Show More
The requested changes are too big and content was truncated. Show full diff
@@ -1,14 +1,14 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | |
|
3 | 3 | __docformat__ = "restructuredtext en" |
|
4 | 4 | |
|
5 | 5 | #------------------------------------------------------------------------------- |
|
6 | # Copyright (C) 2008 The IPython Development Team | |
|
6 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
7 | 7 | # |
|
8 | 8 | # Distributed under the terms of the BSD License. The full license is in |
|
9 | 9 | # the file COPYING, distributed as part of this software. |
|
10 | 10 | #------------------------------------------------------------------------------- |
|
11 | 11 | |
|
12 | 12 | #------------------------------------------------------------------------------- |
|
13 | 13 | # Imports |
|
14 | 14 | #------------------------------------------------------------------------------- No newline at end of file |
@@ -1,183 +1,183 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Tests for IPython.config.configurable |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Brian Granger |
|
8 | 8 | * Fernando Perez (design help) |
|
9 | 9 | """ |
|
10 | 10 | |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 |
# Copyright (C) 2008-201 |
|
|
12 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
13 | 13 | # |
|
14 | 14 | # Distributed under the terms of the BSD License. The full license is in |
|
15 | 15 | # the file COPYING, distributed as part of this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | from unittest import TestCase |
|
23 | 23 | |
|
24 | 24 | from IPython.config.configurable import ( |
|
25 | 25 | Configurable, |
|
26 | 26 | SingletonConfigurable |
|
27 | 27 | ) |
|
28 | 28 | |
|
29 | 29 | from IPython.utils.traitlets import ( |
|
30 | 30 | Integer, Float, Unicode |
|
31 | 31 | ) |
|
32 | 32 | |
|
33 | 33 | from IPython.config.loader import Config |
|
34 | 34 | from IPython.utils.py3compat import PY3 |
|
35 | 35 | |
|
36 | 36 | #----------------------------------------------------------------------------- |
|
37 | 37 | # Test cases |
|
38 | 38 | #----------------------------------------------------------------------------- |
|
39 | 39 | |
|
40 | 40 | |
|
41 | 41 | class MyConfigurable(Configurable): |
|
42 | 42 | a = Integer(1, config=True, help="The integer a.") |
|
43 | 43 | b = Float(1.0, config=True, help="The integer b.") |
|
44 | 44 | c = Unicode('no config') |
|
45 | 45 | |
|
46 | 46 | |
|
47 | 47 | mc_help=u"""MyConfigurable options |
|
48 | 48 | ---------------------- |
|
49 | 49 | --MyConfigurable.a=<Integer> |
|
50 | 50 | Default: 1 |
|
51 | 51 | The integer a. |
|
52 | 52 | --MyConfigurable.b=<Float> |
|
53 | 53 | Default: 1.0 |
|
54 | 54 | The integer b.""" |
|
55 | 55 | |
|
56 | 56 | mc_help_inst=u"""MyConfigurable options |
|
57 | 57 | ---------------------- |
|
58 | 58 | --MyConfigurable.a=<Integer> |
|
59 | 59 | Current: 5 |
|
60 | 60 | The integer a. |
|
61 | 61 | --MyConfigurable.b=<Float> |
|
62 | 62 | Current: 4.0 |
|
63 | 63 | The integer b.""" |
|
64 | 64 | |
|
65 | 65 | # On Python 3, the Integer trait is a synonym for Int |
|
66 | 66 | if PY3: |
|
67 | 67 | mc_help = mc_help.replace(u"<Integer>", u"<Int>") |
|
68 | 68 | mc_help_inst = mc_help_inst.replace(u"<Integer>", u"<Int>") |
|
69 | 69 | |
|
70 | 70 | class Foo(Configurable): |
|
71 | 71 | a = Integer(0, config=True, help="The integer a.") |
|
72 | 72 | b = Unicode('nope', config=True) |
|
73 | 73 | |
|
74 | 74 | |
|
75 | 75 | class Bar(Foo): |
|
76 | 76 | b = Unicode('gotit', config=False, help="The string b.") |
|
77 | 77 | c = Float(config=True, help="The string c.") |
|
78 | 78 | |
|
79 | 79 | |
|
80 | 80 | class TestConfigurable(TestCase): |
|
81 | 81 | |
|
82 | 82 | def test_default(self): |
|
83 | 83 | c1 = Configurable() |
|
84 | 84 | c2 = Configurable(config=c1.config) |
|
85 | 85 | c3 = Configurable(config=c2.config) |
|
86 | 86 | self.assertEquals(c1.config, c2.config) |
|
87 | 87 | self.assertEquals(c2.config, c3.config) |
|
88 | 88 | |
|
89 | 89 | def test_custom(self): |
|
90 | 90 | config = Config() |
|
91 | 91 | config.foo = 'foo' |
|
92 | 92 | config.bar = 'bar' |
|
93 | 93 | c1 = Configurable(config=config) |
|
94 | 94 | c2 = Configurable(config=c1.config) |
|
95 | 95 | c3 = Configurable(config=c2.config) |
|
96 | 96 | self.assertEquals(c1.config, config) |
|
97 | 97 | self.assertEquals(c2.config, config) |
|
98 | 98 | self.assertEquals(c3.config, config) |
|
99 | 99 | # Test that copies are not made |
|
100 | 100 | self.assert_(c1.config is config) |
|
101 | 101 | self.assert_(c2.config is config) |
|
102 | 102 | self.assert_(c3.config is config) |
|
103 | 103 | self.assert_(c1.config is c2.config) |
|
104 | 104 | self.assert_(c2.config is c3.config) |
|
105 | 105 | |
|
106 | 106 | def test_inheritance(self): |
|
107 | 107 | config = Config() |
|
108 | 108 | config.MyConfigurable.a = 2 |
|
109 | 109 | config.MyConfigurable.b = 2.0 |
|
110 | 110 | c1 = MyConfigurable(config=config) |
|
111 | 111 | c2 = MyConfigurable(config=c1.config) |
|
112 | 112 | self.assertEquals(c1.a, config.MyConfigurable.a) |
|
113 | 113 | self.assertEquals(c1.b, config.MyConfigurable.b) |
|
114 | 114 | self.assertEquals(c2.a, config.MyConfigurable.a) |
|
115 | 115 | self.assertEquals(c2.b, config.MyConfigurable.b) |
|
116 | 116 | |
|
117 | 117 | def test_parent(self): |
|
118 | 118 | config = Config() |
|
119 | 119 | config.Foo.a = 10 |
|
120 | 120 | config.Foo.b = "wow" |
|
121 | 121 | config.Bar.b = 'later' |
|
122 | 122 | config.Bar.c = 100.0 |
|
123 | 123 | f = Foo(config=config) |
|
124 | 124 | b = Bar(config=f.config) |
|
125 | 125 | self.assertEquals(f.a, 10) |
|
126 | 126 | self.assertEquals(f.b, 'wow') |
|
127 | 127 | self.assertEquals(b.b, 'gotit') |
|
128 | 128 | self.assertEquals(b.c, 100.0) |
|
129 | 129 | |
|
130 | 130 | def test_override1(self): |
|
131 | 131 | config = Config() |
|
132 | 132 | config.MyConfigurable.a = 2 |
|
133 | 133 | config.MyConfigurable.b = 2.0 |
|
134 | 134 | c = MyConfigurable(a=3, config=config) |
|
135 | 135 | self.assertEquals(c.a, 3) |
|
136 | 136 | self.assertEquals(c.b, config.MyConfigurable.b) |
|
137 | 137 | self.assertEquals(c.c, 'no config') |
|
138 | 138 | |
|
139 | 139 | def test_override2(self): |
|
140 | 140 | config = Config() |
|
141 | 141 | config.Foo.a = 1 |
|
142 | 142 | config.Bar.b = 'or' # Up above b is config=False, so this won't do it. |
|
143 | 143 | config.Bar.c = 10.0 |
|
144 | 144 | c = Bar(config=config) |
|
145 | 145 | self.assertEquals(c.a, config.Foo.a) |
|
146 | 146 | self.assertEquals(c.b, 'gotit') |
|
147 | 147 | self.assertEquals(c.c, config.Bar.c) |
|
148 | 148 | c = Bar(a=2, b='and', c=20.0, config=config) |
|
149 | 149 | self.assertEquals(c.a, 2) |
|
150 | 150 | self.assertEquals(c.b, 'and') |
|
151 | 151 | self.assertEquals(c.c, 20.0) |
|
152 | 152 | |
|
153 | 153 | def test_help(self): |
|
154 | 154 | self.assertEquals(MyConfigurable.class_get_help(), mc_help) |
|
155 | 155 | |
|
156 | 156 | def test_help_inst(self): |
|
157 | 157 | inst = MyConfigurable(a=5, b=4) |
|
158 | 158 | self.assertEquals(MyConfigurable.class_get_help(inst), mc_help_inst) |
|
159 | 159 | |
|
160 | 160 | |
|
161 | 161 | class TestSingletonConfigurable(TestCase): |
|
162 | 162 | |
|
163 | 163 | def test_instance(self): |
|
164 | 164 | from IPython.config.configurable import SingletonConfigurable |
|
165 | 165 | class Foo(SingletonConfigurable): pass |
|
166 | 166 | self.assertEquals(Foo.initialized(), False) |
|
167 | 167 | foo = Foo.instance() |
|
168 | 168 | self.assertEquals(Foo.initialized(), True) |
|
169 | 169 | self.assertEquals(foo, Foo.instance()) |
|
170 | 170 | self.assertEquals(SingletonConfigurable._instance, None) |
|
171 | 171 | |
|
172 | 172 | def test_inheritance(self): |
|
173 | 173 | class Bar(SingletonConfigurable): pass |
|
174 | 174 | class Bam(Bar): pass |
|
175 | 175 | self.assertEquals(Bar.initialized(), False) |
|
176 | 176 | self.assertEquals(Bam.initialized(), False) |
|
177 | 177 | bam = Bam.instance() |
|
178 | 178 | bam == Bar.instance() |
|
179 | 179 | self.assertEquals(Bar.initialized(), True) |
|
180 | 180 | self.assertEquals(Bam.initialized(), True) |
|
181 | 181 | self.assertEquals(bam, Bam._instance) |
|
182 | 182 | self.assertEquals(bam, Bar._instance) |
|
183 | 183 | self.assertEquals(SingletonConfigurable._instance, None) |
@@ -1,255 +1,255 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Tests for IPython.config.loader |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Brian Granger |
|
8 | 8 | * Fernando Perez (design help) |
|
9 | 9 | """ |
|
10 | 10 | |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 |
# Copyright (C) 2008-20 |
|
|
12 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
13 | 13 | # |
|
14 | 14 | # Distributed under the terms of the BSD License. The full license is in |
|
15 | 15 | # the file COPYING, distributed as part of this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | import os |
|
23 | 23 | import sys |
|
24 | 24 | from tempfile import mkstemp |
|
25 | 25 | from unittest import TestCase |
|
26 | 26 | |
|
27 | 27 | from nose import SkipTest |
|
28 | 28 | |
|
29 | 29 | from IPython.testing.tools import mute_warn |
|
30 | 30 | |
|
31 | 31 | from IPython.utils.traitlets import Unicode |
|
32 | 32 | from IPython.config.configurable import Configurable |
|
33 | 33 | from IPython.config.loader import ( |
|
34 | 34 | Config, |
|
35 | 35 | PyFileConfigLoader, |
|
36 | 36 | KeyValueConfigLoader, |
|
37 | 37 | ArgParseConfigLoader, |
|
38 | 38 | KVArgParseConfigLoader, |
|
39 | 39 | ConfigError |
|
40 | 40 | ) |
|
41 | 41 | |
|
42 | 42 | #----------------------------------------------------------------------------- |
|
43 | 43 | # Actual tests |
|
44 | 44 | #----------------------------------------------------------------------------- |
|
45 | 45 | |
|
46 | 46 | |
|
47 | 47 | pyfile = """ |
|
48 | 48 | c = get_config() |
|
49 | 49 | c.a=10 |
|
50 | 50 | c.b=20 |
|
51 | 51 | c.Foo.Bar.value=10 |
|
52 | 52 | c.Foo.Bam.value=list(range(10)) # list() is just so it's the same on Python 3 |
|
53 | 53 | c.D.C.value='hi there' |
|
54 | 54 | """ |
|
55 | 55 | |
|
56 | 56 | class TestPyFileCL(TestCase): |
|
57 | 57 | |
|
58 | 58 | def test_basic(self): |
|
59 | 59 | fd, fname = mkstemp('.py') |
|
60 | 60 | f = os.fdopen(fd, 'w') |
|
61 | 61 | f.write(pyfile) |
|
62 | 62 | f.close() |
|
63 | 63 | # Unlink the file |
|
64 | 64 | cl = PyFileConfigLoader(fname) |
|
65 | 65 | config = cl.load_config() |
|
66 | 66 | self.assertEquals(config.a, 10) |
|
67 | 67 | self.assertEquals(config.b, 20) |
|
68 | 68 | self.assertEquals(config.Foo.Bar.value, 10) |
|
69 | 69 | self.assertEquals(config.Foo.Bam.value, range(10)) |
|
70 | 70 | self.assertEquals(config.D.C.value, 'hi there') |
|
71 | 71 | |
|
72 | 72 | class MyLoader1(ArgParseConfigLoader): |
|
73 | 73 | def _add_arguments(self, aliases=None, flags=None): |
|
74 | 74 | p = self.parser |
|
75 | 75 | p.add_argument('-f', '--foo', dest='Global.foo', type=str) |
|
76 | 76 | p.add_argument('-b', dest='MyClass.bar', type=int) |
|
77 | 77 | p.add_argument('-n', dest='n', action='store_true') |
|
78 | 78 | p.add_argument('Global.bam', type=str) |
|
79 | 79 | |
|
80 | 80 | class MyLoader2(ArgParseConfigLoader): |
|
81 | 81 | def _add_arguments(self, aliases=None, flags=None): |
|
82 | 82 | subparsers = self.parser.add_subparsers(dest='subparser_name') |
|
83 | 83 | subparser1 = subparsers.add_parser('1') |
|
84 | 84 | subparser1.add_argument('-x',dest='Global.x') |
|
85 | 85 | subparser2 = subparsers.add_parser('2') |
|
86 | 86 | subparser2.add_argument('y') |
|
87 | 87 | |
|
88 | 88 | class TestArgParseCL(TestCase): |
|
89 | 89 | |
|
90 | 90 | def test_basic(self): |
|
91 | 91 | cl = MyLoader1() |
|
92 | 92 | config = cl.load_config('-f hi -b 10 -n wow'.split()) |
|
93 | 93 | self.assertEquals(config.Global.foo, 'hi') |
|
94 | 94 | self.assertEquals(config.MyClass.bar, 10) |
|
95 | 95 | self.assertEquals(config.n, True) |
|
96 | 96 | self.assertEquals(config.Global.bam, 'wow') |
|
97 | 97 | config = cl.load_config(['wow']) |
|
98 | 98 | self.assertEquals(config.keys(), ['Global']) |
|
99 | 99 | self.assertEquals(config.Global.keys(), ['bam']) |
|
100 | 100 | self.assertEquals(config.Global.bam, 'wow') |
|
101 | 101 | |
|
102 | 102 | def test_add_arguments(self): |
|
103 | 103 | cl = MyLoader2() |
|
104 | 104 | config = cl.load_config('2 frobble'.split()) |
|
105 | 105 | self.assertEquals(config.subparser_name, '2') |
|
106 | 106 | self.assertEquals(config.y, 'frobble') |
|
107 | 107 | config = cl.load_config('1 -x frobble'.split()) |
|
108 | 108 | self.assertEquals(config.subparser_name, '1') |
|
109 | 109 | self.assertEquals(config.Global.x, 'frobble') |
|
110 | 110 | |
|
111 | 111 | def test_argv(self): |
|
112 | 112 | cl = MyLoader1(argv='-f hi -b 10 -n wow'.split()) |
|
113 | 113 | config = cl.load_config() |
|
114 | 114 | self.assertEquals(config.Global.foo, 'hi') |
|
115 | 115 | self.assertEquals(config.MyClass.bar, 10) |
|
116 | 116 | self.assertEquals(config.n, True) |
|
117 | 117 | self.assertEquals(config.Global.bam, 'wow') |
|
118 | 118 | |
|
119 | 119 | |
|
120 | 120 | class TestKeyValueCL(TestCase): |
|
121 | 121 | klass = KeyValueConfigLoader |
|
122 | 122 | |
|
123 | 123 | def test_basic(self): |
|
124 | 124 | cl = self.klass() |
|
125 | 125 | argv = ['--'+s.strip('c.') for s in pyfile.split('\n')[2:-1]] |
|
126 | 126 | with mute_warn(): |
|
127 | 127 | config = cl.load_config(argv) |
|
128 | 128 | self.assertEquals(config.a, 10) |
|
129 | 129 | self.assertEquals(config.b, 20) |
|
130 | 130 | self.assertEquals(config.Foo.Bar.value, 10) |
|
131 | 131 | self.assertEquals(config.Foo.Bam.value, range(10)) |
|
132 | 132 | self.assertEquals(config.D.C.value, 'hi there') |
|
133 | 133 | |
|
134 | 134 | def test_expanduser(self): |
|
135 | 135 | cl = self.klass() |
|
136 | 136 | argv = ['--a=~/1/2/3', '--b=~', '--c=~/', '--d="~/"'] |
|
137 | 137 | with mute_warn(): |
|
138 | 138 | config = cl.load_config(argv) |
|
139 | 139 | self.assertEquals(config.a, os.path.expanduser('~/1/2/3')) |
|
140 | 140 | self.assertEquals(config.b, os.path.expanduser('~')) |
|
141 | 141 | self.assertEquals(config.c, os.path.expanduser('~/')) |
|
142 | 142 | self.assertEquals(config.d, '~/') |
|
143 | 143 | |
|
144 | 144 | def test_extra_args(self): |
|
145 | 145 | cl = self.klass() |
|
146 | 146 | with mute_warn(): |
|
147 | 147 | config = cl.load_config(['--a=5', 'b', '--c=10', 'd']) |
|
148 | 148 | self.assertEquals(cl.extra_args, ['b', 'd']) |
|
149 | 149 | self.assertEquals(config.a, 5) |
|
150 | 150 | self.assertEquals(config.c, 10) |
|
151 | 151 | with mute_warn(): |
|
152 | 152 | config = cl.load_config(['--', '--a=5', '--c=10']) |
|
153 | 153 | self.assertEquals(cl.extra_args, ['--a=5', '--c=10']) |
|
154 | 154 | |
|
155 | 155 | def test_unicode_args(self): |
|
156 | 156 | cl = self.klass() |
|
157 | 157 | argv = [u'--a=épsîlön'] |
|
158 | 158 | with mute_warn(): |
|
159 | 159 | config = cl.load_config(argv) |
|
160 | 160 | self.assertEquals(config.a, u'épsîlön') |
|
161 | 161 | |
|
162 | 162 | def test_unicode_bytes_args(self): |
|
163 | 163 | uarg = u'--a=é' |
|
164 | 164 | try: |
|
165 | 165 | barg = uarg.encode(sys.stdin.encoding) |
|
166 | 166 | except (TypeError, UnicodeEncodeError): |
|
167 | 167 | raise SkipTest("sys.stdin.encoding can't handle 'é'") |
|
168 | 168 | |
|
169 | 169 | cl = self.klass() |
|
170 | 170 | with mute_warn(): |
|
171 | 171 | config = cl.load_config([barg]) |
|
172 | 172 | self.assertEquals(config.a, u'é') |
|
173 | 173 | |
|
174 | 174 | def test_unicode_alias(self): |
|
175 | 175 | cl = self.klass() |
|
176 | 176 | argv = [u'--a=épsîlön'] |
|
177 | 177 | with mute_warn(): |
|
178 | 178 | config = cl.load_config(argv, aliases=dict(a='A.a')) |
|
179 | 179 | self.assertEquals(config.A.a, u'épsîlön') |
|
180 | 180 | |
|
181 | 181 | |
|
182 | 182 | class TestArgParseKVCL(TestKeyValueCL): |
|
183 | 183 | klass = KVArgParseConfigLoader |
|
184 | 184 | |
|
185 | 185 | def test_expanduser2(self): |
|
186 | 186 | cl = self.klass() |
|
187 | 187 | argv = ['-a', '~/1/2/3', '--b', "'~/1/2/3'"] |
|
188 | 188 | with mute_warn(): |
|
189 | 189 | config = cl.load_config(argv, aliases=dict(a='A.a', b='A.b')) |
|
190 | 190 | self.assertEquals(config.A.a, os.path.expanduser('~/1/2/3')) |
|
191 | 191 | self.assertEquals(config.A.b, '~/1/2/3') |
|
192 | 192 | |
|
193 | 193 | class TestConfig(TestCase): |
|
194 | 194 | |
|
195 | 195 | def test_setget(self): |
|
196 | 196 | c = Config() |
|
197 | 197 | c.a = 10 |
|
198 | 198 | self.assertEquals(c.a, 10) |
|
199 | 199 | self.assertEquals(c.has_key('b'), False) |
|
200 | 200 | |
|
201 | 201 | def test_auto_section(self): |
|
202 | 202 | c = Config() |
|
203 | 203 | self.assertEquals(c.has_key('A'), True) |
|
204 | 204 | self.assertEquals(c._has_section('A'), False) |
|
205 | 205 | A = c.A |
|
206 | 206 | A.foo = 'hi there' |
|
207 | 207 | self.assertEquals(c._has_section('A'), True) |
|
208 | 208 | self.assertEquals(c.A.foo, 'hi there') |
|
209 | 209 | del c.A |
|
210 | 210 | self.assertEquals(len(c.A.keys()),0) |
|
211 | 211 | |
|
212 | 212 | def test_merge_doesnt_exist(self): |
|
213 | 213 | c1 = Config() |
|
214 | 214 | c2 = Config() |
|
215 | 215 | c2.bar = 10 |
|
216 | 216 | c2.Foo.bar = 10 |
|
217 | 217 | c1._merge(c2) |
|
218 | 218 | self.assertEquals(c1.Foo.bar, 10) |
|
219 | 219 | self.assertEquals(c1.bar, 10) |
|
220 | 220 | c2.Bar.bar = 10 |
|
221 | 221 | c1._merge(c2) |
|
222 | 222 | self.assertEquals(c1.Bar.bar, 10) |
|
223 | 223 | |
|
224 | 224 | def test_merge_exists(self): |
|
225 | 225 | c1 = Config() |
|
226 | 226 | c2 = Config() |
|
227 | 227 | c1.Foo.bar = 10 |
|
228 | 228 | c1.Foo.bam = 30 |
|
229 | 229 | c2.Foo.bar = 20 |
|
230 | 230 | c2.Foo.wow = 40 |
|
231 | 231 | c1._merge(c2) |
|
232 | 232 | self.assertEquals(c1.Foo.bam, 30) |
|
233 | 233 | self.assertEquals(c1.Foo.bar, 20) |
|
234 | 234 | self.assertEquals(c1.Foo.wow, 40) |
|
235 | 235 | c2.Foo.Bam.bam = 10 |
|
236 | 236 | c1._merge(c2) |
|
237 | 237 | self.assertEquals(c1.Foo.Bam.bam, 10) |
|
238 | 238 | |
|
239 | 239 | def test_deepcopy(self): |
|
240 | 240 | c1 = Config() |
|
241 | 241 | c1.Foo.bar = 10 |
|
242 | 242 | c1.Foo.bam = 30 |
|
243 | 243 | c1.a = 'asdf' |
|
244 | 244 | c1.b = range(10) |
|
245 | 245 | import copy |
|
246 | 246 | c2 = copy.deepcopy(c1) |
|
247 | 247 | self.assertEquals(c1, c2) |
|
248 | 248 | self.assert_(c1 is not c2) |
|
249 | 249 | self.assert_(c1.Foo is not c2.Foo) |
|
250 | 250 | |
|
251 | 251 | def test_builtin(self): |
|
252 | 252 | c1 = Config() |
|
253 | 253 | exec 'foo = True' in c1 |
|
254 | 254 | self.assertEquals(c1.foo, True) |
|
255 | 255 | self.assertRaises(ConfigError, setattr, c1, 'ValueError', 10) |
@@ -1,263 +1,263 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | System command aliases. |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Fernando Perez |
|
8 | 8 | * Brian Granger |
|
9 | 9 | """ |
|
10 | 10 | |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 |
# Copyright (C) 2008-201 |
|
|
12 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
13 | 13 | # |
|
14 | 14 | # Distributed under the terms of the BSD License. |
|
15 | 15 | # |
|
16 | 16 | # The full license is in the file COPYING.txt, distributed with this software. |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | # Imports |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | |
|
23 | 23 | import __builtin__ |
|
24 | 24 | import keyword |
|
25 | 25 | import os |
|
26 | 26 | import re |
|
27 | 27 | import sys |
|
28 | 28 | |
|
29 | 29 | from IPython.config.configurable import Configurable |
|
30 | 30 | from IPython.core.splitinput import split_user_input |
|
31 | 31 | |
|
32 | 32 | from IPython.utils.traitlets import List, Instance |
|
33 | 33 | from IPython.utils.autoattr import auto_attr |
|
34 | 34 | from IPython.utils.warn import warn, error |
|
35 | 35 | |
|
36 | 36 | #----------------------------------------------------------------------------- |
|
37 | 37 | # Utilities |
|
38 | 38 | #----------------------------------------------------------------------------- |
|
39 | 39 | |
|
40 | 40 | # This is used as the pattern for calls to split_user_input. |
|
41 | 41 | shell_line_split = re.compile(r'^(\s*)()(\S+)(.*$)') |
|
42 | 42 | |
|
43 | 43 | def default_aliases(): |
|
44 | 44 | """Return list of shell aliases to auto-define. |
|
45 | 45 | """ |
|
46 | 46 | # Note: the aliases defined here should be safe to use on a kernel |
|
47 | 47 | # regardless of what frontend it is attached to. Frontends that use a |
|
48 | 48 | # kernel in-process can define additional aliases that will only work in |
|
49 | 49 | # their case. For example, things like 'less' or 'clear' that manipulate |
|
50 | 50 | # the terminal should NOT be declared here, as they will only work if the |
|
51 | 51 | # kernel is running inside a true terminal, and not over the network. |
|
52 | 52 | |
|
53 | 53 | if os.name == 'posix': |
|
54 | 54 | default_aliases = [('mkdir', 'mkdir'), ('rmdir', 'rmdir'), |
|
55 | 55 | ('mv', 'mv -i'), ('rm', 'rm -i'), ('cp', 'cp -i'), |
|
56 | 56 | ('cat', 'cat'), |
|
57 | 57 | ] |
|
58 | 58 | # Useful set of ls aliases. The GNU and BSD options are a little |
|
59 | 59 | # different, so we make aliases that provide as similar as possible |
|
60 | 60 | # behavior in ipython, by passing the right flags for each platform |
|
61 | 61 | if sys.platform.startswith('linux'): |
|
62 | 62 | ls_aliases = [('ls', 'ls -F --color'), |
|
63 | 63 | # long ls |
|
64 | 64 | ('ll', 'ls -F -o --color'), |
|
65 | 65 | # ls normal files only |
|
66 | 66 | ('lf', 'ls -F -o --color %l | grep ^-'), |
|
67 | 67 | # ls symbolic links |
|
68 | 68 | ('lk', 'ls -F -o --color %l | grep ^l'), |
|
69 | 69 | # directories or links to directories, |
|
70 | 70 | ('ldir', 'ls -F -o --color %l | grep /$'), |
|
71 | 71 | # things which are executable |
|
72 | 72 | ('lx', 'ls -F -o --color %l | grep ^-..x'), |
|
73 | 73 | ] |
|
74 | 74 | else: |
|
75 | 75 | # BSD, OSX, etc. |
|
76 | 76 | ls_aliases = [('ls', 'ls -F'), |
|
77 | 77 | # long ls |
|
78 | 78 | ('ll', 'ls -F -l'), |
|
79 | 79 | # ls normal files only |
|
80 | 80 | ('lf', 'ls -F -l %l | grep ^-'), |
|
81 | 81 | # ls symbolic links |
|
82 | 82 | ('lk', 'ls -F -l %l | grep ^l'), |
|
83 | 83 | # directories or links to directories, |
|
84 | 84 | ('ldir', 'ls -F -l %l | grep /$'), |
|
85 | 85 | # things which are executable |
|
86 | 86 | ('lx', 'ls -F -l %l | grep ^-..x'), |
|
87 | 87 | ] |
|
88 | 88 | default_aliases = default_aliases + ls_aliases |
|
89 | 89 | elif os.name in ['nt', 'dos']: |
|
90 | 90 | default_aliases = [('ls', 'dir /on'), |
|
91 | 91 | ('ddir', 'dir /ad /on'), ('ldir', 'dir /ad /on'), |
|
92 | 92 | ('mkdir', 'mkdir'), ('rmdir', 'rmdir'), |
|
93 | 93 | ('echo', 'echo'), ('ren', 'ren'), ('copy', 'copy'), |
|
94 | 94 | ] |
|
95 | 95 | else: |
|
96 | 96 | default_aliases = [] |
|
97 | 97 | |
|
98 | 98 | return default_aliases |
|
99 | 99 | |
|
100 | 100 | |
|
101 | 101 | class AliasError(Exception): |
|
102 | 102 | pass |
|
103 | 103 | |
|
104 | 104 | |
|
105 | 105 | class InvalidAliasError(AliasError): |
|
106 | 106 | pass |
|
107 | 107 | |
|
108 | 108 | #----------------------------------------------------------------------------- |
|
109 | 109 | # Main AliasManager class |
|
110 | 110 | #----------------------------------------------------------------------------- |
|
111 | 111 | |
|
112 | 112 | class AliasManager(Configurable): |
|
113 | 113 | |
|
114 | 114 | default_aliases = List(default_aliases(), config=True) |
|
115 | 115 | user_aliases = List(default_value=[], config=True) |
|
116 | 116 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
117 | 117 | |
|
118 | 118 | def __init__(self, shell=None, config=None): |
|
119 | 119 | super(AliasManager, self).__init__(shell=shell, config=config) |
|
120 | 120 | self.alias_table = {} |
|
121 | 121 | self.exclude_aliases() |
|
122 | 122 | self.init_aliases() |
|
123 | 123 | |
|
124 | 124 | def __contains__(self, name): |
|
125 | 125 | return name in self.alias_table |
|
126 | 126 | |
|
127 | 127 | @property |
|
128 | 128 | def aliases(self): |
|
129 | 129 | return [(item[0], item[1][1]) for item in self.alias_table.iteritems()] |
|
130 | 130 | |
|
131 | 131 | def exclude_aliases(self): |
|
132 | 132 | # set of things NOT to alias (keywords, builtins and some magics) |
|
133 | 133 | no_alias = set(['cd','popd','pushd','dhist','alias','unalias']) |
|
134 | 134 | no_alias.update(set(keyword.kwlist)) |
|
135 | 135 | no_alias.update(set(__builtin__.__dict__.keys())) |
|
136 | 136 | self.no_alias = no_alias |
|
137 | 137 | |
|
138 | 138 | def init_aliases(self): |
|
139 | 139 | # Load default aliases |
|
140 | 140 | for name, cmd in self.default_aliases: |
|
141 | 141 | self.soft_define_alias(name, cmd) |
|
142 | 142 | |
|
143 | 143 | # Load user aliases |
|
144 | 144 | for name, cmd in self.user_aliases: |
|
145 | 145 | self.soft_define_alias(name, cmd) |
|
146 | 146 | |
|
147 | 147 | def clear_aliases(self): |
|
148 | 148 | self.alias_table.clear() |
|
149 | 149 | |
|
150 | 150 | def soft_define_alias(self, name, cmd): |
|
151 | 151 | """Define an alias, but don't raise on an AliasError.""" |
|
152 | 152 | try: |
|
153 | 153 | self.define_alias(name, cmd) |
|
154 | 154 | except AliasError, e: |
|
155 | 155 | error("Invalid alias: %s" % e) |
|
156 | 156 | |
|
157 | 157 | def define_alias(self, name, cmd): |
|
158 | 158 | """Define a new alias after validating it. |
|
159 | 159 | |
|
160 | 160 | This will raise an :exc:`AliasError` if there are validation |
|
161 | 161 | problems. |
|
162 | 162 | """ |
|
163 | 163 | nargs = self.validate_alias(name, cmd) |
|
164 | 164 | self.alias_table[name] = (nargs, cmd) |
|
165 | 165 | |
|
166 | 166 | def undefine_alias(self, name): |
|
167 | 167 | if self.alias_table.has_key(name): |
|
168 | 168 | del self.alias_table[name] |
|
169 | 169 | |
|
170 | 170 | def validate_alias(self, name, cmd): |
|
171 | 171 | """Validate an alias and return the its number of arguments.""" |
|
172 | 172 | if name in self.no_alias: |
|
173 | 173 | raise InvalidAliasError("The name %s can't be aliased " |
|
174 | 174 | "because it is a keyword or builtin." % name) |
|
175 | 175 | if not (isinstance(cmd, basestring)): |
|
176 | 176 | raise InvalidAliasError("An alias command must be a string, " |
|
177 | 177 | "got: %r" % cmd) |
|
178 | 178 | nargs = cmd.count('%s') |
|
179 | 179 | if nargs>0 and cmd.find('%l')>=0: |
|
180 | 180 | raise InvalidAliasError('The %s and %l specifiers are mutually ' |
|
181 | 181 | 'exclusive in alias definitions.') |
|
182 | 182 | return nargs |
|
183 | 183 | |
|
184 | 184 | def call_alias(self, alias, rest=''): |
|
185 | 185 | """Call an alias given its name and the rest of the line.""" |
|
186 | 186 | cmd = self.transform_alias(alias, rest) |
|
187 | 187 | try: |
|
188 | 188 | self.shell.system(cmd) |
|
189 | 189 | except: |
|
190 | 190 | self.shell.showtraceback() |
|
191 | 191 | |
|
192 | 192 | def transform_alias(self, alias,rest=''): |
|
193 | 193 | """Transform alias to system command string.""" |
|
194 | 194 | nargs, cmd = self.alias_table[alias] |
|
195 | 195 | |
|
196 | 196 | if ' ' in cmd and os.path.isfile(cmd): |
|
197 | 197 | cmd = '"%s"' % cmd |
|
198 | 198 | |
|
199 | 199 | # Expand the %l special to be the user's input line |
|
200 | 200 | if cmd.find('%l') >= 0: |
|
201 | 201 | cmd = cmd.replace('%l', rest) |
|
202 | 202 | rest = '' |
|
203 | 203 | if nargs==0: |
|
204 | 204 | # Simple, argument-less aliases |
|
205 | 205 | cmd = '%s %s' % (cmd, rest) |
|
206 | 206 | else: |
|
207 | 207 | # Handle aliases with positional arguments |
|
208 | 208 | args = rest.split(None, nargs) |
|
209 | 209 | if len(args) < nargs: |
|
210 | 210 | raise AliasError('Alias <%s> requires %s arguments, %s given.' % |
|
211 | 211 | (alias, nargs, len(args))) |
|
212 | 212 | cmd = '%s %s' % (cmd % tuple(args[:nargs]),' '.join(args[nargs:])) |
|
213 | 213 | return cmd |
|
214 | 214 | |
|
215 | 215 | def expand_alias(self, line): |
|
216 | 216 | """ Expand an alias in the command line |
|
217 | 217 | |
|
218 | 218 | Returns the provided command line, possibly with the first word |
|
219 | 219 | (command) translated according to alias expansion rules. |
|
220 | 220 | |
|
221 | 221 | [ipython]|16> _ip.expand_aliases("np myfile.txt") |
|
222 | 222 | <16> 'q:/opt/np/notepad++.exe myfile.txt' |
|
223 | 223 | """ |
|
224 | 224 | |
|
225 | 225 | pre,_,fn,rest = split_user_input(line) |
|
226 | 226 | res = pre + self.expand_aliases(fn, rest) |
|
227 | 227 | return res |
|
228 | 228 | |
|
229 | 229 | def expand_aliases(self, fn, rest): |
|
230 | 230 | """Expand multiple levels of aliases: |
|
231 | 231 | |
|
232 | 232 | if: |
|
233 | 233 | |
|
234 | 234 | alias foo bar /tmp |
|
235 | 235 | alias baz foo |
|
236 | 236 | |
|
237 | 237 | then: |
|
238 | 238 | |
|
239 | 239 | baz huhhahhei -> bar /tmp huhhahhei |
|
240 | 240 | """ |
|
241 | 241 | line = fn + " " + rest |
|
242 | 242 | |
|
243 | 243 | done = set() |
|
244 | 244 | while 1: |
|
245 | 245 | pre,_,fn,rest = split_user_input(line, shell_line_split) |
|
246 | 246 | if fn in self.alias_table: |
|
247 | 247 | if fn in done: |
|
248 | 248 | warn("Cyclic alias definition, repeated '%s'" % fn) |
|
249 | 249 | return "" |
|
250 | 250 | done.add(fn) |
|
251 | 251 | |
|
252 | 252 | l2 = self.transform_alias(fn, rest) |
|
253 | 253 | if l2 == line: |
|
254 | 254 | break |
|
255 | 255 | # ls -> ls -F should not recurse forever |
|
256 | 256 | if l2.split(None,1)[0] == line.split(None,1)[0]: |
|
257 | 257 | line = l2 |
|
258 | 258 | break |
|
259 | 259 | line=l2 |
|
260 | 260 | else: |
|
261 | 261 | break |
|
262 | 262 | |
|
263 | 263 | return line |
@@ -1,70 +1,70 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Autocall capabilities for IPython.core. |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Brian Granger |
|
8 | 8 | * Fernando Perez |
|
9 | 9 | * Thomas Kluyver |
|
10 | 10 | |
|
11 | 11 | Notes |
|
12 | 12 | ----- |
|
13 | 13 | """ |
|
14 | 14 | |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 |
# Copyright (C) 2008-20 |
|
|
16 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
17 | 17 | # |
|
18 | 18 | # Distributed under the terms of the BSD License. The full license is in |
|
19 | 19 | # the file COPYING, distributed as part of this software. |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | # Imports |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | |
|
26 | 26 | |
|
27 | 27 | #----------------------------------------------------------------------------- |
|
28 | 28 | # Code |
|
29 | 29 | #----------------------------------------------------------------------------- |
|
30 | 30 | |
|
31 | 31 | class IPyAutocall(object): |
|
32 | 32 | """ Instances of this class are always autocalled |
|
33 | 33 | |
|
34 | 34 | This happens regardless of 'autocall' variable state. Use this to |
|
35 | 35 | develop macro-like mechanisms. |
|
36 | 36 | """ |
|
37 | 37 | _ip = None |
|
38 | 38 | rewrite = True |
|
39 | 39 | def __init__(self, ip=None): |
|
40 | 40 | self._ip = ip |
|
41 | 41 | |
|
42 | 42 | def set_ip(self, ip): |
|
43 | 43 | """ Will be used to set _ip point to current ipython instance b/f call |
|
44 | 44 | |
|
45 | 45 | Override this method if you don't want this to happen. |
|
46 | 46 | |
|
47 | 47 | """ |
|
48 | 48 | self._ip = ip |
|
49 | 49 | |
|
50 | 50 | |
|
51 | 51 | class ExitAutocall(IPyAutocall): |
|
52 | 52 | """An autocallable object which will be added to the user namespace so that |
|
53 | 53 | exit, exit(), quit or quit() are all valid ways to close the shell.""" |
|
54 | 54 | rewrite = False |
|
55 | 55 | |
|
56 | 56 | def __call__(self): |
|
57 | 57 | self._ip.ask_exit() |
|
58 | 58 | |
|
59 | 59 | class ZMQExitAutocall(ExitAutocall): |
|
60 | 60 | """Exit IPython. Autocallable, so it needn't be explicitly called. |
|
61 | 61 | |
|
62 | 62 | Parameters |
|
63 | 63 | ---------- |
|
64 | 64 | keep_kernel : bool |
|
65 | 65 | If True, leave the kernel alive. Otherwise, tell the kernel to exit too |
|
66 | 66 | (default). |
|
67 | 67 | """ |
|
68 | 68 | def __call__(self, keep_kernel=False): |
|
69 | 69 | self._ip.keepkernel_on_exit = keep_kernel |
|
70 | 70 | self._ip.ask_exit() |
@@ -1,128 +1,128 b'' | |||
|
1 | 1 | """ |
|
2 | 2 | A context manager for managing things injected into :mod:`__builtin__`. |
|
3 | 3 | |
|
4 | 4 | Authors: |
|
5 | 5 | |
|
6 | 6 | * Brian Granger |
|
7 | 7 | * Fernando Perez |
|
8 | 8 | """ |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 | # Copyright (C) 2010 The IPython Development Team. | |
|
10 | # Copyright (C) 2010-2011 The IPython Development Team. | |
|
11 | 11 | # |
|
12 | 12 | # Distributed under the terms of the BSD License. |
|
13 | 13 | # |
|
14 | 14 | # Complete license in the file COPYING.txt, distributed with this software. |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | # Imports |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | |
|
21 | 21 | import __builtin__ |
|
22 | 22 | |
|
23 | 23 | from IPython.config.configurable import Configurable |
|
24 | 24 | |
|
25 | 25 | from IPython.utils.traitlets import Instance |
|
26 | 26 | |
|
27 | 27 | #----------------------------------------------------------------------------- |
|
28 | 28 | # Classes and functions |
|
29 | 29 | #----------------------------------------------------------------------------- |
|
30 | 30 | |
|
31 | 31 | class __BuiltinUndefined(object): pass |
|
32 | 32 | BuiltinUndefined = __BuiltinUndefined() |
|
33 | 33 | |
|
34 | 34 | class __HideBuiltin(object): pass |
|
35 | 35 | HideBuiltin = __HideBuiltin() |
|
36 | 36 | |
|
37 | 37 | |
|
38 | 38 | class BuiltinTrap(Configurable): |
|
39 | 39 | |
|
40 | 40 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
41 | 41 | |
|
42 | 42 | def __init__(self, shell=None): |
|
43 | 43 | super(BuiltinTrap, self).__init__(shell=shell, config=None) |
|
44 | 44 | self._orig_builtins = {} |
|
45 | 45 | # We define this to track if a single BuiltinTrap is nested. |
|
46 | 46 | # Only turn off the trap when the outermost call to __exit__ is made. |
|
47 | 47 | self._nested_level = 0 |
|
48 | 48 | self.shell = shell |
|
49 | 49 | # builtins we always add - if set to HideBuiltin, they will just |
|
50 | 50 | # be removed instead of being replaced by something else |
|
51 | 51 | self.auto_builtins = {'exit': HideBuiltin, |
|
52 | 52 | 'quit': HideBuiltin, |
|
53 | 53 | 'get_ipython': self.shell.get_ipython, |
|
54 | 54 | } |
|
55 | 55 | # Recursive reload function |
|
56 | 56 | try: |
|
57 | 57 | from IPython.lib import deepreload |
|
58 | 58 | if self.shell.deep_reload: |
|
59 | 59 | self.auto_builtins['reload'] = deepreload.reload |
|
60 | 60 | else: |
|
61 | 61 | self.auto_builtins['dreload']= deepreload.reload |
|
62 | 62 | except ImportError: |
|
63 | 63 | pass |
|
64 | 64 | |
|
65 | 65 | def __enter__(self): |
|
66 | 66 | if self._nested_level == 0: |
|
67 | 67 | self.activate() |
|
68 | 68 | self._nested_level += 1 |
|
69 | 69 | # I return self, so callers can use add_builtin in a with clause. |
|
70 | 70 | return self |
|
71 | 71 | |
|
72 | 72 | def __exit__(self, type, value, traceback): |
|
73 | 73 | if self._nested_level == 1: |
|
74 | 74 | self.deactivate() |
|
75 | 75 | self._nested_level -= 1 |
|
76 | 76 | # Returning False will cause exceptions to propagate |
|
77 | 77 | return False |
|
78 | 78 | |
|
79 | 79 | def add_builtin(self, key, value): |
|
80 | 80 | """Add a builtin and save the original.""" |
|
81 | 81 | bdict = __builtin__.__dict__ |
|
82 | 82 | orig = bdict.get(key, BuiltinUndefined) |
|
83 | 83 | if value is HideBuiltin: |
|
84 | 84 | if orig is not BuiltinUndefined: #same as 'key in bdict' |
|
85 | 85 | self._orig_builtins[key] = orig |
|
86 | 86 | del bdict[key] |
|
87 | 87 | else: |
|
88 | 88 | self._orig_builtins[key] = orig |
|
89 | 89 | bdict[key] = value |
|
90 | 90 | |
|
91 | 91 | def remove_builtin(self, key): |
|
92 | 92 | """Remove an added builtin and re-set the original.""" |
|
93 | 93 | try: |
|
94 | 94 | orig = self._orig_builtins.pop(key) |
|
95 | 95 | except KeyError: |
|
96 | 96 | pass |
|
97 | 97 | else: |
|
98 | 98 | if orig is BuiltinUndefined: |
|
99 | 99 | del __builtin__.__dict__[key] |
|
100 | 100 | else: |
|
101 | 101 | __builtin__.__dict__[key] = orig |
|
102 | 102 | |
|
103 | 103 | def activate(self): |
|
104 | 104 | """Store ipython references in the __builtin__ namespace.""" |
|
105 | 105 | |
|
106 | 106 | add_builtin = self.add_builtin |
|
107 | 107 | for name, func in self.auto_builtins.iteritems(): |
|
108 | 108 | add_builtin(name, func) |
|
109 | 109 | |
|
110 | 110 | # Keep in the builtins a flag for when IPython is active. We set it |
|
111 | 111 | # with setdefault so that multiple nested IPythons don't clobber one |
|
112 | 112 | # another. |
|
113 | 113 | __builtin__.__dict__.setdefault('__IPYTHON__active', 0) |
|
114 | 114 | |
|
115 | 115 | def deactivate(self): |
|
116 | 116 | """Remove any builtins which might have been added by add_builtins, or |
|
117 | 117 | restore overwritten ones to their previous values.""" |
|
118 | 118 | # Note: must iterate over a static keys() list because we'll be |
|
119 | 119 | # mutating the dict itself |
|
120 | 120 | remove_builtin = self.remove_builtin |
|
121 | 121 | for key in self._orig_builtins.keys(): |
|
122 | 122 | remove_builtin(key) |
|
123 | 123 | self._orig_builtins.clear() |
|
124 | 124 | self._builtins_added = False |
|
125 | 125 | try: |
|
126 | 126 | del __builtin__.__dict__['__IPYTHON__active'] |
|
127 | 127 | except KeyError: |
|
128 | 128 | pass |
@@ -1,131 +1,131 b'' | |||
|
1 | 1 | """Compiler tools with improved interactive support. |
|
2 | 2 | |
|
3 | 3 | Provides compilation machinery similar to codeop, but with caching support so |
|
4 | 4 | we can provide interactive tracebacks. |
|
5 | 5 | |
|
6 | 6 | Authors |
|
7 | 7 | ------- |
|
8 | 8 | * Robert Kern |
|
9 | 9 | * Fernando Perez |
|
10 | 10 | * Thomas Kluyver |
|
11 | 11 | """ |
|
12 | 12 | |
|
13 | 13 | # Note: though it might be more natural to name this module 'compiler', that |
|
14 | 14 | # name is in the stdlib and name collisions with the stdlib tend to produce |
|
15 | 15 | # weird problems (often with third-party tools). |
|
16 | 16 | |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | # Copyright (C) 2010 The IPython Development Team. | |
|
18 | # Copyright (C) 2010-2011 The IPython Development Team. | |
|
19 | 19 | # |
|
20 | 20 | # Distributed under the terms of the BSD License. |
|
21 | 21 | # |
|
22 | 22 | # The full license is in the file COPYING.txt, distributed with this software. |
|
23 | 23 | #----------------------------------------------------------------------------- |
|
24 | 24 | |
|
25 | 25 | #----------------------------------------------------------------------------- |
|
26 | 26 | # Imports |
|
27 | 27 | #----------------------------------------------------------------------------- |
|
28 | 28 | from __future__ import print_function |
|
29 | 29 | |
|
30 | 30 | # Stdlib imports |
|
31 | 31 | from ast import PyCF_ONLY_AST |
|
32 | 32 | import codeop |
|
33 | 33 | import hashlib |
|
34 | 34 | import linecache |
|
35 | 35 | import time |
|
36 | 36 | |
|
37 | 37 | #----------------------------------------------------------------------------- |
|
38 | 38 | # Local utilities |
|
39 | 39 | #----------------------------------------------------------------------------- |
|
40 | 40 | |
|
41 | 41 | def code_name(code, number=0): |
|
42 | 42 | """ Compute a (probably) unique name for code for caching. |
|
43 | 43 | |
|
44 | 44 | This now expects code to be unicode. |
|
45 | 45 | """ |
|
46 | 46 | hash_digest = hashlib.md5(code.encode("utf-8")).hexdigest() |
|
47 | 47 | # Include the number and 12 characters of the hash in the name. It's |
|
48 | 48 | # pretty much impossible that in a single session we'll have collisions |
|
49 | 49 | # even with truncated hashes, and the full one makes tracebacks too long |
|
50 | 50 | return '<ipython-input-{0}-{1}>'.format(number, hash_digest[:12]) |
|
51 | 51 | |
|
52 | 52 | #----------------------------------------------------------------------------- |
|
53 | 53 | # Classes and functions |
|
54 | 54 | #----------------------------------------------------------------------------- |
|
55 | 55 | |
|
56 | 56 | class CachingCompiler(codeop.Compile): |
|
57 | 57 | """A compiler that caches code compiled from interactive statements. |
|
58 | 58 | """ |
|
59 | 59 | |
|
60 | 60 | def __init__(self): |
|
61 | 61 | codeop.Compile.__init__(self) |
|
62 | 62 | |
|
63 | 63 | # This is ugly, but it must be done this way to allow multiple |
|
64 | 64 | # simultaneous ipython instances to coexist. Since Python itself |
|
65 | 65 | # directly accesses the data structures in the linecache module, and |
|
66 | 66 | # the cache therein is global, we must work with that data structure. |
|
67 | 67 | # We must hold a reference to the original checkcache routine and call |
|
68 | 68 | # that in our own check_cache() below, but the special IPython cache |
|
69 | 69 | # must also be shared by all IPython instances. If we were to hold |
|
70 | 70 | # separate caches (one in each CachingCompiler instance), any call made |
|
71 | 71 | # by Python itself to linecache.checkcache() would obliterate the |
|
72 | 72 | # cached data from the other IPython instances. |
|
73 | 73 | if not hasattr(linecache, '_ipython_cache'): |
|
74 | 74 | linecache._ipython_cache = {} |
|
75 | 75 | if not hasattr(linecache, '_checkcache_ori'): |
|
76 | 76 | linecache._checkcache_ori = linecache.checkcache |
|
77 | 77 | # Now, we must monkeypatch the linecache directly so that parts of the |
|
78 | 78 | # stdlib that call it outside our control go through our codepath |
|
79 | 79 | # (otherwise we'd lose our tracebacks). |
|
80 | 80 | linecache.checkcache = self.check_cache |
|
81 | 81 | |
|
82 | 82 | def ast_parse(self, source, filename='<unknown>', symbol='exec'): |
|
83 | 83 | """Parse code to an AST with the current compiler flags active. |
|
84 | 84 | |
|
85 | 85 | Arguments are exactly the same as ast.parse (in the standard library), |
|
86 | 86 | and are passed to the built-in compile function.""" |
|
87 | 87 | return compile(source, filename, symbol, self.flags | PyCF_ONLY_AST, 1) |
|
88 | 88 | |
|
89 | 89 | def reset_compiler_flags(self): |
|
90 | 90 | """Reset compiler flags to default state.""" |
|
91 | 91 | # This value is copied from codeop.Compile.__init__, so if that ever |
|
92 | 92 | # changes, it will need to be updated. |
|
93 | 93 | self.flags = codeop.PyCF_DONT_IMPLY_DEDENT |
|
94 | 94 | |
|
95 | 95 | @property |
|
96 | 96 | def compiler_flags(self): |
|
97 | 97 | """Flags currently active in the compilation process. |
|
98 | 98 | """ |
|
99 | 99 | return self.flags |
|
100 | 100 | |
|
101 | 101 | def cache(self, code, number=0): |
|
102 | 102 | """Make a name for a block of code, and cache the code. |
|
103 | 103 | |
|
104 | 104 | Parameters |
|
105 | 105 | ---------- |
|
106 | 106 | code : str |
|
107 | 107 | The Python source code to cache. |
|
108 | 108 | number : int |
|
109 | 109 | A number which forms part of the code's name. Used for the execution |
|
110 | 110 | counter. |
|
111 | 111 | |
|
112 | 112 | Returns |
|
113 | 113 | ------- |
|
114 | 114 | The name of the cached code (as a string). Pass this as the filename |
|
115 | 115 | argument to compilation, so that tracebacks are correctly hooked up. |
|
116 | 116 | """ |
|
117 | 117 | name = code_name(code, number) |
|
118 | 118 | entry = (len(code), time.time(), |
|
119 | 119 | [line+'\n' for line in code.splitlines()], name) |
|
120 | 120 | linecache.cache[name] = entry |
|
121 | 121 | linecache._ipython_cache[name] = entry |
|
122 | 122 | return name |
|
123 | 123 | |
|
124 | 124 | def check_cache(self, *args): |
|
125 | 125 | """Call linecache.checkcache() safely protecting our cached values. |
|
126 | 126 | """ |
|
127 | 127 | # First call the orignal checkcache as intended |
|
128 | 128 | linecache._checkcache_ori(*args) |
|
129 | 129 | # Then, update back the cache with our data, so that tracebacks related |
|
130 | 130 | # to our compiled codes can be produced. |
|
131 | 131 | linecache.cache.update(linecache._ipython_cache) |
@@ -1,925 +1,925 b'' | |||
|
1 | 1 | """Word completion for IPython. |
|
2 | 2 | |
|
3 | 3 | This module is a fork of the rlcompleter module in the Python standard |
|
4 | 4 | library. The original enhancements made to rlcompleter have been sent |
|
5 | 5 | upstream and were accepted as of Python 2.3, but we need a lot more |
|
6 | 6 | functionality specific to IPython, so this module will continue to live as an |
|
7 | 7 | IPython-specific utility. |
|
8 | 8 | |
|
9 | 9 | Original rlcompleter documentation: |
|
10 | 10 | |
|
11 | 11 | This requires the latest extension to the readline module (the |
|
12 | 12 | completes keywords, built-ins and globals in __main__; when completing |
|
13 | 13 | NAME.NAME..., it evaluates (!) the expression up to the last dot and |
|
14 | 14 | completes its attributes. |
|
15 | 15 | |
|
16 | 16 | It's very cool to do "import string" type "string.", hit the |
|
17 | 17 | completion key (twice), and see the list of names defined by the |
|
18 | 18 | string module! |
|
19 | 19 | |
|
20 | 20 | Tip: to use the tab key as the completion key, call |
|
21 | 21 | |
|
22 | 22 | readline.parse_and_bind("tab: complete") |
|
23 | 23 | |
|
24 | 24 | Notes: |
|
25 | 25 | |
|
26 | 26 | - Exceptions raised by the completer function are *ignored* (and |
|
27 | 27 | generally cause the completion to fail). This is a feature -- since |
|
28 | 28 | readline sets the tty device in raw (or cbreak) mode, printing a |
|
29 | 29 | traceback wouldn't work well without some complicated hoopla to save, |
|
30 | 30 | reset and restore the tty state. |
|
31 | 31 | |
|
32 | 32 | - The evaluation of the NAME.NAME... form may cause arbitrary |
|
33 | 33 | application defined code to be executed if an object with a |
|
34 | 34 | __getattr__ hook is found. Since it is the responsibility of the |
|
35 | 35 | application (or the user) to enable this feature, I consider this an |
|
36 | 36 | acceptable risk. More complicated expressions (e.g. function calls or |
|
37 | 37 | indexing operations) are *not* evaluated. |
|
38 | 38 | |
|
39 | 39 | - GNU readline is also used by the built-in functions input() and |
|
40 | 40 | raw_input(), and thus these also benefit/suffer from the completer |
|
41 | 41 | features. Clearly an interactive application can benefit by |
|
42 | 42 | specifying its own completer function and using raw_input() for all |
|
43 | 43 | its input. |
|
44 | 44 | |
|
45 | 45 | - When the original stdin is not a tty device, GNU readline is never |
|
46 | 46 | used, and this module (and the readline module) are silently inactive. |
|
47 | 47 | """ |
|
48 | 48 | |
|
49 | 49 | #***************************************************************************** |
|
50 | 50 | # |
|
51 | 51 | # Since this file is essentially a minimally modified copy of the rlcompleter |
|
52 | 52 | # module which is part of the standard Python distribution, I assume that the |
|
53 | 53 | # proper procedure is to maintain its copyright as belonging to the Python |
|
54 | 54 | # Software Foundation (in addition to my own, for all new code). |
|
55 | 55 | # |
|
56 |
# Copyright (C) 2008-201 |
|
|
56 | # Copyright (C) 2008-2011 IPython Development Team | |
|
57 | 57 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
58 | 58 | # Copyright (C) 2001 Python Software Foundation, www.python.org |
|
59 | 59 | # |
|
60 | 60 | # Distributed under the terms of the BSD License. The full license is in |
|
61 | 61 | # the file COPYING, distributed as part of this software. |
|
62 | 62 | # |
|
63 | 63 | #***************************************************************************** |
|
64 | 64 | from __future__ import print_function |
|
65 | 65 | |
|
66 | 66 | #----------------------------------------------------------------------------- |
|
67 | 67 | # Imports |
|
68 | 68 | #----------------------------------------------------------------------------- |
|
69 | 69 | |
|
70 | 70 | import __builtin__ |
|
71 | 71 | import __main__ |
|
72 | 72 | import glob |
|
73 | 73 | import inspect |
|
74 | 74 | import itertools |
|
75 | 75 | import keyword |
|
76 | 76 | import os |
|
77 | 77 | import re |
|
78 | 78 | import shlex |
|
79 | 79 | import sys |
|
80 | 80 | |
|
81 | 81 | from IPython.config.configurable import Configurable |
|
82 | 82 | from IPython.core.error import TryNext |
|
83 | 83 | from IPython.core.prefilter import ESC_MAGIC |
|
84 | 84 | from IPython.utils import generics |
|
85 | 85 | from IPython.utils import io |
|
86 | 86 | from IPython.utils.dir2 import dir2 |
|
87 | 87 | from IPython.utils.process import arg_split |
|
88 | 88 | from IPython.utils.traitlets import CBool, Enum |
|
89 | 89 | |
|
90 | 90 | #----------------------------------------------------------------------------- |
|
91 | 91 | # Globals |
|
92 | 92 | #----------------------------------------------------------------------------- |
|
93 | 93 | |
|
94 | 94 | # Public API |
|
95 | 95 | __all__ = ['Completer','IPCompleter'] |
|
96 | 96 | |
|
97 | 97 | if sys.platform == 'win32': |
|
98 | 98 | PROTECTABLES = ' ' |
|
99 | 99 | else: |
|
100 | 100 | PROTECTABLES = ' ()[]{}?=\\|;:\'#*"^&' |
|
101 | 101 | |
|
102 | 102 | #----------------------------------------------------------------------------- |
|
103 | 103 | # Main functions and classes |
|
104 | 104 | #----------------------------------------------------------------------------- |
|
105 | 105 | |
|
106 | 106 | def has_open_quotes(s): |
|
107 | 107 | """Return whether a string has open quotes. |
|
108 | 108 | |
|
109 | 109 | This simply counts whether the number of quote characters of either type in |
|
110 | 110 | the string is odd. |
|
111 | 111 | |
|
112 | 112 | Returns |
|
113 | 113 | ------- |
|
114 | 114 | If there is an open quote, the quote character is returned. Else, return |
|
115 | 115 | False. |
|
116 | 116 | """ |
|
117 | 117 | # We check " first, then ', so complex cases with nested quotes will get |
|
118 | 118 | # the " to take precedence. |
|
119 | 119 | if s.count('"') % 2: |
|
120 | 120 | return '"' |
|
121 | 121 | elif s.count("'") % 2: |
|
122 | 122 | return "'" |
|
123 | 123 | else: |
|
124 | 124 | return False |
|
125 | 125 | |
|
126 | 126 | |
|
127 | 127 | def protect_filename(s): |
|
128 | 128 | """Escape a string to protect certain characters.""" |
|
129 | 129 | |
|
130 | 130 | return "".join([(ch in PROTECTABLES and '\\' + ch or ch) |
|
131 | 131 | for ch in s]) |
|
132 | 132 | |
|
133 | 133 | |
|
134 | 134 | def mark_dirs(matches): |
|
135 | 135 | """Mark directories in input list by appending '/' to their names.""" |
|
136 | 136 | out = [] |
|
137 | 137 | isdir = os.path.isdir |
|
138 | 138 | for x in matches: |
|
139 | 139 | if isdir(x): |
|
140 | 140 | out.append(x+'/') |
|
141 | 141 | else: |
|
142 | 142 | out.append(x) |
|
143 | 143 | return out |
|
144 | 144 | |
|
145 | 145 | |
|
146 | 146 | def expand_user(path): |
|
147 | 147 | """Expand '~'-style usernames in strings. |
|
148 | 148 | |
|
149 | 149 | This is similar to :func:`os.path.expanduser`, but it computes and returns |
|
150 | 150 | extra information that will be useful if the input was being used in |
|
151 | 151 | computing completions, and you wish to return the completions with the |
|
152 | 152 | original '~' instead of its expanded value. |
|
153 | 153 | |
|
154 | 154 | Parameters |
|
155 | 155 | ---------- |
|
156 | 156 | path : str |
|
157 | 157 | String to be expanded. If no ~ is present, the output is the same as the |
|
158 | 158 | input. |
|
159 | 159 | |
|
160 | 160 | Returns |
|
161 | 161 | ------- |
|
162 | 162 | newpath : str |
|
163 | 163 | Result of ~ expansion in the input path. |
|
164 | 164 | tilde_expand : bool |
|
165 | 165 | Whether any expansion was performed or not. |
|
166 | 166 | tilde_val : str |
|
167 | 167 | The value that ~ was replaced with. |
|
168 | 168 | """ |
|
169 | 169 | # Default values |
|
170 | 170 | tilde_expand = False |
|
171 | 171 | tilde_val = '' |
|
172 | 172 | newpath = path |
|
173 | 173 | |
|
174 | 174 | if path.startswith('~'): |
|
175 | 175 | tilde_expand = True |
|
176 | 176 | rest = len(path)-1 |
|
177 | 177 | newpath = os.path.expanduser(path) |
|
178 | 178 | if rest: |
|
