend(group_actions[i + 1:]) |
|
1706 | conflicts.extend(group_actions[i + 1:]) | |
1741 |
|
1707 | |||
1742 | # find all option indices, and determine the arg_string_pattern |
|
1708 | # find all option indices, and determine the arg_string_pattern | |
1743 | # which has an 'O' if there is an option at an index, |
|
1709 | # which has an 'O' if there is an option at an index, | |
1744 | # an 'A' if there is an argument, or a '-' if there is a '--' |
|
1710 | # an 'A' if there is an argument, or a '-' if there is a '--' | |
1745 | option_string_indices = {} |
|
1711 | option_string_indices = {} | |
1746 | arg_string_pattern_parts = [] |
|
1712 | arg_string_pattern_parts = [] | |
1747 | arg_strings_iter = iter(arg_strings) |
|
1713 | arg_strings_iter = iter(arg_strings) | |
1748 | for i, arg_string in enumerate(arg_strings_iter): |
|
1714 | for i, arg_string in enumerate(arg_strings_iter): | |
1749 |
|
1715 | |||
1750 | # all args after -- are non-options |
|
1716 | # all args after -- are non-options | |
1751 | if arg_string == '--': |
|
1717 | if arg_string == '--': | |
1752 | arg_string_pattern_parts.append('-') |
|
1718 | arg_string_pattern_parts.append('-') | |
1753 | for arg_string in arg_strings_iter: |
|
1719 | for arg_string in arg_strings_iter: | |
1754 | arg_string_pattern_parts.append('A') |
|
1720 | arg_string_pattern_parts.append('A') | |
1755 |
|
1721 | |||
1756 | # otherwise, add the arg to the arg strings |
|
1722 | # otherwise, add the arg to the arg strings | |
1757 | # and note the index if it was an option |
|
1723 | # and note the index if it was an option | |
1758 | else: |
|
1724 | else: | |
1759 | option_tuple = self._parse_optional(arg_string) |
|
1725 | option_tuple = self._parse_optional(arg_string) | |
1760 | if option_tuple is None: |
|
1726 | if option_tuple is None: | |
1761 | pattern = 'A' |
|
1727 | pattern = 'A' | |
1762 | else: |
|
1728 | else: | |
1763 | option_string_indices[i] = option_tuple |
|
1729 | option_string_indices[i] = option_tuple | |
1764 | pattern = 'O' |
|
1730 | pattern = 'O' | |
1765 | arg_string_pattern_parts.append(pattern) |
|
1731 | arg_string_pattern_parts.append(pattern) | |
1766 |
|
1732 | |||
1767 | # join the pieces together to form the pattern |
|
1733 | # join the pieces together to form the pattern | |
1768 | arg_strings_pattern = ''.join(arg_string_pattern_parts) |
|
1734 | arg_strings_pattern = ''.join(arg_string_pattern_parts) | |
1769 |
|
1735 | |||
1770 | # converts arg strings to the appropriate and then takes the action |
|
1736 | # converts arg strings to the appropriate and then takes the action | |
1771 |
seen_actions = |
|
1737 | seen_actions = set() | |
1772 |
seen_non_default_actions = |
|
1738 | seen_non_default_actions = set() | |
1773 |
|
1739 | |||
1774 | def take_action(action, argument_strings, option_string=None): |
|
1740 | def take_action(action, argument_strings, option_string=None): | |
1775 | seen_actions.add(action) |
|
1741 | seen_actions.add(action) | |
1776 | argument_values = self._get_values(action, argument_strings) |
|
1742 | argument_values = self._get_values(action, argument_strings) | |
1777 |
|
1743 | |||
1778 | # error if this argument is not allowed with other previously |
|
1744 | # error if this argument is not allowed with other previously | |
1779 | # seen arguments, assuming that actions that use the default |
|
1745 | # seen arguments, assuming that actions that use the default | |
1780 | # value don't really count as "present" |
|
1746 | # value don't really count as "present" | |
1781 | if argument_values is not action.default: |
|
1747 | if argument_values is not action.default: | |
1782 | seen_non_default_actions.add(action) |
|
1748 | seen_non_default_actions.add(action) | |
1783 | for conflict_action in action_conflicts.get(action, []): |
|
1749 | for conflict_action in action_conflicts.get(action, []): | |
1784 | if conflict_action in seen_non_default_actions: |
|
1750 | if conflict_action in seen_non_default_actions: | |
1785 | msg = _('not allowed with argument %s') |
|
1751 | msg = _('not allowed with argument %s') | |
1786 | action_name = _get_action_name(conflict_action) |
|
1752 | action_name = _get_action_name(conflict_action) | |
1787 | raise ArgumentError(action, msg % action_name) |
|
1753 | raise ArgumentError(action, msg % action_name) | |
1788 |
|
1754 | |||
1789 | # take the action if we didn't receive a SUPPRESS value |
|
1755 | # take the action if we didn't receive a SUPPRESS value | |
1790 | # (e.g. from a default) |
|
1756 | # (e.g. from a default) | |
1791 | if argument_values is not SUPPRESS: |
|
1757 | if argument_values is not SUPPRESS: | |
1792 | action(self, namespace, argument_values, option_string) |
|
1758 | action(self, namespace, argument_values, option_string) | |
1793 |
|
1759 | |||
1794 | # function to convert arg_strings into an optional action |
|
1760 | # function to convert arg_strings into an optional action | |
1795 | def consume_optional(start_index): |
|
1761 | def consume_optional(start_index): | |
1796 |
|
1762 | |||
1797 | # get the optional identified at this index |
|
1763 | # get the optional identified at this index | |
1798 | option_tuple = option_string_indices[start_index] |
|
1764 | option_tuple = option_string_indices[start_index] | |
1799 | action, option_string, explicit_arg = option_tuple |
|
1765 | action, option_string, explicit_arg = option_tuple | |
1800 |
|
1766 | |||
1801 | # identify additional optionals in the same arg string |
|
1767 | # identify additional optionals in the same arg string | |
1802 | # (e.g. -xyz is the same as -x -y -z if no args are required) |
|
1768 | # (e.g. -xyz is the same as -x -y -z if no args are required) | |
1803 | match_argument = self._match_argument |
|
1769 | match_argument = self._match_argument | |
1804 | action_tuples = [] |
|
1770 | action_tuples = [] | |
1805 | while True: |
|
1771 | while True: | |
1806 |
|
1772 | |||
1807 | # if we found no optional action, skip it |
|
1773 | # if we found no optional action, skip it | |
1808 | if action is None: |
|
1774 | if action is None: | |
1809 | extras.append(arg_strings[start_index]) |
|
1775 | extras.append(arg_strings[start_index]) | |
1810 | return start_index + 1 |
|
1776 | return start_index + 1 | |
1811 |
|
1777 | |||
1812 | # if there is an explicit argument, try to match the |
|
1778 | # if there is an explicit argument, try to match the | |
1813 | # optional's string arguments to only this |
|
1779 | # optional's string arguments to only this | |
1814 | if explicit_arg is not None: |
|
1780 | if explicit_arg is not None: | |
1815 | arg_count = match_argument(action, 'A') |
|
1781 | arg_count = match_argument(action, 'A') | |
1816 |
|
1782 | |||
1817 | # if the action is a single-dash option and takes no |
|
1783 | # if the action is a single-dash option and takes no | |
1818 | # arguments, try to parse more single-dash options out |
|
1784 | # arguments, try to parse more single-dash options out | |
1819 | # of the tail of the option string |
|
1785 | # of the tail of the option string | |
1820 | chars = self.prefix_chars |
|
1786 | chars = self.prefix_chars | |
1821 | if arg_count == 0 and option_string[1] not in chars: |
|
1787 | if arg_count == 0 and option_string[1] not in chars: | |
1822 | action_tuples.append((action, [], option_string)) |
|
1788 | action_tuples.append((action, [], option_string)) | |
1823 | for char in self.prefix_chars: |
|
1789 | for char in self.prefix_chars: | |
1824 | option_string = char + explicit_arg[0] |
|
1790 | option_string = char + explicit_arg[0] | |
1825 | explicit_arg = explicit_arg[1:] or None |
|
1791 | explicit_arg = explicit_arg[1:] or None | |
1826 | optionals_map = self._option_string_actions |
|
1792 | optionals_map = self._option_string_actions | |
1827 | if option_string in optionals_map: |
|
1793 | if option_string in optionals_map: | |
1828 | action = optionals_map[option_string] |
|
1794 | action = optionals_map[option_string] | |
1829 | break |
|
1795 | break | |
1830 | else: |
|
1796 | else: | |
1831 | msg = _('ignored explicit argument %r') |
|
1797 | msg = _('ignored explicit argument %r') | |
1832 | raise ArgumentError(action, msg % explicit_arg) |
|
1798 | raise ArgumentError(action, msg % explicit_arg) | |
1833 |
|
1799 | |||
1834 | # if the action expect exactly one argument, we've |
|
1800 | # if the action expect exactly one argument, we've | |
1835 | # successfully matched the option; exit the loop |
|
1801 | # successfully matched the option; exit the loop | |
1836 | elif arg_count == 1: |
|
1802 | elif arg_count == 1: | |
1837 | stop = start_index + 1 |
|
1803 | stop = start_index + 1 | |
1838 | args = [explicit_arg] |
|
1804 | args = [explicit_arg] | |
1839 | action_tuples.append((action, args, option_string)) |
|
1805 | action_tuples.append((action, args, option_string)) | |
1840 | break |
|
1806 | break | |
1841 |
|
1807 | |||
1842 | # error if a double-dash option did not use the |
|
1808 | # error if a double-dash option did not use the | |
1843 | # explicit argument |
|
1809 | # explicit argument | |
1844 | else: |
|
1810 | else: | |
1845 | msg = _('ignored explicit argument %r') |
|
1811 | msg = _('ignored explicit argument %r') | |
1846 | raise ArgumentError(action, msg % explicit_arg) |
|
1812 | raise ArgumentError(action, msg % explicit_arg) | |
1847 |
|
1813 | |||
1848 | # if there is no explicit argument, try to match the |
|
1814 | # if there is no explicit argument, try to match the | |
1849 | # optional's string arguments with the following strings |
|
1815 | # optional's string arguments with the following strings | |
1850 | # if successful, exit the loop |
|
1816 | # if successful, exit the loop | |
1851 | else: |
|
1817 | else: | |
1852 | start = start_index + 1 |
|
1818 | start = start_index + 1 | |
1853 | selected_patterns = arg_strings_pattern[start:] |
|
1819 | selected_patterns = arg_strings_pattern[start:] | |
1854 | arg_count = match_argument(action, selected_patterns) |
|
1820 | arg_count = match_argument(action, selected_patterns) | |
1855 | stop = start + arg_count |
|
1821 | stop = start + arg_count | |
1856 | args = arg_strings[start:stop] |
|
1822 | args = arg_strings[start:stop] | |
1857 | action_tuples.append((action, args, option_string)) |
|
1823 | action_tuples.append((action, args, option_string)) | |
1858 | break |
|
1824 | break | |
1859 |
