Show More
@@ -1,620 +1,620 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Display formatters. |
|
2 | """Display formatters. | |
3 |
|
3 | |||
4 |
|
4 | |||
5 | Authors: |
|
5 | Authors: | |
6 |
|
6 | |||
7 | * Robert Kern |
|
7 | * Robert Kern | |
8 | * Brian Granger |
|
8 | * Brian Granger | |
9 | """ |
|
9 | """ | |
10 | #----------------------------------------------------------------------------- |
|
10 | #----------------------------------------------------------------------------- | |
11 | # Copyright (c) 2010, IPython Development Team. |
|
11 | # Copyright (c) 2010, IPython Development Team. | |
12 | # |
|
12 | # | |
13 | # Distributed under the terms of the Modified BSD License. |
|
13 | # Distributed under the terms of the Modified BSD License. | |
14 | # |
|
14 | # | |
15 | # The full license is in the file COPYING.txt, distributed with this software. |
|
15 | # The full license is in the file COPYING.txt, distributed with this software. | |
16 | #----------------------------------------------------------------------------- |
|
16 | #----------------------------------------------------------------------------- | |
17 |
|
17 | |||
18 | #----------------------------------------------------------------------------- |
|
18 | #----------------------------------------------------------------------------- | |
19 | # Imports |
|
19 | # Imports | |
20 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
21 |
|
21 | |||
22 | # Stdlib imports |
|
22 | # Stdlib imports | |
23 | import abc |
|
23 | import abc | |
24 | import sys |
|
24 | import sys | |
25 | # We must use StringIO, as cStringIO doesn't handle unicode properly. |
|
25 | # We must use StringIO, as cStringIO doesn't handle unicode properly. | |
26 | from StringIO import StringIO |
|
26 | from StringIO import StringIO | |
27 |
|
27 | |||
28 | # Our own imports |
|
28 | # Our own imports | |
29 | from IPython.config.configurable import Configurable |
|
29 | from IPython.config.configurable import Configurable | |
30 | from IPython.lib import pretty |
|
30 | from IPython.lib import pretty | |
31 | from IPython.utils.traitlets import Bool, Dict, Int, Unicode, CUnicode, ObjectName |
|
31 | from IPython.utils.traitlets import Bool, Dict, Int, Unicode, CUnicode, ObjectName | |
32 | from IPython.utils.py3compat import unicode_to_str |
|
32 | from IPython.utils.py3compat import unicode_to_str | |
33 |
|
33 | |||
34 |
|
34 | |||
35 | #----------------------------------------------------------------------------- |
|
35 | #----------------------------------------------------------------------------- | |
36 | # The main DisplayFormatter class |
|
36 | # The main DisplayFormatter class | |
37 | #----------------------------------------------------------------------------- |
|
37 | #----------------------------------------------------------------------------- | |
38 |
|
38 | |||
39 |
|
39 | |||
40 | class DisplayFormatter(Configurable): |
|
40 | class DisplayFormatter(Configurable): | |
41 |
|
41 | |||
42 | # When set to true only the default plain text formatter will be used. |
|
42 | # When set to true only the default plain text formatter will be used. | |
43 | plain_text_only = Bool(False, config=True) |
|
43 | plain_text_only = Bool(False, config=True) | |
44 |
|
44 | |||
45 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
45 | # A dict of formatter whose keys are format types (MIME types) and whose | |
46 | # values are subclasses of BaseFormatter. |
|
46 | # values are subclasses of BaseFormatter. | |
47 |
formatters = Dict( |
|
47 | formatters = Dict() | |
48 | def _formatters_default(self): |
|
48 | def _formatters_default(self): | |
49 | """Activate the default formatters.""" |
|
49 | """Activate the default formatters.""" | |
50 | formatter_classes = [ |
|
50 | formatter_classes = [ | |
51 | PlainTextFormatter, |
|
51 | PlainTextFormatter, | |
52 | HTMLFormatter, |
|
52 | HTMLFormatter, | |
53 | SVGFormatter, |
|
53 | SVGFormatter, | |
54 | PNGFormatter, |
|
54 | PNGFormatter, | |
55 | JPEGFormatter, |
|
55 | JPEGFormatter, | |
56 | LatexFormatter, |
|
56 | LatexFormatter, | |
57 | JSONFormatter, |
|
57 | JSONFormatter, | |
58 | JavascriptFormatter |
|
58 | JavascriptFormatter | |
59 | ] |
|
59 | ] | |
60 | d = {} |
|
60 | d = {} | |
61 | for cls in formatter_classes: |
|
61 | for cls in formatter_classes: | |
62 | f = cls(config=self.config) |
|
62 | f = cls(config=self.config) | |
63 | d[f.format_type] = f |
|
63 | d[f.format_type] = f | |
64 | return d |
|
64 | return d | |
65 |
|
65 | |||
66 | def format(self, obj, include=None, exclude=None): |
|
66 | def format(self, obj, include=None, exclude=None): | |
67 | """Return a format data dict for an object. |
|
67 | """Return a format data dict for an object. | |
68 |
|
68 | |||
69 | By default all format types will be computed. |
|
69 | By default all format types will be computed. | |
70 |
|
70 | |||
71 | The following MIME types are currently implemented: |
|
71 | The following MIME types are currently implemented: | |
72 |
|
72 | |||
73 | * text/plain |
|
73 | * text/plain | |
74 | * text/html |
|
74 | * text/html | |
75 | * text/latex |
|
75 | * text/latex | |
76 | * application/json |
|
76 | * application/json | |
77 | * application/javascript |
|
77 | * application/javascript | |
78 | * image/png |
|
78 | * image/png | |
79 | * image/jpeg |
|
79 | * image/jpeg | |
80 | * image/svg+xml |
|
80 | * image/svg+xml | |
81 |
|
81 | |||
82 | Parameters |
|
82 | Parameters | |
83 | ---------- |
|
83 | ---------- | |
84 | obj : object |
|
84 | obj : object | |
85 | The Python object whose format data will be computed. |
|
85 | The Python object whose format data will be computed. | |
86 | include : list or tuple, optional |
|
86 | include : list or tuple, optional | |
87 | A list of format type strings (MIME types) to include in the |