179 | 179 | tilde_val = newpath[:-rest] |
|
180 | 180 | else: |
|
181 | 181 | tilde_val = newpath |
|
182 | 182 | |
|
183 | 183 | return newpath, tilde_expand, tilde_val |
|
184 | 184 | |
|
185 | 185 | |
|
186 | 186 | def compress_user(path, tilde_expand, tilde_val): |
|
187 | 187 | """Does the opposite of expand_user, with its outputs. |
|
188 | 188 | """ |
|
189 | 189 | if tilde_expand: |
|
190 | 190 | return path.replace(tilde_val, '~') |
|
191 | 191 | else: |
|
192 | 192 | return path |
|
193 | 193 | |
|
194 | 194 | |
|
195 | 195 | def single_dir_expand(matches): |
|
196 | 196 | "Recursively expand match lists containing a single dir." |
|
197 | 197 | |
|
198 | 198 | if len(matches) == 1 and os.path.isdir(matches[0]): |
|
199 | 199 | # Takes care of links to directories also. Use '/' |
|
200 | 200 | # explicitly, even under Windows, so that name completions |
|
201 | 201 | # don't end up escaped. |
|
202 | 202 | d = matches[0] |
|
203 | 203 | if d[-1] in ['/','\\']: |
|
204 | 204 | d = d[:-1] |
|
205 | 205 | |
|
206 | 206 | subdirs = os.listdir(d) |
|
207 | 207 | if subdirs: |
|
208 | 208 | matches = [ (d + '/' + p) for p in subdirs] |
|
209 | 209 | return single_dir_expand(matches) |
|
210 | 210 | else: |
|
211 | 211 | return matches |
|
212 | 212 | else: |
|
213 | 213 | return matches |
|
214 | 214 | |
|
215 | 215 | |
|
216 | 216 | class Bunch(object): pass |
|
217 | 217 | |
|
218 | 218 | DELIMS = ' \t\n`!@#$^&*()=+[{]}\\|;:\'",<>?' |
|
219 | 219 | GREEDY_DELIMS = ' \r\n' |
|
220 | 220 | |
|
221 | 221 | class CompletionSplitter(object): |
|
222 | 222 | """An object to split an input line in a manner similar to readline. |
|
223 | 223 | |
|
224 | 224 | By having our own implementation, we can expose readline-like completion in |
|
225 | 225 | a uniform manner to all frontends. This object only needs to be given the |
|
226 | 226 | line of text to be split and the cursor position on said line, and it |
|
227 | 227 | returns the 'word' to be completed on at the cursor after splitting the |
|
228 | 228 | entire line. |
|
229 | 229 | |
|
230 | 230 | What characters are used as splitting delimiters can be controlled by |
|
231 | 231 | setting the `delims` attribute (this is a property that internally |
|
232 | 232 | automatically builds the necessary """ |
|
233 | 233 | |
|
234 | 234 | # Private interface |
|
235 | 235 | |
|
236 | 236 | # A string of delimiter characters. The default value makes sense for |
|
237 | 237 | # IPython's most typical usage patterns. |
|
238 | 238 | _delims = DELIMS |
|
239 | 239 | |
|
240 | 240 | # The expression (a normal string) to be compiled into a regular expression |
|
241 | 241 | # for actual splitting. We store it as an attribute mostly for ease of |
|
242 | 242 | # debugging, since this type of code can be so tricky to debug. |
|
243 | 243 | _delim_expr = None |
|
244 | 244 | |
|
245 | 245 | # The regular expression that does the actual splitting |
|
246 | 246 | _delim_re = None |
|
247 | 247 | |
|
248 | 248 | def __init__(self, delims=None): |
|
249 | 249 | delims = CompletionSplitter._delims if delims is None else delims |
|
250 | 250 | self.set_delims(delims) |
|
251 | 251 | |
|
252 | 252 | def set_delims(self, delims): |
|
253 | 253 | """Set the delimiters for line splitting.""" |
|
254 | 254 | expr = '[' + ''.join('\\'+ c for c in delims) + ']' |
|
255 | 255 | self._delim_re = re.compile(expr) |
|
256 | 256 | self._delims = delims |
|
257 | 257 | self._delim_expr = expr |
|
258 | 258 | |
|
259 | 259 | def get_delims(self): |
|
260 | 260 | """Return the string of delimiter characters.""" |
|
261 | 261 | return self._delims |
|
262 | 262 | |
|
263 | 263 | def split_line(self, line, cursor_pos=None): |
|
264 | 264 | """Split a line of text with a cursor at the given position. |
|
265 | 265 | """ |
|
266 | 266 | l = line if cursor_pos is None else line[:cursor_pos] |
|
267 | 267 | return self._delim_re.split(l)[-1] |
|
268 | 268 | |
|
269 | 269 | |
|
270 | 270 | class Completer(Configurable): |
|
271 | 271 | |
|
272 | 272 | greedy = CBool(False, config=True, |
|
273 | 273 | help="""Activate greedy completion |
|
274 | 274 | |
|
275 | 275 | This will enable completion on elements of lists, results of function calls, etc., |
|
276 | 276 | but can be unsafe because the code is actually evaluated on TAB. |
|
277 | 277 | """ |
|
278 | 278 | ) |
|
279 | 279 | |
|
280 | 280 | |
|
281 | 281 | def __init__(self, namespace=None, global_namespace=None, config=None, **kwargs): |
|
282 | 282 | """Create a new completer for the command line. |
|
283 | 283 | |
|
284 | 284 | Completer(namespace=ns,global_namespace=ns2) -> completer instance. |
|
285 | 285 | |
|
286 | 286 | If unspecified, the default namespace where completions are performed |
|
287 | 287 | is __main__ (technically, __main__.__dict__). Namespaces should be |
|
288 | 288 | given as dictionaries. |
|
289 | 289 | |
|
290 | 290 | An optional second namespace can be given. This allows the completer |
|
291 | 291 | to handle cases where both the local and global scopes need to be |
|
292 | 292 | distinguished. |
|
293 | 293 | |
|
294 | 294 | Completer instances should be used as the completion mechanism of |
|
295 | 295 | readline via the set_completer() call: |
|
296 | 296 | |
|
297 | 297 | readline.set_completer(Completer(my_namespace).complete) |
|
298 | 298 | """ |
|
299 | 299 | |
|
300 | 300 | # Don't bind to namespace quite yet, but flag whether the user wants a |
|
301 | 301 | # specific namespace or to use __main__.__dict__. This will allow us |
|
302 | 302 | # to bind to __main__.__dict__ at completion time, not now. |
|
303 | 303 | if namespace is None: |
|
304 | 304 | self.use_main_ns = 1 |
|
305 | 305 | else: |
|
306 | 306 | self.use_main_ns = 0 |
|
307 | 307 | self.namespace = namespace |
|
308 | 308 | |
|
309 | 309 | # The global namespace, if given, can be bound directly |
|
310 | 310 | if global_namespace is None: |
|
311 | 311 | self.global_namespace = {} |
|
312 | 312 | else: |
|
313 | 313 | self.global_namespace = global_namespace |
|
314 | 314 | |
|
315 | 315 | super(Completer, self).__init__(config=config, **kwargs) |
|
316 | 316 | |
|
317 | 317 | def complete(self, text, state): |
|
318 | 318 | """Return the next possible completion for 'text'. |
|
319 | 319 | |
|
320 | 320 | This is called successively with state == 0, 1, 2, ... until it |
|
321 | 321 | returns None. The completion should begin with 'text'. |
|
322 | 322 | |
|
323 | 323 | """ |
|
324 | 324 | if self.use_main_ns: |
|
325 | 325 | self.namespace = __main__.__dict__ |
|
326 | 326 | |
|
327 | 327 | if state == 0: |
|
328 | 328 | if "." in text: |
|
329 | 329 | self.matches = self.attr_matches(text) |
|
330 | 330 | else: |
|
331 | 331 | self.matches = self.global_matches(text) |
|
332 | 332 | try: |
|
333 | 333 | return self.matches[state] |
|
334 | 334 | except IndexError: |
|
335 | 335 | return None |
|
336 | 336 | |
|
337 | 337 | def global_matches(self, text): |
|
338 | 338 | """Compute matches when text is a simple name. |
|
339 | 339 | |
|
340 | 340 | Return a list of all keywords, built-in functions and names currently |
|
341 | 341 | defined in self.namespace or self.global_namespace that match. |
|
342 | 342 | |
|
343 | 343 | """ |
|
344 | 344 | #print 'Completer->global_matches, txt=%r' % text # dbg |
|
345 | 345 | matches = [] |
|
346 | 346 | match_append = matches.append |
|
347 | 347 | n = len(text) |
|
348 | 348 | for lst in [keyword.kwlist, |
|
349 | 349 | __builtin__.__dict__.keys(), |
|
350 | 350 | self.namespace.keys(), |
|
351 | 351 | self.global_namespace.keys()]: |
|
352 | 352 | for word in lst: |
|
353 | 353 | if word[:n] == text and word != "__builtins__": |
|
354 | 354 | match_append(word) |
|
355 | 355 | return matches |
|
356 | 356 | |
|
357 | 357 | def attr_matches(self, text): |
|
358 | 358 | """Compute matches when text contains a dot. |
|
359 | 359 | |
|
360 | 360 | Assuming the text is of the form NAME.NAME....[NAME], and is |
|
361 | 361 | evaluatable in self.namespace or self.global_namespace, it will be |
|
362 | 362 | evaluated and its attributes (as revealed by dir()) are used as |
|
363 | 363 | possible completions. (For class instances, class members are are |
|
364 | 364 | also considered.) |
|
365 | 365 | |
|
366 | 366 | WARNING: this can still invoke arbitrary C code, if an object |
|
367 | 367 | with a __getattr__ hook is evaluated. |
|
368 | 368 | |
|
369 | 369 | """ |
|
370 | 370 | |
|
371 | 371 | #io.rprint('Completer->attr_matches, txt=%r' % text) # dbg |
|
372 | 372 | # Another option, seems to work great. Catches things like ''.<tab> |
|
373 | 373 | m = re.match(r"(\S+(\.\w+)*)\.(\w*)$", text) |
|
374 | 374 | |
|
375 | 375 | if m: |
|
376 | 376 | expr, attr = m.group(1, 3) |
|
377 | 377 | elif self.greedy: |
|
378 | 378 | m2 = re.match(r"(.+)\.(\w*)$", self.line_buffer) |
|
379 | 379 | if not m2: |
|
380 | 380 | return [] |
|
381 | 381 | expr, attr = m2.group(1,2) |
|
382 | 382 | else: |
|
383 | 383 | return [] |
|
384 | 384 | |
|
385 | 385 | try: |
|
386 | 386 | obj = eval(expr, self.namespace) |
|
387 | 387 | except: |
|
388 | 388 | try: |
|
389 | 389 | obj = eval(expr, self.global_namespace) |
|
390 | 390 | except: |
|
391 | 391 | return [] |
|
392 | 392 | |
|
393 | 393 | words = dir2(obj) |
|
394 | 394 | |
|
395 | 395 | try: |
|
396 | 396 | words = generics.complete_object(obj, words) |
|
397 | 397 | except TryNext: |
|
398 | 398 | pass |
|
399 | 399 | except Exception: |
|
400 | 400 | # Silence errors from completion function |
|
401 | 401 | #raise # dbg |
|
402 | 402 | pass |
|
403 | 403 | # Build match list to return |
|
404 | 404 | n = len(attr) |
|
405 | 405 | res = ["%s.%s" % (expr, w) for w in words if w[:n] == attr ] |
|
406 | 406 | return res |
|
407 | 407 | |
|
408 | 408 | |
|
409 | 409 | class IPCompleter(Completer): |
|
410 | 410 | """Extension of the completer class with IPython-specific features""" |
|
411 | 411 | |
|
412 | 412 | def _greedy_changed(self, name, old, new): |
|
413 | 413 | """update the splitter and readline delims when greedy is changed""" |
|
414 | 414 | if new: |
|
415 | 415 | self.splitter.set_delims(GREEDY_DELIMS) |
|
416 | 416 | else: |
|
417 | 417 | self.splitter.set_delims(DELIMS) |
|
418 | 418 | |
|
419 | 419 | if self.readline: |
|
420 | 420 | self.readline.set_completer_delims(self.splitter.get_delims()) |
|
421 | 421 | |
|
422 | 422 | merge_completions = CBool(True, config=True, |
|
423 | 423 | help="""Whether to merge completion results into a single list |
|
424 | 424 | |
|
425 | 425 | If False, only the completion results from the first non-empty |
|
426 | 426 | completer will be returned. |
|
427 | 427 | """ |
|
428 | 428 | ) |
|
429 | 429 | omit__names = Enum((0,1,2), default_value=2, config=True, |
|
430 | 430 | help="""Instruct the completer to omit private method names |
|
431 | 431 | |
|
432 | 432 | Specifically, when completing on ``object.<tab>``. |
|
433 | 433 | |
|
434 | 434 | When 2 [default]: all names that start with '_' will be excluded. |
|
435 | 435 | |
|
436 | 436 | When 1: all 'magic' names (``__foo__``) will be excluded. |
|
437 | 437 | |
|
438 | 438 | When 0: nothing will be excluded. |
|
439 | 439 | """ |
|
440 | 440 | ) |
|
441 | 441 | |
|
442 | 442 | def __init__(self, shell=None, namespace=None, global_namespace=None, |
|
443 | 443 | alias_table=None, use_readline=True, |
|
444 | 444 | config=None, **kwargs): |
|
445 | 445 | """IPCompleter() -> completer |
|
446 | 446 | |
|
447 | 447 | Return a completer object suitable for use by the readline library |
|
448 | 448 | via readline.set_completer(). |
|
449 | 449 | |
|
450 | 450 | Inputs: |
|
451 | 451 | |
|
452 | 452 | - shell: a pointer to the ipython shell itself. This is needed |
|
453 | 453 | because this completer knows about magic functions, and those can |
|
454 | 454 | only be accessed via the ipython instance. |
|
455 | 455 | |
|
456 | 456 | - namespace: an optional dict where completions are performed. |
|
457 | 457 | |
|
458 | 458 | - global_namespace: secondary optional dict for completions, to |
|
459 | 459 | handle cases (such as IPython embedded inside functions) where |
|
460 | 460 | both Python scopes are visible. |
|
461 | 461 | |
|
462 | 462 | - If alias_table is supplied, it should be a dictionary of aliases |
|
463 | 463 | to complete. |
|
464 | 464 | |
|
465 | 465 | use_readline : bool, optional |
|
466 | 466 | If true, use the readline library. This completer can still function |
|
467 | 467 | without readline, though in that case callers must provide some extra |
|
468 | 468 | information on each call about the current line.""" |
|
469 | 469 | |
|
470 | 470 | self.magic_escape = ESC_MAGIC |
|
471 | 471 | self.splitter = CompletionSplitter() |
|
472 | 472 | |
|
473 | 473 | # Readline configuration, only used by the rlcompleter method. |
|
474 | 474 | if use_readline: |
|
475 | 475 | # We store the right version of readline so that later code |
|
476 | 476 | import IPython.utils.rlineimpl as readline |
|
477 | 477 | self.readline = readline |
|
478 | 478 | else: |
|
479 | 479 | self.readline = None |
|
480 | 480 | |
|
481 | 481 | # _greedy_changed() depends on splitter and readline being defined: |
|
482 | 482 | Completer.__init__(self, namespace=namespace, global_namespace=global_namespace, |
|
483 | 483 | config=config, **kwargs) |
|
484 | 484 | |
|
485 | 485 | # List where completion matches will be stored |
|
486 | 486 | self.matches = [] |
|
487 | 487 | self.shell = shell.shell |
|
488 | 488 | if alias_table is None: |
|
489 | 489 | alias_table = {} |
|
490 | 490 | self.alias_table = alias_table |
|
491 | 491 | # Regexp to split filenames with spaces in them |
|
492 | 492 | self.space_name_re = re.compile(r'([^\\] )') |
|
493 | 493 | # Hold a local ref. to glob.glob for speed |
|
494 | 494 | self.glob = glob.glob |
|
495 | 495 | |
|
496 | 496 | # Determine if we are running on 'dumb' terminals, like (X)Emacs |
|
497 | 497 | # buffers, to avoid completion problems. |
|
498 | 498 | term = os.environ.get('TERM','xterm') |
|
499 | 499 | self.dumb_terminal = term in ['dumb','emacs'] |
|
500 | 500 | |
|
501 | 501 | # Special handling of backslashes needed in win32 platforms |
|
502 | 502 | if sys.platform == "win32": |
|
503 | 503 | self.clean_glob = self._clean_glob_win32 |
|
504 | 504 | else: |
|
505 | 505 | self.clean_glob = self._clean_glob |
|
506 | 506 | |
|
507 | 507 | # All active matcher routines for completion |
|
508 | 508 | self.matchers = [self.python_matches, |
|
509 | 509 | self.file_matches, |
|
510 | 510 | self.magic_matches, |
|
511 | 511 | self.alias_matches, |
|
512 | 512 | self.python_func_kw_matches, |
|
513 | 513 | ] |
|
514 | 514 | |
|
515 | 515 | def all_completions(self, text): |
|
516 | 516 | """ |
|
517 | 517 | Wrapper around the complete method for the benefit of emacs |
|
518 | 518 | and pydb. |
|
519 | 519 | """ |
|
520 | 520 | return self.complete(text)[1] |
|
521 | 521 | |
|
522 | 522 | def _clean_glob(self,text): |
|
523 | 523 | return self.glob("%s*" % text) |
|
524 | 524 | |
|
525 | 525 | def _clean_glob_win32(self,text): |
|
526 | 526 | return [f.replace("\\","/") |
|
527 | 527 | for f in self.glob("%s*" % text)] |
|
528 | 528 | |
|
529 | 529 | def file_matches(self, text): |
|
530 | 530 | """Match filenames, expanding ~USER type strings. |
|
531 | 531 | |
|
532 | 532 | Most of the seemingly convoluted logic in this completer is an |
|
533 | 533 | attempt to handle filenames with spaces in them. And yet it's not |
|
534 | 534 | quite perfect, because Python's readline doesn't expose all of the |
|
535 | 535 | GNU readline details needed for this to be done correctly. |
|
536 | 536 | |
|
537 | 537 | For a filename with a space in it, the printed completions will be |
|
538 | 538 | only the parts after what's already been typed (instead of the |
|
539 | 539 | full completions, as is normally done). I don't think with the |
|
540 | 540 | current (as of Python 2.3) Python readline it's possible to do |
|
541 | 541 | better.""" |
|
542 | 542 | |
|
543 | 543 | #io.rprint('Completer->file_matches: <%r>' % text) # dbg |
|
544 | 544 | |
|
545 | 545 | # chars that require escaping with backslash - i.e. chars |
|
546 | 546 | # that readline treats incorrectly as delimiters, but we |
|
547 | 547 | # don't want to treat as delimiters in filename matching |
|
548 | 548 | # when escaped with backslash |
|
549 | 549 | if text.startswith('!'): |
|
550 | 550 | text = text[1:] |
|
551 | 551 | text_prefix = '!' |
|
552 | 552 | else: |
|
553 | 553 | text_prefix = '' |
|
554 | 554 | |
|
555 | 555 | text_until_cursor = self.text_until_cursor |
|
556 | 556 | # track strings with open quotes |
|
557 | 557 | open_quotes = has_open_quotes(text_until_cursor) |
|
558 | 558 | |
|
559 | 559 | if '(' in text_until_cursor or '[' in text_until_cursor: |
|
560 | 560 | lsplit = text |
|
561 | 561 | else: |
|
562 | 562 | try: |
|
563 | 563 | # arg_split ~ shlex.split, but with unicode bugs fixed by us |
|
564 | 564 | lsplit = arg_split(text_until_cursor)[-1] |
|
565 | 565 | except ValueError: |
|
566 | 566 | # typically an unmatched ", or backslash without escaped char. |
|
567 | 567 | if open_quotes: |
|
568 | 568 | lsplit = text_until_cursor.split(open_quotes)[-1] |
|
569 | 569 | else: |
|
570 | 570 | return [] |
|
571 | 571 | except IndexError: |
|
572 | 572 | # tab pressed on empty line |
|
573 | 573 | lsplit = "" |
|
574 | 574 | |
|
575 | 575 | if not open_quotes and lsplit != protect_filename(lsplit): |
|
576 | 576 | # if protectables are found, do matching on the whole escaped name |
|
577 | 577 | has_protectables = True |
|
578 | 578 | text0,text = text,lsplit |
|
579 | 579 | else: |
|
580 | 580 | has_protectables = False |
|
581 | 581 | text = os.path.expanduser(text) |
|
582 | 582 | |
|
583 | 583 | if text == "": |
|
584 | 584 | return [text_prefix + protect_filename(f) for f in self.glob("*")] |
|
585 | 585 | |
|
586 | 586 | # Compute the matches from the filesystem |
|
587 | 587 | m0 = self.clean_glob(text.replace('\\','')) |
|
588 | 588 | |
|
589 | 589 | if has_protectables: |
|
590 | 590 | # If we had protectables, we need to revert our changes to the |
|
591 | 591 | # beginning of filename so that we don't double-write the part |
|
592 | 592 | # of the filename we have so far |
|
593 | 593 | len_lsplit = len(lsplit) |
|
594 | 594 | matches = [text_prefix + text0 + |
|
595 | 595 | protect_filename(f[len_lsplit:]) for f in m0] |
|
596 | 596 | else: |
|
597 | 597 | if open_quotes: |
|
598 | 598 | # if we have a string with an open quote, we don't need to |
|
599 | 599 | # protect the names at all (and we _shouldn't_, as it |
|
600 | 600 | # would cause bugs when the filesystem call is made). |
|
601 | 601 | matches = m0 |
|
602 | 602 | else: |
|
603 | 603 | matches = [text_prefix + |
|
604 | 604 | protect_filename(f) for f in m0] |
|
605 | 605 | |
|
606 | 606 | #io.rprint('mm', matches) # dbg |
|
607 | 607 | return mark_dirs(matches) |
|
608 | 608 | |
|
609 | 609 | def magic_matches(self, text): |
|
610 | 610 | """Match magics""" |
|
611 | 611 | #print 'Completer->magic_matches:',text,'lb',self.text_until_cursor # dbg |
|
612 | 612 | # Get all shell magics now rather than statically, so magics loaded at |
|
613 | 613 | # runtime show up too |
|
614 | 614 | magics = self.shell.lsmagic() |
|
615 | 615 | pre = self.magic_escape |
|
616 | 616 | baretext = text.lstrip(pre) |
|
617 | 617 | return [ pre+m for m in magics if m.startswith(baretext)] |
|
618 | 618 | |
|
619 | 619 | def alias_matches(self, text): |
|
620 | 620 | """Match internal system aliases""" |
|
621 | 621 | #print 'Completer->alias_matches:',text,'lb',self.text_until_cursor # dbg |
|
622 | 622 | |
|
623 | 623 | # if we are not in the first 'item', alias matching |
|
624 | 624 | # doesn't make sense - unless we are starting with 'sudo' command. |
|
625 | 625 | main_text = self.text_until_cursor.lstrip() |
|
626 | 626 | if ' ' in main_text and not main_text.startswith('sudo'): |
|
627 | 627 | return [] |
|
628 | 628 | text = os.path.expanduser(text) |
|
629 | 629 | aliases = self.alias_table.keys() |
|
630 | 630 | if text == '': |
|
631 | 631 | return aliases |
|
632 | 632 | else: |
|
633 | 633 | return [a for a in aliases if a.startswith(text)] |
|
634 | 634 | |
|
635 | 635 | def python_matches(self,text): |
|
636 | 636 | """Match attributes or global python names""" |
|
637 | 637 | |
|
638 | 638 | #io.rprint('Completer->python_matches, txt=%r' % text) # dbg |
|
639 | 639 | if "." in text: |
|
640 | 640 | try: |
|
641 | 641 | matches = self.attr_matches(text) |
|
642 | 642 | if text.endswith('.') and self.omit__names: |
|
643 | 643 | if self.omit__names == 1: |
|
644 | 644 | # true if txt is _not_ a __ name, false otherwise: |
|
645 | 645 | no__name = (lambda txt: |
|
646 | 646 | re.match(r'.*\.__.*?__',txt) is None) |
|
647 | 647 | else: |
|
648 | 648 | # true if txt is _not_ a _ name, false otherwise: |
|
649 | 649 | no__name = (lambda txt: |
|
650 | 650 | re.match(r'.*\._.*?',txt) is None) |
|
651 | 651 | matches = filter(no__name, matches) |
|
652 | 652 | except NameError: |
|
653 | 653 | # catches <undefined attributes>.<tab> |
|
654 | 654 | matches = [] |
|
655 | 655 | else: |
|
656 | 656 | matches = self.global_matches(text) |
|
657 | 657 | |
|
658 | 658 | return matches |
|
659 | 659 | |
|
660 | 660 | def _default_arguments(self, obj): |
|
661 | 661 | """Return the list of default arguments of obj if it is callable, |
|
662 | 662 | or empty list otherwise.""" |
|
663 | 663 | |
|
664 | 664 | if not (inspect.isfunction(obj) or inspect.ismethod(obj)): |
|
665 | 665 | # for classes, check for __init__,__new__ |
|
666 | 666 | if inspect.isclass(obj): |
|
667 | 667 | obj = (getattr(obj,'__init__',None) or |
|
668 | 668 | getattr(obj,'__new__',None)) |
|
669 | 669 | # for all others, check if they are __call__able |
|
670 | 670 | elif hasattr(obj, '__call__'): |
|
671 | 671 | obj = obj.__call__ |
|
672 | 672 | # XXX: is there a way to handle the builtins ? |
|
673 | 673 | try: |
|
674 | 674 | args,_,_1,defaults = inspect.getargspec(obj) |
|
675 | 675 | if defaults: |
|
676 | 676 | return args[-len(defaults):] |
|
677 | 677 | except TypeError: pass |
|
678 | 678 | return [] |
|
679 | 679 | |
|
680 | 680 | def python_func_kw_matches(self,text): |
|
681 | 681 | """Match named parameters (kwargs) of the last open function""" |
|
682 | 682 | |
|
683 | 683 | if "." in text: # a parameter cannot be dotted |
|
684 | 684 | return [] |
|
685 | 685 | try: regexp = self.__funcParamsRegex |
|
686 | 686 | except AttributeError: |
|
687 | 687 | regexp = self.__funcParamsRegex = re.compile(r''' |
|
688 | 688 | '.*?' | # single quoted strings or |
|
689 | 689 | ".*?" | # double quoted strings or |
|
690 | 690 | \w+ | # identifier |
|
691 | 691 | \S # other characters |
|
692 | 692 | ''', re.VERBOSE | re.DOTALL) |
|
693 | 693 | # 1. find the nearest identifier that comes before an unclosed |
|
694 | 694 | # parenthesis e.g. for "foo (1+bar(x), pa", the candidate is "foo" |
|
695 | 695 | tokens = regexp.findall(self.line_buffer) |
|
696 | 696 | tokens.reverse() |
|
697 | 697 | iterTokens = iter(tokens); openPar = 0 |
|
698 | 698 | for token in iterTokens: |
|
699 | 699 | if token == ')': |
|
700 | 700 | openPar -= 1 |
|
701 | 701 | elif token == '(': |
|
702 | 702 | openPar += 1 |
|
703 | 703 | if openPar > 0: |
|
704 | 704 | # found the last unclosed parenthesis |
|
705 | 705 | break |
|
706 | 706 | else: |
|
707 | 707 | return [] |
|
708 | 708 | # 2. Concatenate dotted names ("foo.bar" for "foo.bar(x, pa" ) |
|
709 | 709 | ids = [] |
|
710 | 710 | isId = re.compile(r'\w+$').match |
|
711 | 711 | while True: |
|
712 | 712 | try: |
|
713 | 713 | ids.append(iterTokens.next()) |
|
714 | 714 | if not isId(ids[-1]): |
|
715 | 715 | ids.pop(); break |
|
716 | 716 | if not iterTokens.next() == '.': |
|
717 | 717 | break |
|
718 | 718 | except StopIteration: |
|
719 | 719 | break |
|
720 | 720 | # lookup the candidate callable matches either using global_matches |
|
721 | 721 | # or attr_matches for dotted names |
|
722 | 722 | if len(ids) == 1: |
|
723 | 723 | callableMatches = self.global_matches(ids[0]) |
|
724 | 724 | else: |
|
725 | 725 | callableMatches = self.attr_matches('.'.join(ids[::-1])) |
|
726 | 726 | argMatches = [] |
|
727 | 727 | for callableMatch in callableMatches: |
|
728 | 728 | try: |
|
729 | 729 | namedArgs = self._default_arguments(eval(callableMatch, |
|
730 | 730 | self.namespace)) |
|
731 | 731 | except: |
|
732 | 732 | continue |
|
733 | 733 | for namedArg in namedArgs: |
|
734 | 734 | if namedArg.startswith(text): |
|
735 | 735 | argMatches.append("%s=" %namedArg) |
|
736 | 736 | return argMatches |
|
737 | 737 | |
|
738 | 738 | def dispatch_custom_completer(self, text): |
|
739 | 739 | #io.rprint("Custom! '%s' %s" % (text, self.custom_completers)) # dbg |
|
740 | 740 | line = self.line_buffer |
|
741 | 741 | if not line.strip(): |
|
742 | 742 | return None |
|
743 | 743 | |
|
744 | 744 | # Create a little structure to pass all the relevant information about |
|
745 | 745 | # the current completion to any custom completer. |
|
746 | 746 | event = Bunch() |
|
747 | 747 | event.line = line |
|
748 | 748 | event.symbol = text |
|
749 | 749 | cmd = line.split(None,1)[0] |
|
750 | 750 | event.command = cmd |
|
751 | 751 | event.text_until_cursor = self.text_until_cursor |
|
752 | 752 | |
|
753 | 753 | #print "\ncustom:{%s]\n" % event # dbg |
|
754 | 754 | |
|
755 | 755 | # for foo etc, try also to find completer for %foo |
|
756 | 756 | if not cmd.startswith(self.magic_escape): |
|
757 | 757 | try_magic = self.custom_completers.s_matches( |
|
758 | 758 | self.magic_escape + cmd) |
|
759 | 759 | else: |
|
760 | 760 | try_magic = [] |
|
761 | 761 | |
|
762 | 762 | for c in itertools.chain(self.custom_completers.s_matches(cmd), |
|
763 | 763 | try_magic, |
|
764 | 764 | self.custom_completers.flat_matches(self.text_until_cursor)): |
|
765 | 765 | #print "try",c # dbg |
|
766 | 766 | try: |
|
767 | 767 | res = c(event) |
|
768 | 768 | if res: |
|
769 | 769 | # first, try case sensitive match |
|
770 | 770 | withcase = [r for r in res if r.startswith(text)] |
|
771 | 771 | if withcase: |
|
772 | 772 | return withcase |
|
773 | 773 | # if none, then case insensitive ones are ok too |
|
774 | 774 | text_low = text.lower() |
|
775 | 775 | return [r for r in res if r.lower().startswith(text_low)] |
|
776 | 776 | except TryNext: |
|
777 | 777 | pass |
|
778 | 778 | |
|
779 | 779 | return None |
|
780 | 780 | |
|
781 | 781 | def complete(self, text=None, line_buffer=None, cursor_pos=None): |
|
782 | 782 | """Find completions for the given text and line context. |
|
783 | 783 | |
|
784 | 784 | This is called successively with state == 0, 1, 2, ... until it |
|
785 | 785 | returns None. The completion should begin with 'text'. |
|
786 | 786 | |
|
787 | 787 | Note that both the text and the line_buffer are optional, but at least |
|
788 | 788 | one of them must be given. |
|
789 | 789 | |
|
790 | 790 | Parameters |
|
791 | 791 | ---------- |
|
792 | 792 | text : string, optional |
|
793 | 793 | Text to perform the completion on. If not given, the line buffer |
|
794 | 794 | is split using the instance's CompletionSplitter object. |
|
795 | 795 | |
|
796 | 796 | line_buffer : string, optional |
|
797 | 797 | If not given, the completer attempts to obtain the current line |
|
798 | 798 | buffer via readline. This keyword allows clients which are |
|
799 | 799 | requesting for text completions in non-readline contexts to inform |
|
800 | 800 | the completer of the entire text. |
|
801 | 801 | |
|
802 | 802 | cursor_pos : int, optional |
|
803 | 803 | Index of the cursor in the full line buffer. Should be provided by |
|
804 | 804 | remote frontends where kernel has no access to frontend state. |
|
805 | 805 | |
|
806 | 806 | Returns |
|
807 | 807 | ------- |
|
808 | 808 | text : str |
|
809 | 809 | Text that was actually used in the completion. |
|
810 | 810 | |
|
811 | 811 | matches : list |
|
812 | 812 | A list of completion matches. |
|
813 | 813 | """ |
|
814 | 814 | #io.rprint('\nCOMP1 %r %r %r' % (text, line_buffer, cursor_pos)) # dbg |
|
815 | 815 | |
|
816 | 816 | # if the cursor position isn't given, the only sane assumption we can |
|
817 | 817 | # make is that it's at the end of the line (the common case) |
|
818 | 818 | if cursor_pos is None: |
|
819 | 819 | cursor_pos = len(line_buffer) if text is None else len(text) |
|
820 | 820 | |
|
821 | 821 | # if text is either None or an empty string, rely on the line buffer |
|
822 | 822 | if not text: |
|
823 | 823 | text = self.splitter.split_line(line_buffer, cursor_pos) |
|
824 | 824 | |
|
825 | 825 | # If no line buffer is given, assume the input text is all there was |
|
826 | 826 | if line_buffer is None: |
|
827 | 827 | line_buffer = text |
|
828 | 828 | |
|
829 | 829 | self.line_buffer = line_buffer |
|
830 | 830 | self.text_until_cursor = self.line_buffer[:cursor_pos] |
|
831 | 831 | #io.rprint('\nCOMP2 %r %r %r' % (text, line_buffer, cursor_pos)) # dbg |
|
832 | 832 | |
|
833 | 833 | # Start with a clean slate of completions |
|
834 | 834 | self.matches[:] = [] |
|
835 | 835 | custom_res = self.dispatch_custom_completer(text) |
|
836 | 836 | if custom_res is not None: |
|
837 | 837 | # did custom completers produce something? |
|
838 | 838 | self.matches = custom_res |
|
839 | 839 | else: |
|
840 | 840 | # Extend the list of completions with the results of each |
|
841 | 841 | # matcher, so we return results to the user from all |
|
842 | 842 | # namespaces. |
|
843 | 843 | if self.merge_completions: |
|
844 | 844 | self.matches = [] |
|
845 | 845 | for matcher in self.matchers: |
|
846 | 846 | try: |
|
847 | 847 | self.matches.extend(matcher(text)) |
|
848 | 848 | except: |
|
849 | 849 | # Show the ugly traceback if the matcher causes an |
|
850 | 850 | # exception, but do NOT crash the kernel! |
|
851 | 851 | sys.excepthook(*sys.exc_info()) |
|
852 | 852 | else: |
|
853 | 853 | for matcher in self.matchers: |
|
854 | 854 | self.matches = matcher(text) |
|
855 | 855 | if self.matches: |
|
856 | 856 | break |
|
857 | 857 | # FIXME: we should extend our api to return a dict with completions for |
|
858 | 858 | # different types of objects. The rlcomplete() method could then |
|
859 | 859 | # simply collapse the dict into a list for readline, but we'd have |
|
860 | 860 | # richer completion semantics in other evironments. |
|
861 | 861 | self.matches = sorted(set(self.matches)) |
|
862 | 862 | #io.rprint('COMP TEXT, MATCHES: %r, %r' % (text, self.matches)) # dbg |
|
863 | 863 | return text, self.matches |
|
864 | 864 | |
|
865 | 865 | def rlcomplete(self, text, state): |
|
866 | 866 | """Return the state-th possible completion for 'text'. |
|
867 | 867 | |
|
868 | 868 | This is called successively with state == 0, 1, 2, ... until it |
|
869 | 869 | returns None. The completion should begin with 'text'. |
|
870 | 870 | |
|
871 | 871 | Parameters |
|
872 | 872 | ---------- |
|
873 | 873 | text : string |
|
874 | 874 | Text to perform the completion on. |
|
875 | 875 | |
|
876 | 876 | state : int |
|
877 | 877 | Counter used by readline. |
|
878 | 878 | """ |
|
879 | 879 | if state==0: |
|
880 | 880 | |
|
881 | 881 | self.line_buffer = line_buffer = self.readline.get_line_buffer() |
|
882 | 882 | cursor_pos = self.readline.get_endidx() |
|
883 | 883 | |
|
884 | 884 | #io.rprint("\nRLCOMPLETE: %r %r %r" % |
|
885 | 885 | # (text, line_buffer, cursor_pos) ) # dbg |
|
886 | 886 | |
|
887 | 887 | # if there is only a tab on a line with only whitespace, instead of |
|
888 | 888 | # the mostly useless 'do you want to see all million completions' |
|
889 | 889 | # message, just do the right thing and give the user his tab! |
|
890 | 890 | # Incidentally, this enables pasting of tabbed text from an editor |
|
891 | 891 | # (as long as autoindent is off). |
|
892 | 892 | |
|
893 | 893 | # It should be noted that at least pyreadline still shows file |
|
894 | 894 | # completions - is there a way around it? |
|
895 | 895 | |
|
896 | 896 | # don't apply this on 'dumb' terminals, such as emacs buffers, so |
|
897 | 897 | # we don't interfere with their own tab-completion mechanism. |
|
898 | 898 | if not (self.dumb_terminal or line_buffer.strip()): |
|
899 | 899 | self.readline.insert_text('\t') |
|
900 | 900 | sys.stdout.flush() |
|
901 | 901 | return None |
|
902 | 902 | |
|
903 | 903 | # Note: debugging exceptions that may occur in completion is very |
|
904 | 904 | # tricky, because readline unconditionally silences them. So if |
|
905 | 905 | # during development you suspect a bug in the completion code, turn |
|
906 | 906 | # this flag on temporarily by uncommenting the second form (don't |
|
907 | 907 | # flip the value in the first line, as the '# dbg' marker can be |
|
908 | 908 | # automatically detected and is used elsewhere). |
|
909 | 909 | DEBUG = False |
|
910 | 910 | #DEBUG = True # dbg |
|
911 | 911 | if DEBUG: |
|
912 | 912 | try: |
|
913 | 913 | self.complete(text, line_buffer, cursor_pos) |
|
914 | 914 | except: |
|
915 | 915 | import traceback; traceback.print_exc() |
|
916 | 916 | else: |
|
917 | 917 | # The normal production version is here |
|
918 | 918 | |
|
919 | 919 | # This method computes the self.matches array |
|
920 | 920 | self.complete(text, line_buffer, cursor_pos) |
|
921 | 921 | |
|
922 | 922 | try: |
|
923 | 923 | return self.matches[state] |
|
924 | 924 | except IndexError: |
|
925 | 925 | return None |
@@ -1,347 +1,347 b'' | |||
|
1 | 1 | """Implementations for various useful completers. |
|
2 | 2 | |
|
3 | 3 | These are all loaded by default by IPython. |
|
4 | 4 | """ |
|
5 | 5 | #----------------------------------------------------------------------------- |
|
6 | # Copyright (C) 2010 The IPython Development Team. | |
|
6 | # Copyright (C) 2010-2011 The IPython Development Team. | |
|
7 | 7 | # |
|
8 | 8 | # Distributed under the terms of the BSD License. |
|
9 | 9 | # |
|
10 | 10 | # The full license is in the file COPYING.txt, distributed with this software. |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | # Imports |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | from __future__ import print_function |
|
17 | 17 | |
|
18 | 18 | # Stdlib imports |
|
19 | 19 | import glob |
|
20 | 20 | import inspect |
|
21 | 21 | import os |
|
22 | 22 | import re |
|
23 | 23 | import shlex |
|
24 | 24 | import sys |
|
25 | 25 | |
|
26 | 26 | # Third-party imports |
|
27 | 27 | from time import time |
|
28 | 28 | from zipimport import zipimporter |
|
29 | 29 | |
|
30 | 30 | # Our own imports |
|
31 | 31 | from IPython.core.completer import expand_user, compress_user |
|
32 | 32 | from IPython.core.error import TryNext |
|
33 | 33 | from IPython.utils import py3compat |
|
34 | 34 | |
|
35 | 35 | # FIXME: this should be pulled in with the right call via the component system |
|
36 | 36 | from IPython.core.ipapi import get as get_ipython |
|
37 | 37 | |
|
38 | 38 | #----------------------------------------------------------------------------- |
|
39 | 39 | # Globals and constants |
|
40 | 40 | #----------------------------------------------------------------------------- |
|
41 | 41 | |
|
42 | 42 | # Time in seconds after which the rootmodules will be stored permanently in the |
|
43 | 43 | # ipython ip.db database (kept in the user's .ipython dir). |
|
44 | 44 | TIMEOUT_STORAGE = 2 |
|
45 | 45 | |
|
46 | 46 | # Time in seconds after which we give up |
|
47 | 47 | TIMEOUT_GIVEUP = 20 |
|
48 | 48 | |
|
49 | 49 | # Regular expression for the python import statement |
|
50 | 50 | import_re = re.compile(r'.*(\.so|\.py[cod]?)$') |
|
51 | 51 | |
|
52 | 52 | # RE for the ipython %run command (python + ipython scripts) |
|
53 | 53 | magic_run_re = re.compile(r'.*(\.ipy|\.py[w]?)$') |
|
54 | 54 | |
|
55 | 55 | #----------------------------------------------------------------------------- |
|
56 | 56 | # Local utilities |
|
57 | 57 | #----------------------------------------------------------------------------- |
|
58 | 58 | |
|
59 | 59 | def shlex_split(x): |
|
60 | 60 | """Helper function to split lines into segments. |
|
61 | 61 | """ |
|
62 | 62 | # shlex.split raises an exception if there is a syntax error in sh syntax |
|
63 | 63 | # for example if no closing " is found. This function keeps dropping the |
|
64 | 64 | # last character of the line until shlex.split does not raise |
|
65 | 65 | # an exception. It adds end of the line to the result of shlex.split |
|
66 | 66 | # |
|
67 | 67 | # Example: |
|
68 | 68 | # %run "c:/python -> ['%run','"c:/python'] |
|
69 | 69 | |
|
70 | 70 | # shlex.split has unicode bugs in Python 2, so encode first to str |
|
71 | 71 | if not py3compat.PY3: |
|
72 | 72 | x = py3compat.cast_bytes(x) |
|
73 | 73 | |
|
74 | 74 | endofline = [] |
|
75 | 75 | while x != '': |
|
76 | 76 | try: |
|
77 | 77 | comps = shlex.split(x) |
|
78 | 78 | if len(endofline) >= 1: |
|
79 | 79 | comps.append(''.join(endofline)) |
|
80 | 80 | return comps |
|
81 | 81 | |
|
82 | 82 | except ValueError: |
|
83 | 83 | endofline = [x[-1:]]+endofline |
|
84 | 84 | x = x[:-1] |
|
85 | 85 | |
|
86 | 86 | return [''.join(endofline)] |
|
87 | 87 | |
|
88 | 88 | def module_list(path): |
|
89 | 89 | """ |
|
90 | 90 | Return the list containing the names of the modules available in the given |
|
91 | 91 | folder. |
|
92 | 92 | """ |
|
93 | 93 | |
|
94 | 94 | if os.path.isdir(path): |
|
95 | 95 | folder_list = os.listdir(path) |
|
96 | 96 | elif path.endswith('.egg'): |
|
97 | 97 | try: |
|
98 | 98 | folder_list = [f for f in zipimporter(path)._files] |
|
99 | 99 | except: |
|
100 | 100 | folder_list = [] |
|
101 | 101 | else: |
|
102 | 102 | folder_list = [] |
|
103 | 103 | |
|
104 | 104 | if not folder_list: |
|
105 | 105 | return [] |
|
106 | 106 | |
|
107 | 107 | # A few local constants to be used in loops below |
|
108 | 108 | isfile = os.path.isfile |
|
109 | 109 | pjoin = os.path.join |
|
110 | 110 | basename = os.path.basename |
|
111 | 111 | |
|
112 | 112 | # Now find actual path matches for packages or modules |
|
113 | 113 | folder_list = [p for p in folder_list |
|
114 | 114 | if isfile(pjoin(path, p,'__init__.py')) |
|
115 | 115 | or import_re.match(p) ] |
|
116 | 116 | |
|
117 | 117 | return [basename(p).split('.')[0] for p in folder_list] |
|
118 | 118 | |
|
119 | 119 | def get_root_modules(): |
|
120 | 120 | """ |
|
121 | 121 | Returns a list containing the names of all the modules available in the |
|
122 | 122 | folders of the pythonpath. |
|
123 | 123 | """ |
|
124 | 124 | ip = get_ipython() |
|
125 | 125 | |
|
126 | 126 | if 'rootmodules' in ip.db: |
|
127 | 127 | return ip.db['rootmodules'] |
|
128 | 128 | |
|
129 | 129 | t = time() |
|
130 | 130 | store = False |
|
131 | 131 | modules = list(sys.builtin_module_names) |
|
132 | 132 | for path in sys.path: |
|
133 | 133 | modules += module_list(path) |
|
134 | 134 | if time() - t >= TIMEOUT_STORAGE and not store: |
|
135 | 135 | store = True |
|
136 | 136 | print("\nCaching the list of root modules, please wait!") |
|
137 | 137 | print("(This will only be done once - type '%rehashx' to " |
|
138 | 138 | "reset cache!)\n") |
|
139 | 139 | sys.stdout.flush() |
|
140 | 140 | if time() - t > TIMEOUT_GIVEUP: |
|
141 | 141 | print("This is taking too long, we give up.\n") |
|
142 | 142 | ip.db['rootmodules'] = [] |
|
143 | 143 | return [] |
|
144 | 144 | |
|
145 | 145 | modules = set(modules) |
|
146 | 146 | if '__init__' in modules: |
|
147 | 147 | modules.remove('__init__') |
|
148 | 148 | modules = list(modules) |
|
149 | 149 | if store: |
|
150 | 150 | ip.db['rootmodules'] = modules |
|
151 | 151 | return modules |
|
152 | 152 | |
|
153 | 153 | |
|
154 | 154 | def is_importable(module, attr, only_modules): |
|
155 | 155 | if only_modules: |
|
156 | 156 | return inspect.ismodule(getattr(module, attr)) |
|
157 | 157 | else: |
|
158 | 158 | return not(attr[:2] == '__' and attr[-2:] == '__') |
|
159 | 159 | |
|
160 | 160 | |
|
161 | 161 | def try_import(mod, only_modules=False): |
|
162 | 162 | try: |
|
163 | 163 | m = __import__(mod) |
|
164 | 164 | except: |
|
165 | 165 | return [] |
|
166 | 166 | mods = mod.split('.') |
|
167 | 167 | for module in mods[1:]: |
|
168 | 168 | m = getattr(m, module) |
|
169 | 169 | |
|
170 | 170 | m_is_init = hasattr(m, '__file__') and '__init__' in m.__file__ |
|
171 | 171 | |
|
172 | 172 | completions = [] |
|
173 | 173 | if (not hasattr(m, '__file__')) or (not only_modules) or m_is_init: |
|
174 | 174 | completions.extend( [attr for attr in dir(m) if |
|
175 | 175 | is_importable(m, attr, only_modules)]) |
|
176 | 176 | |
|
177 | 177 | completions.extend(getattr(m, '__all__', [])) |
|
178 | 178 | if m_is_init: |
|
179 | 179 | completions.extend(module_list(os.path.dirname(m.__file__))) |
|
180 | 180 | completions = set(completions) |
|
181 | 181 | if '__init__' in completions: |
|
182 | 182 | completions.remove('__init__') |
|
183 | 183 | return list(completions) |
|
184 | 184 | |
|
185 | 185 | |
|
186 | 186 | #----------------------------------------------------------------------------- |
|
187 | 187 | # Completion-related functions. |
|
188 | 188 | #----------------------------------------------------------------------------- |
|
189 | 189 | |
|
190 | 190 | def quick_completer(cmd, completions): |
|
191 | 191 | """ Easily create a trivial completer for a command. |
|
192 | 192 | |
|
193 | 193 | Takes either a list of completions, or all completions in string (that will |
|
194 | 194 | be split on whitespace). |
|
195 | 195 | |
|
196 | 196 | Example:: |
|
197 | 197 | |
|
198 | 198 | [d:\ipython]|1> import ipy_completers |
|
199 | 199 | [d:\ipython]|2> ipy_completers.quick_completer('foo', ['bar','baz']) |
|
200 | 200 | [d:\ipython]|3> foo b<TAB> |
|
201 | 201 | bar baz |
|
202 | 202 | [d:\ipython]|3> foo ba |
|
203 | 203 | """ |
|
204 | 204 | |
|
205 | 205 | if isinstance(completions, basestring): |
|
206 | 206 | completions = completions.split() |
|
207 | 207 | |
|
208 | 208 | def do_complete(self, event): |
|
209 | 209 | return completions |
|
210 | 210 | |
|
211 | 211 | get_ipython().set_hook('complete_command',do_complete, str_key = cmd) |
|
212 | 212 | |
|
213 | 213 | |
|
214 | 214 | def module_completion(line): |
|
215 | 215 | """ |
|
216 | 216 | Returns a list containing the completion possibilities for an import line. |
|
217 | 217 | |
|
218 | 218 | The line looks like this : |
|
219 | 219 | 'import xml.d' |
|
220 | 220 | 'from xml.dom import' |
|
221 | 221 | """ |
|
222 | 222 | |
|
223 | 223 | words = line.split(' ') |
|
224 | 224 | nwords = len(words) |
|
225 | 225 | |
|
226 | 226 | # from whatever <tab> -> 'import ' |
|
227 | 227 | if nwords == 3 and words[0] == 'from': |
|
228 | 228 | return ['import '] |
|
229 | 229 | |
|
230 | 230 | # 'from xy<tab>' or 'import xy<tab>' |
|
231 | 231 | if nwords < 3 and (words[0] in ['import','from']) : |
|
232 | 232 | if nwords == 1: |
|
233 | 233 | return get_root_modules() |
|
234 | 234 | mod = words[1].split('.') |
|
235 | 235 | if len(mod) < 2: |
|
236 | 236 | return get_root_modules() |
|
237 | 237 | completion_list = try_import('.'.join(mod[:-1]), True) |
|
238 | 238 | return ['.'.join(mod[:-1] + [el]) for el in completion_list] |
|
239 | 239 | |
|
240 | 240 | # 'from xyz import abc<tab>' |
|
241 | 241 | if nwords >= 3 and words[0] == 'from': |
|
242 | 242 | mod = words[1] |
|
243 | 243 | return try_import(mod) |
|
244 | 244 | |
|
245 | 245 | #----------------------------------------------------------------------------- |
|
246 | 246 | # Completers |
|
247 | 247 | #----------------------------------------------------------------------------- |
|
248 | 248 | # These all have the func(self, event) signature to be used as custom |
|
249 | 249 | # completers |
|
250 | 250 | |
|
251 | 251 | def module_completer(self,event): |
|
252 | 252 | """Give completions after user has typed 'import ...' or 'from ...'""" |
|
253 | 253 | |
|
254 | 254 | # This works in all versions of python. While 2.5 has |
|
255 | 255 | # pkgutil.walk_packages(), that particular routine is fairly dangerous, |
|
256 | 256 | # since it imports *EVERYTHING* on sys.path. That is: a) very slow b) full |
|
257 | 257 | # of possibly problematic side effects. |
|
258 | 258 | # This search the folders in the sys.path for available modules. |
|
259 | 259 | |
|
260 | 260 | return module_completion(event.line) |
|
261 | 261 | |
|
262 | 262 | # FIXME: there's a lot of logic common to the run, cd and builtin file |
|
263 | 263 | # completers, that is currently reimplemented in each. |
|
264 | 264 | |
|
265 | 265 | def magic_run_completer(self, event): |
|
266 | 266 | """Complete files that end in .py or .ipy for the %run command. |
|
267 | 267 | """ |
|
268 | 268 | comps = shlex_split(event.line) |
|
269 | 269 | relpath = (len(comps) > 1 and comps[-1] or '').strip("'\"") |
|
270 | 270 | |
|
271 | 271 | #print("\nev=", event) # dbg |
|
272 | 272 | #print("rp=", relpath) # dbg |
|
273 | 273 | #print('comps=', comps) # dbg |
|
274 | 274 | |
|
275 | 275 | lglob = glob.glob |
|
276 | 276 | isdir = os.path.isdir |
|
277 | 277 | relpath, tilde_expand, tilde_val = expand_user(relpath) |
|
278 | 278 | |
|
279 | 279 | dirs = [f.replace('\\','/') + "/" for f in lglob(relpath+'*') if isdir(f)] |
|
280 | 280 | |
|
281 | 281 | # Find if the user has already typed the first filename, after which we |
|
282 | 282 | # should complete on all files, since after the first one other files may |
|
283 | 283 | # be arguments to the input script. |
|
284 | 284 | |
|
285 | 285 | if filter(magic_run_re.match, comps): |
|
286 | 286 | pys = [f.replace('\\','/') for f in lglob('*')] |
|
287 | 287 | else: |
|
288 | 288 | pys = [f.replace('\\','/') |
|
289 | 289 | for f in lglob(relpath+'*.py') + lglob(relpath+'*.ipy') + |
|
290 | 290 | lglob(relpath + '*.pyw')] |
|
291 | 291 | #print('run comp:', dirs+pys) # dbg |
|
292 | 292 | return [compress_user(p, tilde_expand, tilde_val) for p in dirs+pys] |
|
293 | 293 | |
|
294 | 294 | |
|
295 | 295 | def cd_completer(self, event): |
|
296 | 296 | """Completer function for cd, which only returns directories.""" |
|
297 | 297 | ip = get_ipython() |
|
298 | 298 | relpath = event.symbol |
|
299 | 299 | |
|
300 | 300 | #print(event) # dbg |
|
301 | 301 | if event.line.endswith('-b') or ' -b ' in event.line: |
|
302 | 302 | # return only bookmark completions |
|
303 | 303 | bkms = self.db.get('bookmarks', None) |
|
304 | 304 | if bkms: |
|
305 | 305 | return bkms.keys() |
|
306 | 306 | else: |
|
307 | 307 | return [] |
|
308 | 308 | |
|
309 | 309 | if event.symbol == '-': |
|
310 | 310 | width_dh = str(len(str(len(ip.user_ns['_dh']) + 1))) |
|
311 | 311 | # jump in directory history by number |
|
312 | 312 | fmt = '-%0' + width_dh +'d [%s]' |
|
313 | 313 | ents = [ fmt % (i,s) for i,s in enumerate(ip.user_ns['_dh'])] |
|
314 | 314 | if len(ents) > 1: |
|
315 | 315 | return ents |
|
316 | 316 | return [] |
|
317 | 317 | |
|
318 | 318 | if event.symbol.startswith('--'): |
|
319 | 319 | return ["--" + os.path.basename(d) for d in ip.user_ns['_dh']] |
|
320 | 320 | |
|
321 | 321 | # Expand ~ in path and normalize directory separators. |
|
322 | 322 | relpath, tilde_expand, tilde_val = expand_user(relpath) |
|
323 | 323 | relpath = relpath.replace('\\','/') |
|
324 | 324 | |
|
325 | 325 | found = [] |
|
326 | 326 | for d in [f.replace('\\','/') + '/' for f in glob.glob(relpath+'*') |
|
327 | 327 | if os.path.isdir(f)]: |
|
328 | 328 | if ' ' in d: |
|
329 | 329 | # we don't want to deal with any of that, complex code |
|
330 | 330 | # for this is elsewhere |
|
331 | 331 | raise TryNext |
|
332 | 332 | |
|
333 | 333 | found.append(d) |
|
334 | 334 | |
|
335 | 335 | if not found: |
|
336 | 336 | if os.path.isdir(relpath): |
|
337 | 337 | return [compress_user(relpath, tilde_expand, tilde_val)] |
|
338 | 338 | |
|
339 | 339 | # if no completions so far, try bookmarks |
|
340 | 340 | bks = self.db.get('bookmarks',{}).iterkeys() |
|
341 | 341 | bkmatches = [s for s in bks if s.startswith(event.symbol)] |
|
342 | 342 | if bkmatches: |
|
343 | 343 | return bkmatches |
|
344 | 344 | |
|
345 | 345 | raise TryNext |
|
346 | 346 | |
|
347 | 347 | return [compress_user(p, tilde_expand, tilde_val) for p in found] |
@@ -1,214 +1,214 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """sys.excepthook for IPython itself, leaves a detailed report on disk. |
|
3 | 3 | |
|
4 | 4 | Authors: |
|
5 | 5 | |
|
6 | 6 | * Fernando Perez |
|
7 | 7 | * Brian E. Granger |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
12 |
# Copyright (C) 2008-201 |
|
|
12 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
13 | 13 | # |
|
14 | 14 | # Distributed under the terms of the BSD License. The full license is in |
|
15 | 15 | # the file COPYING, distributed as part of this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | import os |
|
23 | 23 | import sys |
|
24 | 24 | import traceback |
|
25 | 25 | from pprint import pformat |
|
26 | 26 | |
|
27 | 27 | from IPython.core import ultratb |
|
28 | 28 | from IPython.core.release import author_email |
|
29 | 29 | from IPython.utils.sysinfo import sys_info |
|
30 | 30 | |
|
31 | 31 | #----------------------------------------------------------------------------- |
|
32 | 32 | # Code |
|
33 | 33 | #----------------------------------------------------------------------------- |
|
34 | 34 | |
|
35 | 35 | # Template for the user message. |
|
36 | 36 | _default_message_template = """\ |
|
37 | 37 | Oops, {app_name} crashed. We do our best to make it stable, but... |
|
38 | 38 | |
|
39 | 39 | A crash report was automatically generated with the following information: |
|
40 | 40 | - A verbatim copy of the crash traceback. |
|
41 | 41 | - A copy of your input history during this session. |
|
42 | 42 | - Data on your current {app_name} configuration. |
|
43 | 43 | |
|
44 | 44 | It was left in the file named: |
|
45 | 45 | \t'{crash_report_fname}' |
|
46 | 46 | If you can email this file to the developers, the information in it will help |
|
47 | 47 | them in understanding and correcting the problem. |
|
48 | 48 | |
|
49 | 49 | You can mail it to: {contact_name} at {contact_email} |
|
50 | 50 | with the subject '{app_name} Crash Report'. |
|
51 | 51 | |
|
52 | 52 | If you want to do it now, the following command will work (under Unix): |
|
53 | 53 | mail -s '{app_name} Crash Report' {contact_email} < {crash_report_fname} |
|
54 | 54 | |
|
55 | 55 | To ensure accurate tracking of this issue, please file a report about it at: |
|
56 | 56 | {bug_tracker} |
|
57 | 57 | """ |
|
58 | 58 | |
|
59 | 59 | _lite_message_template = """ |
|
60 | 60 | If you suspect this is an IPython bug, please report it at: |
|
61 | 61 | https://github.com/ipython/ipython/issues |
|
62 | 62 | or send an email to the mailing list at {email} |
|
63 | 63 | |
|
64 | 64 | You can print a more detailed traceback right now with "%tb", or use "%debug" |
|
65 | 65 | to interactively debug it. |
|
66 | 66 | |
|
67 | 67 | Extra-detailed tracebacks for bug-reporting purposes can be enabled via: |
|
68 | 68 | {config}Application.verbose_crash=True |
|
69 | 69 | """ |
|
70 | 70 | |
|
71 | 71 | |
|
72 | 72 | class CrashHandler(object): |
|
73 | 73 | """Customizable crash handlers for IPython applications. |
|
74 | 74 | |
|
75 | 75 | Instances of this class provide a :meth:`__call__` method which can be |
|
76 | 76 | used as a ``sys.excepthook``. The :meth:`__call__` signature is:: |
|
77 | 77 | |
|
78 | 78 | def __call__(self, etype, evalue, etb) |
|
79 | 79 | """ |
|
80 | 80 | |
|
81 | 81 | message_template = _default_message_template |
|
82 | 82 | section_sep = '\n\n'+'*'*75+'\n\n' |
|
83 | 83 | |
|
84 | 84 | def __init__(self, app, contact_name=None, contact_email=None, |
|
85 | 85 | bug_tracker=None, show_crash_traceback=True, call_pdb=False): |
|
86 | 86 | """Create a new crash handler |
|
87 | 87 | |
|
88 | 88 | Parameters |
|
89 | 89 | ---------- |
|
90 | 90 | app : Application |
|
91 | 91 | A running :class:`Application` instance, which will be queried at |
|
92 | 92 | crash time for internal information. |
|
93 | 93 | |
|
94 | 94 | contact_name : str |
|
95 | 95 | A string with the name of the person to contact. |
|
96 | 96 | |
|
97 | 97 | contact_email : str |
|
98 | 98 | A string with the email address of the contact. |
|
99 | 99 | |
|
100 | 100 | bug_tracker : str |
|
101 | 101 | A string with the URL for your project's bug tracker. |