|
1825 | |||
1860 | # add the Optional to the list and return the index at which |
|
1826 | # add the Optional to the list and return the index at which | |
1861 | # the Optional's string args stopped |
|
1827 | # the Optional's string args stopped | |
1862 | assert action_tuples |
|
1828 | assert action_tuples | |
1863 | for action, args, option_string in action_tuples: |
|
1829 | for action, args, option_string in action_tuples: | |
1864 | take_action(action, args, option_string) |
|
1830 | take_action(action, args, option_string) | |
1865 | return stop |
|
1831 | return stop | |
1866 |
|
1832 | |||
1867 | # the list of Positionals left to be parsed; this is modified |
|
1833 | # the list of Positionals left to be parsed; this is modified | |
1868 | # by consume_positionals() |
|
1834 | # by consume_positionals() | |
1869 | positionals = self._get_positional_actions() |
|
1835 | positionals = self._get_positional_actions() | |
1870 |
|
1836 | |||
1871 | # function to convert arg_strings into positional actions |
|
1837 | # function to convert arg_strings into positional actions | |
1872 | def consume_positionals(start_index): |
|
1838 | def consume_positionals(start_index): | |
1873 | # match as many Positionals as possible |
|
1839 | # match as many Positionals as possible | |
1874 | match_partial = self._match_arguments_partial |
|
1840 | match_partial = self._match_arguments_partial | |
1875 | selected_pattern = arg_strings_pattern[start_index:] |
|
1841 | selected_pattern = arg_strings_pattern[start_index:] | |
1876 | arg_counts = match_partial(positionals, selected_pattern) |
|
1842 | arg_counts = match_partial(positionals, selected_pattern) | |
1877 |
|
1843 | |||
1878 | # slice off the appropriate arg strings for each Positional |
|
1844 | # slice off the appropriate arg strings for each Positional | |
1879 | # and add the Positional and its args to the list |
|
1845 | # and add the Positional and its args to the list | |
1880 | for action, arg_count in zip(positionals, arg_counts): |
|
1846 | for action, arg_count in zip(positionals, arg_counts): | |
1881 | args = arg_strings[start_index: start_index + arg_count] |
|
1847 | args = arg_strings[start_index: start_index + arg_count] | |
1882 | start_index += arg_count |
|
1848 | start_index += arg_count | |
1883 | take_action(action, args) |
|
1849 | take_action(action, args) | |
1884 |
|
1850 | |||
1885 | # slice off the Positionals that we just parsed and return the |
|
1851 | # slice off the Positionals that we just parsed and return the | |
1886 | # index at which the Positionals' string args stopped |
|
1852 | # index at which the Positionals' string args stopped | |
1887 | positionals[:] = positionals[len(arg_counts):] |
|
1853 | positionals[:] = positionals[len(arg_counts):] | |
1888 | return start_index |
|
1854 | return start_index | |
1889 |
|
1855 | |||
1890 | # consume Positionals and Optionals alternately, until we have |
|
1856 | # consume Positionals and Optionals alternately, until we have | |
1891 | # passed the last option string |
|
1857 | # passed the last option string | |
1892 | extras = [] |
|
1858 | extras = [] | |
1893 | start_index = 0 |
|
1859 | start_index = 0 | |
1894 | if option_string_indices: |
|
1860 | if option_string_indices: | |
1895 | max_option_string_index = max(option_string_indices) |
|
1861 | max_option_string_index = max(option_string_indices) | |
1896 | else: |
|
1862 | else: | |
1897 | max_option_string_index = -1 |
|
1863 | max_option_string_index = -1 | |
1898 | while start_index <= max_option_string_index: |
|
1864 | while start_index <= max_option_string_index: | |
1899 |
|
1865 | |||
1900 | # consume any Positionals preceding the next option |
|
1866 | # consume any Positionals preceding the next option | |
1901 | next_option_string_index = min([ |
|
1867 | next_option_string_index = min([ | |
1902 | index |
|
1868 | index | |
1903 | for index in option_string_indices |
|
1869 | for index in option_string_indices | |
1904 | if index >= start_index]) |
|
1870 | if index >= start_index]) | |
1905 | if start_index != next_option_string_index: |
|
1871 | if start_index != next_option_string_index: | |
1906 | positionals_end_index = consume_positionals(start_index) |
|
1872 | positionals_end_index = consume_positionals(start_index) | |
1907 |
|
1873 | |||
1908 | # only try to parse the next optional if we didn't consume |
|
1874 | # only try to parse the next optional if we didn't consume | |
1909 | # the option string during the positionals parsing |
|
1875 | # the option string during the positionals parsing | |
1910 | if positionals_end_index > start_index: |
|
1876 | if positionals_end_index > start_index: | |
1911 | start_index = positionals_end_index |
|
1877 | start_index = positionals_end_index | |
1912 | continue |
|
1878 | continue | |
1913 | else: |
|
1879 | else: | |
1914 | start_index = positionals_end_index |
|
1880 | start_index = positionals_end_index | |
1915 |
|
1881 | |||
1916 | # if we consumed all the positionals we could and we're not |
|
1882 | # if we consumed all the positionals we could and we're not | |
1917 | # at the index of an option string, there were extra arguments |
|
1883 | # at the index of an option string, there were extra arguments | |
1918 | if start_index not in option_string_indices: |
|
1884 | if start_index not in option_string_indices: | |
1919 | strings = arg_strings[start_index:next_option_string_index] |
|
1885 | strings = arg_strings[start_index:next_option_string_index] | |
1920 | extras.extend(strings) |
|
1886 | extras.extend(strings) | |
1921 | start_index = next_option_string_index |
|
1887 | start_index = next_option_string_index | |
1922 |
|
1888 | |||
1923 | # consume the next optional and any arguments for it |
|
1889 | # consume the next optional and any arguments for it | |
1924 | start_index = consume_optional(start_index) |
|
1890 | start_index = consume_optional(start_index) | |
1925 |
|
1891 | |||
1926 | # consume any positionals following the last Optional |
|
1892 | # consume any positionals following the last Optional | |
1927 | stop_index = consume_positionals(start_index) |
|
1893 | stop_index = consume_positionals(start_index) | |
1928 |
|
1894 | |||
1929 | # if we didn't consume all the argument strings, there were extras |
|
1895 | # if we didn't consume all the argument strings, there were extras | |
1930 | extras.extend(arg_strings[stop_index:]) |
|
1896 | extras.extend(arg_strings[stop_index:]) | |
1931 |
|
1897 | |||
1932 | # if we didn't use all the Positional objects, there were too few |
|
1898 | # if we didn't use all the Positional objects, there were too few | |
1933 | # arg strings supplied. |
|
1899 | # arg strings supplied. | |
1934 | if positionals: |
|
1900 | if positionals: | |
1935 | self.error(_('too few arguments')) |
|
1901 | self.error(_('too few arguments')) | |
1936 |
|
1902 | |||
1937 | # make sure all required actions were present |
|
1903 | # make sure all required actions were present | |
1938 | for action in self._actions: |
|
1904 | for action in self._actions: | |
1939 | if action.required: |
|
1905 | if action.required: | |
1940 | if action not in seen_actions: |
|
1906 | if action not in seen_actions: | |
1941 | name = _get_action_name(action) |
|
1907 | name = _get_action_name(action) | |
1942 | self.error(_('argument %s is required') % name) |
|
1908 | self.error(_('argument %s is required') % name) | |
1943 |
|
1909 | |||
1944 | # make sure all required groups had one option present |
|
1910 | # make sure all required groups had one option present | |
1945 | for group in self._mutually_exclusive_groups: |
|
1911 | for group in self._mutually_exclusive_groups: | |
1946 | if group.required: |
|
1912 | if group.required: | |
1947 | for action in group._group_actions: |
|
1913 | for action in group._group_actions: | |
1948 | if action in seen_non_default_actions: |
|
1914 | if action in seen_non_default_actions: | |
1949 | break |
|
1915 | break | |
1950 |
|
1916 | |||
1951 | # if no actions were used, report the error |
|
1917 | # if no actions were used, report the error | |
1952 | else: |
|
1918 | else: | |
1953 | names = [_get_action_name(action) |
|
1919 | names = [_get_action_name(action) | |
1954 | for action in group._group_actions |
|
1920 | for action in group._group_actions | |
1955 | if action.help is not SUPPRESS] |
|
1921 | if action.help is not SUPPRESS] | |
1956 | msg = _('one of the arguments %s is required') |
|
1922 | msg = _('one of the arguments %s is required') | |
1957 | self.error(msg % ' '.join(names)) |
|
1923 | self.error(msg % ' '.join(names)) | |
1958 |
|
1924 | |||
1959 | # return the updated namespace and the extra arguments |
|
1925 | # return the updated namespace and the extra arguments | |
1960 | return namespace, extras |
|
1926 | return namespace, extras | |
1961 |
|
1927 | |||
1962 | def _read_args_from_files(self, arg_strings): |
|
1928 | def _read_args_from_files(self, arg_strings): | |
1963 | # expand arguments referencing files |
|
1929 | # expand arguments referencing files | |
1964 | new_arg_strings = [] |
|
1930 | new_arg_strings = [] | |
1965 | for arg_string in arg_strings: |
|
1931 | for arg_string in arg_strings: | |
1966 |
|
1932 | |||
1967 | # for regular arguments, just add them back into the list |
|
1933 | # for regular arguments, just add them back into the list | |
1968 | if arg_string[0] not in self.fromfile_prefix_chars: |
|
1934 | if arg_string[0] not in self.fromfile_prefix_chars: | |
1969 | new_arg_strings.append(arg_string) |
|
1935 | new_arg_strings.append(arg_string) | |
1970 |
|
1936 | |||
1971 | # replace arguments referencing files with the file content |
|
1937 | # replace arguments referencing files with the file content | |
1972 | else: |
|
1938 | else: | |
1973 | try: |
|
1939 | try: | |
1974 | args_file = open(arg_string[1:]) |
|
1940 | args_file = open(arg_string[1:]) | |
1975 | try: |
|
1941 | try: | |
1976 |
arg_strings = |
|
1942 | arg_strings = [] | |
|
1943 | for arg_line in args_file.read().splitlines(): | |||
|
1944 | for arg in self.convert_arg_line_to_args(arg_line): | |||
|
1945 | arg_strings.append(arg) | |||
1977 | arg_strings = self._read_args_from_files(arg_strings) |
|
1946 | arg_strings = self._read_args_from_files(arg_strings) | |
1978 | new_arg_strings.extend(arg_strings) |
|
1947 | new_arg_strings.extend(arg_strings) | |