|
87 | A list of format type strings (MIME types) to include in the | |
88 | format data dict. If this is set *only* the format types included |
|
88 | format data dict. If this is set *only* the format types included | |
89 | in this list will be computed. |
|
89 | in this list will be computed. | |
90 | exclude : list or tuple, optional |
|
90 | exclude : list or tuple, optional | |
91 | A list of format type string (MIME types) to exclue in the format |
|
91 | A list of format type string (MIME types) to exclue in the format | |
92 | data dict. If this is set all format types will be computed, |
|
92 | data dict. If this is set all format types will be computed, | |
93 | except for those included in this argument. |
|
93 | except for those included in this argument. | |
94 |
|
94 | |||
95 | Returns |
|
95 | Returns | |
96 | ------- |
|
96 | ------- | |
97 | format_dict : dict |
|
97 | format_dict : dict | |
98 | A dictionary of key/value pairs, one or each format that was |
|
98 | A dictionary of key/value pairs, one or each format that was | |
99 | generated for the object. The keys are the format types, which |
|
99 | generated for the object. The keys are the format types, which | |
100 | will usually be MIME type strings and the values and JSON'able |
|
100 | will usually be MIME type strings and the values and JSON'able | |
101 | data structure containing the raw data for the representation in |
|
101 | data structure containing the raw data for the representation in | |
102 | that format. |
|
102 | that format. | |
103 | """ |
|
103 | """ | |
104 | format_dict = {} |
|
104 | format_dict = {} | |
105 |
|
105 | |||
106 | # If plain text only is active |
|
106 | # If plain text only is active | |
107 | if self.plain_text_only: |
|
107 | if self.plain_text_only: | |
108 | formatter = self.formatters['text/plain'] |
|
108 | formatter = self.formatters['text/plain'] | |
109 | try: |
|
109 | try: | |
110 | data = formatter(obj) |
|
110 | data = formatter(obj) | |
111 | except: |
|
111 | except: | |
112 | # FIXME: log the exception |
|
112 | # FIXME: log the exception | |
113 | raise |
|
113 | raise | |
114 | if data is not None: |
|
114 | if data is not None: | |
115 | format_dict['text/plain'] = data |
|
115 | format_dict['text/plain'] = data | |
116 | return format_dict |
|
116 | return format_dict | |
117 |
|
117 | |||
118 | for format_type, formatter in self.formatters.items(): |
|
118 | for format_type, formatter in self.formatters.items(): | |
119 | if include is not None: |
|
119 | if include is not None: | |
120 | if format_type not in include: |
|
120 | if format_type not in include: | |
121 | continue |
|
121 | continue | |
122 | if exclude is not None: |
|
122 | if exclude is not None: | |
123 | if format_type in exclude: |
|
123 | if format_type in exclude: | |
124 | continue |
|
124 | continue | |
125 | try: |
|
125 | try: | |
126 | data = formatter(obj) |
|
126 | data = formatter(obj) | |
127 | except: |
|
127 | except: | |
128 | # FIXME: log the exception |
|
128 | # FIXME: log the exception | |
129 | raise |
|
129 | raise | |
130 | if data is not None: |
|
130 | if data is not None: | |
131 | format_dict[format_type] = data |
|
131 | format_dict[format_type] = data | |
132 | return format_dict |
|
132 | return format_dict | |
133 |
|
133 | |||
134 | @property |
|
134 | @property | |
135 | def format_types(self): |
|
135 | def format_types(self): | |
136 | """Return the format types (MIME types) of the active formatters.""" |
|
136 | """Return the format types (MIME types) of the active formatters.""" | |
137 | return self.formatters.keys() |
|
137 | return self.formatters.keys() | |
138 |
|
138 | |||
139 |
|
139 | |||
140 | #----------------------------------------------------------------------------- |
|
140 | #----------------------------------------------------------------------------- | |
141 | # Formatters for specific format types (text, html, svg, etc.) |
|
141 | # Formatters for specific format types (text, html, svg, etc.) | |
142 | #----------------------------------------------------------------------------- |
|
142 | #----------------------------------------------------------------------------- | |
143 |
|
143 | |||
144 |
|
144 | |||
145 | class FormatterABC(object): |
|
145 | class FormatterABC(object): | |
146 | """ Abstract base class for Formatters. |
|
146 | """ Abstract base class for Formatters. | |
147 |
|
147 | |||
148 | A formatter is a callable class that is responsible for computing the |
|
148 | A formatter is a callable class that is responsible for computing the | |
149 | raw format data for a particular format type (MIME type). For example, |
|
149 | raw format data for a particular format type (MIME type). For example, | |
150 | an HTML formatter would have a format type of `text/html` and would return |
|
150 | an HTML formatter would have a format type of `text/html` and would return | |
151 | the HTML representation of the object when called. |
|
151 | the HTML representation of the object when called. | |
152 | """ |
|
152 | """ | |
153 | __metaclass__ = abc.ABCMeta |
|
153 | __metaclass__ = abc.ABCMeta | |
154 |
|
154 | |||
155 | # The format type of the data returned, usually a MIME type. |
|
155 | # The format type of the data returned, usually a MIME type. | |
156 | format_type = 'text/plain' |
|
156 | format_type = 'text/plain' | |
157 |
|
157 | |||
158 | # Is the formatter enabled... |
|
158 | # Is the formatter enabled... | |
159 | enabled = True |
|
159 | enabled = True | |
160 |
|
160 | |||
161 | @abc.abstractmethod |
|
161 | @abc.abstractmethod | |
162 | def __call__(self, obj): |
|
162 | def __call__(self, obj): | |
163 | """Return a JSON'able representation of the object. |
|
163 | """Return a JSON'able representation of the object. | |