|
102 | 102 | |
|
103 | 103 | show_crash_traceback : bool |
|
104 | 104 | If false, don't print the crash traceback on stderr, only generate |
|
105 | 105 | the on-disk report |
|
106 | 106 | |
|
107 | 107 | Non-argument instance attributes: |
|
108 | 108 | |
|
109 | 109 | These instances contain some non-argument attributes which allow for |
|
110 | 110 | further customization of the crash handler's behavior. Please see the |
|
111 | 111 | source for further details. |
|
112 | 112 | """ |
|
113 | 113 | self.crash_report_fname = "Crash_report_%s.txt" % app.name |
|
114 | 114 | self.app = app |
|
115 | 115 | self.call_pdb = call_pdb |
|
116 | 116 | #self.call_pdb = True # dbg |
|
117 | 117 | self.show_crash_traceback = show_crash_traceback |
|
118 | 118 | self.info = dict(app_name = app.name, |
|
119 | 119 | contact_name = contact_name, |
|
120 | 120 | contact_email = contact_email, |
|
121 | 121 | bug_tracker = bug_tracker, |
|
122 | 122 | crash_report_fname = self.crash_report_fname) |
|
123 | 123 | |
|
124 | 124 | |
|
125 | 125 | def __call__(self, etype, evalue, etb): |
|
126 | 126 | """Handle an exception, call for compatible with sys.excepthook""" |
|
127 | 127 | |
|
128 | 128 | # do not allow the crash handler to be called twice without reinstalling it |
|
129 | 129 | # this prevents unlikely errors in the crash handling from entering an |
|
130 | 130 | # infinite loop. |
|
131 | 131 | sys.excepthook = sys.__excepthook__ |
|
132 | 132 | |
|
133 | 133 | # Report tracebacks shouldn't use color in general (safer for users) |
|
134 | 134 | color_scheme = 'NoColor' |
|
135 | 135 | |
|
136 | 136 | # Use this ONLY for developer debugging (keep commented out for release) |
|
137 | 137 | #color_scheme = 'Linux' # dbg |
|
138 | 138 | try: |
|
139 | 139 | rptdir = self.app.ipython_dir |
|
140 | 140 | except: |
|
141 | 141 | rptdir = os.getcwdu() |
|
142 | 142 | if rptdir is None or not os.path.isdir(rptdir): |
|
143 | 143 | rptdir = os.getcwdu() |
|
144 | 144 | report_name = os.path.join(rptdir,self.crash_report_fname) |
|
145 | 145 | # write the report filename into the instance dict so it can get |
|
146 | 146 | # properly expanded out in the user message template |
|
147 | 147 | self.crash_report_fname = report_name |
|
148 | 148 | self.info['crash_report_fname'] = report_name |
|
149 | 149 | TBhandler = ultratb.VerboseTB( |
|
150 | 150 | color_scheme=color_scheme, |
|
151 | 151 | long_header=1, |
|
152 | 152 | call_pdb=self.call_pdb, |
|
153 | 153 | ) |
|
154 | 154 | if self.call_pdb: |
|
155 | 155 | TBhandler(etype,evalue,etb) |
|
156 | 156 | return |
|
157 | 157 | else: |
|
158 | 158 | traceback = TBhandler.text(etype,evalue,etb,context=31) |
|
159 | 159 | |
|
160 | 160 | # print traceback to screen |
|
161 | 161 | if self.show_crash_traceback: |
|
162 | 162 | print >> sys.stderr, traceback |
|
163 | 163 | |
|
164 | 164 | # and generate a complete report on disk |
|
165 | 165 | try: |
|
166 | 166 | report = open(report_name,'w') |
|
167 | 167 | except: |
|
168 | 168 | print >> sys.stderr, 'Could not create crash report on disk.' |
|
169 | 169 | return |
|
170 | 170 | |
|
171 | 171 | # Inform user on stderr of what happened |
|
172 | 172 | print >> sys.stderr, '\n'+'*'*70+'\n' |
|
173 | 173 | print >> sys.stderr, self.message_template.format(**self.info) |
|
174 | 174 | |
|
175 | 175 | # Construct report on disk |
|
176 | 176 | report.write(self.make_report(traceback)) |
|
177 | 177 | report.close() |
|
178 | 178 | raw_input("Hit <Enter> to quit (your terminal may close):") |
|
179 | 179 | |
|
180 | 180 | def make_report(self,traceback): |
|
181 | 181 | """Return a string containing a crash report.""" |
|
182 | 182 | |
|
183 | 183 | sec_sep = self.section_sep |
|
184 | 184 | |
|
185 | 185 | report = ['*'*75+'\n\n'+'IPython post-mortem report\n\n'] |
|
186 | 186 | rpt_add = report.append |
|
187 | 187 | rpt_add(sys_info()) |
|
188 | 188 | |
|
189 | 189 | try: |
|
190 | 190 | config = pformat(self.app.config) |
|
191 | 191 | rpt_add(sec_sep) |
|
192 | 192 | rpt_add('Application name: %s\n\n' % self.app_name) |
|
193 | 193 | rpt_add('Current user configuration structure:\n\n') |
|
194 | 194 | rpt_add(config) |
|
195 | 195 | except: |
|
196 | 196 | pass |
|
197 | 197 | rpt_add(sec_sep+'Crash traceback:\n\n' + traceback) |
|
198 | 198 | |
|
199 | 199 | return ''.join(report) |
|
200 | 200 | |
|
201 | 201 | |
|
202 | 202 | def crash_handler_lite(etype, evalue, tb): |
|
203 | 203 | """a light excepthook, adding a small message to the usual traceback""" |
|
204 | 204 | traceback.print_exception(etype, evalue, tb) |
|
205 | 205 | |
|
206 | 206 | from IPython.core.interactiveshell import InteractiveShell |
|
207 | 207 | if InteractiveShell.initialized(): |
|
208 | 208 | # we are in a Shell environment, give %magic example |
|
209 | 209 | config = "%config " |
|
210 | 210 | else: |
|
211 | 211 | # we are not in a shell, show generic config |
|
212 | 212 | config = "c." |
|
213 | 213 | print >> sys.stderr, _lite_message_template.format(email=author_email, config=config) |
|
214 | 214 |
@@ -1,407 +1,407 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Top-level display functions for displaying object in different formats. |
|
3 | 3 | |
|
4 | 4 | Authors: |
|
5 | 5 | |
|
6 | 6 | * Brian Granger |
|
7 | 7 | """ |
|
8 | 8 | |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 |
# Copyright (C) 2008-201 |
|
|
10 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
11 | 11 | # |
|
12 | 12 | # Distributed under the terms of the BSD License. The full license is in |
|
13 | 13 | # the file COPYING, distributed as part of this software. |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | # Imports |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | |
|
20 | 20 | from .displaypub import ( |
|
21 | 21 | publish_pretty, publish_html, |
|
22 | 22 | publish_latex, publish_svg, |
|
23 | 23 | publish_png, publish_json, |
|
24 | 24 | publish_javascript, publish_jpeg |
|
25 | 25 | ) |
|
26 | 26 | |
|
27 | 27 | #----------------------------------------------------------------------------- |
|
28 | 28 | # Main functions |
|
29 | 29 | #----------------------------------------------------------------------------- |
|
30 | 30 | |
|
31 | 31 | def display(*objs, **kwargs): |
|
32 | 32 | """Display a Python object in all frontends. |
|
33 | 33 | |
|
34 | 34 | By default all representations will be computed and sent to the frontends. |
|
35 | 35 | Frontends can decide which representation is used and how. |
|
36 | 36 | |
|
37 | 37 | Parameters |
|
38 | 38 | ---------- |
|
39 | 39 | objs : tuple of objects |
|
40 | 40 | The Python objects to display. |
|
41 | 41 | include : list or tuple, optional |
|
42 | 42 | A list of format type strings (MIME types) to include in the |
|
43 | 43 | format data dict. If this is set *only* the format types included |
|
44 | 44 | in this list will be computed. |
|
45 | 45 | exclude : list or tuple, optional |
|
46 | 46 | A list of format type string (MIME types) to exclue in the format |
|
47 | 47 | data dict. If this is set all format types will be computed, |
|
48 | 48 | except for those included in this argument. |
|
49 | 49 | """ |
|
50 | 50 | include = kwargs.get('include') |
|
51 | 51 | exclude = kwargs.get('exclude') |
|
52 | 52 | |
|
53 | 53 | from IPython.core.interactiveshell import InteractiveShell |
|
54 | 54 | inst = InteractiveShell.instance() |
|
55 | 55 | format = inst.display_formatter.format |
|
56 | 56 | publish = inst.display_pub.publish |
|
57 | 57 | |
|
58 | 58 | for obj in objs: |
|
59 | 59 | format_dict = format(obj, include=include, exclude=exclude) |
|
60 | 60 | publish('IPython.core.display.display', format_dict) |
|
61 | 61 | |
|
62 | 62 | |
|
63 | 63 | def display_pretty(*objs, **kwargs): |
|
64 | 64 | """Display the pretty (default) representation of an object. |
|
65 | 65 | |
|
66 | 66 | Parameters |
|
67 | 67 | ---------- |
|
68 | 68 | objs : tuple of objects |
|
69 | 69 | The Python objects to display, or if raw=True raw text data to |
|
70 | 70 | display. |
|
71 | 71 | raw : bool |
|
72 | 72 | Are the data objects raw data or Python objects that need to be |
|
73 | 73 | formatted before display? [default: False] |
|
74 | 74 | """ |
|
75 | 75 | raw = kwargs.pop('raw',False) |
|
76 | 76 | if raw: |
|
77 | 77 | for obj in objs: |
|
78 | 78 | publish_pretty(obj) |
|
79 | 79 | else: |
|
80 | 80 | display(*objs, include=['text/plain']) |
|
81 | 81 | |
|
82 | 82 | |
|
83 | 83 | def display_html(*objs, **kwargs): |
|
84 | 84 | """Display the HTML representation of an object. |
|
85 | 85 | |
|
86 | 86 | Parameters |
|
87 | 87 | ---------- |
|
88 | 88 | objs : tuple of objects |
|
89 | 89 | The Python objects to display, or if raw=True raw HTML data to |
|
90 | 90 | display. |
|
91 | 91 | raw : bool |
|
92 | 92 | Are the data objects raw data or Python objects that need to be |
|
93 | 93 | formatted before display? [default: False] |
|
94 | 94 | """ |
|
95 | 95 | raw = kwargs.pop('raw',False) |
|
96 | 96 | if raw: |
|
97 | 97 | for obj in objs: |
|
98 | 98 | publish_html(obj) |
|
99 | 99 | else: |
|
100 | 100 | display(*objs, include=['text/plain','text/html']) |
|
101 | 101 | |
|
102 | 102 | |
|
103 | 103 | def display_svg(*objs, **kwargs): |
|
104 | 104 | """Display the SVG representation of an object. |
|
105 | 105 | |
|
106 | 106 | Parameters |
|
107 | 107 | ---------- |
|
108 | 108 | objs : tuple of objects |
|
109 | 109 | The Python objects to display, or if raw=True raw svg data to |
|
110 | 110 | display. |
|
111 | 111 | raw : bool |
|
112 | 112 | Are the data objects raw data or Python objects that need to be |
|
113 | 113 | formatted before display? [default: False] |
|
114 | 114 | """ |
|
115 | 115 | raw = kwargs.pop('raw',False) |
|
116 | 116 | if raw: |
|
117 | 117 | for obj in objs: |
|
118 | 118 | publish_svg(obj) |
|
119 | 119 | else: |
|
120 | 120 | display(*objs, include=['text/plain','image/svg+xml']) |
|
121 | 121 | |
|
122 | 122 | |
|
123 | 123 | def display_png(*objs, **kwargs): |
|
124 | 124 | """Display the PNG representation of an object. |
|
125 | 125 | |
|
126 | 126 | Parameters |
|
127 | 127 | ---------- |
|
128 | 128 | objs : tuple of objects |
|
129 | 129 | The Python objects to display, or if raw=True raw png data to |
|
130 | 130 | display. |
|
131 | 131 | raw : bool |
|
132 | 132 | Are the data objects raw data or Python objects that need to be |
|
133 | 133 | formatted before display? [default: False] |
|
134 | 134 | """ |
|
135 | 135 | raw = kwargs.pop('raw',False) |
|
136 | 136 | if raw: |
|
137 | 137 | for obj in objs: |
|
138 | 138 | publish_png(obj) |
|
139 | 139 | else: |
|
140 | 140 | display(*objs, include=['text/plain','image/png']) |
|
141 | 141 | |
|
142 | 142 | |
|
143 | 143 | def display_jpeg(*objs, **kwargs): |
|
144 | 144 | """Display the JPEG representation of an object. |
|
145 | 145 | |
|
146 | 146 | Parameters |
|
147 | 147 | ---------- |
|
148 | 148 | objs : tuple of objects |
|
149 | 149 | The Python objects to display, or if raw=True raw JPEG data to |
|
150 | 150 | display. |
|
151 | 151 | raw : bool |
|
152 | 152 | Are the data objects raw data or Python objects that need to be |
|
153 | 153 | formatted before display? [default: False] |
|
154 | 154 | """ |
|
155 | 155 | raw = kwargs.pop('raw',False) |
|
156 | 156 | if raw: |
|
157 | 157 | for obj in objs: |
|
158 | 158 | publish_jpeg(obj) |
|
159 | 159 | else: |
|
160 | 160 | display(*objs, include=['text/plain','image/jpeg']) |
|
161 | 161 | |
|
162 | 162 | |
|
163 | 163 | def display_latex(*objs, **kwargs): |
|
164 | 164 | """Display the LaTeX representation of an object. |
|
165 | 165 | |
|
166 | 166 | Parameters |
|
167 | 167 | ---------- |
|
168 | 168 | objs : tuple of objects |
|
169 | 169 | The Python objects to display, or if raw=True raw latex data to |
|
170 | 170 | display. |
|
171 | 171 | raw : bool |
|
172 | 172 | Are the data objects raw data or Python objects that need to be |
|
173 | 173 | formatted before display? [default: False] |
|
174 | 174 | """ |
|
175 | 175 | raw = kwargs.pop('raw',False) |
|
176 | 176 | if raw: |
|
177 | 177 | for obj in objs: |
|
178 | 178 | publish_latex(obj) |
|
179 | 179 | else: |
|
180 | 180 | display(*objs, include=['text/plain','text/latex']) |
|
181 | 181 | |
|
182 | 182 | |
|
183 | 183 | def display_json(*objs, **kwargs): |
|
184 | 184 | """Display the JSON representation of an object. |
|
185 | 185 | |
|
186 | 186 | Parameters |
|
187 | 187 | ---------- |
|
188 | 188 | objs : tuple of objects |
|
189 | 189 | The Python objects to display, or if raw=True raw json data to |
|
190 | 190 | display. |
|
191 | 191 | raw : bool |
|
192 | 192 | Are the data objects raw data or Python objects that need to be |
|
193 | 193 | formatted before display? [default: False] |
|
194 | 194 | """ |
|
195 | 195 | raw = kwargs.pop('raw',False) |
|
196 | 196 | if raw: |
|
197 | 197 | for obj in objs: |
|
198 | 198 | publish_json(obj) |
|
199 | 199 | else: |
|
200 | 200 | display(*objs, include=['text/plain','application/json']) |
|
201 | 201 | |
|
202 | 202 | |
|
203 | 203 | def display_javascript(*objs, **kwargs): |
|
204 | 204 | """Display the Javascript representation of an object. |
|
205 | 205 | |
|
206 | 206 | Parameters |
|
207 | 207 | ---------- |
|
208 | 208 | objs : tuple of objects |
|
209 | 209 | The Python objects to display, or if raw=True raw javascript data to |
|
210 | 210 | display. |
|
211 | 211 | raw : bool |
|
212 | 212 | Are the data objects raw data or Python objects that need to be |
|
213 | 213 | formatted before display? [default: False] |
|
214 | 214 | """ |
|
215 | 215 | raw = kwargs.pop('raw',False) |
|
216 | 216 | if raw: |
|
217 | 217 | for obj in objs: |
|
218 | 218 | publish_javascript(obj) |
|
219 | 219 | else: |
|
220 | 220 | display(*objs, include=['text/plain','application/javascript']) |
|
221 | 221 | |
|
222 | 222 | #----------------------------------------------------------------------------- |
|
223 | 223 | # Smart classes |
|
224 | 224 | #----------------------------------------------------------------------------- |
|
225 | 225 | |
|
226 | 226 | |
|
227 | 227 | class DisplayObject(object): |
|
228 | 228 | """An object that wraps data to be displayed.""" |
|
229 | 229 | |
|
230 | 230 | _read_flags = 'r' |
|
231 | 231 | |
|
232 | 232 | def __init__(self, data=None, url=None, filename=None): |
|
233 | 233 | """Create a display object given raw data. |
|
234 | 234 | |
|
235 | 235 | When this object is returned by an expression or passed to the |
|
236 | 236 | display function, it will result in the data being displayed |
|
237 | 237 | in the frontend. The MIME type of the data should match the |
|
238 | 238 | subclasses used, so the Png subclass should be used for 'image/png' |
|
239 | 239 | data. If the data is a URL, the data will first be downloaded |
|
240 | 240 | and then displayed. If |
|
241 | 241 | |
|
242 | 242 | Parameters |
|
243 | 243 | ---------- |
|
244 | 244 | data : unicode, str or bytes |
|
245 | 245 | The raw data or a URL to download the data from. |
|
246 | 246 | url : unicode |
|
247 | 247 | A URL to download the data from. |
|
248 | 248 | filename : unicode |
|
249 | 249 | Path to a local file to load the data from. |
|
250 | 250 | """ |
|
251 | 251 | if data is not None and data.startswith('http'): |
|
252 | 252 | self.url = data |
|
253 | 253 | self.filename = None |
|
254 | 254 | self.data = None |
|
255 | 255 | else: |
|
256 | 256 | self.data = data |
|
257 | 257 | self.url = url |
|
258 | 258 | self.filename = None if filename is None else unicode(filename) |
|
259 | 259 | self.reload() |
|
260 | 260 | |
|
261 | 261 | def reload(self): |
|
262 | 262 | """Reload the raw data from file or URL.""" |
|
263 | 263 | if self.filename is not None: |
|
264 | 264 | with open(self.filename, self._read_flags) as f: |
|
265 | 265 | self.data = f.read() |
|
266 | 266 | elif self.url is not None: |
|
267 | 267 | try: |
|
268 | 268 | import urllib2 |
|
269 | 269 | response = urllib2.urlopen(self.url) |
|
270 | 270 | self.data = response.read() |
|
271 | 271 | # extract encoding from header, if there is one: |
|
272 | 272 | encoding = None |
|
273 | 273 | for sub in response.headers['content-type'].split(';'): |
|
274 | 274 | sub = sub.strip() |
|
275 | 275 | if sub.startswith('charset'): |
|
276 | 276 | encoding = sub.split('=')[-1].strip() |
|
277 | 277 | break |
|
278 | 278 | # decode data, if an encoding was specified |
|
279 | 279 | if encoding: |
|
280 | 280 | self.data = self.data.decode(encoding, 'replace') |
|
281 | 281 | except: |
|
282 | 282 | self.data = None |
|
283 | 283 | |
|
284 | 284 | class Pretty(DisplayObject): |
|
285 | 285 | |
|
286 | 286 | def _repr_pretty_(self): |
|
287 | 287 | return self.data |
|
288 | 288 | |
|
289 | 289 | |
|
290 | 290 | class HTML(DisplayObject): |
|
291 | 291 | |
|
292 | 292 | def _repr_html_(self): |
|
293 | 293 | return self.data |
|
294 | 294 | |
|
295 | 295 | |
|
296 | 296 | class Math(DisplayObject): |
|
297 | 297 | |
|
298 | 298 | def _repr_latex_(self): |
|
299 | 299 | return self.data |
|
300 | 300 | |
|
301 | 301 | |
|
302 | 302 | class SVG(DisplayObject): |
|
303 | 303 | |
|
304 | 304 | def _repr_svg_(self): |
|
305 | 305 | return self.data |
|
306 | 306 | |
|
307 | 307 | |
|
308 | 308 | class JSON(DisplayObject): |
|
309 | 309 | |
|
310 | 310 | def _repr_json_(self): |
|
311 | 311 | return self.data |
|
312 | 312 | |
|
313 | 313 | |
|
314 | 314 | class Javascript(DisplayObject): |
|
315 | 315 | |
|
316 | 316 | def _repr_javascript_(self): |
|
317 | 317 | return self.data |
|
318 | 318 | |
|
319 | 319 | |
|
320 | 320 | class Image(DisplayObject): |
|
321 | 321 | |
|
322 | 322 | _read_flags = 'rb' |
|
323 | 323 | |
|
324 | 324 | def __init__(self, data=None, url=None, filename=None, format=u'png', embed=False): |
|
325 | 325 | """Create a display an PNG/JPEG image given raw data. |
|
326 | 326 | |
|
327 | 327 | When this object is returned by an expression or passed to the |
|
328 | 328 | display function, it will result in the image being displayed |
|
329 | 329 | in the frontend. |
|
330 | 330 | |
|
331 | 331 | Parameters |
|
332 | 332 | ---------- |
|
333 | 333 | data : unicode, str or bytes |
|
334 | 334 | The raw data or a URL to download the data from. |
|
335 | 335 | url : unicode |
|
336 | 336 | A URL to download the data from. |
|
337 | 337 | filename : unicode |
|
338 | 338 | Path to a local file to load the data from. |
|
339 | 339 | format : unicode |
|
340 | 340 | The format of the image data (png/jpeg/jpg). If a filename or URL is given |
|
341 | 341 | for format will be inferred from the filename extension. |
|
342 | 342 | embed : bool |
|
343 | 343 | Should the image data be embedded in the notebook using a data URI (True) |
|
344 | 344 | or be loaded using an <img> tag. Set this to True if you want the image |
|
345 | 345 | to be viewable later with no internet connection. If a filename is given |
|
346 | 346 | embed is always set to True. |
|
347 | 347 | """ |
|
348 | 348 | if filename is not None: |
|
349 | 349 | ext = self._find_ext(filename) |
|
350 | 350 | elif url is not None: |
|
351 | 351 | ext = self._find_ext(url) |
|
352 | 352 | elif data.startswith('http'): |
|
353 | 353 | ext = self._find_ext(data) |
|
354 | 354 | else: |
|
355 | 355 | ext = None |
|
356 | 356 | if ext is not None: |
|
357 | 357 | if ext == u'jpg' or ext == u'jpeg': |
|
358 | 358 | format = u'jpeg' |
|
359 | 359 | if ext == u'png': |
|
360 | 360 | format = u'png' |
|
361 | 361 | self.format = unicode(format).lower() |
|
362 | 362 | self.embed = True if filename is not None else embed |
|
363 | 363 | super(Image, self).__init__(data=data, url=url, filename=filename) |
|
364 | 364 | |
|
365 | 365 | def reload(self): |
|
366 | 366 | """Reload the raw data from file or URL.""" |
|
367 | 367 | if self.embed: |
|
368 | 368 | super(Image,self).reload() |
|
369 | 369 | |
|
370 | 370 | def _repr_html_(self): |
|
371 | 371 | if not self.embed: |
|
372 | 372 | return u'<img src="%s" />' % self.url |
|
373 | 373 | |
|
374 | 374 | def _repr_png_(self): |
|
375 | 375 | if self.embed and self.format == u'png': |
|
376 | 376 | return self.data |
|
377 | 377 | |
|
378 | 378 | def _repr_jpeg_(self): |
|
379 | 379 | if self.embed and (self.format == u'jpeg' or self.format == u'jpg'): |
|
380 | 380 | return self.data |
|
381 | 381 | |
|
382 | 382 | def _find_ext(self, s): |
|
383 | 383 | return unicode(s.split('.')[-1].lower()) |
|
384 | 384 | |
|
385 | 385 | |
|
386 | 386 | def clear_output(stdout=True, stderr=True, other=True): |
|
387 | 387 | """Clear the output of the current cell receiving output. |
|
388 | 388 | |
|
389 | 389 | Optionally, each of stdout/stderr or other non-stream data (e.g. anything |
|
390 | 390 | produced by display()) can be excluded from the clear event. |
|
391 | 391 | |
|
392 | 392 | By default, everything is cleared. |
|
393 | 393 | |
|
394 | 394 | Parameters |
|
395 | 395 | ---------- |
|
396 | 396 | stdout : bool [default: True] |
|
397 | 397 | Whether to clear stdout. |
|
398 | 398 | stderr : bool [default: True] |
|
399 | 399 | Whether to clear stderr. |
|
400 | 400 | other : bool [default: True] |
|
401 | 401 | Whether to clear everything else that is not stdout/stderr |
|
402 | 402 | (e.g. figures,images,HTML, any result of display()). |
|
403 | 403 | """ |
|
404 | 404 | from IPython.core.interactiveshell import InteractiveShell |
|
405 | 405 | InteractiveShell.instance().display_pub.clear_output( |
|
406 | 406 | stdout=stdout, stderr=stderr, other=other, |
|
407 | 407 | ) |
@@ -1,70 +1,70 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | A context manager for handling sys.displayhook. |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Robert Kern |
|
8 | 8 | * Brian Granger |
|
9 | 9 | """ |
|
10 | 10 | |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 |
# Copyright (C) 2008-20 |
|
|
12 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
13 | 13 | # |
|
14 | 14 | # Distributed under the terms of the BSD License. The full license is in |
|
15 | 15 | # the file COPYING, distributed as part of this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | import sys |
|
23 | 23 | |
|
24 | 24 | from IPython.config.configurable import Configurable |
|
25 | 25 | from IPython.utils.traitlets import Any |
|
26 | 26 | |
|
27 | 27 | #----------------------------------------------------------------------------- |
|
28 | 28 | # Classes and functions |
|
29 | 29 | #----------------------------------------------------------------------------- |
|
30 | 30 | |
|
31 | 31 | |
|
32 | 32 | class DisplayTrap(Configurable): |
|
33 | 33 | """Object to manage sys.displayhook. |
|
34 | 34 | |
|
35 | 35 | This came from IPython.core.kernel.display_hook, but is simplified |
|
36 | 36 | (no callbacks or formatters) until more of the core is refactored. |
|
37 | 37 | """ |
|
38 | 38 | |
|
39 | 39 | hook = Any |
|
40 | 40 | |
|
41 | 41 | def __init__(self, hook=None): |
|
42 | 42 | super(DisplayTrap, self).__init__(hook=hook, config=None) |
|
43 | 43 | self.old_hook = None |
|
44 | 44 | # We define this to track if a single BuiltinTrap is nested. |
|
45 | 45 | # Only turn off the trap when the outermost call to __exit__ is made. |
|
46 | 46 | self._nested_level = 0 |
|
47 | 47 | |
|
48 | 48 | def __enter__(self): |
|
49 | 49 | if self._nested_level == 0: |
|
50 | 50 | self.set() |
|
51 | 51 | self._nested_level += 1 |
|
52 | 52 | return self |
|
53 | 53 | |
|
54 | 54 | def __exit__(self, type, value, traceback): |
|
55 | 55 | if self._nested_level == 1: |
|
56 | 56 | self.unset() |
|
57 | 57 | self._nested_level -= 1 |
|
58 | 58 | # Returning False will cause exceptions to propagate |
|
59 | 59 | return False |
|
60 | 60 | |
|
61 | 61 | def set(self): |
|
62 | 62 | """Set the hook.""" |
|
63 | 63 | if sys.displayhook is not self.hook: |
|
64 | 64 | self.old_hook = sys.displayhook |
|
65 | 65 | sys.displayhook = self.hook |
|
66 | 66 | |
|
67 | 67 | def unset(self): |
|
68 | 68 | """Unset the hook.""" |
|
69 | 69 | sys.displayhook = self.old_hook |
|
70 | 70 |
@@ -1,329 +1,329 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Displayhook for IPython. |
|
3 | 3 | |
|
4 | 4 | This defines a callable class that IPython uses for `sys.displayhook`. |
|
5 | 5 | |
|
6 | 6 | Authors: |
|
7 | 7 | |
|
8 | 8 | * Fernando Perez |
|
9 | 9 | * Brian Granger |
|
10 | 10 | * Robert Kern |
|
11 | 11 | """ |
|
12 | 12 | |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 |
# Copyright (C) 2008-201 |
|
|
14 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
15 | 15 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> |
|
16 | 16 | # |
|
17 | 17 | # Distributed under the terms of the BSD License. The full license is in |
|
18 | 18 | # the file COPYING, distributed as part of this software. |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | # Imports |
|
23 | 23 | #----------------------------------------------------------------------------- |
|
24 | 24 | |
|
25 | 25 | import __builtin__ |
|
26 | 26 | |
|
27 | 27 | from IPython.config.configurable import Configurable |
|
28 | 28 | from IPython.core import prompts |
|
29 | 29 | from IPython.utils import io |
|
30 | 30 | from IPython.utils.traitlets import Instance, List |
|
31 | 31 | from IPython.utils.warn import warn |
|
32 | 32 | |
|
33 | 33 | #----------------------------------------------------------------------------- |
|
34 | 34 | # Main displayhook class |
|
35 | 35 | #----------------------------------------------------------------------------- |
|
36 | 36 | |
|
37 | 37 | # TODO: The DisplayHook class should be split into two classes, one that |
|
38 | 38 | # manages the prompts and their synchronization and another that just does the |
|
39 | 39 | # displayhook logic and calls into the prompt manager. |
|
40 | 40 | |
|
41 | 41 | # TODO: Move the various attributes (cache_size, colors, input_sep, |
|
42 | 42 | # output_sep, output_sep2, ps1, ps2, ps_out, pad_left). Some of these are also |
|
43 | 43 | # attributes of InteractiveShell. They should be on ONE object only and the |
|
44 | 44 | # other objects should ask that one object for their values. |
|
45 | 45 | |
|
46 | 46 | class DisplayHook(Configurable): |
|
47 | 47 | """The custom IPython displayhook to replace sys.displayhook. |
|
48 | 48 | |
|
49 | 49 | This class does many things, but the basic idea is that it is a callable |
|
50 | 50 | that gets called anytime user code returns a value. |
|
51 | 51 | |
|
52 | 52 | Currently this class does more than just the displayhook logic and that |
|
53 | 53 | extra logic should eventually be moved out of here. |
|
54 | 54 | """ |
|
55 | 55 | |
|
56 | 56 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
57 | 57 | |
|
58 | 58 | def __init__(self, shell=None, cache_size=1000, |
|
59 | 59 | colors='NoColor', input_sep='\n', |
|
60 | 60 | output_sep='\n', output_sep2='', |
|
61 | 61 | ps1 = None, ps2 = None, ps_out = None, pad_left=True, |
|
62 | 62 | config=None): |
|
63 | 63 | super(DisplayHook, self).__init__(shell=shell, config=config) |
|
64 | 64 | |
|
65 | 65 | cache_size_min = 3 |
|
66 | 66 | if cache_size <= 0: |
|
67 | 67 | self.do_full_cache = 0 |
|
68 | 68 | cache_size = 0 |
|
69 | 69 | elif cache_size < cache_size_min: |
|
70 | 70 | self.do_full_cache = 0 |
|
71 | 71 | cache_size = 0 |
|
72 | 72 | warn('caching was disabled (min value for cache size is %s).' % |
|
73 | 73 | cache_size_min,level=3) |
|
74 | 74 | else: |
|
75 | 75 | self.do_full_cache = 1 |
|
76 | 76 | |
|
77 | 77 | self.cache_size = cache_size |
|
78 | 78 | self.input_sep = input_sep |
|
79 | 79 | |
|
80 | 80 | # we need a reference to the user-level namespace |
|
81 | 81 | self.shell = shell |
|
82 | 82 | |
|
83 | 83 | # Set input prompt strings and colors |
|
84 | 84 | if cache_size == 0: |
|
85 | 85 | if ps1.find('%n') > -1 or ps1.find(r'\#') > -1 \ |
|
86 | 86 | or ps1.find(r'\N') > -1: |
|
87 | 87 | ps1 = '>>> ' |
|
88 | 88 | if ps2.find('%n') > -1 or ps2.find(r'\#') > -1 \ |
|
89 | 89 | or ps2.find(r'\N') > -1: |
|
90 | 90 | ps2 = '... ' |
|
91 | 91 | self.ps1_str = self._set_prompt_str(ps1,'In [\\#]: ','>>> ') |
|
92 | 92 | self.ps2_str = self._set_prompt_str(ps2,' .\\D.: ','... ') |
|
93 | 93 | self.ps_out_str = self._set_prompt_str(ps_out,'Out[\\#]: ','') |
|
94 | 94 | |
|
95 | 95 | self.color_table = prompts.PromptColors |
|
96 | 96 | self.prompt1 = prompts.Prompt1(self,sep=input_sep,prompt=self.ps1_str, |
|
97 | 97 | pad_left=pad_left) |
|
98 | 98 | self.prompt2 = prompts.Prompt2(self,prompt=self.ps2_str,pad_left=pad_left) |
|
99 | 99 | self.prompt_out = prompts.PromptOut(self,sep='',prompt=self.ps_out_str, |
|
100 | 100 | pad_left=pad_left) |
|
101 | 101 | self.set_colors(colors) |
|
102 | 102 | |
|
103 | 103 | # Store the last prompt string each time, we need it for aligning |
|
104 | 104 | # continuation and auto-rewrite prompts |
|
105 | 105 | self.last_prompt = '' |
|
106 | 106 | self.output_sep = output_sep |
|
107 | 107 | self.output_sep2 = output_sep2 |
|
108 | 108 | self._,self.__,self.___ = '','','' |
|
109 | 109 | |
|
110 | 110 | # these are deliberately global: |
|
111 | 111 | to_user_ns = {'_':self._,'__':self.__,'___':self.___} |
|
112 | 112 | self.shell.user_ns.update(to_user_ns) |
|
113 | 113 | |
|
114 | 114 | @property |
|
115 | 115 | def prompt_count(self): |
|
116 | 116 | return self.shell.execution_count |
|
117 | 117 | |
|
118 | 118 | def _set_prompt_str(self,p_str,cache_def,no_cache_def): |
|
119 | 119 | if p_str is None: |
|
120 | 120 | if self.do_full_cache: |
|
121 | 121 | return cache_def |
|
122 | 122 | else: |
|
123 | 123 | return no_cache_def |
|
124 | 124 | else: |
|
125 | 125 | return p_str |
|
126 | 126 | |
|
127 | 127 | def set_colors(self, colors): |
|
128 | 128 | """Set the active color scheme and configure colors for the three |
|
129 | 129 | prompt subsystems.""" |
|
130 | 130 | |
|
131 | 131 | # FIXME: This modifying of the global prompts.prompt_specials needs |
|
132 | 132 | # to be fixed. We need to refactor all of the prompts stuff to use |
|
133 | 133 | # proper configuration and traits notifications. |
|
134 | 134 | if colors.lower()=='nocolor': |
|
135 | 135 | prompts.prompt_specials = prompts.prompt_specials_nocolor |
|
136 | 136 | else: |
|
137 | 137 | prompts.prompt_specials = prompts.prompt_specials_color |
|
138 | 138 | |
|
139 | 139 | self.color_table.set_active_scheme(colors) |
|
140 | 140 | self.prompt1.set_colors() |
|
141 | 141 | self.prompt2.set_colors() |
|
142 | 142 | self.prompt_out.set_colors() |
|
143 | 143 | |
|
144 | 144 | #------------------------------------------------------------------------- |
|
145 | 145 | # Methods used in __call__. Override these methods to modify the behavior |
|
146 | 146 | # of the displayhook. |
|
147 | 147 | #------------------------------------------------------------------------- |
|
148 | 148 | |
|
149 | 149 | def check_for_underscore(self): |
|
150 | 150 | """Check if the user has set the '_' variable by hand.""" |
|
151 | 151 | # If something injected a '_' variable in __builtin__, delete |
|
152 | 152 | # ipython's automatic one so we don't clobber that. gettext() in |
|
153 | 153 | # particular uses _, so we need to stay away from it. |
|
154 | 154 | if '_' in __builtin__.__dict__: |
|
155 | 155 | try: |
|
156 | 156 | del self.shell.user_ns['_'] |
|
157 | 157 | except KeyError: |
|
158 | 158 | pass |
|
159 | 159 | |
|
160 | 160 | def quiet(self): |
|
161 | 161 | """Should we silence the display hook because of ';'?""" |
|
162 | 162 | # do not print output if input ends in ';' |
|
163 | 163 | try: |
|
164 | 164 | cell = self.shell.history_manager.input_hist_parsed[self.prompt_count] |
|
165 | 165 | if cell.rstrip().endswith(';'): |
|
166 | 166 | return True |
|
167 | 167 | except IndexError: |
|
168 | 168 | # some uses of ipshellembed may fail here |
|
169 | 169 | pass |
|
170 | 170 | return False |
|
171 | 171 | |
|
172 | 172 | def start_displayhook(self): |
|
173 | 173 | """Start the displayhook, initializing resources.""" |
|
174 | 174 | pass |
|
175 | 175 | |
|
176 | 176 | def write_output_prompt(self): |
|
177 | 177 | """Write the output prompt. |
|
178 | 178 | |
|
179 | 179 | The default implementation simply writes the prompt to |
|
180 | 180 | ``io.stdout``. |
|
181 | 181 | """ |
|
182 | 182 | # Use write, not print which adds an extra space. |
|
183 | 183 | io.stdout.write(self.output_sep) |
|
184 | 184 | outprompt = str(self.prompt_out) |
|
185 | 185 | if self.do_full_cache: |
|
186 | 186 | io.stdout.write(outprompt) |
|
187 | 187 | |
|
188 | 188 | def compute_format_data(self, result): |
|
189 | 189 | """Compute format data of the object to be displayed. |
|
190 | 190 | |
|
191 | 191 | The format data is a generalization of the :func:`repr` of an object. |
|
192 | 192 | In the default implementation the format data is a :class:`dict` of |
|
193 | 193 | key value pair where the keys are valid MIME types and the values |
|
194 | 194 | are JSON'able data structure containing the raw data for that MIME |
|
195 | 195 | type. It is up to frontends to determine pick a MIME to to use and |
|
196 | 196 | display that data in an appropriate manner. |
|
197 | 197 | |
|
198 | 198 | This method only computes the format data for the object and should |
|
199 | 199 | NOT actually print or write that to a stream. |
|
200 | 200 | |
|
201 | 201 | Parameters |
|
202 | 202 | ---------- |
|
203 | 203 | result : object |
|
204 | 204 | The Python object passed to the display hook, whose format will be |
|
205 | 205 | computed. |
|
206 | 206 | |
|
207 | 207 | Returns |
|
208 | 208 | ------- |
|
209 | 209 | format_data : dict |
|
210 | 210 | A :class:`dict` whose keys are valid MIME types and values are |
|
211 | 211 | JSON'able raw data for that MIME type. It is recommended that |
|
212 | 212 | all return values of this should always include the "text/plain" |
|
213 | 213 | MIME type representation of the object. |
|
214 | 214 | """ |
|
215 | 215 | return self.shell.display_formatter.format(result) |
|
216 | 216 | |
|
217 | 217 | def write_format_data(self, format_dict): |
|
218 | 218 | """Write the format data dict to the frontend. |
|
219 | 219 | |
|
220 | 220 | This default version of this method simply writes the plain text |
|
221 | 221 | representation of the object to ``io.stdout``. Subclasses should |
|
222 | 222 | override this method to send the entire `format_dict` to the |
|
223 | 223 | frontends. |
|
224 | 224 | |
|
225 | 225 | Parameters |
|
226 | 226 | ---------- |
|
227 | 227 | format_dict : dict |
|
228 | 228 | The format dict for the object passed to `sys.displayhook`. |
|
229 | 229 | """ |
|
230 | 230 | # We want to print because we want to always make sure we have a |
|
231 | 231 | # newline, even if all the prompt separators are ''. This is the |
|
232 | 232 | # standard IPython behavior. |
|
233 | 233 | result_repr = format_dict['text/plain'] |
|
234 | 234 | if '\n' in result_repr: |
|
235 | 235 | # So that multi-line strings line up with the left column of |
|
236 | 236 | # the screen, instead of having the output prompt mess up |
|
237 | 237 | # their first line. |
|
238 | 238 | # We use the ps_out_str template instead of the expanded prompt |
|
239 | 239 | # because the expansion may add ANSI escapes that will interfere |
|
240 | 240 | # with our ability to determine whether or not we should add |
|
241 | 241 | # a newline. |
|
242 | 242 | if self.ps_out_str and not self.ps_out_str.endswith('\n'): |
|
243 | 243 | # But avoid extraneous empty lines. |
|
244 | 244 | result_repr = '\n' + result_repr |
|
245 | 245 | |
|
246 | 246 | print >>io.stdout, result_repr |
|
247 | 247 | |
|
248 | 248 | def update_user_ns(self, result): |
|
249 | 249 | """Update user_ns with various things like _, __, _1, etc.""" |
|
250 | 250 | |
|
251 | 251 | # Avoid recursive reference when displaying _oh/Out |
|
252 | 252 | if result is not self.shell.user_ns['_oh']: |
|
253 | 253 | if len(self.shell.user_ns['_oh']) >= self.cache_size and self.do_full_cache: |
|
254 | 254 | warn('Output cache limit (currently '+ |
|
255 | 255 | `self.cache_size`+' entries) hit.\n' |
|
256 | 256 | 'Flushing cache and resetting history counter...\n' |
|
257 | 257 | 'The only history variables available will be _,__,___ and _1\n' |
|
258 | 258 | 'with the current result.') |
|
259 | 259 | |
|
260 | 260 | self.flush() |
|
261 | 261 | # Don't overwrite '_' and friends if '_' is in __builtin__ (otherwise |
|
262 | 262 | # we cause buggy behavior for things like gettext). |
|
263 | 263 | |
|
264 | 264 | if '_' not in __builtin__.__dict__: |
|
265 | 265 | self.___ = self.__ |
|
266 | 266 | self.__ = self._ |
|
267 | 267 | self._ = result |
|
268 | 268 | self.shell.user_ns.update({'_':self._, |
|
269 | 269 | '__':self.__, |
|
270 | 270 | '___':self.___}) |
|
271 | 271 | |
|
272 | 272 | # hackish access to top-level namespace to create _1,_2... dynamically |
|
273 | 273 | to_main = {} |
|
274 | 274 | if self.do_full_cache: |
|
275 | 275 | new_result = '_'+`self.prompt_count` |
|
276 | 276 | to_main[new_result] = result |
|
277 | 277 | self.shell.user_ns.update(to_main) |
|
278 | 278 | self.shell.user_ns['_oh'][self.prompt_count] = result |
|
279 | 279 | |
|
280 | 280 | def log_output(self, format_dict): |
|
281 | 281 | """Log the output.""" |
|
282 | 282 | if self.shell.logger.log_output: |
|
283 | 283 | self.shell.logger.log_write(format_dict['text/plain'], 'output') |
|
284 | 284 | self.shell.history_manager.output_hist_reprs[self.prompt_count] = \ |
|
285 | 285 | format_dict['text/plain'] |
|
286 | 286 | |
|
287 | 287 | def finish_displayhook(self): |
|
288 | 288 | """Finish up all displayhook activities.""" |
|
289 | 289 | io.stdout.write(self.output_sep2) |
|
290 | 290 | io.stdout.flush() |
|
291 | 291 | |
|
292 | 292 | def __call__(self, result=None): |
|
293 | 293 | """Printing with history cache management. |
|
294 | 294 | |
|
295 | 295 | This is invoked everytime the interpreter needs to print, and is |
|
296 | 296 | activated by setting the variable sys.displayhook to it. |
|
297 | 297 | """ |
|
298 | 298 | self.check_for_underscore() |
|
299 | 299 | if result is not None and not self.quiet(): |
|
300 | 300 | self.start_displayhook() |
|
301 | 301 | self.write_output_prompt() |
|
302 | 302 | format_dict = self.compute_format_data(result) |
|
303 | 303 | self.write_format_data(format_dict) |
|
304 | 304 | self.update_user_ns(result) |
|
305 | 305 | self.log_output(format_dict) |
|
306 | 306 | self.finish_displayhook() |
|
307 | 307 | |
|
308 | 308 | def flush(self): |
|
309 | 309 | if not self.do_full_cache: |
|
310 | 310 | raise ValueError,"You shouldn't have reached the cache flush "\ |
|
311 | 311 | "if full caching is not enabled!" |
|
312 | 312 | # delete auto-generated vars from global namespace |
|
313 | 313 | |
|
314 | 314 | for n in range(1,self.prompt_count + 1): |
|
315 | 315 | key = '_'+`n` |
|
316 | 316 | try: |
|
317 | 317 | del self.shell.user_ns[key] |
|
318 | 318 | except: pass |
|
319 | 319 | self.shell.user_ns['_oh'].clear() |
|
320 | 320 | |
|
321 | 321 | # Release our own references to objects: |
|
322 | 322 | self._, self.__, self.___ = '', '', '' |
|
323 | 323 | |
|
324 | 324 | if '_' not in __builtin__.__dict__: |
|
325 | 325 | self.shell.user_ns.update({'_':None,'__':None, '___':None}) |
|
326 | 326 | import gc |
|
327 | 327 | # TODO: Is this really needed? |
|
328 | 328 | gc.collect() |
|
329 | 329 |
@@ -1,302 +1,302 b'' | |||
|
1 | 1 | """An interface for publishing rich data to frontends. |
|
2 | 2 | |
|
3 | 3 | There are two components of the display system: |
|
4 | 4 | |
|
5 | 5 | * Display formatters, which take a Python object and compute the |
|
6 | 6 | representation of the object in various formats (text, HTML, SVg, etc.). |
|
7 | 7 | * The display publisher that is used to send the representation data to the |
|
8 | 8 | various frontends. |
|
9 | 9 | |
|
10 | 10 | This module defines the logic display publishing. The display publisher uses |
|
11 | 11 | the ``display_data`` message type that is defined in the IPython messaging |
|
12 | 12 | spec. |
|
13 | 13 | |
|
14 | 14 | Authors: |
|
15 | 15 | |
|
16 | 16 | * Brian Granger |
|
17 | 17 | """ |
|
18 | 18 | |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 |
# Copyright (C) 2008-201 |
|
|
20 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
21 | 21 | # |
|
22 | 22 | # Distributed under the terms of the BSD License. The full license is in |
|
23 | 23 | # the file COPYING, distributed as part of this software. |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | # Imports |
|
28 | 28 | #----------------------------------------------------------------------------- |
|
29 | 29 | |
|
30 | 30 | from __future__ import print_function |
|
31 | 31 | |
|
32 | 32 | from IPython.config.configurable import Configurable |
|
33 | 33 | |
|
34 | 34 | #----------------------------------------------------------------------------- |
|
35 | 35 | # Main payload class |
|
36 | 36 | #----------------------------------------------------------------------------- |
|
37 | 37 | |
|
38 | 38 | class DisplayPublisher(Configurable): |
|
39 | 39 | """A traited class that publishes display data to frontends. |
|
40 | 40 | |
|
41 | 41 | Instances of this class are created by the main IPython object and should |
|
42 | 42 | be accessed there. |
|
43 | 43 | """ |
|
44 | 44 | |
|
45 | 45 | def _validate_data(self, source, data, metadata=None): |
|
46 | 46 | """Validate the display data. |
|
47 | 47 | |
|
48 | 48 | Parameters |
|
49 | 49 | ---------- |
|
50 | 50 | source : str |
|
51 | 51 | The fully dotted name of the callable that created the data, like |
|
52 | 52 | :func:`foo.bar.my_formatter`. |
|
53 | 53 | data : dict |
|
54 | 54 | The formata data dictionary. |
|
55 | 55 | metadata : dict |
|
56 | 56 | Any metadata for the data. |
|
57 | 57 | """ |
|
58 | 58 | |
|
59 | 59 | if not isinstance(source, basestring): |
|
60 | 60 | raise TypeError('source must be a str, got: %r' % source) |
|
61 | 61 | if not isinstance(data, dict): |
|
62 | 62 | raise TypeError('data must be a dict, got: %r' % data) |
|
63 | 63 | if metadata is not None: |
|
64 | 64 | if not isinstance(metadata, dict): |
|
65 | 65 | raise TypeError('metadata must be a dict, got: %r' % data) |
|
66 | 66 | |
|
67 | 67 | def publish(self, source, data, metadata=None): |
|
68 | 68 | """Publish data and metadata to all frontends. |
|
69 | 69 | |
|
70 | 70 | See the ``display_data`` message in the messaging documentation for |
|
71 | 71 | more details about this message type. |
|
72 | 72 | |
|
73 | 73 | The following MIME types are currently implemented: |
|
74 | 74 | |
|
75 | 75 | * text/plain |
|
76 | 76 | * text/html |
|
77 | 77 | * text/latex |
|
78 | 78 | * application/json |
|
79 | 79 | * application/javascript |
|
80 | 80 | * image/png |
|
81 | 81 | * image/jpeg |
|
82 | 82 | * image/svg+xml |
|
83 | 83 | |
|
84 | 84 | Parameters |
|
85 | 85 | ---------- |
|
86 | 86 | source : str |
|
87 | 87 | A string that give the function or method that created the data, |
|
88 | 88 | such as 'IPython.core.page'. |
|
89 | 89 | data : dict |
|
90 | 90 | A dictionary having keys that are valid MIME types (like |
|
91 | 91 | 'text/plain' or 'image/svg+xml') and values that are the data for |
|
92 | 92 | that MIME type. The data itself must be a JSON'able data |
|
93 | 93 | structure. Minimally all data should have the 'text/plain' data, |
|
94 | 94 | which can be displayed by all frontends. If more than the plain |
|
95 | 95 | text is given, it is up to the frontend to decide which |
|
96 | 96 | representation to use. |
|
97 | 97 | metadata : dict |
|
98 | 98 | A dictionary for metadata related to the data. This can contain |
|
99 | 99 | arbitrary key, value pairs that frontends can use to interpret |
|
100 | 100 | the data. |
|
101 | 101 | """ |
|
102 | 102 | from IPython.utils import io |
|
103 | 103 | # The default is to simply write the plain text data using io.stdout. |
|
104 | 104 | if data.has_key('text/plain'): |
|
105 | 105 | print(data['text/plain'], file=io.stdout) |
|
106 | 106 | |
|
107 | 107 | def clear_output(self, stdout=True, stderr=True, other=True): |
|
108 | 108 | """Clear the output of the cell receiving output.""" |
|
109 | 109 | pass |
|
110 | 110 | |
|
111 | 111 | |
|
112 | 112 | def publish_display_data(source, data, metadata=None): |
|
113 | 113 | """Publish data and metadata to all frontends. |
|
114 | 114 | |
|
115 | 115 | See the ``display_data`` message in the messaging documentation for |
|
116 | 116 | more details about this message type. |
|
117 | 117 | |
|
118 | 118 | The following MIME types are currently implemented: |
|
119 | 119 | |
|
120 | 120 | * text/plain |
|
121 | 121 | * text/html |
|
122 | 122 | * text/latex |
|
123 | 123 | * application/json |
|
124 | 124 | * application/javascript |
|
125 | 125 | * image/png |
|
126 | 126 | * image/jpeg |
|
127 | 127 | * image/svg+xml |
|
128 | 128 | |
|
129 | 129 | Parameters |
|
130 | 130 | ---------- |
|
131 | 131 | source : str |
|
132 | 132 | A string that give the function or method that created the data, |
|
133 | 133 | such as 'IPython.core.page'. |
|
134 | 134 | data : dict |
|
135 | 135 | A dictionary having keys that are valid MIME types (like |
|
136 | 136 | 'text/plain' or 'image/svg+xml') and values that are the data for |
|
137 | 137 | that MIME type. The data itself must be a JSON'able data |
|
138 | 138 | structure. Minimally all data should have the 'text/plain' data, |
|
139 | 139 | which can be displayed by all frontends. If more than the plain |
|
140 | 140 | text is given, it is up to the frontend to decide which |
|
141 | 141 | representation to use. |
|
142 | 142 | metadata : dict |
|
143 | 143 | A dictionary for metadata related to the data. This can contain |
|
144 | 144 | arbitrary key, value pairs that frontends can use to interpret |
|
145 | 145 | the data. |
|
146 | 146 | """ |
|
147 | 147 | from IPython.core.interactiveshell import InteractiveShell |
|
148 | 148 | InteractiveShell.instance().display_pub.publish( |
|
149 | 149 | source, |
|
150 | 150 | data, |
|
151 | 151 | metadata |
|
152 | 152 | ) |
|
153 | 153 | |
|
154 | 154 | |
|
155 | 155 | def publish_pretty(data, metadata=None): |
|
156 | 156 | """Publish raw text data to all frontends. |
|
157 | 157 | |
|
158 | 158 | Parameters |
|
159 | 159 | ---------- |
|
160 | 160 | data : unicode |
|
161 | 161 | The raw text data to publish. |
|
162 | 162 | metadata : dict |
|
163 | 163 | A dictionary for metadata related to the data. This can contain |
|
164 | 164 | arbitrary key, value pairs that frontends can use to interpret |
|
165 | 165 | the data. |
|
166 | 166 | """ |
|
167 | 167 | publish_display_data( |
|
168 | 168 | u'IPython.core.displaypub.publish_pretty', |
|
169 | 169 | {'text/plain':data}, |
|
170 | 170 | metadata=metadata |
|
171 | 171 | ) |
|
172 | 172 | |
|
173 | 173 | |
|
174 | 174 | def publish_html(data, metadata=None): |
|
175 | 175 | """Publish raw HTML data to all frontends. |
|
176 | 176 | |
|
177 | 177 | Parameters |
|
178 | 178 | ---------- |
|
179 | 179 | data : unicode |
|
180 | 180 | The raw HTML data to publish. |
|
181 | 181 | metadata : dict |
|
182 | 182 | A dictionary for metadata related to the data. This can contain |
|
183 | 183 | arbitrary key, value pairs that frontends can use to interpret |
|
184 | 184 | the data. |
|
185 | 185 | """ |
|
186 | 186 | publish_display_data( |
|
187 | 187 | u'IPython.core.displaypub.publish_html', |
|
188 | 188 | {'text/html':data}, |
|
189 | 189 | metadata=metadata |
|
190 | 190 | ) |
|
191 | 191 | |
|
192 | 192 | |
|
193 | 193 | def publish_latex(data, metadata=None): |
|
194 | 194 | """Publish raw LaTeX data to all frontends. |
|
195 | 195 | |
|
196 | 196 | Parameters |
|
197 | 197 | ---------- |
|
198 | 198 | data : unicode |
|
199 | 199 | The raw LaTeX data to publish. |
|
200 | 200 | metadata : dict |
|
201 | 201 | A dictionary for metadata related to the data. This can contain |
|
202 | 202 | arbitrary key, value pairs that frontends can use to interpret |
|
203 | 203 | the data. |
|
204 | 204 | """ |
|
205 | 205 | publish_display_data( |
|
206 | 206 | u'IPython.core.displaypub.publish_latex', |
|
207 | 207 | {'text/latex':data}, |
|
208 | 208 | metadata=metadata |
|
209 | 209 | ) |
|
210 | 210 | |
|
211 | 211 | def publish_png(data, metadata=None): |
|
212 | 212 | """Publish raw binary PNG data to all frontends. |
|
213 | 213 | |
|
214 | 214 | Parameters |
|
215 | 215 | ---------- |
|
216 | 216 | data : str/bytes |
|
217 | 217 | The raw binary PNG data to publish. |
|
218 | 218 | metadata : dict |
|
219 | 219 | A dictionary for metadata related to the data. This can contain |
|
220 | 220 | arbitrary key, value pairs that frontends can use to interpret |
|
221 | 221 | the data. |
|
222 | 222 | """ |
|
223 | 223 | publish_display_data( |
|
224 | 224 | u'IPython.core.displaypub.publish_png', |
|
225 | 225 | {'image/png':data}, |
|
226 | 226 | metadata=metadata |
|
227 | 227 | ) |
|
228 | 228 | |
|
229 | 229 | |
|
230 | 230 | def publish_jpeg(data, metadata=None): |
|
231 | 231 | """Publish raw binary JPEG data to all frontends. |
|
232 | 232 | |
|
233 | 233 | Parameters |
|
234 | 234 | ---------- |
|
235 | 235 | data : str/bytes |
|
236 | 236 | The raw binary JPEG data to publish. |
|
237 | 237 | metadata : dict |
|
238 | 238 | A dictionary for metadata related to the data. This can contain |
|
239 | 239 | arbitrary key, value pairs that frontends can use to interpret |
|
240 | 240 | the data. |
|
241 | 241 | """ |
|
242 | 242 | publish_display_data( |
|
243 | 243 | u'IPython.core.displaypub.publish_jpeg', |
|
244 | 244 | {'image/jpeg':data}, |
|
245 | 245 | metadata=metadata |
|
246 | 246 | ) |
|
247 | 247 | |
|
248 | 248 | |
|
249 | 249 | def publish_svg(data, metadata=None): |
|
250 | 250 | """Publish raw SVG data to all frontends. |
|
251 | 251 | |
|
252 | 252 | Parameters |
|
253 | 253 | ---------- |
|
254 | 254 | data : unicode |
|
255 | 255 | The raw SVG data to publish. |
|
256 | 256 | metadata : dict |
|
257 | 257 | A dictionary for metadata related to the data. This can contain |
|
258 | 258 | arbitrary key, value pairs that frontends can use to interpret |
|
259 | 259 | the data. |
|
260 | 260 | """ |
|
261 | 261 | publish_display_data( |
|
262 | 262 | u'IPython.core.displaypub.publish_svg', |
|
263 | 263 | {'image/svg+xml':data}, |
|
264 | 264 | metadata=metadata |
|
265 | 265 | ) |
|
266 | 266 | |
|
267 | 267 | def publish_json(data, metadata=None): |
|
268 | 268 | """Publish raw JSON data to all frontends. |
|
269 | 269 | |
|
270 | 270 | Parameters |
|
271 | 271 | ---------- |
|
272 | 272 | data : unicode |
|
273 | 273 | The raw JSON data to publish. |
|
274 | 274 | metadata : dict |
|
275 | 275 | A dictionary for metadata related to the data. This can contain |
|
276 | 276 | arbitrary key, value pairs that frontends can use to interpret |
|
277 | 277 | the data. |
|
278 | 278 | """ |
|
279 | 279 | publish_display_data( |
|
280 | 280 | u'IPython.core.displaypub.publish_json', |
|
281 | 281 | {'application/json':data}, |
|
282 | 282 | metadata=metadata |
|
283 | 283 | ) |
|
284 | 284 | |
|
285 | 285 | def publish_javascript(data, metadata=None): |
|
286 | 286 | """Publish raw Javascript data to all frontends. |
|
287 | 287 | |
|
288 | 288 | Parameters |
|
289 | 289 | ---------- |
|
290 | 290 | data : unicode |
|
291 | 291 | The raw Javascript data to publish. |
|
292 | 292 | metadata : dict |
|
293 | 293 | A dictionary for metadata related to the data. This can contain |
|
294 | 294 | arbitrary key, value pairs that frontends can use to interpret |
|
295 | 295 | the data. |
|
296 | 296 | """ |
|
297 | 297 | publish_display_data( |
|
298 | 298 | u'IPython.core.displaypub.publish_javascript', |
|
299 | 299 | {'application/javascript':data}, |
|
300 | 300 | metadata=metadata |
|
301 | 301 | ) |
|
302 | 302 |
@@ -1,59 +1,59 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Global exception classes for IPython.core. |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Brian Granger |
|
8 | 8 | * Fernando Perez |
|
9 | 9 | * Min Ragan-Kelley |
|
10 | 10 | |
|
11 | 11 | Notes |
|
12 | 12 | ----- |
|
13 | 13 | """ |
|
14 | 14 | |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 |
# Copyright (C) 2008-20 |
|
|
16 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
17 | 17 | # |
|
18 | 18 | # Distributed under the terms of the BSD License. The full license is in |
|