1979 | finally: |
|
1948 | finally: | |
1980 | args_file.close() |
|
1949 | args_file.close() | |
1981 | except IOError: |
|
1950 | except IOError: | |
1982 | err = _sys.exc_info()[1] |
|
1951 | err = _sys.exc_info()[1] | |
1983 | self.error(str(err)) |
|
1952 | self.error(str(err)) | |
1984 |
|
1953 | |||
1985 | # return the modified argument list |
|
1954 | # return the modified argument list | |
1986 | return new_arg_strings |
|
1955 | return new_arg_strings | |
1987 |
|
1956 | |||
|
1957 | def convert_arg_line_to_args(self, arg_line): | |||
|
1958 | return [arg_line] | |||
|
1959 | ||||
1988 | def _match_argument(self, action, arg_strings_pattern): |
|
1960 | def _match_argument(self, action, arg_strings_pattern): | |
1989 | # match the pattern for this action to the arg strings |
|
1961 | # match the pattern for this action to the arg strings | |
1990 | nargs_pattern = self._get_nargs_pattern(action) |
|
1962 | nargs_pattern = self._get_nargs_pattern(action) | |
1991 | match = _re.match(nargs_pattern, arg_strings_pattern) |
|
1963 | match = _re.match(nargs_pattern, arg_strings_pattern) | |
1992 |
|
1964 | |||
1993 | # raise an exception if we weren't able to find a match |
|
1965 | # raise an exception if we weren't able to find a match | |
1994 | if match is None: |
|
1966 | if match is None: | |
1995 | nargs_errors = { |
|
1967 | nargs_errors = { | |
1996 | None: _('expected one argument'), |
|
1968 | None: _('expected one argument'), | |
1997 | OPTIONAL: _('expected at most one argument'), |
|
1969 | OPTIONAL: _('expected at most one argument'), | |
1998 | ONE_OR_MORE: _('expected at least one argument'), |
|
1970 | ONE_OR_MORE: _('expected at least one argument'), | |
1999 | } |
|
1971 | } | |
2000 | default = _('expected %s argument(s)') % action.nargs |
|
1972 | default = _('expected %s argument(s)') % action.nargs | |
2001 | msg = nargs_errors.get(action.nargs, default) |
|
1973 | msg = nargs_errors.get(action.nargs, default) | |
2002 | raise ArgumentError(action, msg) |
|
1974 | raise ArgumentError(action, msg) | |
2003 |
|
1975 | |||
2004 | # return the number of arguments matched |
|
1976 | # return the number of arguments matched | |
2005 | return len(match.group(1)) |
|
1977 | return len(match.group(1)) | |
2006 |
|
1978 | |||
2007 | def _match_arguments_partial(self, actions, arg_strings_pattern): |
|
1979 | def _match_arguments_partial(self, actions, arg_strings_pattern): | |
2008 | # progressively shorten the actions list by slicing off the |
|
1980 | # progressively shorten the actions list by slicing off the | |
2009 | # final actions until we find a match |
|
1981 | # final actions until we find a match | |
2010 | result = [] |
|
1982 | result = [] | |
2011 | for i in range(len(actions), 0, -1): |
|
1983 | for i in range(len(actions), 0, -1): | |
2012 | actions_slice = actions[:i] |
|
1984 | actions_slice = actions[:i] | |
2013 | pattern = ''.join([self._get_nargs_pattern(action) |
|
1985 | pattern = ''.join([self._get_nargs_pattern(action) | |
2014 | for action in actions_slice]) |
|
1986 | for action in actions_slice]) | |
2015 | match = _re.match(pattern, arg_strings_pattern) |
|
1987 | match = _re.match(pattern, arg_strings_pattern) | |
2016 | if match is not None: |
|
1988 | if match is not None: | |
2017 | result.extend([len(string) for string in match.groups()]) |
|
1989 | result.extend([len(string) for string in match.groups()]) | |
2018 | break |
|
1990 | break | |
2019 |
|
1991 | |||
2020 | # return the list of arg string counts |
|
1992 | # return the list of arg string counts | |
2021 | return result |
|
1993 | return result | |
2022 |
|
1994 | |||
2023 | def _parse_optional(self, arg_string): |
|
1995 | def _parse_optional(self, arg_string): | |
2024 | # if it's an empty string, it was meant to be a positional |
|
1996 | # if it's an empty string, it was meant to be a positional | |
2025 | if not arg_string: |
|
1997 | if not arg_string: | |
2026 | return None |
|
1998 | return None | |
2027 |
|
1999 | |||
2028 | # if it doesn't start with a prefix, it was meant to be positional |
|
2000 | # if it doesn't start with a prefix, it was meant to be positional | |
2029 | if not arg_string[0] in self.prefix_chars: |
|
2001 | if not arg_string[0] in self.prefix_chars: | |
2030 | return None |
|
2002 | return None | |
2031 |
|
2003 | |||
2032 | # if it's just dashes, it was meant to be positional |
|
|||
2033 | if not arg_string.strip('-'): |
|
|||
2034 | return None |
|
|||
2035 |
|
||||
2036 | # if the option string is present in the parser, return the action |
|
2004 | # if the option string is present in the parser, return the action | |
2037 | if arg_string in self._option_string_actions: |
|
2005 | if arg_string in self._option_string_actions: | |
2038 | action = self._option_string_actions[arg_string] |
|
2006 | action = self._option_string_actions[arg_string] | |
2039 | return action, arg_string, None |
|
2007 | return action, arg_string, None | |
2040 |
|
2008 | |||
|
2009 | # if it's just a single character, it was meant to be positional | |||
|
2010 | if len(arg_string) == 1: | |||
|
2011 | return None | |||
|
2012 | ||||
2041 | # if the option string before the "=" is present, return the action |
|
2013 | # if the option string before the "=" is present, return the action | |
2042 | if '=' in arg_string: |
|
2014 | if '=' in arg_string: | |
2043 | option_string, explicit_arg = arg_string.split('=', 1) |
|
2015 | option_string, explicit_arg = arg_string.split('=', 1) | |
2044 | if option_string in self._option_string_actions: |
|
2016 | if option_string in self._option_string_actions: | |
2045 | action = self._option_string_actions[option_string] |
|
2017 | action = self._option_string_actions[option_string] | |
2046 | return action, option_string, explicit_arg |
|
2018 | return action, option_string, explicit_arg | |
2047 |
|
2019 | |||
2048 | # search through all possible prefixes of the option string |
|
2020 | # search through all possible prefixes of the option string | |
2049 | # and all actions in the parser for possible interpretations |
|
2021 | # and all actions in the parser for possible interpretations | |
2050 | option_tuples = self._get_option_tuples(arg_string) |
|
2022 | option_tuples = self._get_option_tuples(arg_string) | |
2051 |
|
2023 | |||
2052 | # if multiple actions match, the option string was ambiguous |
|
2024 | # if multiple actions match, the option string was ambiguous | |
2053 | if len(option_tuples) > 1: |
|
2025 | if len(option_tuples) > 1: | |
2054 | options = ', '.join([option_string |
|
2026 | options = ', '.join([option_string | |
2055 | for action, option_string, explicit_arg in option_tuples]) |
|
2027 | for action, option_string, explicit_arg in option_tuples]) | |
2056 | tup = arg_string, options |
|
2028 | tup = arg_string, options | |
2057 | self.error(_('ambiguous option: %s could match %s') % tup) |
|
2029 | self.error(_('ambiguous option: %s could match %s') % tup) | |
2058 |
|
2030 | |||
2059 | # if exactly one action matched, this segmentation is good, |
|
2031 | # if exactly one action matched, this segmentation is good, | |
2060 | # so return the parsed action |
|
2032 | # so return the parsed action | |
2061 | elif len(option_tuples) == 1: |
|
2033 | elif len(option_tuples) == 1: | |
2062 | option_tuple, = option_tuples |
|
2034 | option_tuple, = option_tuples | |
2063 | return option_tuple |
|
2035 | return option_tuple | |
2064 |
|
2036 | |||
2065 | # if it was not found as an option, but it looks like a negative |
|
2037 | # if it was not found as an option, but it looks like a negative | |
2066 | # number, it was meant to be positional |
|
2038 | # number, it was meant to be positional | |
2067 | # unless there are negative-number-like options |
|
2039 | # unless there are negative-number-like options | |
2068 | if self._negative_number_matcher.match(arg_string): |
|
2040 | if self._negative_number_matcher.match(arg_string): | |
2069 | if not self._has_negative_number_optionals: |
|
2041 | if not self._has_negative_number_optionals: | |
2070 | return None |
|
2042 | return None | |
2071 |
|
2043 | |||
2072 | # if it contains a space, it was meant to be a positional |
|
2044 | # if it contains a space, it was meant to be a positional | |
2073 | if ' ' in arg_string: |
|
2045 | if ' ' in arg_string: | |
2074 | return None |
|
2046 | return None | |
2075 |
|
2047 | |||
2076 | # it was meant to be an optional but there is no such option |
|
2048 | # it was meant to be an optional but there is no such option | |
2077 | # in this parser (though it might be a valid option in a subparser) |
|
2049 | # in this parser (though it might be a valid option in a subparser) | |
2078 | return None, arg_string, None |
|
2050 | return None, arg_string, None | |
2079 |
|
2051 | |||
2080 | def _get_option_tuples(self, option_string): |
|
2052 | def _get_option_tuples(self, option_string): | |
2081 | result = [] |
|
2053 | result = [] | |
2082 |
|
2054 | |||
2083 | # option strings starting with two prefix characters are only |
|
2055 | # option strings starting with two prefix characters are only | |
2084 | # split at the '=' |
|
2056 | # split at the '=' | |
2085 | chars = self.prefix_chars |
|
2057 | chars = self.prefix_chars | |
2086 | if option_string[0] in chars and option_string[1] in chars: |
|
2058 | if option_string[0] in chars and option_string[1] in chars: | |
2087 | if '=' in option_string: |
|
2059 | if '=' in option_string: | |
2088 | option_prefix, explicit_arg = option_string.split('=', 1) |
|
2060 | option_prefix, explicit_arg = option_string.split('=', 1) | |
2089 | else: |
|
2061 | else: | |
2090 | option_prefix = option_string |
|
2062 | option_prefix = option_string | |
2091 | explicit_arg = None |
|
2063 | explicit_arg = None | |
2092 | for option_string in self._option_string_actions: |
|
2064 | for option_string in self._option_string_actions: | |
2093 | if option_string.startswith(option_prefix): |
|
2065 | if option_string.startswith(option_prefix): | |
2094 | action = self._option_string_actions[option_string] |
|
2066 | action = self._option_string_actions[option_string] | |
2095 | tup = action, option_string, explicit_arg |
|
2067 | tup = action, option_string, explicit_arg | |
2096 | result.append(tup) |
|
2068 | result.append(tup) | |
2097 |
|
2069 | |||
2098 | # single character options can be concatenated with their arguments |