164 |
|
164 | |||
165 | If the object cannot be formatted by this formatter, then return None |
|
165 | If the object cannot be formatted by this formatter, then return None | |
166 | """ |
|
166 | """ | |
167 | try: |
|
167 | try: | |
168 | return repr(obj) |
|
168 | return repr(obj) | |
169 | except TypeError: |
|
169 | except TypeError: | |
170 | return None |
|
170 | return None | |
171 |
|
171 | |||
172 |
|
172 | |||
173 | class BaseFormatter(Configurable): |
|
173 | class BaseFormatter(Configurable): | |
174 | """A base formatter class that is configurable. |
|
174 | """A base formatter class that is configurable. | |
175 |
|
175 | |||
176 | This formatter should usually be used as the base class of all formatters. |
|
176 | This formatter should usually be used as the base class of all formatters. | |
177 | It is a traited :class:`Configurable` class and includes an extensible |
|
177 | It is a traited :class:`Configurable` class and includes an extensible | |
178 | API for users to determine how their objects are formatted. The following |
|
178 | API for users to determine how their objects are formatted. The following | |
179 | logic is used to find a function to format an given object. |
|
179 | logic is used to find a function to format an given object. | |
180 |
|
180 | |||
181 | 1. The object is introspected to see if it has a method with the name |
|
181 | 1. The object is introspected to see if it has a method with the name | |
182 | :attr:`print_method`. If is does, that object is passed to that method |
|
182 | :attr:`print_method`. If is does, that object is passed to that method | |
183 | for formatting. |
|
183 | for formatting. | |
184 | 2. If no print method is found, three internal dictionaries are consulted |
|
184 | 2. If no print method is found, three internal dictionaries are consulted | |
185 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
185 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` | |
186 | and :attr:`deferred_printers`. |
|
186 | and :attr:`deferred_printers`. | |
187 |
|
187 | |||
188 | Users should use these dictionaries to register functions that will be |
|
188 | Users should use these dictionaries to register functions that will be | |
189 | used to compute the format data for their objects (if those objects don't |
|
189 | used to compute the format data for their objects (if those objects don't | |
190 | have the special print methods). The easiest way of using these |
|
190 | have the special print methods). The easiest way of using these | |
191 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
191 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` | |
192 | methods. |
|
192 | methods. | |
193 |
|
193 | |||
194 | If no function/callable is found to compute the format data, ``None`` is |
|
194 | If no function/callable is found to compute the format data, ``None`` is | |
195 | returned and this format type is not used. |
|
195 | returned and this format type is not used. | |
196 | """ |
|
196 | """ | |
197 |
|
197 | |||
198 | format_type = Unicode('text/plain') |
|
198 | format_type = Unicode('text/plain') | |
199 |
|
199 | |||
200 | enabled = Bool(True, config=True) |
|
200 | enabled = Bool(True, config=True) | |
201 |
|
201 | |||
202 | print_method = ObjectName('__repr__') |
|
202 | print_method = ObjectName('__repr__') | |
203 |
|
203 | |||
204 | # The singleton printers. |
|
204 | # The singleton printers. | |
205 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
205 | # Maps the IDs of the builtin singleton objects to the format functions. | |
206 | singleton_printers = Dict(config=True) |
|
206 | singleton_printers = Dict(config=True) | |
207 | def _singleton_printers_default(self): |
|
207 | def _singleton_printers_default(self): | |
208 | return {} |
|
208 | return {} | |
209 |
|
209 | |||
210 | # The type-specific printers. |
|
210 | # The type-specific printers. | |
211 | # Map type objects to the format functions. |
|
211 | # Map type objects to the format functions. | |
212 | type_printers = Dict(config=True) |
|
212 | type_printers = Dict(config=True) | |
213 | def _type_printers_default(self): |
|
213 | def _type_printers_default(self): | |
214 | return {} |
|
214 | return {} | |
215 |
|
215 | |||
216 | # The deferred-import type-specific printers. |
|
216 | # The deferred-import type-specific printers. | |
217 | # Map (modulename, classname) pairs to the format functions. |
|
217 | # Map (modulename, classname) pairs to the format functions. | |
218 | deferred_printers = Dict(config=True) |
|
218 | deferred_printers = Dict(config=True) | |
219 | def _deferred_printers_default(self): |
|
219 | def _deferred_printers_default(self): | |
220 | return {} |
|
220 | return {} | |
221 |
|
221 | |||
222 | def __call__(self, obj): |
|
222 | def __call__(self, obj): | |
223 | """Compute the format for an object.""" |
|
223 | """Compute the format for an object.""" | |
224 | if self.enabled: |
|
224 | if self.enabled: | |
225 | obj_id = id(obj) |
|
225 | obj_id = id(obj) | |
226 | try: |
|
226 | try: | |
227 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
227 | obj_class = getattr(obj, '__class__', None) or type(obj) | |
228 | # First try to find registered singleton printers for the type. |
|
228 | # First try to find registered singleton printers for the type. | |
229 | try: |
|
229 | try: | |
230 | printer = self.singleton_printers[obj_id] |
|
230 | printer = self.singleton_printers[obj_id] | |
231 | except (TypeError, KeyError): |
|
231 | except (TypeError, KeyError): | |
232 | pass |
|
232 | pass | |
233 | else: |
|
233 | else: | |
234 | return printer(obj) |
|
234 | return printer(obj) | |
235 | # Next look for type_printers. |
|
235 | # Next look for type_printers. | |
236 | for cls in pretty._get_mro(obj_class): |
|