19 | 19 | # the file COPYING, distributed as part of this software. |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | # Imports |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | # Exception classes |
|
28 | 28 | #----------------------------------------------------------------------------- |
|
29 | 29 | |
|
30 | 30 | class IPythonCoreError(Exception): |
|
31 | 31 | pass |
|
32 | 32 | |
|
33 | 33 | |
|
34 | 34 | class TryNext(IPythonCoreError): |
|
35 | 35 | """Try next hook exception. |
|
36 | 36 | |
|
37 | 37 | Raise this in your hook function to indicate that the next hook handler |
|
38 | 38 | should be used to handle the operation. If you pass arguments to the |
|
39 | 39 | constructor those arguments will be used by the next hook instead of the |
|
40 | 40 | original ones. |
|
41 | 41 | """ |
|
42 | 42 | |
|
43 | 43 | def __init__(self, *args, **kwargs): |
|
44 | 44 | self.args = args |
|
45 | 45 | self.kwargs = kwargs |
|
46 | 46 | |
|
47 | 47 | class UsageError(IPythonCoreError): |
|
48 | 48 | """Error in magic function arguments, etc. |
|
49 | 49 | |
|
50 | 50 | Something that probably won't warrant a full traceback, but should |
|
51 | 51 | nevertheless interrupt a macro / batch file. |
|
52 | 52 | """ |
|
53 | 53 | |
|
54 | 54 | class StdinNotImplementedError(IPythonCoreError, NotImplementedError): |
|
55 | 55 | """raw_input was requested in a context where it is not supported |
|
56 | 56 | |
|
57 | 57 | For use in IPython kernels, where only some frontends may support |
|
58 | 58 | stdin requests. |
|
59 | 59 | """ |
@@ -1,125 +1,125 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """A class for managing IPython extensions. |
|
3 | 3 | |
|
4 | 4 | Authors: |
|
5 | 5 | |
|
6 | 6 | * Brian Granger |
|
7 | 7 | """ |
|
8 | 8 | |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 | # Copyright (C) 2010 The IPython Development Team | |
|
10 | # Copyright (C) 2010-2011 The IPython Development Team | |
|
11 | 11 | # |
|
12 | 12 | # Distributed under the terms of the BSD License. The full license is in |
|
13 | 13 | # the file COPYING, distributed as part of this software. |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | # Imports |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | |
|
20 | 20 | import os |
|
21 | 21 | import sys |
|
22 | 22 | |
|
23 | 23 | from IPython.config.configurable import Configurable |
|
24 | 24 | from IPython.utils.traitlets import Instance |
|
25 | 25 | |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | # Main class |
|
28 | 28 | #----------------------------------------------------------------------------- |
|
29 | 29 | |
|
30 | 30 | class ExtensionManager(Configurable): |
|
31 | 31 | """A class to manage IPython extensions. |
|
32 | 32 | |
|
33 | 33 | An IPython extension is an importable Python module that has |
|
34 | 34 | a function with the signature:: |
|
35 | 35 | |
|
36 | 36 | def load_ipython_extension(ipython): |
|
37 | 37 | # Do things with ipython |
|
38 | 38 | |
|
39 | 39 | This function is called after your extension is imported and the |
|
40 | 40 | currently active :class:`InteractiveShell` instance is passed as |
|
41 | 41 | the only argument. You can do anything you want with IPython at |
|
42 | 42 | that point, including defining new magic and aliases, adding new |
|
43 | 43 | components, etc. |
|
44 | 44 | |
|
45 | 45 | The :func:`load_ipython_extension` will be called again is you |
|
46 | 46 | load or reload the extension again. It is up to the extension |
|
47 | 47 | author to add code to manage that. |
|
48 | 48 | |
|
49 | 49 | You can put your extension modules anywhere you want, as long as |
|
50 | 50 | they can be imported by Python's standard import mechanism. However, |
|
51 | 51 | to make it easy to write extensions, you can also put your extensions |
|
52 | 52 | in ``os.path.join(self.ipython_dir, 'extensions')``. This directory |
|
53 | 53 | is added to ``sys.path`` automatically. |
|
54 | 54 | """ |
|
55 | 55 | |
|
56 | 56 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
57 | 57 | |
|
58 | 58 | def __init__(self, shell=None, config=None): |
|
59 | 59 | super(ExtensionManager, self).__init__(shell=shell, config=config) |
|
60 | 60 | self.shell.on_trait_change( |
|
61 | 61 | self._on_ipython_dir_changed, 'ipython_dir' |
|
62 | 62 | ) |
|
63 | 63 | |
|
64 | 64 | def __del__(self): |
|
65 | 65 | self.shell.on_trait_change( |
|
66 | 66 | self._on_ipython_dir_changed, 'ipython_dir', remove=True |
|
67 | 67 | ) |
|
68 | 68 | |
|
69 | 69 | @property |
|
70 | 70 | def ipython_extension_dir(self): |
|
71 | 71 | return os.path.join(self.shell.ipython_dir, u'extensions') |
|
72 | 72 | |
|
73 | 73 | def _on_ipython_dir_changed(self): |
|
74 | 74 | if not os.path.isdir(self.ipython_extension_dir): |
|
75 | 75 | os.makedirs(self.ipython_extension_dir, mode = 0777) |
|
76 | 76 | |
|
77 | 77 | def load_extension(self, module_str): |
|
78 | 78 | """Load an IPython extension by its module name. |
|
79 | 79 | |
|
80 | 80 | If :func:`load_ipython_extension` returns anything, this function |
|
81 | 81 | will return that object. |
|
82 | 82 | """ |
|
83 | 83 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
84 | 84 | |
|
85 | 85 | if module_str not in sys.modules: |
|
86 | 86 | with prepended_to_syspath(self.ipython_extension_dir): |
|
87 | 87 | __import__(module_str) |
|
88 | 88 | mod = sys.modules[module_str] |
|
89 | 89 | return self._call_load_ipython_extension(mod) |
|
90 | 90 | |
|
91 | 91 | def unload_extension(self, module_str): |
|
92 | 92 | """Unload an IPython extension by its module name. |
|
93 | 93 | |
|
94 | 94 | This function looks up the extension's name in ``sys.modules`` and |
|
95 | 95 | simply calls ``mod.unload_ipython_extension(self)``. |
|
96 | 96 | """ |
|
97 | 97 | if module_str in sys.modules: |
|
98 | 98 | mod = sys.modules[module_str] |
|
99 | 99 | self._call_unload_ipython_extension(mod) |
|
100 | 100 | |
|
101 | 101 | def reload_extension(self, module_str): |
|
102 | 102 | """Reload an IPython extension by calling reload. |
|
103 | 103 | |
|
104 | 104 | If the module has not been loaded before, |
|
105 | 105 | :meth:`InteractiveShell.load_extension` is called. Otherwise |
|
106 | 106 | :func:`reload` is called and then the :func:`load_ipython_extension` |
|
107 | 107 | function of the module, if it exists is called. |
|
108 | 108 | """ |
|
109 | 109 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
110 | 110 | |
|
111 | 111 | with prepended_to_syspath(self.ipython_extension_dir): |
|
112 | 112 | if module_str in sys.modules: |
|
113 | 113 | mod = sys.modules[module_str] |
|
114 | 114 | reload(mod) |
|
115 | 115 | self._call_load_ipython_extension(mod) |
|
116 | 116 | else: |
|
117 | 117 | self.load_extension(module_str) |
|
118 | 118 | |
|
119 | 119 | def _call_load_ipython_extension(self, mod): |
|
120 | 120 | if hasattr(mod, 'load_ipython_extension'): |
|
121 | 121 | return mod.load_ipython_extension(self.shell) |
|
122 | 122 | |
|
123 | 123 | def _call_unload_ipython_extension(self, mod): |
|
124 | 124 | if hasattr(mod, 'unload_ipython_extension'): |
|
125 | 125 | return mod.unload_ipython_extension(self.shell) |
@@ -1,620 +1,620 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Robert Kern |
|
8 | 8 | * Brian Granger |
|
9 | 9 | """ |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 |
# Copyright ( |
|
|
11 | # Copyright (C) 2010-2011, IPython Development Team. | |
|
12 | 12 | # |
|
13 | 13 | # Distributed under the terms of the Modified BSD License. |
|
14 | 14 | # |
|
15 | 15 | # The full license is in the file COPYING.txt, distributed with this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | # Stdlib imports |
|
23 | 23 | import abc |
|
24 | 24 | import sys |
|
25 | 25 | # We must use StringIO, as cStringIO doesn't handle unicode properly. |
|
26 | 26 | from StringIO import StringIO |
|
27 | 27 | |
|
28 | 28 | # Our own imports |
|
29 | 29 | from IPython.config.configurable import Configurable |
|
30 | 30 | from IPython.lib import pretty |
|
31 | 31 | from IPython.utils.traitlets import Bool, Dict, Integer, Unicode, CUnicode, ObjectName |
|
32 | 32 | from IPython.utils.py3compat import unicode_to_str |
|
33 | 33 | |
|
34 | 34 | |
|
35 | 35 | #----------------------------------------------------------------------------- |
|
36 | 36 | # The main DisplayFormatter class |
|
37 | 37 | #----------------------------------------------------------------------------- |
|
38 | 38 | |
|
39 | 39 | |
|
40 | 40 | class DisplayFormatter(Configurable): |
|
41 | 41 | |
|
42 | 42 | # When set to true only the default plain text formatter will be used. |
|
43 | 43 | plain_text_only = Bool(False, config=True) |
|
44 | 44 | |
|
45 | 45 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
46 | 46 | # values are subclasses of BaseFormatter. |
|
47 | 47 | formatters = Dict() |
|
48 | 48 | def _formatters_default(self): |
|
49 | 49 | """Activate the default formatters.""" |
|
50 | 50 | formatter_classes = [ |
|
51 | 51 | PlainTextFormatter, |
|
52 | 52 | HTMLFormatter, |
|
53 | 53 | SVGFormatter, |
|
54 | 54 | PNGFormatter, |
|
55 | 55 | JPEGFormatter, |
|
56 | 56 | LatexFormatter, |
|
57 | 57 | JSONFormatter, |
|
58 | 58 | JavascriptFormatter |
|
59 | 59 | ] |
|
60 | 60 | d = {} |
|
61 | 61 | for cls in formatter_classes: |
|
62 | 62 | f = cls(config=self.config) |
|
63 | 63 | d[f.format_type] = f |
|
64 | 64 | return d |
|
65 | 65 | |
|
66 | 66 | def format(self, obj, include=None, exclude=None): |
|
67 | 67 | """Return a format data dict for an object. |
|
68 | 68 | |
|
69 | 69 | By default all format types will be computed. |
|
70 | 70 | |
|
71 | 71 | The following MIME types are currently implemented: |
|
72 | 72 | |
|
73 | 73 | * text/plain |
|
74 | 74 | * text/html |
|
75 | 75 | * text/latex |
|
76 | 76 | * application/json |
|
77 | 77 | * application/javascript |
|
78 | 78 | * image/png |
|
79 | 79 | * image/jpeg |
|
80 | 80 | * image/svg+xml |
|
81 | 81 | |
|
82 | 82 | Parameters |
|
83 | 83 | ---------- |
|
84 | 84 | obj : object |
|
85 | 85 | The Python object whose format data will be computed. |
|
86 | 86 | include : list or tuple, optional |
|
87 | 87 | A list of format type strings (MIME types) to include in the |
|
88 | 88 | format data dict. If this is set *only* the format types included |
|
89 | 89 | in this list will be computed. |
|
90 | 90 | exclude : list or tuple, optional |
|
91 | 91 | A list of format type string (MIME types) to exclue in the format |
|
92 | 92 | data dict. If this is set all format types will be computed, |
|
93 | 93 | except for those included in this argument. |
|
94 | 94 | |
|
95 | 95 | Returns |
|
96 | 96 | ------- |
|
97 | 97 | format_dict : dict |
|
98 | 98 | A dictionary of key/value pairs, one or each format that was |
|
99 | 99 | generated for the object. The keys are the format types, which |
|
100 | 100 | will usually be MIME type strings and the values and JSON'able |
|
101 | 101 | data structure containing the raw data for the representation in |
|
102 | 102 | that format. |
|
103 | 103 | """ |
|
104 | 104 | format_dict = {} |
|
105 | 105 | |
|
106 | 106 | # If plain text only is active |
|
107 | 107 | if self.plain_text_only: |
|
108 | 108 | formatter = self.formatters['text/plain'] |
|
109 | 109 | try: |
|
110 | 110 | data = formatter(obj) |
|
111 | 111 | except: |
|
112 | 112 | # FIXME: log the exception |
|
113 | 113 | raise |
|
114 | 114 | if data is not None: |
|
115 | 115 | format_dict['text/plain'] = data |
|
116 | 116 | return format_dict |
|
117 | 117 | |
|
118 | 118 | for format_type, formatter in self.formatters.items(): |
|
119 | 119 | if include is not None: |
|
120 | 120 | if format_type not in include: |
|
121 | 121 | continue |
|
122 | 122 | if exclude is not None: |
|
123 | 123 | if format_type in exclude: |
|
124 | 124 | continue |
|
125 | 125 | try: |
|
126 | 126 | data = formatter(obj) |
|
127 | 127 | except: |
|
128 | 128 | # FIXME: log the exception |
|
129 | 129 | raise |
|
130 | 130 | if data is not None: |
|
131 | 131 | format_dict[format_type] = data |
|
132 | 132 | return format_dict |
|
133 | 133 | |
|
134 | 134 | @property |
|
135 | 135 | def format_types(self): |
|
136 | 136 | """Return the format types (MIME types) of the active formatters.""" |
|
137 | 137 | return self.formatters.keys() |
|
138 | 138 | |
|
139 | 139 | |
|
140 | 140 | #----------------------------------------------------------------------------- |
|
141 | 141 | # Formatters for specific format types (text, html, svg, etc.) |
|
142 | 142 | #----------------------------------------------------------------------------- |
|
143 | 143 | |
|
144 | 144 | |
|
145 | 145 | class FormatterABC(object): |
|
146 | 146 | """ Abstract base class for Formatters. |
|
147 | 147 | |
|
148 | 148 | A formatter is a callable class that is responsible for computing the |
|
149 | 149 | raw format data for a particular format type (MIME type). For example, |
|
150 | 150 | an HTML formatter would have a format type of `text/html` and would return |
|
151 | 151 | the HTML representation of the object when called. |
|
152 | 152 | """ |
|
153 | 153 | __metaclass__ = abc.ABCMeta |
|
154 | 154 | |
|
155 | 155 | # The format type of the data returned, usually a MIME type. |
|
156 | 156 | format_type = 'text/plain' |
|
157 | 157 | |
|
158 | 158 | # Is the formatter enabled... |
|
159 | 159 | enabled = True |
|
160 | 160 | |
|
161 | 161 | @abc.abstractmethod |
|
162 | 162 | def __call__(self, obj): |
|
163 | 163 | """Return a JSON'able representation of the object. |
|
164 | 164 | |
|
165 | 165 | If the object cannot be formatted by this formatter, then return None |
|
166 | 166 | """ |
|
167 | 167 | try: |
|
168 | 168 | return repr(obj) |
|
169 | 169 | except TypeError: |
|
170 | 170 | return None |
|
171 | 171 | |
|
172 | 172 | |
|
173 | 173 | class BaseFormatter(Configurable): |
|
174 | 174 | """A base formatter class that is configurable. |
|
175 | 175 | |
|
176 | 176 | This formatter should usually be used as the base class of all formatters. |
|
177 | 177 | It is a traited :class:`Configurable` class and includes an extensible |
|
178 | 178 | API for users to determine how their objects are formatted. The following |
|
179 | 179 | logic is used to find a function to format an given object. |
|
180 | 180 | |
|
181 | 181 | 1. The object is introspected to see if it has a method with the name |
|
182 | 182 | :attr:`print_method`. If is does, that object is passed to that method |
|
183 | 183 | for formatting. |
|
184 | 184 | 2. If no print method is found, three internal dictionaries are consulted |
|
185 | 185 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
186 | 186 | and :attr:`deferred_printers`. |
|
187 | 187 | |
|
188 | 188 | Users should use these dictionaries to register functions that will be |
|
189 | 189 | used to compute the format data for their objects (if those objects don't |
|
190 | 190 | have the special print methods). The easiest way of using these |
|
191 | 191 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
192 | 192 | methods. |
|
193 | 193 | |
|
194 | 194 | If no function/callable is found to compute the format data, ``None`` is |
|
195 | 195 | returned and this format type is not used. |
|
196 | 196 | """ |
|
197 | 197 | |
|
198 | 198 | format_type = Unicode('text/plain') |
|
199 | 199 | |
|
200 | 200 | enabled = Bool(True, config=True) |
|
201 | 201 | |
|
202 | 202 | print_method = ObjectName('__repr__') |
|
203 | 203 | |
|
204 | 204 | # The singleton printers. |
|
205 | 205 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
206 | 206 | singleton_printers = Dict(config=True) |
|
207 | 207 | def _singleton_printers_default(self): |
|
208 | 208 | return {} |
|
209 | 209 | |
|
210 | 210 | # The type-specific printers. |
|
211 | 211 | # Map type objects to the format functions. |
|
212 | 212 | type_printers = Dict(config=True) |
|
213 | 213 | def _type_printers_default(self): |
|
214 | 214 | return {} |
|
215 | 215 | |
|
216 | 216 | # The deferred-import type-specific printers. |
|
217 | 217 | # Map (modulename, classname) pairs to the format functions. |
|
218 | 218 | deferred_printers = Dict(config=True) |
|
219 | 219 | def _deferred_printers_default(self): |
|
220 | 220 | return {} |
|
221 | 221 | |
|
222 | 222 | def __call__(self, obj): |
|
223 | 223 | """Compute the format for an object.""" |
|
224 | 224 | if self.enabled: |
|
225 | 225 | obj_id = id(obj) |
|
226 | 226 | try: |
|
227 | 227 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
228 | 228 | # First try to find registered singleton printers for the type. |
|
229 | 229 | try: |
|
230 | 230 | printer = self.singleton_printers[obj_id] |
|
231 | 231 | except (TypeError, KeyError): |
|
232 | 232 | pass |
|
233 | 233 | else: |
|
234 | 234 | return printer(obj) |
|
235 | 235 | # Next look for type_printers. |
|
236 | 236 | for cls in pretty._get_mro(obj_class): |
|
237 | 237 | if cls in self.type_printers: |
|
238 | 238 | return self.type_printers[cls](obj) |
|
239 | 239 | else: |
|
240 | 240 | printer = self._in_deferred_types(cls) |
|
241 | 241 | if printer is not None: |
|
242 | 242 | return printer(obj) |
|
243 | 243 | # Finally look for special method names. |
|
244 | 244 | if hasattr(obj_class, self.print_method): |
|
245 | 245 | printer = getattr(obj_class, self.print_method) |
|
246 | 246 | return printer(obj) |
|
247 | 247 | return None |
|
248 | 248 | except Exception: |
|
249 | 249 | pass |
|
250 | 250 | else: |
|
251 | 251 | return None |
|
252 | 252 | |
|
253 | 253 | def for_type(self, typ, func): |
|
254 | 254 | """Add a format function for a given type. |
|
255 | 255 | |
|
256 | 256 | Parameters |
|
257 | 257 | ----------- |
|
258 | 258 | typ : class |
|
259 | 259 | The class of the object that will be formatted using `func`. |
|
260 | 260 | func : callable |
|
261 | 261 | The callable that will be called to compute the format data. The |
|
262 | 262 | call signature of this function is simple, it must take the |
|
263 | 263 | object to be formatted and return the raw data for the given |
|
264 | 264 | format. Subclasses may use a different call signature for the |
|
265 | 265 | `func` argument. |
|
266 | 266 | """ |
|
267 | 267 | oldfunc = self.type_printers.get(typ, None) |
|
268 | 268 | if func is not None: |
|
269 | 269 | # To support easy restoration of old printers, we need to ignore |
|
270 | 270 | # Nones. |
|
271 | 271 | self.type_printers[typ] = func |
|
272 | 272 | return oldfunc |
|
273 | 273 | |
|
274 | 274 | def for_type_by_name(self, type_module, type_name, func): |
|
275 | 275 | """Add a format function for a type specified by the full dotted |
|
276 | 276 | module and name of the type, rather than the type of the object. |
|
277 | 277 | |
|
278 | 278 | Parameters |
|
279 | 279 | ---------- |
|
280 | 280 | type_module : str |
|
281 | 281 | The full dotted name of the module the type is defined in, like |
|
282 | 282 | ``numpy``. |
|
283 | 283 | type_name : str |
|
284 | 284 | The name of the type (the class name), like ``dtype`` |
|
285 | 285 | func : callable |
|
286 | 286 | The callable that will be called to compute the format data. The |
|
287 | 287 | call signature of this function is simple, it must take the |
|
288 | 288 | object to be formatted and return the raw data for the given |
|
289 | 289 | format. Subclasses may use a different call signature for the |
|
290 | 290 | `func` argument. |
|
291 | 291 | """ |
|
292 | 292 | key = (type_module, type_name) |
|
293 | 293 | oldfunc = self.deferred_printers.get(key, None) |
|
294 | 294 | if func is not None: |
|
295 | 295 | # To support easy restoration of old printers, we need to ignore |
|
296 | 296 | # Nones. |
|
297 | 297 | self.deferred_printers[key] = func |
|
298 | 298 | return oldfunc |
|
299 | 299 | |
|
300 | 300 | def _in_deferred_types(self, cls): |
|
301 | 301 | """ |
|
302 | 302 | Check if the given class is specified in the deferred type registry. |
|
303 | 303 | |
|
304 | 304 | Returns the printer from the registry if it exists, and None if the |
|
305 | 305 | class is not in the registry. Successful matches will be moved to the |
|
306 | 306 | regular type registry for future use. |
|
307 | 307 | """ |
|
308 | 308 | mod = getattr(cls, '__module__', None) |
|
309 | 309 | name = getattr(cls, '__name__', None) |
|
310 | 310 | key = (mod, name) |
|
311 | 311 | printer = None |
|
312 | 312 | if key in self.deferred_printers: |
|
313 | 313 | # Move the printer over to the regular registry. |
|
314 | 314 | printer = self.deferred_printers.pop(key) |
|
315 | 315 | self.type_printers[cls] = printer |
|
316 | 316 | return printer |
|
317 | 317 | |
|
318 | 318 | |
|
319 | 319 | class PlainTextFormatter(BaseFormatter): |
|
320 | 320 | """The default pretty-printer. |
|
321 | 321 | |
|
322 | 322 | This uses :mod:`IPython.external.pretty` to compute the format data of |
|
323 | 323 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
324 | 324 | See the documentation of :mod:`IPython.external.pretty` for details on |
|
325 | 325 | how to write pretty printers. Here is a simple example:: |
|
326 | 326 | |
|
327 | 327 | def dtype_pprinter(obj, p, cycle): |
|
328 | 328 | if cycle: |
|
329 | 329 | return p.text('dtype(...)') |
|
330 | 330 | if hasattr(obj, 'fields'): |
|
331 | 331 | if obj.fields is None: |
|
332 | 332 | p.text(repr(obj)) |
|
333 | 333 | else: |
|
334 | 334 | p.begin_group(7, 'dtype([') |
|
335 | 335 | for i, field in enumerate(obj.descr): |
|
336 | 336 | if i > 0: |
|
337 | 337 | p.text(',') |
|
338 | 338 | p.breakable() |
|
339 | 339 | p.pretty(field) |
|
340 | 340 | p.end_group(7, '])') |
|
341 | 341 | """ |
|
342 | 342 | |
|
343 | 343 | # The format type of data returned. |
|
344 | 344 | format_type = Unicode('text/plain') |
|
345 | 345 | |
|
346 | 346 | # This subclass ignores this attribute as it always need to return |
|
347 | 347 | # something. |
|
348 | 348 | enabled = Bool(True, config=False) |
|
349 | 349 | |
|
350 | 350 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
351 | 351 | print_method = ObjectName('_repr_pretty_') |
|
352 | 352 | |
|
353 | 353 | # Whether to pretty-print or not. |
|
354 | 354 | pprint = Bool(True, config=True) |
|
355 | 355 | |
|
356 | 356 | # Whether to be verbose or not. |
|
357 | 357 | verbose = Bool(False, config=True) |
|
358 | 358 | |
|
359 | 359 | # The maximum width. |
|
360 | 360 | max_width = Integer(79, config=True) |
|
361 | 361 | |
|
362 | 362 | # The newline character. |
|
363 | 363 | newline = Unicode('\n', config=True) |
|
364 | 364 | |
|
365 | 365 | # format-string for pprinting floats |
|
366 | 366 | float_format = Unicode('%r') |
|
367 | 367 | # setter for float precision, either int or direct format-string |
|
368 | 368 | float_precision = CUnicode('', config=True) |
|
369 | 369 | |
|
370 | 370 | def _float_precision_changed(self, name, old, new): |
|
371 | 371 | """float_precision changed, set float_format accordingly. |
|
372 | 372 | |
|
373 | 373 | float_precision can be set by int or str. |
|
374 | 374 | This will set float_format, after interpreting input. |
|
375 | 375 | If numpy has been imported, numpy print precision will also be set. |
|
376 | 376 | |
|
377 | 377 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
378 | 378 | |
|
379 | 379 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
380 | 380 | |
|
381 | 381 | This parameter can be set via the '%precision' magic. |
|
382 | 382 | """ |
|
383 | 383 | |
|
384 | 384 | if '%' in new: |
|
385 | 385 | # got explicit format string |
|
386 | 386 | fmt = new |
|
387 | 387 | try: |
|
388 | 388 | fmt%3.14159 |
|
389 | 389 | except Exception: |
|
390 | 390 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
391 | 391 | elif new: |
|
392 | 392 | # otherwise, should be an int |
|
393 | 393 | try: |
|
394 | 394 | i = int(new) |
|
395 | 395 | assert i >= 0 |
|
396 | 396 | except ValueError: |
|
397 | 397 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
398 | 398 | except AssertionError: |
|
399 | 399 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
400 | 400 | |
|
401 | 401 | fmt = '%%.%if'%i |
|
402 | 402 | if 'numpy' in sys.modules: |
|
403 | 403 | # set numpy precision if it has been imported |
|
404 | 404 | import numpy |
|
405 | 405 | numpy.set_printoptions(precision=i) |
|
406 | 406 | else: |
|
407 | 407 | # default back to repr |
|
408 | 408 | fmt = '%r' |
|
409 | 409 | if 'numpy' in sys.modules: |
|
410 | 410 | import numpy |
|
411 | 411 | # numpy default is 8 |
|
412 | 412 | numpy.set_printoptions(precision=8) |
|
413 | 413 | self.float_format = fmt |
|
414 | 414 | |
|
415 | 415 | # Use the default pretty printers from IPython.external.pretty. |
|
416 | 416 | def _singleton_printers_default(self): |
|
417 | 417 | return pretty._singleton_pprinters.copy() |
|
418 | 418 | |
|
419 | 419 | def _type_printers_default(self): |
|
420 | 420 | d = pretty._type_pprinters.copy() |
|
421 | 421 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
422 | 422 | return d |
|
423 | 423 | |
|
424 | 424 | def _deferred_printers_default(self): |
|
425 | 425 | return pretty._deferred_type_pprinters.copy() |
|
426 | 426 | |
|
427 | 427 | #### FormatterABC interface #### |
|
428 | 428 | |
|
429 | 429 | def __call__(self, obj): |
|
430 | 430 | """Compute the pretty representation of the object.""" |
|
431 | 431 | if not self.pprint: |
|
432 | 432 | try: |
|
433 | 433 | return repr(obj) |
|
434 | 434 | except TypeError: |
|
435 | 435 | return '' |
|
436 | 436 | else: |
|
437 | 437 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
438 | 438 | stream = StringIO() |
|
439 | 439 | # self.newline.encode() is a quick fix for issue gh-597. We need to |
|
440 | 440 | # ensure that stream does not get a mix of unicode and bytestrings, |
|
441 | 441 | # or it will cause trouble. |
|
442 | 442 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
443 | 443 | self.max_width, unicode_to_str(self.newline), |
|
444 | 444 | singleton_pprinters=self.singleton_printers, |
|
445 | 445 | type_pprinters=self.type_printers, |
|
446 | 446 | deferred_pprinters=self.deferred_printers) |
|
447 | 447 | printer.pretty(obj) |
|
448 | 448 | printer.flush() |
|
449 | 449 | return stream.getvalue() |
|
450 | 450 | |
|
451 | 451 | |
|
452 | 452 | class HTMLFormatter(BaseFormatter): |
|
453 | 453 | """An HTML formatter. |
|
454 | 454 | |
|
455 | 455 | To define the callables that compute the HTML representation of your |
|
456 | 456 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
457 | 457 | or :meth:`for_type_by_name` methods to register functions that handle |
|
458 | 458 | this. |
|
459 | 459 | |
|
460 | 460 | The return value of this formatter should be a valid HTML snippet that |
|
461 | 461 | could be injected into an existing DOM. It should *not* include the |
|
462 | 462 | ```<html>`` or ```<body>`` tags. |
|
463 | 463 | """ |
|
464 | 464 | format_type = Unicode('text/html') |
|
465 | 465 | |
|
466 | 466 | print_method = ObjectName('_repr_html_') |
|
467 | 467 | |
|
468 | 468 | |
|
469 | 469 | class SVGFormatter(BaseFormatter): |
|
470 | 470 | """An SVG formatter. |
|
471 | 471 | |
|
472 | 472 | To define the callables that compute the SVG representation of your |
|
473 | 473 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
474 | 474 | or :meth:`for_type_by_name` methods to register functions that handle |
|
475 | 475 | this. |
|
476 | 476 | |
|
477 | 477 | The return value of this formatter should be valid SVG enclosed in |
|
478 | 478 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
479 | 479 | *not* include the ```<html>`` or ```<body>`` tags. |
|
480 | 480 | """ |
|
481 | 481 | format_type = Unicode('image/svg+xml') |
|
482 | 482 | |
|
483 | 483 | print_method = ObjectName('_repr_svg_') |
|
484 | 484 | |
|
485 | 485 | |
|
486 | 486 | class PNGFormatter(BaseFormatter): |
|
487 | 487 | """A PNG formatter. |
|
488 | 488 | |
|
489 | 489 | To define the callables that compute the PNG representation of your |
|
490 | 490 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
491 | 491 | or :meth:`for_type_by_name` methods to register functions that handle |
|
492 | 492 | this. |
|
493 | 493 | |
|
494 | 494 | The return value of this formatter should be raw PNG data, *not* |
|
495 | 495 | base64 encoded. |
|
496 | 496 | """ |
|
497 | 497 | format_type = Unicode('image/png') |
|
498 | 498 | |
|
499 | 499 | print_method = ObjectName('_repr_png_') |
|
500 | 500 | |
|
501 | 501 | |
|
502 | 502 | class JPEGFormatter(BaseFormatter): |
|
503 | 503 | """A JPEG formatter. |
|
504 | 504 | |
|
505 | 505 | To define the callables that compute the JPEG representation of your |
|
506 | 506 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
507 | 507 | or :meth:`for_type_by_name` methods to register functions that handle |
|
508 | 508 | this. |
|
509 | 509 | |
|
510 | 510 | The return value of this formatter should be raw JPEG data, *not* |
|
511 | 511 | base64 encoded. |
|
512 | 512 | """ |
|
513 | 513 | format_type = Unicode('image/jpeg') |
|
514 | 514 | |
|
515 | 515 | print_method = ObjectName('_repr_jpeg_') |
|
516 | 516 | |
|
517 | 517 | |
|
518 | 518 | class LatexFormatter(BaseFormatter): |
|
519 | 519 | """A LaTeX formatter. |
|
520 | 520 | |
|
521 | 521 | To define the callables that compute the LaTeX representation of your |
|
522 | 522 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
523 | 523 | or :meth:`for_type_by_name` methods to register functions that handle |
|
524 | 524 | this. |
|
525 | 525 | |
|
526 | 526 | The return value of this formatter should be a valid LaTeX equation, |
|
527 | 527 | enclosed in either ```$``` or ```$$```. |
|
528 | 528 | """ |
|
529 | 529 | format_type = Unicode('text/latex') |
|
530 | 530 | |
|
531 | 531 | print_method = ObjectName('_repr_latex_') |
|
532 | 532 | |
|
533 | 533 | |
|
534 | 534 | class JSONFormatter(BaseFormatter): |
|
535 | 535 | """A JSON string formatter. |
|
536 | 536 | |
|
537 | 537 | To define the callables that compute the JSON string representation of |
|
538 | 538 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
539 | 539 | or :meth:`for_type_by_name` methods to register functions that handle |
|
540 | 540 | this. |
|
541 | 541 | |
|
542 | 542 | The return value of this formatter should be a valid JSON string. |
|
543 | 543 | """ |
|
544 | 544 | format_type = Unicode('application/json') |
|
545 | 545 | |
|
546 | 546 | print_method = ObjectName('_repr_json_') |
|
547 | 547 | |
|
548 | 548 | |
|
549 | 549 | class JavascriptFormatter(BaseFormatter): |
|
550 | 550 | """A Javascript formatter. |
|
551 | 551 | |
|
552 | 552 | To define the callables that compute the Javascript representation of |
|
553 | 553 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
554 | 554 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
555 | 555 | that handle this. |
|
556 | 556 | |
|
557 | 557 | The return value of this formatter should be valid Javascript code and |
|
558 | 558 | should *not* be enclosed in ```<script>``` tags. |
|
559 | 559 | """ |
|
560 | 560 | format_type = Unicode('application/javascript') |
|
561 | 561 | |
|
562 | 562 | print_method = ObjectName('_repr_javascript_') |
|
563 | 563 | |
|
564 | 564 | FormatterABC.register(BaseFormatter) |
|
565 | 565 | FormatterABC.register(PlainTextFormatter) |
|
566 | 566 | FormatterABC.register(HTMLFormatter) |
|
567 | 567 | FormatterABC.register(SVGFormatter) |
|
568 | 568 | FormatterABC.register(PNGFormatter) |
|
569 | 569 | FormatterABC.register(JPEGFormatter) |
|
570 | 570 | FormatterABC.register(LatexFormatter) |
|
571 | 571 | FormatterABC.register(JSONFormatter) |
|
572 | 572 | FormatterABC.register(JavascriptFormatter) |
|
573 | 573 | |
|
574 | 574 | |
|
575 | 575 | def format_display_data(obj, include=None, exclude=None): |
|
576 | 576 | """Return a format data dict for an object. |
|
577 | 577 | |
|
578 | 578 | By default all format types will be computed. |
|
579 | 579 | |
|
580 | 580 | The following MIME types are currently implemented: |
|
581 | 581 | |
|
582 | 582 | * text/plain |
|
583 | 583 | * text/html |
|
584 | 584 | * text/latex |
|
585 | 585 | * application/json |
|
586 | 586 | * application/javascript |
|
587 | 587 | * image/png |
|
588 | 588 | * image/jpeg |
|
589 | 589 | * image/svg+xml |
|
590 | 590 | |
|
591 | 591 | Parameters |
|
592 | 592 | ---------- |
|
593 | 593 | obj : object |
|
594 | 594 | The Python object whose format data will be computed. |
|
595 | 595 | |
|
596 | 596 | Returns |
|
597 | 597 | ------- |
|
598 | 598 | format_dict : dict |
|
599 | 599 | A dictionary of key/value pairs, one or each format that was |
|
600 | 600 | generated for the object. The keys are the format types, which |
|
601 | 601 | will usually be MIME type strings and the values and JSON'able |
|
602 | 602 | data structure containing the raw data for the representation in |
|
603 | 603 | that format. |
|
604 | 604 | include : list or tuple, optional |
|
605 | 605 | A list of format type strings (MIME types) to include in the |
|
606 | 606 | format data dict. If this is set *only* the format types included |
|
607 | 607 | in this list will be computed. |
|
608 | 608 | exclude : list or tuple, optional |
|
609 | 609 | A list of format type string (MIME types) to exclue in the format |
|
610 | 610 | data dict. If this is set all format types will be computed, |
|
611 | 611 | except for those included in this argument. |
|
612 | 612 | """ |
|
613 | 613 | from IPython.core.interactiveshell import InteractiveShell |
|
614 | 614 | |
|
615 | 615 | InteractiveShell.instance().display_formatter.format( |
|
616 | 616 | obj, |
|
617 | 617 | include, |
|
618 | 618 | exclude |
|
619 | 619 | ) |
|
620 | 620 |
@@ -1,967 +1,967 b'' | |||
|
1 | 1 | """ History related magics and functionality """ |
|
2 | 2 | #----------------------------------------------------------------------------- |
|
3 | # Copyright (C) 2010 The IPython Development Team. | |
|
3 | # Copyright (C) 2010-2011 The IPython Development Team. | |
|
4 | 4 | # |
|
5 | 5 | # Distributed under the terms of the BSD License. |
|
6 | 6 | # |
|
7 | 7 | # The full license is in the file COPYING.txt, distributed with this software. |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | # Imports |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | from __future__ import print_function |
|
14 | 14 | |
|
15 | 15 | # Stdlib imports |
|
16 | 16 | import atexit |
|
17 | 17 | import datetime |
|
18 | 18 | import os |
|
19 | 19 | import re |
|
20 | 20 | try: |
|
21 | 21 | import sqlite3 |
|
22 | 22 | except ImportError: |
|
23 | 23 | sqlite3 = None |
|
24 | 24 | import threading |
|
25 | 25 | |
|
26 | 26 | # Our own packages |
|
27 | 27 | from IPython.config.configurable import Configurable |
|
28 | 28 | from IPython.external.decorator import decorator |
|
29 | 29 | from IPython.testing.skipdoctest import skip_doctest |
|
30 | 30 | from IPython.utils import io |
|
31 | 31 | from IPython.utils.path import locate_profile |
|
32 | 32 | from IPython.utils.traitlets import Bool, Dict, Instance, Integer, List, Unicode |
|
33 | 33 | from IPython.utils.warn import warn |
|
34 | 34 | |
|
35 | 35 | #----------------------------------------------------------------------------- |
|
36 | 36 | # Classes and functions |
|
37 | 37 | #----------------------------------------------------------------------------- |
|
38 | 38 | |
|
39 | 39 | class DummyDB(object): |
|
40 | 40 | """Dummy DB that will act as a black hole for history. |
|
41 | 41 | |
|
42 | 42 | Only used in the absence of sqlite""" |
|
43 | 43 | def execute(*args, **kwargs): |
|
44 | 44 | return [] |
|
45 | 45 | |
|
46 | 46 | def commit(self, *args, **kwargs): |
|
47 | 47 | pass |
|
48 | 48 | |
|
49 | 49 | def __enter__(self, *args, **kwargs): |
|
50 | 50 | pass |
|
51 | 51 | |
|
52 | 52 | def __exit__(self, *args, **kwargs): |
|
53 | 53 | pass |
|
54 | 54 | |
|
55 | 55 | @decorator |
|
56 | 56 | def needs_sqlite(f,*a,**kw): |
|
57 | 57 | """return an empty list in the absence of sqlite""" |
|
58 | 58 | if sqlite3 is None: |
|
59 | 59 | return [] |
|
60 | 60 | else: |
|
61 | 61 | return f(*a,**kw) |
|
62 | 62 | |
|
63 | 63 | class HistoryAccessor(Configurable): |
|
64 | 64 | """Access the history database without adding to it. |
|
65 | 65 | |
|
66 | 66 | This is intended for use by standalone history tools. IPython shells use |
|
67 | 67 | HistoryManager, below, which is a subclass of this.""" |
|
68 | 68 | |
|
69 | 69 | # String holding the path to the history file |
|
70 | 70 | hist_file = Unicode(config=True, |
|
71 | 71 | help="""Path to file to use for SQLite history database. |
|
72 | 72 | |
|
73 | 73 | By default, IPython will put the history database in the IPython profile |
|
74 | 74 | directory. If you would rather share one history among profiles, |
|
75 | 75 | you ca set this value in each, so that they are consistent. |
|
76 | 76 | |
|
77 | 77 | Due to an issue with fcntl, SQLite is known to misbehave on some NFS mounts. |
|
78 | 78 | If you see IPython hanging, try setting this to something on a local disk, |
|
79 | 79 | e.g:: |
|
80 | 80 | |
|
81 | 81 | ipython --HistoryManager.hist_file=/tmp/ipython_hist.sqlite |
|
82 | 82 | |
|
83 | 83 | """) |
|
84 | 84 | |
|
85 | 85 | |
|
86 | 86 | # The SQLite database |
|
87 | 87 | if sqlite3: |
|
88 | 88 | db = Instance(sqlite3.Connection) |
|
89 | 89 | else: |
|
90 | 90 | db = Instance(DummyDB) |
|
91 | 91 | |
|
92 | 92 | def __init__(self, profile='default', hist_file=u'', config=None, **traits): |
|
93 | 93 | """Create a new history accessor. |
|
94 | 94 | |
|
95 | 95 | Parameters |
|
96 | 96 | ---------- |
|
97 | 97 | profile : str |
|
98 | 98 | The name of the profile from which to open history. |
|
99 | 99 | hist_file : str |
|
100 | 100 | Path to an SQLite history database stored by IPython. If specified, |
|
101 | 101 | hist_file overrides profile. |
|
102 | 102 | config : |
|
103 | 103 | Config object. hist_file can also be set through this. |
|
104 | 104 | """ |
|
105 | 105 | # We need a pointer back to the shell for various tasks. |
|
106 | 106 | super(HistoryAccessor, self).__init__(config=config, **traits) |
|
107 | 107 | # defer setting hist_file from kwarg until after init, |
|
108 | 108 | # otherwise the default kwarg value would clobber any value |
|
109 | 109 | # set by config |
|
110 | 110 | if hist_file: |
|
111 | 111 | self.hist_file = hist_file |
|
112 | 112 | |
|
113 | 113 | if self.hist_file == u'': |
|
114 | 114 | # No one has set the hist_file, yet. |
|
115 | 115 | self.hist_file = self._get_hist_file_name(profile) |
|
116 | 116 | |
|
117 | 117 | if sqlite3 is None: |
|
118 | 118 | warn("IPython History requires SQLite, your history will not be saved\n") |
|
119 | 119 | self.db = DummyDB() |
|
120 | 120 | return |
|
121 | 121 | |
|
122 | 122 | try: |
|
123 | 123 | self.init_db() |
|
124 | 124 | except sqlite3.DatabaseError: |
|
125 | 125 | if os.path.isfile(self.hist_file): |
|
126 | 126 | # Try to move the file out of the way |
|
127 | 127 | base,ext = os.path.splitext(self.hist_file) |
|
128 | 128 | newpath = base + '-corrupt' + ext |
|
129 | 129 | os.rename(self.hist_file, newpath) |
|
130 | 130 | print("ERROR! History file wasn't a valid SQLite database.", |
|
131 | 131 | "It was moved to %s" % newpath, "and a new file created.") |
|
132 | 132 | self.init_db() |
|
133 | 133 | else: |
|
134 | 134 | # The hist_file is probably :memory: or something else. |
|
135 | 135 | raise |
|
136 | 136 | |
|
137 | 137 | def _get_hist_file_name(self, profile='default'): |
|
138 | 138 | """Find the history file for the given profile name. |
|
139 | 139 | |
|
140 | 140 | This is overridden by the HistoryManager subclass, to use the shell's |
|
141 | 141 | active profile. |
|
142 | 142 | |
|
143 | 143 | Parameters |
|
144 | 144 | ---------- |
|
145 | 145 | profile : str |
|
146 | 146 | The name of a profile which has a history file. |
|
147 | 147 | """ |
|
148 | 148 | return os.path.join(locate_profile(profile), 'history.sqlite') |
|
149 | 149 | |
|
150 | 150 | def init_db(self): |
|
151 | 151 | """Connect to the database, and create tables if necessary.""" |
|
152 | 152 | # use detect_types so that timestamps return datetime objects |
|
153 | 153 | self.db = sqlite3.connect(self.hist_file, detect_types=sqlite3.PARSE_DECLTYPES|sqlite3.PARSE_COLNAMES) |
|
154 | 154 | self.db.execute("""CREATE TABLE IF NOT EXISTS sessions (session integer |
|
155 | 155 | primary key autoincrement, start timestamp, |
|
156 | 156 | end timestamp, num_cmds integer, remark text)""") |
|
157 | 157 | self.db.execute("""CREATE TABLE IF NOT EXISTS history |
|
158 | 158 | (session integer, line integer, source text, source_raw text, |
|
159 | 159 | PRIMARY KEY (session, line))""") |
|
160 | 160 | # Output history is optional, but ensure the table's there so it can be |
|
161 | 161 | # enabled later. |
|
162 | 162 | self.db.execute("""CREATE TABLE IF NOT EXISTS output_history |
|
163 | 163 | (session integer, line integer, output text, |
|
164 | 164 | PRIMARY KEY (session, line))""") |
|
165 | 165 | self.db.commit() |
|
166 | 166 | |
|
167 | 167 | def writeout_cache(self): |
|
168 | 168 | """Overridden by HistoryManager to dump the cache before certain |
|
169 | 169 | database lookups.""" |
|
170 | 170 | pass |
|
171 | 171 | |
|
172 | 172 | ## ------------------------------- |
|
173 | 173 | ## Methods for retrieving history: |
|
174 | 174 | ## ------------------------------- |
|
175 | 175 | def _run_sql(self, sql, params, raw=True, output=False): |
|
176 | 176 | """Prepares and runs an SQL query for the history database. |
|
177 | 177 | |
|
178 | 178 | Parameters |
|
179 | 179 | ---------- |
|
180 | 180 | sql : str |
|
181 | 181 | Any filtering expressions to go after SELECT ... FROM ... |
|
182 | 182 | params : tuple |
|
183 | 183 | Parameters passed to the SQL query (to replace "?") |
|
184 | 184 | raw, output : bool |
|
185 | 185 | See :meth:`get_range` |
|
186 | 186 | |
|
187 | 187 | Returns |
|
188 | 188 | ------- |
|
189 | 189 | Tuples as :meth:`get_range` |
|
190 | 190 | """ |
|
191 | 191 | toget = 'source_raw' if raw else 'source' |
|
192 | 192 | sqlfrom = "history" |
|
193 | 193 | if output: |
|
194 | 194 | sqlfrom = "history LEFT JOIN output_history USING (session, line)" |
|
195 | 195 | toget = "history.%s, output_history.output" % toget |
|
196 | 196 | cur = self.db.execute("SELECT session, line, %s FROM %s " %\ |
|
197 | 197 | (toget, sqlfrom) + sql, params) |
|
198 | 198 | if output: # Regroup into 3-tuples, and parse JSON |
|
199 | 199 | return ((ses, lin, (inp, out)) for ses, lin, inp, out in cur) |
|
200 | 200 | return cur |
|
201 | 201 | |
|
202 | 202 | @needs_sqlite |
|
203 | 203 | def get_session_info(self, session=0): |
|
204 | 204 | """get info about a session |
|
205 | 205 | |
|
206 | 206 | Parameters |
|
207 | 207 | ---------- |
|
208 | 208 | |
|
209 | 209 | session : int |
|
210 | 210 | Session number to retrieve. The current session is 0, and negative |
|
211 | 211 | numbers count back from current session, so -1 is previous session. |
|
212 | 212 | |
|
213 | 213 | Returns |
|
214 | 214 | ------- |
|
215 | 215 | |
|
216 | 216 | (session_id [int], start [datetime], end [datetime], num_cmds [int], remark [unicode]) |
|
217 | 217 | |
|
218 | 218 | Sessions that are running or did not exit cleanly will have `end=None` |
|
219 | 219 | and `num_cmds=None`. |
|
220 | 220 | |
|
221 | 221 | """ |
|
222 | 222 | |
|
223 | 223 | if session <= 0: |
|
224 | 224 | session += self.session_number |
|
225 | 225 | |
|
226 | 226 | query = "SELECT * from sessions where session == ?" |
|
227 | 227 | return self.db.execute(query, (session,)).fetchone() |
|
228 | 228 | |
|
229 | 229 | def get_tail(self, n=10, raw=True, output=False, include_latest=False): |
|
230 | 230 | """Get the last n lines from the history database. |
|
231 | 231 | |
|
232 | 232 | Parameters |
|
233 | 233 | ---------- |
|
234 | 234 | n : int |
|
235 | 235 | The number of lines to get |
|
236 | 236 | raw, output : bool |
|
237 | 237 | See :meth:`get_range` |
|
238 | 238 | include_latest : bool |
|
239 | 239 | If False (default), n+1 lines are fetched, and the latest one |
|
240 | 240 | is discarded. This is intended to be used where the function |
|
241 | 241 | is called by a user command, which it should not return. |
|
242 | 242 | |
|
243 | 243 | Returns |
|
244 | 244 | ------- |
|
245 | 245 | Tuples as :meth:`get_range` |
|
246 | 246 | """ |
|
247 | 247 | self.writeout_cache() |
|
248 | 248 | if not include_latest: |
|
249 | 249 | n += 1 |
|
250 | 250 | cur = self._run_sql("ORDER BY session DESC, line DESC LIMIT ?", |
|
251 | 251 | (n,), raw=raw, output=output) |
|
252 | 252 | if not include_latest: |
|
253 | 253 | return reversed(list(cur)[1:]) |
|
254 | 254 | return reversed(list(cur)) |
|
255 | 255 | |
|
256 | 256 | def search(self, pattern="*", raw=True, search_raw=True, |
|
257 | 257 | output=False): |
|
258 | 258 | """Search the database using unix glob-style matching (wildcards |
|
259 | 259 | * and ?). |
|
260 | 260 | |
|
261 | 261 | Parameters |
|
262 | 262 | ---------- |
|
263 | 263 | pattern : str |
|
264 | 264 | The wildcarded pattern to match when searching |
|
265 | 265 | search_raw : bool |
|
266 | 266 | If True, search the raw input, otherwise, the parsed input |
|
267 | 267 | raw, output : bool |
|
268 | 268 | See :meth:`get_range` |
|
269 | 269 | |
|
270 | 270 | Returns |
|
271 | 271 | ------- |
|
272 | 272 | Tuples as :meth:`get_range` |
|
273 | 273 | """ |
|
274 | 274 | tosearch = "source_raw" if search_raw else "source" |
|
275 | 275 | if output: |
|
276 | 276 | tosearch = "history." + tosearch |
|
277 | 277 | self.writeout_cache() |
|
278 | 278 | return self._run_sql("WHERE %s GLOB ?" % tosearch, (pattern,), |
|
279 | 279 | raw=raw, output=output) |
|
280 | 280 | |
|
281 | 281 | def get_range(self, session, start=1, stop=None, raw=True,output=False): |
|
282 | 282 | """Retrieve input by session. |
|
283 | 283 | |
|
284 | 284 | Parameters |
|
285 | 285 | ---------- |
|
286 | 286 | session : int |
|
287 | 287 | Session number to retrieve. |
|
288 | 288 | start : int |
|
289 | 289 | First line to retrieve. |
|
290 | 290 | stop : int |
|
291 | 291 | End of line range (excluded from output itself). If None, retrieve |
|
292 | 292 | to the end of the session. |
|
293 | 293 | raw : bool |
|
294 | 294 | If True, return untranslated input |
|
295 | 295 | output : bool |
|
296 | 296 | If True, attempt to include output. This will be 'real' Python |
|
297 | 297 | objects for the current session, or text reprs from previous |
|
298 | 298 | sessions if db_log_output was enabled at the time. Where no output |
|
299 | 299 | is found, None is used. |
|
300 | 300 | |
|
301 | 301 | Returns |
|
302 | 302 | ------- |
|
303 | 303 | An iterator over the desired lines. Each line is a 3-tuple, either |
|
304 | 304 | (session, line, input) if output is False, or |
|
305 | 305 | (session, line, (input, output)) if output is True. |
|
306 | 306 | """ |
|
307 | 307 | if stop: |
|
308 | 308 | lineclause = "line >= ? AND line < ?" |
|
309 | 309 | params = (session, start, stop) |
|
310 | 310 | else: |
|
311 | 311 | lineclause = "line>=?" |
|
312 | 312 | params = (session, start) |
|
313 | 313 | |
|
314 | 314 | return self._run_sql("WHERE session==? AND %s""" % lineclause, |
|
315 | 315 | params, raw=raw, output=output) |
|
316 | 316 | |
|
317 | 317 | def get_range_by_str(self, rangestr, raw=True, output=False): |
|
318 | 318 | """Get lines of history from a string of ranges, as used by magic |
|
319 | 319 | commands %hist, %save, %macro, etc. |
|
320 | 320 | |
|
321 | 321 | Parameters |
|
322 | 322 | ---------- |
|
323 | 323 | rangestr : str |
|
324 | 324 | A string specifying ranges, e.g. "5 ~2/1-4". See |
|
325 | 325 | :func:`magic_history` for full details. |
|
326 | 326 | raw, output : bool |
|
327 | 327 | As :meth:`get_range` |
|
328 | 328 | |
|
329 | 329 | Returns |
|
330 | 330 | ------- |
|
331 | 331 | Tuples as :meth:`get_range` |
|
332 | 332 | """ |
|
333 | 333 | for sess, s, e in extract_hist_ranges(rangestr): |
|
334 | 334 | for line in self.get_range(sess, s, e, raw=raw, output=output): |
|
335 | 335 | yield line |
|
336 | 336 | |
|
337 | 337 | |
|
338 | 338 | class HistoryManager(HistoryAccessor): |
|
339 | 339 | """A class to organize all history-related functionality in one place. |
|
340 | 340 | """ |
|
341 | 341 | # Public interface |
|
342 | 342 | |
|
343 | 343 | # An instance of the IPython shell we are attached to |
|
344 | 344 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
345 | 345 | # Lists to hold processed and raw history. These start with a blank entry |
|
346 | 346 | # so that we can index them starting from 1 |
|
347 | 347 | input_hist_parsed = List([""]) |
|
348 | 348 | input_hist_raw = List([""]) |
|
349 | 349 | # A list of directories visited during session |
|
350 | 350 | dir_hist = List() |
|
351 | 351 | def _dir_hist_default(self): |
|
352 | 352 | try: |
|
353 | 353 | return [os.getcwdu()] |
|
354 | 354 | except OSError: |
|
355 | 355 | return [] |
|
356 | 356 | |
|
357 | 357 | # A dict of output history, keyed with ints from the shell's |
|
358 | 358 | # execution count. |
|
359 | 359 | output_hist = Dict() |
|
360 | 360 | # The text/plain repr of outputs. |
|
361 | 361 | output_hist_reprs = Dict() |
|
362 | 362 | |
|
363 | 363 | # The number of the current session in the history database |
|
364 | 364 | session_number = Integer() |
|
365 | 365 | # Should we log output to the database? (default no) |
|
366 | 366 | db_log_output = Bool(False, config=True) |
|
367 | 367 | # Write to database every x commands (higher values save disk access & power) |
|
368 | 368 | # Values of 1 or less effectively disable caching. |
|
369 | 369 | db_cache_size = Integer(0, config=True) |
|
370 | 370 | # The input and output caches |
|
371 | 371 | db_input_cache = List() |
|
372 | 372 | db_output_cache = List() |
|
373 | 373 | |
|
374 | 374 | # History saving in separate thread |
|
375 | 375 | save_thread = Instance('IPython.core.history.HistorySavingThread') |
|
376 | 376 | try: # Event is a function returning an instance of _Event... |
|
377 | 377 | save_flag = Instance(threading._Event) |
|
378 | 378 | except AttributeError: # ...until Python 3.3, when it's a class. |
|
379 | 379 | save_flag = Instance(threading.Event) |
|
380 | 380 | |
|
381 | 381 | # Private interface |
|
382 | 382 | # Variables used to store the three last inputs from the user. On each new |
|
383 | 383 | # history update, we populate the user's namespace with these, shifted as |
|
384 | 384 | # necessary. |
|
385 | 385 | _i00 = Unicode(u'') |
|
386 | 386 | _i = Unicode(u'') |
|
387 | 387 | _ii = Unicode(u'') |
|
388 | 388 | _iii = Unicode(u'') |
|
389 | 389 | |
|
390 | 390 | # A regex matching all forms of the exit command, so that we don't store |
|
391 | 391 | # them in the history (it's annoying to rewind the first entry and land on |
|
392 | 392 | # an exit call). |
|
393 | 393 | _exit_re = re.compile(r"(exit|quit)(\s*\(.*\))?$") |
|
394 | 394 | |
|
395 | 395 | def __init__(self, shell=None, config=None, **traits): |
|
396 | 396 | """Create a new history manager associated with a shell instance. |
|
397 | 397 | """ |
|
398 | 398 | # We need a pointer back to the shell for various tasks. |
|
399 | 399 | super(HistoryManager, self).__init__(shell=shell, config=config, |
|
400 | 400 | **traits) |
|
401 | 401 | self.save_flag = threading.Event() |
|
402 | 402 | self.db_input_cache_lock = threading.Lock() |
|
403 | 403 | self.db_output_cache_lock = threading.Lock() |
|
404 | 404 | self.save_thread = HistorySavingThread(self) |
|
405 | 405 | self.save_thread.start() |
|
406 | 406 | |
|
407 | 407 | self.new_session() |
|
408 | 408 | |
|
409 | 409 | def _get_hist_file_name(self, profile=None): |
|
410 | 410 | """Get default history file name based on the Shell's profile. |
|
411 | 411 | |
|
412 | 412 | The profile parameter is ignored, but must exist for compatibility with |
|
413 | 413 | the parent class.""" |
|
414 | 414 | profile_dir = self.shell.profile_dir.location |
|
415 | 415 | return os.path.join(profile_dir, 'history.sqlite') |
|
416 | 416 | |
|
417 | 417 | @needs_sqlite |
|
418 | 418 | def new_session(self, conn=None): |
|
419 | 419 | """Get a new session number.""" |
|
420 | 420 | if conn is None: |
|
421 | 421 | conn = self.db |
|
422 | 422 | |
|
423 | 423 | with conn: |
|
424 | 424 | cur = conn.execute("""INSERT INTO sessions VALUES (NULL, ?, NULL, |
|