|
2070 | # single character options can be concatenated with their arguments | |
2099 | # but multiple character options always have to have their argument |
|
2071 | # but multiple character options always have to have their argument | |
2100 | # separate |
|
2072 | # separate | |
2101 | elif option_string[0] in chars and option_string[1] not in chars: |
|
2073 | elif option_string[0] in chars and option_string[1] not in chars: | |
2102 | option_prefix = option_string |
|
2074 | option_prefix = option_string | |
2103 | explicit_arg = None |
|
2075 | explicit_arg = None | |
2104 | short_option_prefix = option_string[:2] |
|
2076 | short_option_prefix = option_string[:2] | |
2105 | short_explicit_arg = option_string[2:] |
|
2077 | short_explicit_arg = option_string[2:] | |
2106 |
|
2078 | |||
2107 | for option_string in self._option_string_actions: |
|
2079 | for option_string in self._option_string_actions: | |
2108 | if option_string == short_option_prefix: |
|
2080 | if option_string == short_option_prefix: | |
2109 | action = self._option_string_actions[option_string] |
|
2081 | action = self._option_string_actions[option_string] | |
2110 | tup = action, option_string, short_explicit_arg |
|
2082 | tup = action, option_string, short_explicit_arg | |
2111 | result.append(tup) |
|
2083 | result.append(tup) | |
2112 | elif option_string.startswith(option_prefix): |
|
2084 | elif option_string.startswith(option_prefix): | |
2113 | action = self._option_string_actions[option_string] |
|
2085 | action = self._option_string_actions[option_string] | |
2114 | tup = action, option_string, explicit_arg |
|
2086 | tup = action, option_string, explicit_arg | |
2115 | result.append(tup) |
|
2087 | result.append(tup) | |
2116 |
|
2088 | |||
2117 | # shouldn't ever get here |
|
2089 | # shouldn't ever get here | |
2118 | else: |
|
2090 | else: | |
2119 | self.error(_('unexpected option string: %s') % option_string) |
|
2091 | self.error(_('unexpected option string: %s') % option_string) | |
2120 |
|
2092 | |||
2121 | # return the collected option tuples |
|
2093 | # return the collected option tuples | |
2122 | return result |
|
2094 | return result | |
2123 |
|
2095 | |||
2124 | def _get_nargs_pattern(self, action): |
|
2096 | def _get_nargs_pattern(self, action): | |
2125 | # in all examples below, we have to allow for '--' args |
|
2097 | # in all examples below, we have to allow for '--' args | |
2126 | # which are represented as '-' in the pattern |
|
2098 | # which are represented as '-' in the pattern | |
2127 | nargs = action.nargs |
|
2099 | nargs = action.nargs | |
2128 |
|
2100 | |||
2129 | # the default (None) is assumed to be a single argument |
|
2101 | # the default (None) is assumed to be a single argument | |
2130 | if nargs is None: |
|
2102 | if nargs is None: | |
2131 | nargs_pattern = '(-*A-*)' |
|
2103 | nargs_pattern = '(-*A-*)' | |
2132 |
|
2104 | |||
2133 | # allow zero or one arguments |
|
2105 | # allow zero or one arguments | |
2134 | elif nargs == OPTIONAL: |
|
2106 | elif nargs == OPTIONAL: | |
2135 | nargs_pattern = '(-*A?-*)' |
|
2107 | nargs_pattern = '(-*A?-*)' | |
2136 |
|
2108 | |||
2137 | # allow zero or more arguments |
|
2109 | # allow zero or more arguments | |
2138 | elif nargs == ZERO_OR_MORE: |
|
2110 | elif nargs == ZERO_OR_MORE: | |
2139 | nargs_pattern = '(-*[A-]*)' |
|
2111 | nargs_pattern = '(-*[A-]*)' | |
2140 |
|
2112 | |||
2141 | # allow one or more arguments |
|
2113 | # allow one or more arguments | |
2142 | elif nargs == ONE_OR_MORE: |
|
2114 | elif nargs == ONE_OR_MORE: | |
2143 | nargs_pattern = '(-*A[A-]*)' |
|
2115 | nargs_pattern = '(-*A[A-]*)' | |
2144 |
|
2116 | |||
2145 | # allow any number of options or arguments |
|
2117 | # allow any number of options or arguments | |
2146 | elif nargs == REMAINDER: |
|
2118 | elif nargs == REMAINDER: | |
2147 | nargs_pattern = '([-AO]*)' |
|
2119 | nargs_pattern = '([-AO]*)' | |
2148 |
|
2120 | |||
2149 | # allow one argument followed by any number of options or arguments |
|
2121 | # allow one argument followed by any number of options or arguments | |
2150 | elif nargs == PARSER: |
|
2122 | elif nargs == PARSER: | |
2151 | nargs_pattern = '(-*A[-AO]*)' |
|
2123 | nargs_pattern = '(-*A[-AO]*)' | |
2152 |
|
2124 | |||
2153 | # all others should be integers |
|
2125 | # all others should be integers | |
2154 | else: |
|
2126 | else: | |
2155 | nargs_pattern = '(-*%s-*)' % '-*'.join('A' * nargs) |
|
2127 | nargs_pattern = '(-*%s-*)' % '-*'.join('A' * nargs) | |
2156 |
|
2128 | |||
2157 | # if this is an optional action, -- is not allowed |
|
2129 | # if this is an optional action, -- is not allowed | |
2158 | if action.option_strings: |
|
2130 | if action.option_strings: | |
2159 | nargs_pattern = nargs_pattern.replace('-*', '') |
|
2131 | nargs_pattern = nargs_pattern.replace('-*', '') | |
2160 | nargs_pattern = nargs_pattern.replace('-', '') |
|
2132 | nargs_pattern = nargs_pattern.replace('-', '') | |
2161 |
|
2133 | |||
2162 | # return the pattern |
|
2134 | # return the pattern | |
2163 | return nargs_pattern |
|
2135 | return nargs_pattern | |
2164 |
|
2136 | |||
2165 | # ======================== |
|
2137 | # ======================== | |
2166 | # Value conversion methods |
|
2138 | # Value conversion methods | |
2167 | # ======================== |
|
2139 | # ======================== | |
2168 | def _get_values(self, action, arg_strings): |
|
2140 | def _get_values(self, action, arg_strings): | |
2169 | # for everything but PARSER args, strip out '--' |
|
2141 | # for everything but PARSER args, strip out '--' | |
2170 | if action.nargs not in [PARSER, REMAINDER]: |
|
2142 | if action.nargs not in [PARSER, REMAINDER]: | |
2171 | arg_strings = [s for s in arg_strings if s != '--'] |
|
2143 | arg_strings = [s for s in arg_strings if s != '--'] | |
2172 |
|
2144 | |||
2173 | # optional argument produces a default when not present |
|
2145 | # optional argument produces a default when not present | |
2174 | if not arg_strings and action.nargs == OPTIONAL: |
|
2146 | if not arg_strings and action.nargs == OPTIONAL: | |
2175 | if action.option_strings: |
|
2147 | if action.option_strings: | |
2176 | value = action.const |
|
2148 | value = action.const | |
2177 | else: |
|
2149 | else: | |
2178 | value = action.default |
|
2150 | value = action.default | |
2179 |
if isinstance(value, |
|
2151 | if isinstance(value, basestring): | |
2180 | value = self._get_value(action, value) |
|
2152 | value = self._get_value(action, value) | |
2181 | self._check_value(action, value) |
|
2153 | self._check_value(action, value) | |
2182 |
|
2154 | |||
2183 | # when nargs='*' on a positional, if there were no command-line |
|
2155 | # when nargs='*' on a positional, if there were no command-line | |
2184 | # args, use the default if it is anything other than None |
|
2156 | # args, use the default if it is anything other than None | |
2185 | elif (not arg_strings and action.nargs == ZERO_OR_MORE and |
|
2157 | elif (not arg_strings and action.nargs == ZERO_OR_MORE and | |
2186 | not action.option_strings): |
|
2158 | not action.option_strings): | |
2187 | if action.default is not None: |
|
2159 | if action.default is not None: | |
2188 | value = action.default |
|
2160 | value = action.default | |
2189 | else: |
|
2161 | else: | |
2190 | value = arg_strings |
|
2162 | value = arg_strings | |
2191 | self._check_value(action, value) |
|
2163 | self._check_value(action, value) | |
2192 |
|
2164 | |||
2193 | # single argument or optional argument produces a single value |
|
2165 | # single argument or optional argument produces a single value | |
2194 | elif len(arg_strings) == 1 and action.nargs in [None, OPTIONAL]: |
|
2166 | elif len(arg_strings) == 1 and action.nargs in [None, OPTIONAL]: | |
2195 | arg_string, = arg_strings |
|
2167 | arg_string, = arg_strings | |
2196 | value = self._get_value(action, arg_string) |
|
2168 | value = self._get_value(action, arg_string) | |
2197 | self._check_value(action, value) |
|
2169 | self._check_value(action, value) | |
2198 |
|
2170 | |||
2199 | # REMAINDER arguments convert all values, checking none |
|
2171 | # REMAINDER arguments convert all values, checking none | |
2200 | elif action.nargs == REMAINDER: |
|
2172 | elif action.nargs == REMAINDER: | |
2201 | value = [self._get_value(action, v) for v in arg_strings] |
|
2173 | value = [self._get_value(action, v) for v in arg_strings] | |
2202 |
|
2174 | |||
2203 | # PARSER arguments convert all values, but check only the first |
|
2175 | # PARSER arguments convert all values, but check only the first | |
2204 | elif action.nargs == PARSER: |
|
2176 | elif action.nargs == PARSER: | |
2205 | value = [self._get_value(action, v) for v in arg_strings] |
|
2177 | value = [self._get_value(action, v) for v in arg_strings] | |
2206 | self._check_value(action, value[0]) |
|
2178 | self._check_value(action, value[0]) | |
2207 |
|
2179 | |||
2208 | # all other types of nargs produce a list |
|
2180 | # all other types of nargs produce a list | |
2209 | else: |
|
2181 | else: | |
2210 | value = [self._get_value(action, v) for v in arg_strings] |
|
2182 | value = [self._get_value(action, v) for v in arg_strings] | |
2211 | for v in value: |
|
2183 | for v in value: | |
2212 | self._check_value(action, v) |
|
2184 | self._check_value(action, v) | |
2213 |
|
2185 | |||
2214 | # return the converted value |
|
2186 | # return the converted value | |
2215 | return value |
|
2187 | return value | |
2216 |
|
2188 | |||
2217 | def _get_value(self, action, arg_string): |
|
2189 | def _get_value(self, action, arg_string): | |
2218 | type_func = self._registry_get('type', action.type, action.type) |
|
2190 | type_func = self._registry_get('type', action.type, action.type) | |
2219 | if not _callable(type_func): |
|
2191 | if not _callable(type_func): | |
2220 | msg = _('%r is not callable') |
|
2192 | msg = _('%r is not callable') | |
2221 | raise ArgumentError(action, msg % type_func) |
|
2193 | raise ArgumentError(action, msg % type_func) | |
2222 |
|
2194 | |||
2223 | # convert the value to the appropriate type |
|
2195 | # convert the value to the appropriate type | |
2224 | try: |
|
2196 | try: | |
2225 | result = type_func(arg_string) |
|
2197 | result = type_func(arg_string) | |
2226 |
|
2198 | |||
2227 | # ArgumentTypeErrors indicate errors |
|