236 | for cls in pretty._get_mro(obj_class): | |
237 | if cls in self.type_printers: |
|
237 | if cls in self.type_printers: | |
238 | return self.type_printers[cls](obj) |
|
238 | return self.type_printers[cls](obj) | |
239 | else: |
|
239 | else: | |
240 | printer = self._in_deferred_types(cls) |
|
240 | printer = self._in_deferred_types(cls) | |
241 | if printer is not None: |
|
241 | if printer is not None: | |
242 | return printer(obj) |
|
242 | return printer(obj) | |
243 | # Finally look for special method names. |
|
243 | # Finally look for special method names. | |
244 | if hasattr(obj_class, self.print_method): |
|
244 | if hasattr(obj_class, self.print_method): | |
245 | printer = getattr(obj_class, self.print_method) |
|
245 | printer = getattr(obj_class, self.print_method) | |
246 | return printer(obj) |
|
246 | return printer(obj) | |
247 | return None |
|
247 | return None | |
248 | except Exception: |
|
248 | except Exception: | |
249 | pass |
|
249 | pass | |
250 | else: |
|
250 | else: | |
251 | return None |
|
251 | return None | |
252 |
|
252 | |||
253 | def for_type(self, typ, func): |
|
253 | def for_type(self, typ, func): | |
254 | """Add a format function for a given type. |
|
254 | """Add a format function for a given type. | |
255 |
|
255 | |||
256 | Parameters |
|
256 | Parameters | |
257 | ----------- |
|
257 | ----------- | |
258 | typ : class |
|
258 | typ : class | |
259 | The class of the object that will be formatted using `func`. |
|
259 | The class of the object that will be formatted using `func`. | |
260 | func : callable |
|
260 | func : callable | |
261 | The callable that will be called to compute the format data. The |
|
261 | The callable that will be called to compute the format data. The | |
262 | call signature of this function is simple, it must take the |
|
262 | call signature of this function is simple, it must take the | |
263 | object to be formatted and return the raw data for the given |
|
263 | object to be formatted and return the raw data for the given | |
264 | format. Subclasses may use a different call signature for the |
|
264 | format. Subclasses may use a different call signature for the | |
265 | `func` argument. |
|
265 | `func` argument. | |
266 | """ |
|
266 | """ | |
267 | oldfunc = self.type_printers.get(typ, None) |
|
267 | oldfunc = self.type_printers.get(typ, None) | |
268 | if func is not None: |
|
268 | if func is not None: | |
269 | # To support easy restoration of old printers, we need to ignore |
|
269 | # To support easy restoration of old printers, we need to ignore | |
270 | # Nones. |
|
270 | # Nones. | |
271 | self.type_printers[typ] = func |
|
271 | self.type_printers[typ] = func | |
272 | return oldfunc |
|
272 | return oldfunc | |
273 |
|
273 | |||
274 | def for_type_by_name(self, type_module, type_name, func): |
|
274 | def for_type_by_name(self, type_module, type_name, func): | |
275 | """Add a format function for a type specified by the full dotted |
|
275 | """Add a format function for a type specified by the full dotted | |
276 | module and name of the type, rather than the type of the object. |
|
276 | module and name of the type, rather than the type of the object. | |
277 |
|
277 | |||
278 | Parameters |
|
278 | Parameters | |
279 | ---------- |
|
279 | ---------- | |
280 | type_module : str |
|
280 | type_module : str | |
281 | The full dotted name of the module the type is defined in, like |
|
281 | The full dotted name of the module the type is defined in, like | |
282 | ``numpy``. |
|
282 | ``numpy``. | |
283 | type_name : str |
|
283 | type_name : str | |
284 | The name of the type (the class name), like ``dtype`` |
|
284 | The name of the type (the class name), like ``dtype`` | |
285 | func : callable |
|
285 | func : callable | |
286 | The callable that will be called to compute the format data. The |
|
286 | The callable that will be called to compute the format data. The | |
287 | call signature of this function is simple, it must take the |
|
287 | call signature of this function is simple, it must take the | |
288 | object to be formatted and return the raw data for the given |
|
288 | object to be formatted and return the raw data for the given | |
289 | format. Subclasses may use a different call signature for the |
|
289 | format. Subclasses may use a different call signature for the | |
290 | `func` argument. |
|
290 | `func` argument. | |
291 | """ |
|
291 | """ | |
292 | key = (type_module, type_name) |
|
292 | key = (type_module, type_name) | |
293 | oldfunc = self.deferred_printers.get(key, None) |
|
293 | oldfunc = self.deferred_printers.get(key, None) | |
294 | if func is not None: |
|
294 | if func is not None: | |
295 | # To support easy restoration of old printers, we need to ignore |
|
295 | # To support easy restoration of old printers, we need to ignore | |
296 | # Nones. |
|
296 | # Nones. | |
297 | self.deferred_printers[key] = func |
|
297 | self.deferred_printers[key] = func | |
298 | return oldfunc |
|
298 | return oldfunc | |
299 |
|
299 | |||
300 | def _in_deferred_types(self, cls): |
|
300 | def _in_deferred_types(self, cls): | |
301 | """ |
|
301 | """ | |
302 | Check if the given class is specified in the deferred type registry. |
|
302 | Check if the given class is specified in the deferred type registry. | |
303 |
|
303 | |||
304 | Returns the printer from the registry if it exists, and None if the |
|
304 | Returns the printer from the registry if it exists, and None if the | |
305 | class is not in the registry. Successful matches will be moved to the |
|
305 | class is not in the registry. Successful matches will be moved to the | |
306 | regular type registry for future use. |
|
306 | regular type registry for future use. | |
307 | """ |
|
307 | """ | |
308 | mod = getattr(cls, '__module__', None) |