425 | 425 | NULL, "") """, (datetime.datetime.now(),)) |
|
426 | 426 | self.session_number = cur.lastrowid |
|
427 | 427 | |
|
428 | 428 | def end_session(self): |
|
429 | 429 | """Close the database session, filling in the end time and line count.""" |
|
430 | 430 | self.writeout_cache() |
|
431 | 431 | with self.db: |
|
432 | 432 | self.db.execute("""UPDATE sessions SET end=?, num_cmds=? WHERE |
|
433 | 433 | session==?""", (datetime.datetime.now(), |
|
434 | 434 | len(self.input_hist_parsed)-1, self.session_number)) |
|
435 | 435 | self.session_number = 0 |
|
436 | 436 | |
|
437 | 437 | def name_session(self, name): |
|
438 | 438 | """Give the current session a name in the history database.""" |
|
439 | 439 | with self.db: |
|
440 | 440 | self.db.execute("UPDATE sessions SET remark=? WHERE session==?", |
|
441 | 441 | (name, self.session_number)) |
|
442 | 442 | |
|
443 | 443 | def reset(self, new_session=True): |
|
444 | 444 | """Clear the session history, releasing all object references, and |
|
445 | 445 | optionally open a new session.""" |
|
446 | 446 | self.output_hist.clear() |
|
447 | 447 | # The directory history can't be completely empty |
|
448 | 448 | self.dir_hist[:] = [os.getcwdu()] |
|
449 | 449 | |
|
450 | 450 | if new_session: |
|
451 | 451 | if self.session_number: |
|
452 | 452 | self.end_session() |
|
453 | 453 | self.input_hist_parsed[:] = [""] |
|
454 | 454 | self.input_hist_raw[:] = [""] |
|
455 | 455 | self.new_session() |
|
456 | 456 | |
|
457 | 457 | # ------------------------------ |
|
458 | 458 | # Methods for retrieving history |
|
459 | 459 | # ------------------------------ |
|
460 | 460 | def _get_range_session(self, start=1, stop=None, raw=True, output=False): |
|
461 | 461 | """Get input and output history from the current session. Called by |
|
462 | 462 | get_range, and takes similar parameters.""" |
|
463 | 463 | input_hist = self.input_hist_raw if raw else self.input_hist_parsed |
|
464 | 464 | |
|
465 | 465 | n = len(input_hist) |
|
466 | 466 | if start < 0: |
|
467 | 467 | start += n |
|
468 | 468 | if not stop or (stop > n): |
|
469 | 469 | stop = n |
|
470 | 470 | elif stop < 0: |
|
471 | 471 | stop += n |
|
472 | 472 | |
|
473 | 473 | for i in range(start, stop): |
|
474 | 474 | if output: |
|
475 | 475 | line = (input_hist[i], self.output_hist_reprs.get(i)) |
|
476 | 476 | else: |
|
477 | 477 | line = input_hist[i] |
|
478 | 478 | yield (0, i, line) |
|
479 | 479 | |
|
480 | 480 | def get_range(self, session=0, start=1, stop=None, raw=True,output=False): |
|
481 | 481 | """Retrieve input by session. |
|
482 | 482 | |
|
483 | 483 | Parameters |
|
484 | 484 | ---------- |
|
485 | 485 | session : int |
|
486 | 486 | Session number to retrieve. The current session is 0, and negative |
|
487 | 487 | numbers count back from current session, so -1 is previous session. |
|
488 | 488 | start : int |
|
489 | 489 | First line to retrieve. |
|
490 | 490 | stop : int |
|
491 | 491 | End of line range (excluded from output itself). If None, retrieve |
|
492 | 492 | to the end of the session. |
|
493 | 493 | raw : bool |
|
494 | 494 | If True, return untranslated input |
|
495 | 495 | output : bool |
|
496 | 496 | If True, attempt to include output. This will be 'real' Python |
|
497 | 497 | objects for the current session, or text reprs from previous |
|
498 | 498 | sessions if db_log_output was enabled at the time. Where no output |
|
499 | 499 | is found, None is used. |
|
500 | 500 | |
|
501 | 501 | Returns |
|
502 | 502 | ------- |
|
503 | 503 | An iterator over the desired lines. Each line is a 3-tuple, either |
|
504 | 504 | (session, line, input) if output is False, or |
|
505 | 505 | (session, line, (input, output)) if output is True. |
|
506 | 506 | """ |
|
507 | 507 | if session <= 0: |
|
508 | 508 | session += self.session_number |
|
509 | 509 | if session==self.session_number: # Current session |
|
510 | 510 | return self._get_range_session(start, stop, raw, output) |
|
511 | 511 | return super(HistoryManager, self).get_range(session, start, stop, raw, output) |
|
512 | 512 | |
|
513 | 513 | ## ---------------------------- |
|
514 | 514 | ## Methods for storing history: |
|
515 | 515 | ## ---------------------------- |
|
516 | 516 | def store_inputs(self, line_num, source, source_raw=None): |
|
517 | 517 | """Store source and raw input in history and create input cache |
|
518 | 518 | variables _i*. |
|
519 | 519 | |
|
520 | 520 | Parameters |
|
521 | 521 | ---------- |
|
522 | 522 | line_num : int |
|
523 | 523 | The prompt number of this input. |
|
524 | 524 | |
|
525 | 525 | source : str |
|
526 | 526 | Python input. |
|
527 | 527 | |
|
528 | 528 | source_raw : str, optional |
|
529 | 529 | If given, this is the raw input without any IPython transformations |
|
530 | 530 | applied to it. If not given, ``source`` is used. |
|
531 | 531 | """ |
|
532 | 532 | if source_raw is None: |
|
533 | 533 | source_raw = source |
|
534 | 534 | source = source.rstrip('\n') |
|
535 | 535 | source_raw = source_raw.rstrip('\n') |
|
536 | 536 | |
|
537 | 537 | # do not store exit/quit commands |
|
538 | 538 | if self._exit_re.match(source_raw.strip()): |
|
539 | 539 | return |
|
540 | 540 | |
|
541 | 541 | self.input_hist_parsed.append(source) |
|
542 | 542 | self.input_hist_raw.append(source_raw) |
|
543 | 543 | |
|
544 | 544 | with self.db_input_cache_lock: |
|
545 | 545 | self.db_input_cache.append((line_num, source, source_raw)) |
|
546 | 546 | # Trigger to flush cache and write to DB. |
|
547 | 547 | if len(self.db_input_cache) >= self.db_cache_size: |
|
548 | 548 | self.save_flag.set() |
|
549 | 549 | |
|
550 | 550 | # update the auto _i variables |
|
551 | 551 | self._iii = self._ii |
|
552 | 552 | self._ii = self._i |
|
553 | 553 | self._i = self._i00 |
|
554 | 554 | self._i00 = source_raw |
|
555 | 555 | |
|
556 | 556 | # hackish access to user namespace to create _i1,_i2... dynamically |
|
557 | 557 | new_i = '_i%s' % line_num |
|
558 | 558 | to_main = {'_i': self._i, |
|
559 | 559 | '_ii': self._ii, |
|
560 | 560 | '_iii': self._iii, |
|
561 | 561 | new_i : self._i00 } |
|
562 | 562 | self.shell.user_ns.update(to_main) |
|
563 | 563 | |
|
564 | 564 | def store_output(self, line_num): |
|
565 | 565 | """If database output logging is enabled, this saves all the |
|
566 | 566 | outputs from the indicated prompt number to the database. It's |
|
567 | 567 | called by run_cell after code has been executed. |
|
568 | 568 | |
|
569 | 569 | Parameters |
|
570 | 570 | ---------- |
|
571 | 571 | line_num : int |
|
572 | 572 | The line number from which to save outputs |
|
573 | 573 | """ |
|
574 | 574 | if (not self.db_log_output) or (line_num not in self.output_hist_reprs): |
|
575 | 575 | return |
|
576 | 576 | output = self.output_hist_reprs[line_num] |
|
577 | 577 | |
|
578 | 578 | with self.db_output_cache_lock: |
|
579 | 579 | self.db_output_cache.append((line_num, output)) |
|
580 | 580 | if self.db_cache_size <= 1: |
|
581 | 581 | self.save_flag.set() |
|
582 | 582 | |
|
583 | 583 | def _writeout_input_cache(self, conn): |
|
584 | 584 | with conn: |
|
585 | 585 | for line in self.db_input_cache: |
|
586 | 586 | conn.execute("INSERT INTO history VALUES (?, ?, ?, ?)", |
|
587 | 587 | (self.session_number,)+line) |
|
588 | 588 | |
|
589 | 589 | def _writeout_output_cache(self, conn): |
|
590 | 590 | with conn: |
|
591 | 591 | for line in self.db_output_cache: |
|
592 | 592 | conn.execute("INSERT INTO output_history VALUES (?, ?, ?)", |
|
593 | 593 | (self.session_number,)+line) |
|
594 | 594 | |
|
595 | 595 | @needs_sqlite |
|
596 | 596 | def writeout_cache(self, conn=None): |
|
597 | 597 | """Write any entries in the cache to the database.""" |
|
598 | 598 | if conn is None: |
|
599 | 599 | conn = self.db |
|
600 | 600 | |
|
601 | 601 | with self.db_input_cache_lock: |
|
602 | 602 | try: |
|
603 | 603 | self._writeout_input_cache(conn) |
|
604 | 604 | except sqlite3.IntegrityError: |
|
605 | 605 | self.new_session(conn) |
|
606 | 606 | print("ERROR! Session/line number was not unique in", |
|
607 | 607 | "database. History logging moved to new session", |
|
608 | 608 | self.session_number) |
|
609 | 609 | try: # Try writing to the new session. If this fails, don't recurse |
|
610 | 610 | self._writeout_input_cache(conn) |
|
611 | 611 | except sqlite3.IntegrityError: |
|
612 | 612 | pass |
|
613 | 613 | finally: |
|
614 | 614 | self.db_input_cache = [] |
|
615 | 615 | |
|
616 | 616 | with self.db_output_cache_lock: |
|
617 | 617 | try: |
|
618 | 618 | self._writeout_output_cache(conn) |
|
619 | 619 | except sqlite3.IntegrityError: |
|
620 | 620 | print("!! Session/line number for output was not unique", |
|
621 | 621 | "in database. Output will not be stored.") |
|
622 | 622 | finally: |
|
623 | 623 | self.db_output_cache = [] |
|
624 | 624 | |
|
625 | 625 | |
|
626 | 626 | class HistorySavingThread(threading.Thread): |
|
627 | 627 | """This thread takes care of writing history to the database, so that |
|
628 | 628 | the UI isn't held up while that happens. |
|
629 | 629 | |
|
630 | 630 | It waits for the HistoryManager's save_flag to be set, then writes out |
|
631 | 631 | the history cache. The main thread is responsible for setting the flag when |
|
632 | 632 | the cache size reaches a defined threshold.""" |
|
633 | 633 | daemon = True |
|
634 | 634 | stop_now = False |
|
635 | 635 | def __init__(self, history_manager): |
|
636 | 636 | super(HistorySavingThread, self).__init__() |
|
637 | 637 | self.history_manager = history_manager |
|
638 | 638 | atexit.register(self.stop) |
|
639 | 639 | |
|
640 | 640 | @needs_sqlite |
|
641 | 641 | def run(self): |
|
642 | 642 | # We need a separate db connection per thread: |
|
643 | 643 | try: |
|
644 | 644 | self.db = sqlite3.connect(self.history_manager.hist_file) |
|
645 | 645 | while True: |
|
646 | 646 | self.history_manager.save_flag.wait() |
|
647 | 647 | if self.stop_now: |
|
648 | 648 | return |
|
649 | 649 | self.history_manager.save_flag.clear() |
|
650 | 650 | self.history_manager.writeout_cache(self.db) |
|
651 | 651 | except Exception as e: |
|
652 | 652 | print(("The history saving thread hit an unexpected error (%s)." |
|
653 | 653 | "History will not be written to the database.") % repr(e)) |
|
654 | 654 | |
|
655 | 655 | def stop(self): |
|
656 | 656 | """This can be called from the main thread to safely stop this thread. |
|
657 | 657 | |
|
658 | 658 | Note that it does not attempt to write out remaining history before |
|
659 | 659 | exiting. That should be done by calling the HistoryManager's |
|
660 | 660 | end_session method.""" |
|
661 | 661 | self.stop_now = True |
|
662 | 662 | self.history_manager.save_flag.set() |
|
663 | 663 | self.join() |
|
664 | 664 | |
|
665 | 665 | |
|
666 | 666 | # To match, e.g. ~5/8-~2/3 |
|
667 | 667 | range_re = re.compile(r""" |
|
668 | 668 | ((?P<startsess>~?\d+)/)? |
|
669 | 669 | (?P<start>\d+) # Only the start line num is compulsory |
|
670 | 670 | ((?P<sep>[\-:]) |
|
671 | 671 | ((?P<endsess>~?\d+)/)? |
|
672 | 672 | (?P<end>\d+))? |
|
673 | 673 | $""", re.VERBOSE) |
|
674 | 674 | |
|
675 | 675 | def extract_hist_ranges(ranges_str): |
|
676 | 676 | """Turn a string of history ranges into 3-tuples of (session, start, stop). |
|
677 | 677 | |
|
678 | 678 | Examples |
|
679 | 679 | -------- |
|
680 | 680 | list(extract_input_ranges("~8/5-~7/4 2")) |
|
681 | 681 | [(-8, 5, None), (-7, 1, 4), (0, 2, 3)] |
|
682 | 682 | """ |
|
683 | 683 | for range_str in ranges_str.split(): |
|
684 | 684 | rmatch = range_re.match(range_str) |
|
685 | 685 | if not rmatch: |
|
686 | 686 | continue |
|
687 | 687 | start = int(rmatch.group("start")) |
|
688 | 688 | end = rmatch.group("end") |
|
689 | 689 | end = int(end) if end else start+1 # If no end specified, get (a, a+1) |
|
690 | 690 | if rmatch.group("sep") == "-": # 1-3 == 1:4 --> [1, 2, 3] |
|
691 | 691 | end += 1 |
|
692 | 692 | startsess = rmatch.group("startsess") or "0" |
|
693 | 693 | endsess = rmatch.group("endsess") or startsess |
|
694 | 694 | startsess = int(startsess.replace("~","-")) |
|
695 | 695 | endsess = int(endsess.replace("~","-")) |
|
696 | 696 | assert endsess >= startsess |
|
697 | 697 | |
|
698 | 698 | if endsess == startsess: |
|
699 | 699 | yield (startsess, start, end) |
|
700 | 700 | continue |
|
701 | 701 | # Multiple sessions in one range: |
|
702 | 702 | yield (startsess, start, None) |
|
703 | 703 | for sess in range(startsess+1, endsess): |
|
704 | 704 | yield (sess, 1, None) |
|
705 | 705 | yield (endsess, 1, end) |
|
706 | 706 | |
|
707 | 707 | def _format_lineno(session, line): |
|
708 | 708 | """Helper function to format line numbers properly.""" |
|
709 | 709 | if session == 0: |
|
710 | 710 | return str(line) |
|
711 | 711 | return "%s#%s" % (session, line) |
|
712 | 712 | |
|
713 | 713 | @skip_doctest |
|
714 | 714 | def magic_history(self, parameter_s = ''): |
|
715 | 715 | """Print input history (_i<n> variables), with most recent last. |
|
716 | 716 | |
|
717 | 717 | %history -> print at most 40 inputs (some may be multi-line)\\ |
|
718 | 718 | %history n -> print at most n inputs\\ |
|
719 | 719 | %history n1 n2 -> print inputs between n1 and n2 (n2 not included)\\ |
|
720 | 720 | |
|
721 | 721 | By default, input history is printed without line numbers so it can be |
|
722 | 722 | directly pasted into an editor. Use -n to show them. |
|
723 | 723 | |
|
724 | 724 | Ranges of history can be indicated using the syntax: |
|
725 | 725 | 4 : Line 4, current session |
|
726 | 726 | 4-6 : Lines 4-6, current session |
|
727 | 727 | 243/1-5: Lines 1-5, session 243 |
|
728 | 728 | ~2/7 : Line 7, session 2 before current |
|
729 | 729 | ~8/1-~6/5 : From the first line of 8 sessions ago, to the fifth line |
|
730 | 730 | of 6 sessions ago. |
|
731 | 731 | Multiple ranges can be entered, separated by spaces |
|
732 | 732 | |
|
733 | 733 | The same syntax is used by %macro, %save, %edit, %rerun |
|
734 | 734 | |
|
735 | 735 | Options: |
|
736 | 736 | |
|
737 | 737 | -n: print line numbers for each input. |
|
738 | 738 | This feature is only available if numbered prompts are in use. |
|
739 | 739 | |
|
740 | 740 | -o: also print outputs for each input. |
|
741 | 741 | |
|
742 | 742 | -p: print classic '>>>' python prompts before each input. This is useful |
|
743 | 743 | for making documentation, and in conjunction with -o, for producing |
|
744 | 744 | doctest-ready output. |
|
745 | 745 | |
|
746 | 746 | -r: (default) print the 'raw' history, i.e. the actual commands you typed. |
|
747 | 747 | |
|
748 | 748 | -t: print the 'translated' history, as IPython understands it. IPython |
|
749 | 749 | filters your input and converts it all into valid Python source before |
|
750 | 750 | executing it (things like magics or aliases are turned into function |
|
751 | 751 | calls, for example). With this option, you'll see the native history |
|
752 | 752 | instead of the user-entered version: '%cd /' will be seen as |
|
753 | 753 | 'get_ipython().magic("%cd /")' instead of '%cd /'. |
|
754 | 754 | |
|
755 | 755 | -g: treat the arg as a pattern to grep for in (full) history. |
|
756 | 756 | This includes the saved history (almost all commands ever written). |
|
757 | 757 | Use '%hist -g' to show full saved history (may be very long). |
|
758 | 758 | |
|
759 | 759 | -l: get the last n lines from all sessions. Specify n as a single arg, or |
|
760 | 760 | the default is the last 10 lines. |
|
761 | 761 | |
|
762 | 762 | -f FILENAME: instead of printing the output to the screen, redirect it to |
|
763 | 763 | the given file. The file is always overwritten, though IPython asks for |
|
764 | 764 | confirmation first if it already exists. |
|
765 | 765 | |
|
766 | 766 | Examples |
|
767 | 767 | -------- |
|
768 | 768 | :: |
|
769 | 769 | |
|
770 | 770 | In [6]: %hist -n 4 6 |
|
771 | 771 | 4:a = 12 |
|
772 | 772 | 5:print a**2 |
|
773 | 773 | |
|
774 | 774 | """ |
|
775 | 775 | |
|
776 | 776 | if not self.shell.displayhook.do_full_cache: |
|
777 | 777 | print('This feature is only available if numbered prompts are in use.') |
|
778 | 778 | return |
|
779 | 779 | opts,args = self.parse_options(parameter_s,'noprtglf:',mode='string') |
|
780 | 780 | |
|
781 | 781 | # For brevity |
|
782 | 782 | history_manager = self.shell.history_manager |
|
783 | 783 | |
|
784 | 784 | def _format_lineno(session, line): |
|
785 | 785 | """Helper function to format line numbers properly.""" |
|
786 | 786 | if session in (0, history_manager.session_number): |
|
787 | 787 | return str(line) |
|
788 | 788 | return "%s/%s" % (session, line) |
|
789 | 789 | |
|
790 | 790 | # Check if output to specific file was requested. |
|
791 | 791 | try: |
|
792 | 792 | outfname = opts['f'] |
|
793 | 793 | except KeyError: |
|
794 | 794 | outfile = io.stdout # default |
|
795 | 795 | # We don't want to close stdout at the end! |
|
796 | 796 | close_at_end = False |
|
797 | 797 | else: |
|
798 | 798 | if os.path.exists(outfname): |
|
799 | 799 | if not io.ask_yes_no("File %r exists. Overwrite?" % outfname): |
|
800 | 800 | print('Aborting.') |
|
801 | 801 | return |
|
802 | 802 | |
|
803 | 803 | outfile = open(outfname,'w') |
|
804 | 804 | close_at_end = True |
|
805 | 805 | |
|
806 | 806 | print_nums = 'n' in opts |
|
807 | 807 | get_output = 'o' in opts |
|
808 | 808 | pyprompts = 'p' in opts |
|
809 | 809 | # Raw history is the default |
|
810 | 810 | raw = not('t' in opts) |
|
811 | 811 | |
|
812 | 812 | default_length = 40 |
|
813 | 813 | pattern = None |
|
814 | 814 | |
|
815 | 815 | if 'g' in opts: # Glob search |
|
816 | 816 | pattern = "*" + args + "*" if args else "*" |
|
817 | 817 | hist = history_manager.search(pattern, raw=raw, output=get_output) |
|
818 | 818 | print_nums = True |
|
819 | 819 | elif 'l' in opts: # Get 'tail' |
|
820 | 820 | try: |
|
821 | 821 | n = int(args) |
|
822 | 822 | except ValueError, IndexError: |
|
823 | 823 | n = 10 |
|
824 | 824 | hist = history_manager.get_tail(n, raw=raw, output=get_output) |
|
825 | 825 | else: |
|
826 | 826 | if args: # Get history by ranges |
|
827 | 827 | hist = history_manager.get_range_by_str(args, raw, get_output) |
|
828 | 828 | else: # Just get history for the current session |
|
829 | 829 | hist = history_manager.get_range(raw=raw, output=get_output) |
|
830 | 830 | |
|
831 | 831 | # We could be displaying the entire history, so let's not try to pull it |
|
832 | 832 | # into a list in memory. Anything that needs more space will just misalign. |
|
833 | 833 | width = 4 |
|
834 | 834 | |
|
835 | 835 | for session, lineno, inline in hist: |
|
836 | 836 | # Print user history with tabs expanded to 4 spaces. The GUI clients |
|
837 | 837 | # use hard tabs for easier usability in auto-indented code, but we want |
|
838 | 838 | # to produce PEP-8 compliant history for safe pasting into an editor. |
|
839 | 839 | if get_output: |
|
840 | 840 | inline, output = inline |
|
841 | 841 | inline = inline.expandtabs(4).rstrip() |
|
842 | 842 | |
|
843 | 843 | multiline = "\n" in inline |
|
844 | 844 | line_sep = '\n' if multiline else ' ' |
|
845 | 845 | if print_nums: |
|
846 | 846 | print('%s:%s' % (_format_lineno(session, lineno).rjust(width), |
|
847 | 847 | line_sep), file=outfile, end='') |
|
848 | 848 | if pyprompts: |
|
849 | 849 | print(">>> ", end="", file=outfile) |
|
850 | 850 | if multiline: |
|
851 | 851 | inline = "\n... ".join(inline.splitlines()) + "\n..." |
|
852 | 852 | print(inline, file=outfile) |
|
853 | 853 | if get_output and output: |
|
854 | 854 | print(output, file=outfile) |
|
855 | 855 | |
|
856 | 856 | if close_at_end: |
|
857 | 857 | outfile.close() |
|
858 | 858 | |
|
859 | 859 | |
|
860 | 860 | def magic_rep(self, arg): |
|
861 | 861 | r"""Repeat a command, or get command to input line for editing. |
|
862 | 862 | |
|
863 | 863 | %recall and %rep are equivalent. |
|
864 | 864 | |
|
865 | 865 | - %recall (no arguments): |
|
866 | 866 | |
|
867 | 867 | Place a string version of last computation result (stored in the special '_' |
|
868 | 868 | variable) to the next input prompt. Allows you to create elaborate command |
|
869 | 869 | lines without using copy-paste:: |
|
870 | 870 | |
|
871 | 871 | In[1]: l = ["hei", "vaan"] |
|
872 | 872 | In[2]: "".join(l) |
|
873 | 873 | Out[2]: heivaan |
|
874 | 874 | In[3]: %rep |
|
875 | 875 | In[4]: heivaan_ <== cursor blinking |
|
876 | 876 | |
|
877 | 877 | %recall 45 |
|
878 | 878 | |
|
879 | 879 | Place history line 45 on the next input prompt. Use %hist to find |
|
880 | 880 | out the number. |
|
881 | 881 | |
|
882 | 882 | %recall 1-4 |
|
883 | 883 | |
|
884 | 884 | Combine the specified lines into one cell, and place it on the next |
|
885 | 885 | input prompt. See %history for the slice syntax. |
|
886 | 886 | |
|
887 | 887 | %recall foo+bar |
|
888 | 888 | |
|
889 | 889 | If foo+bar can be evaluated in the user namespace, the result is |
|
890 | 890 | placed at the next input prompt. Otherwise, the history is searched |
|
891 | 891 | for lines which contain that substring, and the most recent one is |
|
892 | 892 | placed at the next input prompt. |
|
893 | 893 | """ |
|
894 | 894 | if not arg: # Last output |
|
895 | 895 | self.set_next_input(str(self.shell.user_ns["_"])) |
|
896 | 896 | return |
|
897 | 897 | # Get history range |
|
898 | 898 | histlines = self.history_manager.get_range_by_str(arg) |
|
899 | 899 | cmd = "\n".join(x[2] for x in histlines) |
|
900 | 900 | if cmd: |
|
901 | 901 | self.set_next_input(cmd.rstrip()) |
|
902 | 902 | return |
|
903 | 903 | |
|
904 | 904 | try: # Variable in user namespace |
|
905 | 905 | cmd = str(eval(arg, self.shell.user_ns)) |
|
906 | 906 | except Exception: # Search for term in history |
|
907 | 907 | histlines = self.history_manager.search("*"+arg+"*") |
|
908 | 908 | for h in reversed([x[2] for x in histlines]): |
|
909 | 909 | if 'rep' in h: |
|
910 | 910 | continue |
|
911 | 911 | self.set_next_input(h.rstrip()) |
|
912 | 912 | return |
|
913 | 913 | else: |
|
914 | 914 | self.set_next_input(cmd.rstrip()) |
|
915 | 915 | print("Couldn't evaluate or find in history:", arg) |
|
916 | 916 | |
|
917 | 917 | def magic_rerun(self, parameter_s=''): |
|
918 | 918 | """Re-run previous input |
|
919 | 919 | |
|
920 | 920 | By default, you can specify ranges of input history to be repeated |
|
921 | 921 | (as with %history). With no arguments, it will repeat the last line. |
|
922 | 922 | |
|
923 | 923 | Options: |
|
924 | 924 | |
|
925 | 925 | -l <n> : Repeat the last n lines of input, not including the |
|
926 | 926 | current command. |
|
927 | 927 | |
|
928 | 928 | -g foo : Repeat the most recent line which contains foo |
|
929 | 929 | """ |
|
930 | 930 | opts, args = self.parse_options(parameter_s, 'l:g:', mode='string') |
|
931 | 931 | if "l" in opts: # Last n lines |
|
932 | 932 | n = int(opts['l']) |
|
933 | 933 | hist = self.history_manager.get_tail(n) |
|
934 | 934 | elif "g" in opts: # Search |
|
935 | 935 | p = "*"+opts['g']+"*" |
|
936 | 936 | hist = list(self.history_manager.search(p)) |
|
937 | 937 | for l in reversed(hist): |
|
938 | 938 | if "rerun" not in l[2]: |
|
939 | 939 | hist = [l] # The last match which isn't a %rerun |
|
940 | 940 | break |
|
941 | 941 | else: |
|
942 | 942 | hist = [] # No matches except %rerun |
|
943 | 943 | elif args: # Specify history ranges |
|
944 | 944 | hist = self.history_manager.get_range_by_str(args) |
|
945 | 945 | else: # Last line |
|
946 | 946 | hist = self.history_manager.get_tail(1) |
|
947 | 947 | hist = [x[2] for x in hist] |
|
948 | 948 | if not hist: |
|
949 | 949 | print("No lines in history match specification") |
|
950 | 950 | return |
|
951 | 951 | histlines = "\n".join(hist) |
|
952 | 952 | print("=== Executing: ===") |
|
953 | 953 | print(histlines) |
|
954 | 954 | print("=== Output: ===") |
|
955 | 955 | self.run_cell("\n".join(hist), store_history=False) |
|
956 | 956 | |
|
957 | 957 | |
|
958 | 958 | def init_ipython(ip): |
|
959 | 959 | ip.define_magic("rep", magic_rep) |
|
960 | 960 | ip.define_magic("recall", magic_rep) |
|
961 | 961 | ip.define_magic("rerun", magic_rerun) |
|
962 | 962 | ip.define_magic("hist",magic_history) # Alternative name |
|
963 | 963 | ip.define_magic("history",magic_history) |
|
964 | 964 | |
|
965 | 965 | # XXX - ipy_completers are in quarantine, need to be updated to new apis |
|
966 | 966 | #import ipy_completers |
|
967 | 967 | #ipy_completers.quick_completer('%hist' ,'-g -t -r -n') |
@@ -1,767 +1,767 b'' | |||
|
1 | 1 | """Analysis of text input into executable blocks. |
|
2 | 2 | |
|
3 | 3 | The main class in this module, :class:`InputSplitter`, is designed to break |
|
4 | 4 | input from either interactive, line-by-line environments or block-based ones, |
|
5 | 5 | into standalone blocks that can be executed by Python as 'single' statements |
|
6 | 6 | (thus triggering sys.displayhook). |
|
7 | 7 | |
|
8 | 8 | A companion, :class:`IPythonInputSplitter`, provides the same functionality but |
|
9 | 9 | with full support for the extended IPython syntax (magics, system calls, etc). |
|
10 | 10 | |
|
11 | 11 | For more details, see the class docstring below. |
|
12 | 12 | |
|
13 | 13 | Syntax Transformations |
|
14 | 14 | ---------------------- |
|
15 | 15 | |
|
16 | 16 | One of the main jobs of the code in this file is to apply all syntax |
|
17 | 17 | transformations that make up 'the IPython language', i.e. magics, shell |
|
18 | 18 | escapes, etc. All transformations should be implemented as *fully stateless* |
|
19 | 19 | entities, that simply take one line as their input and return a line. |
|
20 | 20 | Internally for implementation purposes they may be a normal function or a |
|
21 | 21 | callable object, but the only input they receive will be a single line and they |
|
22 | 22 | should only return a line, without holding any data-dependent state between |
|
23 | 23 | calls. |
|
24 | 24 | |
|
25 | 25 | As an example, the EscapedTransformer is a class so we can more clearly group |
|
26 | 26 | together the functionality of dispatching to individual functions based on the |
|
27 | 27 | starting escape character, but the only method for public use is its call |
|
28 | 28 | method. |
|
29 | 29 | |
|
30 | 30 | |
|
31 | 31 | ToDo |
|
32 | 32 | ---- |
|
33 | 33 | |
|
34 | 34 | - Should we make push() actually raise an exception once push_accepts_more() |
|
35 | 35 | returns False? |
|
36 | 36 | |
|
37 | 37 | - Naming cleanups. The tr_* names aren't the most elegant, though now they are |
|
38 | 38 | at least just attributes of a class so not really very exposed. |
|
39 | 39 | |
|
40 | 40 | - Think about the best way to support dynamic things: automagic, autocall, |
|
41 | 41 | macros, etc. |
|
42 | 42 | |
|
43 | 43 | - Think of a better heuristic for the application of the transforms in |
|
44 | 44 | IPythonInputSplitter.push() than looking at the buffer ending in ':'. Idea: |
|
45 | 45 | track indentation change events (indent, dedent, nothing) and apply them only |
|
46 | 46 | if the indentation went up, but not otherwise. |
|
47 | 47 | |
|
48 | 48 | - Think of the cleanest way for supporting user-specified transformations (the |
|
49 | 49 | user prefilters we had before). |
|
50 | 50 | |
|
51 | 51 | Authors |
|
52 | 52 | ------- |
|
53 | 53 | |
|
54 | 54 | * Fernando Perez |
|
55 | 55 | * Brian Granger |
|
56 | 56 | """ |
|
57 | 57 | #----------------------------------------------------------------------------- |
|
58 | # Copyright (C) 2010 The IPython Development Team | |
|
58 | # Copyright (C) 2010-2011 The IPython Development Team | |
|
59 | 59 | # |
|
60 | 60 | # Distributed under the terms of the BSD License. The full license is in |
|
61 | 61 | # the file COPYING, distributed as part of this software. |
|
62 | 62 | #----------------------------------------------------------------------------- |
|
63 | 63 | from __future__ import print_function |
|
64 | 64 | |
|
65 | 65 | #----------------------------------------------------------------------------- |
|
66 | 66 | # Imports |
|
67 | 67 | #----------------------------------------------------------------------------- |
|
68 | 68 | # stdlib |
|
69 | 69 | import ast |
|
70 | 70 | import codeop |
|
71 | 71 | import re |
|
72 | 72 | import sys |
|
73 | 73 | import tokenize |
|
74 | 74 | from StringIO import StringIO |
|
75 | 75 | |
|
76 | 76 | # IPython modules |
|
77 | 77 | from IPython.core.splitinput import split_user_input, LineInfo |
|
78 | 78 | from IPython.utils.py3compat import cast_unicode |
|
79 | 79 | |
|
80 | 80 | #----------------------------------------------------------------------------- |
|
81 | 81 | # Globals |
|
82 | 82 | #----------------------------------------------------------------------------- |
|
83 | 83 | |
|
84 | 84 | # The escape sequences that define the syntax transformations IPython will |
|
85 | 85 | # apply to user input. These can NOT be just changed here: many regular |
|
86 | 86 | # expressions and other parts of the code may use their hardcoded values, and |
|
87 | 87 | # for all intents and purposes they constitute the 'IPython syntax', so they |
|
88 | 88 | # should be considered fixed. |
|
89 | 89 | |
|
90 | 90 | ESC_SHELL = '!' # Send line to underlying system shell |
|
91 | 91 | ESC_SH_CAP = '!!' # Send line to system shell and capture output |
|
92 | 92 | ESC_HELP = '?' # Find information about object |
|
93 | 93 | ESC_HELP2 = '??' # Find extra-detailed information about object |
|
94 | 94 | ESC_MAGIC = '%' # Call magic function |
|
95 | 95 | ESC_QUOTE = ',' # Split args on whitespace, quote each as string and call |
|
96 | 96 | ESC_QUOTE2 = ';' # Quote all args as a single string, call |
|
97 | 97 | ESC_PAREN = '/' # Call first argument with rest of line as arguments |
|
98 | 98 | |
|
99 | 99 | #----------------------------------------------------------------------------- |
|
100 | 100 | # Utilities |
|
101 | 101 | #----------------------------------------------------------------------------- |
|
102 | 102 | |
|
103 | 103 | # FIXME: These are general-purpose utilities that later can be moved to the |
|
104 | 104 | # general ward. Kept here for now because we're being very strict about test |
|
105 | 105 | # coverage with this code, and this lets us ensure that we keep 100% coverage |
|
106 | 106 | # while developing. |
|
107 | 107 | |
|
108 | 108 | # compiled regexps for autoindent management |
|
109 | 109 | dedent_re = re.compile('|'.join([ |
|
110 | 110 | r'^\s+raise(\s.*)?$', # raise statement (+ space + other stuff, maybe) |
|
111 | 111 | r'^\s+raise\([^\)]*\).*$', # wacky raise with immediate open paren |
|
112 | 112 | r'^\s+return(\s.*)?$', # normal return (+ space + other stuff, maybe) |
|
113 | 113 | r'^\s+return\([^\)]*\).*$', # wacky return with immediate open paren |
|
114 | 114 | r'^\s+pass\s*$' # pass (optionally followed by trailing spaces) |
|
115 | 115 | ])) |
|
116 | 116 | ini_spaces_re = re.compile(r'^([ \t\r\f\v]+)') |
|
117 | 117 | |
|
118 | 118 | # regexp to match pure comment lines so we don't accidentally insert 'if 1:' |
|
119 | 119 | # before pure comments |
|
120 | 120 | comment_line_re = re.compile('^\s*\#') |
|
121 | 121 | |
|
122 | 122 | |
|
123 | 123 | def num_ini_spaces(s): |
|
124 | 124 | """Return the number of initial spaces in a string. |
|
125 | 125 | |
|
126 | 126 | Note that tabs are counted as a single space. For now, we do *not* support |
|
127 | 127 | mixing of tabs and spaces in the user's input. |
|
128 | 128 | |
|
129 | 129 | Parameters |
|
130 | 130 | ---------- |
|
131 | 131 | s : string |
|
132 | 132 | |
|
133 | 133 | Returns |
|
134 | 134 | ------- |
|
135 | 135 | n : int |
|
136 | 136 | """ |
|
137 | 137 | |
|
138 | 138 | ini_spaces = ini_spaces_re.match(s) |
|
139 | 139 | if ini_spaces: |
|
140 | 140 | return ini_spaces.end() |
|
141 | 141 | else: |
|
142 | 142 | return 0 |
|
143 | 143 | |
|
144 | 144 | |
|
145 | 145 | def remove_comments(src): |
|
146 | 146 | """Remove all comments from input source. |
|
147 | 147 | |
|
148 | 148 | Note: comments are NOT recognized inside of strings! |
|
149 | 149 | |
|
150 | 150 | Parameters |
|
151 | 151 | ---------- |
|
152 | 152 | src : string |
|
153 | 153 | A single or multiline input string. |
|
154 | 154 | |
|
155 | 155 | Returns |
|
156 | 156 | ------- |
|
157 | 157 | String with all Python comments removed. |
|
158 | 158 | """ |
|
159 | 159 | |
|
160 | 160 | return re.sub('#.*', '', src) |
|
161 | 161 | |
|
162 | 162 | def has_comment(src): |
|
163 | 163 | """Indicate whether an input line has (i.e. ends in, or is) a comment. |
|
164 | 164 | |
|
165 | 165 | This uses tokenize, so it can distinguish comments from # inside strings. |
|
166 | 166 | |
|
167 | 167 | Parameters |
|
168 | 168 | ---------- |
|
169 | 169 | src : string |
|
170 | 170 | A single line input string. |
|
171 | 171 | |
|
172 | 172 | Returns |
|
173 | 173 | ------- |
|
174 | 174 | Boolean: True if source has a comment. |
|
175 | 175 | """ |
|
176 | 176 | readline = StringIO(src).readline |
|
177 | 177 | toktypes = set() |
|
178 | 178 | try: |
|
179 | 179 | for t in tokenize.generate_tokens(readline): |
|
180 | 180 | toktypes.add(t[0]) |
|
181 | 181 | except tokenize.TokenError: |
|
182 | 182 | pass |
|
183 | 183 | return(tokenize.COMMENT in toktypes) |
|
184 | 184 | |
|
185 | 185 | |
|
186 | 186 | def get_input_encoding(): |
|
187 | 187 | """Return the default standard input encoding. |
|
188 | 188 | |
|
189 | 189 | If sys.stdin has no encoding, 'ascii' is returned.""" |
|
190 | 190 | # There are strange environments for which sys.stdin.encoding is None. We |
|
191 | 191 | # ensure that a valid encoding is returned. |
|
192 | 192 | encoding = getattr(sys.stdin, 'encoding', None) |
|
193 | 193 | if encoding is None: |
|
194 | 194 | encoding = 'ascii' |
|
195 | 195 | return encoding |
|
196 | 196 | |
|
197 | 197 | #----------------------------------------------------------------------------- |
|
198 | 198 | # Classes and functions for normal Python syntax handling |
|
199 | 199 | #----------------------------------------------------------------------------- |
|
200 | 200 | |
|
201 | 201 | class InputSplitter(object): |
|
202 | 202 | """An object that can accumulate lines of Python source before execution. |
|
203 | 203 | |
|
204 | 204 | This object is designed to be fed python source line-by-line, using |
|
205 | 205 | :meth:`push`. It will return on each push whether the currently pushed |
|
206 | 206 | code could be executed already. In addition, it provides a method called |
|
207 | 207 | :meth:`push_accepts_more` that can be used to query whether more input |
|
208 | 208 | can be pushed into a single interactive block. |
|
209 | 209 | |
|
210 | 210 | This is a simple example of how an interactive terminal-based client can use |
|
211 | 211 | this tool:: |
|
212 | 212 | |
|
213 | 213 | isp = InputSplitter() |
|
214 | 214 | while isp.push_accepts_more(): |
|
215 | 215 | indent = ' '*isp.indent_spaces |
|
216 | 216 | prompt = '>>> ' + indent |
|
217 | 217 | line = indent + raw_input(prompt) |
|
218 | 218 | isp.push(line) |
|
219 | 219 | print 'Input source was:\n', isp.source_reset(), |
|
220 | 220 | """ |
|
221 | 221 | # Number of spaces of indentation computed from input that has been pushed |
|
222 | 222 | # so far. This is the attributes callers should query to get the current |
|
223 | 223 | # indentation level, in order to provide auto-indent facilities. |
|
224 | 224 | indent_spaces = 0 |
|
225 | 225 | # String, indicating the default input encoding. It is computed by default |
|
226 | 226 | # at initialization time via get_input_encoding(), but it can be reset by a |
|
227 | 227 | # client with specific knowledge of the encoding. |
|
228 | 228 | encoding = '' |
|
229 | 229 | # String where the current full source input is stored, properly encoded. |
|
230 | 230 | # Reading this attribute is the normal way of querying the currently pushed |
|
231 | 231 | # source code, that has been properly encoded. |
|
232 | 232 | source = '' |
|
233 | 233 | # Code object corresponding to the current source. It is automatically |
|
234 | 234 | # synced to the source, so it can be queried at any time to obtain the code |
|
235 | 235 | # object; it will be None if the source doesn't compile to valid Python. |
|
236 | 236 | code = None |
|
237 | 237 | # Input mode |
|
238 | 238 | input_mode = 'line' |
|
239 | 239 | |
|
240 | 240 | # Private attributes |
|
241 | 241 | |
|
242 | 242 | # List with lines of input accumulated so far |
|
243 | 243 | _buffer = None |
|
244 | 244 | # Command compiler |
|
245 | 245 | _compile = None |
|
246 | 246 | # Mark when input has changed indentation all the way back to flush-left |
|
247 | 247 | _full_dedent = False |
|
248 | 248 | # Boolean indicating whether the current block is complete |
|
249 | 249 | _is_complete = None |
|
250 | 250 | |
|
251 | 251 | def __init__(self, input_mode=None): |
|
252 | 252 | """Create a new InputSplitter instance. |
|
253 | 253 | |
|
254 | 254 | Parameters |
|
255 | 255 | ---------- |
|
256 | 256 | input_mode : str |
|
257 | 257 | |
|
258 | 258 | One of ['line', 'cell']; default is 'line'. |
|
259 | 259 | |
|
260 | 260 | The input_mode parameter controls how new inputs are used when fed via |
|
261 | 261 | the :meth:`push` method: |
|
262 | 262 | |
|
263 | 263 | - 'line': meant for line-oriented clients, inputs are appended one at a |
|
264 | 264 | time to the internal buffer and the whole buffer is compiled. |
|
265 | 265 | |
|
266 | 266 | - 'cell': meant for clients that can edit multi-line 'cells' of text at |
|
267 | 267 | a time. A cell can contain one or more blocks that can be compile in |
|
268 | 268 | 'single' mode by Python. In this mode, each new input new input |
|
269 | 269 | completely replaces all prior inputs. Cell mode is thus equivalent |
|
270 | 270 | to prepending a full reset() to every push() call. |
|
271 | 271 | """ |
|
272 | 272 | self._buffer = [] |
|
273 | 273 | self._compile = codeop.CommandCompiler() |
|
274 | 274 | self.encoding = get_input_encoding() |
|
275 | 275 | self.input_mode = InputSplitter.input_mode if input_mode is None \ |
|
276 | 276 | else input_mode |
|
277 | 277 | |
|
278 | 278 | def reset(self): |
|
279 | 279 | """Reset the input buffer and associated state.""" |
|
280 | 280 | self.indent_spaces = 0 |
|
281 | 281 | self._buffer[:] = [] |
|
282 | 282 | self.source = '' |
|
283 | 283 | self.code = None |
|
284 | 284 | self._is_complete = False |
|
285 | 285 | self._full_dedent = False |
|
286 | 286 | |
|
287 | 287 | def source_reset(self): |
|
288 | 288 | """Return the input source and perform a full reset. |
|
289 | 289 | """ |
|
290 | 290 | out = self.source |
|
291 | 291 | self.reset() |
|
292 | 292 | return out |
|
293 | 293 | |
|
294 | 294 | def push(self, lines): |
|
295 | 295 | """Push one or more lines of input. |
|
296 | 296 | |
|
297 | 297 | This stores the given lines and returns a status code indicating |
|
298 | 298 | whether the code forms a complete Python block or not. |
|
299 | 299 | |
|
300 | 300 | Any exceptions generated in compilation are swallowed, but if an |
|
301 | 301 | exception was produced, the method returns True. |
|
302 | 302 | |
|
303 | 303 | Parameters |
|
304 | 304 | ---------- |
|
305 | 305 | lines : string |
|
306 | 306 | One or more lines of Python input. |
|
307 | 307 | |
|
308 | 308 | Returns |
|
309 | 309 | ------- |
|
310 | 310 | is_complete : boolean |
|
311 | 311 | True if the current input source (the result of the current input |
|
312 | 312 | plus prior inputs) forms a complete Python execution block. Note that |
|
313 | 313 | this value is also stored as a private attribute (_is_complete), so it |
|
314 | 314 | can be queried at any time. |
|
315 | 315 | """ |
|
316 | 316 | if self.input_mode == 'cell': |
|
317 | 317 | self.reset() |
|
318 | 318 | |
|
319 | 319 | self._store(lines) |
|
320 | 320 | source = self.source |
|
321 | 321 | |
|
322 | 322 | # Before calling _compile(), reset the code object to None so that if an |
|
323 | 323 | # exception is raised in compilation, we don't mislead by having |
|
324 | 324 | # inconsistent code/source attributes. |
|
325 | 325 | self.code, self._is_complete = None, None |
|
326 | 326 | |
|
327 | 327 | # Honor termination lines properly |
|
328 | 328 | if source.rstrip().endswith('\\'): |
|
329 | 329 | return False |
|
330 | 330 | |
|
331 | 331 | self._update_indent(lines) |
|
332 | 332 | try: |
|
333 | 333 | self.code = self._compile(source, symbol="exec") |
|
334 | 334 | # Invalid syntax can produce any of a number of different errors from |
|
335 | 335 | # inside the compiler, so we have to catch them all. Syntax errors |
|
336 | 336 | # immediately produce a 'ready' block, so the invalid Python can be |
|
337 | 337 | # sent to the kernel for evaluation with possible ipython |
|
338 | 338 | # special-syntax conversion. |
|
339 | 339 | except (SyntaxError, OverflowError, ValueError, TypeError, |
|
340 | 340 | MemoryError): |
|
341 | 341 | self._is_complete = True |
|
342 | 342 | else: |
|
343 | 343 | # Compilation didn't produce any exceptions (though it may not have |
|
344 | 344 | # given a complete code object) |
|
345 | 345 | self._is_complete = self.code is not None |
|
346 | 346 | |
|
347 | 347 | return self._is_complete |
|
348 | 348 | |
|
349 | 349 | def push_accepts_more(self): |
|
350 | 350 | """Return whether a block of interactive input can accept more input. |
|
351 | 351 | |
|
352 | 352 | This method is meant to be used by line-oriented frontends, who need to |
|
353 | 353 | guess whether a block is complete or not based solely on prior and |
|
354 | 354 | current input lines. The InputSplitter considers it has a complete |
|
355 | 355 | interactive block and will not accept more input only when either a |
|
356 | 356 | SyntaxError is raised, or *all* of the following are true: |
|
357 | 357 | |
|
358 | 358 | 1. The input compiles to a complete statement. |
|
359 | 359 | |
|
360 | 360 | 2. The indentation level is flush-left (because if we are indented, |
|
361 | 361 | like inside a function definition or for loop, we need to keep |
|
362 | 362 | reading new input). |
|
363 | 363 | |
|
364 | 364 | 3. There is one extra line consisting only of whitespace. |
|
365 | 365 | |
|
366 | 366 | Because of condition #3, this method should be used only by |
|
367 | 367 | *line-oriented* frontends, since it means that intermediate blank lines |
|
368 | 368 | are not allowed in function definitions (or any other indented block). |
|
369 | 369 | |
|
370 | 370 | If the current input produces a syntax error, this method immediately |
|
371 | 371 | returns False but does *not* raise the syntax error exception, as |
|
372 | 372 | typically clients will want to send invalid syntax to an execution |
|
373 | 373 | backend which might convert the invalid syntax into valid Python via |
|
374 | 374 | one of the dynamic IPython mechanisms. |
|
375 | 375 | """ |
|
376 | 376 | |
|
377 | 377 | # With incomplete input, unconditionally accept more |
|
378 | 378 | if not self._is_complete: |
|
379 | 379 | return True |
|
380 | 380 | |
|
381 | 381 | # If we already have complete input and we're flush left, the answer |
|
382 | 382 | # depends. In line mode, if there hasn't been any indentation, |
|
383 | 383 | # that's it. If we've come back from some indentation, we need |
|
384 | 384 | # the blank final line to finish. |
|
385 | 385 | # In cell mode, we need to check how many blocks the input so far |
|
386 | 386 | # compiles into, because if there's already more than one full |
|
387 | 387 | # independent block of input, then the client has entered full |
|
388 | 388 | # 'cell' mode and is feeding lines that each is complete. In this |
|
389 | 389 | # case we should then keep accepting. The Qt terminal-like console |
|
390 | 390 | # does precisely this, to provide the convenience of terminal-like |
|
391 | 391 | # input of single expressions, but allowing the user (with a |
|
392 | 392 | # separate keystroke) to switch to 'cell' mode and type multiple |
|
393 | 393 | # expressions in one shot. |
|
394 | 394 | if self.indent_spaces==0: |
|
395 | 395 | if self.input_mode=='line': |
|
396 | 396 | if not self._full_dedent: |
|
397 | 397 | return False |
|
398 | 398 | else: |
|
399 | 399 | try: |
|
400 | 400 | code_ast = ast.parse(u''.join(self._buffer)) |
|
401 | 401 | except Exception: |
|
402 | 402 | return False |
|
403 | 403 | else: |
|
404 | 404 | if len(code_ast.body) == 1: |
|
405 | 405 | return False |
|
406 | 406 | |
|
407 | 407 | # When input is complete, then termination is marked by an extra blank |
|
408 | 408 | # line at the end. |
|
409 | 409 | last_line = self.source.splitlines()[-1] |
|
410 | 410 | return bool(last_line and not last_line.isspace()) |
|
411 | 411 | |
|
412 | 412 | #------------------------------------------------------------------------ |
|
413 | 413 | # Private interface |
|
414 | 414 | #------------------------------------------------------------------------ |
|
415 | 415 | |
|
416 | 416 | def _find_indent(self, line): |
|
417 | 417 | """Compute the new indentation level for a single line. |
|
418 | 418 | |
|
419 | 419 | Parameters |
|
420 | 420 | ---------- |
|
421 | 421 | line : str |
|
422 | 422 | A single new line of non-whitespace, non-comment Python input. |
|
423 | 423 | |
|
424 | 424 | Returns |
|
425 | 425 | ------- |
|
426 | 426 | indent_spaces : int |
|
427 | 427 | New value for the indent level (it may be equal to self.indent_spaces |
|
428 | 428 | if indentation doesn't change. |
|
429 | 429 | |
|
430 | 430 | full_dedent : boolean |
|
431 | 431 | Whether the new line causes a full flush-left dedent. |
|
432 | 432 | """ |
|
433 | 433 | indent_spaces = self.indent_spaces |
|
434 | 434 | full_dedent = self._full_dedent |
|
435 | 435 | |
|
436 | 436 | inisp = num_ini_spaces(line) |
|
437 | 437 | if inisp < indent_spaces: |
|
438 | 438 | indent_spaces = inisp |
|
439 | 439 | if indent_spaces <= 0: |
|
440 | 440 | #print 'Full dedent in text',self.source # dbg |
|
441 | 441 | full_dedent = True |
|
442 | 442 | |
|
443 | 443 | if line.rstrip()[-1] == ':': |
|
444 | 444 | indent_spaces += 4 |
|
445 | 445 | elif dedent_re.match(line): |
|
446 | 446 | indent_spaces -= 4 |
|
447 | 447 | if indent_spaces <= 0: |
|
448 | 448 | full_dedent = True |
|
449 | 449 | |
|
450 | 450 | # Safety |
|
451 | 451 | if indent_spaces < 0: |
|
452 | 452 | indent_spaces = 0 |
|
453 | 453 | #print 'safety' # dbg |
|
454 | 454 | |
|
455 | 455 | return indent_spaces, full_dedent |
|
456 | 456 | |
|
457 | 457 | def _update_indent(self, lines): |
|
458 | 458 | for line in remove_comments(lines).splitlines(): |
|
459 | 459 | if line and not line.isspace(): |
|
460 | 460 | self.indent_spaces, self._full_dedent = self._find_indent(line) |
|
461 | 461 | |
|
462 | 462 | def _store(self, lines, buffer=None, store='source'): |
|
463 | 463 | """Store one or more lines of input. |
|
464 | 464 | |
|
465 | 465 | If input lines are not newline-terminated, a newline is automatically |
|
466 | 466 | appended.""" |
|
467 | 467 | |
|
468 | 468 | if buffer is None: |
|
469 | 469 | buffer = self._buffer |
|
470 | 470 | |
|
471 | 471 | if lines.endswith('\n'): |
|
472 | 472 | buffer.append(lines) |
|
473 | 473 | else: |
|
474 | 474 | buffer.append(lines+'\n') |
|
475 | 475 | setattr(self, store, self._set_source(buffer)) |
|
476 | 476 | |
|
477 | 477 | def _set_source(self, buffer): |
|
478 | 478 | return u''.join(buffer) |
|
479 | 479 | |
|
480 | 480 | |
|
481 | 481 | #----------------------------------------------------------------------------- |
|
482 | 482 | # Functions and classes for IPython-specific syntactic support |
|
483 | 483 | #----------------------------------------------------------------------------- |
|
484 | 484 | |
|
485 | 485 | # The escaped translators ALL receive a line where their own escape has been |
|
486 | 486 | # stripped. Only '?' is valid at the end of the line, all others can only be |
|
487 | 487 | # placed at the start. |
|
488 | 488 | |
|
489 | 489 | # Transformations of the special syntaxes that don't rely on an explicit escape |
|
490 | 490 | # character but instead on patterns on the input line |
|
491 | 491 | |
|
492 | 492 | # The core transformations are implemented as standalone functions that can be |
|
493 | 493 | # tested and validated in isolation. Each of these uses a regexp, we |
|
494 | 494 | # pre-compile these and keep them close to each function definition for clarity |
|
495 | 495 | |
|
496 | 496 | _assign_system_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' |
|
497 | 497 | r'\s*=\s*!\s*(?P<cmd>.*)') |
|
498 | 498 | |
|
499 | 499 | def transform_assign_system(line): |
|
500 | 500 | """Handle the `files = !ls` syntax.""" |
|
501 | 501 | m = _assign_system_re.match(line) |
|
502 | 502 | if m is not None: |
|
503 | 503 | cmd = m.group('cmd') |
|
504 | 504 | lhs = m.group('lhs') |
|
505 | 505 | new_line = '%s = get_ipython().getoutput(%r)' % (lhs, cmd) |
|
506 | 506 | return new_line |
|
507 | 507 | return line |
|
508 | 508 | |
|
509 | 509 | |
|
510 | 510 | _assign_magic_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' |
|
511 | 511 | r'\s*=\s*%\s*(?P<cmd>.*)') |
|
512 | 512 | |
|
513 | 513 | def transform_assign_magic(line): |
|
514 | 514 | """Handle the `a = %who` syntax.""" |
|
515 | 515 | m = _assign_magic_re.match(line) |
|
516 | 516 | if m is not None: |
|
517 | 517 | cmd = m.group('cmd') |
|
518 | 518 | lhs = m.group('lhs') |
|
519 | 519 | new_line = '%s = get_ipython().magic(%r)' % (lhs, cmd) |
|
520 | 520 | return new_line |
|
521 | 521 | return line |
|
522 | 522 | |
|
523 | 523 | |
|
524 | 524 | _classic_prompt_re = re.compile(r'^([ \t]*>>> |^[ \t]*\.\.\. )') |
|
525 | 525 | |
|
526 | 526 | def transform_classic_prompt(line): |
|
527 | 527 | """Handle inputs that start with '>>> ' syntax.""" |
|
528 | 528 | |
|
529 | 529 | if not line or line.isspace(): |
|
530 | 530 | return line |
|
531 | 531 | m = _classic_prompt_re.match(line) |
|
532 | 532 | if m: |
|
533 | 533 | return line[len(m.group(0)):] |
|
534 | 534 | else: |
|
535 | 535 | return line |
|
536 | 536 | |
|
537 | 537 | |
|
538 | 538 | _ipy_prompt_re = re.compile(r'^([ \t]*In \[\d+\]: |^[ \t]*\ \ \ \.\.\.+: )') |
|
539 | 539 | |
|
540 | 540 | def transform_ipy_prompt(line): |
|
541 | 541 | """Handle inputs that start classic IPython prompt syntax.""" |
|
542 | 542 | |
|
543 | 543 | if not line or line.isspace(): |
|
544 | 544 | return line |
|
545 | 545 | #print 'LINE: %r' % line # dbg |
|
546 | 546 | m = _ipy_prompt_re.match(line) |
|
547 | 547 | if m: |
|
548 | 548 | #print 'MATCH! %r -> %r' % (line, line[len(m.group(0)):]) # dbg |
|
549 | 549 | return line[len(m.group(0)):] |
|
550 | 550 | else: |
|
551 | 551 | return line |
|
552 | 552 | |
|
553 | 553 | |
|
554 | 554 | def _make_help_call(target, esc, lspace, next_input=None): |
|
555 | 555 | """Prepares a pinfo(2)/psearch call from a target name and the escape |
|
556 | 556 | (i.e. ? or ??)""" |
|
557 | 557 | method = 'pinfo2' if esc == '??' \ |
|
558 | 558 | else 'psearch' if '*' in target \ |
|
559 | 559 | else 'pinfo' |
|
560 | 560 | arg = " ".join([method, target]) |
|
561 | 561 | |
|
562 | 562 | if next_input: |
|
563 | 563 | tpl = '%sget_ipython().magic(%r, next_input=%r)' |
|
564 | 564 | return tpl % (lspace, arg, next_input) |
|
565 | 565 | else: |
|
566 | 566 | return '%sget_ipython().magic(%r)' % (lspace, arg) |
|
567 | 567 | |
|
568 | 568 | _initial_space_re = re.compile(r'\s*') |
|
569 | 569 | _help_end_re = re.compile(r"""(%? |
|
570 | 570 | [a-zA-Z_*][\w*]* # Variable name |
|
571 | 571 | (\.[a-zA-Z_*][\w*]*)* # .etc.etc |
|
572 | 572 | ) |
|
573 | 573 | (\?\??)$ # ? or ??""", |
|
574 | 574 | re.VERBOSE) |
|
575 | 575 | def transform_help_end(line): |
|
576 | 576 | """Translate lines with ?/?? at the end""" |
|
577 | 577 | m = _help_end_re.search(line) |
|
578 | 578 | if m is None or has_comment(line): |
|
579 | 579 | return line |
|
580 | 580 | target = m.group(1) |
|
581 | 581 | esc = m.group(3) |
|
582 | 582 | lspace = _initial_space_re.match(line).group(0) |
|
583 | 583 | |
|
584 | 584 | # If we're mid-command, put it back on the next prompt for the user. |
|
585 | 585 | next_input = line.rstrip('?') if line.strip() != m.group(0) else None |
|
586 | 586 | |
|
587 | 587 | return _make_help_call(target, esc, lspace, next_input) |
|
588 | 588 | |
|
589 | 589 | |
|
590 | 590 | class EscapedTransformer(object): |
|
591 | 591 | """Class to transform lines that are explicitly escaped out.""" |