2199 | # ArgumentTypeErrors indicate errors | |
2228 | except ArgumentTypeError: |
|
2200 | except ArgumentTypeError: | |
2229 | name = getattr(action.type, '__name__', repr(action.type)) |
|
2201 | name = getattr(action.type, '__name__', repr(action.type)) | |
2230 | msg = str(_sys.exc_info()[1]) |
|
2202 | msg = str(_sys.exc_info()[1]) | |
2231 | raise ArgumentError(action, msg) |
|
2203 | raise ArgumentError(action, msg) | |
2232 |
|
2204 | |||
2233 | # TypeErrors or ValueErrors also indicate errors |
|
2205 | # TypeErrors or ValueErrors also indicate errors | |
2234 | except (TypeError, ValueError): |
|
2206 | except (TypeError, ValueError): | |
2235 | name = getattr(action.type, '__name__', repr(action.type)) |
|
2207 | name = getattr(action.type, '__name__', repr(action.type)) | |
2236 | msg = _('invalid %s value: %r') |
|
2208 | msg = _('invalid %s value: %r') | |
2237 | raise ArgumentError(action, msg % (name, arg_string)) |
|
2209 | raise ArgumentError(action, msg % (name, arg_string)) | |
2238 |
|
2210 | |||
2239 | # return the converted value |
|
2211 | # return the converted value | |
2240 | return result |
|
2212 | return result | |
2241 |
|
2213 | |||
2242 | def _check_value(self, action, value): |
|
2214 | def _check_value(self, action, value): | |
2243 | # converted value must be one of the choices (if specified) |
|
2215 | # converted value must be one of the choices (if specified) | |
2244 | if action.choices is not None and value not in action.choices: |
|
2216 | if action.choices is not None and value not in action.choices: | |
2245 | tup = value, ', '.join(map(repr, action.choices)) |
|
2217 | tup = value, ', '.join(map(repr, action.choices)) | |
2246 | msg = _('invalid choice: %r (choose from %s)') % tup |
|
2218 | msg = _('invalid choice: %r (choose from %s)') % tup | |
2247 | raise ArgumentError(action, msg) |
|
2219 | raise ArgumentError(action, msg) | |
2248 |
|
2220 | |||
2249 | # ======================= |
|
2221 | # ======================= | |
2250 | # Help-formatting methods |
|
2222 | # Help-formatting methods | |
2251 | # ======================= |
|
2223 | # ======================= | |
2252 | def format_usage(self): |
|
2224 | def format_usage(self): | |
2253 | formatter = self._get_formatter() |
|
2225 | formatter = self._get_formatter() | |
2254 | formatter.add_usage(self.usage, self._actions, |
|
2226 | formatter.add_usage(self.usage, self._actions, | |
2255 | self._mutually_exclusive_groups) |
|
2227 | self._mutually_exclusive_groups) | |
2256 | return formatter.format_help() |
|
2228 | return formatter.format_help() | |
2257 |
|
2229 | |||
2258 | def format_help(self): |
|
2230 | def format_help(self): | |
2259 | formatter = self._get_formatter() |
|
2231 | formatter = self._get_formatter() | |
2260 |
|
2232 | |||
2261 | # usage |
|
2233 | # usage | |
2262 | formatter.add_usage(self.usage, self._actions, |
|
2234 | formatter.add_usage(self.usage, self._actions, | |
2263 | self._mutually_exclusive_groups) |
|
2235 | self._mutually_exclusive_groups) | |
2264 |
|
2236 | |||
2265 | # description |
|
2237 | # description | |
2266 | formatter.add_text(self.description) |
|
2238 | formatter.add_text(self.description) | |
2267 |
|
2239 | |||
2268 | # positionals, optionals and user-defined groups |
|
2240 | # positionals, optionals and user-defined groups | |
2269 | for action_group in self._action_groups: |
|
2241 | for action_group in self._action_groups: | |
2270 | formatter.start_section(action_group.title) |
|
2242 | formatter.start_section(action_group.title) | |
2271 | formatter.add_text(action_group.description) |
|
2243 | formatter.add_text(action_group.description) | |
2272 | formatter.add_arguments(action_group._group_actions) |
|
2244 | formatter.add_arguments(action_group._group_actions) | |
2273 | formatter.end_section() |
|
2245 | formatter.end_section() | |
2274 |
|
2246 | |||
2275 | # epilog |
|
2247 | # epilog | |
2276 | formatter.add_text(self.epilog) |
|
2248 | formatter.add_text(self.epilog) | |
2277 |
|
2249 | |||
2278 | # determine help from format above |
|
2250 | # determine help from format above | |
2279 | return formatter.format_help() |
|
2251 | return formatter.format_help() | |
2280 |
|
2252 | |||
2281 | def format_version(self): |
|
2253 | def format_version(self): | |
|
2254 | import warnings | |||
|
2255 | warnings.warn( | |||
|
2256 | 'The format_version method is deprecated -- the "version" ' | |||
|
2257 | 'argument to ArgumentParser is no longer supported.', | |||
|
2258 | DeprecationWarning) | |||
2282 | formatter = self._get_formatter() |
|
2259 | formatter = self._get_formatter() | |
2283 | formatter.add_text(self.version) |
|
2260 | formatter.add_text(self.version) | |
2284 | return formatter.format_help() |
|
2261 | return formatter.format_help() | |
2285 |
|
2262 | |||
2286 | def _get_formatter(self): |
|
2263 | def _get_formatter(self): | |
2287 | return self.formatter_class(prog=self.prog) |
|
2264 | return self.formatter_class(prog=self.prog) | |
2288 |
|
2265 | |||
2289 | # ===================== |
|
2266 | # ===================== | |
2290 | # Help-printing methods |
|
2267 | # Help-printing methods | |
2291 | # ===================== |
|
2268 | # ===================== | |
2292 | def print_usage(self, file=None): |
|
2269 | def print_usage(self, file=None): | |
2293 | if file is None: |
|
2270 | if file is None: | |
2294 | file = _sys.stdout |
|
2271 | file = _sys.stdout | |
2295 | self._print_message(self.format_usage(), file) |
|
2272 | self._print_message(self.format_usage(), file) | |
2296 |
|
2273 | |||
2297 | def print_help(self, file=None): |
|
2274 | def print_help(self, file=None): | |
2298 | if file is None: |
|
2275 | if file is None: | |
2299 | file = _sys.stdout |
|
2276 | file = _sys.stdout | |
2300 | self._print_message(self.format_help(), file) |
|
2277 | self._print_message(self.format_help(), file) | |
2301 |
|
2278 | |||
2302 | def print_version(self, file=None): |
|
2279 | def print_version(self, file=None): | |
|
2280 | import warnings | |||
|
2281 | warnings.warn( | |||
|
2282 | 'The print_version method is deprecated -- the "version" ' | |||
|
2283 | 'argument to ArgumentParser is no longer supported.', | |||
|
2284 | DeprecationWarning) | |||
2303 | self._print_message(self.format_version(), file) |
|
2285 | self._print_message(self.format_version(), file) | |
2304 |
|
2286 | |||
2305 | def _print_message(self, message, file=None): |
|
2287 | def _print_message(self, message, file=None): | |
2306 | if message: |
|
2288 | if message: | |
2307 | if file is None: |
|
2289 | if file is None: | |
2308 | file = _sys.stderr |
|
2290 | file = _sys.stderr | |
2309 | file.write(message) |
|
2291 | file.write(message) | |
2310 |
|
2292 | |||
2311 | # =============== |
|
2293 | # =============== | |
2312 | # Exiting methods |
|
2294 | # Exiting methods | |
2313 | # =============== |
|
2295 | # =============== | |
2314 | def exit(self, status=0, message=None): |
|
2296 | def exit(self, status=0, message=None): | |
2315 | if message: |
|
2297 | if message: | |
2316 | self._print_message(message, _sys.stderr) |
|
2298 | self._print_message(message, _sys.stderr) | |
2317 | _sys.exit(status) |
|
2299 | _sys.exit(status) | |
2318 |
|
2300 | |||
2319 | def error(self, message): |
|
2301 | def error(self, message): | |
2320 | """error(message: string) |
|
2302 | """error(message: string) | |
2321 |
|
2303 | |||
2322 | Prints a usage message incorporating the message to stderr and |
|
2304 | Prints a usage message incorporating the message to stderr and | |
2323 | exits. |
|
2305 | exits. | |
2324 |
|
2306 | |||
2325 | If you override this in a subclass, it should not return -- it |
|
2307 | If you override this in a subclass, it should not return -- it | |
2326 | should either exit or raise an exception. |
|
2308 | should either exit or raise an exception. | |
2327 | """ |
|
2309 | """ | |
2328 | self.print_usage(_sys.stderr) |
|
2310 | self.print_usage(_sys.stderr) | |
2329 | self.exit(2, _('%s: error: %s\n') % (self.prog, message)) |
|
2311 | self.exit(2, _('%s: error: %s\n') % (self.prog, message)) |
1 | NO CONTENT: file renamed from IPython/external/configobj.py to IPython/external/configobj/_configobj.py |
|
NO CONTENT: file renamed from IPython/external/configobj.py to IPython/external/configobj/_configobj.py |
1 | NO CONTENT: file renamed from IPython/external/decorator.py to IPython/external/decorator/_decorator.py |
|
NO CONTENT: file renamed from IPython/external/decorator.py to IPython/external/decorator/_decorator.py |
1 | NO CONTENT: file renamed from IPython/external/decorators.py to IPython/external/decorators/_decorators.py |
|
NO CONTENT: file renamed from IPython/external/decorators.py to IPython/external/decorators/_decorators.py |
1 | NO CONTENT: file renamed from IPython/external/_numpy_testing_utils.py to IPython/external/decorators/_numpy_testing_utils.py |
|
NO CONTENT: file renamed from IPython/external/_numpy_testing_utils.py to IPython/external/decorators/_numpy_testing_utils.py |
1 | NO CONTENT: file renamed from IPython/external/guid.py to IPython/external/guid/_guid.py |
|
NO CONTENT: file renamed from IPython/external/guid.py to IPython/external/guid/_guid.py |
1 | NO CONTENT: file renamed from IPython/external/mglob.py to IPython/external/mglob/_mglob.py |
|
NO CONTENT: file renamed from IPython/external/mglob.py to IPython/external/mglob/_mglob.py |
1 | NO CONTENT: file renamed from IPython/external/path.py to IPython/external/path/_path.py |
|
NO CONTENT: file renamed from IPython/external/path.py to IPython/external/path/_path.py |
1 | NO CONTENT: file renamed from IPython/external/pexpect.py to IPython/external/pexpect/_pexpect.py |
|
NO CONTENT: file renamed from IPython/external/pexpect.py to IPython/external/pexpect/_pexpect.py |
1 | NO CONTENT: file renamed from IPython/external/pyparsing.py to IPython/external/pyparsing/_pyparsing.py |
|
NO CONTENT: file renamed from IPython/external/pyparsing.py to IPython/external/pyparsing/_pyparsing.py |
1 | NO CONTENT: file renamed from IPython/external/simplegeneric.py to IPython/external/simplegeneric/_simplegeneric.py |
|
NO CONTENT: file renamed from IPython/external/simplegeneric.py to IPython/external/simplegeneric/_simplegeneric.py |
1 | NO CONTENT: file renamed from IPython/external/validate.py to IPython/external/validate/_validate.py |
|