|
308 | mod = getattr(cls, '__module__', None) | |
309 | name = getattr(cls, '__name__', None) |
|
309 | name = getattr(cls, '__name__', None) | |
310 | key = (mod, name) |
|
310 | key = (mod, name) | |
311 | printer = None |
|
311 | printer = None | |
312 | if key in self.deferred_printers: |
|
312 | if key in self.deferred_printers: | |
313 | # Move the printer over to the regular registry. |
|
313 | # Move the printer over to the regular registry. | |
314 | printer = self.deferred_printers.pop(key) |
|
314 | printer = self.deferred_printers.pop(key) | |
315 | self.type_printers[cls] = printer |
|
315 | self.type_printers[cls] = printer | |
316 | return printer |
|
316 | return printer | |
317 |
|
317 | |||
318 |
|
318 | |||
319 | class PlainTextFormatter(BaseFormatter): |
|
319 | class PlainTextFormatter(BaseFormatter): | |
320 | """The default pretty-printer. |
|
320 | """The default pretty-printer. | |
321 |
|
321 | |||
322 | This uses :mod:`IPython.external.pretty` to compute the format data of |
|
322 | This uses :mod:`IPython.external.pretty` to compute the format data of | |
323 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
323 | the object. If the object cannot be pretty printed, :func:`repr` is used. | |
324 | See the documentation of :mod:`IPython.external.pretty` for details on |
|
324 | See the documentation of :mod:`IPython.external.pretty` for details on | |
325 | how to write pretty printers. Here is a simple example:: |
|
325 | how to write pretty printers. Here is a simple example:: | |
326 |
|
326 | |||
327 | def dtype_pprinter(obj, p, cycle): |
|
327 | def dtype_pprinter(obj, p, cycle): | |
328 | if cycle: |
|
328 | if cycle: | |
329 | return p.text('dtype(...)') |
|
329 | return p.text('dtype(...)') | |
330 | if hasattr(obj, 'fields'): |
|
330 | if hasattr(obj, 'fields'): | |
331 | if obj.fields is None: |
|
331 | if obj.fields is None: | |
332 | p.text(repr(obj)) |
|
332 | p.text(repr(obj)) | |
333 | else: |
|
333 | else: | |
334 | p.begin_group(7, 'dtype([') |
|
334 | p.begin_group(7, 'dtype([') | |
335 | for i, field in enumerate(obj.descr): |
|
335 | for i, field in enumerate(obj.descr): | |
336 | if i > 0: |
|
336 | if i > 0: | |
337 | p.text(',') |
|
337 | p.text(',') | |
338 | p.breakable() |
|
338 | p.breakable() | |
339 | p.pretty(field) |
|
339 | p.pretty(field) | |
340 | p.end_group(7, '])') |
|
340 | p.end_group(7, '])') | |
341 | """ |
|
341 | """ | |
342 |
|
342 | |||
343 | # The format type of data returned. |
|
343 | # The format type of data returned. | |
344 | format_type = Unicode('text/plain') |
|
344 | format_type = Unicode('text/plain') | |
345 |
|
345 | |||
346 | # This subclass ignores this attribute as it always need to return |
|
346 | # This subclass ignores this attribute as it always need to return | |
347 | # something. |
|
347 | # something. | |
348 | enabled = Bool(True, config=False) |
|
348 | enabled = Bool(True, config=False) | |
349 |
|
349 | |||
350 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
350 | # Look for a _repr_pretty_ methods to use for pretty printing. | |
351 | print_method = ObjectName('_repr_pretty_') |
|
351 | print_method = ObjectName('_repr_pretty_') | |
352 |
|
352 | |||
353 | # Whether to pretty-print or not. |
|
353 | # Whether to pretty-print or not. | |
354 | pprint = Bool(True, config=True) |
|
354 | pprint = Bool(True, config=True) | |
355 |
|
355 | |||
356 | # Whether to be verbose or not. |
|
356 | # Whether to be verbose or not. | |
357 | verbose = Bool(False, config=True) |
|
357 | verbose = Bool(False, config=True) | |
358 |
|
358 | |||
359 | # The maximum width. |
|
359 | # The maximum width. | |
360 | max_width = Int(79, config=True) |
|
360 | max_width = Int(79, config=True) | |
361 |
|
361 | |||
362 | # The newline character. |
|
362 | # The newline character. | |
363 | newline = Unicode('\n', config=True) |
|
363 | newline = Unicode('\n', config=True) | |
364 |
|
364 | |||
365 | # format-string for pprinting floats |
|
365 | # format-string for pprinting floats | |
366 | float_format = Unicode('%r') |
|
366 | float_format = Unicode('%r') | |
367 | # setter for float precision, either int or direct format-string |
|
367 | # setter for float precision, either int or direct format-string | |
368 | float_precision = CUnicode('', config=True) |
|
368 | float_precision = CUnicode('', config=True) | |
369 |
|
369 | |||
370 | def _float_precision_changed(self, name, old, new): |
|
370 | def _float_precision_changed(self, name, old, new): | |
371 | """float_precision changed, set float_format accordingly. |
|
371 | """float_precision changed, set float_format accordingly. | |
372 |
|
372 | |||
373 | float_precision can be set by int or str. |
|
373 | float_precision can be set by int or str. | |
374 | This will set float_format, after interpreting input. |
|
374 | This will set float_format, after interpreting input. | |
375 | If numpy has been imported, numpy print precision will also be set. |
|
375 | If numpy has been imported, numpy print precision will also be set. | |
376 |
|
376 | |||
377 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
377 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
378 |
|
378 | |||
379 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
379 | An empty string returns to defaults (repr for float, 8 for numpy). | |
380 |
|
380 | |||
381 | This parameter can be set via the '%precision' magic. |
|
381 | This parameter can be set via the '%precision' magic. | |
382 | """ |
|
382 | """ | |
383 |
|
383 | |||
384 | if '%' in new: |
|
384 | if '%' in new: | |
385 | # got explicit format string |
|
385 | # got explicit format string | |
386 | fmt = new |
|
386 | fmt = new | |
387 | try: |
|
387 | try: | |
388 | fmt%3.14159 |
|
388 | fmt%3.14159 | |
389 | except Exception: |
|