|
592 | 592 | |
|
593 | 593 | def __init__(self): |
|
594 | 594 | tr = { ESC_SHELL : self._tr_system, |
|
595 | 595 | ESC_SH_CAP : self._tr_system2, |
|
596 | 596 | ESC_HELP : self._tr_help, |
|
597 | 597 | ESC_HELP2 : self._tr_help, |
|
598 | 598 | ESC_MAGIC : self._tr_magic, |
|
599 | 599 | ESC_QUOTE : self._tr_quote, |
|
600 | 600 | ESC_QUOTE2 : self._tr_quote2, |
|
601 | 601 | ESC_PAREN : self._tr_paren } |
|
602 | 602 | self.tr = tr |
|
603 | 603 | |
|
604 | 604 | # Support for syntax transformations that use explicit escapes typed by the |
|
605 | 605 | # user at the beginning of a line |
|
606 | 606 | @staticmethod |
|
607 | 607 | def _tr_system(line_info): |
|
608 | 608 | "Translate lines escaped with: !" |
|
609 | 609 | cmd = line_info.line.lstrip().lstrip(ESC_SHELL) |
|
610 | 610 | return '%sget_ipython().system(%r)' % (line_info.pre, cmd) |
|
611 | 611 | |
|
612 | 612 | @staticmethod |
|
613 | 613 | def _tr_system2(line_info): |
|
614 | 614 | "Translate lines escaped with: !!" |
|
615 | 615 | cmd = line_info.line.lstrip()[2:] |
|
616 | 616 | return '%sget_ipython().getoutput(%r)' % (line_info.pre, cmd) |
|
617 | 617 | |
|
618 | 618 | @staticmethod |
|
619 | 619 | def _tr_help(line_info): |
|
620 | 620 | "Translate lines escaped with: ?/??" |
|
621 | 621 | # A naked help line should just fire the intro help screen |
|
622 | 622 | if not line_info.line[1:]: |
|
623 | 623 | return 'get_ipython().show_usage()' |
|
624 | 624 | |
|
625 | 625 | return _make_help_call(line_info.ifun, line_info.esc, line_info.pre) |
|
626 | 626 | |
|
627 | 627 | @staticmethod |
|
628 | 628 | def _tr_magic(line_info): |
|
629 | 629 | "Translate lines escaped with: %" |
|
630 | 630 | tpl = '%sget_ipython().magic(%r)' |
|
631 | 631 | cmd = ' '.join([line_info.ifun, line_info.the_rest]).strip() |
|
632 | 632 | return tpl % (line_info.pre, cmd) |
|
633 | 633 | |
|
634 | 634 | @staticmethod |
|
635 | 635 | def _tr_quote(line_info): |
|
636 | 636 | "Translate lines escaped with: ," |
|
637 | 637 | return '%s%s("%s")' % (line_info.pre, line_info.ifun, |
|
638 | 638 | '", "'.join(line_info.the_rest.split()) ) |
|
639 | 639 | |
|
640 | 640 | @staticmethod |
|
641 | 641 | def _tr_quote2(line_info): |
|
642 | 642 | "Translate lines escaped with: ;" |
|
643 | 643 | return '%s%s("%s")' % (line_info.pre, line_info.ifun, |
|
644 | 644 | line_info.the_rest) |
|
645 | 645 | |
|
646 | 646 | @staticmethod |
|
647 | 647 | def _tr_paren(line_info): |
|
648 | 648 | "Translate lines escaped with: /" |
|
649 | 649 | return '%s%s(%s)' % (line_info.pre, line_info.ifun, |
|
650 | 650 | ", ".join(line_info.the_rest.split())) |
|
651 | 651 | |
|
652 | 652 | def __call__(self, line): |
|
653 | 653 | """Class to transform lines that are explicitly escaped out. |
|
654 | 654 | |
|
655 | 655 | This calls the above _tr_* static methods for the actual line |
|
656 | 656 | translations.""" |
|
657 | 657 | |
|
658 | 658 | # Empty lines just get returned unmodified |
|
659 | 659 | if not line or line.isspace(): |
|
660 | 660 | return line |
|
661 | 661 | |
|
662 | 662 | # Get line endpoints, where the escapes can be |
|
663 | 663 | line_info = LineInfo(line) |
|
664 | 664 | |
|
665 | 665 | if not line_info.esc in self.tr: |
|
666 | 666 | # If we don't recognize the escape, don't modify the line |
|
667 | 667 | return line |
|
668 | 668 | |
|
669 | 669 | return self.tr[line_info.esc](line_info) |
|
670 | 670 | |
|
671 | 671 | |
|
672 | 672 | # A function-looking object to be used by the rest of the code. The purpose of |
|
673 | 673 | # the class in this case is to organize related functionality, more than to |
|
674 | 674 | # manage state. |
|
675 | 675 | transform_escaped = EscapedTransformer() |
|
676 | 676 | |
|
677 | 677 | |
|
678 | 678 | class IPythonInputSplitter(InputSplitter): |
|
679 | 679 | """An input splitter that recognizes all of IPython's special syntax.""" |
|
680 | 680 | |
|
681 | 681 | # String with raw, untransformed input. |
|
682 | 682 | source_raw = '' |
|
683 | 683 | |
|
684 | 684 | # Private attributes |
|
685 | 685 | |
|
686 | 686 | # List with lines of raw input accumulated so far. |
|
687 | 687 | _buffer_raw = None |
|
688 | 688 | |
|
689 | 689 | def __init__(self, input_mode=None): |
|
690 | 690 | InputSplitter.__init__(self, input_mode) |
|
691 | 691 | self._buffer_raw = [] |
|
692 | 692 | |
|
693 | 693 | def reset(self): |
|
694 | 694 | """Reset the input buffer and associated state.""" |
|
695 | 695 | InputSplitter.reset(self) |
|
696 | 696 | self._buffer_raw[:] = [] |
|
697 | 697 | self.source_raw = '' |
|
698 | 698 | |
|
699 | 699 | def source_raw_reset(self): |
|
700 | 700 | """Return input and raw source and perform a full reset. |
|
701 | 701 | """ |
|
702 | 702 | out = self.source |
|
703 | 703 | out_r = self.source_raw |
|
704 | 704 | self.reset() |
|
705 | 705 | return out, out_r |
|
706 | 706 | |
|
707 | 707 | def push(self, lines): |
|
708 | 708 | """Push one or more lines of IPython input. |
|
709 | 709 | """ |
|
710 | 710 | if not lines: |
|
711 | 711 | return super(IPythonInputSplitter, self).push(lines) |
|
712 | 712 | |
|
713 | 713 | # We must ensure all input is pure unicode |
|
714 | 714 | lines = cast_unicode(lines, self.encoding) |
|
715 | 715 | |
|
716 | 716 | lines_list = lines.splitlines() |
|
717 | 717 | |
|
718 | 718 | transforms = [transform_ipy_prompt, transform_classic_prompt, |
|
719 | 719 | transform_help_end, transform_escaped, |
|
720 | 720 | transform_assign_system, transform_assign_magic] |
|
721 | 721 | |
|
722 | 722 | # Transform logic |
|
723 | 723 | # |
|
724 | 724 | # We only apply the line transformers to the input if we have either no |
|
725 | 725 | # input yet, or complete input, or if the last line of the buffer ends |
|
726 | 726 | # with ':' (opening an indented block). This prevents the accidental |
|
727 | 727 | # transformation of escapes inside multiline expressions like |
|
728 | 728 | # triple-quoted strings or parenthesized expressions. |
|
729 | 729 | # |
|
730 | 730 | # The last heuristic, while ugly, ensures that the first line of an |
|
731 | 731 | # indented block is correctly transformed. |
|
732 | 732 | # |
|
733 | 733 | # FIXME: try to find a cleaner approach for this last bit. |
|
734 | 734 | |
|
735 | 735 | # If we were in 'block' mode, since we're going to pump the parent |
|
736 | 736 | # class by hand line by line, we need to temporarily switch out to |
|
737 | 737 | # 'line' mode, do a single manual reset and then feed the lines one |
|
738 | 738 | # by one. Note that this only matters if the input has more than one |
|
739 | 739 | # line. |
|
740 | 740 | changed_input_mode = False |
|
741 | 741 | |
|
742 | 742 | if self.input_mode == 'cell': |
|
743 | 743 | self.reset() |
|
744 | 744 | changed_input_mode = True |
|
745 | 745 | saved_input_mode = 'cell' |
|
746 | 746 | self.input_mode = 'line' |
|
747 | 747 | |
|
748 | 748 | # Store raw source before applying any transformations to it. Note |
|
749 | 749 | # that this must be done *after* the reset() call that would otherwise |
|
750 | 750 | # flush the buffer. |
|
751 | 751 | self._store(lines, self._buffer_raw, 'source_raw') |
|
752 | 752 | |
|
753 | 753 | try: |
|
754 | 754 | push = super(IPythonInputSplitter, self).push |
|
755 | 755 | buf = self._buffer |
|
756 | 756 | for line in lines_list: |
|
757 | 757 | if self._is_complete or not buf or \ |
|
758 | 758 | (buf and (buf[-1].rstrip().endswith(':') or |
|
759 | 759 | buf[-1].rstrip().endswith(',')) ): |
|
760 | 760 | for f in transforms: |
|
761 | 761 | line = f(line) |
|
762 | 762 | |
|
763 | 763 | out = push(line) |
|
764 | 764 | finally: |
|
765 | 765 | if changed_input_mode: |
|
766 | 766 | self.input_mode = saved_input_mode |
|
767 | 767 | return out |
@@ -1,29 +1,29 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | This module is *completely* deprecated and should no longer be used for |
|
4 | 4 | any purpose. Currently, we have a few parts of the core that have |
|
5 | 5 | not been componentized and thus, still rely on this module. When everything |
|
6 | 6 | has been made into a component, this module will be sent to deathrow. |
|
7 | 7 | """ |
|
8 | 8 | |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 |
# Copyright (C) 2008-20 |
|
|
10 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
11 | 11 | # |
|
12 | 12 | # Distributed under the terms of the BSD License. The full license is in |
|
13 | 13 | # the file COPYING, distributed as part of this software. |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | # Imports |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | # Classes and functions |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | |
|
24 | 24 | |
|
25 | 25 | def get(): |
|
26 | 26 | """Get the global InteractiveShell instance.""" |
|
27 | 27 | from IPython.core.interactiveshell import InteractiveShell |
|
28 | 28 | return InteractiveShell.instance() |
|
29 | 29 |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
@@ -1,217 +1,217 b'' | |||
|
1 | 1 | ''' A decorator-based method of constructing IPython magics with `argparse` |
|
2 | 2 | option handling. |
|
3 | 3 | |
|
4 | 4 | New magic functions can be defined like so:: |
|
5 | 5 | |
|
6 | 6 | from IPython.core.magic_arguments import (argument, magic_arguments, |
|
7 | 7 | parse_argstring) |
|
8 | 8 | |
|
9 | 9 | @magic_arguments() |
|
10 | 10 | @argument('-o', '--option', help='An optional argument.') |
|
11 | 11 | @argument('arg', type=int, help='An integer positional argument.') |
|
12 | 12 | def magic_cool(self, arg): |
|
13 | 13 | """ A really cool magic command. |
|
14 | 14 | |
|
15 | 15 | """ |
|
16 | 16 | args = parse_argstring(magic_cool, arg) |
|
17 | 17 | ... |
|
18 | 18 | |
|
19 | 19 | The `@magic_arguments` decorator marks the function as having argparse arguments. |
|
20 | 20 | The `@argument` decorator adds an argument using the same syntax as argparse's |
|
21 | 21 | `add_argument()` method. More sophisticated uses may also require the |
|
22 | 22 | `@argument_group` or `@kwds` decorator to customize the formatting and the |
|
23 | 23 | parsing. |
|
24 | 24 | |
|
25 | 25 | Help text for the magic is automatically generated from the docstring and the |
|
26 | 26 | arguments:: |
|
27 | 27 | |
|
28 | 28 | In[1]: %cool? |
|
29 | 29 | %cool [-o OPTION] arg |
|
30 | 30 | |
|
31 | 31 | A really cool magic command. |
|
32 | 32 | |
|
33 | 33 | positional arguments: |
|
34 | 34 | arg An integer positional argument. |
|
35 | 35 | |
|
36 | 36 | optional arguments: |
|
37 | 37 | -o OPTION, --option OPTION |
|
38 | 38 | An optional argument. |
|
39 | 39 | |
|
40 | 40 | ''' |
|
41 | 41 | #----------------------------------------------------------------------------- |
|
42 |
# Copyright ( |
|
|
42 | # Copyright (C) 2010-2011, IPython Development Team. | |
|
43 | 43 | # |
|
44 | 44 | # Distributed under the terms of the Modified BSD License. |
|
45 | 45 | # |
|
46 | 46 | # The full license is in the file COPYING.txt, distributed with this software. |
|
47 | 47 | #----------------------------------------------------------------------------- |
|
48 | 48 | |
|
49 | 49 | # Our own imports |
|
50 | 50 | from IPython.external import argparse |
|
51 | 51 | from IPython.core.error import UsageError |
|
52 | 52 | from IPython.utils.process import arg_split |
|
53 | 53 | |
|
54 | 54 | |
|
55 | 55 | class MagicArgumentParser(argparse.ArgumentParser): |
|
56 | 56 | """ An ArgumentParser tweaked for use by IPython magics. |
|
57 | 57 | """ |
|
58 | 58 | def __init__(self, |
|
59 | 59 | prog=None, |
|
60 | 60 | usage=None, |
|
61 | 61 | description=None, |
|
62 | 62 | epilog=None, |
|
63 | 63 | version=None, |
|
64 | 64 | parents=None, |
|
65 | 65 | formatter_class=argparse.HelpFormatter, |
|
66 | 66 | prefix_chars='-', |
|
67 | 67 | argument_default=None, |
|
68 | 68 | conflict_handler='error', |
|
69 | 69 | add_help=False): |
|
70 | 70 | if parents is None: |
|
71 | 71 | parents = [] |
|
72 | 72 | super(MagicArgumentParser, self).__init__(prog=prog, usage=usage, |
|
73 | 73 | description=description, epilog=epilog, version=version, |
|
74 | 74 | parents=parents, formatter_class=formatter_class, |
|
75 | 75 | prefix_chars=prefix_chars, argument_default=argument_default, |
|
76 | 76 | conflict_handler=conflict_handler, add_help=add_help) |
|
77 | 77 | |
|
78 | 78 | def error(self, message): |
|
79 | 79 | """ Raise a catchable error instead of exiting. |
|
80 | 80 | """ |
|
81 | 81 | raise UsageError(message) |
|
82 | 82 | |
|
83 | 83 | def parse_argstring(self, argstring): |
|
84 | 84 | """ Split a string into an argument list and parse that argument list. |
|
85 | 85 | """ |
|
86 | 86 | argv = arg_split(argstring) |
|
87 | 87 | return self.parse_args(argv) |
|
88 | 88 | |
|
89 | 89 | |
|
90 | 90 | def construct_parser(magic_func): |
|
91 | 91 | """ Construct an argument parser using the function decorations. |
|
92 | 92 | """ |
|
93 | 93 | kwds = getattr(magic_func, 'argcmd_kwds', {}) |
|
94 | 94 | if 'description' not in kwds: |
|
95 | 95 | kwds['description'] = getattr(magic_func, '__doc__', None) |
|
96 | 96 | arg_name = real_name(magic_func) |
|
97 | 97 | parser = MagicArgumentParser(arg_name, **kwds) |
|
98 | 98 | # Reverse the list of decorators in order to apply them in the |
|
99 | 99 | # order in which they appear in the source. |
|
100 | 100 | group = None |
|
101 | 101 | for deco in magic_func.decorators[::-1]: |
|
102 | 102 | result = deco.add_to_parser(parser, group) |
|
103 | 103 | if result is not None: |
|
104 | 104 | group = result |
|
105 | 105 | |
|
106 | 106 | # Replace the starting 'usage: ' with IPython's %. |
|
107 | 107 | help_text = parser.format_help() |
|
108 | 108 | if help_text.startswith('usage: '): |
|
109 | 109 | help_text = help_text.replace('usage: ', '%', 1) |
|
110 | 110 | else: |
|
111 | 111 | help_text = '%' + help_text |
|
112 | 112 | |
|
113 | 113 | # Replace the magic function's docstring with the full help text. |
|
114 | 114 | magic_func.__doc__ = help_text |
|
115 | 115 | |
|
116 | 116 | return parser |
|
117 | 117 | |
|
118 | 118 | |
|
119 | 119 | def parse_argstring(magic_func, argstring): |
|
120 | 120 | """ Parse the string of arguments for the given magic function. |
|
121 | 121 | """ |
|
122 | 122 | return magic_func.parser.parse_argstring(argstring) |
|
123 | 123 | |
|
124 | 124 | |
|
125 | 125 | def real_name(magic_func): |
|
126 | 126 | """ Find the real name of the magic. |
|
127 | 127 | """ |
|
128 | 128 | magic_name = magic_func.__name__ |
|
129 | 129 | if magic_name.startswith('magic_'): |
|
130 | 130 | magic_name = magic_name[len('magic_'):] |
|
131 | 131 | return getattr(magic_func, 'argcmd_name', magic_name) |
|
132 | 132 | |
|
133 | 133 | |
|
134 | 134 | class ArgDecorator(object): |
|
135 | 135 | """ Base class for decorators to add ArgumentParser information to a method. |
|
136 | 136 | """ |
|
137 | 137 | |
|
138 | 138 | def __call__(self, func): |
|
139 | 139 | if not getattr(func, 'has_arguments', False): |
|
140 | 140 | func.has_arguments = True |
|
141 | 141 | func.decorators = [] |
|
142 | 142 | func.decorators.append(self) |
|
143 | 143 | return func |
|
144 | 144 | |
|
145 | 145 | def add_to_parser(self, parser, group): |
|
146 | 146 | """ Add this object's information to the parser, if necessary. |
|
147 | 147 | """ |
|
148 | 148 | pass |
|
149 | 149 | |
|
150 | 150 | |
|
151 | 151 | class magic_arguments(ArgDecorator): |
|
152 | 152 | """ Mark the magic as having argparse arguments and possibly adjust the |
|
153 | 153 | name. |
|
154 | 154 | """ |
|
155 | 155 | |
|
156 | 156 | def __init__(self, name=None): |
|
157 | 157 | self.name = name |
|
158 | 158 | |
|
159 | 159 | def __call__(self, func): |
|
160 | 160 | if not getattr(func, 'has_arguments', False): |
|
161 | 161 | func.has_arguments = True |
|
162 | 162 | func.decorators = [] |
|
163 | 163 | if self.name is not None: |
|
164 | 164 | func.argcmd_name = self.name |
|
165 | 165 | # This should be the first decorator in the list of decorators, thus the |
|
166 | 166 | # last to execute. Build the parser. |
|
167 | 167 | func.parser = construct_parser(func) |
|
168 | 168 | return func |
|
169 | 169 | |
|
170 | 170 | |
|
171 | 171 | class argument(ArgDecorator): |
|
172 | 172 | """ Store arguments and keywords to pass to add_argument(). |
|
173 | 173 | |
|
174 | 174 | Instances also serve to decorate command methods. |
|
175 | 175 | """ |
|
176 | 176 | def __init__(self, *args, **kwds): |
|
177 | 177 | self.args = args |
|
178 | 178 | self.kwds = kwds |
|
179 | 179 | |
|
180 | 180 | def add_to_parser(self, parser, group): |
|
181 | 181 | """ Add this object's information to the parser. |
|
182 | 182 | """ |
|
183 | 183 | if group is not None: |
|
184 | 184 | parser = group |
|
185 | 185 | parser.add_argument(*self.args, **self.kwds) |
|
186 | 186 | return None |
|
187 | 187 | |
|
188 | 188 | |
|
189 | 189 | class argument_group(ArgDecorator): |
|
190 | 190 | """ Store arguments and keywords to pass to add_argument_group(). |
|
191 | 191 | |
|
192 | 192 | Instances also serve to decorate command methods. |
|
193 | 193 | """ |
|
194 | 194 | def __init__(self, *args, **kwds): |
|
195 | 195 | self.args = args |
|
196 | 196 | self.kwds = kwds |
|
197 | 197 | |
|
198 | 198 | def add_to_parser(self, parser, group): |
|
199 | 199 | """ Add this object's information to the parser. |
|
200 | 200 | """ |
|
201 | 201 | return parser.add_argument_group(*self.args, **self.kwds) |
|
202 | 202 | |
|
203 | 203 | |
|
204 | 204 | class kwds(ArgDecorator): |
|
205 | 205 | """ Provide other keywords to the sub-parser constructor. |
|
206 | 206 | """ |
|
207 | 207 | def __init__(self, **kwds): |
|
208 | 208 | self.kwds = kwds |
|
209 | 209 | |
|
210 | 210 | def __call__(self, func): |
|
211 | 211 | func = super(kwds, self).__call__(func) |
|
212 | 212 | func.argcmd_kwds = self.kwds |
|
213 | 213 | return func |
|
214 | 214 | |
|
215 | 215 | |
|
216 | 216 | __all__ = ['magic_arguments', 'argument', 'argument_group', 'kwds', |
|
217 | 217 | 'parse_argstring'] |
@@ -1,340 +1,340 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Paging capabilities for IPython.core |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Brian Granger |
|
8 | 8 | * Fernando Perez |
|
9 | 9 | |
|
10 | 10 | Notes |
|
11 | 11 | ----- |
|
12 | 12 | |
|
13 | 13 | For now this uses ipapi, so it can't be in IPython.utils. If we can get |
|
14 | 14 | rid of that dependency, we could move it there. |
|
15 | 15 | ----- |
|
16 | 16 | """ |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 |
# Copyright (C) 2008-20 |
|
|
19 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
20 | 20 | # |
|
21 | 21 | # Distributed under the terms of the BSD License. The full license is in |
|
22 | 22 | # the file COPYING, distributed as part of this software. |
|
23 | 23 | #----------------------------------------------------------------------------- |
|
24 | 24 | |
|
25 | 25 | #----------------------------------------------------------------------------- |
|
26 | 26 | # Imports |
|
27 | 27 | #----------------------------------------------------------------------------- |
|
28 | 28 | |
|
29 | 29 | import os |
|
30 | 30 | import re |
|
31 | 31 | import sys |
|
32 | 32 | import tempfile |
|
33 | 33 | |
|
34 | 34 | from io import UnsupportedOperation |
|
35 | 35 | |
|
36 | 36 | from IPython.core import ipapi |
|
37 | 37 | from IPython.core.error import TryNext |
|
38 | 38 | from IPython.utils.cursesimport import use_curses |
|
39 | 39 | from IPython.utils.data import chop |
|
40 | 40 | from IPython.utils import io |
|
41 | 41 | from IPython.utils.process import system |
|
42 | 42 | from IPython.utils.terminal import get_terminal_size |
|
43 | 43 | |
|
44 | 44 | |
|
45 | 45 | #----------------------------------------------------------------------------- |
|
46 | 46 | # Classes and functions |
|
47 | 47 | #----------------------------------------------------------------------------- |
|
48 | 48 | |
|
49 | 49 | esc_re = re.compile(r"(\x1b[^m]+m)") |
|
50 | 50 | |
|
51 | 51 | def page_dumb(strng, start=0, screen_lines=25): |
|
52 | 52 | """Very dumb 'pager' in Python, for when nothing else works. |
|
53 | 53 | |
|
54 | 54 | Only moves forward, same interface as page(), except for pager_cmd and |
|
55 | 55 | mode.""" |
|
56 | 56 | |
|
57 | 57 | out_ln = strng.splitlines()[start:] |
|
58 | 58 | screens = chop(out_ln,screen_lines-1) |
|
59 | 59 | if len(screens) == 1: |
|
60 | 60 | print >>io.stdout, os.linesep.join(screens[0]) |
|
61 | 61 | else: |
|
62 | 62 | last_escape = "" |
|
63 | 63 | for scr in screens[0:-1]: |
|
64 | 64 | hunk = os.linesep.join(scr) |
|
65 | 65 | print >>io.stdout, last_escape + hunk |
|
66 | 66 | if not page_more(): |
|
67 | 67 | return |
|
68 | 68 | esc_list = esc_re.findall(hunk) |
|
69 | 69 | if len(esc_list) > 0: |
|
70 | 70 | last_escape = esc_list[-1] |
|
71 | 71 | print >>io.stdout, last_escape + os.linesep.join(screens[-1]) |
|
72 | 72 | |
|
73 | 73 | def _detect_screen_size(use_curses, screen_lines_def): |
|
74 | 74 | """Attempt to work out the number of lines on the screen. |
|
75 | 75 | |
|
76 | 76 | This is called by page(). It can raise an error (e.g. when run in the |
|
77 | 77 | test suite), so it's separated out so it can easily be called in a try block. |
|
78 | 78 | """ |
|
79 | 79 | TERM = os.environ.get('TERM',None) |
|
80 | 80 | if (TERM=='xterm' or TERM=='xterm-color') and sys.platform != 'sunos5': |
|
81 | 81 | local_use_curses = use_curses |
|
82 | 82 | else: |
|
83 | 83 | # curses causes problems on many terminals other than xterm, and |
|
84 | 84 | # some termios calls lock up on Sun OS5. |
|
85 | 85 | local_use_curses = False |
|
86 | 86 | if local_use_curses: |
|
87 | 87 | import termios |
|
88 | 88 | import curses |
|
89 | 89 | # There is a bug in curses, where *sometimes* it fails to properly |
|
90 | 90 | # initialize, and then after the endwin() call is made, the |
|
91 | 91 | # terminal is left in an unusable state. Rather than trying to |
|
92 | 92 | # check everytime for this (by requesting and comparing termios |
|
93 | 93 | # flags each time), we just save the initial terminal state and |
|
94 | 94 | # unconditionally reset it every time. It's cheaper than making |
|
95 | 95 | # the checks. |
|
96 | 96 | term_flags = termios.tcgetattr(sys.stdout) |
|
97 | 97 | |
|
98 | 98 | # Curses modifies the stdout buffer size by default, which messes |
|
99 | 99 | # up Python's normal stdout buffering. This would manifest itself |
|
100 | 100 | # to IPython users as delayed printing on stdout after having used |
|
101 | 101 | # the pager. |
|
102 | 102 | # |
|
103 | 103 | # We can prevent this by manually setting the NCURSES_NO_SETBUF |
|
104 | 104 | # environment variable. For more details, see: |
|
105 | 105 | # http://bugs.python.org/issue10144 |
|
106 | 106 | NCURSES_NO_SETBUF = os.environ.get('NCURSES_NO_SETBUF', None) |
|
107 | 107 | os.environ['NCURSES_NO_SETBUF'] = '' |
|
108 | 108 | |
|
109 | 109 | # Proceed with curses initialization |
|
110 | 110 | scr = curses.initscr() |
|
111 | 111 | screen_lines_real,screen_cols = scr.getmaxyx() |
|
112 | 112 | curses.endwin() |
|
113 | 113 | |
|
114 | 114 | # Restore environment |
|
115 | 115 | if NCURSES_NO_SETBUF is None: |
|
116 | 116 | del os.environ['NCURSES_NO_SETBUF'] |
|
117 | 117 | else: |
|
118 | 118 | os.environ['NCURSES_NO_SETBUF'] = NCURSES_NO_SETBUF |
|
119 | 119 | |
|
120 | 120 | # Restore terminal state in case endwin() didn't. |
|
121 | 121 | termios.tcsetattr(sys.stdout,termios.TCSANOW,term_flags) |
|
122 | 122 | # Now we have what we needed: the screen size in rows/columns |
|
123 | 123 | return screen_lines_real |
|
124 | 124 | #print '***Screen size:',screen_lines_real,'lines x',\ |
|
125 | 125 | #screen_cols,'columns.' # dbg |
|
126 | 126 | else: |
|
127 | 127 | return screen_lines_def |
|
128 | 128 | |
|
129 | 129 | def page(strng, start=0, screen_lines=0, pager_cmd=None): |
|
130 | 130 | """Print a string, piping through a pager after a certain length. |
|
131 | 131 | |
|
132 | 132 | The screen_lines parameter specifies the number of *usable* lines of your |
|
133 | 133 | terminal screen (total lines minus lines you need to reserve to show other |
|
134 | 134 | information). |
|
135 | 135 | |
|
136 | 136 | If you set screen_lines to a number <=0, page() will try to auto-determine |
|
137 | 137 | your screen size and will only use up to (screen_size+screen_lines) for |
|
138 | 138 | printing, paging after that. That is, if you want auto-detection but need |
|
139 | 139 | to reserve the bottom 3 lines of the screen, use screen_lines = -3, and for |
|
140 | 140 | auto-detection without any lines reserved simply use screen_lines = 0. |
|
141 | 141 | |
|
142 | 142 | If a string won't fit in the allowed lines, it is sent through the |
|
143 | 143 | specified pager command. If none given, look for PAGER in the environment, |
|
144 | 144 | and ultimately default to less. |
|
145 | 145 | |
|
146 | 146 | If no system pager works, the string is sent through a 'dumb pager' |
|
147 | 147 | written in python, very simplistic. |
|
148 | 148 | """ |
|
149 | 149 | |
|
150 | 150 | # Some routines may auto-compute start offsets incorrectly and pass a |
|
151 | 151 | # negative value. Offset to 0 for robustness. |
|
152 | 152 | start = max(0, start) |
|
153 | 153 | |
|
154 | 154 | # first, try the hook |
|
155 | 155 | ip = ipapi.get() |
|
156 | 156 | if ip: |
|
157 | 157 | try: |
|
158 | 158 | ip.hooks.show_in_pager(strng) |
|
159 | 159 | return |
|
160 | 160 | except TryNext: |
|
161 | 161 | pass |
|
162 | 162 | |
|
163 | 163 | # Ugly kludge, but calling curses.initscr() flat out crashes in emacs |
|
164 | 164 | TERM = os.environ.get('TERM','dumb') |
|
165 | 165 | if TERM in ['dumb','emacs'] and os.name != 'nt': |
|
166 | 166 | print strng |
|
167 | 167 | return |
|
168 | 168 | # chop off the topmost part of the string we don't want to see |
|
169 | 169 | str_lines = strng.splitlines()[start:] |
|
170 | 170 | str_toprint = os.linesep.join(str_lines) |
|
171 | 171 | num_newlines = len(str_lines) |
|
172 | 172 | len_str = len(str_toprint) |
|
173 | 173 | |
|
174 | 174 | # Dumb heuristics to guesstimate number of on-screen lines the string |
|
175 | 175 | # takes. Very basic, but good enough for docstrings in reasonable |
|
176 | 176 | # terminals. If someone later feels like refining it, it's not hard. |
|
177 | 177 | numlines = max(num_newlines,int(len_str/80)+1) |
|
178 | 178 | |
|
179 | 179 | screen_lines_def = get_terminal_size()[1] |
|
180 | 180 | |
|
181 | 181 | # auto-determine screen size |
|
182 | 182 | if screen_lines <= 0: |
|
183 | 183 | try: |
|
184 | 184 | screen_lines += _detect_screen_size(use_curses, screen_lines_def) |
|
185 | 185 | except (TypeError, UnsupportedOperation): |
|
186 | 186 | print >>io.stdout, str_toprint |
|
187 | 187 | return |
|
188 | 188 | |
|
189 | 189 | #print 'numlines',numlines,'screenlines',screen_lines # dbg |
|
190 | 190 | if numlines <= screen_lines : |
|
191 | 191 | #print '*** normal print' # dbg |
|
192 | 192 | print >>io.stdout, str_toprint |
|
193 | 193 | else: |
|
194 | 194 | # Try to open pager and default to internal one if that fails. |
|
195 | 195 | # All failure modes are tagged as 'retval=1', to match the return |
|
196 | 196 | # value of a failed system command. If any intermediate attempt |
|
197 | 197 | # sets retval to 1, at the end we resort to our own page_dumb() pager. |
|
198 | 198 | pager_cmd = get_pager_cmd(pager_cmd) |
|
199 | 199 | pager_cmd += ' ' + get_pager_start(pager_cmd,start) |
|
200 | 200 | if os.name == 'nt': |
|
201 | 201 | if pager_cmd.startswith('type'): |
|
202 | 202 | # The default WinXP 'type' command is failing on complex strings. |
|
203 | 203 | retval = 1 |
|
204 | 204 | else: |
|
205 | 205 | tmpname = tempfile.mktemp('.txt') |
|
206 | 206 | tmpfile = file(tmpname,'wt') |
|
207 | 207 | tmpfile.write(strng) |
|
208 | 208 | tmpfile.close() |
|
209 | 209 | cmd = "%s < %s" % (pager_cmd,tmpname) |
|
210 | 210 | if os.system(cmd): |
|
211 | 211 | retval = 1 |
|
212 | 212 | else: |
|
213 | 213 | retval = None |
|
214 | 214 | os.remove(tmpname) |
|
215 | 215 | else: |
|
216 | 216 | try: |
|
217 | 217 | retval = None |
|
218 | 218 | # if I use popen4, things hang. No idea why. |
|
219 | 219 | #pager,shell_out = os.popen4(pager_cmd) |
|
220 | 220 | pager = os.popen(pager_cmd,'w') |
|
221 | 221 | pager.write(strng) |
|
222 | 222 | pager.close() |
|
223 | 223 | retval = pager.close() # success returns None |
|
224 | 224 | except IOError,msg: # broken pipe when user quits |
|
225 | 225 | if msg.args == (32,'Broken pipe'): |
|
226 | 226 | retval = None |
|
227 | 227 | else: |
|
228 | 228 | retval = 1 |
|
229 | 229 | except OSError: |
|
230 | 230 | # Other strange problems, sometimes seen in Win2k/cygwin |
|
231 | 231 | retval = 1 |
|
232 | 232 | if retval is not None: |
|
233 | 233 | page_dumb(strng,screen_lines=screen_lines) |
|
234 | 234 | |
|
235 | 235 | |
|
236 | 236 | def page_file(fname, start=0, pager_cmd=None): |
|
237 | 237 | """Page a file, using an optional pager command and starting line. |
|
238 | 238 | """ |
|
239 | 239 | |
|
240 | 240 | pager_cmd = get_pager_cmd(pager_cmd) |
|
241 | 241 | pager_cmd += ' ' + get_pager_start(pager_cmd,start) |
|
242 | 242 | |
|
243 | 243 | try: |
|
244 | 244 | if os.environ['TERM'] in ['emacs','dumb']: |
|
245 | 245 | raise EnvironmentError |
|
246 | 246 | system(pager_cmd + ' ' + fname) |
|
247 | 247 | except: |
|
248 | 248 | try: |
|
249 | 249 | if start > 0: |
|
250 | 250 | start -= 1 |
|
251 | 251 | page(open(fname).read(),start) |
|
252 | 252 | except: |
|
253 | 253 | print 'Unable to show file',`fname` |
|
254 | 254 | |
|
255 | 255 | |
|
256 | 256 | def get_pager_cmd(pager_cmd=None): |
|
257 | 257 | """Return a pager command. |
|
258 | 258 | |
|
259 | 259 | Makes some attempts at finding an OS-correct one. |
|
260 | 260 | """ |
|
261 | 261 | if os.name == 'posix': |
|
262 | 262 | default_pager_cmd = 'less -r' # -r for color control sequences |
|
263 | 263 | elif os.name in ['nt','dos']: |
|
264 | 264 | default_pager_cmd = 'type' |
|
265 | 265 | |
|
266 | 266 | if pager_cmd is None: |
|
267 | 267 | try: |
|
268 | 268 | pager_cmd = os.environ['PAGER'] |
|
269 | 269 | except: |
|
270 | 270 | pager_cmd = default_pager_cmd |
|
271 | 271 | return pager_cmd |
|
272 | 272 | |
|
273 | 273 | |
|
274 | 274 | def get_pager_start(pager, start): |
|
275 | 275 | """Return the string for paging files with an offset. |
|
276 | 276 | |
|
277 | 277 | This is the '+N' argument which less and more (under Unix) accept. |
|
278 | 278 | """ |
|
279 | 279 | |
|
280 | 280 | if pager in ['less','more']: |
|
281 | 281 | if start: |
|
282 | 282 | start_string = '+' + str(start) |
|
283 | 283 | else: |
|
284 | 284 | start_string = '' |
|
285 | 285 | else: |
|
286 | 286 | start_string = '' |
|
287 | 287 | return start_string |
|
288 | 288 | |
|
289 | 289 | |
|
290 | 290 | # (X)emacs on win32 doesn't like to be bypassed with msvcrt.getch() |
|
291 | 291 | if os.name == 'nt' and os.environ.get('TERM','dumb') != 'emacs': |
|
292 | 292 | import msvcrt |
|
293 | 293 | def page_more(): |
|
294 | 294 | """ Smart pausing between pages |
|
295 | 295 | |
|
296 | 296 | @return: True if need print more lines, False if quit |
|
297 | 297 | """ |
|
298 | 298 | io.stdout.write('---Return to continue, q to quit--- ') |
|
299 | 299 | ans = msvcrt.getch() |
|
300 | 300 | if ans in ("q", "Q"): |
|
301 | 301 | result = False |
|
302 | 302 | else: |
|
303 | 303 | result = True |
|
304 | 304 | io.stdout.write("\b"*37 + " "*37 + "\b"*37) |
|
305 | 305 | return result |
|
306 | 306 | else: |
|
307 | 307 | def page_more(): |
|
308 | 308 | ans = raw_input('---Return to continue, q to quit--- ') |
|
309 | 309 | if ans.lower().startswith('q'): |
|
310 | 310 | return False |
|
311 | 311 | else: |
|
312 | 312 | return True |
|
313 | 313 | |
|
314 | 314 | |
|
315 | 315 | def snip_print(str,width = 75,print_full = 0,header = ''): |
|
316 | 316 | """Print a string snipping the midsection to fit in width. |
|
317 | 317 | |
|
318 | 318 | print_full: mode control: |
|
319 | 319 | - 0: only snip long strings |
|
320 | 320 | - 1: send to page() directly. |
|
321 | 321 | - 2: snip long strings and ask for full length viewing with page() |
|
322 | 322 | Return 1 if snipping was necessary, 0 otherwise.""" |
|
323 | 323 | |
|
324 | 324 | if print_full == 1: |
|
325 | 325 | page(header+str) |
|
326 | 326 | return 0 |
|
327 | 327 | |
|
328 | 328 | print header, |
|
329 | 329 | if len(str) < width: |
|
330 | 330 | print str |
|
331 | 331 | snip = 0 |
|
332 | 332 | else: |
|
333 | 333 | whalf = int((width -5)/2) |
|
334 | 334 | print str[:whalf] + ' <...> ' + str[-whalf:] |
|
335 | 335 | snip = 1 |
|
336 | 336 | if snip and print_full == 2: |
|
337 | 337 | if raw_input(header+' Snipped. View (y/n)? [N]').lower() == 'y': |
|
338 | 338 | page(str) |
|
339 | 339 | return snip |
|
340 | 340 |
@@ -1,41 +1,41 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Payload system for IPython. |
|
3 | 3 | |
|
4 | 4 | Authors: |
|
5 | 5 | |
|
6 | 6 | * Fernando Perez |
|
7 | 7 | * Brian Granger |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 |
# Copyright (C) 2008-201 |
|
|
11 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
12 | 12 | # |
|
13 | 13 | # Distributed under the terms of the BSD License. The full license is in |
|
14 | 14 | # the file COPYING, distributed as part of this software. |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | # Imports |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | |
|
21 | 21 | from IPython.config.configurable import Configurable |
|
22 | 22 | from IPython.utils.traitlets import List |
|
23 | 23 | |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | # Main payload class |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | |
|
28 | 28 | class PayloadManager(Configurable): |
|
29 | 29 | |
|
30 | 30 | _payload = List([]) |
|
31 | 31 | |
|
32 | 32 | def write_payload(self, data): |
|
33 | 33 | if not isinstance(data, dict): |
|
34 | 34 | raise TypeError('Each payload write must be a dict, got: %r' % data) |
|
35 | 35 | self._payload.append(data) |
|
36 | 36 | |
|
37 | 37 | def read_payload(self): |
|
38 | 38 | return self._payload |
|
39 | 39 | |
|
40 | 40 | def clear_payload(self): |
|
41 | 41 | self._payload = [] |
@@ -1,96 +1,96 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | A payload based version of page. |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Brian Granger |
|
8 | 8 | * Fernando Perez |
|
9 | 9 | """ |
|
10 | 10 | |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 |
# Copyright (C) 2008-201 |
|
|
12 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
13 | 13 | # |
|
14 | 14 | # Distributed under the terms of the BSD License. The full license is in |
|
15 | 15 | # the file COPYING, distributed as part of this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | # Third-party |
|
23 | 23 | try: |
|
24 | 24 | from docutils.core import publish_string |
|
25 | 25 | except ImportError: |
|
26 | 26 | # html paging won't be available, but we don't raise any errors. It's a |
|
27 | 27 | # purely optional feature. |
|
28 | 28 | pass |
|
29 | 29 | |
|
30 | 30 | # Our own |
|
31 | 31 | from IPython.core.interactiveshell import InteractiveShell |
|
32 | 32 | |
|
33 | 33 | #----------------------------------------------------------------------------- |
|
34 | 34 | # Classes and functions |
|
35 | 35 | #----------------------------------------------------------------------------- |
|
36 | 36 | |
|
37 | 37 | def page(strng, start=0, screen_lines=0, pager_cmd=None, |
|
38 | 38 | html=None, auto_html=False): |
|
39 | 39 | """Print a string, piping through a pager. |
|
40 | 40 | |
|
41 | 41 | This version ignores the screen_lines and pager_cmd arguments and uses |
|
42 | 42 | IPython's payload system instead. |
|
43 | 43 | |
|
44 | 44 | Parameters |
|
45 | 45 | ---------- |
|
46 | 46 | strng : str |
|
47 | 47 | Text to page. |
|
48 | 48 | |
|
49 | 49 | start : int |
|
50 | 50 | Starting line at which to place the display. |
|
51 | 51 | |
|
52 | 52 | html : str, optional |
|
53 | 53 | If given, an html string to send as well. |
|
54 | 54 | |
|
55 | 55 | auto_html : bool, optional |
|
56 | 56 | If true, the input string is assumed to be valid reStructuredText and is |
|
57 | 57 | converted to HTML with docutils. Note that if docutils is not found, |
|
58 | 58 | this option is silently ignored. |
|
59 | 59 | |
|
60 | 60 | Note |
|
61 | 61 | ---- |
|
62 | 62 | |
|
63 | 63 | Only one of the ``html`` and ``auto_html`` options can be given, not |
|
64 | 64 | both. |
|
65 | 65 | """ |
|
66 | 66 | |
|
67 | 67 | # Some routines may auto-compute start offsets incorrectly and pass a |
|
68 | 68 | # negative value. Offset to 0 for robustness. |
|
69 | 69 | start = max(0, start) |
|
70 | 70 | shell = InteractiveShell.instance() |
|
71 | 71 | |
|
72 | 72 | if auto_html: |
|
73 | 73 | try: |
|
74 | 74 | # These defaults ensure user configuration variables for docutils |
|
75 | 75 | # are not loaded, only our config is used here. |
|
76 | 76 | defaults = {'file_insertion_enabled': 0, |
|
77 | 77 | 'raw_enabled': 0, |
|
78 | 78 | '_disable_config': 1} |
|
79 | 79 | html = publish_string(strng, writer_name='html', |
|
80 | 80 | settings_overrides=defaults) |
|
81 | 81 | except: |
|
82 | 82 | pass |
|
83 | 83 | |
|
84 | 84 | payload = dict( |
|
85 | 85 | source='IPython.zmq.page.page', |
|
86 | 86 | text=strng, |
|
87 | 87 | html=html, |
|
88 | 88 | start_line_number=start |
|
89 | 89 | ) |
|
90 | 90 | shell.payload_manager.write_payload(payload) |
|
91 | 91 | |
|
92 | 92 | |
|
93 | 93 | def install_payload_page(): |
|
94 | 94 | """Install this version of page as IPython.core.page.page.""" |
|
95 | 95 | from IPython.core import page as corepage |
|
96 | 96 | corepage.page = page |
@@ -1,51 +1,51 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """IPython plugins. |
|
3 | 3 | |
|
4 | 4 | Authors: |
|
5 | 5 | |
|
6 | 6 | * Brian Granger |
|
7 | 7 | """ |
|
8 | 8 | |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 | # Copyright (C) 2010 The IPython Development Team | |
|
10 | # Copyright (C) 2010-2011 The IPython Development Team | |
|
11 | 11 | # |
|
12 | 12 | # Distributed under the terms of the BSD License. The full license is in |
|
13 | 13 | # the file COPYING, distributed as part of this software. |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | # Imports |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | |
|
20 | 20 | from IPython.config.configurable import Configurable |
|
21 | 21 | from IPython.utils.traitlets import Dict |
|
22 | 22 | |
|
23 | 23 | #----------------------------------------------------------------------------- |
|
24 | 24 | # Main class |
|
25 | 25 | #----------------------------------------------------------------------------- |
|
26 | 26 | |
|
27 | 27 | class PluginManager(Configurable): |
|
28 | 28 | """A manager for IPython plugins.""" |
|
29 | 29 | |
|
30 | 30 | plugins = Dict({}) |
|
31 | 31 | |
|
32 | 32 | def __init__(self, config=None): |
|
33 | 33 | super(PluginManager, self).__init__(config=config) |
|
34 | 34 | |
|
35 | 35 | def register_plugin(self, name, plugin): |
|
36 | 36 | if not isinstance(plugin, Plugin): |
|
37 | 37 | raise TypeError('Expected Plugin, got: %r' % plugin) |
|
38 | 38 | if self.plugins.has_key(name): |
|
39 | 39 | raise KeyError('Plugin with name already exists: %r' % name) |
|
40 | 40 | self.plugins[name] = plugin |
|
41 | 41 | |
|
42 | 42 | def unregister_plugin(self, name): |
|
43 | 43 | del self.plugins[name] |
|
44 | 44 | |
|
45 | 45 | def get_plugin(self, name, default=None): |
|
46 | 46 | return self.plugins.get(name, default) |
|
47 | 47 | |
|
48 | 48 | |
|
49 | 49 | class Plugin(Configurable): |
|
50 | 50 | """Base class for IPython plugins.""" |
|
51 | 51 | pass |
@@ -1,946 +1,946 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Prefiltering components. |
|
4 | 4 | |
|
5 | 5 | Prefilters transform user input before it is exec'd by Python. These |
|
6 | 6 | transforms are used to implement additional syntax such as !ls and %magic. |
|
7 | 7 | |
|
8 | 8 | Authors: |
|
9 | 9 | |
|
10 | 10 | * Brian Granger |
|
11 | 11 | * Fernando Perez |
|
12 | 12 | * Dan Milstein |
|
13 | 13 | * Ville Vainio |
|
14 | 14 | """ |
|
15 | 15 | |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 |
# Copyright (C) 2008-20 |
|
|
17 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
18 | 18 | # |
|
19 | 19 | # Distributed under the terms of the BSD License. The full license is in |
|
20 | 20 | # the file COPYING, distributed as part of this software. |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | |
|
23 | 23 | #----------------------------------------------------------------------------- |
|
24 | 24 | # Imports |
|
25 | 25 | #----------------------------------------------------------------------------- |
|
26 | 26 | |
|
27 | 27 | import __builtin__ |
|
28 | 28 | import codeop |
|
29 | 29 | import re |
|
30 | 30 | |
|
31 | 31 | from IPython.core.alias import AliasManager |
|
32 | 32 | from IPython.core.autocall import IPyAutocall |
|
33 | 33 | from IPython.config.configurable import Configurable |
|
34 | 34 | from IPython.core.macro import Macro |
|
35 | 35 | from IPython.core.splitinput import split_user_input, LineInfo |
|
36 | 36 | from IPython.core import page |
|
37 | 37 | |
|
38 | 38 | from IPython.utils.traitlets import List, Integer, Any, Unicode, CBool, Bool, Instance |
|
39 | 39 | from IPython.utils.autoattr import auto_attr |
|
40 | 40 | |
|
41 | 41 | #----------------------------------------------------------------------------- |
|
42 | 42 | # Global utilities, errors and constants |
|
43 | 43 | #----------------------------------------------------------------------------- |
|
44 | 44 | |
|
45 | 45 | # Warning, these cannot be changed unless various regular expressions |
|
46 | 46 | # are updated in a number of places. Not great, but at least we told you. |
|
47 | 47 | ESC_SHELL = '!' |
|
48 | 48 | ESC_SH_CAP = '!!' |
|
49 | 49 | ESC_HELP = '?' |
|
50 | 50 | ESC_MAGIC = '%' |
|
51 | 51 | ESC_QUOTE = ',' |
|
52 | 52 | ESC_QUOTE2 = ';' |
|
53 | 53 | ESC_PAREN = '/' |
|
54 | 54 | |
|
55 | 55 | |
|
56 | 56 | class PrefilterError(Exception): |
|
57 | 57 | pass |
|
58 | 58 | |
|
59 | 59 | |
|
60 | 60 | # RegExp to identify potential function names |
|
61 | 61 | re_fun_name = re.compile(r'[a-zA-Z_]([a-zA-Z0-9_.]*) *$') |
|
62 | 62 | |
|
63 | 63 | # RegExp to exclude strings with this start from autocalling. In |
|
64 | 64 | # particular, all binary operators should be excluded, so that if foo is |
|
65 | 65 | # callable, foo OP bar doesn't become foo(OP bar), which is invalid. The |
|
66 | 66 | # characters '!=()' don't need to be checked for, as the checkPythonChars |
|
67 | 67 | # routine explicitely does so, to catch direct calls and rebindings of |
|
68 | 68 | # existing names. |
|
69 | 69 | |
|
70 | 70 | # Warning: the '-' HAS TO BE AT THE END of the first group, otherwise |
|
71 | 71 | # it affects the rest of the group in square brackets. |
|
72 | 72 | re_exclude_auto = re.compile(r'^[,&^\|\*/\+-]' |
|
73 | 73 | r'|^is |^not |^in |^and |^or ') |
|
74 | 74 | |
|
75 | 75 | # try to catch also methods for stuff in lists/tuples/dicts: off |
|
76 | 76 | # (experimental). For this to work, the line_split regexp would need |
|
77 | 77 | # to be modified so it wouldn't break things at '['. That line is |
|
78 | 78 | # nasty enough that I shouldn't change it until I can test it _well_. |
|
79 | 79 | #self.re_fun_name = re.compile (r'[a-zA-Z_]([a-zA-Z0-9_.\[\]]*) ?$') |
|
80 | 80 | |
|
81 | 81 | |
|
82 | 82 | # Handler Check Utilities |
|
83 | 83 | def is_shadowed(identifier, ip): |
|
84 | 84 | """Is the given identifier defined in one of the namespaces which shadow |
|
85 | 85 | the alias and magic namespaces? Note that an identifier is different |
|
86 | 86 | than ifun, because it can not contain a '.' character.""" |
|
87 | 87 | # This is much safer than calling ofind, which can change state |
|
88 | 88 | return (identifier in ip.user_ns \ |
|
89 | 89 | or identifier in ip.internal_ns \ |
|
90 | 90 | or identifier in ip.ns_table['builtin']) |
|
91 | 91 | |
|
92 | 92 | |
|
93 | 93 | #----------------------------------------------------------------------------- |
|
94 | 94 | # Main Prefilter manager |
|
95 | 95 | #----------------------------------------------------------------------------- |
|
96 | 96 | |
|
97 | 97 | |
|
98 | 98 | class PrefilterManager(Configurable): |
|
99 | 99 | """Main prefilter component. |
|
100 | 100 | |
|
101 | 101 | The IPython prefilter is run on all user input before it is run. The |
|
102 | 102 | prefilter consumes lines of input and produces transformed lines of |
|
103 | 103 | input. |
|
104 | 104 | |
|
105 | 105 | The iplementation consists of two phases: |
|
106 | 106 | |
|
107 | 107 | 1. Transformers |
|
108 | 108 | 2. Checkers and handlers |
|
109 | 109 | |
|
110 | 110 | Over time, we plan on deprecating the checkers and handlers and doing |
|
111 | 111 | everything in the transformers. |
|
112 | 112 | |
|
113 | 113 | The transformers are instances of :class:`PrefilterTransformer` and have |
|
114 | 114 | a single method :meth:`transform` that takes a line and returns a |
|
115 | 115 | transformed line. The transformation can be accomplished using any |
|
116 | 116 | tool, but our current ones use regular expressions for speed. We also |
|
117 | 117 | ship :mod:`pyparsing` in :mod:`IPython.external` for use in transformers. |
|
118 | 118 | |
|
119 | 119 | After all the transformers have been run, the line is fed to the checkers, |
|
120 | 120 | which are instances of :class:`PrefilterChecker`. The line is passed to |
|
121 | 121 | the :meth:`check` method, which either returns `None` or a |
|
122 | 122 | :class:`PrefilterHandler` instance. If `None` is returned, the other |
|
123 | 123 | checkers are tried. If an :class:`PrefilterHandler` instance is returned, |
|
124 | 124 | the line is passed to the :meth:`handle` method of the returned |
|
125 | 125 | handler and no further checkers are tried. |
|
126 | 126 | |
|
127 | 127 | Both transformers and checkers have a `priority` attribute, that determines |
|
128 | 128 | the order in which they are called. Smaller priorities are tried first. |
|
129 | 129 | |
|
130 | 130 | Both transformers and checkers also have `enabled` attribute, which is |
|
131 | 131 | a boolean that determines if the instance is used. |
|
132 | 132 | |
|
133 | 133 | Users or developers can change the priority or enabled attribute of |
|
134 | 134 | transformers or checkers, but they must call the :meth:`sort_checkers` |
|
135 | 135 | or :meth:`sort_transformers` method after changing the priority. |
|
136 | 136 | """ |
|
137 | 137 | |
|
138 | 138 | multi_line_specials = CBool(True, config=True) |
|
139 | 139 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
140 | 140 | |
|
141 | 141 | def __init__(self, shell=None, config=None): |
|
142 | 142 | super(PrefilterManager, self).__init__(shell=shell, config=config) |
|
143 | 143 | self.shell = shell |
|
144 | 144 | self.init_transformers() |
|
145 | 145 | self.init_handlers() |
|
146 | 146 | self.init_checkers() |
|
147 | 147 | |
|
148 | 148 | #------------------------------------------------------------------------- |
|
149 | 149 | # API for managing transformers |
|
150 | 150 | #------------------------------------------------------------------------- |
|
151 | 151 | |
|
152 | 152 | def init_transformers(self): |
|
153 | 153 | """Create the default transformers.""" |
|
154 | 154 | self._transformers = [] |
|
155 | 155 | for transformer_cls in _default_transformers: |
|
156 | 156 | transformer_cls( |
|
157 | 157 | shell=self.shell, prefilter_manager=self, config=self.config |
|
158 | 158 | ) |
|
159 | 159 | |
|
160 | 160 | def sort_transformers(self): |
|
161 | 161 | """Sort the transformers by priority. |
|
162 | 162 | |
|
163 | 163 | This must be called after the priority of a transformer is changed. |
|
164 | 164 | The :meth:`register_transformer` method calls this automatically. |
|
165 | 165 | """ |
|
166 | 166 | self._transformers.sort(key=lambda x: x.priority) |
|
167 | 167 | |
|
168 | 168 | @property |
|
169 | 169 | def transformers(self): |
|
170 | 170 | """Return a list of checkers, sorted by priority.""" |
|
171 | 171 | return self._transformers |
|
172 | 172 | |
|
173 | 173 | def register_transformer(self, transformer): |
|
174 | 174 | """Register a transformer instance.""" |
|
175 | 175 | if transformer not in self._transformers: |
|
176 | 176 | self._transformers.append(transformer) |
|
177 | 177 | self.sort_transformers() |
|
178 | 178 | |
|
179 | 179 | def unregister_transformer(self, transformer): |
|
180 | 180 | """Unregister a transformer instance.""" |
|
181 | 181 | if transformer in self._transformers: |
|
182 | 182 | self._transformers.remove(transformer) |
|
183 | 183 | |
|
184 | 184 | #------------------------------------------------------------------------- |
|
185 | 185 | # API for managing checkers |
|
186 | 186 | #------------------------------------------------------------------------- |
|
187 | 187 | |
|
188 | 188 | def init_checkers(self): |
|
189 | 189 | """Create the default checkers.""" |
|
190 | 190 | self._checkers = [] |
|
191 | 191 | for checker in _default_checkers: |
|
192 | 192 | checker( |
|
193 | 193 | shell=self.shell, prefilter_manager=self, config=self.config |
|
194 | 194 | ) |
|
195 | 195 | |
|
196 | 196 | def sort_checkers(self): |
|
197 | 197 | """Sort the checkers by priority. |
|
198 | 198 | |
|
199 | 199 | This must be called after the priority of a checker is changed. |
|
200 | 200 | The :meth:`register_checker` method calls this automatically. |
|
201 | 201 | """ |
|
202 | 202 | self._checkers.sort(key=lambda x: x.priority) |
|
203 | 203 | |
|
204 | 204 | @property |
|
205 | 205 | def checkers(self): |
|
206 | 206 | """Return a list of checkers, sorted by priority.""" |
|
207 | 207 | return self._checkers |
|
208 | 208 | |
|
209 | 209 | def register_checker(self, checker): |
|
210 | 210 | """Register a checker instance.""" |
|
211 | 211 | if checker not in self._checkers: |
|
212 | 212 | self._checkers.append(checker) |
|
213 | 213 | self.sort_checkers() |
|
214 | 214 | |
|
215 | 215 | def unregister_checker(self, checker): |
|
216 | 216 | """Unregister a checker instance.""" |
|
217 | 217 | if checker in self._checkers: |
|
218 | 218 | self._checkers.remove(checker) |
|
219 | 219 | |
|
220 | 220 | #------------------------------------------------------------------------- |
|
221 | 221 | # API for managing checkers |
|
222 | 222 | #------------------------------------------------------------------------- |
|
223 | 223 | |
|
224 | 224 | def init_handlers(self): |
|
225 | 225 | """Create the default handlers.""" |
|
226 | 226 | self._handlers = {} |
|
227 | 227 | self._esc_handlers = {} |
|
228 | 228 | for handler in _default_handlers: |
|
229 | 229 | handler( |
|
230 | 230 | shell=self.shell, prefilter_manager=self, config=self.config |
|
231 | 231 | ) |
|
232 | 232 | |
|
233 | 233 | @property |
|
234 | 234 | def handlers(self): |
|
235 | 235 | """Return a dict of all the handlers.""" |
|
236 | 236 | return self._handlers |
|
237 | 237 | |
|
238 | 238 | def register_handler(self, name, handler, esc_strings): |
|
239 | 239 | """Register a handler instance by name with esc_strings.""" |
|
240 | 240 | self._handlers[name] = handler |
|
241 | 241 | for esc_str in esc_strings: |
|
242 | 242 | self._esc_handlers[esc_str] = handler |
|
243 | 243 | |
|
244 | 244 | def unregister_handler(self, name, handler, esc_strings): |
|
245 | 245 | """Unregister a handler instance by name with esc_strings.""" |
|
246 | 246 | try: |
|
247 | 247 | del self._handlers[name] |
|
248 | 248 | except KeyError: |
|
249 | 249 | pass |
|
250 | 250 | for esc_str in esc_strings: |
|
251 | 251 | h = self._esc_handlers.get(esc_str) |
|
252 | 252 | if h is handler: |
|
253 | 253 | del self._esc_handlers[esc_str] |
|
254 | 254 | |
|
255 | 255 | def get_handler_by_name(self, name): |
|
256 | 256 | """Get a handler by its name.""" |
|
257 | 257 | return self._handlers.get(name) |
|
258 | 258 | |
|
259 | 259 | def get_handler_by_esc(self, esc_str): |
|
260 | 260 | """Get a handler by its escape string.""" |
|
261 | 261 | return self._esc_handlers.get(esc_str) |
|
262 | 262 | |
|