NO CONTENT: file renamed from IPython/external/validate.py to IPython/external/validate/_validate.py |
1 | NO CONTENT: file renamed from IPython/external/pretty.py to IPython/lib/pretty.py |
|
NO CONTENT: file renamed from IPython/external/pretty.py to IPython/lib/pretty.py |
@@ -1,369 +1,380 b'' | |||||
1 | # encoding: utf-8 |
|
1 | # encoding: utf-8 | |
2 | """ |
|
2 | """ | |
3 | This module defines the things that are used in setup.py for building IPython |
|
3 | This module defines the things that are used in setup.py for building IPython | |
4 |
|
4 | |||
5 | This includes: |
|
5 | This includes: | |
6 |
|
6 | |||
7 | * The basic arguments to setup |
|
7 | * The basic arguments to setup | |
8 | * Functions for finding things like packages, package data, etc. |
|
8 | * Functions for finding things like packages, package data, etc. | |
9 | * A function for checking dependencies. |
|
9 | * A function for checking dependencies. | |
10 | """ |
|
10 | """ | |
11 | from __future__ import print_function |
|
11 | from __future__ import print_function | |
12 |
|
12 | |||
13 | #------------------------------------------------------------------------------- |
|
13 | #------------------------------------------------------------------------------- | |
14 | # Copyright (C) 2008 The IPython Development Team |
|
14 | # Copyright (C) 2008 The IPython Development Team | |
15 | # |
|
15 | # | |
16 | # Distributed under the terms of the BSD License. The full license is in |
|
16 | # Distributed under the terms of the BSD License. The full license is in | |
17 | # the file COPYING, distributed as part of this software. |
|
17 | # the file COPYING, distributed as part of this software. | |
18 | #------------------------------------------------------------------------------- |
|
18 | #------------------------------------------------------------------------------- | |
19 |
|
19 | |||
20 | #------------------------------------------------------------------------------- |
|
20 | #------------------------------------------------------------------------------- | |
21 | # Imports |
|
21 | # Imports | |
22 | #------------------------------------------------------------------------------- |
|
22 | #------------------------------------------------------------------------------- | |
23 | import os |
|
23 | import os | |
24 | import sys |
|
24 | import sys | |
25 |
|
25 | |||
26 | from ConfigParser import ConfigParser |
|
26 | from ConfigParser import ConfigParser | |
27 | from distutils.command.build_py import build_py |
|
27 | from distutils.command.build_py import build_py | |
28 | from glob import glob |
|
28 | from glob import glob | |
29 |
|
29 | |||
30 | from setupext import install_data_ext |
|
30 | from setupext import install_data_ext | |
31 |
|
31 | |||
32 | #------------------------------------------------------------------------------- |
|
32 | #------------------------------------------------------------------------------- | |
33 | # Useful globals and utility functions |
|
33 | # Useful globals and utility functions | |
34 | #------------------------------------------------------------------------------- |
|
34 | #------------------------------------------------------------------------------- | |
35 |
|
35 | |||
36 | # A few handy globals |
|
36 | # A few handy globals | |
37 | isfile = os.path.isfile |
|
37 | isfile = os.path.isfile | |
38 | pjoin = os.path.join |
|
38 | pjoin = os.path.join | |
39 |
|
39 | |||
40 | def oscmd(s): |
|
40 | def oscmd(s): | |
41 | print(">", s) |
|
41 | print(">", s) | |
42 | os.system(s) |
|
42 | os.system(s) | |
43 |
|
43 | |||
44 | # A little utility we'll need below, since glob() does NOT allow you to do |
|
44 | # A little utility we'll need below, since glob() does NOT allow you to do | |
45 | # exclusion on multiple endings! |
|
45 | # exclusion on multiple endings! | |
46 | def file_doesnt_endwith(test,endings): |
|
46 | def file_doesnt_endwith(test,endings): | |
47 | """Return true if test is a file and its name does NOT end with any |
|
47 | """Return true if test is a file and its name does NOT end with any | |
48 | of the strings listed in endings.""" |
|
48 | of the strings listed in endings.""" | |
49 | if not isfile(test): |
|
49 | if not isfile(test): | |
50 | return False |
|
50 | return False | |
51 | for e in endings: |
|
51 | for e in endings: | |
52 | if test.endswith(e): |
|
52 | if test.endswith(e): | |
53 | return False |
|
53 | return False | |
54 | return True |
|
54 | return True | |
55 |
|
55 | |||
56 | #--------------------------------------------------------------------------- |
|
56 | #--------------------------------------------------------------------------- | |
57 | # Basic project information |
|
57 | # Basic project information | |
58 | #--------------------------------------------------------------------------- |
|
58 | #--------------------------------------------------------------------------- | |
59 |
|
59 | |||
60 | # release.py contains version, authors, license, url, keywords, etc. |
|
60 | # release.py contains version, authors, license, url, keywords, etc. | |
61 | execfile(pjoin('IPython','core','release.py')) |
|
61 | execfile(pjoin('IPython','core','release.py')) | |
62 |
|
62 | |||
63 | # Create a dict with the basic information |
|
63 | # Create a dict with the basic information | |
64 | # This dict is eventually passed to setup after additional keys are added. |
|
64 | # This dict is eventually passed to setup after additional keys are added. | |
65 | setup_args = dict( |
|
65 | setup_args = dict( | |
66 | name = name, |
|
66 | name = name, | |
67 | version = version, |
|
67 | version = version, | |
68 | description = description, |
|
68 | description = description, | |
69 | long_description = long_description, |
|
69 | long_description = long_description, | |
70 | author = author, |
|
70 | author = author, | |
71 | author_email = author_email, |
|
71 | author_email = author_email, | |
72 | url = url, |
|
72 | url = url, | |
73 | download_url = download_url, |
|
73 | download_url = download_url, | |
74 | license = license, |
|
74 | license = license, | |
75 | platforms = platforms, |
|
75 | platforms = platforms, | |
76 | keywords = keywords, |
|
76 | keywords = keywords, | |
77 | cmdclass = {'install_data': install_data_ext}, |
|
77 | cmdclass = {'install_data': install_data_ext}, | |
78 | ) |
|
78 | ) | |
79 |
|
79 | |||
80 |
|
80 | |||
81 | #--------------------------------------------------------------------------- |
|
81 | #--------------------------------------------------------------------------- | |
82 | # Find packages |
|
82 | # Find packages | |
83 | #--------------------------------------------------------------------------- |
|
83 | #--------------------------------------------------------------------------- | |
84 |
|
84 | |||
85 | def add_package(packages,pname,config=False,tests=False,scripts=False, |
|
85 | def add_package(packages,pname,config=False,tests=False,scripts=False, | |
86 | others=None): |
|
86 | others=None): | |
87 | """ |
|
87 | """ | |
88 | Add a package to the list of packages, including certain subpackages. |
|
88 | Add a package to the list of packages, including certain subpackages. | |
89 | """ |
|
89 | """ | |
90 | packages.append('.'.join(['IPython',pname])) |
|
90 | packages.append('.'.join(['IPython',pname])) | |
91 | if config: |
|
91 | if config: | |
92 | packages.append('.'.join(['IPython',pname,'config'])) |
|
92 | packages.append('.'.join(['IPython',pname,'config'])) | |
93 | if tests: |
|
93 | if tests: | |
94 | packages.append('.'.join(['IPython',pname,'tests'])) |
|
94 | packages.append('.'.join(['IPython',pname,'tests'])) | |
95 | if scripts: |
|
95 | if scripts: | |
96 | packages.append('.'.join(['IPython',pname,'scripts'])) |
|
96 | packages.append('.'.join(['IPython',pname,'scripts'])) | |
97 | if others is not None: |
|
97 | if others is not None: | |
98 | for o in others: |
|
98 | for o in others: | |
99 | packages.append('.'.join(['IPython',pname,o])) |
|
99 | packages.append('.'.join(['IPython',pname,o])) | |
100 |
|
100 | |||
101 | def find_packages(): |
|
101 | def find_packages(): | |
102 | """ |
|
102 | """ | |
103 | Find all of IPython's packages. |
|
103 | Find all of IPython's packages. | |
104 | """ |
|
104 | """ | |
105 | packages = ['IPython'] |
|
105 | packages = ['IPython'] | |
106 | add_package(packages, 'config', tests=True, others=['default','profile']) |
|
106 | add_package(packages, 'config', tests=True, others=['default','profile']) | |
107 | add_package(packages, 'core', tests=True) |
|
107 | add_package(packages, 'core', tests=True) | |
108 | add_package(packages, 'deathrow', tests=True) |
|
108 | add_package(packages, 'deathrow', tests=True) | |
109 | add_package(packages, 'extensions') |
|
109 | add_package(packages, 'extensions') | |
110 | add_package(packages, 'external') |
|
110 | add_package(packages, 'external') | |
|
111 | add_package(packages, 'external.argparse') | |||
|
112 | add_package(packages, 'external.configobj') | |||
|
113 | add_package(packages, 'external.decorator') | |||
|
114 | add_package(packages, 'external.decorators') | |||
|
115 | add_package(packages, 'external.guid') | |||
|
116 | add_package(packages, 'external.Itpl') | |||
|
117 | add_package(packages, 'external.mglob') | |||
|
118 | add_package(packages, 'external.path') | |||
|
119 | add_package(packages, 'external.pyparsing') | |||
|
120 | add_package(packages, 'external.simplegeneric') | |||
|
121 | add_package(packages, 'external.validate') | |||
111 | add_package(packages, 'frontend') |
|
122 | add_package(packages, 'frontend') | |
112 | add_package(packages, 'frontend.qt') |
|
123 | add_package(packages, 'frontend.qt') | |
113 | add_package(packages, 'frontend.qt.console', tests=True) |
|
124 | add_package(packages, 'frontend.qt.console', tests=True) | |
114 | add_package(packages, 'frontend.terminal', tests=True) |
|
125 | add_package(packages, 'frontend.terminal', tests=True) | |
115 | add_package(packages, 'kernel', config=False, tests=True, scripts=True) |
|
126 | add_package(packages, 'kernel', config=False, tests=True, scripts=True) | |
116 | add_package(packages, 'kernel.core', config=False, tests=True) |
|
127 | add_package(packages, 'kernel.core', config=False, tests=True) | |
117 | add_package(packages, 'lib', tests=True) |
|
128 | add_package(packages, 'lib', tests=True) | |