389 | except Exception: | |
390 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
390 | raise ValueError("Precision must be int or format string, not %r"%new) | |
391 | elif new: |
|
391 | elif new: | |
392 | # otherwise, should be an int |
|
392 | # otherwise, should be an int | |
393 | try: |
|
393 | try: | |
394 | i = int(new) |
|
394 | i = int(new) | |
395 | assert i >= 0 |
|
395 | assert i >= 0 | |
396 | except ValueError: |
|
396 | except ValueError: | |
397 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
397 | raise ValueError("Precision must be int or format string, not %r"%new) | |
398 | except AssertionError: |
|
398 | except AssertionError: | |
399 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
399 | raise ValueError("int precision must be non-negative, not %r"%i) | |
400 |
|
400 | |||
401 | fmt = '%%.%if'%i |
|
401 | fmt = '%%.%if'%i | |
402 | if 'numpy' in sys.modules: |
|
402 | if 'numpy' in sys.modules: | |
403 | # set numpy precision if it has been imported |
|
403 | # set numpy precision if it has been imported | |
404 | import numpy |
|
404 | import numpy | |
405 | numpy.set_printoptions(precision=i) |
|
405 | numpy.set_printoptions(precision=i) | |
406 | else: |
|
406 | else: | |
407 | # default back to repr |
|
407 | # default back to repr | |
408 | fmt = '%r' |
|
408 | fmt = '%r' | |
409 | if 'numpy' in sys.modules: |
|
409 | if 'numpy' in sys.modules: | |
410 | import numpy |
|
410 | import numpy | |
411 | # numpy default is 8 |
|
411 | # numpy default is 8 | |
412 | numpy.set_printoptions(precision=8) |
|
412 | numpy.set_printoptions(precision=8) | |
413 | self.float_format = fmt |
|
413 | self.float_format = fmt | |
414 |
|
414 | |||
415 | # Use the default pretty printers from IPython.external.pretty. |
|
415 | # Use the default pretty printers from IPython.external.pretty. | |
416 | def _singleton_printers_default(self): |
|
416 | def _singleton_printers_default(self): | |
417 | return pretty._singleton_pprinters.copy() |
|
417 | return pretty._singleton_pprinters.copy() | |
418 |
|
418 | |||
419 | def _type_printers_default(self): |
|
419 | def _type_printers_default(self): | |
420 | d = pretty._type_pprinters.copy() |
|
420 | d = pretty._type_pprinters.copy() | |
421 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
421 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
422 | return d |
|
422 | return d | |
423 |
|
423 | |||
424 | def _deferred_printers_default(self): |
|
424 | def _deferred_printers_default(self): | |
425 | return pretty._deferred_type_pprinters.copy() |
|
425 | return pretty._deferred_type_pprinters.copy() | |
426 |
|
426 | |||
427 | #### FormatterABC interface #### |
|
427 | #### FormatterABC interface #### | |
428 |
|
428 | |||
429 | def __call__(self, obj): |
|
429 | def __call__(self, obj): | |
430 | """Compute the pretty representation of the object.""" |
|
430 | """Compute the pretty representation of the object.""" | |
431 | if not self.pprint: |
|
431 | if not self.pprint: | |
432 | try: |
|
432 | try: | |
433 | return repr(obj) |
|
433 | return repr(obj) | |
434 | except TypeError: |
|
434 | except TypeError: | |
435 | return '' |
|
435 | return '' | |
436 | else: |
|
436 | else: | |
437 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
437 | # This uses use StringIO, as cStringIO doesn't handle unicode. | |
438 | stream = StringIO() |
|
438 | stream = StringIO() | |
439 | # self.newline.encode() is a quick fix for issue gh-597. We need to |
|
439 | # self.newline.encode() is a quick fix for issue gh-597. We need to | |
440 | # ensure that stream does not get a mix of unicode and bytestrings, |
|
440 | # ensure that stream does not get a mix of unicode and bytestrings, | |
441 | # or it will cause trouble. |
|
441 | # or it will cause trouble. | |
442 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
442 | printer = pretty.RepresentationPrinter(stream, self.verbose, | |
443 | self.max_width, unicode_to_str(self.newline), |
|
443 | self.max_width, unicode_to_str(self.newline), | |
444 | singleton_pprinters=self.singleton_printers, |
|
444 | singleton_pprinters=self.singleton_printers, | |
445 | type_pprinters=self.type_printers, |
|
445 | type_pprinters=self.type_printers, | |
446 | deferred_pprinters=self.deferred_printers) |
|
446 | deferred_pprinters=self.deferred_printers) | |
447 | printer.pretty(obj) |
|
447 | printer.pretty(obj) | |
448 | printer.flush() |
|
448 | printer.flush() | |
449 | return stream.getvalue() |
|
449 | return stream.getvalue() | |
450 |
|
450 | |||
451 |
|
451 | |||
452 | class HTMLFormatter(BaseFormatter): |
|
452 | class HTMLFormatter(BaseFormatter): | |
453 | """An HTML formatter. |
|
453 | """An HTML formatter. | |
454 |
|
454 | |||
455 | To define the callables that compute the HTML representation of your |
|
455 | To define the callables that compute the HTML representation of your | |
456 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
456 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` | |
457 | or :meth:`for_type_by_name` methods to register functions that handle |
|
457 | or :meth:`for_type_by_name` methods to register functions that handle | |
458 | this. |
|
458 | this. | |
459 |
|
459 | |||
460 | The return value of this formatter should be a valid HTML snippet that |
|
460 | The return value of this formatter should be a valid HTML snippet that | |
461 | could be injected into an existing DOM. It should *not* include the |
|
461 | could be injected into an existing DOM. It should *not* include the | |
462 | ```<html>`` or ```<body>`` tags. |
|
462 | ```<html>`` or ```<body>`` tags. | |
463 | """ |
|
463 | """ | |
464 | format_type = Unicode('text/html') |
|
464 | format_type = Unicode('text/html') | |
465 |
|
465 | |||
466 | print_method = ObjectName('_repr_html_') |
|