263 | 263 | #------------------------------------------------------------------------- |
|
264 | 264 | # Main prefiltering API |
|
265 | 265 | #------------------------------------------------------------------------- |
|
266 | 266 | |
|
267 | 267 | def prefilter_line_info(self, line_info): |
|
268 | 268 | """Prefilter a line that has been converted to a LineInfo object. |
|
269 | 269 | |
|
270 | 270 | This implements the checker/handler part of the prefilter pipe. |
|
271 | 271 | """ |
|
272 | 272 | # print "prefilter_line_info: ", line_info |
|
273 | 273 | handler = self.find_handler(line_info) |
|
274 | 274 | return handler.handle(line_info) |
|
275 | 275 | |
|
276 | 276 | def find_handler(self, line_info): |
|
277 | 277 | """Find a handler for the line_info by trying checkers.""" |
|
278 | 278 | for checker in self.checkers: |
|
279 | 279 | if checker.enabled: |
|
280 | 280 | handler = checker.check(line_info) |
|
281 | 281 | if handler: |
|
282 | 282 | return handler |
|
283 | 283 | return self.get_handler_by_name('normal') |
|
284 | 284 | |
|
285 | 285 | def transform_line(self, line, continue_prompt): |
|
286 | 286 | """Calls the enabled transformers in order of increasing priority.""" |
|
287 | 287 | for transformer in self.transformers: |
|
288 | 288 | if transformer.enabled: |
|
289 | 289 | line = transformer.transform(line, continue_prompt) |
|
290 | 290 | return line |
|
291 | 291 | |
|
292 | 292 | def prefilter_line(self, line, continue_prompt=False): |
|
293 | 293 | """Prefilter a single input line as text. |
|
294 | 294 | |
|
295 | 295 | This method prefilters a single line of text by calling the |
|
296 | 296 | transformers and then the checkers/handlers. |
|
297 | 297 | """ |
|
298 | 298 | |
|
299 | 299 | # print "prefilter_line: ", line, continue_prompt |
|
300 | 300 | # All handlers *must* return a value, even if it's blank (''). |
|
301 | 301 | |
|
302 | 302 | # save the line away in case we crash, so the post-mortem handler can |
|
303 | 303 | # record it |
|
304 | 304 | self.shell._last_input_line = line |
|
305 | 305 | |
|
306 | 306 | if not line: |
|
307 | 307 | # Return immediately on purely empty lines, so that if the user |
|
308 | 308 | # previously typed some whitespace that started a continuation |
|
309 | 309 | # prompt, he can break out of that loop with just an empty line. |
|
310 | 310 | # This is how the default python prompt works. |
|
311 | 311 | return '' |
|
312 | 312 | |
|
313 | 313 | # At this point, we invoke our transformers. |
|
314 | 314 | if not continue_prompt or (continue_prompt and self.multi_line_specials): |
|
315 | 315 | line = self.transform_line(line, continue_prompt) |
|
316 | 316 | |
|
317 | 317 | # Now we compute line_info for the checkers and handlers |
|
318 | 318 | line_info = LineInfo(line, continue_prompt) |
|
319 | 319 | |
|
320 | 320 | # the input history needs to track even empty lines |
|
321 | 321 | stripped = line.strip() |
|
322 | 322 | |
|
323 | 323 | normal_handler = self.get_handler_by_name('normal') |
|
324 | 324 | if not stripped: |
|
325 | 325 | if not continue_prompt: |
|
326 | 326 | self.shell.displayhook.prompt_count -= 1 |
|
327 | 327 | |
|
328 | 328 | return normal_handler.handle(line_info) |
|
329 | 329 | |
|
330 | 330 | # special handlers are only allowed for single line statements |
|
331 | 331 | if continue_prompt and not self.multi_line_specials: |
|
332 | 332 | return normal_handler.handle(line_info) |
|
333 | 333 | |
|
334 | 334 | prefiltered = self.prefilter_line_info(line_info) |
|
335 | 335 | # print "prefiltered line: %r" % prefiltered |
|
336 | 336 | return prefiltered |
|
337 | 337 | |
|
338 | 338 | def prefilter_lines(self, lines, continue_prompt=False): |
|
339 | 339 | """Prefilter multiple input lines of text. |
|
340 | 340 | |
|
341 | 341 | This is the main entry point for prefiltering multiple lines of |
|
342 | 342 | input. This simply calls :meth:`prefilter_line` for each line of |
|
343 | 343 | input. |
|
344 | 344 | |
|
345 | 345 | This covers cases where there are multiple lines in the user entry, |
|
346 | 346 | which is the case when the user goes back to a multiline history |
|
347 | 347 | entry and presses enter. |
|
348 | 348 | """ |
|
349 | 349 | llines = lines.rstrip('\n').split('\n') |
|
350 | 350 | # We can get multiple lines in one shot, where multiline input 'blends' |
|
351 | 351 | # into one line, in cases like recalling from the readline history |
|
352 | 352 | # buffer. We need to make sure that in such cases, we correctly |
|
353 | 353 | # communicate downstream which line is first and which are continuation |
|
354 | 354 | # ones. |
|
355 | 355 | if len(llines) > 1: |
|
356 | 356 | out = '\n'.join([self.prefilter_line(line, lnum>0) |
|
357 | 357 | for lnum, line in enumerate(llines) ]) |
|
358 | 358 | else: |
|
359 | 359 | out = self.prefilter_line(llines[0], continue_prompt) |
|
360 | 360 | |
|
361 | 361 | return out |
|
362 | 362 | |
|
363 | 363 | #----------------------------------------------------------------------------- |
|
364 | 364 | # Prefilter transformers |
|
365 | 365 | #----------------------------------------------------------------------------- |
|
366 | 366 | |
|
367 | 367 | |
|
368 | 368 | class PrefilterTransformer(Configurable): |
|
369 | 369 | """Transform a line of user input.""" |
|
370 | 370 | |
|
371 | 371 | priority = Integer(100, config=True) |
|
372 | 372 | # Transformers don't currently use shell or prefilter_manager, but as we |
|
373 | 373 | # move away from checkers and handlers, they will need them. |
|
374 | 374 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
375 | 375 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
376 | 376 | enabled = Bool(True, config=True) |
|
377 | 377 | |
|
378 | 378 | def __init__(self, shell=None, prefilter_manager=None, config=None): |
|
379 | 379 | super(PrefilterTransformer, self).__init__( |
|
380 | 380 | shell=shell, prefilter_manager=prefilter_manager, config=config |
|
381 | 381 | ) |
|
382 | 382 | self.prefilter_manager.register_transformer(self) |
|
383 | 383 | |
|
384 | 384 | def transform(self, line, continue_prompt): |
|
385 | 385 | """Transform a line, returning the new one.""" |
|
386 | 386 | return None |
|
387 | 387 | |
|
388 | 388 | def __repr__(self): |
|
389 | 389 | return "<%s(priority=%r, enabled=%r)>" % ( |
|
390 | 390 | self.__class__.__name__, self.priority, self.enabled) |
|
391 | 391 | |
|
392 | 392 | |
|
393 | 393 | _assign_system_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' |
|
394 | 394 | r'\s*=\s*!(?P<cmd>.*)') |
|
395 | 395 | |
|
396 | 396 | |
|
397 | 397 | class AssignSystemTransformer(PrefilterTransformer): |
|
398 | 398 | """Handle the `files = !ls` syntax.""" |
|
399 | 399 | |
|
400 | 400 | priority = Integer(100, config=True) |
|
401 | 401 | |
|
402 | 402 | def transform(self, line, continue_prompt): |
|
403 | 403 | m = _assign_system_re.match(line) |
|
404 | 404 | if m is not None: |
|
405 | 405 | cmd = m.group('cmd') |
|
406 | 406 | lhs = m.group('lhs') |
|
407 | 407 | expr = "sc =%s" % cmd |
|
408 | 408 | new_line = '%s = get_ipython().magic(%r)' % (lhs, expr) |
|
409 | 409 | return new_line |
|
410 | 410 | return line |
|
411 | 411 | |
|
412 | 412 | |
|
413 | 413 | _assign_magic_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' |
|
414 | 414 | r'\s*=\s*%(?P<cmd>.*)') |
|
415 | 415 | |
|
416 | 416 | class AssignMagicTransformer(PrefilterTransformer): |
|
417 | 417 | """Handle the `a = %who` syntax.""" |
|
418 | 418 | |
|
419 | 419 | priority = Integer(200, config=True) |
|
420 | 420 | |
|
421 | 421 | def transform(self, line, continue_prompt): |
|
422 | 422 | m = _assign_magic_re.match(line) |
|
423 | 423 | if m is not None: |
|
424 | 424 | cmd = m.group('cmd') |
|
425 | 425 | lhs = m.group('lhs') |
|
426 | 426 | new_line = '%s = get_ipython().magic(%r)' % (lhs, cmd) |
|
427 | 427 | return new_line |
|
428 | 428 | return line |
|
429 | 429 | |
|
430 | 430 | |
|
431 | 431 | _classic_prompt_re = re.compile(r'(^[ \t]*>>> |^[ \t]*\.\.\. )') |
|
432 | 432 | |
|
433 | 433 | class PyPromptTransformer(PrefilterTransformer): |
|
434 | 434 | """Handle inputs that start with '>>> ' syntax.""" |
|
435 | 435 | |
|
436 | 436 | priority = Integer(50, config=True) |
|
437 | 437 | |
|
438 | 438 | def transform(self, line, continue_prompt): |
|
439 | 439 | |
|
440 | 440 | if not line or line.isspace() or line.strip() == '...': |
|
441 | 441 | # This allows us to recognize multiple input prompts separated by |
|
442 | 442 | # blank lines and pasted in a single chunk, very common when |
|
443 | 443 | # pasting doctests or long tutorial passages. |
|
444 | 444 | return '' |
|
445 | 445 | m = _classic_prompt_re.match(line) |
|
446 | 446 | if m: |
|
447 | 447 | return line[len(m.group(0)):] |
|
448 | 448 | else: |
|
449 | 449 | return line |
|
450 | 450 | |
|
451 | 451 | |
|
452 | 452 | _ipy_prompt_re = re.compile(r'(^[ \t]*In \[\d+\]: |^[ \t]*\ \ \ \.\.\.+: )') |
|
453 | 453 | |
|
454 | 454 | class IPyPromptTransformer(PrefilterTransformer): |
|
455 | 455 | """Handle inputs that start classic IPython prompt syntax.""" |
|
456 | 456 | |
|
457 | 457 | priority = Integer(50, config=True) |
|
458 | 458 | |
|
459 | 459 | def transform(self, line, continue_prompt): |
|
460 | 460 | |
|
461 | 461 | if not line or line.isspace() or line.strip() == '...': |
|
462 | 462 | # This allows us to recognize multiple input prompts separated by |
|
463 | 463 | # blank lines and pasted in a single chunk, very common when |
|
464 | 464 | # pasting doctests or long tutorial passages. |
|
465 | 465 | return '' |
|
466 | 466 | m = _ipy_prompt_re.match(line) |
|
467 | 467 | if m: |
|
468 | 468 | return line[len(m.group(0)):] |
|
469 | 469 | else: |
|
470 | 470 | return line |
|
471 | 471 | |
|
472 | 472 | #----------------------------------------------------------------------------- |
|
473 | 473 | # Prefilter checkers |
|
474 | 474 | #----------------------------------------------------------------------------- |
|
475 | 475 | |
|
476 | 476 | |
|
477 | 477 | class PrefilterChecker(Configurable): |
|
478 | 478 | """Inspect an input line and return a handler for that line.""" |
|
479 | 479 | |
|
480 | 480 | priority = Integer(100, config=True) |
|
481 | 481 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
482 | 482 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
483 | 483 | enabled = Bool(True, config=True) |
|
484 | 484 | |
|
485 | 485 | def __init__(self, shell=None, prefilter_manager=None, config=None): |
|
486 | 486 | super(PrefilterChecker, self).__init__( |
|
487 | 487 | shell=shell, prefilter_manager=prefilter_manager, config=config |
|
488 | 488 | ) |
|
489 | 489 | self.prefilter_manager.register_checker(self) |
|
490 | 490 | |
|
491 | 491 | def check(self, line_info): |
|
492 | 492 | """Inspect line_info and return a handler instance or None.""" |
|
493 | 493 | return None |
|
494 | 494 | |
|
495 | 495 | def __repr__(self): |
|
496 | 496 | return "<%s(priority=%r, enabled=%r)>" % ( |
|
497 | 497 | self.__class__.__name__, self.priority, self.enabled) |
|
498 | 498 | |
|
499 | 499 | |
|
500 | 500 | class EmacsChecker(PrefilterChecker): |
|
501 | 501 | |
|
502 | 502 | priority = Integer(100, config=True) |
|
503 | 503 | enabled = Bool(False, config=True) |
|
504 | 504 | |
|
505 | 505 | def check(self, line_info): |
|
506 | 506 | "Emacs ipython-mode tags certain input lines." |
|
507 | 507 | if line_info.line.endswith('# PYTHON-MODE'): |
|
508 | 508 | return self.prefilter_manager.get_handler_by_name('emacs') |
|
509 | 509 | else: |
|
510 | 510 | return None |
|
511 | 511 | |
|
512 | 512 | |
|
513 | 513 | class ShellEscapeChecker(PrefilterChecker): |
|
514 | 514 | |
|
515 | 515 | priority = Integer(200, config=True) |
|
516 | 516 | |
|
517 | 517 | def check(self, line_info): |
|
518 | 518 | if line_info.line.lstrip().startswith(ESC_SHELL): |
|
519 | 519 | return self.prefilter_manager.get_handler_by_name('shell') |
|
520 | 520 | |
|
521 | 521 | |
|
522 | 522 | class MacroChecker(PrefilterChecker): |
|
523 | 523 | |
|
524 | 524 | priority = Integer(250, config=True) |
|
525 | 525 | |
|
526 | 526 | def check(self, line_info): |
|
527 | 527 | obj = self.shell.user_ns.get(line_info.ifun) |
|
528 | 528 | if isinstance(obj, Macro): |
|
529 | 529 | return self.prefilter_manager.get_handler_by_name('macro') |
|
530 | 530 | else: |
|
531 | 531 | return None |
|
532 | 532 | |
|
533 | 533 | |
|
534 | 534 | class IPyAutocallChecker(PrefilterChecker): |
|
535 | 535 | |
|
536 | 536 | priority = Integer(300, config=True) |
|
537 | 537 | |
|
538 | 538 | def check(self, line_info): |
|
539 | 539 | "Instances of IPyAutocall in user_ns get autocalled immediately" |
|
540 | 540 | obj = self.shell.user_ns.get(line_info.ifun, None) |
|
541 | 541 | if isinstance(obj, IPyAutocall): |
|
542 | 542 | obj.set_ip(self.shell) |
|
543 | 543 | return self.prefilter_manager.get_handler_by_name('auto') |
|
544 | 544 | else: |
|
545 | 545 | return None |
|
546 | 546 | |
|
547 | 547 | |
|
548 | 548 | class MultiLineMagicChecker(PrefilterChecker): |
|
549 | 549 | |
|
550 | 550 | priority = Integer(400, config=True) |
|
551 | 551 | |
|
552 | 552 | def check(self, line_info): |
|
553 | 553 | "Allow ! and !! in multi-line statements if multi_line_specials is on" |
|
554 | 554 | # Note that this one of the only places we check the first character of |
|
555 | 555 | # ifun and *not* the pre_char. Also note that the below test matches |
|
556 | 556 | # both ! and !!. |
|
557 | 557 | if line_info.continue_prompt \ |
|
558 | 558 | and self.prefilter_manager.multi_line_specials: |
|
559 | 559 | if line_info.esc == ESC_MAGIC: |
|
560 | 560 | return self.prefilter_manager.get_handler_by_name('magic') |
|
561 | 561 | else: |
|
562 | 562 | return None |
|
563 | 563 | |
|
564 | 564 | |
|
565 | 565 | class EscCharsChecker(PrefilterChecker): |
|
566 | 566 | |
|
567 | 567 | priority = Integer(500, config=True) |
|
568 | 568 | |
|
569 | 569 | def check(self, line_info): |
|
570 | 570 | """Check for escape character and return either a handler to handle it, |
|
571 | 571 | or None if there is no escape char.""" |
|
572 | 572 | if line_info.line[-1] == ESC_HELP \ |
|
573 | 573 | and line_info.esc != ESC_SHELL \ |
|
574 | 574 | and line_info.esc != ESC_SH_CAP: |
|
575 | 575 | # the ? can be at the end, but *not* for either kind of shell escape, |
|
576 | 576 | # because a ? can be a vaild final char in a shell cmd |
|
577 | 577 | return self.prefilter_manager.get_handler_by_name('help') |
|
578 | 578 | else: |
|
579 | 579 | if line_info.pre: |
|
580 | 580 | return None |
|
581 | 581 | # This returns None like it should if no handler exists |
|
582 | 582 | return self.prefilter_manager.get_handler_by_esc(line_info.esc) |
|
583 | 583 | |
|
584 | 584 | |
|
585 | 585 | class AssignmentChecker(PrefilterChecker): |
|
586 | 586 | |
|
587 | 587 | priority = Integer(600, config=True) |
|
588 | 588 | |
|
589 | 589 | def check(self, line_info): |
|
590 | 590 | """Check to see if user is assigning to a var for the first time, in |
|
591 | 591 | which case we want to avoid any sort of automagic / autocall games. |
|
592 | 592 | |
|
593 | 593 | This allows users to assign to either alias or magic names true python |
|
594 | 594 | variables (the magic/alias systems always take second seat to true |
|
595 | 595 | python code). E.g. ls='hi', or ls,that=1,2""" |
|
596 | 596 | if line_info.the_rest: |
|
597 | 597 | if line_info.the_rest[0] in '=,': |
|
598 | 598 | return self.prefilter_manager.get_handler_by_name('normal') |
|
599 | 599 | else: |
|
600 | 600 | return None |
|
601 | 601 | |
|
602 | 602 | |
|
603 | 603 | class AutoMagicChecker(PrefilterChecker): |
|
604 | 604 | |
|
605 | 605 | priority = Integer(700, config=True) |
|
606 | 606 | |
|
607 | 607 | def check(self, line_info): |
|
608 | 608 | """If the ifun is magic, and automagic is on, run it. Note: normal, |
|
609 | 609 | non-auto magic would already have been triggered via '%' in |
|
610 | 610 | check_esc_chars. This just checks for automagic. Also, before |
|
611 | 611 | triggering the magic handler, make sure that there is nothing in the |
|
612 | 612 | user namespace which could shadow it.""" |
|
613 | 613 | if not self.shell.automagic or not hasattr(self.shell,'magic_'+line_info.ifun): |
|
614 | 614 | return None |
|
615 | 615 | |
|
616 | 616 | # We have a likely magic method. Make sure we should actually call it. |
|
617 | 617 | if line_info.continue_prompt and not self.prefilter_manager.multi_line_specials: |
|
618 | 618 | return None |
|
619 | 619 | |
|
620 | 620 | head = line_info.ifun.split('.',1)[0] |
|
621 | 621 | if is_shadowed(head, self.shell): |
|
622 | 622 | return None |
|
623 | 623 | |
|
624 | 624 | return self.prefilter_manager.get_handler_by_name('magic') |
|
625 | 625 | |
|
626 | 626 | |
|
627 | 627 | class AliasChecker(PrefilterChecker): |
|
628 | 628 | |
|
629 | 629 | priority = Integer(800, config=True) |
|
630 | 630 | |
|
631 | 631 | def check(self, line_info): |
|
632 | 632 | "Check if the initital identifier on the line is an alias." |
|
633 | 633 | # Note: aliases can not contain '.' |
|
634 | 634 | head = line_info.ifun.split('.',1)[0] |
|
635 | 635 | if line_info.ifun not in self.shell.alias_manager \ |
|
636 | 636 | or head not in self.shell.alias_manager \ |
|
637 | 637 | or is_shadowed(head, self.shell): |
|
638 | 638 | return None |
|
639 | 639 | |
|
640 | 640 | return self.prefilter_manager.get_handler_by_name('alias') |
|
641 | 641 | |
|
642 | 642 | |
|
643 | 643 | class PythonOpsChecker(PrefilterChecker): |
|
644 | 644 | |
|
645 | 645 | priority = Integer(900, config=True) |
|
646 | 646 | |
|
647 | 647 | def check(self, line_info): |
|
648 | 648 | """If the 'rest' of the line begins with a function call or pretty much |
|
649 | 649 | any python operator, we should simply execute the line (regardless of |
|
650 | 650 | whether or not there's a possible autocall expansion). This avoids |
|
651 | 651 | spurious (and very confusing) geattr() accesses.""" |
|
652 | 652 | if line_info.the_rest and line_info.the_rest[0] in '!=()<>,+*/%^&|': |
|
653 | 653 | return self.prefilter_manager.get_handler_by_name('normal') |
|
654 | 654 | else: |
|
655 | 655 | return None |
|
656 | 656 | |
|
657 | 657 | |
|
658 | 658 | class AutocallChecker(PrefilterChecker): |
|
659 | 659 | |
|
660 | 660 | priority = Integer(1000, config=True) |
|
661 | 661 | |
|
662 | 662 | def check(self, line_info): |
|
663 | 663 | "Check if the initial word/function is callable and autocall is on." |
|
664 | 664 | if not self.shell.autocall: |
|
665 | 665 | return None |
|
666 | 666 | |
|
667 | 667 | oinfo = line_info.ofind(self.shell) # This can mutate state via getattr |
|
668 | 668 | if not oinfo['found']: |
|
669 | 669 | return None |
|
670 | 670 | |
|
671 | 671 | if callable(oinfo['obj']) \ |
|
672 | 672 | and (not re_exclude_auto.match(line_info.the_rest)) \ |
|
673 | 673 | and re_fun_name.match(line_info.ifun): |
|
674 | 674 | return self.prefilter_manager.get_handler_by_name('auto') |
|
675 | 675 | else: |
|
676 | 676 | return None |
|
677 | 677 | |
|
678 | 678 | |
|
679 | 679 | #----------------------------------------------------------------------------- |
|
680 | 680 | # Prefilter handlers |
|
681 | 681 | #----------------------------------------------------------------------------- |
|
682 | 682 | |
|
683 | 683 | |
|
684 | 684 | class PrefilterHandler(Configurable): |
|
685 | 685 | |
|
686 | 686 | handler_name = Unicode('normal') |
|
687 | 687 | esc_strings = List([]) |
|
688 | 688 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
689 | 689 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
690 | 690 | |
|
691 | 691 | def __init__(self, shell=None, prefilter_manager=None, config=None): |
|
692 | 692 | super(PrefilterHandler, self).__init__( |
|
693 | 693 | shell=shell, prefilter_manager=prefilter_manager, config=config |
|
694 | 694 | ) |
|
695 | 695 | self.prefilter_manager.register_handler( |
|
696 | 696 | self.handler_name, |
|
697 | 697 | self, |
|
698 | 698 | self.esc_strings |
|
699 | 699 | ) |
|
700 | 700 | |
|
701 | 701 | def handle(self, line_info): |
|
702 | 702 | # print "normal: ", line_info |
|
703 | 703 | """Handle normal input lines. Use as a template for handlers.""" |
|
704 | 704 | |
|
705 | 705 | # With autoindent on, we need some way to exit the input loop, and I |
|
706 | 706 | # don't want to force the user to have to backspace all the way to |
|
707 | 707 | # clear the line. The rule will be in this case, that either two |
|
708 | 708 | # lines of pure whitespace in a row, or a line of pure whitespace but |
|
709 | 709 | # of a size different to the indent level, will exit the input loop. |
|
710 | 710 | line = line_info.line |
|
711 | 711 | continue_prompt = line_info.continue_prompt |
|
712 | 712 | |
|
713 | 713 | if (continue_prompt and |
|
714 | 714 | self.shell.autoindent and |
|
715 | 715 | line.isspace() and |
|
716 | 716 | 0 < abs(len(line) - self.shell.indent_current_nsp) <= 2): |
|
717 | 717 | line = '' |
|
718 | 718 | |
|
719 | 719 | return line |
|
720 | 720 | |
|
721 | 721 | def __str__(self): |
|
722 | 722 | return "<%s(name=%s)>" % (self.__class__.__name__, self.handler_name) |
|
723 | 723 | |
|
724 | 724 | |
|
725 | 725 | class AliasHandler(PrefilterHandler): |
|
726 | 726 | |
|
727 | 727 | handler_name = Unicode('alias') |
|
728 | 728 | |
|
729 | 729 | def handle(self, line_info): |
|
730 | 730 | """Handle alias input lines. """ |
|
731 | 731 | transformed = self.shell.alias_manager.expand_aliases(line_info.ifun,line_info.the_rest) |
|
732 | 732 | # pre is needed, because it carries the leading whitespace. Otherwise |
|
733 | 733 | # aliases won't work in indented sections. |
|
734 | 734 | line_out = '%sget_ipython().system(%r)' % (line_info.pre_whitespace, transformed) |
|
735 | 735 | |
|
736 | 736 | return line_out |
|
737 | 737 | |
|
738 | 738 | |
|
739 | 739 | class ShellEscapeHandler(PrefilterHandler): |
|
740 | 740 | |
|
741 | 741 | handler_name = Unicode('shell') |
|
742 | 742 | esc_strings = List([ESC_SHELL, ESC_SH_CAP]) |
|
743 | 743 | |
|
744 | 744 | def handle(self, line_info): |
|
745 | 745 | """Execute the line in a shell, empty return value""" |
|
746 | 746 | magic_handler = self.prefilter_manager.get_handler_by_name('magic') |
|
747 | 747 | |
|
748 | 748 | line = line_info.line |
|
749 | 749 | if line.lstrip().startswith(ESC_SH_CAP): |
|
750 | 750 | # rewrite LineInfo's line, ifun and the_rest to properly hold the |
|
751 | 751 | # call to %sx and the actual command to be executed, so |
|
752 | 752 | # handle_magic can work correctly. Note that this works even if |
|
753 | 753 | # the line is indented, so it handles multi_line_specials |
|
754 | 754 | # properly. |
|
755 | 755 | new_rest = line.lstrip()[2:] |
|
756 | 756 | line_info.line = '%ssx %s' % (ESC_MAGIC, new_rest) |
|
757 | 757 | line_info.ifun = 'sx' |
|
758 | 758 | line_info.the_rest = new_rest |
|
759 | 759 | return magic_handler.handle(line_info) |
|
760 | 760 | else: |
|
761 | 761 | cmd = line.lstrip().lstrip(ESC_SHELL) |
|
762 | 762 | line_out = '%sget_ipython().system(%r)' % (line_info.pre_whitespace, cmd) |
|
763 | 763 | return line_out |
|
764 | 764 | |
|
765 | 765 | |
|
766 | 766 | class MacroHandler(PrefilterHandler): |
|
767 | 767 | handler_name = Unicode("macro") |
|
768 | 768 | |
|
769 | 769 | def handle(self, line_info): |
|
770 | 770 | obj = self.shell.user_ns.get(line_info.ifun) |
|
771 | 771 | pre_space = line_info.pre_whitespace |
|
772 | 772 | line_sep = "\n" + pre_space |
|
773 | 773 | return pre_space + line_sep.join(obj.value.splitlines()) |
|
774 | 774 | |
|
775 | 775 | |
|
776 | 776 | class MagicHandler(PrefilterHandler): |
|
777 | 777 | |
|
778 | 778 | handler_name = Unicode('magic') |
|
779 | 779 | esc_strings = List([ESC_MAGIC]) |
|
780 | 780 | |
|
781 | 781 | def handle(self, line_info): |
|
782 | 782 | """Execute magic functions.""" |
|
783 | 783 | ifun = line_info.ifun |
|
784 | 784 | the_rest = line_info.the_rest |
|
785 | 785 | cmd = '%sget_ipython().magic(%r)' % (line_info.pre_whitespace, |
|
786 | 786 | (ifun + " " + the_rest)) |
|
787 | 787 | return cmd |
|
788 | 788 | |
|
789 | 789 | |
|
790 | 790 | class AutoHandler(PrefilterHandler): |
|
791 | 791 | |
|
792 | 792 | handler_name = Unicode('auto') |
|
793 | 793 | esc_strings = List([ESC_PAREN, ESC_QUOTE, ESC_QUOTE2]) |
|
794 | 794 | |
|
795 | 795 | def handle(self, line_info): |
|
796 | 796 | """Handle lines which can be auto-executed, quoting if requested.""" |
|
797 | 797 | line = line_info.line |
|
798 | 798 | ifun = line_info.ifun |
|
799 | 799 | the_rest = line_info.the_rest |
|
800 | 800 | pre = line_info.pre |
|
801 | 801 | esc = line_info.esc |
|
802 | 802 | continue_prompt = line_info.continue_prompt |
|
803 | 803 | obj = line_info.ofind(self)['obj'] |
|
804 | 804 | #print 'pre <%s> ifun <%s> rest <%s>' % (pre,ifun,the_rest) # dbg |
|
805 | 805 | |
|
806 | 806 | # This should only be active for single-line input! |
|
807 | 807 | if continue_prompt: |
|
808 | 808 | return line |
|
809 | 809 | |
|
810 | 810 | force_auto = isinstance(obj, IPyAutocall) |
|
811 | 811 | |
|
812 | 812 | # User objects sometimes raise exceptions on attribute access other |
|
813 | 813 | # than AttributeError (we've seen it in the past), so it's safest to be |
|
814 | 814 | # ultra-conservative here and catch all. |
|
815 | 815 | try: |
|
816 | 816 | auto_rewrite = obj.rewrite |
|
817 | 817 | except Exception: |
|
818 | 818 | auto_rewrite = True |
|
819 | 819 | |
|
820 | 820 | if esc == ESC_QUOTE: |
|
821 | 821 | # Auto-quote splitting on whitespace |
|
822 | 822 | newcmd = '%s("%s")' % (ifun,'", "'.join(the_rest.split()) ) |
|
823 | 823 | elif esc == ESC_QUOTE2: |
|
824 | 824 | # Auto-quote whole string |
|
825 | 825 | newcmd = '%s("%s")' % (ifun,the_rest) |
|
826 | 826 | elif esc == ESC_PAREN: |
|
827 | 827 | newcmd = '%s(%s)' % (ifun,",".join(the_rest.split())) |
|
828 | 828 | else: |
|
829 | 829 | # Auto-paren. |
|
830 | 830 | # We only apply it to argument-less calls if the autocall |
|
831 | 831 | # parameter is set to 2. We only need to check that autocall is < |
|
832 | 832 | # 2, since this function isn't called unless it's at least 1. |
|
833 | 833 | if not the_rest and (self.shell.autocall < 2) and not force_auto: |
|
834 | 834 | newcmd = '%s %s' % (ifun,the_rest) |
|
835 | 835 | auto_rewrite = False |
|
836 | 836 | else: |
|
837 | 837 | if not force_auto and the_rest.startswith('['): |
|
838 | 838 | if hasattr(obj,'__getitem__'): |
|
839 | 839 | # Don't autocall in this case: item access for an object |
|
840 | 840 | # which is BOTH callable and implements __getitem__. |
|
841 | 841 | newcmd = '%s %s' % (ifun,the_rest) |
|
842 | 842 | auto_rewrite = False |
|
843 | 843 | else: |
|
844 | 844 | # if the object doesn't support [] access, go ahead and |
|
845 | 845 | # autocall |
|
846 | 846 | newcmd = '%s(%s)' % (ifun.rstrip(),the_rest) |
|
847 | 847 | elif the_rest.endswith(';'): |
|
848 | 848 | newcmd = '%s(%s);' % (ifun.rstrip(),the_rest[:-1]) |
|
849 | 849 | else: |
|
850 | 850 | newcmd = '%s(%s)' % (ifun.rstrip(), the_rest) |
|
851 | 851 | |
|
852 | 852 | if auto_rewrite: |
|
853 | 853 | self.shell.auto_rewrite_input(newcmd) |
|
854 | 854 | |
|
855 | 855 | return newcmd |
|
856 | 856 | |
|
857 | 857 | |
|
858 | 858 | class HelpHandler(PrefilterHandler): |
|
859 | 859 | |
|
860 | 860 | handler_name = Unicode('help') |
|
861 | 861 | esc_strings = List([ESC_HELP]) |
|
862 | 862 | |
|
863 | 863 | def handle(self, line_info): |
|
864 | 864 | """Try to get some help for the object. |
|
865 | 865 | |
|
866 | 866 | obj? or ?obj -> basic information. |
|
867 | 867 | obj?? or ??obj -> more details. |
|
868 | 868 | """ |
|
869 | 869 | normal_handler = self.prefilter_manager.get_handler_by_name('normal') |
|
870 | 870 | line = line_info.line |
|
871 | 871 | # We need to make sure that we don't process lines which would be |
|
872 | 872 | # otherwise valid python, such as "x=1 # what?" |
|
873 | 873 | try: |
|
874 | 874 | codeop.compile_command(line) |
|
875 | 875 | except SyntaxError: |
|
876 | 876 | # We should only handle as help stuff which is NOT valid syntax |
|
877 | 877 | if line[0]==ESC_HELP: |
|
878 | 878 | line = line[1:] |
|
879 | 879 | elif line[-1]==ESC_HELP: |
|
880 | 880 | line = line[:-1] |
|
881 | 881 | if line: |
|
882 | 882 | #print 'line:<%r>' % line # dbg |
|
883 | 883 | self.shell.magic_pinfo(line_info.ifun) |
|
884 | 884 | else: |
|
885 | 885 | self.shell.show_usage() |
|
886 | 886 | return '' # Empty string is needed here! |
|
887 | 887 | except: |
|
888 | 888 | raise |
|
889 | 889 | # Pass any other exceptions through to the normal handler |
|
890 | 890 | return normal_handler.handle(line_info) |
|
891 | 891 | else: |
|
892 | 892 | # If the code compiles ok, we should handle it normally |
|
893 | 893 | return normal_handler.handle(line_info) |
|
894 | 894 | |
|
895 | 895 | |
|
896 | 896 | class EmacsHandler(PrefilterHandler): |
|
897 | 897 | |
|
898 | 898 | handler_name = Unicode('emacs') |
|
899 | 899 | esc_strings = List([]) |
|
900 | 900 | |
|
901 | 901 | def handle(self, line_info): |
|
902 | 902 | """Handle input lines marked by python-mode.""" |
|
903 | 903 | |
|
904 | 904 | # Currently, nothing is done. Later more functionality can be added |
|
905 | 905 | # here if needed. |
|
906 | 906 | |
|
907 | 907 | # The input cache shouldn't be updated |
|
908 | 908 | return line_info.line |
|
909 | 909 | |
|
910 | 910 | |
|
911 | 911 | #----------------------------------------------------------------------------- |
|
912 | 912 | # Defaults |
|
913 | 913 | #----------------------------------------------------------------------------- |
|
914 | 914 | |
|
915 | 915 | |
|
916 | 916 | _default_transformers = [ |
|
917 | 917 | AssignSystemTransformer, |
|
918 | 918 | AssignMagicTransformer, |
|
919 | 919 | PyPromptTransformer, |
|
920 | 920 | IPyPromptTransformer, |
|
921 | 921 | ] |
|
922 | 922 | |
|
923 | 923 | _default_checkers = [ |
|
924 | 924 | EmacsChecker, |
|
925 | 925 | ShellEscapeChecker, |
|
926 | 926 | MacroChecker, |
|
927 | 927 | IPyAutocallChecker, |
|
928 | 928 | MultiLineMagicChecker, |
|
929 | 929 | EscCharsChecker, |
|
930 | 930 | AssignmentChecker, |
|
931 | 931 | AutoMagicChecker, |
|
932 | 932 | AliasChecker, |
|
933 | 933 | PythonOpsChecker, |
|
934 | 934 | AutocallChecker |
|
935 | 935 | ] |
|
936 | 936 | |
|
937 | 937 | _default_handlers = [ |
|
938 | 938 | PrefilterHandler, |
|
939 | 939 | AliasHandler, |
|
940 | 940 | ShellEscapeHandler, |
|
941 | 941 | MacroHandler, |
|
942 | 942 | MagicHandler, |
|
943 | 943 | AutoHandler, |
|
944 | 944 | HelpHandler, |
|
945 | 945 | EmacsHandler |
|
946 | 946 | ] |
@@ -1,436 +1,436 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Classes for handling input/output prompts. |
|
3 | 3 | |
|
4 | 4 | Authors: |
|
5 | 5 | |
|
6 | 6 | * Fernando Perez |
|
7 | 7 | * Brian Granger |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 |
# Copyright (C) 2008-201 |
|
|
11 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
12 | 12 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> |
|
13 | 13 | # |
|
14 | 14 | # Distributed under the terms of the BSD License. The full license is in |
|
15 | 15 | # the file COPYING, distributed as part of this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | import os |
|
23 | 23 | import re |
|
24 | 24 | import socket |
|
25 | 25 | import sys |
|
26 | 26 | |
|
27 | 27 | from IPython.core import release |
|
28 | 28 | from IPython.external.Itpl import ItplNS |
|
29 | 29 | from IPython.utils import coloransi |
|
30 | 30 | |
|
31 | 31 | #----------------------------------------------------------------------------- |
|
32 | 32 | # Color schemes for prompts |
|
33 | 33 | #----------------------------------------------------------------------------- |
|
34 | 34 | |
|
35 | 35 | PromptColors = coloransi.ColorSchemeTable() |
|
36 | 36 | InputColors = coloransi.InputTermColors # just a shorthand |
|
37 | 37 | Colors = coloransi.TermColors # just a shorthand |
|
38 | 38 | |
|
39 | 39 | PromptColors.add_scheme(coloransi.ColorScheme( |
|
40 | 40 | 'NoColor', |
|
41 | 41 | in_prompt = InputColors.NoColor, # Input prompt |
|
42 | 42 | in_number = InputColors.NoColor, # Input prompt number |
|
43 | 43 | in_prompt2 = InputColors.NoColor, # Continuation prompt |
|
44 | 44 | in_normal = InputColors.NoColor, # color off (usu. Colors.Normal) |
|
45 | 45 | |
|
46 | 46 | out_prompt = Colors.NoColor, # Output prompt |
|
47 | 47 | out_number = Colors.NoColor, # Output prompt number |
|
48 | 48 | |
|
49 | 49 | normal = Colors.NoColor # color off (usu. Colors.Normal) |
|
50 | 50 | )) |
|
51 | 51 | |
|
52 | 52 | # make some schemes as instances so we can copy them for modification easily: |
|
53 | 53 | __PColLinux = coloransi.ColorScheme( |
|
54 | 54 | 'Linux', |
|
55 | 55 | in_prompt = InputColors.Green, |
|
56 | 56 | in_number = InputColors.LightGreen, |
|
57 | 57 | in_prompt2 = InputColors.Green, |
|
58 | 58 | in_normal = InputColors.Normal, # color off (usu. Colors.Normal) |
|
59 | 59 | |
|
60 | 60 | out_prompt = Colors.Red, |
|
61 | 61 | out_number = Colors.LightRed, |
|
62 | 62 | |
|
63 | 63 | normal = Colors.Normal |
|
64 | 64 | ) |
|
65 | 65 | # Don't forget to enter it into the table! |
|
66 | 66 | PromptColors.add_scheme(__PColLinux) |
|
67 | 67 | |
|
68 | 68 | # Slightly modified Linux for light backgrounds |
|
69 | 69 | __PColLightBG = __PColLinux.copy('LightBG') |
|
70 | 70 | |
|
71 | 71 | __PColLightBG.colors.update( |
|
72 | 72 | in_prompt = InputColors.Blue, |
|
73 | 73 | in_number = InputColors.LightBlue, |
|
74 | 74 | in_prompt2 = InputColors.Blue |
|
75 | 75 | ) |
|
76 | 76 | PromptColors.add_scheme(__PColLightBG) |
|
77 | 77 | |
|
78 | 78 | del Colors,InputColors |
|
79 | 79 | |
|
80 | 80 | #----------------------------------------------------------------------------- |
|
81 | 81 | # Utilities |
|
82 | 82 | #----------------------------------------------------------------------------- |
|
83 | 83 | |
|
84 | 84 | def multiple_replace(dict, text): |
|
85 | 85 | """ Replace in 'text' all occurences of any key in the given |
|
86 | 86 | dictionary by its corresponding value. Returns the new string.""" |
|
87 | 87 | |
|
88 | 88 | # Function by Xavier Defrang, originally found at: |
|
89 | 89 | # http://aspn.activestate.com/ASPN/Cookbook/Python/Recipe/81330 |
|
90 | 90 | |
|
91 | 91 | # Create a regular expression from the dictionary keys |
|
92 | 92 | regex = re.compile("(%s)" % "|".join(map(re.escape, dict.keys()))) |
|
93 | 93 | # For each match, look-up corresponding value in dictionary |
|
94 | 94 | return regex.sub(lambda mo: dict[mo.string[mo.start():mo.end()]], text) |
|
95 | 95 | |
|
96 | 96 | #----------------------------------------------------------------------------- |
|
97 | 97 | # Special characters that can be used in prompt templates, mainly bash-like |
|
98 | 98 | #----------------------------------------------------------------------------- |
|
99 | 99 | |
|
100 | 100 | # If $HOME isn't defined (Windows), make it an absurd string so that it can |
|
101 | 101 | # never be expanded out into '~'. Basically anything which can never be a |
|
102 | 102 | # reasonable directory name will do, we just want the $HOME -> '~' operation |
|
103 | 103 | # to become a no-op. We pre-compute $HOME here so it's not done on every |
|
104 | 104 | # prompt call. |
|
105 | 105 | |
|
106 | 106 | # FIXME: |
|
107 | 107 | |
|
108 | 108 | # - This should be turned into a class which does proper namespace management, |
|
109 | 109 | # since the prompt specials need to be evaluated in a certain namespace. |
|
110 | 110 | # Currently it's just globals, which need to be managed manually by code |
|
111 | 111 | # below. |
|
112 | 112 | |
|
113 | 113 | # - I also need to split up the color schemes from the prompt specials |
|
114 | 114 | # somehow. I don't have a clean design for that quite yet. |
|
115 | 115 | |
|
116 | 116 | HOME = os.environ.get("HOME","//////:::::ZZZZZ,,,~~~") |
|
117 | 117 | |
|
118 | 118 | # We precompute a few more strings here for the prompt_specials, which are |
|
119 | 119 | # fixed once ipython starts. This reduces the runtime overhead of computing |
|
120 | 120 | # prompt strings. |
|
121 | 121 | USER = os.environ.get("USER") |
|
122 | 122 | HOSTNAME = socket.gethostname() |
|
123 | 123 | HOSTNAME_SHORT = HOSTNAME.split(".")[0] |
|
124 | 124 | ROOT_SYMBOL = "$#"[os.name=='nt' or os.getuid()==0] |
|
125 | 125 | |
|
126 | 126 | prompt_specials_color = { |
|
127 | 127 | # Prompt/history count |
|
128 | 128 | '%n' : '${self.col_num}' '${self.cache.prompt_count}' '${self.col_p}', |
|
129 | 129 | r'\#': '${self.col_num}' '${self.cache.prompt_count}' '${self.col_p}', |
|
130 | 130 | # Just the prompt counter number, WITHOUT any coloring wrappers, so users |
|
131 | 131 | # can get numbers displayed in whatever color they want. |
|
132 | 132 | r'\N': '${self.cache.prompt_count}', |
|
133 | 133 | |
|
134 | 134 | # Prompt/history count, with the actual digits replaced by dots. Used |
|
135 | 135 | # mainly in continuation prompts (prompt_in2) |
|
136 | 136 | #r'\D': '${"."*len(str(self.cache.prompt_count))}', |
|
137 | 137 | |
|
138 | 138 | # More robust form of the above expression, that uses the __builtin__ |
|
139 | 139 | # module. Note that we can NOT use __builtins__ (note the 's'), because |
|
140 | 140 | # that can either be a dict or a module, and can even mutate at runtime, |
|
141 | 141 | # depending on the context (Python makes no guarantees on it). In |
|
142 | 142 | # contrast, __builtin__ is always a module object, though it must be |
|
143 | 143 | # explicitly imported. |
|
144 | 144 | r'\D': '${"."*__builtin__.len(__builtin__.str(self.cache.prompt_count))}', |
|
145 | 145 | |
|
146 | 146 | # Current working directory |
|
147 | 147 | r'\w': '${os.getcwd()}', |
|
148 | 148 | # Current time |
|
149 | 149 | r'\t' : '${time.strftime("%H:%M:%S")}', |
|
150 | 150 | # Basename of current working directory. |
|
151 | 151 | # (use os.sep to make this portable across OSes) |
|
152 | 152 | r'\W' : '${os.getcwd().split("%s")[-1]}' % os.sep, |
|
153 | 153 | # These X<N> are an extension to the normal bash prompts. They return |
|
154 | 154 | # N terms of the path, after replacing $HOME with '~' |
|
155 | 155 | r'\X0': '${os.getcwd().replace("%s","~")}' % HOME, |
|
156 | 156 | r'\X1': '${self.cwd_filt(1)}', |
|
157 | 157 | r'\X2': '${self.cwd_filt(2)}', |
|
158 | 158 | r'\X3': '${self.cwd_filt(3)}', |
|
159 | 159 | r'\X4': '${self.cwd_filt(4)}', |
|
160 | 160 | r'\X5': '${self.cwd_filt(5)}', |
|
161 | 161 | # Y<N> are similar to X<N>, but they show '~' if it's the directory |
|
162 | 162 | # N+1 in the list. Somewhat like %cN in tcsh. |
|
163 | 163 | r'\Y0': '${self.cwd_filt2(0)}', |
|
164 | 164 | r'\Y1': '${self.cwd_filt2(1)}', |
|
165 | 165 | r'\Y2': '${self.cwd_filt2(2)}', |
|
166 | 166 | r'\Y3': '${self.cwd_filt2(3)}', |
|
167 | 167 | r'\Y4': '${self.cwd_filt2(4)}', |
|
168 | 168 | r'\Y5': '${self.cwd_filt2(5)}', |
|
169 | 169 | # Hostname up to first . |
|
170 | 170 | r'\h': HOSTNAME_SHORT, |
|
171 | 171 | # Full hostname |
|
172 | 172 | r'\H': HOSTNAME, |
|
173 | 173 | # Username of current user |
|
174 | 174 | r'\u': USER, |
|
175 | 175 | # Escaped '\' |
|
176 | 176 | '\\\\': '\\', |
|
177 | 177 | # Newline |
|
178 | 178 | r'\n': '\n', |
|
179 | 179 | # Carriage return |
|
180 | 180 | r'\r': '\r', |
|
181 | 181 | # Release version |
|
182 | 182 | r'\v': release.version, |
|
183 | 183 | # Root symbol ($ or #) |
|
184 | 184 | r'\$': ROOT_SYMBOL, |
|
185 | 185 | } |
|
186 | 186 | |
|
187 | 187 | # A copy of the prompt_specials dictionary but with all color escapes removed, |
|
188 | 188 | # so we can correctly compute the prompt length for the auto_rewrite method. |
|
189 | 189 | prompt_specials_nocolor = prompt_specials_color.copy() |
|
190 | 190 | prompt_specials_nocolor['%n'] = '${self.cache.prompt_count}' |
|
191 | 191 | prompt_specials_nocolor[r'\#'] = '${self.cache.prompt_count}' |
|
192 | 192 | |
|
193 | 193 | # Add in all the InputTermColors color escapes as valid prompt characters. |
|
194 | 194 | # They all get added as \\C_COLORNAME, so that we don't have any conflicts |
|
195 | 195 | # with a color name which may begin with a letter used by any other of the |
|
196 | 196 | # allowed specials. This of course means that \\C will never be allowed for |
|
197 | 197 | # anything else. |
|
198 | 198 | input_colors = coloransi.InputTermColors |
|
199 | 199 | for _color in dir(input_colors): |
|
200 | 200 | if _color[0] != '_': |
|
201 | 201 | c_name = r'\C_'+_color |
|
202 | 202 | prompt_specials_color[c_name] = getattr(input_colors,_color) |
|
203 | 203 | prompt_specials_nocolor[c_name] = '' |
|
204 | 204 | |
|
205 | 205 | # we default to no color for safety. Note that prompt_specials is a global |
|
206 | 206 | # variable used by all prompt objects. |
|
207 | 207 | prompt_specials = prompt_specials_nocolor |
|
208 | 208 | |
|
209 | 209 | #----------------------------------------------------------------------------- |
|
210 | 210 | # More utilities |
|
211 | 211 | #----------------------------------------------------------------------------- |
|
212 | 212 | |
|
213 | 213 | def str_safe(arg): |
|
214 | 214 | """Convert to a string, without ever raising an exception. |
|
215 | 215 | |
|
216 | 216 | If str(arg) fails, <ERROR: ... > is returned, where ... is the exception |
|
217 | 217 | error message.""" |
|
218 | 218 | |
|
219 | 219 | try: |
|
220 | 220 | out = str(arg) |
|
221 | 221 | except UnicodeError: |
|
222 | 222 | try: |
|
223 | 223 | out = arg.encode('utf_8','replace') |
|
224 | 224 | except Exception,msg: |
|
225 | 225 | # let's keep this little duplication here, so that the most common |
|
226 | 226 | # case doesn't suffer from a double try wrapping. |
|
227 | 227 | out = '<ERROR: %s>' % msg |
|
228 | 228 | except Exception,msg: |
|
229 | 229 | out = '<ERROR: %s>' % msg |
|
230 | 230 | #raise # dbg |
|
231 | 231 | return out |
|
232 | 232 | |
|
233 | 233 | #----------------------------------------------------------------------------- |
|
234 | 234 | # Prompt classes |
|
235 | 235 | #----------------------------------------------------------------------------- |
|
236 | 236 | |
|
237 | 237 | class BasePrompt(object): |
|
238 | 238 | """Interactive prompt similar to Mathematica's.""" |
|
239 | 239 | |
|
240 | 240 | def _get_p_template(self): |
|
241 | 241 | return self._p_template |
|
242 | 242 | |
|
243 | 243 | def _set_p_template(self,val): |
|
244 | 244 | self._p_template = val |
|
245 | 245 | self.set_p_str() |
|
246 | 246 | |
|
247 | 247 | p_template = property(_get_p_template,_set_p_template, |
|
248 | 248 | doc='Template for prompt string creation') |
|
249 | 249 | |
|
250 | 250 | def __init__(self, cache, sep, prompt, pad_left=False): |
|
251 | 251 | |
|
252 | 252 | # Hack: we access information about the primary prompt through the |
|
253 | 253 | # cache argument. We need this, because we want the secondary prompt |
|
254 | 254 | # to be aligned with the primary one. Color table info is also shared |
|
255 | 255 | # by all prompt classes through the cache. Nice OO spaghetti code! |
|
256 | 256 | self.cache = cache |
|
257 | 257 | self.sep = sep |
|
258 | 258 | |
|
259 | 259 | # regexp to count the number of spaces at the end of a prompt |
|
260 | 260 | # expression, useful for prompt auto-rewriting |
|
261 | 261 | self.rspace = re.compile(r'(\s*)$') |
|
262 | 262 | # Flag to left-pad prompt strings to match the length of the primary |
|
263 | 263 | # prompt |
|
264 | 264 | self.pad_left = pad_left |
|
265 | 265 | |
|
266 | 266 | # Set template to create each actual prompt (where numbers change). |
|
267 | 267 | # Use a property |
|
268 | 268 | self.p_template = prompt |
|
269 | 269 | self.set_p_str() |
|
270 | 270 | |
|
271 | 271 | def set_p_str(self): |
|
272 | 272 | """ Set the interpolating prompt strings. |
|
273 | 273 | |
|
274 | 274 | This must be called every time the color settings change, because the |
|
275 | 275 | prompt_specials global may have changed.""" |
|
276 | 276 | |
|
277 | 277 | import os,time # needed in locals for prompt string handling |
|
278 | 278 | loc = locals() |
|
279 | 279 | try: |
|
280 | 280 | self.p_str = ItplNS('%s%s%s' % |
|
281 | 281 | ('${self.sep}${self.col_p}', |
|
282 | 282 | multiple_replace(prompt_specials, self.p_template), |
|
283 | 283 | '${self.col_norm}'),self.cache.shell.user_ns,loc) |
|
284 | 284 | |
|
285 | 285 | self.p_str_nocolor = ItplNS(multiple_replace(prompt_specials_nocolor, |
|
286 | 286 | self.p_template), |
|
287 | 287 | self.cache.shell.user_ns,loc) |
|
288 | 288 | except: |
|
289 | 289 | print "Illegal prompt template (check $ usage!):",self.p_template |
|
290 | 290 | self.p_str = self.p_template |
|
291 | 291 | self.p_str_nocolor = self.p_template |
|
292 | 292 | |
|
293 | 293 | def write(self, msg): |
|
294 | 294 | sys.stdout.write(msg) |
|
295 | 295 | return '' |
|
296 | 296 | |
|
297 | 297 | def __str__(self): |
|
298 | 298 | """Return a string form of the prompt. |
|
299 | 299 | |
|
300 | 300 | This for is useful for continuation and output prompts, since it is |
|
301 | 301 | left-padded to match lengths with the primary one (if the |
|
302 | 302 | self.pad_left attribute is set).""" |
|
303 | 303 | |
|
304 | 304 | out_str = str_safe(self.p_str) |
|
305 | 305 | if self.pad_left: |
|
306 | 306 | # We must find the amount of padding required to match lengths, |
|
307 | 307 | # taking the color escapes (which are invisible on-screen) into |
|
308 | 308 | # account. |
|
309 | 309 | esc_pad = len(out_str) - len(str_safe(self.p_str_nocolor)) |
|
310 | 310 | format = '%%%ss' % (len(str(self.cache.last_prompt))+esc_pad) |
|
311 | 311 | return format % out_str |
|
312 | 312 | else: |
|
313 | 313 | return out_str |
|
314 | 314 | |
|
315 | 315 | # these path filters are put in as methods so that we can control the |
|
316 | 316 | # namespace where the prompt strings get evaluated |
|
317 | 317 | def cwd_filt(self, depth): |
|
318 | 318 | """Return the last depth elements of the current working directory. |
|
319 | 319 | |
|
320 | 320 | $HOME is always replaced with '~'. |
|
321 | 321 | If depth==0, the full path is returned.""" |
|
322 | 322 | |
|
323 | 323 | cwd = os.getcwd().replace(HOME,"~") |
|
324 | 324 | out = os.sep.join(cwd.split(os.sep)[-depth:]) |
|
325 | 325 | if out: |
|
326 | 326 | return out |
|
327 | 327 | else: |
|
328 | 328 | return os.sep |
|
329 | 329 | |
|
330 | 330 | def cwd_filt2(self, depth): |
|
331 | 331 | """Return the last depth elements of the current working directory. |
|
332 | 332 | |
|
333 | 333 | $HOME is always replaced with '~'. |
|
334 | 334 | If depth==0, the full path is returned.""" |
|
335 | 335 | |
|
336 | 336 | full_cwd = os.getcwd() |
|
337 | 337 | cwd = full_cwd.replace(HOME,"~").split(os.sep) |
|
338 | 338 | if '~' in cwd and len(cwd) == depth+1: |
|
339 | 339 | depth += 1 |
|
340 | 340 | drivepart = '' |
|
341 | 341 | if sys.platform == 'win32' and len(cwd) > depth: |
|
342 | 342 | drivepart = os.path.splitdrive(full_cwd)[0] |
|
343 | 343 | out = drivepart + '/'.join(cwd[-depth:]) |
|
344 | 344 | |
|
345 | 345 | if out: |
|
346 | 346 | return out |
|
347 | 347 | else: |
|
348 | 348 | return os.sep |
|
349 | 349 | |
|
350 | 350 | def __nonzero__(self): |
|
351 | 351 | """Implement boolean behavior. |
|
352 | 352 | |
|
353 | 353 | Checks whether the p_str attribute is non-empty""" |
|
354 | 354 | |
|
355 | 355 | return bool(self.p_template) |
|
356 | 356 | |
|
357 | 357 | |
|
358 | 358 | class Prompt1(BasePrompt): |
|
359 | 359 | """Input interactive prompt similar to Mathematica's.""" |
|
360 | 360 | |
|
361 | 361 | def __init__(self, cache, sep='\n', prompt='In [\\#]: ', pad_left=True): |
|
362 | 362 | BasePrompt.__init__(self, cache, sep, prompt, pad_left) |
|
363 | 363 | |
|
364 | 364 | def set_colors(self): |
|
365 | 365 | self.set_p_str() |
|
366 | 366 | Colors = self.cache.color_table.active_colors # shorthand |
|
367 | 367 | self.col_p = Colors.in_prompt |
|
368 | 368 | self.col_num = Colors.in_number |
|
369 | 369 | self.col_norm = Colors.in_normal |
|
370 | 370 | # We need a non-input version of these escapes for the '--->' |
|
371 | 371 | # auto-call prompts used in the auto_rewrite() method. |
|
372 | 372 | self.col_p_ni = self.col_p.replace('\001','').replace('\002','') |
|
373 | 373 | self.col_norm_ni = Colors.normal |
|
374 | 374 | |
|
375 | 375 | def __str__(self): |
|
376 | 376 | self.cache.last_prompt = str_safe(self.p_str_nocolor).split('\n')[-1] |
|
377 | 377 | return str_safe(self.p_str) |
|
378 | 378 | |
|
379 | 379 | def auto_rewrite(self): |
|
380 | 380 | """Return a string of the form '--->' which lines up with the previous |
|
381 | 381 | input string. Useful for systems which re-write the user input when |
|
382 | 382 | handling automatically special syntaxes.""" |
|
383 | 383 | |
|
384 | 384 | curr = str(self.cache.last_prompt) |
|
385 | 385 | nrspaces = len(self.rspace.search(curr).group()) |
|
386 | 386 | return '%s%s>%s%s' % (self.col_p_ni,'-'*(len(curr)-nrspaces-1), |
|
387 | 387 | ' '*nrspaces,self.col_norm_ni) |
|
388 | 388 | |
|
389 | 389 | |
|
390 | 390 | class PromptOut(BasePrompt): |
|
391 | 391 | """Output interactive prompt similar to Mathematica's.""" |
|
392 | 392 | |
|
393 | 393 | def __init__(self, cache, sep='', prompt='Out[\\#]: ', pad_left=True): |
|
394 | 394 | BasePrompt.__init__(self, cache, sep, prompt, pad_left) |
|
395 | 395 | if not self.p_template: |
|
396 | 396 | self.__str__ = lambda: '' |
|
397 | 397 | |
|
398 | 398 | def set_colors(self): |
|
399 | 399 | self.set_p_str() |
|
400 | 400 | Colors = self.cache.color_table.active_colors # shorthand |
|
401 | 401 | self.col_p = Colors.out_prompt |
|
402 | 402 | self.col_num = Colors.out_number |
|
403 | 403 | self.col_norm = Colors.normal |
|
404 | 404 | |
|
405 | 405 | |
|
406 | 406 | class Prompt2(BasePrompt): |
|
407 | 407 | """Interactive continuation prompt.""" |
|
408 | 408 | |
|
409 | 409 | def __init__(self, cache, prompt=' .\\D.: ', pad_left=True): |
|
410 | 410 | self.cache = cache |
|
411 | 411 | self.p_template = prompt |
|
412 | 412 | self.pad_left = pad_left |
|
413 | 413 | self.set_p_str() |
|
414 | 414 | |
|
415 | 415 | def set_p_str(self): |
|
416 | 416 | import os,time # needed in locals for prompt string handling |
|
417 | 417 | loc = locals() |
|
418 | 418 | self.p_str = ItplNS('%s%s%s' % |
|
419 | 419 | ('${self.col_p2}', |
|
420 | 420 | multiple_replace(prompt_specials, self.p_template), |
|
421 | 421 | '$self.col_norm'), |
|
422 | 422 | self.cache.shell.user_ns,loc) |
|
423 | 423 | self.p_str_nocolor = ItplNS(multiple_replace(prompt_specials_nocolor, |
|
424 | 424 | self.p_template), |
|
425 | 425 | self.cache.shell.user_ns,loc) |
|
426 | 426 | |
|
427 | 427 | def set_colors(self): |
|
428 | 428 | self.set_p_str() |
|
429 | 429 | Colors = self.cache.color_table.active_colors |
|
430 | 430 | self.col_p2 = Colors.in_prompt2 |
|
431 | 431 | self.col_norm = Colors.in_normal |
|
432 | 432 | # FIXME (2004-06-16) HACK: prevent crashes for users who haven't |
|
433 | 433 | # updated their prompt_in2 definitions. Remove eventually. |
|
434 | 434 | self.col_p = Colors.out_prompt |
|
435 | 435 | self.col_num = Colors.out_number |
|
436 | 436 |
@@ -1,138 +1,138 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Simple utility for splitting user input. This is used by both inputsplitter and |
|
4 | 4 | prefilter. |
|
5 | 5 | |
|
6 | 6 | Authors: |
|
7 | 7 | |
|
8 | 8 | * Brian Granger |
|
9 | 9 | * Fernando Perez |
|
10 | 10 | """ |
|
11 | 11 | |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 |
# Copyright (C) 2008-20 |
|
|
13 | # Copyright (C) 2008-2011 The IPython Development Team | |
|
14 | 14 | # |
|
15 | 15 | # Distributed under the terms of the BSD License. The full license is in |
|
16 | 16 | # the file COPYING, distributed as part of this software. |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | # Imports |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | |
|
23 | 23 | import re |
|
24 | 24 | import sys |
|
25 | 25 | |
|
26 | 26 | from IPython.utils import py3compat |
|
27 | 27 | |
|
28 | 28 | #----------------------------------------------------------------------------- |
|
29 | 29 | # Main function |
|
30 | 30 | #----------------------------------------------------------------------------- |
|
31 | 31 | |
|
32 | 32 | # RegExp for splitting line contents into pre-char//first word-method//rest. |