118 | add_package(packages, 'quarantine', tests=True) |
|
129 | add_package(packages, 'quarantine', tests=True) | |
119 | add_package(packages, 'scripts') |
|
130 | add_package(packages, 'scripts') | |
120 | add_package(packages, 'testing', tests=True) |
|
131 | add_package(packages, 'testing', tests=True) | |
121 | add_package(packages, 'testing.plugin', tests=False) |
|
132 | add_package(packages, 'testing.plugin', tests=False) | |
122 | add_package(packages, 'utils', tests=True) |
|
133 | add_package(packages, 'utils', tests=True) | |
123 | add_package(packages, 'zmq') |
|
134 | add_package(packages, 'zmq') | |
124 | add_package(packages, 'zmq.pylab') |
|
135 | add_package(packages, 'zmq.pylab') | |
125 | return packages |
|
136 | return packages | |
126 |
|
137 | |||
127 | #--------------------------------------------------------------------------- |
|
138 | #--------------------------------------------------------------------------- | |
128 | # Find package data |
|
139 | # Find package data | |
129 | #--------------------------------------------------------------------------- |
|
140 | #--------------------------------------------------------------------------- | |
130 |
|
141 | |||
131 | def find_package_data(): |
|
142 | def find_package_data(): | |
132 | """ |
|
143 | """ | |
133 | Find IPython's package_data. |
|
144 | Find IPython's package_data. | |
134 | """ |
|
145 | """ | |
135 | # This is not enough for these things to appear in an sdist. |
|
146 | # This is not enough for these things to appear in an sdist. | |
136 | # We need to muck with the MANIFEST to get this to work |
|
147 | # We need to muck with the MANIFEST to get this to work | |
137 | package_data = { |
|
148 | package_data = { | |
138 | 'IPython.config.userconfig' : ['*'], |
|
149 | 'IPython.config.userconfig' : ['*'], | |
139 | 'IPython.testing' : ['*.txt'] |
|
150 | 'IPython.testing' : ['*.txt'] | |
140 | } |
|
151 | } | |
141 | return package_data |
|
152 | return package_data | |
142 |
|
153 | |||
143 |
|
154 | |||
144 | #--------------------------------------------------------------------------- |
|
155 | #--------------------------------------------------------------------------- | |
145 | # Find data files |
|
156 | # Find data files | |
146 | #--------------------------------------------------------------------------- |
|
157 | #--------------------------------------------------------------------------- | |
147 |
|
158 | |||
148 | def make_dir_struct(tag,base,out_base): |
|
159 | def make_dir_struct(tag,base,out_base): | |
149 | """Make the directory structure of all files below a starting dir. |
|
160 | """Make the directory structure of all files below a starting dir. | |
150 |
|
161 | |||
151 | This is just a convenience routine to help build a nested directory |
|
162 | This is just a convenience routine to help build a nested directory | |
152 | hierarchy because distutils is too stupid to do this by itself. |
|
163 | hierarchy because distutils is too stupid to do this by itself. | |
153 |
|
164 | |||
154 | XXX - this needs a proper docstring! |
|
165 | XXX - this needs a proper docstring! | |
155 | """ |
|
166 | """ | |
156 |
|
167 | |||
157 | # we'll use these a lot below |
|
168 | # we'll use these a lot below | |
158 | lbase = len(base) |
|
169 | lbase = len(base) | |
159 | pathsep = os.path.sep |
|
170 | pathsep = os.path.sep | |
160 | lpathsep = len(pathsep) |
|
171 | lpathsep = len(pathsep) | |
161 |
|
172 | |||
162 | out = [] |
|
173 | out = [] | |
163 | for (dirpath,dirnames,filenames) in os.walk(base): |
|
174 | for (dirpath,dirnames,filenames) in os.walk(base): | |
164 | # we need to strip out the dirpath from the base to map it to the |
|
175 | # we need to strip out the dirpath from the base to map it to the | |
165 | # output (installation) path. This requires possibly stripping the |
|
176 | # output (installation) path. This requires possibly stripping the | |
166 | # path separator, because otherwise pjoin will not work correctly |
|
177 | # path separator, because otherwise pjoin will not work correctly | |
167 | # (pjoin('foo/','/bar') returns '/bar'). |
|
178 | # (pjoin('foo/','/bar') returns '/bar'). | |
168 |
|
179 | |||
169 | dp_eff = dirpath[lbase:] |
|
180 | dp_eff = dirpath[lbase:] | |
170 | if dp_eff.startswith(pathsep): |
|
181 | if dp_eff.startswith(pathsep): | |
171 | dp_eff = dp_eff[lpathsep:] |
|
182 | dp_eff = dp_eff[lpathsep:] | |
172 | # The output path must be anchored at the out_base marker |
|
183 | # The output path must be anchored at the out_base marker | |
173 | out_path = pjoin(out_base,dp_eff) |
|
184 | out_path = pjoin(out_base,dp_eff) | |
174 | # Now we can generate the final filenames. Since os.walk only produces |
|
185 | # Now we can generate the final filenames. Since os.walk only produces | |
175 | # filenames, we must join back with the dirpath to get full valid file |
|
186 | # filenames, we must join back with the dirpath to get full valid file | |
176 | # paths: |
|
187 | # paths: | |
177 | pfiles = [pjoin(dirpath,f) for f in filenames] |
|
188 | pfiles = [pjoin(dirpath,f) for f in filenames] | |
178 | # Finally, generate the entry we need, which is a pari of (output |
|
189 | # Finally, generate the entry we need, which is a pari of (output | |
179 | # path, files) for use as a data_files parameter in install_data. |
|
190 | # path, files) for use as a data_files parameter in install_data. | |
180 | out.append((out_path, pfiles)) |
|
191 | out.append((out_path, pfiles)) | |
181 |
|
192 | |||
182 | return out |
|
193 | return out | |
183 |
|
194 | |||
184 |
|
195 | |||
185 | def find_data_files(): |
|
196 | def find_data_files(): | |
186 | """ |
|
197 | """ | |
187 | Find IPython's data_files. |
|
198 | Find IPython's data_files. | |
188 |
|
199 | |||
189 | Most of these are docs. |
|
200 | Most of these are docs. | |
190 | """ |
|
201 | """ | |
191 |
|
202 | |||
192 | docdirbase = pjoin('share', 'doc', 'ipython') |
|
203 | docdirbase = pjoin('share', 'doc', 'ipython') | |
193 | manpagebase = pjoin('share', 'man', 'man1') |
|
204 | manpagebase = pjoin('share', 'man', 'man1') | |
194 |
|
205 | |||
195 | # Simple file lists can be made by hand |
|
206 | # Simple file lists can be made by hand | |
196 | manpages = filter(isfile, glob(pjoin('docs','man','*.1.gz'))) |
|
207 | manpages = filter(isfile, glob(pjoin('docs','man','*.1.gz'))) | |
197 | igridhelpfiles = filter(isfile, |
|
208 | igridhelpfiles = filter(isfile, | |
198 | glob(pjoin('IPython','extensions','igrid_help.*'))) |
|
209 | glob(pjoin('IPython','extensions','igrid_help.*'))) | |
199 |
|
210 | |||
200 | # For nested structures, use the utility above |
|
211 | # For nested structures, use the utility above | |
201 | example_files = make_dir_struct( |
|
212 | example_files = make_dir_struct( | |
202 | 'data', |
|
213 | 'data', | |
203 | pjoin('docs','examples'), |
|
214 | pjoin('docs','examples'), | |
204 | pjoin(docdirbase,'examples') |
|
215 | pjoin(docdirbase,'examples') | |
205 | ) |
|
216 | ) | |
206 | manual_files = make_dir_struct( |
|
217 | manual_files = make_dir_struct( | |
207 | 'data', |
|
218 | 'data', | |
208 | pjoin('docs','dist'), |
|
219 | pjoin('docs','dist'), | |
209 | pjoin(docdirbase,'manual') |
|
220 | pjoin(docdirbase,'manual') | |
210 | ) |
|
221 | ) | |
211 |
|
222 | |||
212 | # And assemble the entire output list |
|
223 | # And assemble the entire output list | |
213 | data_files = [ (manpagebase, manpages), |
|
224 | data_files = [ (manpagebase, manpages), | |
214 | (pjoin(docdirbase, 'extensions'), igridhelpfiles), |
|
225 | (pjoin(docdirbase, 'extensions'), igridhelpfiles), | |
215 | ] + manual_files + example_files |
|
226 | ] + manual_files + example_files | |
216 |
|
227 | |||
217 | return data_files |
|
228 | return data_files | |
218 |
|
229 | |||
219 |
|
230 | |||
220 | def make_man_update_target(manpage): |
|
231 | def make_man_update_target(manpage): | |
221 | """Return a target_update-compliant tuple for the given manpage. |
|
232 | """Return a target_update-compliant tuple for the given manpage. | |
222 |
|
233 | |||
223 | Parameters |
|
234 | Parameters | |
224 | ---------- |
|
235 | ---------- | |
225 | manpage : string |
|
236 | manpage : string | |
226 | Name of the manpage, must include the section number (trailing number). |
|
237 | Name of the manpage, must include the section number (trailing number). | |
227 |
|
238 | |||
228 | Example |
|
239 | Example | |
229 | ------- |
|
240 | ------- | |
230 |
|
241 | |||
231 | >>> make_man_update_target('ipython.1') #doctest: +NORMALIZE_WHITESPACE |
|
242 | >>> make_man_update_target('ipython.1') #doctest: +NORMALIZE_WHITESPACE | |
232 | ('docs/man/ipython.1.gz', |
|
243 | ('docs/man/ipython.1.gz', | |
233 | ['docs/man/ipython.1'], |
|
244 | ['docs/man/ipython.1'], | |
234 | 'cd docs/man && gzip -9c ipython.1 > ipython.1.gz') |
|
245 | 'cd docs/man && gzip -9c ipython.1 > ipython.1.gz') | |
235 | """ |
|
246 | """ | |
236 | man_dir = pjoin('docs', 'man') |
|
247 | man_dir = pjoin('docs', 'man') | |
237 | manpage_gz = manpage + '.gz' |
|
248 | manpage_gz = manpage + '.gz' | |
238 | manpath = pjoin(man_dir, manpage) |
|
249 | manpath = pjoin(man_dir, manpage) | |
239 | manpath_gz = pjoin(man_dir, manpage_gz) |
|
250 | manpath_gz = pjoin(man_dir, manpage_gz) | |
240 | gz_cmd = ( "cd %(man_dir)s && gzip -9c %(manpage)s > %(manpage_gz)s" % |
|
251 | gz_cmd = ( "cd %(man_dir)s && gzip -9c %(manpage)s > %(manpage_gz)s" % | |
241 | locals() ) |
|
252 | locals() ) | |
242 | return (manpath_gz, [manpath], gz_cmd) |
|
253 | return (manpath_gz, [manpath], gz_cmd) | |
243 |
|
254 | |||
244 | #--------------------------------------------------------------------------- |
|
255 | #--------------------------------------------------------------------------- | |
245 | # Find scripts |
|
256 | # Find scripts | |
246 | #--------------------------------------------------------------------------- |
|
257 | #--------------------------------------------------------------------------- | |
247 |
|
258 | |||
248 | def find_scripts(): |
|
259 | def find_scripts(): | |
249 | """ |
|
260 | """ | |
250 | Find IPython's scripts. |
|
261 | Find IPython's scripts. | |
251 | """ |
|
262 | """ | |
252 | kernel_scripts = pjoin('IPython','kernel','scripts') |
|
263 | kernel_scripts = pjoin('IPython','kernel','scripts') | |
253 | main_scripts = pjoin('IPython','scripts') |