466 | print_method = ObjectName('_repr_html_') | |
467 |
|
467 | |||
468 |
|
468 | |||
469 | class SVGFormatter(BaseFormatter): |
|
469 | class SVGFormatter(BaseFormatter): | |
470 | """An SVG formatter. |
|
470 | """An SVG formatter. | |
471 |
|
471 | |||
472 | To define the callables that compute the SVG representation of your |
|
472 | To define the callables that compute the SVG representation of your | |
473 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
473 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` | |
474 | or :meth:`for_type_by_name` methods to register functions that handle |
|
474 | or :meth:`for_type_by_name` methods to register functions that handle | |
475 | this. |
|
475 | this. | |
476 |
|
476 | |||
477 | The return value of this formatter should be valid SVG enclosed in |
|
477 | The return value of this formatter should be valid SVG enclosed in | |
478 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
478 | ```<svg>``` tags, that could be injected into an existing DOM. It should | |
479 | *not* include the ```<html>`` or ```<body>`` tags. |
|
479 | *not* include the ```<html>`` or ```<body>`` tags. | |
480 | """ |
|
480 | """ | |
481 | format_type = Unicode('image/svg+xml') |
|
481 | format_type = Unicode('image/svg+xml') | |
482 |
|
482 | |||
483 | print_method = ObjectName('_repr_svg_') |
|
483 | print_method = ObjectName('_repr_svg_') | |
484 |
|
484 | |||
485 |
|
485 | |||
486 | class PNGFormatter(BaseFormatter): |
|
486 | class PNGFormatter(BaseFormatter): | |
487 | """A PNG formatter. |
|
487 | """A PNG formatter. | |
488 |
|
488 | |||
489 | To define the callables that compute the PNG representation of your |
|
489 | To define the callables that compute the PNG representation of your | |
490 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
490 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` | |
491 | or :meth:`for_type_by_name` methods to register functions that handle |
|
491 | or :meth:`for_type_by_name` methods to register functions that handle | |
492 | this. |
|
492 | this. | |
493 |
|
493 | |||
494 | The return value of this formatter should be raw PNG data, *not* |
|
494 | The return value of this formatter should be raw PNG data, *not* | |
495 | base64 encoded. |
|
495 | base64 encoded. | |
496 | """ |
|
496 | """ | |
497 | format_type = Unicode('image/png') |
|
497 | format_type = Unicode('image/png') | |
498 |
|
498 | |||
499 | print_method = ObjectName('_repr_png_') |
|
499 | print_method = ObjectName('_repr_png_') | |
500 |
|
500 | |||
501 |
|
501 | |||
502 | class JPEGFormatter(BaseFormatter): |
|
502 | class JPEGFormatter(BaseFormatter): | |
503 | """A JPEG formatter. |
|
503 | """A JPEG formatter. | |
504 |
|
504 | |||
505 | To define the callables that compute the JPEG representation of your |
|
505 | To define the callables that compute the JPEG representation of your | |
506 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
506 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` | |
507 | or :meth:`for_type_by_name` methods to register functions that handle |
|
507 | or :meth:`for_type_by_name` methods to register functions that handle | |
508 | this. |
|
508 | this. | |
509 |
|
509 | |||
510 | The return value of this formatter should be raw JPEG data, *not* |
|
510 | The return value of this formatter should be raw JPEG data, *not* | |
511 | base64 encoded. |
|
511 | base64 encoded. | |
512 | """ |
|
512 | """ | |
513 | format_type = Unicode('image/jpeg') |
|
513 | format_type = Unicode('image/jpeg') | |
514 |
|
514 | |||
515 | print_method = ObjectName('_repr_jpeg_') |
|
515 | print_method = ObjectName('_repr_jpeg_') | |
516 |
|
516 | |||
517 |
|
517 | |||
518 | class LatexFormatter(BaseFormatter): |
|
518 | class LatexFormatter(BaseFormatter): | |
519 | """A LaTeX formatter. |
|
519 | """A LaTeX formatter. | |
520 |
|
520 | |||
521 | To define the callables that compute the LaTeX representation of your |
|
521 | To define the callables that compute the LaTeX representation of your | |
522 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
522 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` | |
523 | or :meth:`for_type_by_name` methods to register functions that handle |
|
523 | or :meth:`for_type_by_name` methods to register functions that handle | |
524 | this. |
|
524 | this. | |
525 |
|
525 | |||
526 | The return value of this formatter should be a valid LaTeX equation, |
|
526 | The return value of this formatter should be a valid LaTeX equation, | |
527 | enclosed in either ```$``` or ```$$```. |
|
527 | enclosed in either ```$``` or ```$$```. | |
528 | """ |
|
528 | """ | |
529 | format_type = Unicode('text/latex') |
|
529 | format_type = Unicode('text/latex') | |
530 |
|
530 | |||
531 | print_method = ObjectName('_repr_latex_') |
|
531 | print_method = ObjectName('_repr_latex_') | |
532 |
|
532 | |||
533 |
|
533 | |||
534 | class JSONFormatter(BaseFormatter): |
|
534 | class JSONFormatter(BaseFormatter): | |
535 | """A JSON string formatter. |
|
535 | """A JSON string formatter. | |
536 |
|
536 | |||
537 | To define the callables that compute the JSON string representation of |
|
537 | To define the callables that compute the JSON string representation of | |
538 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
538 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` | |
539 | or :meth:`for_type_by_name` methods to register functions that handle |
|
539 | or :meth:`for_type_by_name` methods to register functions that handle | |
540 | this. |
|
540 | this. | |
541 |
|
541 | |||
542 | The return value of this formatter should be a valid JSON string. |
|
542 | The return value of this formatter should be a valid JSON string. | |
543 | """ |
|
543 | """ | |
544 | format_type = Unicode('application/json') |
|