|
33 | 33 | # For clarity, each group in on one line. |
|
34 | 34 | |
|
35 | 35 | # WARNING: update the regexp if the escapes in interactiveshell are changed, as |
|
36 | 36 | # they are hardwired in. |
|
37 | 37 | |
|
38 | 38 | # Although it's not solely driven by the regex, note that: |
|
39 | 39 | # ,;/% only trigger if they are the first character on the line |
|
40 | 40 | # ! and !! trigger if they are first char(s) *or* follow an indent |
|
41 | 41 | # ? triggers as first or last char. |
|
42 | 42 | |
|
43 | 43 | line_split = re.compile(""" |
|
44 | 44 | ^(\s*) # any leading space |
|
45 | 45 | ([,;/%]|!!?|\?\??)? # escape character or characters |
|
46 | 46 | \s*(%?[\w\.\*]*) # function/method, possibly with leading % |
|
47 | 47 | # to correctly treat things like '?%magic' |
|
48 | 48 | (.*?$|$) # rest of line |
|
49 | 49 | """, re.VERBOSE) |
|
50 | 50 | |
|
51 | 51 | def split_user_input(line, pattern=None): |
|
52 | 52 | """Split user input into initial whitespace, escape character, function part |
|
53 | 53 | and the rest. |
|
54 | 54 | """ |
|
55 | 55 | # We need to ensure that the rest of this routine deals only with unicode |
|
56 | 56 | line = py3compat.cast_unicode(line, sys.stdin.encoding or 'utf-8') |
|
57 | 57 | |
|
58 | 58 | if pattern is None: |
|
59 | 59 | pattern = line_split |
|
60 | 60 | match = pattern.match(line) |
|
61 | 61 | if not match: |
|
62 | 62 | # print "match failed for line '%s'" % line |
|
63 | 63 | try: |
|
64 | 64 | ifun, the_rest = line.split(None,1) |
|
65 | 65 | except ValueError: |
|
66 | 66 | # print "split failed for line '%s'" % line |
|
67 | 67 | ifun, the_rest = line, u'' |
|
68 | 68 | pre = re.match('^(\s*)(.*)',line).groups()[0] |
|
69 | 69 | esc = "" |
|
70 | 70 | else: |
|
71 | 71 | pre, esc, ifun, the_rest = match.groups() |
|
72 | 72 | |
|
73 | 73 | #print 'line:<%s>' % line # dbg |
|
74 | 74 | #print 'pre <%s> ifun <%s> rest <%s>' % (pre,ifun.strip(),the_rest) # dbg |
|
75 | 75 | return pre, esc or '', ifun.strip(), the_rest.lstrip() |
|
76 | 76 | |
|
77 | 77 | class LineInfo(object): |
|
78 | 78 | """A single line of input and associated info. |
|
79 | 79 | |
|
80 | 80 | Includes the following as properties: |
|
81 | 81 | |
|
82 | 82 | line |
|
83 | 83 | The original, raw line |
|
84 | 84 | |
|
85 | 85 | continue_prompt |
|
86 | 86 | Is this line a continuation in a sequence of multiline input? |
|
87 | 87 | |
|
88 | 88 | pre |
|
89 | 89 | Any leading whitespace. |
|
90 | 90 | |
|
91 | 91 | esc |
|
92 | 92 | The escape character(s) in pre or the empty string if there isn't one. |
|
93 | 93 | Note that '!!' and '??' are possible values for esc. Otherwise it will |
|
94 | 94 | always be a single character. |
|
95 | 95 | |
|
96 | 96 | ifun |
|
97 | 97 | The 'function part', which is basically the maximal initial sequence |
|
98 | 98 | of valid python identifiers and the '.' character. This is what is |
|
99 | 99 | checked for alias and magic transformations, used for auto-calling, |
|
100 | 100 | etc. In contrast to Python identifiers, it may start with "%" and contain |
|
101 | 101 | "*". |
|
102 | 102 | |
|
103 | 103 | the_rest |
|
104 | 104 | Everything else on the line. |
|
105 | 105 | """ |
|
106 | 106 | def __init__(self, line, continue_prompt=False): |
|
107 | 107 | self.line = line |
|
108 | 108 | self.continue_prompt = continue_prompt |
|
109 | 109 | self.pre, self.esc, self.ifun, self.the_rest = split_user_input(line) |
|
110 | 110 | |
|
111 | 111 | self.pre_char = self.pre.strip() |
|
112 | 112 | if self.pre_char: |
|
113 | 113 | self.pre_whitespace = '' # No whitespace allowd before esc chars |
|
114 | 114 | else: |
|
115 | 115 | self.pre_whitespace = self.pre |
|
116 | 116 | |
|
117 | 117 | self._oinfo = None |
|
118 | 118 | |
|
119 | 119 | def ofind(self, ip): |
|
120 | 120 | """Do a full, attribute-walking lookup of the ifun in the various |
|
121 | 121 | namespaces for the given IPython InteractiveShell instance. |
|
122 | 122 | |
|
123 | 123 | Return a dict with keys: found,obj,ospace,ismagic |
|
124 | 124 | |
|
125 | 125 | Note: can cause state changes because of calling getattr, but should |
|
126 | 126 | only be run if autocall is on and if the line hasn't matched any |
|
127 | 127 | other, less dangerous handlers. |
|
128 | 128 | |
|
129 | 129 | Does cache the results of the call, so can be called multiple times |
|
130 | 130 | without worrying about *further* damaging state. |
|
131 | 131 | """ |
|
132 | 132 | if not self._oinfo: |
|
133 | 133 | # ip.shell._ofind is actually on the Magic class! |
|
134 | 134 | self._oinfo = ip.shell._ofind(self.ifun) |
|
135 | 135 | return self._oinfo |
|
136 | 136 | |
|
137 | 137 | def __str__(self): |
|
138 | 138 | return "LineInfo [%s|%s|%s|%s]" %(self.pre, self.esc, self.ifun, self.the_rest) |
@@ -1,75 +1,75 b'' | |||
|
1 | 1 | # coding: utf-8 |
|
2 | 2 | """Tests for the compilerop module. |
|
3 | 3 | """ |
|
4 | 4 | #----------------------------------------------------------------------------- |
|
5 | # Copyright (C) 2010 The IPython Development Team. | |
|
5 | # Copyright (C) 2010-2011 The IPython Development Team. | |
|
6 | 6 | # |
|
7 | 7 | # Distributed under the terms of the BSD License. |
|
8 | 8 | # |
|
9 | 9 | # The full license is in the file COPYING.txt, distributed with this software. |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | # Imports |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | from __future__ import print_function |
|
16 | 16 | |
|
17 | 17 | # Stdlib imports |
|
18 | 18 | import linecache |
|
19 | 19 | import sys |
|
20 | 20 | |
|
21 | 21 | # Third-party imports |
|
22 | 22 | import nose.tools as nt |
|
23 | 23 | |
|
24 | 24 | # Our own imports |
|
25 | 25 | from IPython.core import compilerop |
|
26 | 26 | from IPython.utils import py3compat |
|
27 | 27 | |
|
28 | 28 | #----------------------------------------------------------------------------- |
|
29 | 29 | # Test functions |
|
30 | 30 | #----------------------------------------------------------------------------- |
|
31 | 31 | |
|
32 | 32 | def test_code_name(): |
|
33 | 33 | code = 'x=1' |
|
34 | 34 | name = compilerop.code_name(code) |
|
35 | 35 | nt.assert_true(name.startswith('<ipython-input-0')) |
|
36 | 36 | |
|
37 | 37 | |
|
38 | 38 | def test_code_name2(): |
|
39 | 39 | code = 'x=1' |
|
40 | 40 | name = compilerop.code_name(code, 9) |
|
41 | 41 | nt.assert_true(name.startswith('<ipython-input-9')) |
|
42 | 42 | |
|
43 | 43 | |
|
44 | 44 | def test_cache(): |
|
45 | 45 | """Test the compiler correctly compiles and caches inputs |
|
46 | 46 | """ |
|
47 | 47 | cp = compilerop.CachingCompiler() |
|
48 | 48 | ncache = len(linecache.cache) |
|
49 | 49 | cp.cache('x=1') |
|
50 | 50 | nt.assert_true(len(linecache.cache) > ncache) |
|
51 | 51 | |
|
52 | 52 | def setUp(): |
|
53 | 53 | # Check we're in a proper Python 2 environment (some imports, such |
|
54 | 54 | # as GTK, can change the default encoding, which can hide bugs.) |
|
55 | 55 | nt.assert_equal(sys.getdefaultencoding(), "utf-8" if py3compat.PY3 else "ascii") |
|
56 | 56 | |
|
57 | 57 | def test_cache_unicode(): |
|
58 | 58 | cp = compilerop.CachingCompiler() |
|
59 | 59 | ncache = len(linecache.cache) |
|
60 | 60 | cp.cache(u"t = 'žćčšđ'") |
|
61 | 61 | nt.assert_true(len(linecache.cache) > ncache) |
|
62 | 62 | |
|
63 | 63 | def test_compiler_check_cache(): |
|
64 | 64 | """Test the compiler properly manages the cache. |
|
65 | 65 | """ |
|
66 | 66 | # Rather simple-minded tests that just exercise the API |
|
67 | 67 | cp = compilerop.CachingCompiler() |
|
68 | 68 | cp.cache('x=1', 99) |
|
69 | 69 | # Ensure now that after clearing the cache, our entries survive |
|
70 | 70 | cp.check_cache() |
|
71 | 71 | for k in linecache.cache: |
|
72 | 72 | if k.startswith('<ipython-input-99'): |
|
73 | 73 | break |
|
74 | 74 | else: |
|
75 | 75 | raise AssertionError('Entry for input-99 missing from linecache') |
@@ -1,706 +1,706 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Tests for the inputsplitter module. |
|
3 | 3 | |
|
4 | 4 | Authors |
|
5 | 5 | ------- |
|
6 | 6 | * Fernando Perez |
|
7 | 7 | * Robert Kern |
|
8 | 8 | """ |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 | # Copyright (C) 2010 The IPython Development Team | |
|
10 | # Copyright (C) 2010-2011 The IPython Development Team | |
|
11 | 11 | # |
|
12 | 12 | # Distributed under the terms of the BSD License. The full license is in |
|
13 | 13 | # the file COPYING, distributed as part of this software. |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | # Imports |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # stdlib |
|
20 | 20 | import unittest |
|
21 | 21 | import sys |
|
22 | 22 | |
|
23 | 23 | # Third party |
|
24 | 24 | import nose.tools as nt |
|
25 | 25 | |
|
26 | 26 | # Our own |
|
27 | 27 | from IPython.core import inputsplitter as isp |
|
28 | 28 | from IPython.testing import tools as tt |
|
29 | 29 | from IPython.utils import py3compat |
|
30 | 30 | |
|
31 | 31 | #----------------------------------------------------------------------------- |
|
32 | 32 | # Semi-complete examples (also used as tests) |
|
33 | 33 | #----------------------------------------------------------------------------- |
|
34 | 34 | |
|
35 | 35 | # Note: at the bottom, there's a slightly more complete version of this that |
|
36 | 36 | # can be useful during development of code here. |
|
37 | 37 | |
|
38 | 38 | def mini_interactive_loop(input_func): |
|
39 | 39 | """Minimal example of the logic of an interactive interpreter loop. |
|
40 | 40 | |
|
41 | 41 | This serves as an example, and it is used by the test system with a fake |
|
42 | 42 | raw_input that simulates interactive input.""" |
|
43 | 43 | |
|
44 | 44 | from IPython.core.inputsplitter import InputSplitter |
|
45 | 45 | |
|
46 | 46 | isp = InputSplitter() |
|
47 | 47 | # In practice, this input loop would be wrapped in an outside loop to read |
|
48 | 48 | # input indefinitely, until some exit/quit command was issued. Here we |
|
49 | 49 | # only illustrate the basic inner loop. |
|
50 | 50 | while isp.push_accepts_more(): |
|
51 | 51 | indent = ' '*isp.indent_spaces |
|
52 | 52 | prompt = '>>> ' + indent |
|
53 | 53 | line = indent + input_func(prompt) |
|
54 | 54 | isp.push(line) |
|
55 | 55 | |
|
56 | 56 | # Here we just return input so we can use it in a test suite, but a real |
|
57 | 57 | # interpreter would instead send it for execution somewhere. |
|
58 | 58 | src = isp.source_reset() |
|
59 | 59 | #print 'Input source was:\n', src # dbg |
|
60 | 60 | return src |
|
61 | 61 | |
|
62 | 62 | #----------------------------------------------------------------------------- |
|
63 | 63 | # Test utilities, just for local use |
|
64 | 64 | #----------------------------------------------------------------------------- |
|
65 | 65 | |
|
66 | 66 | def assemble(block): |
|
67 | 67 | """Assemble a block into multi-line sub-blocks.""" |
|
68 | 68 | return ['\n'.join(sub_block)+'\n' for sub_block in block] |
|
69 | 69 | |
|
70 | 70 | |
|
71 | 71 | def pseudo_input(lines): |
|
72 | 72 | """Return a function that acts like raw_input but feeds the input list.""" |
|
73 | 73 | ilines = iter(lines) |
|
74 | 74 | def raw_in(prompt): |
|
75 | 75 | try: |
|
76 | 76 | return next(ilines) |
|
77 | 77 | except StopIteration: |
|
78 | 78 | return '' |
|
79 | 79 | return raw_in |
|
80 | 80 | |
|
81 | 81 | #----------------------------------------------------------------------------- |
|
82 | 82 | # Tests |
|
83 | 83 | #----------------------------------------------------------------------------- |
|
84 | 84 | def test_spaces(): |
|
85 | 85 | tests = [('', 0), |
|
86 | 86 | (' ', 1), |
|
87 | 87 | ('\n', 0), |
|
88 | 88 | (' \n', 1), |
|
89 | 89 | ('x', 0), |
|
90 | 90 | (' x', 1), |
|
91 | 91 | (' x',2), |
|
92 | 92 | (' x',4), |
|
93 | 93 | # Note: tabs are counted as a single whitespace! |
|
94 | 94 | ('\tx', 1), |
|
95 | 95 | ('\t x', 2), |
|
96 | 96 | ] |
|
97 | 97 | tt.check_pairs(isp.num_ini_spaces, tests) |
|
98 | 98 | |
|
99 | 99 | |
|
100 | 100 | def test_remove_comments(): |
|
101 | 101 | tests = [('text', 'text'), |
|
102 | 102 | ('text # comment', 'text '), |
|
103 | 103 | ('text # comment\n', 'text \n'), |
|
104 | 104 | ('text # comment \n', 'text \n'), |
|
105 | 105 | ('line # c \nline\n','line \nline\n'), |
|
106 | 106 | ('line # c \nline#c2 \nline\nline #c\n\n', |
|
107 | 107 | 'line \nline\nline\nline \n\n'), |
|
108 | 108 | ] |
|
109 | 109 | tt.check_pairs(isp.remove_comments, tests) |
|
110 | 110 | |
|
111 | 111 | def test_has_comment(): |
|
112 | 112 | tests = [('text', False), |
|
113 | 113 | ('text #comment', True), |
|
114 | 114 | ('text #comment\n', True), |
|
115 | 115 | ('#comment', True), |
|
116 | 116 | ('#comment\n', True), |
|
117 | 117 | ('a = "#string"', False), |
|
118 | 118 | ('a = "#string" # comment', True), |
|
119 | 119 | ('a #comment not "string"', True), |
|
120 | 120 | ] |
|
121 | 121 | tt.check_pairs(isp.has_comment, tests) |
|
122 | 122 | |
|
123 | 123 | |
|
124 | 124 | def test_get_input_encoding(): |
|
125 | 125 | encoding = isp.get_input_encoding() |
|
126 | 126 | nt.assert_true(isinstance(encoding, basestring)) |
|
127 | 127 | # simple-minded check that at least encoding a simple string works with the |
|
128 | 128 | # encoding we got. |
|
129 | 129 | nt.assert_equal(u'test'.encode(encoding), b'test') |
|
130 | 130 | |
|
131 | 131 | |
|
132 | 132 | class NoInputEncodingTestCase(unittest.TestCase): |
|
133 | 133 | def setUp(self): |
|
134 | 134 | self.old_stdin = sys.stdin |
|
135 | 135 | class X: pass |
|
136 | 136 | fake_stdin = X() |
|
137 | 137 | sys.stdin = fake_stdin |
|
138 | 138 | |
|
139 | 139 | def test(self): |
|
140 | 140 | # Verify that if sys.stdin has no 'encoding' attribute we do the right |
|
141 | 141 | # thing |
|
142 | 142 | enc = isp.get_input_encoding() |
|
143 | 143 | self.assertEqual(enc, 'ascii') |
|
144 | 144 | |
|
145 | 145 | def tearDown(self): |
|
146 | 146 | sys.stdin = self.old_stdin |
|
147 | 147 | |
|
148 | 148 | |
|
149 | 149 | class InputSplitterTestCase(unittest.TestCase): |
|
150 | 150 | def setUp(self): |
|
151 | 151 | self.isp = isp.InputSplitter() |
|
152 | 152 | |
|
153 | 153 | def test_reset(self): |
|
154 | 154 | isp = self.isp |
|
155 | 155 | isp.push('x=1') |
|
156 | 156 | isp.reset() |
|
157 | 157 | self.assertEqual(isp._buffer, []) |
|
158 | 158 | self.assertEqual(isp.indent_spaces, 0) |
|
159 | 159 | self.assertEqual(isp.source, '') |
|
160 | 160 | self.assertEqual(isp.code, None) |
|
161 | 161 | self.assertEqual(isp._is_complete, False) |
|
162 | 162 | |
|
163 | 163 | def test_source(self): |
|
164 | 164 | self.isp._store('1') |
|
165 | 165 | self.isp._store('2') |
|
166 | 166 | self.assertEqual(self.isp.source, '1\n2\n') |
|
167 | 167 | self.assertTrue(len(self.isp._buffer)>0) |
|
168 | 168 | self.assertEqual(self.isp.source_reset(), '1\n2\n') |
|
169 | 169 | self.assertEqual(self.isp._buffer, []) |
|
170 | 170 | self.assertEqual(self.isp.source, '') |
|
171 | 171 | |
|
172 | 172 | def test_indent(self): |
|
173 | 173 | isp = self.isp # shorthand |
|
174 | 174 | isp.push('x=1') |
|
175 | 175 | self.assertEqual(isp.indent_spaces, 0) |
|
176 | 176 | isp.push('if 1:\n x=1') |
|
177 | 177 | self.assertEqual(isp.indent_spaces, 4) |
|
178 | 178 | isp.push('y=2\n') |
|
179 | 179 | self.assertEqual(isp.indent_spaces, 0) |
|
180 | 180 | |
|
181 | 181 | def test_indent2(self): |
|
182 | 182 | # In cell mode, inputs must be fed in whole blocks, so skip this test |
|
183 | 183 | if self.isp.input_mode == 'cell': return |
|
184 | 184 | |
|
185 | 185 | isp = self.isp |
|
186 | 186 | isp.push('if 1:') |
|
187 | 187 | self.assertEqual(isp.indent_spaces, 4) |
|
188 | 188 | isp.push(' x=1') |
|
189 | 189 | self.assertEqual(isp.indent_spaces, 4) |
|
190 | 190 | # Blank lines shouldn't change the indent level |
|
191 | 191 | isp.push(' '*2) |
|
192 | 192 | self.assertEqual(isp.indent_spaces, 4) |
|
193 | 193 | |
|
194 | 194 | def test_indent3(self): |
|
195 | 195 | # In cell mode, inputs must be fed in whole blocks, so skip this test |
|
196 | 196 | if self.isp.input_mode == 'cell': return |
|
197 | 197 | |
|
198 | 198 | isp = self.isp |
|
199 | 199 | # When a multiline statement contains parens or multiline strings, we |
|
200 | 200 | # shouldn't get confused. |
|
201 | 201 | isp.push("if 1:") |
|
202 | 202 | isp.push(" x = (1+\n 2)") |
|
203 | 203 | self.assertEqual(isp.indent_spaces, 4) |
|
204 | 204 | |
|
205 | 205 | def test_indent4(self): |
|
206 | 206 | # In cell mode, inputs must be fed in whole blocks, so skip this test |
|
207 | 207 | if self.isp.input_mode == 'cell': return |
|
208 | 208 | |
|
209 | 209 | isp = self.isp |
|
210 | 210 | # whitespace after ':' should not screw up indent level |
|
211 | 211 | isp.push('if 1: \n x=1') |
|
212 | 212 | self.assertEqual(isp.indent_spaces, 4) |
|
213 | 213 | isp.push('y=2\n') |
|
214 | 214 | self.assertEqual(isp.indent_spaces, 0) |
|
215 | 215 | isp.push('if 1:\t\n x=1') |
|
216 | 216 | self.assertEqual(isp.indent_spaces, 4) |
|
217 | 217 | isp.push('y=2\n') |
|
218 | 218 | self.assertEqual(isp.indent_spaces, 0) |
|
219 | 219 | |
|
220 | 220 | def test_dedent_pass(self): |
|
221 | 221 | isp = self.isp # shorthand |
|
222 | 222 | # should NOT cause dedent |
|
223 | 223 | isp.push('if 1:\n passes = 5') |
|
224 | 224 | self.assertEqual(isp.indent_spaces, 4) |
|
225 | 225 | isp.push('if 1:\n pass') |
|
226 | 226 | self.assertEqual(isp.indent_spaces, 0) |
|
227 | 227 | isp.push('if 1:\n pass ') |
|
228 | 228 | self.assertEqual(isp.indent_spaces, 0) |
|
229 | 229 | |
|
230 | 230 | def test_dedent_raise(self): |
|
231 | 231 | isp = self.isp # shorthand |
|
232 | 232 | # should NOT cause dedent |
|
233 | 233 | isp.push('if 1:\n raised = 4') |
|
234 | 234 | self.assertEqual(isp.indent_spaces, 4) |
|
235 | 235 | isp.push('if 1:\n raise TypeError()') |
|
236 | 236 | self.assertEqual(isp.indent_spaces, 0) |
|
237 | 237 | isp.push('if 1:\n raise') |
|
238 | 238 | self.assertEqual(isp.indent_spaces, 0) |
|
239 | 239 | isp.push('if 1:\n raise ') |
|
240 | 240 | self.assertEqual(isp.indent_spaces, 0) |
|
241 | 241 | |
|
242 | 242 | def test_dedent_return(self): |
|
243 | 243 | isp = self.isp # shorthand |
|
244 | 244 | # should NOT cause dedent |
|
245 | 245 | isp.push('if 1:\n returning = 4') |
|
246 | 246 | self.assertEqual(isp.indent_spaces, 4) |
|
247 | 247 | isp.push('if 1:\n return 5 + 493') |
|
248 | 248 | self.assertEqual(isp.indent_spaces, 0) |
|
249 | 249 | isp.push('if 1:\n return') |
|
250 | 250 | self.assertEqual(isp.indent_spaces, 0) |
|
251 | 251 | isp.push('if 1:\n return ') |
|
252 | 252 | self.assertEqual(isp.indent_spaces, 0) |
|
253 | 253 | isp.push('if 1:\n return(0)') |
|
254 | 254 | self.assertEqual(isp.indent_spaces, 0) |
|
255 | 255 | |
|
256 | 256 | def test_push(self): |
|
257 | 257 | isp = self.isp |
|
258 | 258 | self.assertTrue(isp.push('x=1')) |
|
259 | 259 | |
|
260 | 260 | def test_push2(self): |
|
261 | 261 | isp = self.isp |
|
262 | 262 | self.assertFalse(isp.push('if 1:')) |
|
263 | 263 | for line in [' x=1', '# a comment', ' y=2']: |
|
264 | 264 | self.assertTrue(isp.push(line)) |
|
265 | 265 | |
|
266 | 266 | def test_push3(self): |
|
267 | 267 | isp = self.isp |
|
268 | 268 | isp.push('if True:') |
|
269 | 269 | isp.push(' a = 1') |
|
270 | 270 | self.assertFalse(isp.push('b = [1,')) |
|
271 | 271 | |
|
272 | 272 | def test_replace_mode(self): |
|
273 | 273 | isp = self.isp |
|
274 | 274 | isp.input_mode = 'cell' |
|
275 | 275 | isp.push('x=1') |
|
276 | 276 | self.assertEqual(isp.source, 'x=1\n') |
|
277 | 277 | isp.push('x=2') |
|
278 | 278 | self.assertEqual(isp.source, 'x=2\n') |
|
279 | 279 | |
|
280 | 280 | def test_push_accepts_more(self): |
|
281 | 281 | isp = self.isp |
|
282 | 282 | isp.push('x=1') |
|
283 | 283 | self.assertFalse(isp.push_accepts_more()) |
|
284 | 284 | |
|
285 | 285 | def test_push_accepts_more2(self): |
|
286 | 286 | # In cell mode, inputs must be fed in whole blocks, so skip this test |
|
287 | 287 | if self.isp.input_mode == 'cell': return |
|
288 | 288 | |
|
289 | 289 | isp = self.isp |
|
290 | 290 | isp.push('if 1:') |
|
291 | 291 | self.assertTrue(isp.push_accepts_more()) |
|
292 | 292 | isp.push(' x=1') |
|
293 | 293 | self.assertTrue(isp.push_accepts_more()) |
|
294 | 294 | isp.push('') |
|
295 | 295 | self.assertFalse(isp.push_accepts_more()) |
|
296 | 296 | |
|
297 | 297 | def test_push_accepts_more3(self): |
|
298 | 298 | isp = self.isp |
|
299 | 299 | isp.push("x = (2+\n3)") |
|
300 | 300 | self.assertFalse(isp.push_accepts_more()) |
|
301 | 301 | |
|
302 | 302 | def test_push_accepts_more4(self): |
|
303 | 303 | # In cell mode, inputs must be fed in whole blocks, so skip this test |
|
304 | 304 | if self.isp.input_mode == 'cell': return |
|
305 | 305 | |
|
306 | 306 | isp = self.isp |
|
307 | 307 | # When a multiline statement contains parens or multiline strings, we |
|
308 | 308 | # shouldn't get confused. |
|
309 | 309 | # FIXME: we should be able to better handle de-dents in statements like |
|
310 | 310 | # multiline strings and multiline expressions (continued with \ or |
|
311 | 311 | # parens). Right now we aren't handling the indentation tracking quite |
|
312 | 312 | # correctly with this, though in practice it may not be too much of a |
|
313 | 313 | # problem. We'll need to see. |
|
314 | 314 | isp.push("if 1:") |
|
315 | 315 | isp.push(" x = (2+") |
|
316 | 316 | isp.push(" 3)") |
|
317 | 317 | self.assertTrue(isp.push_accepts_more()) |
|
318 | 318 | isp.push(" y = 3") |
|
319 | 319 | self.assertTrue(isp.push_accepts_more()) |
|
320 | 320 | isp.push('') |
|
321 | 321 | self.assertFalse(isp.push_accepts_more()) |
|
322 | 322 | |
|
323 | 323 | def test_push_accepts_more5(self): |
|
324 | 324 | # In cell mode, inputs must be fed in whole blocks, so skip this test |
|
325 | 325 | if self.isp.input_mode == 'cell': return |
|
326 | 326 | |
|
327 | 327 | isp = self.isp |
|
328 | 328 | isp.push('try:') |
|
329 | 329 | isp.push(' a = 5') |
|
330 | 330 | isp.push('except:') |
|
331 | 331 | isp.push(' raise') |
|
332 | 332 | self.assertTrue(isp.push_accepts_more()) |
|
333 | 333 | |
|
334 | 334 | def test_continuation(self): |
|
335 | 335 | isp = self.isp |
|
336 | 336 | isp.push("import os, \\") |
|
337 | 337 | self.assertTrue(isp.push_accepts_more()) |
|
338 | 338 | isp.push("sys") |
|
339 | 339 | self.assertFalse(isp.push_accepts_more()) |
|
340 | 340 | |
|
341 | 341 | def test_syntax_error(self): |
|
342 | 342 | isp = self.isp |
|
343 | 343 | # Syntax errors immediately produce a 'ready' block, so the invalid |
|
344 | 344 | # Python can be sent to the kernel for evaluation with possible ipython |
|
345 | 345 | # special-syntax conversion. |
|
346 | 346 | isp.push('run foo') |
|
347 | 347 | self.assertFalse(isp.push_accepts_more()) |
|
348 | 348 | |
|
349 | 349 | def test_unicode(self): |
|
350 | 350 | self.isp.push(u"Pérez") |
|
351 | 351 | self.isp.push(u'\xc3\xa9') |
|
352 | 352 | self.isp.push(u"u'\xc3\xa9'") |
|
353 | 353 | |
|
354 | 354 | class InteractiveLoopTestCase(unittest.TestCase): |
|
355 | 355 | """Tests for an interactive loop like a python shell. |
|
356 | 356 | """ |
|
357 | 357 | def check_ns(self, lines, ns): |
|
358 | 358 | """Validate that the given input lines produce the resulting namespace. |
|
359 | 359 | |
|
360 | 360 | Note: the input lines are given exactly as they would be typed in an |
|
361 | 361 | auto-indenting environment, as mini_interactive_loop above already does |
|
362 | 362 | auto-indenting and prepends spaces to the input. |
|
363 | 363 | """ |
|
364 | 364 | src = mini_interactive_loop(pseudo_input(lines)) |
|
365 | 365 | test_ns = {} |
|
366 | 366 | exec src in test_ns |
|
367 | 367 | # We can't check that the provided ns is identical to the test_ns, |
|
368 | 368 | # because Python fills test_ns with extra keys (copyright, etc). But |
|
369 | 369 | # we can check that the given dict is *contained* in test_ns |
|
370 | 370 | for k,v in ns.iteritems(): |
|
371 | 371 | self.assertEqual(test_ns[k], v) |
|
372 | 372 | |
|
373 | 373 | def test_simple(self): |
|
374 | 374 | self.check_ns(['x=1'], dict(x=1)) |
|
375 | 375 | |
|
376 | 376 | def test_simple2(self): |
|
377 | 377 | self.check_ns(['if 1:', 'x=2'], dict(x=2)) |
|
378 | 378 | |
|
379 | 379 | def test_xy(self): |
|
380 | 380 | self.check_ns(['x=1; y=2'], dict(x=1, y=2)) |
|
381 | 381 | |
|
382 | 382 | def test_abc(self): |
|
383 | 383 | self.check_ns(['if 1:','a=1','b=2','c=3'], dict(a=1, b=2, c=3)) |
|
384 | 384 | |
|
385 | 385 | def test_multi(self): |
|
386 | 386 | self.check_ns(['x =(1+','1+','2)'], dict(x=4)) |
|
387 | 387 | |
|
388 | 388 | |
|
389 | 389 | def test_LineInfo(): |
|
390 | 390 | """Simple test for LineInfo construction and str()""" |
|
391 | 391 | linfo = isp.LineInfo(' %cd /home') |
|
392 | 392 | nt.assert_equals(str(linfo), 'LineInfo [ |%|cd|/home]') |
|
393 | 393 | |
|
394 | 394 | # Transformer tests |
|
395 | 395 | def transform_checker(tests, func): |
|
396 | 396 | """Utility to loop over test inputs""" |
|
397 | 397 | for inp, tr in tests: |
|
398 | 398 | nt.assert_equals(func(inp), tr) |
|
399 | 399 | |
|
400 | 400 | # Data for all the syntax tests in the form of lists of pairs of |
|
401 | 401 | # raw/transformed input. We store it here as a global dict so that we can use |
|
402 | 402 | # it both within single-function tests and also to validate the behavior of the |
|
403 | 403 | # larger objects |
|
404 | 404 | |
|
405 | 405 | syntax = \ |
|
406 | 406 | dict(assign_system = |
|
407 | 407 | [(i,py3compat.u_format(o)) for i,o in \ |
|
408 | 408 | [(u'a =! ls', "a = get_ipython().getoutput({u}'ls')"), |
|
409 | 409 | (u'b = !ls', "b = get_ipython().getoutput({u}'ls')"), |
|
410 | 410 | ('x=1', 'x=1'), # normal input is unmodified |
|
411 | 411 | (' ',' '), # blank lines are kept intact |
|
412 | 412 | ]], |
|
413 | 413 | |
|
414 | 414 | assign_magic = |
|
415 | 415 | [(i,py3compat.u_format(o)) for i,o in \ |
|
416 | 416 | [(u'a =% who', "a = get_ipython().magic({u}'who')"), |
|
417 | 417 | (u'b = %who', "b = get_ipython().magic({u}'who')"), |
|
418 | 418 | ('x=1', 'x=1'), # normal input is unmodified |
|
419 | 419 | (' ',' '), # blank lines are kept intact |
|
420 | 420 | ]], |
|
421 | 421 | |
|
422 | 422 | classic_prompt = |
|
423 | 423 | [('>>> x=1', 'x=1'), |
|
424 | 424 | ('x=1', 'x=1'), # normal input is unmodified |
|
425 | 425 | (' ', ' '), # blank lines are kept intact |
|
426 | 426 | ('... ', ''), # continuation prompts |
|
427 | 427 | ], |
|
428 | 428 | |
|
429 | 429 | ipy_prompt = |
|
430 | 430 | [('In [1]: x=1', 'x=1'), |
|
431 | 431 | ('x=1', 'x=1'), # normal input is unmodified |
|
432 | 432 | (' ',' '), # blank lines are kept intact |
|
433 | 433 | (' ....: ', ''), # continuation prompts |
|
434 | 434 | ], |
|
435 | 435 | |
|
436 | 436 | # Tests for the escape transformer to leave normal code alone |
|
437 | 437 | escaped_noesc = |
|
438 | 438 | [ (' ', ' '), |
|
439 | 439 | ('x=1', 'x=1'), |
|
440 | 440 | ], |
|
441 | 441 | |
|
442 | 442 | # System calls |
|
443 | 443 | escaped_shell = |
|
444 | 444 | [(i,py3compat.u_format(o)) for i,o in \ |
|
445 | 445 | [ (u'!ls', "get_ipython().system({u}'ls')"), |
|
446 | 446 | # Double-escape shell, this means to capture the output of the |
|
447 | 447 | # subprocess and return it |
|
448 | 448 | (u'!!ls', "get_ipython().getoutput({u}'ls')"), |
|
449 | 449 | ]], |
|
450 | 450 | |
|
451 | 451 | # Help/object info |
|
452 | 452 | escaped_help = |
|
453 | 453 | [(i,py3compat.u_format(o)) for i,o in \ |
|
454 | 454 | [ (u'?', 'get_ipython().show_usage()'), |
|
455 | 455 | (u'?x1', "get_ipython().magic({u}'pinfo x1')"), |
|
456 | 456 | (u'??x2', "get_ipython().magic({u}'pinfo2 x2')"), |
|
457 | 457 | (u'?a.*s', "get_ipython().magic({u}'psearch a.*s')"), |
|
458 | 458 | (u'?%hist', "get_ipython().magic({u}'pinfo %hist')"), |
|
459 | 459 | (u'?abc = qwe', "get_ipython().magic({u}'pinfo abc')"), |
|
460 | 460 | ]], |
|
461 | 461 | |
|
462 | 462 | end_help = |
|
463 | 463 | [(i,py3compat.u_format(o)) for i,o in \ |
|
464 | 464 | [ (u'x3?', "get_ipython().magic({u}'pinfo x3')"), |
|
465 | 465 | (u'x4??', "get_ipython().magic({u}'pinfo2 x4')"), |
|
466 | 466 | (u'%hist?', "get_ipython().magic({u}'pinfo %hist')"), |
|
467 | 467 | (u'f*?', "get_ipython().magic({u}'psearch f*')"), |
|
468 | 468 | (u'ax.*aspe*?', "get_ipython().magic({u}'psearch ax.*aspe*')"), |
|
469 | 469 | (u'a = abc?', "get_ipython().magic({u}'pinfo abc', next_input={u}'a = abc')"), |
|
470 | 470 | (u'a = abc.qe??', "get_ipython().magic({u}'pinfo2 abc.qe', next_input={u}'a = abc.qe')"), |
|
471 | 471 | (u'a = *.items?', "get_ipython().magic({u}'psearch *.items', next_input={u}'a = *.items')"), |
|
472 | 472 | (u'plot(a?', "get_ipython().magic({u}'pinfo a', next_input={u}'plot(a')"), |
|
473 | 473 | (u'a*2 #comment?', 'a*2 #comment?'), |
|
474 | 474 | ]], |
|
475 | 475 | |
|
476 | 476 | # Explicit magic calls |
|
477 | 477 | escaped_magic = |
|
478 | 478 | [(i,py3compat.u_format(o)) for i,o in \ |
|
479 | 479 | [ (u'%cd', "get_ipython().magic({u}'cd')"), |
|
480 | 480 | (u'%cd /home', "get_ipython().magic({u}'cd /home')"), |
|
481 | 481 | # Backslashes need to be escaped. |
|
482 | 482 | (u'%cd C:\\User', "get_ipython().magic({u}'cd C:\\\\User')"), |
|
483 | 483 | (u' %magic', " get_ipython().magic({u}'magic')"), |
|
484 | 484 | ]], |
|
485 | 485 | |
|
486 | 486 | # Quoting with separate arguments |
|
487 | 487 | escaped_quote = |
|
488 | 488 | [ (',f', 'f("")'), |
|
489 | 489 | (',f x', 'f("x")'), |
|
490 | 490 | (' ,f y', ' f("y")'), |
|
491 | 491 | (',f a b', 'f("a", "b")'), |
|
492 | 492 | ], |
|
493 | 493 | |
|
494 | 494 | # Quoting with single argument |
|
495 | 495 | escaped_quote2 = |
|
496 | 496 | [ (';f', 'f("")'), |
|
497 | 497 | (';f x', 'f("x")'), |
|
498 | 498 | (' ;f y', ' f("y")'), |
|
499 | 499 | (';f a b', 'f("a b")'), |
|
500 | 500 | ], |
|
501 | 501 | |
|
502 | 502 | # Simply apply parens |
|
503 | 503 | escaped_paren = |
|
504 | 504 | [ ('/f', 'f()'), |
|
505 | 505 | ('/f x', 'f(x)'), |
|
506 | 506 | (' /f y', ' f(y)'), |
|
507 | 507 | ('/f a b', 'f(a, b)'), |
|
508 | 508 | ], |
|
509 | 509 | |
|
510 | 510 | # Check that we transform prompts before other transforms |
|
511 | 511 | mixed = |
|
512 | 512 | [(i,py3compat.u_format(o)) for i,o in \ |
|
513 | 513 | [ (u'In [1]: %lsmagic', "get_ipython().magic({u}'lsmagic')"), |
|
514 | 514 | (u'>>> %lsmagic', "get_ipython().magic({u}'lsmagic')"), |
|
515 | 515 | (u'In [2]: !ls', "get_ipython().system({u}'ls')"), |
|
516 | 516 | (u'In [3]: abs?', "get_ipython().magic({u}'pinfo abs')"), |
|
517 | 517 | (u'In [4]: b = %who', "b = get_ipython().magic({u}'who')"), |
|
518 | 518 | ]], |
|
519 | 519 | ) |
|
520 | 520 | |
|
521 | 521 | # multiline syntax examples. Each of these should be a list of lists, with |
|
522 | 522 | # each entry itself having pairs of raw/transformed input. The union (with |
|
523 | 523 | # '\n'.join() of the transformed inputs is what the splitter should produce |
|
524 | 524 | # when fed the raw lines one at a time via push. |
|
525 | 525 | syntax_ml = \ |
|
526 | 526 | dict(classic_prompt = |
|
527 | 527 | [ [('>>> for i in range(10):','for i in range(10):'), |
|
528 | 528 | ('... print i',' print i'), |
|
529 | 529 | ('... ', ''), |
|
530 | 530 | ], |
|
531 | 531 | ], |
|
532 | 532 | |
|
533 | 533 | ipy_prompt = |
|
534 | 534 | [ [('In [24]: for i in range(10):','for i in range(10):'), |
|
535 | 535 | (' ....: print i',' print i'), |
|
536 | 536 | (' ....: ', ''), |
|
537 | 537 | ], |
|
538 | 538 | ], |
|
539 | 539 | |
|
540 | 540 | multiline_datastructure = |
|
541 | 541 | [ [('>>> a = [1,','a = [1,'), |
|
542 | 542 | ('... 2]','2]'), |
|
543 | 543 | ], |
|
544 | 544 | ], |
|
545 | 545 | ) |
|
546 | 546 | |
|
547 | 547 | |
|
548 | 548 | def test_assign_system(): |
|
549 | 549 | tt.check_pairs(isp.transform_assign_system, syntax['assign_system']) |
|
550 | 550 | |
|
551 | 551 | |
|
552 | 552 | def test_assign_magic(): |
|
553 | 553 | tt.check_pairs(isp.transform_assign_magic, syntax['assign_magic']) |
|
554 | 554 | |
|
555 | 555 | |
|
556 | 556 | def test_classic_prompt(): |
|
557 | 557 | transform_checker(syntax['classic_prompt'], isp.transform_classic_prompt) |
|
558 | 558 | for example in syntax_ml['classic_prompt']: |
|
559 | 559 | transform_checker(example, isp.transform_classic_prompt) |
|
560 | 560 | |
|
561 | 561 | |
|
562 | 562 | def test_ipy_prompt(): |
|
563 | 563 | transform_checker(syntax['ipy_prompt'], isp.transform_ipy_prompt) |
|
564 | 564 | for example in syntax_ml['ipy_prompt']: |
|
565 | 565 | transform_checker(example, isp.transform_ipy_prompt) |
|
566 | 566 | |
|
567 | 567 | def test_end_help(): |
|
568 | 568 | tt.check_pairs(isp.transform_help_end, syntax['end_help']) |
|
569 | 569 | |
|
570 | 570 | def test_escaped_noesc(): |
|
571 | 571 | tt.check_pairs(isp.transform_escaped, syntax['escaped_noesc']) |
|
572 | 572 | |
|
573 | 573 | |
|
574 | 574 | def test_escaped_shell(): |
|
575 | 575 | tt.check_pairs(isp.transform_escaped, syntax['escaped_shell']) |
|
576 | 576 | |
|
577 | 577 | |
|
578 | 578 | def test_escaped_help(): |
|
579 | 579 | tt.check_pairs(isp.transform_escaped, syntax['escaped_help']) |
|
580 | 580 | |
|
581 | 581 | |
|
582 | 582 | def test_escaped_magic(): |
|
583 | 583 | tt.check_pairs(isp.transform_escaped, syntax['escaped_magic']) |
|
584 | 584 | |
|
585 | 585 | |
|
586 | 586 | def test_escaped_quote(): |
|
587 | 587 | tt.check_pairs(isp.transform_escaped, syntax['escaped_quote']) |
|
588 | 588 | |
|
589 | 589 | |
|
590 | 590 | def test_escaped_quote2(): |
|
591 | 591 | tt.check_pairs(isp.transform_escaped, syntax['escaped_quote2']) |
|
592 | 592 | |
|
593 | 593 | |
|
594 | 594 | def test_escaped_paren(): |
|
595 | 595 | tt.check_pairs(isp.transform_escaped, syntax['escaped_paren']) |
|
596 | 596 | |
|
597 | 597 | |
|
598 | 598 | class IPythonInputTestCase(InputSplitterTestCase): |
|
599 | 599 | """By just creating a new class whose .isp is a different instance, we |
|
600 | 600 | re-run the same test battery on the new input splitter. |
|
601 | 601 | |
|
602 | 602 | In addition, this runs the tests over the syntax and syntax_ml dicts that |
|
603 | 603 | were tested by individual functions, as part of the OO interface. |
|
604 | 604 | |
|
605 | 605 | It also makes some checks on the raw buffer storage. |
|
606 | 606 | """ |
|
607 | 607 | |
|
608 | 608 | def setUp(self): |
|
609 | 609 | self.isp = isp.IPythonInputSplitter(input_mode='line') |
|
610 | 610 | |
|
611 | 611 | def test_syntax(self): |
|
612 | 612 | """Call all single-line syntax tests from the main object""" |
|
613 | 613 | isp = self.isp |
|
614 | 614 | for example in syntax.itervalues(): |
|
615 | 615 | for raw, out_t in example: |
|
616 | 616 | if raw.startswith(' '): |
|
617 | 617 | continue |
|
618 | 618 | |
|
619 | 619 | isp.push(raw) |
|
620 | 620 | out, out_raw = isp.source_raw_reset() |
|
621 | 621 | self.assertEqual(out.rstrip(), out_t, |
|
622 | 622 | tt.pair_fail_msg.format("inputsplitter",raw, out_t, out)) |
|
623 | 623 | self.assertEqual(out_raw.rstrip(), raw.rstrip()) |
|
624 | 624 | |
|
625 | 625 | def test_syntax_multiline(self): |
|
626 | 626 | isp = self.isp |
|
627 | 627 | for example in syntax_ml.itervalues(): |
|
628 | 628 | out_t_parts = [] |
|
629 | 629 | raw_parts = [] |
|
630 | 630 | for line_pairs in example: |
|
631 | 631 | for lraw, out_t_part in line_pairs: |
|
632 | 632 | isp.push(lraw) |
|
633 | 633 | out_t_parts.append(out_t_part) |
|
634 | 634 | raw_parts.append(lraw) |
|
635 | 635 | |
|
636 | 636 | out, out_raw = isp.source_raw_reset() |
|
637 | 637 | out_t = '\n'.join(out_t_parts).rstrip() |
|
638 | 638 | raw = '\n'.join(raw_parts).rstrip() |
|
639 | 639 | self.assertEqual(out.rstrip(), out_t) |
|
640 | 640 | self.assertEqual(out_raw.rstrip(), raw) |
|
641 | 641 | |
|
642 | 642 | |
|
643 | 643 | class BlockIPythonInputTestCase(IPythonInputTestCase): |
|
644 | 644 | |
|
645 | 645 | # Deactivate tests that don't make sense for the block mode |
|
646 | 646 | test_push3 = test_split = lambda s: None |
|
647 | 647 | |
|
648 | 648 | def setUp(self): |
|
649 | 649 | self.isp = isp.IPythonInputSplitter(input_mode='cell') |
|
650 | 650 | |
|
651 | 651 | def test_syntax_multiline(self): |
|
652 | 652 | isp = self.isp |
|
653 | 653 | for example in syntax_ml.itervalues(): |
|
654 | 654 | raw_parts = [] |
|
655 | 655 | out_t_parts = [] |
|
656 | 656 | for line_pairs in example: |
|
657 | 657 | for raw, out_t_part in line_pairs: |
|
658 | 658 | raw_parts.append(raw) |
|
659 | 659 | out_t_parts.append(out_t_part) |
|
660 | 660 | |
|
661 | 661 | raw = '\n'.join(raw_parts) |
|
662 | 662 | out_t = '\n'.join(out_t_parts) |
|
663 | 663 | |
|
664 | 664 | isp.push(raw) |
|
665 | 665 | out, out_raw = isp.source_raw_reset() |
|
666 | 666 | # Match ignoring trailing whitespace |
|
667 | 667 | self.assertEqual(out.rstrip(), out_t.rstrip()) |
|
668 | 668 | self.assertEqual(out_raw.rstrip(), raw.rstrip()) |
|
669 | 669 | |
|
670 | 670 | |
|
671 | 671 | #----------------------------------------------------------------------------- |
|
672 | 672 | # Main - use as a script, mostly for developer experiments |
|
673 | 673 | #----------------------------------------------------------------------------- |
|
674 | 674 | |
|
675 | 675 | if __name__ == '__main__': |
|
676 | 676 | # A simple demo for interactive experimentation. This code will not get |
|
677 | 677 | # picked up by any test suite. |
|
678 | 678 | from IPython.core.inputsplitter import InputSplitter, IPythonInputSplitter |
|
679 | 679 | |
|
680 | 680 | # configure here the syntax to use, prompt and whether to autoindent |
|
681 | 681 | #isp, start_prompt = InputSplitter(), '>>> ' |
|
682 | 682 | isp, start_prompt = IPythonInputSplitter(), 'In> ' |
|
683 | 683 | |
|
684 | 684 | autoindent = True |
|
685 | 685 | #autoindent = False |
|
686 | 686 | |
|
687 | 687 | try: |
|
688 | 688 | while True: |
|
689 | 689 | prompt = start_prompt |
|
690 | 690 | while isp.push_accepts_more(): |
|
691 | 691 | indent = ' '*isp.indent_spaces |
|
692 | 692 | if autoindent: |
|
693 | 693 | line = indent + raw_input(prompt+indent) |
|
694 | 694 | else: |
|
695 | 695 | line = raw_input(prompt) |
|
696 | 696 | isp.push(line) |
|
697 | 697 | prompt = '... ' |
|
698 | 698 | |
|
699 | 699 | # Here we just return input so we can use it in a test suite, but a |
|
700 | 700 | # real interpreter would instead send it for execution somewhere. |
|
701 | 701 | #src = isp.source; raise EOFError # dbg |
|
702 | 702 | src, raw = isp.source_raw_reset() |
|
703 | 703 | print 'Input source was:\n', src |
|
704 | 704 | print 'Raw source was:\n', raw |
|
705 | 705 | except EOFError: |
|
706 | 706 | print 'Bye' |
@@ -1,121 +1,121 b'' | |||
|
1 | 1 | #----------------------------------------------------------------------------- |
|
2 |
# Copyright ( |
|
|
2 | # Copyright (C) 2010-2011, IPython Development Team. | |
|
3 | 3 | # |
|
4 | 4 | # Distributed under the terms of the Modified BSD License. |
|
5 | 5 | # |
|
6 | 6 | # The full license is in the file COPYING.txt, distributed with this software. |
|
7 | 7 | #----------------------------------------------------------------------------- |
|
8 | 8 | |
|
9 | 9 | from nose.tools import assert_equal, assert_true |
|
10 | 10 | |
|
11 | 11 | from IPython.external import argparse |
|
12 | 12 | from IPython.core.magic_arguments import (argument, argument_group, kwds, |
|
13 | 13 | magic_arguments, parse_argstring, real_name) |
|
14 | 14 | from IPython.testing.decorators import parametric |
|
15 | 15 | |
|
16 | 16 | |
|
17 | 17 | @magic_arguments() |
|
18 | 18 | @argument('-f', '--foo', help="an argument") |
|
19 | 19 | def magic_foo1(self, args): |
|
20 | 20 | """ A docstring. |
|
21 | 21 | """ |
|
22 | 22 | return parse_argstring(magic_foo1, args) |
|
23 | 23 | |
|
24 | 24 | |
|
25 | 25 | @magic_arguments() |
|
26 | 26 | def magic_foo2(self, args): |
|
27 | 27 | """ A docstring. |
|
28 | 28 | """ |
|
29 | 29 | return parse_argstring(magic_foo2, args) |
|
30 | 30 | |
|
31 | 31 | |
|
32 | 32 | @magic_arguments() |
|
33 | 33 | @argument('-f', '--foo', help="an argument") |
|
34 | 34 | @argument_group('Group') |
|
35 | 35 | @argument('-b', '--bar', help="a grouped argument") |
|
36 | 36 | @argument_group('Second Group') |
|
37 | 37 | @argument('-z', '--baz', help="another grouped argument") |
|
38 | 38 | def magic_foo3(self, args): |
|
39 | 39 | """ A docstring. |
|
40 | 40 | """ |
|
41 | 41 | return parse_argstring(magic_foo3, args) |
|
42 | 42 | |
|
43 | 43 | |
|
44 | 44 | @magic_arguments() |
|
45 | 45 | @kwds(argument_default=argparse.SUPPRESS) |
|
46 | 46 | @argument('-f', '--foo', help="an argument") |
|
47 | 47 | def magic_foo4(self, args): |
|
48 | 48 | """ A docstring. |
|
49 | 49 | """ |
|
50 | 50 | return parse_argstring(magic_foo4, args) |
|
51 | 51 | |
|
52 | 52 | |
|
53 | 53 | @magic_arguments('frobnicate') |
|
54 | 54 | @argument('-f', '--foo', help="an argument") |
|
55 | 55 | def magic_foo5(self, args): |
|
56 | 56 | """ A docstring. |
|
57 | 57 | """ |
|
58 | 58 | return parse_argstring(magic_foo5, args) |
|
59 | 59 | |
|
60 | 60 | |
|
61 | 61 | @magic_arguments() |
|
62 | 62 | @argument('-f', '--foo', help="an argument") |
|
63 | 63 | def magic_magic_foo(self, args): |
|
64 | 64 | """ A docstring. |
|
65 | 65 | """ |
|
66 | 66 | return parse_argstring(magic_magic_foo, args) |
|
67 | 67 | |
|
68 | 68 | |
|
69 | 69 | @magic_arguments() |
|
70 | 70 | @argument('-f', '--foo', help="an argument") |
|
71 | 71 | def foo(self, args): |
|
72 | 72 | """ A docstring. |
|
73 | 73 | """ |
|
74 | 74 | return parse_argstring(foo, args) |
|
75 | 75 | |
|
76 | 76 | |
|
77 | 77 | @parametric |
|
78 | 78 | def test_magic_arguments(): |
|
79 | 79 | # Ideally, these would be doctests, but I could not get it to work. |
|
80 | 80 | yield assert_equal(magic_foo1.__doc__, '%foo1 [-f FOO]\n\nA docstring.\n\noptional arguments:\n -f FOO, --foo FOO an argument\n') |
|
81 | 81 | yield assert_equal(getattr(magic_foo1, 'argcmd_name', None), None) |
|
82 | 82 | yield assert_equal(real_name(magic_foo1), 'foo1') |
|
83 | 83 | yield assert_equal(magic_foo1(None, ''), argparse.Namespace(foo=None)) |
|
84 | 84 | yield assert_true(hasattr(magic_foo1, 'has_arguments')) |
|
85 | 85 | |
|
86 | 86 | yield assert_equal(magic_foo2.__doc__, '%foo2\n\nA docstring.\n') |
|
87 | 87 | yield assert_equal(getattr(magic_foo2, 'argcmd_name', None), None) |
|
88 | 88 | yield assert_equal(real_name(magic_foo2), 'foo2') |
|
89 | 89 | yield assert_equal(magic_foo2(None, ''), argparse.Namespace()) |
|
90 | 90 | yield assert_true(hasattr(magic_foo2, 'has_arguments')) |
|
91 | 91 | |
|
92 | 92 | yield assert_equal(magic_foo3.__doc__, '%foo3 [-f FOO] [-b BAR] [-z BAZ]\n\nA docstring.\n\noptional arguments:\n -f FOO, --foo FOO an argument\n\nGroup:\n -b BAR, --bar BAR a grouped argument\n\nSecond Group:\n -z BAZ, --baz BAZ another grouped argument\n') |
|
93 | 93 | yield assert_equal(getattr(magic_foo3, 'argcmd_name', None), None) |
|
94 | 94 | yield assert_equal(real_name(magic_foo3), 'foo3') |
|
95 | 95 | yield assert_equal(magic_foo3(None, ''), |
|
96 | 96 | argparse.Namespace(bar=None, baz=None, foo=None)) |
|
97 | 97 | yield assert_true(hasattr(magic_foo3, 'has_arguments')) |
|
98 | 98 | |
|
99 | 99 | yield assert_equal(magic_foo4.__doc__, '%foo4 [-f FOO]\n\nA docstring.\n\noptional arguments:\n -f FOO, --foo FOO an argument\n') |
|
100 | 100 | yield assert_equal(getattr(magic_foo4, 'argcmd_name', None), None) |
|
101 | 101 | yield assert_equal(real_name(magic_foo4), 'foo4') |
|
102 | 102 | yield assert_equal(magic_foo4(None, ''), argparse.Namespace()) |
|
103 | 103 | yield assert_true(hasattr(magic_foo4, 'has_arguments')) |
|
104 | 104 | |
|
105 | 105 | yield assert_equal(magic_foo5.__doc__, '%frobnicate [-f FOO]\n\nA docstring.\n\noptional arguments:\n -f FOO, --foo FOO an argument\n') |
|
106 | 106 | yield assert_equal(getattr(magic_foo5, 'argcmd_name', None), 'frobnicate') |
|
107 | 107 | yield assert_equal(real_name(magic_foo5), 'frobnicate') |
|
108 | 108 | yield assert_equal(magic_foo5(None, ''), argparse.Namespace(foo=None)) |
|
109 | 109 | yield assert_true(hasattr(magic_foo5, 'has_arguments')) |
|
110 | 110 | |
|
111 | 111 | yield assert_equal(magic_magic_foo.__doc__, '%magic_foo [-f FOO]\n\nA docstring.\n\noptional arguments:\n -f FOO, --foo FOO an argument\n') |
|
112 | 112 | yield assert_equal(getattr(magic_magic_foo, 'argcmd_name', None), None) |
|
113 | 113 | yield assert_equal(real_name(magic_magic_foo), 'magic_foo') |
|
114 | 114 | yield assert_equal(magic_magic_foo(None, ''), argparse.Namespace(foo=None)) |
|
115 | 115 | yield assert_true(hasattr(magic_magic_foo, 'has_arguments')) |
|
116 | 116 | |
|
117 | 117 | yield assert_equal(foo.__doc__, '%foo [-f FOO]\n\nA docstring.\n\noptional arguments:\n -f FOO, --foo FOO an argument\n') |
|
118 | 118 | yield assert_equal(getattr(foo, 'argcmd_name', None), None) |
|
119 | 119 | yield assert_equal(real_name(foo), 'foo') |
|
120 | 120 | yield assert_equal(foo(None, ''), argparse.Namespace(foo=None)) |
|
121 | 121 | yield assert_true(hasattr(foo, 'has_arguments')) |
@@ -1,136 +1,136 b'' | |||
|
1 | 1 | """Tests for the object inspection functionality. |
|
2 | 2 | """ |
|
3 | 3 | #----------------------------------------------------------------------------- |
|
4 | # Copyright (C) 2010 The IPython Development Team. | |
|
4 | # Copyright (C) 2010-2011 The IPython Development Team. | |
|
5 | 5 | # |
|
6 | 6 | # Distributed under the terms of the BSD License. |
|
7 | 7 | # |
|
8 | 8 | # The full license is in the file COPYING.txt, distributed with this software. |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 | 10 | |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | # Imports |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | from __future__ import print_function |
|
15 | 15 | |
|
16 | 16 | # Stdlib imports |
|
17 | 17 | |
|
18 | 18 | # Third-party imports |
|
19 | 19 | import nose.tools as nt |
|
20 | 20 | |
|
21 | 21 | # Our own imports |
|
22 | 22 | from .. import oinspect |
|
23 | 23 | from IPython.utils import py3compat |
|
24 | 24 | |
|
25 | 25 | #----------------------------------------------------------------------------- |
|
26 | 26 | # Globals and constants |
|
27 | 27 | #----------------------------------------------------------------------------- |
|
28 | 28 | |
|
29 | 29 | inspector = oinspect.Inspector() |
|
30 | 30 | |
|
31 | 31 | #----------------------------------------------------------------------------- |
|
32 | 32 | # Local utilities |
|
33 | 33 | #----------------------------------------------------------------------------- |
|
34 | 34 | |
|
35 | 35 | # A few generic objects we can then inspect in the tests below |
|
36 | 36 | |
|
37 | 37 | class Call(object): |
|
38 | 38 | """This is the class docstring.""" |
|
39 | 39 | |
|
40 | 40 | def __init__(self, x, y=1): |
|
41 | 41 | """This is the constructor docstring.""" |
|
42 | 42 | |
|
43 | 43 | def __call__(self, *a, **kw): |
|
44 | 44 | """This is the call docstring.""" |
|
45 | 45 | |
|
46 | 46 | def method(self, x, z=2): |
|
47 | 47 | """Some method's docstring""" |
|
48 | 48 | |
|
49 | 49 | class OldStyle: |
|
50 | 50 | """An old-style class for testing.""" |
|
51 | 51 | pass |
|
52 | 52 | |
|
53 | 53 | def f(x, y=2, *a, **kw): |
|
54 | 54 | """A simple function.""" |
|
55 | 55 | |
|
56 | 56 | def g(y, z=3, *a, **kw): |
|
57 | 57 | pass # no docstring |
|
58 | 58 | |
|
59 | 59 | |
|
60 | 60 | def check_calltip(obj, name, call, docstring): |
|
61 | 61 | """Generic check pattern all calltip tests will use""" |
|
62 | 62 | info = inspector.info(obj, name) |
|
63 | 63 | call_line, ds = oinspect.call_tip(info) |
|
64 | 64 | nt.assert_equal(call_line, call) |
|
65 | 65 | nt.assert_equal(ds, docstring) |
|
66 | 66 | |
|
67 | 67 | #----------------------------------------------------------------------------- |
|
68 | 68 | # Tests |
|
69 | 69 | #----------------------------------------------------------------------------- |
|
70 | 70 | |
|
71 | 71 | def test_calltip_class(): |
|
72 | 72 | check_calltip(Call, 'Call', 'Call(x, y=1)', Call.__init__.__doc__) |
|
73 | 73 | |
|
74 | 74 | |
|
75 | 75 | def test_calltip_instance(): |
|
76 | 76 | c = Call(1) |
|
77 | 77 | check_calltip(c, 'c', 'c(*a, **kw)', c.__call__.__doc__) |
|
78 | 78 | |
|
79 | 79 | |
|
80 | 80 | def test_calltip_method(): |
|
81 | 81 | c = Call(1) |
|
82 | 82 | check_calltip(c.method, 'c.method', 'c.method(x, z=2)', c.method.__doc__) |
|
83 | 83 | |
|
84 | 84 | |
|
85 | 85 | def test_calltip_function(): |
|
86 | 86 | check_calltip(f, 'f', 'f(x, y=2, *a, **kw)', f.__doc__) |
|
87 | 87 | |
|
88 | 88 | |
|
89 | 89 | def test_calltip_function2(): |
|
90 | 90 | check_calltip(g, 'g', 'g(y, z=3, *a, **kw)', '<no docstring>') |
|
91 | 91 | |
|
92 | 92 | |
|
93 | 93 | def test_calltip_builtin(): |
|
94 | 94 | check_calltip(sum, 'sum', None, sum.__doc__) |
|
95 | 95 | |
|
96 | 96 | def test_info(): |
|
97 | 97 | "Check that Inspector.info fills out various fields as expected." |
|
98 | 98 | i = inspector.info(Call, oname='Call') |
|
99 | 99 | nt.assert_equal(i['type_name'], 'type') |
|
100 | 100 | expted_class = str(type(type)) # <class 'type'> (Python 3) or <type 'type'> |
|
101 | 101 | nt.assert_equal(i['base_class'], expted_class) |
|
102 | 102 | nt.assert_equal(i['string_form'], "<class 'IPython.core.tests.test_oinspect.Call'>") |
|
103 | 103 | fname = __file__ |
|
104 | 104 | if fname.endswith(".pyc"): |
|
105 | 105 | fname = fname[:-1] |
|
106 | 106 | # case-insensitive comparison needed on some filesystems |
|
107 | 107 | # e.g. Windows: |
|
108 | 108 | nt.assert_equal(i['file'].lower(), fname.lower()) |
|
109 | 109 | nt.assert_equal(i['definition'], 'Call(self, *a, **kw)\n') |
|
110 | 110 | nt.assert_equal(i['docstring'], Call.__doc__) |
|
111 | 111 | nt.assert_equal(i['source'], None) |
|
112 | 112 | nt.assert_true(i['isclass']) |
|
113 | 113 | nt.assert_equal(i['init_definition'], "Call(self, x, y=1)\n") |
|
114 | 114 | nt.assert_equal(i['init_docstring'], Call.__init__.__doc__) |
|
115 | 115 | |
|
116 | 116 | i = inspector.info(Call, detail_level=1) |
|
117 | 117 | nt.assert_not_equal(i['source'], None) |
|
118 | 118 | nt.assert_equal(i['docstring'], None) |
|
119 | 119 | |
|
120 | 120 | c = Call(1) |
|
121 | 121 | c.__doc__ = "Modified instance docstring" |
|
122 | 122 | i = inspector.info(c) |
|
123 | 123 | nt.assert_equal(i['type_name'], 'Call') |
|
124 | 124 | nt.assert_equal(i['docstring'], "Modified instance docstring") |
|
125 | 125 | nt.assert_equal(i['class_docstring'], Call.__doc__) |
|
126 | 126 | nt.assert_equal(i['init_docstring'], Call.__init__.__doc__) |
|
127 | 127 | nt.assert_equal(i['call_docstring'], c.__call__.__doc__) |
|
128 | 128 | |
|
129 | 129 | # Test old-style classes, which for example may not have an __init__ method. |
|
130 | 130 | if not py3compat.PY3: |
|
131 | 131 | i = inspector.info(OldStyle) |
|
132 | 132 | nt.assert_equal(i['type_name'], 'classobj') |
|
133 | 133 | |
|
134 | 134 | i = inspector.info(OldStyle()) |
|
135 | 135 | nt.assert_equal(i['type_name'], 'instance') |
|
136 | 136 | nt.assert_equal(i['docstring'], OldStyle.__doc__) |
@@ -1,20 +1,20 b'' | |||
|
1 | 1 | #----------------------------------------------------------------------------- |
|
2 | # Copyright (C) 2010 The IPython Development Team. | |
|
2 | # Copyright (C) 2010-2011 The IPython Development Team. | |
|
3 | 3 | # |
|
4 | 4 | # Distributed under the terms of the BSD License. |
|
5 | 5 | # |
|
6 | 6 | # The full license is in the file COPYING.txt, distributed with this software. |
|
7 | 7 | #----------------------------------------------------------------------------- |
|
8 | 8 | import io |
|
9 | 9 | |
|
10 | 10 | # N.B. For the test suite, page.page is overridden (see IPython.testing.globalipapp) |
|
11 | 11 | from IPython.core import page |
|
12 | 12 | |
|
13 | 13 | def test_detect_screen_size(): |
|
14 | 14 | """Simple smoketest for page._detect_screen_size.""" |
|
15 | 15 | try: |
|
16 | 16 | page._detect_screen_size(True, 25) |
|
17 | 17 | except (TypeError, io.UnsupportedOperation): |
|
18 | 18 | # This can happen in the test suite, because stdout may not have a |
|
19 | 19 | # fileno. |
|
20 | 20 | pass |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
General Comments 0
You need to be logged in to leave comments.
Login now