|
264 | main_scripts = pjoin('IPython','scripts') | |
254 | scripts = [pjoin(kernel_scripts, 'ipengine'), |
|
265 | scripts = [pjoin(kernel_scripts, 'ipengine'), | |
255 | pjoin(kernel_scripts, 'ipcontroller'), |
|
266 | pjoin(kernel_scripts, 'ipcontroller'), | |
256 | pjoin(kernel_scripts, 'ipcluster'), |
|
267 | pjoin(kernel_scripts, 'ipcluster'), | |
257 | pjoin(main_scripts, 'ipython'), |
|
268 | pjoin(main_scripts, 'ipython'), | |
258 | pjoin(main_scripts, 'ipython-qtconsole'), |
|
269 | pjoin(main_scripts, 'ipython-qtconsole'), | |
259 | pjoin(main_scripts, 'pycolor'), |
|
270 | pjoin(main_scripts, 'pycolor'), | |
260 | pjoin(main_scripts, 'irunner'), |
|
271 | pjoin(main_scripts, 'irunner'), | |
261 | pjoin(main_scripts, 'iptest') |
|
272 | pjoin(main_scripts, 'iptest') | |
262 | ] |
|
273 | ] | |
263 |
|
274 | |||
264 | # Script to be run by the windows binary installer after the default setup |
|
275 | # Script to be run by the windows binary installer after the default setup | |
265 | # routine, to add shortcuts and similar windows-only things. Windows |
|
276 | # routine, to add shortcuts and similar windows-only things. Windows | |
266 | # post-install scripts MUST reside in the scripts/ dir, otherwise distutils |
|
277 | # post-install scripts MUST reside in the scripts/ dir, otherwise distutils | |
267 | # doesn't find them. |
|
278 | # doesn't find them. | |
268 | if 'bdist_wininst' in sys.argv: |
|
279 | if 'bdist_wininst' in sys.argv: | |
269 | if len(sys.argv) > 2 and \ |
|
280 | if len(sys.argv) > 2 and \ | |
270 | ('sdist' in sys.argv or 'bdist_rpm' in sys.argv): |
|
281 | ('sdist' in sys.argv or 'bdist_rpm' in sys.argv): | |
271 | print("ERROR: bdist_wininst must be run alone. Exiting.", |
|
282 | print("ERROR: bdist_wininst must be run alone. Exiting.", | |
272 | file=sys.stderr) |
|
283 | file=sys.stderr) | |
273 | sys.exit(1) |
|
284 | sys.exit(1) | |
274 | scripts.append(pjoin('scripts','ipython_win_post_install.py')) |
|
285 | scripts.append(pjoin('scripts','ipython_win_post_install.py')) | |
275 |
|
286 | |||
276 | return scripts |
|
287 | return scripts | |
277 |
|
288 | |||
278 | #--------------------------------------------------------------------------- |
|
289 | #--------------------------------------------------------------------------- | |
279 | # Verify all dependencies |
|
290 | # Verify all dependencies | |
280 | #--------------------------------------------------------------------------- |
|
291 | #--------------------------------------------------------------------------- | |
281 |
|
292 | |||
282 | def check_for_dependencies(): |
|
293 | def check_for_dependencies(): | |
283 | """Check for IPython's dependencies. |
|
294 | """Check for IPython's dependencies. | |
284 |
|
295 | |||
285 | This function should NOT be called if running under setuptools! |
|
296 | This function should NOT be called if running under setuptools! | |
286 | """ |
|
297 | """ | |
287 | from setupext.setupext import ( |
|
298 | from setupext.setupext import ( | |
288 | print_line, print_raw, print_status, |
|
299 | print_line, print_raw, print_status, | |
289 | check_for_zopeinterface, check_for_twisted, |
|
300 | check_for_zopeinterface, check_for_twisted, | |
290 | check_for_foolscap, check_for_pyopenssl, |
|
301 | check_for_foolscap, check_for_pyopenssl, | |
291 | check_for_sphinx, check_for_pygments, |
|
302 | check_for_sphinx, check_for_pygments, | |
292 | check_for_nose, check_for_pexpect |
|
303 | check_for_nose, check_for_pexpect | |
293 | ) |
|
304 | ) | |
294 | print_line() |
|
305 | print_line() | |
295 | print_raw("BUILDING IPYTHON") |
|
306 | print_raw("BUILDING IPYTHON") | |
296 | print_status('python', sys.version) |
|
307 | print_status('python', sys.version) | |
297 | print_status('platform', sys.platform) |
|
308 | print_status('platform', sys.platform) | |
298 | if sys.platform == 'win32': |
|
309 | if sys.platform == 'win32': | |
299 | print_status('Windows version', sys.getwindowsversion()) |
|
310 | print_status('Windows version', sys.getwindowsversion()) | |
300 |
|
311 | |||
301 | print_raw("") |
|
312 | print_raw("") | |
302 | print_raw("OPTIONAL DEPENDENCIES") |
|
313 | print_raw("OPTIONAL DEPENDENCIES") | |
303 |
|
314 | |||
304 | check_for_zopeinterface() |
|
315 | check_for_zopeinterface() | |
305 | check_for_twisted() |
|
316 | check_for_twisted() | |
306 | check_for_foolscap() |
|
317 | check_for_foolscap() | |
307 | check_for_pyopenssl() |
|
318 | check_for_pyopenssl() | |
308 | check_for_sphinx() |
|
319 | check_for_sphinx() | |
309 | check_for_pygments() |
|
320 | check_for_pygments() | |
310 | check_for_nose() |
|
321 | check_for_nose() | |
311 | check_for_pexpect() |
|
322 | check_for_pexpect() | |
312 |
|
323 | |||
313 |
|
324 | |||
314 | def record_commit_info(pkg_dir, build_cmd=build_py): |
|
325 | def record_commit_info(pkg_dir, build_cmd=build_py): | |
315 | """ Return extended build command class for recording commit |
|
326 | """ Return extended build command class for recording commit | |
316 |
|
327 | |||
317 | The extended command tries to run git to find the current commit, getting |
|
328 | The extended command tries to run git to find the current commit, getting | |
318 | the empty string if it fails. It then writes the commit hash into a file |
|
329 | the empty string if it fails. It then writes the commit hash into a file | |
319 | in the `pkg_dir` path, named ``.git_commit_info.ini``. |
|
330 | in the `pkg_dir` path, named ``.git_commit_info.ini``. | |
320 |
|
331 | |||
321 | In due course this information can be used by the package after it is |
|
332 | In due course this information can be used by the package after it is | |
322 | installed, to tell you what commit it was installed from if known. |
|
333 | installed, to tell you what commit it was installed from if known. | |
323 |
|
334 | |||
324 | To make use of this system, you need a package with a .git_commit_info.ini |
|
335 | To make use of this system, you need a package with a .git_commit_info.ini | |
325 | file - e.g. ``myproject/.git_commit_info.ini`` - that might well look like |
|
336 | file - e.g. ``myproject/.git_commit_info.ini`` - that might well look like | |
326 | this:: |
|
337 | this:: | |
327 |
|
338 | |||
328 | # This is an ini file that may contain information about the code state |
|
339 | # This is an ini file that may contain information about the code state | |
329 | [commit hash] |
|
340 | [commit hash] | |
330 | # The line below may contain a valid hash if it has been substituted |
|
341 | # The line below may contain a valid hash if it has been substituted | |
331 | # during 'git archive' |
|
342 | # during 'git archive' | |
332 | archive_subst_hash=$Format:%h$ |
|
343 | archive_subst_hash=$Format:%h$ | |
333 | # This line may be modified by the install process |
|
344 | # This line may be modified by the install process | |
334 | install_hash= |
|
345 | install_hash= | |
335 |
|
346 | |||
336 | The .git_commit_info file above is also designed to be used with git |
|
347 | The .git_commit_info file above is also designed to be used with git | |
337 | substitution - so you probably also want a ``.gitattributes`` file in the |
|
348 | substitution - so you probably also want a ``.gitattributes`` file in the | |
338 | root directory of your working tree that contains something like this:: |
|
349 | root directory of your working tree that contains something like this:: | |
339 |
|
350 | |||
340 | myproject/.git_commit_info.ini export-subst |
|
351 | myproject/.git_commit_info.ini export-subst | |
341 |
|
352 | |||
342 | That will cause the ``.git_commit_info.ini`` file to get filled in by ``git |
|
353 | That will cause the ``.git_commit_info.ini`` file to get filled in by ``git | |
343 | archive`` - useful in case someone makes such an archive - for example with |
|
354 | archive`` - useful in case someone makes such an archive - for example with | |
344 | via the github 'download source' button. |
|
355 | via the github 'download source' button. | |
345 |
|
356 | |||
346 | Although all the above will work as is, you might consider having something |
|
357 | Although all the above will work as is, you might consider having something | |
347 | like a ``get_info()`` function in your package to display the commit |
|
358 | like a ``get_info()`` function in your package to display the commit | |
348 | information at the terminal. See the ``pkg_info.py`` module in the nipy |
|
359 | information at the terminal. See the ``pkg_info.py`` module in the nipy | |
349 | package for an example. |
|
360 | package for an example. | |
350 | """ |
|
361 | """ | |
351 | class MyBuildPy(build_cmd): |
|
362 | class MyBuildPy(build_cmd): | |
352 | ''' Subclass to write commit data into installation tree ''' |
|
363 | ''' Subclass to write commit data into installation tree ''' | |
353 | def run(self): |
|
364 | def run(self): | |
354 | build_py.run(self) |
|
365 | build_py.run(self) | |
355 | import subprocess |
|
366 | import subprocess | |
356 | proc = subprocess.Popen('git rev-parse --short HEAD', |
|
367 | proc = subprocess.Popen('git rev-parse --short HEAD', | |
357 | stdout=subprocess.PIPE, |
|
368 | stdout=subprocess.PIPE, | |
358 | stderr=subprocess.PIPE, |
|
369 | stderr=subprocess.PIPE, | |
359 | shell=True) |
|
370 | shell=True) | |
360 | repo_commit, _ = proc.communicate() |
|
371 | repo_commit, _ = proc.communicate() | |
361 | # We write the installation commit even if it's empty |
|
372 | # We write the installation commit even if it's empty | |
362 | cfg_parser = ConfigParser() |
|
373 | cfg_parser = ConfigParser() | |
363 | cfg_parser.read(pjoin(pkg_dir, '.git_commit_info.ini')) |
|
374 | cfg_parser.read(pjoin(pkg_dir, '.git_commit_info.ini')) | |
364 | cfg_parser.set('commit hash', 'install_hash', repo_commit) |
|
375 | cfg_parser.set('commit hash', 'install_hash', repo_commit) | |
365 | out_pth = pjoin(self.build_lib, pkg_dir, '.git_commit_info.ini') |
|
376 | out_pth = pjoin(self.build_lib, pkg_dir, '.git_commit_info.ini') | |
366 | out_file = open(out_pth, 'wt') |
|
377 | out_file = open(out_pth, 'wt') | |
367 | cfg_parser.write(out_file) |
|
378 | cfg_parser.write(out_file) | |
368 | out_file.close() |
|
379 | out_file.close() | |
369 | return MyBuildPy |
|
380 | return MyBuildPy |
General Comments 0
You need to be logged in to leave comments.
Login now