544 | format_type = Unicode('application/json') | |
545 |
|
545 | |||
546 | print_method = ObjectName('_repr_json_') |
|
546 | print_method = ObjectName('_repr_json_') | |
547 |
|
547 | |||
548 |
|
548 | |||
549 | class JavascriptFormatter(BaseFormatter): |
|
549 | class JavascriptFormatter(BaseFormatter): | |
550 | """A Javascript formatter. |
|
550 | """A Javascript formatter. | |
551 |
|
551 | |||
552 | To define the callables that compute the Javascript representation of |
|
552 | To define the callables that compute the Javascript representation of | |
553 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
553 | your objects, define a :meth:`_repr_javascript_` method or use the | |
554 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
554 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions | |
555 | that handle this. |
|
555 | that handle this. | |
556 |
|
556 | |||
557 | The return value of this formatter should be valid Javascript code and |
|
557 | The return value of this formatter should be valid Javascript code and | |
558 | should *not* be enclosed in ```<script>``` tags. |
|
558 | should *not* be enclosed in ```<script>``` tags. | |
559 | """ |
|
559 | """ | |
560 | format_type = Unicode('application/javascript') |
|
560 | format_type = Unicode('application/javascript') | |
561 |
|
561 | |||
562 | print_method = ObjectName('_repr_javascript_') |
|
562 | print_method = ObjectName('_repr_javascript_') | |
563 |
|
563 | |||
564 | FormatterABC.register(BaseFormatter) |
|
564 | FormatterABC.register(BaseFormatter) | |
565 | FormatterABC.register(PlainTextFormatter) |
|
565 | FormatterABC.register(PlainTextFormatter) | |
566 | FormatterABC.register(HTMLFormatter) |
|
566 | FormatterABC.register(HTMLFormatter) | |
567 | FormatterABC.register(SVGFormatter) |
|
567 | FormatterABC.register(SVGFormatter) | |
568 | FormatterABC.register(PNGFormatter) |
|
568 | FormatterABC.register(PNGFormatter) | |
569 | FormatterABC.register(JPEGFormatter) |
|
569 | FormatterABC.register(JPEGFormatter) | |
570 | FormatterABC.register(LatexFormatter) |
|
570 | FormatterABC.register(LatexFormatter) | |
571 | FormatterABC.register(JSONFormatter) |
|
571 | FormatterABC.register(JSONFormatter) | |
572 | FormatterABC.register(JavascriptFormatter) |
|
572 | FormatterABC.register(JavascriptFormatter) | |
573 |
|
573 | |||
574 |
|
574 | |||
575 | def format_display_data(obj, include=None, exclude=None): |
|
575 | def format_display_data(obj, include=None, exclude=None): | |
576 | """Return a format data dict for an object. |
|
576 | """Return a format data dict for an object. | |
577 |
|
577 | |||
578 | By default all format types will be computed. |
|
578 | By default all format types will be computed. | |
579 |
|
579 | |||
580 | The following MIME types are currently implemented: |
|
580 | The following MIME types are currently implemented: | |
581 |
|
581 | |||
582 | * text/plain |
|
582 | * text/plain | |
583 | * text/html |
|
583 | * text/html | |
584 | * text/latex |
|
584 | * text/latex | |
585 | * application/json |
|
585 | * application/json | |
586 | * application/javascript |
|
586 | * application/javascript | |
587 | * image/png |
|
587 | * image/png | |
588 | * image/jpeg |
|
588 | * image/jpeg | |
589 | * image/svg+xml |
|
589 | * image/svg+xml | |
590 |
|
590 | |||
591 | Parameters |
|
591 | Parameters | |
592 | ---------- |
|
592 | ---------- | |
593 | obj : object |
|
593 | obj : object | |
594 | The Python object whose format data will be computed. |
|
594 | The Python object whose format data will be computed. | |
595 |
|
595 | |||
596 | Returns |
|
596 | Returns | |
597 | ------- |
|
597 | ------- | |
598 | format_dict : dict |
|
598 | format_dict : dict | |
599 | A dictionary of key/value pairs, one or each format that was |
|
599 | A dictionary of key/value pairs, one or each format that was | |
600 | generated for the object. The keys are the format types, which |
|
600 | generated for the object. The keys are the format types, which | |
601 | will usually be MIME type strings and the values and JSON'able |
|
601 | will usually be MIME type strings and the values and JSON'able | |
602 | data structure containing the raw data for the representation in |
|
602 | data structure containing the raw data for the representation in | |
603 | that format. |
|
603 | that format. | |
604 | include : list or tuple, optional |
|
604 | include : list or tuple, optional | |
605 | A list of format type strings (MIME types) to include in the |
|
605 | A list of format type strings (MIME types) to include in the | |
606 | format data dict. If this is set *only* the format types included |
|
606 | format data dict. If this is set *only* the format types included | |
607 | in this list will be computed. |
|
607 | in this list will be computed. | |
608 | exclude : list or tuple, optional |
|
608 | exclude : list or tuple, optional | |
609 | A list of format type string (MIME types) to exclue in the format |
|
609 | A list of format type string (MIME types) to exclue in the format | |
610 | data dict. If this is set all format types will be computed, |
|
610 | data dict. If this is set all format types will be computed, | |
611 | except for those included in this argument. |
|
611 | except for those included in this argument. | |
612 | """ |
|
612 | """ | |
613 | from IPython.core.interactiveshell import InteractiveShell |
|
613 | from IPython.core.interactiveshell import InteractiveShell | |
614 |
|
614 | |||
615 | InteractiveShell.instance().display_formatter.format( |
|
615 | InteractiveShell.instance().display_formatter.format( | |
616 | obj, |
|
616 | obj, | |
617 | include, |
|
617 | include, | |
618 | exclude |
|
618 | exclude | |
619 | ) |
|
619 | ) | |
620 |
|
620 |
General Comments 0
You need to be logged in to leave comments.
Login now